aboutsummaryrefslogtreecommitdiff
path: root/contrib
diff options
context:
space:
mode:
Diffstat (limited to 'contrib')
-rw-r--r--contrib/bluegnu2.0.3/doc/dejagnu.pdf4844
-rw-r--r--contrib/bluegnu2.0.3/doc/dejagnu.ps6690
-rw-r--r--contrib/bluegnu2.0.3/doc/dejagnu.texi3503
-rw-r--r--contrib/bluegnu2.0.3/doc/notice.html395
-rw-r--r--contrib/bluegnu2.0.3/doc/notice.pdf1165
-rw-r--r--contrib/bluegnu2.0.3/doc/notice.ps1394
-rw-r--r--contrib/bluegnu2.0.3/example/Makefile.in98
-rw-r--r--contrib/bluegnu2.0.3/example/calc/Makefile.in112
-rw-r--r--contrib/bluegnu2.0.3/example/calc/calc.129
-rw-r--r--contrib/bluegnu2.0.3/example/calc/calc.c65
-rw-r--r--contrib/bluegnu2.0.3/example/calc/calc.h.in18
-rwxr-xr-xcontrib/bluegnu2.0.3/example/calc/configure812
-rw-r--r--contrib/bluegnu2.0.3/example/calc/configure.in19
-rw-r--r--contrib/bluegnu2.0.3/example/calc/testsuite/calc.test/calc.exp60
-rw-r--r--contrib/bluegnu2.0.3/example/calc/testsuite/config/unix.exp49
-rwxr-xr-xcontrib/bluegnu2.0.3/example/configure697
-rw-r--r--contrib/bluegnu2.0.3/example/configure.in8
-rw-r--r--contrib/bluegnu2.0.3/lib/BlueGnu_target.itcl105
-rw-r--r--contrib/bluegnu2.0.3/lib/Default_target.itcl82
-rw-r--r--contrib/bluegnu2.0.3/lib/Types.itcl216
-rw-r--r--contrib/bluegnu2.0.3/lib/bluegnu.itcl22
-rw-r--r--contrib/bluegnu2.0.3/lib/bug.exp125
-rw-r--r--contrib/bluegnu2.0.3/lib/debugger.exp252
-rw-r--r--contrib/bluegnu2.0.3/lib/dejagnu.itcl81
-rw-r--r--contrib/bluegnu2.0.3/lib/dejagnu.tcl1130
-rw-r--r--contrib/bluegnu2.0.3/lib/dg.exp881
-rw-r--r--contrib/bluegnu2.0.3/lib/foo.itcl21
-rw-r--r--contrib/bluegnu2.0.3/lib/framework.exp677
-rw-r--r--contrib/bluegnu2.0.3/lib/libgloss.exp225
-rw-r--r--contrib/bluegnu2.0.3/lib/nonexpect.itcl74
-rw-r--r--contrib/bluegnu2.0.3/lib/remote.exp896
-rw-r--r--contrib/bluegnu2.0.3/lib/serverUtils.itcl51
-rw-r--r--contrib/bluegnu2.0.3/lib/target.exp520
-rw-r--r--contrib/bluegnu2.0.3/lib/tclIndex21
-rw-r--r--contrib/bluegnu2.0.3/lib/testSessionApplication.itcl314
-rw-r--r--contrib/bluegnu2.0.3/lib/testSessionClasses.itcl1341
-rw-r--r--contrib/bluegnu2.0.3/lib/testSessionFramework.itcl1386
-rw-r--r--contrib/bluegnu2.0.3/lib/testSessionUtils.itcl26
-rw-r--r--contrib/bluegnu2.0.3/lib/udi.exp213
-rw-r--r--contrib/bluegnu2.0.3/lib/util-defs.exp110
-rw-r--r--contrib/bluegnu2.0.3/lib/utils.exp454
-rw-r--r--contrib/bluegnu2.0.3/lib/vrtx.exp334
-rw-r--r--contrib/bluegnu2.0.3/lib/vxworks.exp265
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/appendQueue.itcl9
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/clone_output.itcl156
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/locateFile.itcl46
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/namespaceVariables.itcl36
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/prependQueue.itcl6
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/runtest.itcl19
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/testNaming.itcl19
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/ts001/A.itcl1
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/ts002/A.itcl1
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/types.itcl55
-rw-r--r--contrib/bluegnu2.0.3/testsets/BlueGnu/verbose.itcl562
-rw-r--r--contrib/bluegnu2.0.3/testsets/examples/lib/benchmark.itcl64
-rw-r--r--contrib/bluegnu2.0.3/testsets/examples/tc0013
-rw-r--r--contrib/bluegnu2.0.3/testsets/examples/tc0023
-rw-r--r--contrib/bluegnu2.0.3/testsets/examples/ts_0012
-rw-r--r--contrib/bluegnu2.0.3/testsets/examples/ts_0024
-rw-r--r--contrib/bluegnu2.0.3/testsets/examples/ts_0032
-rw-r--r--contrib/bluegnu2.0.3/testsets/examples/versionTcl.itcl8
-rw-r--r--contrib/bluegnu2.0.3/testsets/tclIndex5
-rw-r--r--contrib/bluegnu2.0.3/testsuite/Makefile.in100
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/env.exp12
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/env.iexp48
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/foo.exp5
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/subT/test_002.exp20
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/test_000.exp8
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/test_001.exp19
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/test_002.exp22
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/test_003.exp3
-rw-r--r--contrib/bluegnu2.0.3/testsuite/T/test_004.exp3
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/clone_output.test68
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/config.test138
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/default_procs.tcl94
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/libs.exp73
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/options.exp91
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/remote.test217
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats-sub.exp16
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats.exp49
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/target.test247
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile11
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile22
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subsubdir1/subsubfile12
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir2/subfile22
-rw-r--r--contrib/bluegnu2.0.3/testsuite/bluegnu.all/utils.test118
-rw-r--r--contrib/bluegnu2.0.3/testsuite/config/default.exp79
-rwxr-xr-xcontrib/bluegnu2.0.3/testsuite/configure1076
-rw-r--r--contrib/bluegnu2.0.3/testsuite/configure.in9
-rw-r--r--contrib/bluegnu2.0.3/testsuite/lib/libsup.exp220
-rw-r--r--contrib/bluegnu2.0.3/testsuite/tools/env.exp20
91 files changed, 33543 insertions, 0 deletions
diff --git a/contrib/bluegnu2.0.3/doc/dejagnu.pdf b/contrib/bluegnu2.0.3/doc/dejagnu.pdf
new file mode 100644
index 0000000..6f6d12d
--- /dev/null
+++ b/contrib/bluegnu2.0.3/doc/dejagnu.pdf
@@ -0,0 +1,4844 @@
+%PDF-1.2
+8 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-40 -250 1009 969]
+/FontName /CMR10
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 7 0 R
+>>
+endobj
+9 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F1
+/FontDescriptor 8 0 R
+/BaseFont /PNKVMB+CMR10
+/FirstChar 0
+/LastChar 127
+/Widths [625 833.34 777.78 694.45 666.67 750 722.22 777.78 722.22 777.78 722.22 583.34
+555.56 555.56 833.34 833.34 277.78 305.56 500 500 500 500 500 750 444.45 500 722.22
+777.78 500 902.78 1013.89 777.78 277.78 277.78 500 833.34 500 833.34 777.78 277.78
+388.89 388.89 500 777.78 277.78 333.33 277.78 500 500 500 500 500 500 500 500 500
+500 500 277.78 277.78 277.78 777.78 472.22 472.22 777.78 750 708.34 722.22 763.89
+680.56 652.78 784.72 750 361.11 513.89 777.78 625 916.67 750 777.78 680.56 777.78
+736.11 555.56 722.22 750 750 1027.78 750 750 611.11 277.78 500 277.78 500 277.78
+277.78 500 555.56 444.45 555.56 444.45 305.56 500 555.56 277.78 305.56 527.78 277.78
+833.34 555.56 500 555.56 527.78 391.67 394.45 388.89 555.56 527.78 722.22 527.78
+527.78 444.45 500 1000 500 500 500]
+>>
+endobj
+11 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 686.11
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-296 -251 1139 946]
+/FontName /CMBX12
+/ItalicAngle 0
+/XHeight 444
+/StemV 80
+/FontFile 10 0 R
+>>
+endobj
+12 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F2
+/FontDescriptor 11 0 R
+/BaseFont /XOEAXU+CMBX12
+/FirstChar 0
+/LastChar 127
+/Widths [675.93 937.5 875 787.04 750 879.63 812.5 875 812.5 875 812.5 656.25 625
+625 937.5 937.5 312.5 343.75 562.5 562.5 562.5 562.5 562.5 849.54 500 574.07 812.5
+875 562.5 1018.52 1143.52 875 312.5 342.59 581.02 937.5 562.5 937.5 875 312.5 437.5
+437.5 562.5 875 312.5 375 312.5 562.5 562.5 562.5 562.5 562.5 562.5 562.5 562.5 562.5
+562.5 562.5 312.5 312.5 342.59 875 531.25 531.25 875 849.54 799.77 812.5 862.27 738.43
+707.18 884.26 879.63 418.98 581.02 880.79 675.93 1067.13 879.63 844.91 768.52 844.91
+839.12 625 782.41 864.58 849.54 1162.04 849.54 849.54 687.5 312.5 581.02 312.5 562.5
+312.5 312.5 546.88 625 500 625 513.31 343.75 562.5 625 312.5 343.75 593.75 312.5
+937.5 625 562.5 625 593.75 459.49 443.75 437.5 625 593.75 812.5 593.75 593.75 500
+562.5 1125 562.5 562.5 562.5]
+>>
+endobj
+14 0 obj
+<<
+/Length 480
+>>
+stream
+0 w 0 g 0 G BT/F1 9.96 Tf 37.93 -9.96 TD[(o)]TJ/F2 20.66 Tf -19.93 -123.44 TD[(The)-374(DejaGn)30(u)-374(T)93(esting)-374(F)92(ramew)32(ork)]TJ ET 18.00 -145.39 m 450.00 -145.39 l 450.00 -141.41 l 18.00 -141.41 l b BT/F1 10.91 Tf 334.5 -156.95 TD[(for)-333(DejaGn)27(u)-332(V)82(ersion)-332(1.3)]TJ 72.92 -26.1 TD[(Jan)-333(1996)]TJ/F2 14.35 Tf -389.42 -425.07 TD[(Rob)-374(Sa)30(v)31(o)31(y)32(e)]TJ ET 18.00 -616.89 m 450.00 -616.89 l 450.00 -614.89 l 18.00 -614.89 l b 0 g 0 G
+endstream
+endobj
+16 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+>>
+endobj
+6 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 16 0 R
+>>
+endobj
+20 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -960
+/Flags 68
+/FontBBox [-29 -960 1116 775]
+/FontName /CMSY10
+/ItalicAngle -14
+/XHeight 431
+/StemV 80
+/FontFile 19 0 R
+>>
+endobj
+21 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F3
+/FontDescriptor 20 0 R
+/BaseFont /ZRNQXX+CMSY10
+/FirstChar 0
+/LastChar 127
+/Widths [777.78 277.78 777.78 500 777.78 500 777.78 777.78 777.78 777.78 777.78 777.78
+777.78 1000 500 500 777.78 777.78 777.78 777.78 777.78 777.78 777.78 777.78 777.78
+777.78 777.78 777.78 1000 1000 777.78 777.78 1000 1000 500 500 1000 1000 1000 777.78
+1000 1000 611.11 611.11 1000 1000 1000 777.78 275 1000 666.67 666.67 888.89 888.89
+0 0 555.56 555.56 666.67 500 722.22 722.22 777.78 777.78 611.11 798.47 656.81 526.53
+771.39 527.78 718.75 594.87 844.52 544.52 677.78 761.95 689.72 1200.9 820.49 796.11
+695.56 816.67 847.5 605.56 544.64 625.83 612.78 987.78 713.3 668.34 724.73 666.67
+666.67 666.67 666.67 666.67 611.11 611.11 444.45 444.45 444.45 444.45 500 500 388.89
+388.89 277.78 500 500 611.11 500 277.78 833.34 750 833.34 416.67 666.67 666.67 777.78
+777.78 444.45 444.45 444.45 611.11 777.78 777.78 777.78 777.78]
+>>
+endobj
+22 0 obj
+<<
+/Length 1550
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 372.64 -49.02 TD[(Cygn)27(us)-332(Supp)-28(ort)]TJ -354.64 -488.63 TD[(Cop)27(yrigh)28(t)]TJ 54.27 0.32 TD[(c)]TJ/F3 10.91 Tf -3.03 -0.32 TD[(\015)]TJ/F1 10.91 Tf 14.55 0 TD[(92,)-333(93,)-333(94,)-333(95,)-334(1996)-333(F)82(ree)-332(Soft)27(w)27(are)-332(F)82(oundation,)-332(Inc.)]TJ -65.79 -16.14 TD[(P)27(ermission)-352(is)-354(gran)27(ted)-352(to)-354(mak)27(e)-352(and)-354(distribute)-353(v)27(erbatim)-353(copies)-353(of)-354(this)-353(man)27(ual)-353(pro)27(vided)-352(the)]TJ 0 -13.15 TD[(cop)27(yrigh)28(t)-332(notice)-334(and)-333(this)-333(p)-28(ermission)-333(notice)-334(are)-333(preserv)27(ed)-333(on)-333(all)-333(copies.)]TJ 0 -16.14 TD[(P)27(ermission)-418(is)-419(gran)27(ted)-419(to)-419(cop)27(y)-418(and)-420(distribute)-419(mo)-28(di\014ed)-419(v)27(ersions)-418(of)-419(this)-420(man)27(ual)-418(under)-419(the)]TJ 0 -13.15 TD[(conditions)-460(for)-461(v)27(erbatim)-459(cop)26(ying,)-491(pro)27(vided)-460(also)-460(that)-461(the)-460(en)26(tire)-459(resulting)-461(deriv)27(ed)-459(w)26(ork)-459(is)]TJ 0 -13.16 TD[(distributed)-333(under)-333(the)-333(terms)-334(of)-333(a)-333(p)-28(ermission)-334(notice)-333(iden)27(tical)-332(to)-334(this)-333(one.)]TJ 0 -16.13 TD[(P)27(ermission)-362(is)-364(gran)27(ted)-363(to)-364(cop)27(y)-363(and)-363(distribute)-364(translations)-364(of)-363(this)-364(man)27(ual)-363(in)27(to)-363(another)-363(lan-)]TJ 0 -13.16 TD[(guage,)-333(under)-333(the)-333(ab)-28(o)27(v)27(e)-332(conditions)-333(for)-334(mo)-27(di\014ed)-334(v)27(ersions.)]TJ ET 0 g 0 G
+endstream
+endobj
+23 0 obj
+<<
+/F1 9 0 R
+/F3 21 0 R
+>>
+endobj
+18 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 23 0 R
+>>
+endobj
+27 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 611.11
+/Ascent 611.11
+/Descent -222.22
+/Flags 5
+/FontBBox [-4 -235 731 800]
+/FontName /CMTT10
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 26 0 R
+>>
+endobj
+28 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F4
+/FontDescriptor 27 0 R
+/BaseFont /YSVNVS+CMTT10
+/FirstChar 0
+/LastChar 127
+/Widths [525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525
+525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525
+525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525
+525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525
+525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525
+525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525 525
+525 525 525 525 525]
+>>
+endobj
+30 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 68
+/FontBBox [-200 -250 1123 969]
+/FontName /CMSL10
+/ItalicAngle -9
+/XHeight 431
+/StemV 80
+/FontFile 29 0 R
+>>
+endobj
+31 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F5
+/FontDescriptor 30 0 R
+/BaseFont /YXBGJA+CMSL10
+/FirstChar 0
+/LastChar 127
+/Widths [625 833.34 777.78 694.45 666.67 750 722.22 777.78 722.22 777.78 722.22 583.34
+555.56 555.56 833.34 833.34 277.78 305.56 500 500 500 500 500 808.65 444.45 500 722.22
+777.78 500 902.78 1013.89 777.78 277.78 277.78 500 833.34 500 833.34 777.78 277.78
+388.89 388.89 500 777.78 277.78 333.33 277.78 500 500 500 500 500 500 500 500 500
+500 500 277.78 277.78 277.78 777.78 472.22 472.22 777.78 750 708.34 722.22 763.89
+680.56 652.78 784.72 750 361.11 513.89 777.78 625 916.67 750 777.78 680.56 777.78
+736.11 555.56 722.22 750 750 1027.78 750 750 611.11 277.78 500 277.78 500 277.78
+277.78 500 555.56 444.45 555.56 444.45 305.56 500 555.56 277.78 305.56 527.78 277.78
+833.34 555.56 500 555.56 527.78 391.67 394.45 388.89 555.56 527.78 722.22 527.78
+527.78 444.45 500 1000 500 500 500]
+>>
+endobj
+32 0 obj
+<<
+/Length 3690
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(1:)-444(What)-334(is)-333(DejaGn)27(u?)-25820(1)]TJ/F2 17.22 Tf 0 -25.91 TD[(1)-562(What)-375(is)-375(DejaGn)30(u?)]TJ/F1 10.91 Tf 14.94 -28.09 TD[(DejaGn)27(u)-378(is)-379(a)-379(framew)27(ork)-378(for)-379(testing)-379(other)-379(programs.)-582(Its)-379(purp)-28(ose)-379(is)-379(to)-379(pro)27(vide)-378(a)-379(single)]TJ -14.94 -13.15 TD[(fron)27(t)-332(end)-333(for)-334(all)-333(tests.)-444(Bey)26(ond)-332(this,)-333(DejaGn)26(u)-332(o\013ers)-333(sev)27(eral)-333(adv)55(an)28(tages)-333(for)-333(testing:)]TJ 5.91 -16.14 TD[(1.)-660(The)-359(\015exibilit)27(y)-359(and)-359(consistency)-360(of)-359(the)-360(DejaGn)27(u)-359(framew)27(ork)-359(mak)27(e)-358(it)-360(easy)-359(to)-360(write)-360(tests)]TJ 15.69 -13.15 TD[(for)-333(an)27(y)-332(program.)]TJ -15.69 -16.14 TD[(2.)-660(DejaGn)27(u)-225(pro)27(vides)-225(a)-226(la)26(y)28(er)-225(of)-226(abstraction)-226(whic)27(h)-226(allo)27(ws)-225(y)27(ou)-225(to)-226(write)-226(tests)-227(that)-226(are)-226(p)-28(ortable)]TJ 15.69 -13.15 TD[(to)-372(an)27(y)-372(host)-373(or)-373(target)-372(where)-373(a)-373(program)-372(m)26(ust)-371(b)-28(e)-373(tested.)-562(F)82(or)-372(instance,)-382(a)-373(test)-373(for)-372(GDB)]TJ 0 -13.15 TD[(can)-282(run)-282(\(from)-283(an)27(y)-281(Unix)-283(based)-282(host\))-283(on)-282(an)27(y)-282(target)-282(arc)27(hitecture)-282(that)-282(DejaGn)27(u)-282(supp)-27(orts.)]TJ 0 -13.15 TD[(Curren)27(tly)-284(DejaGn)27(u)-284(runs)-285(tests)-286(on)-285(sev)27(eral)-284(single)-285(b)-28(oard)-285(computers,)-295(whose)-285(op)-28(erating)-285(soft-)]TJ 0 -13.15 TD[(w)27(are)-332(ranges)-333(from)-334(just)-333(a)-333(b)-28(o)-28(ot)-333(monitor)-334(to)-333(a)-333(full-\015edged,)-334(Unix-lik)27(e)-332(realtime)-333(OS.)]TJ -15.69 -16.14 TD[(3.)-660(All)-414(tests)-414(ha)26(v)28(e)-413(the)-415(same)-414(output)-415(format.)-687(This)-415(mak)27(es)-413(it)-415(easy)-414(to)-415(in)27(tegrate)-413(testing)-415(in)27(to)]TJ 15.69 -13.15 TD[(other)-373(soft)27(w)28(are)-372(dev)27(elopmen)28(t)-372(pro)-28(cesses.)-564(DejaGn)27(u's)-372(output)-373(is)-373(designed)-373(to)-373(b)-28(e)-373(parsed)-373(b)27(y)]TJ 0 -13.15 TD[(other)-333(\014ltering)-333(script,)-333(and)-334(it)-333(is)-333(also)-334(h)27(uman)-332(readable.)]TJ -6.66 -19.13 TD[(DejaGn)27(u)-332(is)-333(written)-334(in)]TJ/F4 10.91 Tf 107.9 0 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(,)-333(whic)27(h)-332(in)-334(turn)-333(uses)]TJ/F5 10.91 Tf 98.03 0 TD[(Tcl)]TJ/F1 10.91 Tf 15.76 0 TD[(|T)83(o)-27(ol)-333(command)-334(language.)]TJ -256.05 -16.14 TD[(Running)-262(tests)-263(requires)-263(t)26(w)28(o)-262(things:)-409(the)-263(testing)-263(framew)27(ork,)-276(and)-263(the)-263(test)-263(suites)-263(themselv)26(es.)]TJ -14.94 -13.15 TD[(T)83(ests)-379(are)-379(usually)-380(written)-380(in)]TJ/F4 10.91 Tf 137.31 0 TD[(expect)]TJ/F1 10.91 Tf 38.51 0 TD[(using)-379(Tcl,)-391(but)-380(y)27(ou)-379(can)-379(also)-380(use)-380(a)-379(Tcl)-380(script)-379(to)-380(run)-380(a)]TJ -175.82 -13.15 TD[(test)-353(suite)-353(that)-353(is)-353(not)-353(based)-353(on)]TJ/F4 10.91 Tf 148.42 0 TD[(expect)]TJ/F1 10.91 Tf 34.37 0 TD[(.)-503(\()]TJ/F4 10.91 Tf 12.77 0 TD[(expect)]TJ/F1 10.91 Tf 38.21 0 TD[(script)-353(\014lenames)-353(con)27(v)28(en)28(tionally)-353(use)-353(`)]TJ/F4 10.91 Tf 172.29 0 TD[(.exp)]TJ/F1 10.91 Tf 22.91 0 TD[(')]TJ -428.97 -13.15 TD[(as)-359(a)-359(su\016x;)-373(for)-359(example,)-366(the)-360(main)-359(implemen)27(tation)-359(of)-359(the)-360(DejaGn)27(u)-358(test)-360(driv)27(er)-359(is)-359(in)-360(the)-359(\014le)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(runtest.exp)]TJ/F1 10.91 Tf 63 0 TD[('.\))]TJ ET 0 g 0 G
+endstream
+endobj
+33 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+25 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 33 0 R
+>>
+endobj
+36 0 obj
+<<
+/Length 116
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(2)-26498(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ ET 0 g 0 G
+endstream
+endobj
+37 0 obj
+<<
+/F1 9 0 R
+>>
+endobj
+35 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 37 0 R
+>>
+endobj
+40 0 obj
+<<
+/Length 4839
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(2:)-444(What)-334(is)-333(new)-333(in)-334(this)-333(release)-333(?)-21300(3)]TJ/F2 17.22 Tf 0 -25.91 TD[(2)-562(What)-375(is)-375(new)-375(in)-375(this)-375(release)-375(?)]TJ/F1 10.91 Tf 14.94 -28.09 TD[(This)-448(release)-448(has)-448(a)-449(n)27(um)28(b)-27(er)-448(of)-449(substan)27(tial)-447(c)27(hanges)-448(o)27(v)28(er)-447(v)26(ersion)-447(1.2.)-789(The)-449(most)-448(visible)]TJ -14.94 -13.15 TD[(c)27(hange)-309(is)-310(that)-310(the)-311(v)27(ersion)-309(of)-310(exp)-28(ect)-310(and)-311(Tcl)-310(included)-310(in)-310(the)-311(release)-310(are)-310(up-to-date)-310(with)-311(the)]TJ 0 -13.15 TD[(curren)27(t)-332(stable)-333(net)-334(releases.)-444(Other)-333(c)26(hanges)-332(are:)]TJ 5.91 -16.14 TD[(1.)-660(The)-390(con\014g)-391(sub-system)-391(in)-391(DejaGn)26(u)-390(has)-391(b)-27(een)-391(completely)-391(redesigned.)-618(It)-390(no)26(w)-390(supp)-27(orts)]TJ 15.69 -13.15 TD[(testing)-333(on)-333(remote)-333(hosts)-334(as)-333(w)27(ell)-333(as)-333(remote)-333(targets.)]TJ -15.69 -16.14 TD[(2.)-660(More)-244(builtin)-244(supp)-28(ort)-245(for)-244(building)-244(target)-245(binaries)-244(with)-245(the)-244(correct)-244(link)26(er)-243(\015ags.)-415(Curren)27(tly)]TJ 15.69 -13.15 TD[(this)-333(only)-333(w)27(orks)-333(with)-333(GCC,)-333(preferably)-334(with)-333(a)-333(target)-334(supp)-27(ort)-334(b)27(y)]TJ/F4 10.91 Tf 305.26 0 TD[(libgloss)]TJ/F1 10.91 Tf 45.82 0 TD[(.)]TJ -366.77 -16.14 TD[(3.)-660(Lots)-333(of)-333(little)-334(bug)-333(\014xes)-333(from)-334(a)-333(y)27(ear)-332(of)-334(hea)27(vy)-332(use)-334(here)-333(at)-333(Cygn)26(us)-332(Supp)-28(ort.)]TJ 0 -16.14 TD[(4.)-660(DejaGn)27(u)-332(no)27(w)-333(uses)]TJ/F4 10.91 Tf 107.55 0 TD[(autoconf)]TJ/F1 10.91 Tf 49.46 0 TD[(for)-333(con\014guration.)]TJ -157.01 -16.14 TD[(5.)-660(New)-412(test)-412(cases)-412(for)-412(DejaGn)26(u)-411(ha)27(v)28(e)-412(b)-27(een)-413(added)-412(for)-412(the)-412(new)-412(features,)-432(plus)-413(the)]TJ/F4 10.91 Tf 390.7 0 TD[(")]TJ/F1 10.91 Tf 5.72 0 TD[({to)-27(ol)]TJ/F4 10.91 Tf 23.94 0 TD[(")]TJ/F1 10.91 Tf -404.67 -13.15 TD[(option)-333(bug)-333(in)-333(the)-334(1.2)-333(testsuite)-333(has)-334(b)-28(een)-333(\014xed.)]TJ -15.69 -16.14 TD[(6.)-660(The)]TJ/F4 10.91 Tf 38.11 0 TD[(--tool)]TJ/F1 10.91 Tf 38 0 TD[(option)-333(is)-333(no)27(w)-333(optional.)]TJ -76.11 -16.14 TD[(7.)]TJ/F4 10.91 Tf 15.69 0 TD[(runtest)]TJ/F1 10.91 Tf 43.39 0 TD[(when)-302(searc)26(hing)-301(for)-303(test)-303(driv)27(ers)-302(ignores)-303(all)-303(directories)-303(named)-302(SCCS,)-303(R)27(CS,)-302(and)]TJ -43.39 -13.15 TD[(CVS.)]TJ -15.69 -16.14 TD[(8.)-660(There)-331(is)-331(no)26(w)-330(a)-331(generic)-332(k)27(eyw)28(ord)-331(based)-331(test)-331(harness)-332(that)-331(uses)-331(commen)26(ts)-330(in)-331(source)-332(co)-28(de)]TJ 15.69 -13.15 TD[(to)-333(con)27(trol)-332(ho)26(w)-332(eac)27(h)-332(test)-334(case)-333(gets)-333(built)-334(and)-333(run.)]TJ -15.69 -16.14 TD[(9.)-660(There)-333(is)-333(no)27(w)-333(some)-333(supp)-28(ort)-333(for)-334(running)-333(a)-333(testsuite)-334(with)-333(m)27(ultiple)-332(passes.)]TJ/F2 14.35 Tf -5.91 -30.88 TD[(2.1)-562(Running)-375(existing)-375(tests)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(T)83(o)-271(run)-272(tests)-271(from)-272(an)-272(existing)-272(collection,)-284(\014rst)-272(use)]TJ/F4 10.91 Tf 229.94 0 TD[(configure)]TJ/F1 10.91 Tf 54.51 0 TD[(as)-271(usual)-272(to)-272(set)-272(up)-271(the)-272(source)]TJ -299.39 -13.15 TD[(directory)-333(con)27(taining)-332(the)-334(tests.)-444(Then)-333(try)-334(running)]TJ/F4 10.91 Tf 28.8 -15.44 TD[(make)-524(check)]TJ/F1 10.91 Tf -13.86 -16.14 TD[(If)-325(the)]TJ/F4 10.91 Tf 29.53 0 TD[(check)]TJ/F1 10.91 Tf 32.19 0 TD[(target)-325(exists,)-327(it)-326(usually)-325(sa)27(v)27(es)-324(y)27(ou)-325(some)-325(trouble|for)-326(instance,)-327(it)-325(can)-326(set)-325(up)]TJ -76.66 -13.15 TD[(an)27(y)-332(auxiliary)-333(programs)-334(or)-333(other)-333(\014les)-334(needed)-333(b)27(y)-333(the)-333(tests.)]TJ 14.94 -16.14 TD[(Once)-329(y)27(ou)-328(ha)27(v)27(e)-328(run)-329(`)]TJ/F4 10.91 Tf 96.52 0 TD[(make)-333(check)]TJ/F1 10.91 Tf 55.18 0 TD[(')-329(to)-329(build)-329(an)27(y)-328(auxiliary)-330(\014les,)-330(y)27(ou)-328(migh)27(t)-328(w)26(an)28(t)-328(to)-329(call)-329(the)]TJ -166.64 -13.15 TD[(test)-293(driv)26(er)]TJ/F4 10.91 Tf 51.99 0 TD[(runtest)]TJ/F1 10.91 Tf 43.3 0 TD[(directly)-293(to)-294(rep)-28(eat)-294(the)-294(tests.)-432(Y)83(ou)-293(ma)27(y)-293(also)-294(ha)26(v)28(e)-293(to)-294(call)]TJ/F4 10.91 Tf 257.32 0 TD[(runtest)]TJ/F1 10.91 Tf 43.3 0 TD[(directly)]TJ -395.91 -13.15 TD[(for)-333(test)-333(collections)-333(with)-334(no)]TJ/F4 10.91 Tf 130.76 0 TD[(check)]TJ/F1 10.91 Tf 32.27 0 TD[(target)-333(in)-333(the)-333(`)]TJ/F4 10.91 Tf 66.7 0 TD[(Makefile)]TJ/F1 10.91 Tf 45.82 0 TD[('.)]TJ ET 0 g 0 G
+endstream
+endobj
+41 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+>>
+endobj
+39 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 41 0 R
+>>
+endobj
+45 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-286 -250 1122 967]
+/FontName /CMR7
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 44 0 R
+>>
+endobj
+46 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F6
+/FontDescriptor 45 0 R
+/BaseFont /AAPMXE+CMR7
+/FirstChar 0
+/LastChar 127
+/Widths [706.35 938.5 876.99 781.75 753.97 843.26 815.48 876.99 815.48 876.99 815.48
+677.58 646.83 646.83 970.24 970.24 323.41 354.17 569.45 569.45 569.45 569.45 569.45
+843.26 507.94 569.45 815.48 876.99 569.45 1013.89 1136.91 876.99 323.41 323.41 569.45
+938.5 569.45 938.5 876.99 323.41 446.43 446.43 569.45 876.99 323.41 384.92 323.41
+569.45 569.45 569.45 569.45 569.45 569.45 569.45 569.45 569.45 569.45 569.45 323.41
+323.41 323.41 876.99 538.69 538.69 876.99 843.26 798.62 815.48 860.12 767.86 737.11
+883.93 843.26 412.7 583.34 874.01 706.35 1027.78 843.26 876.99 767.86 876.99 829.37
+630.96 815.48 843.26 843.26 1150.8 843.26 843.26 692.46 323.41 569.45 323.41 569.45
+323.41 323.41 569.45 630.96 507.94 630.96 507.94 354.17 569.45 630.96 323.41 354.17
+600.2 323.41 938.5 630.96 569.45 630.96 600.2 446.43 452.58 446.43 630.96 600.2 815.48
+600.2 600.2 507.94 569.45 1138.89 569.45 569.45 569.45]
+>>
+endobj
+48 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 513.89
+/Descent -194.44
+/Flags 4
+/FontBBox [-276 -250 1077 969]
+/FontName /CMCSC10
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 47 0 R
+>>
+endobj
+49 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F7
+/FontDescriptor 48 0 R
+/BaseFont /NVUTVS+CMCSC10
+/FirstChar 0
+/LastChar 127
+/Widths [683.33 902.77 844.44 755.55 727.77 813.88 786.1 844.44 786.1 844.44 786.1
+552.77 552.77 319.44 319.44 523.61 302.22 424.44 552.77 552.77 552.77 552.77 552.77
+813.88 494.44 915.55 735.55 824.44 635.55 974.99 1091.66 844.44 319.44 319.44 552.77
+902.77 552.77 902.77 844.44 319.44 436.11 436.11 552.77 844.44 319.44 377.77 319.44
+552.77 552.77 552.77 552.77 552.77 552.77 552.77 552.77 552.77 552.77 552.77 319.44
+319.44 844.44 844.44 844.44 523.61 844.44 813.88 770.83 786.1 829.16 741.66 712.49
+851.38 813.88 405.55 566.66 843.05 683.33 988.88 813.88 844.44 741.66 844.44 799.99
+611.1 786.1 813.88 813.88 1105.55 813.88 813.88 669.44 319.44 552.77 319.44 552.77
+319.44 319.44 613.33 580 591.11 624.44 557.78 535.55 641.11 613.33 302.22 424.44
+635.55 513.33 746.66 613.33 635.55 557.78 635.55 602.22 457.78 591.11 613.33 613.33
+835.55 613.33 613.33 502.22 552.77 1105.55 552.77 552.77 552.77]
+>>
+endobj
+51 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 68
+/FontBBox [-163 -250 1146 969]
+/FontName /CMTI10
+/ItalicAngle -14
+/XHeight 431
+/StemV 80
+/FontFile 50 0 R
+>>
+endobj
+52 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F8
+/FontDescriptor 51 0 R
+/BaseFont /OXLDNK+CMTI10
+/FirstChar 0
+/LastChar 127
+/Widths [627.22 817.77 766.66 692.22 664.44 743.33 715.55 766.66 715.55 766.66 715.55
+613.33 562.22 587.77 881.66 894.44 306.67 332.22 511.11 511.11 511.11 511.11 511.11
+831.29 460 536.66 715.55 715.55 511.11 882.77 984.99 766.66 255.55 306.67 514.44
+817.77 769.09 817.77 766.66 306.67 408.89 408.89 511.11 766.66 306.67 357.78 306.67
+511.11 511.11 511.11 511.11 511.11 511.11 511.11 511.11 511.11 511.11 511.11 306.67
+306.67 306.67 766.66 511.11 511.11 766.66 743.33 703.89 715.55 755 678.33 652.77
+773.61 743.33 385.55 525 768.88 627.22 896.66 743.33 766.66 678.33 766.66 729.44
+562.22 715.55 743.33 743.33 998.88 743.33 743.33 613.33 306.67 514.44 306.67 511.11
+306.67 306.67 511.11 460 460 511.11 460 306.67 460 511.11 306.67 306.67 460 255.55
+817.77 562.22 511.11 511.11 460 421.66 408.89 332.22 536.66 460 664.44 463.89 485.55
+408.89 511.11 1022.22 511.11 511.11 511.11]
+>>
+endobj
+53 0 obj
+<<
+/Length 6907
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(4)-26498(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 14.94 -23.91 TD[(T)27(ypically)84(,)-446(y)27(ou)-422(m)26(ust)-422(use)-424(t)27(w)28(o)-423(command-line)-424(options:)-625(`)]TJ/F4 10.91 Tf 261.34 0 TD[(--tool)]TJ/F1 10.91 Tf 34.37 0 TD[(',)-446(to)-423(sp)-28(ecify)-424(whic)27(h)-423(set)-423(of)]TJ -310.65 -13.15 TD[(tests)-333(to)-333(run)]TJ/F6 6.97 Tf 55.3 3.96 TD[(1)]TJ/F1 10.91 Tf 4.47 -3.96 TD[(,)-333(and)-333(`)]TJ/F4 10.91 Tf 30.91 0 TD[(--srcdir)]TJ/F1 10.91 Tf 45.82 0 TD[(',)-333(to)-333(sp)-28(ecify)-333(where)-334(to)-333(\014nd)-333(test)-334(directories.)]TJ -121.56 -16.14 TD[(F)83(or)-293(example,)-302(if)-294(the)-294(directory)-295(`)]TJ/F4 10.91 Tf 141.53 0 TD[(gdb/testsuite)]TJ/F1 10.91 Tf 74.45 0 TD[(')-294(con)27(tains)-293(a)-294(collection)-294(of)-294(DejaGn)27(u)-294(tests)-294(for)]TJ/F7 10.91 Tf -230.92 -13.15 TD[(gdb)]TJ/F1 10.91 Tf 20.13 0 TD[(,)-333(y)27(ou)-332(can)-334(run)-333(them)-333(lik)26(e)-332(this:)]TJ/F4 10.91 Tf 8.67 -15.45 TD[(eg$)-524(cd)-525(gdb/testsuite)]TJ 0 -12.45 TD[(eg$)-524(runtest)-525(--tool)-525(gdb)]TJ/F8 10.91 Tf -28.8 -12.45 TD[(T)76(est)-357(output)-357(fol)-51(lows,)-358(ending)-358(with:)]TJ/F4 10.91 Tf 28.8 -24.91 TD[(===)-524(gdb)-525(Summary)-525(===)]TJ 0 -24.91 TD[(#)-524(of)-525(expected)-525(passes)-525(508)]TJ 0 -12.45 TD[(#)-524(of)-525(expected)-525(failures)-525(103)]TJ 0 -12.45 TD[(/usr/latest/bin/gdb)-524(version)-525(4.14.4)-525(-nx)]TJ/F1 10.91 Tf -13.86 -16.14 TD[(Y)83(ou)-222(can)-223(use)-223(the)-223(option)-223(`)]TJ/F4 10.91 Tf 111.02 0 TD[(--srcdir)]TJ/F1 10.91 Tf 45.81 0 TD[(')-222(to)-223(p)-28(oin)27(t)-222(to)-223(some)-223(other)-223(directory)-223(con)26(taining)-222(a)-223(collection)]TJ -171.77 -13.15 TD[(of)-333(tests:)]TJ/F4 10.91 Tf 28.8 -15.44 TD[(eg$)-524(runtest)-525(--tool)-525(gdb)-525(--srcdir)-525(/devo/gdb/testsuite)]TJ/F1 10.91 Tf -13.86 -16.14 TD[(These)-468(examples)-468(assume)-468(a)]TJ/F5 10.91 Tf 131.29 0 TD[(nativ)27(e)]TJ/F1 10.91 Tf 34.81 0 TD[(con\014guration,)-502(where)-468(the)-468(same)-468(computer)-469(runs)-468(b)-28(oth)]TJ/F4 10.91 Tf -181.04 -13.15 TD[(runtest)]TJ/F1 10.91 Tf 44.02 0 TD[(and)-360(the)-361(tests)-360(themselv)27(es.)-525(When)-361(y)27(ou)-360(ha)27(v)28(e)-360(a)]TJ/F5 10.91 Tf 214.12 0 TD[(cross)]TJ/F1 10.91 Tf 27.57 0 TD[(con\014guration,)-367(the)-360(tests)-361(run)-360(on)]TJ -285.71 -13.16 TD[(a)-366(di\013eren)27(t)-365(computer,)-374(con)26(trolled)-365(b)27(y)-365(the)-366(host)-366(running)]TJ/F4 10.91 Tf 255.56 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(.)-542(In)-366(this)-367(situation,)-374(y)27(ou)-365(need)]TJ -295.65 -13.15 TD[(the)-333(option)-333(`)]TJ/F4 10.91 Tf 55.76 0 TD[(--name)]TJ/F1 10.91 Tf 34.36 0 TD[(')-333(to)-333(sp)-28(ecify)-333(the)-334(net)27(w)28(ork)-332(address)-334(for)-333(the)-333(other)-334(computer:)]TJ/F4 10.91 Tf -61.32 -15.44 TD[(eg$)-524(runtest)-525(--tool)-525(gdb)-525(--name)-525(vx9.munist.com)]TJ/F1 10.91 Tf -13.86 -16.14 TD[(If)-270(y)27(ou)-269(alw)27(a)27(ys)-269(use)-270(the)-270(same)-270(option)-271(v)55(alues,)-282(y)27(ou)-269(can)-270(record)-271(them)-270(in)-270(a)-270(\014le)-270(called)-271(`)]TJ/F4 10.91 Tf 365.18 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(',)]TJ -425.94 -13.15 TD[(rather)-362(than)-362(t)27(yping)-361(them)-362(eac)27(h)-361(time.)-531(See)-362(Chapter)-362(4)-362([Setting)-362(defaults)-362(for)]TJ/F4 10.91 Tf 347.29 0 TD[(runtest)]TJ/F1 10.91 Tf 44.04 0 TD[(options],)]TJ -391.33 -13.15 TD[(page)-333(15.)]TJ 14.94 -16.14 TD[(By)-392(default,)]TJ/F4 10.91 Tf 58.26 0 TD[(runtest)]TJ/F1 10.91 Tf 44.37 0 TD[(prin)27(ts)-391(only)-392(the)-392(names)-392(of)-392(the)-392(tests)-392(it)-392(runs,)-407(output)-392(from)-392(an)26(y)-391(tests)]TJ -117.57 -13.15 TD[(that)-439(ha)26(v)28(e)-439(unexp)-27(ected)-440(results,)-467(and)-439(a)-440(summary)-440(sho)27(wing)-439(ho)27(w)-439(man)27(y)-439(tests)-440(passed)-440(and)-440(ho)27(w)]TJ 0 -13.15 TD[(man)27(y)-282(failed.)-427(T)82(o)-282(displa)27(y)-282(output)-282(from)-283(all)-283(tests)-283(\(whether)-283(or)-283(not)-282(they)-283(b)-28(eha)27(v)28(e)-282(as)-283(exp)-28(ected\),)-293(use)]TJ 0 -13.15 TD[(the)-392(`)]TJ/F4 10.91 Tf 22.47 0 TD[(--all)]TJ/F1 10.91 Tf 28.63 0 TD[(')-392(option.)-623(F)83(or)-392(more)-393(v)27(erb)-27(ose)-392(output)-393(ab)-28(out)-392(pro)-28(cesses)-393(b)-28(eing)-392(run,)-408(comm)27(unication,)]TJ -51.1 -13.15 TD[(and)-391(so)-391(on,)-406(use)-391(`)]TJ/F4 10.91 Tf 77.35 0 TD[(--verbose)]TJ/F1 10.91 Tf 51.55 0 TD[('.)-618(T)83(o)-391(see)-391(ev)27(en)-390(more)-391(output,)-406(use)-391(m)26(ultiple)-390(`)]TJ/F4 10.91 Tf 206.62 0 TD[(--verbose)]TJ/F1 10.91 Tf 51.55 0 TD[(')-391(options.)]TJ -387.07 -13.15 TD[(See)-393(Chapter)-394(3)-394([Using)]TJ/F4 10.91 Tf 107.27 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(],)-408(page)-394(9,)-409(for)-393(a)-394(more)-394(detailed)-393(explanation)-394(of)-394(eac)27(h)]TJ/F4 10.91 Tf 244.55 0 TD[(runtest)]TJ/F1 10.91 Tf -391.91 -13.15 TD[(option.)]TJ 14.94 -16.14 TD[(T)83(est)-302(output)-303(go)-28(es)-303(in)27(to)-302(t)27(w)28(o)-302(\014les)-303(in)-303(y)27(our)-302(curren)27(t)-302(directory:)-429(summary)-303(output)-303(in)-303(`)]TJ/F5 10.91 Tf 369.61 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.48 0 TD[(.sum)]TJ/F1 10.91 Tf 22.91 0 TD[(',)]TJ -425.94 -13.15 TD[(and)-350(detailed)-351(output)-351(in)-351(`)]TJ/F5 10.91 Tf 114.71 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.48 0 TD[(.log)]TJ/F1 10.91 Tf 22.91 0 TD[('.)-497(\()]TJ/F5 10.91 Tf 15.73 0 TD[(to)-27(ol)]TJ/F1 10.91 Tf 22.74 0 TD[(refers)-350(to)-351(the)-351(collection)-351(of)-351(tests;)-360(for)-350(example,)-356(after)]TJ -194.57 -13.15 TD[(a)-401(run)-402(with)-401(`)]TJ/F4 10.91 Tf 59.24 0 TD[(--tool)-333(gdb)]TJ/F1 10.91 Tf 55.18 0 TD[(',)-418(lo)-28(ok)-402(for)-401(output)-402(\014les)-402(`)]TJ/F4 10.91 Tf 114.61 0 TD[(gdb.sum)]TJ/F1 10.91 Tf 40.09 0 TD[(')-401(and)-402(`)]TJ/F4 10.91 Tf 32.4 0 TD[(gdb.log)]TJ/F1 10.91 Tf 40.09 0 TD[('.\))-649(See)-402(Section)-401(5.7)]TJ -341.61 -13.15 TD[([The)-333(\014les)-333(DejaGn)27(u)-333(writes],)-333(page)-333(35.)]TJ ET 18.00 -488.41 m 162.00 -488.41 l 162.00 -488.01 l 18.00 -488.01 l b BT/F6 6.97 Tf 23.02 -496.35 TD[(1)]TJ/F1 10.91 Tf 9.92 -3.96 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(--tool)]TJ/F1 10.91 Tf 34.37 0 TD[(')-373(selects)-373(a)-373(particular)-373(suite)-374(of)-373(tests,)]TJ/F8 10.91 Tf 170.49 0 TD[(not)]TJ/F1 10.91 Tf 20.44 0 TD[(the)-373(name)-373(of)-373(the)-373(executable)-374(program)-373(to)]TJ -228.33 -13.15 TD[(run.)-620(See)-392(Chapter)-392(4)-391([Con\014guration)-392(dep)-28(enden)27(t)-391(v)54(alues],)-405(page)-392(15,)-407(for)-392(information)-392(on)-392(the)]TJ 0 -13.15 TD[(v)55(ariables)-332(that)-334(y)27(ou)-332(can)-334(use)-333(to)-333(sp)-28(ecify)-333(the)-334(names)-333(of)-333(programs)-334(to)-333(run.)]TJ ET 0 g 0 G
+endstream
+endobj
+54 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F6 46 0 R
+/F7 49 0 R
+/F8 52 0 R
+/F5 31 0 R
+>>
+endobj
+43 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 54 0 R
+>>
+endobj
+58 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 0
+/Ascent 750
+/Descent -2000
+/Flags 4
+/FontBBox [-2000 -2000 2040 2040]
+/FontName /LCIRCLE10
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 57 0 R
+>>
+endobj
+59 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F9
+/FontDescriptor 58 0 R
+/BaseFont /BMCYBZ+LCIRCLE10
+/FirstChar 0
+/LastChar 126
+/Widths [400 400 400 400 800 800 800 800 1200 1200 1200 1200 1600 1600 1600 1600
+2000 2000 2000 2000 2400 2400 2400 2400 2800 2800 2800 2800 3200 3200 3200 3200 3600
+3600 3600 3600 4000 4000 4000 4000 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
+0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 100 200 300 400
+500 600 700 800 900 1000 1100 1200 1300 1400 1500 0 100 200 300 400 500 600 700 800
+900 1000 1100 1200 1300 1400 1500]
+>>
+endobj
+60 0 obj
+<<
+/Length 6627
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(2:)-444(What)-334(is)-333(new)-333(in)-334(this)-333(release)-333(?)-21300(5)]TJ/F2 14.35 Tf 0 -23.91 TD[(2.2)-562(What)-375(do)-31(es)-375(a)-375(DejaGn)30(u)-374(test)-375(lo)-31(ok)-375(lik)30(e?)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(Eac)27(h)-353(DejaGn)27(u)-354(test)-354(is)-355(an)]TJ/F4 10.91 Tf 121.65 0 TD[(expect)]TJ/F1 10.91 Tf 38.23 0 TD[(script;)-364(the)-355(tests)-354(v)54(ary)-353(widely)-355(in)-354(complexit)27(y)83(,)-359(dep)-27(ending)]TJ -174.82 -13.15 TD[(on)-333(the)-333(nature)-333(of)-334(the)-333(to)-28(ol)-333(and)-334(the)-333(feature)-333(tested.)]TJ 14.94 -16.14 TD[(Here)-411(is)-411(a)-411(v)26(ery)-410(simple)]TJ/F7 10.91 Tf 108.07 0 TD[(gdb)]TJ/F1 10.91 Tf 24.63 0 TD[(test|one)-411(of)-411(the)-411(simplest)-412(tests)-411(shipp)-28(ed)-411(with)-411(DejaGn)26(u)-410(\(ex-)]TJ -147.64 -13.15 TD[(tracted)-333(from)-333(`)]TJ/F4 10.91 Tf 66.42 0 TD[(gdb.t00/echo.exp)]TJ/F1 10.91 Tf 91.64 0 TD[('\):)]TJ/F6 6.97 Tf 10.3 3.96 TD[(2)]TJ/F9 9.96 Tf -168.36 -14.01 TD[(\013)]TJ ET 23.98 -85.57 m 450.40 -85.57 l 450.40 -85.17 l 23.98 -85.17 l b BT 456.38 -85.57 TD[(\010)]TJ ET 18.00 -219.92 m 18.40 -219.92 l 18.40 -91.30 l 18.00 -91.30 l b BT/F4 10.91 Tf 21.39 -103.94 TD[(#)-524(send)-525(a)-525(string)-525(to)-525(the)-525(GDB)-525(stdin:)]TJ 0 -12.45 TD[(send)-524("echo)-525(Hello)-525(world!\\n")]TJ 0 -24.91 TD[(#)-524(inspect)-525(the)-525(GDB)-525(stdout)-525(for)-525(the)-525(correct)-525(reply,)]TJ 0 -12.45 TD[(#)-524(and)-525(determine)-525(whether)-525(the)-525(test)-525(passes)-525(or)-525(fails:)]TJ 0 -12.46 TD[(expect)-524({)]TJ 11.45 -12.45 TD[(-re)-524("Hello)-525(world.*$prompt)-525($")-2100({)-525(pass)-525("Echo)-525(test")-525(})]TJ 0 -12.45 TD[(-re)-524("$prompt)-525($")-8925({)-525(fail)-525("Echo)-525(test")-525(})]TJ 0 -12.46 TD[(timeout)-13124({)-525(fail)-525("\(timeout\))-525(Echo)-525(test")-525(})]TJ 0 -12.45 TD[(})]TJ ET 456.38 -219.92 m 456.77 -219.92 l 456.77 -91.30 l 456.38 -91.30 l b BT/F9 9.96 Tf 18 -226.14 TD[(\012)]TJ ET 23.98 -226.14 m 450.40 -226.14 l 450.40 -225.74 l 23.98 -225.74 l b BT 456.38 -226.14 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.39 TD[(Though)-373(brief,)-384(this)-374(example)-373(is)-374(a)-373(complete)-374(test.)-565(It)-374(illustrates)-374(some)-373(of)-374(the)-374(main)-373(features)]TJ -14.94 -13.15 TD[(of)-333(DejaGn)27(u)-332(test)-334(scripts:)]TJ/F3 10.91 Tf 8.95 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(The)-345(test)-346(case)-346(do)-28(es)-345(not)-346(start)-346(the)-346(tested)-345(program)-346(\()]TJ/F7 10.91 Tf 237.07 0 TD[(gdb)]TJ/F1 10.91 Tf 23.9 0 TD[(in)-345(this)-346(case\);)-352(all)-346(test)-345(scripts)-346(for)]TJ -260.97 -13.15 TD[(in)27(teractiv)28(e)-332(to)-28(ols)-333(can)-334(assume)-333(the)-333(corresp)-28(onding)-333(to)-28(ol)-334(is)-333(running.)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(Commen)27(ts)-332(start)-333(with)-334(`)]TJ/F4 10.91 Tf 108.33 0 TD[(#)]TJ/F1 10.91 Tf 5.73 0 TD[('.)]TJ/F3 10.91 Tf -126.71 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(The)-223(main)-223(commands)-223(y)27(ou)-222(use)-224(to)-223(con)27(trol)-222(a)-223(tested)-224(program)-223(are)]TJ/F4 10.91 Tf 283.15 0 TD[(send)]TJ/F1 10.91 Tf 25.34 0 TD[(\(to)-223(giv)27(e)-222(it)-223(commands\))]TJ -308.49 -13.15 TD[(and)]TJ/F4 10.91 Tf 21.21 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(\(to)-333(analyze)-333(its)-333(resp)-28(onses\).)]TJ/F3 10.91 Tf -71.86 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(The)]TJ/F4 10.91 Tf 22.77 0 TD[(expect)]TJ/F1 10.91 Tf 38.34 0 TD[(command)-364(uses)-365(a)-364(list)-365(of)-364(pairs;)-381(a)-364(pattern)-365(\(regular)-365(expression)-364(if)-365(`)]TJ/F4 10.91 Tf 301.1 0 TD[(-re)]TJ/F1 10.91 Tf 17.18 0 TD[(')-364(sp)-28(ec-)]TJ -379.39 -13.15 TD[(i\014ed\),)-395(follo)27(w)27(ed)-382(b)27(y)-382(an)-384(action)-383(to)-383(run)-384(if)-383(the)-383(pattern)-383(matc)26(hes)-382(output)-383(from)-383(the)-384(program.)]TJ 0 -13.15 TD[(Only)-333(the)-333(action)-333(for)-334(the)]TJ/F8 10.91 Tf 113.97 0 TD[(\014rst)]TJ/F1 10.91 Tf 23.49 0 TD[(matc)27(hing)-332(pattern)-333(will)-334(execute.)]TJ/F3 10.91 Tf -150.11 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(T)83(est)-332(cases)-334(use)-333(the)-333(commands)]TJ/F4 10.91 Tf 143.03 0 TD[(pass)]TJ/F1 10.91 Tf 26.55 0 TD[(and)]TJ/F4 10.91 Tf 21.21 0 TD[(fail)]TJ/F1 10.91 Tf 26.54 0 TD[(to)-333(record)-333(the)-333(test)-334(outcome.)]TJ/F2 14.35 Tf -238.93 -30.89 TD[(2.3)-562(Design)-375(goals)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(DejaGn)27(u)-464(grew)-465(out)-465(of)-465(the)-465(in)26(ternal)-464(needs)-465(of)-465(Cygn)27(us)-464(Supp)-28(ort.)-840(Cygn)27(us)-465(main)27(tains)-464(and)]TJ -14.94 -13.15 TD[(enhances)-259(a)-259(v)55(ariet)27(y)-258(of)-259(free)-259(programs)-260(in)-259(man)27(y)-258(di\013eren)26(t)-258(en)27(vironmen)28(ts,)-273(and)-260(w)27(e)-258(needed)-259(a)-260(testing)]TJ 0 -13.15 TD[(to)-27(ol)-334(that:)]TJ/F3 10.91 Tf 8.95 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(is)-333(useful)-333(to)-333(dev)26(elop)-26(ers)-334(while)-333(\014xing)-333(bugs;)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(automates)-333(running)-333(man)27(y)-333(tests)-333(during)-333(a)-334(soft)27(w)28(are)-332(release)-334(pro)-28(cess;)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(is)-333(p)-28(ortable)-333(among)-333(a)-334(v)55(ariet)28(y)-333(of)-333(host)-333(computers;)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(supp)-27(orts)-334(cross-dev)27(elopmen)28(t)-332(testing;)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(p)-27(ermits)-334(testing)-333(in)27(teractiv)28(e)-333(programs,)-333(lik)27(e)]TJ/F7 10.91 Tf 200.3 0 TD[(gdb)]TJ/F1 10.91 Tf 20.14 0 TD[(;)-333(and)]TJ/F3 10.91 Tf -233.09 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(p)-27(ermits)-334(testing)-333(batc)27(h)-332(orien)26(ted)-332(programs,)-333(lik)26(e)]TJ/F7 10.91 Tf 218.79 0 TD[(gcc)]TJ/F1 10.91 Tf 19.89 0 TD[(.)]TJ ET 18.00 -578.60 m 162.00 -578.60 l 162.00 -578.21 l 18.00 -578.21 l b BT/F6 6.97 Tf 23.02 -586.55 TD[(2)]TJ/F1 10.91 Tf 9.92 -3.96 TD[(More)-460(recen)26(t)]TJ/F7 10.91 Tf 63.45 0 TD[(gdb)]TJ/F1 10.91 Tf 25.16 0 TD[(tests)-460(use)-461(the)-461(`)]TJ/F4 10.91 Tf 70.42 0 TD[(gdb_test)]TJ/F1 10.91 Tf 45.81 0 TD[(')-460(pro)-28(cedure.)-827(An)-461(equiv)55(alen)28(t)-460(test)-461(using)-461(that)]TJ -204.84 -13.15 TD[(pro)-27(cedure)-334(is)-333(`)]TJ/F4 10.91 Tf 68.31 0 TD[(gdb_test)-333("echo)-333(Hello)-333(world!")-334("Hello)-333(world!")]TJ/F1 10.91 Tf 239.45 0 TD[(')]TJ ET 0 g 0 G
+endstream
+endobj
+61 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F7 49 0 R
+/F6 46 0 R
+/F9 59 0 R
+/F3 21 0 R
+/F8 52 0 R
+>>
+endobj
+56 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 61 0 R
+>>
+endobj
+64 0 obj
+<<
+/Length 8942
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(6)-26498(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 14.94 -23.91 TD[(Some)-310(of)-311(the)-310(requiremen)27(ts)-310(pro)27(v)28(ed)-310(c)27(hallenging.)-436(F)82(or)-309(example,)-315(in)27(teractiv)27(e)-309(programs)-311(do)-310(not)]TJ -14.94 -13.15 TD[(lend)-398(themselv)27(es)-398(v)27(ery)-397(w)27(ell)-398(to)-398(automated)-399(testing.)-639(But)-399(all)-398(the)-399(requiremen)27(ts)-397(are)-399(imp)-27(ortan)26(t:)]TJ 0 -13.15 TD[(for)-318(instance,)-321(it)-319(is)-318(imp)-28(erativ)27(e)-318(to)-318(mak)27(e)-318(sure)-318(that)]TJ/F7 10.91 Tf 225.51 0 TD[(gdb)]TJ/F1 10.91 Tf 23.61 0 TD[(w)27(orks)-317(as)-319(w)27(ell)-317(when)-319(cross-debugging)-318(as)]TJ -249.12 -13.15 TD[(it)-333(do)-28(es)-333(in)-333(a)-334(nativ)27(e)-332(con\014guration.)]TJ 14.94 -16.14 TD[(Probably)-328(the)-329(greatest)-329(c)27(hallenge)-328(w)27(as)-328(testing)-329(in)-329(a)-329(cross-dev)27(elopmen)28(t)-328(en)27(vironmen)28(t)-328(\(whic)27(h)]TJ -14.94 -13.15 TD[(can)-410(b)-28(e)-410(a)-411(real)-410(nigh)27(tmare\).)-675(Most)-411(cross-dev)27(elopmen)28(t)-410(en)27(vironmen)28(ts)-410(are)-410(customized)-410(b)26(y)-409(eac)27(h)]TJ 0 -13.16 TD[(dev)27(elop)-26(er.)-668(Ev)27(en)-407(when)-408(buying)-407(pac)26(k)56(aged)-407(b)-27(oards)-408(from)-408(v)27(endors)-407(there)-407(are)-408(man)27(y)-407(di\013erences.)]TJ 0 -13.15 TD[(The)-387(comm)26(unication)-387(in)27(terfaces)-387(v)55(ary)-387(from)-388(a)-388(serial)-388(line)-388(to)-388(ethernet.)-609(DejaGn)27(u)-387(w)27(as)-387(designed)]TJ 0 -13.15 TD[(with)-392(a)-392(mo)-28(dular)-392(comm)27(unication)-391(setup,)-407(so)-393(that)-392(eac)27(h)-391(kind)-393(of)-392(comm)27(unication)-391(can)-393(b)-27(e)-393(added)]TJ 0 -13.15 TD[(as)-323(required,)-325(and)-324(supp)-28(orted)-323(thereafter.)-441(Once)-324(a)-323(comm)27(unication)-323(pro)-27(cedure)-324(is)-323(co)-28(ded,)-325(an)26(y)-322(test)]TJ 0 -13.15 TD[(can)-335(use)-335(it.)-450(Curren)27(tly)-334(DejaGn)26(u)-334(can)-335(use)]TJ/F4 10.91 Tf 188.77 0 TD[(rsh)]TJ/F1 10.91 Tf 17.19 0 TD[(,)]TJ/F4 10.91 Tf 6.69 0 TD[(rlogin)]TJ/F1 10.91 Tf 34.36 0 TD[(,)]TJ/F4 10.91 Tf 6.69 0 TD[(telnet)]TJ/F1 10.91 Tf 34.37 0 TD[(,)]TJ/F4 10.91 Tf 6.69 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[(,)]TJ/F4 10.91 Tf 6.69 0 TD[(kermit)]TJ/F1 10.91 Tf 34.37 0 TD[(,)-335(and)]TJ/F4 10.91 Tf 27.92 0 TD[(mondfe)]TJ/F1 10.91 Tf 38.02 0 TD[(for)]TJ -418.94 -13.15 TD[(remote)-333(comm)27(unications.)]TJ 14.94 -16.14 TD[(Julia)-243(Menapace)-243(\014rst)-243(coined)-243(the)-243(term)-243(\\Deja)-243(Gn)27(u")-242(to)-243(describ)-28(e)-243(an)-243(earlier)-243(testing)-243(framew)27(ork)]TJ -14.94 -13.15 TD[(at)-426(Cygn)27(us)-426(Supp)-27(ort.)-724(When)-426(w)26(e)-425(replaced)-426(it)-427(with)-426(the)-427(Exp)-27(ect-based)-427(framew)27(ork,)-449(it)-426(w)27(as)-426(lik)27(e)]TJ 0 -13.15 TD[(DejaGn)27(u)-332(all)-333(o)26(v)28(er)-332(again)-61(.)-242(.)-243(.)]TJ/F2 14.35 Tf 0 -30.88 TD[(2.4)-562(A)-375(POSIX)-375(conforming)-375(test)-375(framew)30(ork)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(DejaGn)27(u)-332(conforms)-333(to)-334(the)]TJ/F7 10.91 Tf 124.56 0 TD[(posix)]TJ/F1 10.91 Tf 31.64 0 TD[(standard)-333(for)-333(test)-333(framew)26(orks.)]TJ/F7 10.91 Tf -156.2 -16.14 TD[(posix)]TJ/F1 10.91 Tf 32.27 0 TD[(standard)-390(1003.3)-391(de\014nes)-391(what)-391(a)-391(testing)-391(framew)27(ork)-390(needs)-391(to)-391(pro)26(vide,)-404(in)-391(order)-391(to)]TJ -47.21 -13.15 TD[(p)-27(ermit)-271(the)-271(creation)-271(of)]TJ/F7 10.91 Tf 105.82 0 TD[(posix)]TJ/F1 10.91 Tf 30.96 0 TD[(conformance)-270(test)-271(suites.)-424(This)-271(standard)-271(is)-271(primarily)-271(orien)27(ted)-270(to)]TJ -136.78 -13.15 TD[(running)]TJ/F7 10.91 Tf 40.66 0 TD[(posix)]TJ/F1 10.91 Tf 31.66 0 TD[(conformance)-335(tests,)-336(but)-336(its)-335(requiremen)26(ts)-334(also)-336(supp)-28(ort)-335(testing)-336(of)-335(features)-336(not)]TJ -72.32 -13.15 TD[(related)-244(to)]TJ/F7 10.91 Tf 47.78 0 TD[(posix)]TJ/F1 10.91 Tf 30.66 0 TD[(conformance.)]TJ/F7 10.91 Tf 67.29 0 TD[(posix)]TJ/F1 10.91 Tf 30.66 0 TD[(1003.3)-244(do)-27(es)-245(not)-244(sp)-27(ecify)-245(a)-244(particular)-244(testing)-244(framew)27(ork,)]TJ -176.39 -13.15 TD[(but)-333(at)-333(this)-333(time)-334(there)-333(is)-333(only)-334(one)-333(other)]TJ/F7 10.91 Tf 190.79 0 TD[(posix)]TJ/F1 10.91 Tf 31.63 0 TD[(conforming)-333(test)-333(framew)27(ork:)]TJ/F7 10.91 Tf 135.91 0 TD[(tet)]TJ/F1 10.91 Tf 18.99 0 TD[(.)]TJ/F6 6.97 Tf 3.03 3.96 TD[(3)]TJ/F1 10.91 Tf -365.41 -20.1 TD[(The)]TJ/F7 10.91 Tf 22.05 0 TD[(posix)]TJ/F1 10.91 Tf 31.25 0 TD[(do)-27(cumen)27(tation)-298(refers)-298(to)]TJ/F5 10.91 Tf 116.24 0 TD[(assertions)]TJ/F1 10.91 Tf 46.28 0 TD[(.)-432(An)-298(assertion)-299(is)-298(a)-298(description)-298(of)-299(b)-27(eha)26(vior.)]TJ -230.76 -13.15 TD[(F)83(or)-445(example,)-475(if)-446(a)-446(standard)-446(sa)27(ys)-445(\\The)-446(sun)-446(shall)-446(shine",)-475(a)-446(corresp)-28(onding)-446(assertion)-446(migh)27(t)]TJ 0 -13.15 TD[(b)-27(e)-405(\\The)-405(sun)-405(is)-405(shining.")-659(A)-405(test)-405(based)-405(on)-405(this)-405(assertion)-405(w)27(ould)-404(pass)-405(or)-405(fail)-405(dep)-28(ending)-405(on)]TJ 0 -13.15 TD[(whether)-342(it)-342(is)-342(da)27(ytime)-341(or)-342(nigh)26(ttime.)-470(It)-342(is)-342(imp)-28(ortan)27(t)-341(to)-342(note)-342(that)-343(the)-342(standard)-342(b)-28(eing)-342(tested)]TJ 0 -13.15 TD[(is)-337(nev)27(er)-337(1003.3;)-339(the)-338(standard)-337(b)-28(eing)-337(tested)-338(is)-337(some)-338(other)-337(standard,)-339(for)-337(whic)26(h)-336(the)-337(assertions)]TJ 0 -13.15 TD[(w)27(ere)-332(written.)]TJ 14.94 -16.14 TD[(As)-343(there)-343(is)-343(no)-343(test)-344(suite)-343(to)-343(test)]TJ/F8 10.91 Tf 153.02 0 TD[(testing)-366(fr)50(ameworks)]TJ/F1 10.91 Tf 93.67 0 TD[(for)]TJ/F7 10.91 Tf 16.81 0 TD[(posix)]TJ/F1 10.91 Tf 31.74 0 TD[(1003.3)-343(conformance,)-345(v)26(eri-)]TJ -310.18 -13.15 TD[(fying)-323(conformance)-323(to)-323(this)-323(standard)-323(is)-323(done)-323(b)27(y)-322(rep)-28(eatedly)-323(reading)-323(the)-323(standard)-323(and)-323(exp)-28(eri-)]TJ 0 -13.15 TD[(men)27(ting.)-437(One)-316(of)-316(the)-316(main)-316(things)-316(1003.3)-316(do)-27(es)-316(sp)-28(ecify)-316(is)-316(the)-316(set)-316(of)-316(allo)27(w)28(ed)-315(output)-316(messages,)]TJ 0 -13.15 TD[(and)-436(their)-437(de\014nitions.)-755(F)82(our)-436(messages)-437(are)-436(supp)-28(orted)-437(for)-437(a)-437(required)-437(feature)-436(of)]TJ/F7 10.91 Tf 379.24 0 TD[(posix)]TJ/F1 10.91 Tf 32.76 0 TD[(con-)]TJ -412 -13.15 TD[(forming)-441(systems,)-468(and)-442(a)-441(\014fth)-442(for)-441(a)-442(conditional)-441(feature.)-769(DejaGn)27(u)-441(supp)-27(orts)-442(the)-441(use)-442(of)-441(all)]TJ 0 -13.16 TD[(\014v)27(e)-443(output)-444(messages;)-499(in)-444(this)-445(sense)-444(a)-444(test)-444(suite)-444(that)-444(uses)-444(exactly)-444(these)-444(messages)-444(can)-444(b)-28(e)]TJ 0 -13.15 TD[(considered)]TJ/F7 10.91 Tf 53.42 0 TD[(posix)]TJ/F1 10.91 Tf 31.64 0 TD[(conforming.)-444(These)-333(de\014nitions)-334(sp)-27(ecify)-334(the)-333(output)-333(of)-334(a)-333(test)-333(case:)]TJ/F4 10.91 Tf -85.06 -28.09 TD[(PASS)]TJ/F1 10.91 Tf 57.6 0 TD[(A)-333(test)-333(has)-333(succeeded.)-445(That)-333(is,)-334(it)-333(demonstrated)-333(that)-334(the)-333(assertion)-333(is)-334(true.)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(XFAIL)]TJ/F7 10.91 Tf 57.6 0 TD[(posix)]TJ/F1 10.91 Tf 33.05 0 TD[(1003.3)-463(do)-28(es)-463(not)-463(incorp)-28(orate)-463(the)-463(notion)-464(of)-463(exp)-28(ected)-463(failures,)-496(so)]TJ/F4 10.91 Tf 315.41 0 TD[(PASS)]TJ/F1 10.91 Tf 22.91 0 TD[(,)]TJ -371.37 -13.15 TD[(instead)-361(of)]TJ/F4 10.91 Tf 50.67 0 TD[(XPASS)]TJ/F1 10.91 Tf 28.64 0 TD[(,)-368(m)27(ust)-361(also)-361(b)-28(e)-361(returned)-362(for)-361(test)-362(cases)-361(whic)27(h)-361(w)27(ere)-361(exp)-27(ected)-362(to)]TJ -79.31 -13.15 TD[(fail)-277(and)-278(did)-278(not.)-426(This)-278(means)-278(that)]TJ/F4 10.91 Tf 160.23 0 TD[(PASS)]TJ/F1 10.91 Tf 25.95 0 TD[(is)-277(in)-278(some)-278(sense)-278(more)-278(am)27(biguous)-277(than)-278(if)]TJ/F4 10.91 Tf -186.18 -13.15 TD[(XPASS)]TJ/F1 10.91 Tf 32.13 0 TD[(is)-320(also)-320(used.)-440(F)83(or)-320(information)-320(on)]TJ/F4 10.91 Tf 155.08 0 TD[(XPASS)]TJ/F1 10.91 Tf 32.13 0 TD[(and)]TJ/F4 10.91 Tf 21.06 0 TD[(XFAIL)]TJ/F1 10.91 Tf 28.64 0 TD[(,)-322(see)-320(Chapter)-320(3)-321([Using)]TJ/F4 10.91 Tf -269.04 -13.15 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(],)-333(page)-333(9.)]TJ ET 18.00 -614.63 m 162.00 -614.63 l 162.00 -614.23 l 18.00 -614.23 l b BT/F6 6.97 Tf 23.02 -622.58 TD[(3)]TJ/F7 10.91 Tf 9.92 -3.96 TD[(tet)]TJ/F1 10.91 Tf 22.45 0 TD[(w)27(as)-316(created)-318(b)27(y)-317(Unisoft)-318(for)-317(a)-318(consortium)-318(comprised)-317(of)-318(X/Op)-28(en,)-321(Unix)-317(In)27(ternational,)]TJ -22.45 -13.15 TD[(and)-333(the)-333(Op)-28(en)-333(Soft)27(w)27(are)-332(F)82(oundation.)]TJ ET 0 g 0 G
+endstream
+endobj
+65 0 obj
+<<
+/F1 9 0 R
+/F7 49 0 R
+/F4 28 0 R
+/F2 12 0 R
+/F6 46 0 R
+/F5 31 0 R
+/F8 52 0 R
+>>
+endobj
+63 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 65 0 R
+>>
+endobj
+68 0 obj
+<<
+/Length 7942
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(2:)-444(What)-334(is)-333(new)-333(in)-334(this)-333(release)-333(?)-21300(7)]TJ/F4 10.91 Tf 0 -23.91 TD[(FAIL)]TJ/F1 10.91 Tf 57.6 0 TD[(A)-290(test)]TJ/F8 10.91 Tf 32.15 0 TD[(has)]TJ/F1 10.91 Tf 19.67 0 TD[(pro)-27(duced)-290(the)-291(bug)-290(it)-290(w)27(as)-289(in)26(tended)-289(to)-290(capture.)-430(That)-290(is,)-299(it)-290(has)-290(demon-)]TJ -51.82 -13.15 TD[(strated)-348(that)-348(the)-348(assertion)-348(is)-348(false.)-489(The)]TJ/F4 10.91 Tf 188.79 0 TD[(FAIL)]TJ/F1 10.91 Tf 26.7 0 TD[(message)-348(is)-348(based)-348(on)-348(the)-348(test)-348(case)]TJ -215.49 -13.15 TD[(only)83(.)-444(Other)-333(messages)-333(are)-334(used)-333(to)-333(indicate)-334(a)-333(failure)-333(of)-334(the)-333(framew)27(ork.)]TJ 0 -16.14 TD[(As)-301(with)]TJ/F4 10.91 Tf 40.27 0 TD[(PASS)]TJ/F1 10.91 Tf 22.91 0 TD[(,)]TJ/F7 10.91 Tf 6.39 0 TD[(posix)]TJ/F1 10.91 Tf 31.29 0 TD[(tests)-301(m)27(ust)-300(return)]TJ/F4 10.91 Tf 84.95 0 TD[(FAIL)]TJ/F1 10.91 Tf 26.2 0 TD[(rather)-301(than)]TJ/F4 10.91 Tf 57.54 0 TD[(XFAIL)]TJ/F1 10.91 Tf 31.93 0 TD[(ev)27(en)-300(if)-301(a)-302(failure)]TJ -301.48 -13.15 TD[(w)27(as)-332(exp)-28(ected.)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(A)-387(test)-387(pro)-28(duced)-387(indeterminate)-388(results.)-606(Usually)82(,)-400(this)-387(means)-387(the)-388(test)-387(executed)]TJ 0 -13.15 TD[(in)-408(an)-408(unexp)-27(ected)-408(fashion;)-446(this)-408(outcome)-408(requires)-408(that)-408(a)-408(h)27(uman)-407(b)-28(eing)-408(go)-408(o)27(v)27(er)]TJ 0 -13.15 TD[(results,)-383(to)-374(determine)-374(if)-374(the)-374(test)-373(should)-374(ha)27(v)27(e)-372(passed)-374(or)-374(failed.)-566(This)-374(message)-374(is)]TJ 0 -13.15 TD[(also)-279(used)-280(for)-280(an)27(y)-279(test)-279(that)-280(requires)-280(h)27(uman)-279(in)27(terv)28(en)27(tion)-278(b)-28(ecause)-280(it)-280(is)-279(b)-28(ey)27(ond)-279(the)]TJ 0 -13.15 TD[(abilities)-309(of)-310(the)-310(testing)-310(framew)26(ork.)-435(An)26(y)-309(unresolv)27(ed)-309(test)-310(should)-310(resolv)27(ed)-309(to)]TJ/F4 10.91 Tf 351.49 0 TD[(PASS)]TJ/F1 10.91 Tf -351.49 -13.16 TD[(or)]TJ/F4 10.91 Tf 13.36 0 TD[(FAIL)]TJ/F1 10.91 Tf 26.55 0 TD[(b)-27(efore)-334(a)-333(test)-333(run)-334(can)-333(b)-28(e)-333(considered)-333(\014nished.)]TJ -39.91 -16.13 TD[(Note)-311(that)-311(for)]TJ/F7 10.91 Tf 65.97 0 TD[(posix)]TJ/F1 10.91 Tf 28 0 TD[(,)-315(eac)27(h)-310(assertion)-312(m)27(ust)-310(pro)-28(duce)-311(a)-311(test)-311(result)-311(co)-28(de.)-437(If)-311(the)-312(test)]TJ -93.97 -13.16 TD[(isn't)-401(actually)-401(run,)-418(it)-402(m)27(ust)-400(pro)-28(duce)]TJ/F4 10.91 Tf 173 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 61.65 0 TD[(rather)-401(than)-401(just)-401(lea)26(ving)-400(that)]TJ -234.65 -13.15 TD[(test)-383(out)-383(of)-383(the)-383(output.)-594(This)-383(means)-384(that)-383(y)27(ou)-382(ha)27(v)27(e)-382(to)-383(b)-28(e)-383(careful)-383(when)-383(writing)]TJ 0 -13.15 TD[(tests,)-363(to)-358(not)-357(carelessly)-357(use)-358(tcl)-357(statemen)26(ts)-356(lik)27(e)]TJ/F4 10.91 Tf 221.42 0 TD[(return)]TJ/F1 10.91 Tf 34.36 0 TD[(|if)-357(y)27(ou)-357(alter)-357(the)-358(\015o)27(w)-356(of)]TJ -255.78 -13.15 TD[(con)27(trol)-272(of)-273(the)-273(tcl)-273(co)-28(de)-273(y)27(ou)-272(m)27(ust)-272(insure)-273(that)-273(ev)26(ery)-272(test)-273(still)-273(pro)-28(duces)-273(some)-273(result)]TJ 0 -13.15 TD[(co)-27(de.)]TJ 0 -16.14 TD[(Here)-333(are)-333(some)-333(of)-334(the)-333(w)27(a)27(ys)-332(a)-333(test)-334(ma)27(y)-332(wind)-333(up)]TJ/F4 10.91 Tf 225.39 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.28 0 TD[(:)]TJ/F3 10.91 Tf -273.72 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(A)-333(test's)-333(execution)-333(is)-334(in)27(terrupted.)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(A)-367(test)-367(do)-27(es)-368(not)-367(pro)-27(duce)-368(a)-367(clear)-367(result.)-546(This)-367(is)-367(usually)-367(b)-28(ecause)-367(there)-367(w)27(as)]TJ 0 -13.15 TD[(an)]TJ/F4 10.91 Tf 15.71 0 TD[(ERROR)]TJ/F1 10.91 Tf 32.83 0 TD[(from)-384(DejaGn)27(u)-384(while)-384(pro)-28(cessing)-384(the)-385(test,)-397(or)-384(b)-28(ecause)-384(there)-385(w)27(ere)]TJ -48.54 -13.15 TD[(three)-445(or)-446(more)]TJ/F4 10.91 Tf 72.25 0 TD[(WARNING)]TJ/F1 10.91 Tf 44.96 0 TD[(messages.)-781(An)27(y)]TJ/F4 10.91 Tf 78.72 0 TD[(WARNING)]TJ/F1 10.91 Tf 44.95 0 TD[(or)]TJ/F4 10.91 Tf 14.59 0 TD[(ERROR)]TJ/F1 10.91 Tf 33.5 0 TD[(messages)-445(can)]TJ -288.97 -13.15 TD[(in)27(v)56(alidate)-361(the)-361(output)-362(of)-361(the)-362(test.)-529(This)-362(usually)-361(requires)-362(a)-362(h)27(uman)-360(b)-28(eing)-362(to)]TJ 0 -13.15 TD[(examine)-382(the)-383(output)-382(to)-383(determine)-382(what)-383(really)-382(happ)-28(ened|and)-382(to)-383(impro)27(v)28(e)]TJ 0 -13.15 TD[(the)-333(test)-333(case.)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(A)-333(test)-333(dep)-28(ends)-333(on)-334(a)-333(previous)-333(test,)-334(whic)27(h)-332(fails.)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(The)-333(test)-333(w)27(as)-333(set)-333(up)-333(incorrectly)82(.)]TJ/F4 10.91 Tf -79.2 -22.12 TD[(UNTESTED)]TJ/F1 10.91 Tf 57.6 0 TD[(A)-341(test)-342(w)27(as)-341(not)-342(run.)-469(This)-342(is)-342(a)-341(placeholder,)-344(used)-342(when)-342(there)-342(is)-341(no)-342(real)-342(test)-341(case)]TJ 0 -13.15 TD[(y)27(et.)]TJ -57.6 -19.12 TD[(The)-395(only)-395(remaining)-395(output)-395(message)-395(left)-395(is)-395(in)27(tended)-394(to)-395(test)-395(features)-395(that)-395(are)-395(sp)-28(eci\014ed)-395(b)27(y)]TJ 0 -13.16 TD[(the)-333(applicable)]TJ/F7 10.91 Tf 70.3 0 TD[(posix)]TJ/F1 10.91 Tf 31.64 0 TD[(standard)-333(as)-333(conditional:)]TJ/F4 10.91 Tf -101.94 -22.11 TD[(UNSUPPORTED)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(There)-444(is)-445(no)-445(supp)-28(ort)-445(for)-445(the)-444(tested)-445(case.)-779(This)-445(ma)27(y)-444(mean)-445(that)-445(a)-445(conditional)]TJ 0 -13.15 TD[(feature)-320(of)-320(an)-320(op)-27(erating)-320(system,)-323(or)-320(of)-320(a)-320(compiler,)-323(is)-320(not)-320(implemen)27(ted.)-439(DejaGn)27(u)]TJ 0 -13.15 TD[(also)-256(uses)-256(this)-256(message)-257(when)-256(a)-256(testing)-257(en)27(vironmen)28(t)-255(\(often)-257(a)-256(\\bare)-256(b)-28(oard")-256(target\))]TJ 0 -13.16 TD[(lac)27(ks)-333(basic)-334(supp)-27(ort)-334(for)-334(compiling)-334(or)-334(running)-334(the)-334(test)-334(case.)-446(F)82(or)-332(example,)-335(a)-333(test)]TJ 0 -13.15 TD[(for)-420(the)-420(system)-420(subroutine)]TJ/F4 10.91 Tf 129.49 0 TD[(gethostname)]TJ/F1 10.91 Tf 67.58 0 TD[(w)27(ould)-419(nev)27(er)-419(w)26(ork)-419(on)-420(a)-420(target)-421(b)-27(oard)]TJ -197.07 -13.15 TD[(running)-333(only)-333(a)-333(b)-28(o)-28(ot)-333(monitor.)]TJ -42.66 -19.13 TD[(DejaGn)27(u)-326(uses)-326(the)-327(same)-327(output)-327(pro)-27(cedures)-327(to)-327(pro)-28(duce)-327(these)-326(messages)-327(for)-327(all)-327(test)-326(suites,)]TJ -14.94 -13.15 TD[(and)-365(these)-366(pro)-28(cedures)-366(are)-366(already)-366(kno)27(wn)-365(to)-366(conform)-366(to)]TJ/F7 10.91 Tf 267.41 0 TD[(posix)]TJ/F1 10.91 Tf 31.99 0 TD[(1003.3.)-542(F)83(or)-365(a)-366(DejaGn)27(u)-365(test)]TJ -299.4 -13.15 TD[(suite)-318(to)-318(conform)-319(to)]TJ/F7 10.91 Tf 94.29 0 TD[(posix)]TJ/F1 10.91 Tf 31.47 0 TD[(1003.3,)-321(y)27(ou)-317(m)26(ust)-317(a)27(v)28(oid)-318(the)]TJ/F4 10.91 Tf 131.4 0 TD[(setup_xfail)]TJ/F1 10.91 Tf 66.47 0 TD[(pro)-27(cedure)-319(as)-318(describ)-28(ed)]TJ -323.63 -13.15 TD[(in)-246(the)]TJ/F4 10.91 Tf 29.63 0 TD[(PASS)]TJ/F1 10.91 Tf 25.6 0 TD[(section)-246(ab)-28(o)27(v)27(e,)-263(and)-246(y)26(ou)-245(m)26(ust)-245(b)-28(e)-247(careful)-247(to)-247(return)]TJ/F4 10.91 Tf 227.96 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 59.97 0 TD[(where)-246(appropriate,)]TJ -343.16 -13.15 TD[(as)-333(describ)-28(ed)-333(in)-333(the)]TJ/F4 10.91 Tf 93.18 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 60.91 0 TD[(section)-333(ab)-28(o)27(v)28(e.)]TJ ET 0 g 0 G
+endstream
+endobj
+69 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F8 52 0 R
+/F7 49 0 R
+/F3 21 0 R
+>>
+endobj
+67 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 69 0 R
+>>
+endobj
+72 0 obj
+<<
+/Length 3732
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(8)-26498(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -23.91 TD[(2.5)-562(F)93(uture)-374(directions)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(In)-318(the)-318(near)-318(future,)-321(there)-318(are)-318(t)27(w)28(o)-318(parallel)-318(directions)-318(for)-318(DejaGn)27(u)-317(dev)27(elopmen)28(t.)-439(The)-318(\014rst)]TJ -14.94 -13.15 TD[(is)-333(to)-333(add)-333(supp)-28(ort)-334(for)-333(more)-333(hosts)-334(and)-333(targets.)]TJ 14.94 -16.14 TD[(The)-302(second)-303(w)26(ould)-302(p)-27(ermit)-303(testing)-303(programs)-303(with)-303(a)-303(more)-303(complex)-303(in)27(terface,)-308(whether)-303(text)]TJ -14.94 -13.15 TD[(based)-338(or)-338(GUI)-338(based.)-459(Tw)27(o)-337(comp)-28(onen)27(ts)-337(already)-338(exist:)-454(a)-338(Tcl)-339(based)-338(X)-338(windo)27(w)-337(to)-28(olkit,)-339(and)-338(a)]TJ 0 -13.15 TD[(terminal)-371(pac)27(k)55(age)-370(for)]TJ/F4 10.91 Tf 102.22 0 TD[(expect)]TJ/F1 10.91 Tf 34.37 0 TD[(.)-559(Both)-372(of)-371(these)-372(could)-371(b)-28(e)-372(merged)-372(in)27(to)-370(DejaGn)26(u)-370(in)-372(a)-372(w)27(a)28(y)-371(that)]TJ -136.59 -13.15 TD[(p)-27(ermits)-334(testing)-333(programs)-333(that)-334(run)-333(in)-333(eac)27(h)-333(en)27(vironmen)28(t.)]TJ 14.94 -16.14 TD[(Mean)27(while,)-292(w)27(e)-282(hop)-28(e)-283(DejaGn)26(u)-282(enables)-283(the)-283(creation)-284(of)-283(test)-283(suites)-283(for)-284(conformance)-283(to)]TJ/F7 10.91 Tf 395.39 0 TD[(ansi)]TJ/F1 10.91 Tf -410.33 -13.15 TD[(C)-369(and)-370(C)]TJ/F4 10.91 Tf 41.4 0 TD[(++)]TJ/F1 10.91 Tf 11.45 0 TD[(,)-378(to)]TJ/F7 10.91 Tf 20.89 0 TD[(posix)]TJ/F1 10.91 Tf 28 0 TD[(,)-378(and)-370(to)-369(other)-370(standards.)-553(W)83(e)-369(encourage)-369(y)26(ou)-368(to)-370(mak)27(e)-368(an)26(y)-368(test)-370(suites)]TJ -101.74 -13.15 TD[(y)27(ou)-332(create)-333(freely)-334(a)27(v)56(ailable,)-333(under)-333(the)-333(same)-334(terms)-333(as)-333(DejaGn)26(u)-332(itself.)]TJ/F2 14.35 Tf 0 -30.88 TD[(2.6)-562(Tcl)-375(and)-375(Exp)-31(ect)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(Tcl)-284(w)27(as)-284(in)27(tro)-27(duced)-285(in)-284(a)-285(pap)-27(er)-285(b)27(y)-284(John)-285(K.)-284(Ousterhout)-285(at)-284(the)-285(1990)-285(Win)27(ter)-283(Usenix)-285(confer-)]TJ -14.94 -13.15 TD[(ence,)]TJ/F5 10.91 Tf 26.8 0 TD[(Tcl:)-417(An)-280(Em)27(b)-27(eddable)-279(Command)-280(Language)]TJ/F1 10.91 Tf 200.37 0 TD[(.)-426(That)-280(pap)-27(er)-280(is)-279(included)-280(in)-279(P)26(ostScript)-278(form)]TJ -227.17 -13.15 TD[(in)-368(the)-368(`)]TJ/F4 10.91 Tf 35.31 0 TD[(doc)]TJ/F1 10.91 Tf 17.18 0 TD[(')-368(sub)-28(directory)-368(of)-368(the)-369(Tcl)-368(distribution.)-549(The)-369(v)27(ersion)-367(of)-368(Tcl)-369(included)-368(in)-368(DejaGn)26(u)]TJ -52.49 -13.15 TD[(at)-333(this)-333(time)-333(is)-334(Tcl)-333(7.4p3.)]TJ 14.94 -16.14 TD[(Don)-331(Lib)-28(es)-331(in)27(tro)-27(duced)]TJ/F4 10.91 Tf 107 0 TD[(expect)]TJ/F1 10.91 Tf 37.98 0 TD[(in)-331(his)-331(pap)-28(er)]TJ/F5 10.91 Tf 60.33 0 TD[(exp)-27(ect:)-444(Curing)-331(Those)-331(Uncon)26(trollable)-330(Fits)-331(of)]TJ -220.25 -13.15 TD[(In)27(teraction)]TJ/F1 10.91 Tf 56.68 0 TD[(at)-414(the)-415(1990)-415(Summer)-414(Usenix)-415(conference.)-688(The)-415(pap)-28(er)-415(is)-414(included)-415(in)-415(P)27(ostScript)]TJ -56.68 -13.15 TD[(form)-306(in)-306(the)]TJ/F4 10.91 Tf 56.42 0 TD[(expect)]TJ/F1 10.91 Tf 37.71 0 TD[(distribution)-306(\(as)-306(are)-307(sev)27(eral)-306(other)-306(pap)-28(ers)-306(ab)-28(out)]TJ/F4 10.91 Tf 223.8 0 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(\).)-435(The)-306(v)26(ersion)-305(of)]TJ -352.29 -13.15 TD[(exp)-27(ect)-334(included)-333(in)-333(DejaGn)27(u)-333(at)-333(this)-333(time)-334(is)-333(exp)-28(ect)-333(5.18.0.)]TJ ET 0 g 0 G
+endstream
+endobj
+73 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F7 49 0 R
+/F5 31 0 R
+>>
+endobj
+71 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 73 0 R
+>>
+endobj
+77 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 611.11
+/Ascent 611.11
+/Descent -222.22
+/Flags 5
+/FontBBox [-1 -234 716 801]
+/FontName /CMTT12
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 76 0 R
+>>
+endobj
+78 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F10
+/FontDescriptor 77 0 R
+/BaseFont /QZZRHI+CMTT12
+/FirstChar 0
+/LastChar 127
+/Widths [514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58]
+>>
+endobj
+79 0 obj
+<<
+/Length 7234
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(3:)-444(Using)]TJ/F4 10.91 Tf 86.45 0 TD[(runtest)]TJ/F1 10.91 Tf 340.1 0 TD[(9)]TJ/F2 17.22 Tf -426.55 -25.91 TD[(3)-562(Using)]TJ/F10 17.22 Tf 74.17 0 TD[(runtest)]TJ/F4 10.91 Tf -59.23 -28.09 TD[(runtest)]TJ/F1 10.91 Tf 43.77 0 TD[(is)-336(the)-337(executable)-337(test)-336(driv)27(er)-336(for)-337(DejaGn)27(u.)-454(Y)83(ou)-336(can)-337(sp)-27(ecify)-337(t)27(w)27(o)-335(kinds)-337(of)-337(things)]TJ -58.71 -13.15 TD[(on)-274(the)]TJ/F4 10.91 Tf 32.66 0 TD[(runtest)]TJ/F1 10.91 Tf 43.09 0 TD[(command)-274(line:)-416(command)-274(line)-275(options,)-287(and)-275(Tcl)-275(v)55(ariables)-274(for)-275(the)-275(test)-274(scripts.)]TJ -75.75 -13.15 TD[(The)-333(options)-333(are)-333(listed)-334(alphab)-28(etically)-333(b)-28(elo)27(w.)]TJ/F4 10.91 Tf 14.94 -16.14 TD[(runtest)]TJ/F1 10.91 Tf 43.74 0 TD[(returns)-334(an)-334(exit)-335(co)-28(de)-334(of)]TJ/F4 10.91 Tf 112.01 0 TD[(1)]TJ/F1 10.91 Tf 9.37 0 TD[(if)-334(an)27(y)-334(test)-334(has)-335(an)-334(unexp)-28(ected)-334(result;)-335(otherwise)-335(\(if)-334(all)]TJ -180.06 -13.15 TD[(tests)-333(pass)-333(or)-333(fail)-334(as)-333(exp)-28(ected\))-333(it)-334(returns)]TJ/F4 10.91 Tf 192.88 0 TD[(0)]TJ/F1 10.91 Tf 9.36 0 TD[(as)-333(the)-333(exit)-333(co)-28(de.)]TJ/F4 10.91 Tf -187.3 -16.14 TD[(runtest)]TJ/F1 10.91 Tf 43.34 0 TD[(\015ags)-297(the)-298(outcome)-297(of)-298(eac)27(h)-297(test)-297(as)-298(one)-298(of)-297(these)-298(cases.)-432(\(See)-298(Section)-298(2.4)-297([A)-298(POSIX)]TJ -58.28 -13.15 TD[(conforming)-301(test)-301(framew)26(ork],)-307(page)-301(6,)-308(for)-301(a)-302(discussion)-301(of)-302(ho)27(w)]TJ/F7 10.91 Tf 284 0 TD[(posix)]TJ/F1 10.91 Tf 31.29 0 TD[(sp)-27(eci\014es)-302(the)-301(meanings)-302(of)]TJ -315.29 -13.15 TD[(these)-333(cases.\))]TJ/F4 10.91 Tf 0 -19.13 TD[(PASS)]TJ/F1 10.91 Tf 57.6 0 TD[(The)-320(most)-320(desirable)-321(outcome:)-438(the)-320(test)-321(succeeded,)-323(and)-320(w)27(as)-320(exp)-28(ected)-320(to)-320(succeed.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(XPASS)]TJ/F1 10.91 Tf 57.6 0 TD[(A)-288(pleasan)27(t)-287(kind)-288(of)-288(failure:)-422(a)-288(test)-288(w)27(as)-287(exp)-28(ected)-288(to)-288(fail,)-297(but)-288(succeeded.)-430(This)-288(ma)27(y)]TJ 0 -13.15 TD[(indicate)-283(progress;)-300(insp)-28(ect)-284(the)-283(test)-284(case)-284(to)-283(determine)-284(whether)-284(y)27(ou)-282(should)-284(amend)]TJ 0 -13.15 TD[(it)-333(to)-333(stop)-333(exp)-28(ecting)-334(failure.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(FAIL)]TJ/F1 10.91 Tf 57.6 0 TD[(A)-358(test)-359(failed,)-366(although)-358(it)-359(w)26(as)-358(exp)-27(ected)-359(to)-359(succeed.)-521(This)-359(ma)27(y)-358(indicate)-359(regress;)]TJ 0 -13.15 TD[(insp)-27(ect)-334(the)-333(test)-333(case)-334(and)-333(the)-333(failing)-334(soft)27(w)28(are)-332(to)-334(lo)-28(cate)-333(the)-333(bug.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(XFAIL)]TJ/F1 10.91 Tf 57.6 0 TD[(A)-414(test)-414(failed,)-435(but)-414(it)-415(w)27(as)-413(exp)-28(ected)-414(to)-415(fail.)-687(This)-415(result)-414(indicates)-415(no)-414(c)27(hange)-414(in)]TJ 0 -13.15 TD[(a)-360(kno)26(wn)-359(bug.)-527(If)-361(a)-361(test)-361(fails)-360(b)-28(ecause)-361(the)-361(op)-27(erating)-361(system)-361(where)-361(the)-361(test)-360(runs)]TJ 0 -13.15 TD[(lac)27(ks)-332(some)-333(facilit)26(y)-332(required)-333(b)27(y)-333(the)-333(test,)-333(the)-334(outcome)-333(is)]TJ/F4 10.91 Tf 264.55 0 TD[(UNSUPPORTED)]TJ/F1 10.91 Tf 66.63 0 TD[(instead.)]TJ/F4 10.91 Tf -388.78 -19.13 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(Output)-444(from)-445(a)-445(test)-445(requires)-445(man)27(ual)-444(insp)-28(ection;)-501(the)-445(test)-445(suite)-445(could)-445(not)-444(au-)]TJ 0 -13.15 TD[(tomatically)-430(determine)-431(the)-430(outcome.)-737(F)82(or)-429(example,)-455(y)27(our)-430(tests)-431(can)-430(rep)-28(ort)-431(this)]TJ 0 -13.15 TD[(outcome)-333(is)-333(when)-333(a)-334(test)-333(do)-28(es)-333(not)-334(complete)-333(as)-333(exp)-28(ected.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(UNTESTED)]TJ/F1 10.91 Tf 57.6 0 TD[(A)-305(test)-305(case)-305(is)-305(not)-305(y)27(et)-304(complete,)-311(and)-305(in)-305(particular)-305(cannot)-305(y)27(et)-304(pro)-28(duce)-305(a)]TJ/F4 10.91 Tf 338.44 0 TD[(PASS)]TJ/F1 10.91 Tf 26.23 0 TD[(or)]TJ/F4 10.91 Tf -364.67 -13.15 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(.)-436(Y)83(ou)-308(can)-308(also)-308(use)-309(this)-308(outcome)-309(in)-308(dumm)27(y)-308(\\tests")-308(that)-308(note)-309(explicitly)-308(the)]TJ -22.91 -13.15 TD[(absence)-333(of)-333(a)-333(real)-334(test)-333(case)-333(for)-334(a)-333(particular)-333(prop)-28(ert)27(y)83(.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(UNSUPPORTED)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(A)-351(test)-352(dep)-28(ends)-352(on)-351(a)-352(conditionally)-352(a)27(v)56(ailable)-351(feature)-352(that)-352(do)-27(es)-352(not)-352(exist)-352(\(in)-351(the)]TJ 0 -13.15 TD[(con\014gured)-446(testing)-447(en)26(vironmen)28(t\).)-784(F)82(or)-446(example,)-475(y)26(ou)-446(can)-447(use)-446(this)-447(outcome)-447(to)]TJ 0 -13.15 TD[(rep)-27(ort)-462(on)-463(a)-462(test)-462(case)-462(that)-462(do)-28(es)-462(not)-462(w)27(ork)-462(on)-462(a)-462(particular)-462(target)-462(b)-28(ecause)-462(its)]TJ 0 -13.15 TD[(op)-27(erating)-334(system)-333(supp)-28(ort)-333(do)-28(es)-333(not)-334(include)-333(a)-333(required)-334(subroutine.)]TJ/F4 10.91 Tf -42.66 -19.13 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(ma)27(y)-332(also)-333(displa)26(y)-332(the)-333(follo)27(wing)-333(messages:)]TJ/F4 10.91 Tf -58.67 -19.13 TD[(ERROR)]TJ/F1 10.91 Tf 57.6 0 TD[(Indicates)-473(a)-474(ma)-55(jor)-474(problem)-474(\(detected)-473(b)26(y)-472(the)-474(test)-474(case)-473(itself)-78(\))-474(in)-473(running)-474(the)]TJ 0 -13.15 TD[(test.)-705(This)-420(is)-421(usually)-420(an)-421(unreco)27(v)28(erable)-419(error,)-443(suc)27(h)-419(as)-420(a)-421(missing)-420(\014le)-421(or)-420(loss)-420(of)]TJ 0 -13.15 TD[(comm)27(unication)-338(to)-339(the)-339(target.)-461(\()]TJ/F7 10.91 Tf 149.18 0 TD[(posix)]TJ/F1 10.91 Tf 31.7 0 TD[(test)-338(suites)-339(should)-339(not)-339(emit)-339(this)-339(message;)]TJ -180.88 -13.15 TD[(use)]TJ/F4 10.91 Tf 18.85 0 TD[(UNSUPPORTED)]TJ/F1 10.91 Tf 63 0 TD[(,)]TJ/F4 10.91 Tf 6.66 0 TD[(UNTESTED)]TJ/F1 10.91 Tf 45.82 0 TD[(,)-333(or)]TJ/F4 10.91 Tf 20.03 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 60.91 0 TD[(instead,)-333(as)-333(appropriate.\))]TJ/F4 10.91 Tf -272.87 -19.13 TD[(WARNING)]TJ/F1 10.91 Tf 57.6 0 TD[(Indicates)-337(a)-337(p)-27(ossible)-338(problem)-337(in)-337(running)-337(the)-337(test.)-456(Usually)-337(w)27(arnings)-336(corresp)-28(ond)]TJ 0 -13.15 TD[(to)-250(reco)27(v)28(erable)-249(errors,)-267(or)-250(displa)27(y)-249(an)-250(imp)-28(ortan)27(t)-249(message)-250(ab)-28(out)-250(the)-250(follo)27(wing)-249(tests.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(NOTE)]TJ/F1 10.91 Tf 57.6 0 TD[(An)-333(informational)-333(message)-333(ab)-28(out)-334(the)-333(test)-333(case.)]TJ -42.66 -19.12 TD[(This)-371(is)-371(the)-372(full)-371(set)-372(of)-371(command)-372(line)-371(options)-372(that)]TJ/F4 10.91 Tf 239.56 0 TD[(runtest)]TJ/F1 10.91 Tf 44.14 0 TD[(recognizes.)-558(Argumen)26(ts)-370(ma)27(y)]TJ -298.64 -13.15 TD[(b)-27(e)-334(abbreviated)-333(to)-333(the)-334(shortest)-333(unique)-333(string.)]TJ ET 0 g 0 G
+endstream
+endobj
+80 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F2 12 0 R
+/F10 78 0 R
+/F7 49 0 R
+>>
+endobj
+75 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 80 0 R
+>>
+endobj
+83 0 obj
+<<
+/Length 9347
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(10)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F4 10.91 Tf 28.8 -23.91 TD[(runtest)-524(--tool)]TJ/F5 10.91 Tf 85.91 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 30.37 0 TD[([)]TJ/F5 10.91 Tf 11.45 0 TD[(testsuite)]TJ/F4 10.91 Tf 40.12 0 TD[(.exp)-524(...)-525(])]TJ -167.85 -12.46 TD[([)]TJ/F5 10.91 Tf 11.45 0 TD[(testsuite)]TJ/F4 10.91 Tf 40.13 0 TD[(.exp="testfile1)-524(...")-525(])]TJ -51.58 -12.45 TD[([)]TJ/F5 10.91 Tf 11.45 0 TD[(tclv)55(ar)]TJ/F4 10.91 Tf 27.79 0 TD[(=)]TJ/F5 10.91 Tf 5.72 0 TD[(v)55(alue)]TJ/F4 10.91 Tf 25.16 0 TD[(...)-524(])]TJ -70.12 -12.45 TD[([)-524(--all)-525(])-1050([)-525(--baud)]TJ/F5 10.91 Tf 114.54 0 TD[(baud-rate)]TJ/F4 10.91 Tf 52.43 0 TD[(])-1049([)-525(--connect)]TJ/F5 10.91 Tf 85.91 0 TD[(t)27(yp)-26(e)]TJ/F4 10.91 Tf 27.25 0 TD[(])]TJ -280.13 -12.46 TD[([)-524(--debug)-525(])-1050([)-525(--help)-525(])-1050([)-525(--host)]TJ/F5 10.91 Tf 194.73 0 TD[(string)]TJ/F4 10.91 Tf 34.02 0 TD[(])]TJ -228.75 -12.45 TD[([)-524(--mail)-525(")]TJ/F5 10.91 Tf 57.27 0 TD[(name)]TJ/F4 10.91 Tf 31.79 0 TD[(...")-524(])-1050([)-525(--name)]TJ/F5 10.91 Tf 97.37 0 TD[(string)]TJ/F4 10.91 Tf 34.02 0 TD[(])]TJ -220.45 -12.45 TD[([)-524(--name)]TJ/F5 10.91 Tf 51.54 0 TD[(name)]TJ/F4 10.91 Tf 31.8 0 TD[(])-1049([)-525(--outdir)]TJ/F5 10.91 Tf 80.18 0 TD[(path)]TJ/F4 10.91 Tf 27.54 0 TD[(])]TJ -191.06 -12.46 TD[([)-524(--objdir)]TJ/F5 10.91 Tf 63 0 TD[(path)]TJ/F4 10.91 Tf 27.54 0 TD[(])-1049([)-525(--reboot)-525(])]TJ -90.54 -12.45 TD[([)-524(--srcdir)]TJ/F5 10.91 Tf 63 0 TD[(path)]TJ/F4 10.91 Tf 27.54 0 TD[(])-1049([)-525(--strace)]TJ/F5 10.91 Tf 80.19 0 TD[(n)]TJ/F4 10.91 Tf 11.78 0 TD[(])]TJ -182.51 -12.45 TD[([)-524(--target)]TJ/F5 10.91 Tf 63 0 TD[(string)]TJ/F4 10.91 Tf 34.02 0 TD[(--build)]TJ/F5 10.91 Tf 45.82 0 TD[(string)]TJ/F4 10.91 Tf 34.03 0 TD[(])]TJ -176.87 -12.46 TD[([)-524(-v)-525(|)-525(--verbose)-525(])-1050([)-525(-V)-525(|)-525(--version)-525(])-1050([)-525(--D)]TJ/F5 10.91 Tf 257.72 0 TD[(n)]TJ/F4 10.91 Tf 11.79 0 TD[(])]TJ -298.31 -18.2 TD[(--tool)]TJ/F5 10.91 Tf 38 0 TD[(to)-27(ol)]TJ 19.6 -13.15 TD[(to)-27(ol)]TJ/F1 10.91 Tf 23.21 0 TD[(sp)-27(eci\014es)-394(what)-394(set)-393(of)-394(tests)-394(to)-394(run,)-408(and)-394(what)-394(initialization)-394(mo)-27(dule)-394(to)-394(use.)]TJ/F5 10.91 Tf -23.21 -13.16 TD[(to)-27(ol)]TJ/F1 10.91 Tf 22.47 0 TD[(is)-325(used)]TJ/F8 10.91 Tf 35.71 0 TD[(only)]TJ/F1 10.91 Tf 24.31 0 TD[(for)-325(these)-326(t)27(w)28(o)-325(purp)-28(oses:)-440(it)-326(is)]TJ/F8 10.91 Tf 136.2 0 TD[(not)]TJ/F1 10.91 Tf 19.92 0 TD[(used)-325(to)-326(name)-325(the)-326(executable)]TJ -238.61 -13.15 TD[(program)-276(to)-276(test.)-425(Executable)-276(to)-28(ol)-276(names)-276(\(and)-276(paths\))-277(are)-276(recorded)-276(in)-276(`)]TJ/F4 10.91 Tf 325.55 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')]TJ -371.37 -13.15 TD[(\(see)-251(Chapter)-251(4)-252([Con\014guration)-251(dep)-28(enden)27(t)-250(v)54(alues],)-266(page)-252(15\),)-268(and)-251(y)27(ou)-251(can)-251(o)27(v)28(erride)]TJ 0 -13.15 TD[(them)-333(b)27(y)-332(sp)-28(ecifying)-333(Tcl)-334(v)55(ariables)-333(on)-333(the)-333(command)-334(line.)]TJ 0 -15.68 TD[(F)83(or)-356(example,)-364(including)-357(`)]TJ/F4 10.91 Tf 116.48 0 TD[(--tool)-333(gcc)]TJ/F1 10.91 Tf 55.19 0 TD[(')-357(on)-357(the)]TJ/F4 10.91 Tf 41.38 0 TD[(runtest)]TJ/F1 10.91 Tf 43.99 0 TD[(command)-357(line)-357(runs)-357(tests)]TJ -257.04 -13.15 TD[(from)-413(all)-413(test)-414(sub)-28(directories)-413(whose)-413(names)-414(matc)27(h)-412(`)]TJ/F4 10.91 Tf 239.54 0 TD[(gcc.*)]TJ/F1 10.91 Tf 28.64 0 TD[(',)-433(and)-413(uses)-414(one)-413(of)-414(the)]TJ -268.18 -13.15 TD[(initialization)-329(mo)-27(dules)-329(named)-329(`)]TJ/F4 10.91 Tf 144.47 0 TD[(config/*-gcc.exp)]TJ/F1 10.91 Tf 91.63 0 TD[('.)-443(T)83(o)-328(sp)-28(ecify)-329(the)-329(name)-329(of)-329(the)]TJ -236.1 -13.15 TD[(compiler)-225(\(p)-28(erhaps)-225(as)-225(an)-225(alternativ)26(e)-224(path)-225(to)-225(what)]TJ/F4 10.91 Tf 229.27 0 TD[(runtest)]TJ/F1 10.91 Tf 42.55 0 TD[(w)27(ould)-224(use)-225(b)27(y)-225(default\),)]TJ -271.82 -13.15 TD[(use)-333(`)]TJ/F4 10.91 Tf 21.88 0 TD[(GCC=)]TJ/F5 10.91 Tf 22.91 0 TD[(binname)]TJ/F1 10.91 Tf 41.22 0 TD[(')-333(on)-333(the)]TJ/F4 10.91 Tf 40.6 0 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(command)-333(line.)]TJ/F5 10.91 Tf -227.94 -18.21 TD[(testsuite)]TJ/F4 10.91 Tf 40.12 0 TD[(.exp)-333(...)]TJ/F1 10.91 Tf 17.48 -13.15 TD[(Sp)-27(ecify)-379(the)-379(names)-379(of)-379(testsuites)-379(to)-379(run.)-581(By)-379(default,)]TJ/F4 10.91 Tf 250.56 0 TD[(runtest)]TJ/F1 10.91 Tf 44.23 0 TD[(runs)-378(all)-379(tests)-379(for)]TJ -294.79 -13.15 TD[(the)-339(to)-28(ol,)-341(but)-339(y)27(ou)-339(can)-339(restrict)-339(it)-340(to)-339(particular)-340(testsuites)-339(b)27(y)-339(giving)-339(the)-340(names)-339(of)]TJ 0 -13.15 TD[(the)-333(`)]TJ/F4 10.91 Tf 21.82 0 TD[(.exp)]TJ/F1 10.91 Tf 22.91 0 TD[(')]TJ/F4 10.91 Tf 6.66 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(scripts)-333(that)-333(con)27(trol)-333(them.)]TJ/F5 10.91 Tf -89.39 -15.68 TD[(testsuite)]TJ/F1 10.91 Tf 40.12 0 TD[(.exp)-333(ma)27(y)-332(not)-334(include)-333(path)-333(information;)-334(use)-333(plain)-333(\014lenames.)]TJ/F5 10.91 Tf -97.72 -18.21 TD[(test\014le)]TJ/F4 10.91 Tf 31.58 0 TD[(.exp="testfile1)-333(...")]TJ/F1 10.91 Tf 26.02 -13.15 TD[(Sp)-27(ecify)-441(a)-440(subset)-441(of)-440(tests)-441(in)-440(a)-441(suite)-440(to)-441(run.)-766(F)83(or)-440(compiler)-440(or)-441(assem)27(bler)-439(tests,)]TJ 0 -13.15 TD[(whic)27(h)-353(often)-355(use)-354(a)-355(single)-354(`)]TJ/F4 10.91 Tf 121.27 0 TD[(.exp)]TJ/F1 10.91 Tf 22.91 0 TD[(')-354(script)-354(co)26(v)28(ering)-353(man)26(y)-353(di\013eren)27(t)-354(source)-354(\014les,)-360(this)]TJ -144.18 -13.15 TD[(option)-373(allo)27(ws)-373(y)27(ou)-373(to)-374(further)-373(restrict)-374(the)-374(tests)-373(b)27(y)-373(listing)-374(particular)-373(source)-374(\014les)]TJ 0 -13.15 TD[(to)-339(compile.)-462(Some)-340(to)-27(ols)-340(ev)27(en)-338(supp)-28(ort)-339(wildcards)-340(here.)-462(The)-339(wildcards)-340(supp)-27(orted)]TJ 0 -13.15 TD[(dep)-27(end)-334(up)-27(on)-334(the)-333(to)-28(ol,)-333(but)-334(t)27(ypically)-332(they)-333(are)]TJ/F4 10.91 Tf 216.7 0 TD[(?)]TJ/F1 10.91 Tf 5.72 0 TD[(,)]TJ/F4 10.91 Tf 6.67 0 TD[(*)]TJ/F1 10.91 Tf 5.73 0 TD[(,)-333(and)]TJ/F4 10.91 Tf 27.88 0 TD[([chars])]TJ/F1 10.91 Tf 40.09 0 TD[(.)]TJ/F5 10.91 Tf -360.39 -18.21 TD[(tclv)55(ar)]TJ/F4 10.91 Tf 27.78 0 TD[(=)]TJ/F5 10.91 Tf 5.73 0 TD[(v)55(alue)]TJ/F1 10.91 Tf 24.09 -13.15 TD[(Y)83(ou)-324(can)-325(de\014ne)-325(Tcl)-325(v)54(ariables)-324(for)-325(use)-325(b)27(y)-324(y)27(our)-324(test)-325(scripts)-325(in)-325(the)-325(same)-326(st)27(yle)-324(used)]TJ 0 -13.15 TD[(with)]TJ/F4 10.91 Tf 26.57 0 TD[(make)]TJ/F1 10.91 Tf 28.27 0 TD[(for)-491(en)27(vironmen)28(t)-491(v)55(ariables.)-918(F)83(or)-491(example,)-531(`)]TJ/F4 10.91 Tf 209.8 0 TD[(runtest)-333(GDB=gdb.old)]TJ/F1 10.91 Tf 106.73 0 TD[(')]TJ -371.37 -13.15 TD[(de\014nes)-435(a)-436(v)54(ariable)-434(called)-436(`)]TJ/F4 10.91 Tf 124.26 0 TD[(GDB)]TJ/F1 10.91 Tf 17.18 0 TD[(';)-487(when)-435(y)26(our)-435(scripts)-435(refer)-436(to)-436(`)]TJ/F4 10.91 Tf 146.61 0 TD[($GDB)]TJ/F1 10.91 Tf 22.9 0 TD[(')-435(in)-436(this)-436(run,)]TJ -310.95 -13.15 TD[(they)-333(use)-333(the)-333(v)54(alue)-332(`)]TJ/F4 10.91 Tf 93.39 0 TD[(gdb.old)]TJ/F1 10.91 Tf 40.09 0 TD[('.)]TJ -133.48 -15.68 TD[(The)-326(default)-326(Tcl)-326(v)54(ariables)-325(used)-326(for)-326(most)-326(to)-28(ols)-326(are)-327(de\014ned)-326(in)-326(the)-326(main)-327(DejaGn)27(u)]TJ/F4 10.91 Tf 0 -13.15 TD[(Makefile)]TJ/F1 10.91 Tf 45.82 0 TD[(;)-572(their)-493(v)55(alues)-492(are)-493(captured)-493(in)-493(the)-493(`)]TJ/F4 10.91 Tf 176.53 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-492(\014le.)-923(See)-493(Chapter)-493(4)]TJ -268.17 -13.15 TD[([Con\014guration)-333(dep)-28(enden)27(t)-332(v)54(alues],)-332(page)-333(15.)]TJ/F4 10.91 Tf -57.6 -18.21 TD[(--all)]TJ/F1 10.91 Tf 57.6 0 TD[(Displa)27(y)-422(all)-423(test)-423(output.)-713(By)-423(default,)]TJ/F4 10.91 Tf 180.62 0 TD[(runtest)]TJ/F1 10.91 Tf 44.71 0 TD[(sho)27(ws)-422(only)-423(the)-423(output)-423(of)-423(tests)]TJ -225.33 -13.15 TD[(that)-357(pro)-28(duce)-357(unexp)-28(ected)-357(results;)-370(that)-357(is,)-364(tests)-357(with)-357(status)-358(`)]TJ/F4 10.91 Tf 286.38 0 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(')-357(\(unexp)-28(ected)]TJ -309.29 -13.15 TD[(failure\),)-286(`)]TJ/F4 10.91 Tf 43.46 0 TD[(XPASS)]TJ/F1 10.91 Tf 28.64 0 TD[(')-275(\(unexp)-27(ected)-276(success\),)-286(or)-276(`)]TJ/F4 10.91 Tf 126.89 0 TD[(ERROR)]TJ/F1 10.91 Tf 28.64 0 TD[(')-275(\(a)-275(sev)27(ere)-274(error)-275(in)-276(the)-275(test)-275(case)]TJ -227.63 -13.16 TD[(itself)-77(\).)-629(Sp)-28(ecify)-395(`)]TJ/F4 10.91 Tf 79.35 0 TD[(--all)]TJ/F1 10.91 Tf 28.63 0 TD[(')-394(to)-395(see)-395(output)-395(for)-394(tests)-395(with)-395(status)-395(`)]TJ/F4 10.91 Tf 181.15 0 TD[(PASS)]TJ/F1 10.91 Tf 22.91 0 TD[(')-394(\(success,)-410(as)]TJ -312.04 -13.15 TD[(exp)-27(ected\))-369(`)]TJ/F4 10.91 Tf 53.12 0 TD[(XFAIL)]TJ/F1 10.91 Tf 28.63 0 TD[(')-368(\(failure,)-378(as)-369(exp)-28(ected\),)-378(or)-369(`)]TJ/F4 10.91 Tf 132.26 0 TD[(WARNING)]TJ/F1 10.91 Tf 40.09 0 TD[(')-368(\(minor)-369(error)-369(in)-369(the)-369(test)]TJ -254.1 -13.15 TD[(case)-333(itself)-78(\).)]TJ ET 0 g 0 G
+endstream
+endobj
+84 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F8 52 0 R
+>>
+endobj
+82 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 84 0 R
+>>
+endobj
+87 0 obj
+<<
+/Length 8947
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(3:)-444(Using)]TJ/F4 10.91 Tf 86.45 0 TD[(runtest)]TJ/F1 10.91 Tf 334.64 0 TD[(11)]TJ/F4 10.91 Tf -421.09 -23.91 TD[(--baud)]TJ/F5 10.91 Tf 38 0 TD[(baud-rate)]TJ/F4 10.91 Tf -38 -13.15 TD[(-b)]TJ/F5 10.91 Tf 15.09 0 TD[(baud-rate)]TJ/F1 10.91 Tf 42.51 -13.15 TD[(Set)-322(the)-323(default)-323(baud)-323(rate)-323(to)-323(something)-322(other)-323(than)-323(9600.)-441(\(Some)-323(serial)-323(in)27(terface)]TJ 0 -13.15 TD[(programs,)-333(lik)27(e)]TJ/F4 10.91 Tf 71.03 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[(,)-333(use)-333(a)-333(separate)-334(initialization)-333(\014le)-333(instead)-334(of)-333(this)-333(v)54(alue.\))]TJ/F4 10.91 Tf -145.81 -19.13 TD[(--connect)]TJ/F5 10.91 Tf 55.18 0 TD[(t)27(yp)-26(e)]TJ/F1 10.91 Tf 2.42 -13.15 TD[(Connect)-269(to)-270(a)-270(target)-270(testing)-269(en)26(vironmen)28(t)-269(as)-269(sp)-28(eci\014ed)-270(b)27(y)]TJ/F5 10.91 Tf 262.49 0 TD[(t)27(yp)-26(e)]TJ/F1 10.91 Tf 20.91 0 TD[(,)-282(if)-270(the)-269(target)-270(is)-270(not)]TJ -283.4 -13.15 TD[(the)-397(computer)-397(running)]TJ/F4 10.91 Tf 110.03 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(.)-635(F)82(or)-396(example,)-413(use)-397(`)]TJ/F4 10.91 Tf 99.44 0 TD[(--connect)]TJ/F1 10.91 Tf 51.54 0 TD[(')-397(to)-397(c)27(hange)-396(the)]TJ -301.1 -13.15 TD[(program)-302(used)-303(to)-303(connect)-303(to)-303(a)-303(\\bare)-303(b)-28(oard")-303(b)-28(o)-28(ot)-303(monitor.)-434(The)-303(c)27(hoices)-302(for)]TJ/F5 10.91 Tf 353.49 0 TD[(t)27(yp)-26(e)]TJ/F1 10.91 Tf -353.49 -13.16 TD[(in)-368(the)-368(DejaGn)27(u)-367(1.0)-368(distribution)-368(are)-368(`)]TJ/F4 10.91 Tf 178.08 0 TD[(rlogin)]TJ/F1 10.91 Tf 34.36 0 TD[(',)-376(`)]TJ/F4 10.91 Tf 13.21 0 TD[(telnet)]TJ/F1 10.91 Tf 34.36 0 TD[(',)-376(`)]TJ/F4 10.91 Tf 13.2 0 TD[(rsh)]TJ/F1 10.91 Tf 17.18 0 TD[(',)-376(`)]TJ/F4 10.91 Tf 13.2 0 TD[(tip)]TJ/F1 10.91 Tf 17.19 0 TD[(',)-376(`)]TJ/F4 10.91 Tf 13.2 0 TD[(kermit)]TJ/F1 10.91 Tf 34.36 0 TD[(',)]TJ -368.34 -13.15 TD[(and)-333(`)]TJ/F4 10.91 Tf 24.24 0 TD[(mondfe)]TJ/F1 10.91 Tf 34.37 0 TD[('.)]TJ -58.61 -16.14 TD[(The)-363(default)-364(for)-364(this)-364(option)-364(dep)-28(ends)-364(on)-364(the)-364(con\014guration)-364(\(see)-364(Section)-364(5.5)-363([Re-)]TJ 0 -13.15 TD[(mote)-370(targets)-370(supp)-28(orted],)-380(page)-370(32\).)-555(The)-371(default)-370(is)-370(c)26(hosen)-369(to)-370(b)-28(e)-370(the)-371(most)-370(con-)]TJ 0 -13.15 TD[(v)27(enien)28(t)-347(comm)27(unication)-347(metho)-28(d)-347(a)26(v)56(ailable,)-350(but)-348(often)-348(other)-348(alternativ)27(es)-347(w)27(ork)-347(as)]TJ 0 -13.15 TD[(w)27(ell;)-316(y)26(ou)-309(ma)27(y)-309(\014nd)-310(it)-310(useful)-310(to)-310(try)-310(alternativ)27(e)-309(connect)-310(metho)-28(ds)-310(if)-310(y)27(ou)-309(susp)-28(ect)-310(a)]TJ 0 -13.15 TD[(comm)27(unication)-332(problem)-333(with)-334(y)27(our)-332(testing)-334(target.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(--debug)]TJ/F1 10.91 Tf 57.6 0 TD[(T)83(urns)-269(on)-271(the)]TJ/F4 10.91 Tf 63.18 0 TD[(expect)]TJ/F1 10.91 Tf 37.31 0 TD[(in)27(ternal)-269(debugging)-270(output.)-424(Debugging)-270(output)-270(is)-271(displa)27(y)28(ed)]TJ -100.49 -13.15 TD[(as)-482(part)-482(of)-482(the)]TJ/F4 10.91 Tf 74.76 0 TD[(runtest)]TJ/F1 10.91 Tf 45.35 0 TD[(output,)-519(and)-482(logged)-482(to)-482(a)-482(\014le)-482(called)-482(`)]TJ/F4 10.91 Tf 179.64 0 TD[(dbg.log)]TJ/F1 10.91 Tf 40.09 0 TD[('.)-890(The)]TJ -339.84 -13.15 TD[(extra)-261(debugging)-262(output)-261(do)-28(es)]TJ/F8 10.91 Tf 137.57 0 TD[(not)]TJ/F1 10.91 Tf 19.22 0 TD[(app)-27(ear)-262(on)-261(standard)-262(output,)-276(unless)-262(the)-261(v)27(erb)-27(ose)]TJ -156.79 -13.15 TD[(lev)27(el)-369(is)-369(greater)-370(than)-370(2)-370(\(for)-370(instance,)-379(to)-369(see)-370(debug)-370(output)-370(immediately)82(,)-377(sp)-28(ecify)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(--debug)-333(-v)-333(-v)]TJ/F1 10.91 Tf 70.27 0 TD[('\).)-618(The)-392(debugging)-391(output)-392(sho)27(ws)-390(all)-392(attempts)-391(at)-392(matc)27(hing)-391(the)]TJ -73.3 -13.15 TD[(test)-364(output)-365(of)-365(the)-364(to)-28(ol)-365(with)-364(the)-365(scripted)-365(patterns)-365(describing)-364(exp)-28(ected)-365(output.)]TJ 0 -13.15 TD[(The)-333(output)-333(generated)-333(with)-334(`)]TJ/F4 10.91 Tf 135.79 0 TD[(--strace)]TJ/F1 10.91 Tf 45.82 0 TD[(')-333(also)-333(go)-28(es)-333(in)27(to)-333(`)]TJ/F4 10.91 Tf 77.69 0 TD[(dbg.log)]TJ/F1 10.91 Tf 40.09 0 TD[('.)]TJ/F4 10.91 Tf -356.99 -19.13 TD[(--help)]TJ 0 -13.15 TD[(-he)]TJ/F1 10.91 Tf 57.6 0 TD[(Prin)27(ts)-284(out)-286(a)-285(short)-286(summary)-285(of)-286(the)]TJ/F4 10.91 Tf 164.35 0 TD[(runtest)]TJ/F1 10.91 Tf 43.2 0 TD[(options,)-295(then)-285(exits)-285(\(ev)26(en)-284(if)-286(y)27(ou)-284(also)]TJ -207.55 -13.15 TD[(sp)-27(ecify)-334(other)-333(options\).)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(--host)]TJ/F5 10.91 Tf 38 0 TD[(string)]TJ 19.6 -13.15 TD[(string)]TJ/F1 10.91 Tf 33.12 0 TD[(is)-442(a)-442(full)-442(con\014guration)-442(\\triple")-442(name)-442(as)-442(used)-443(b)27(y)]TJ/F4 10.91 Tf 238.5 0 TD[(configure)]TJ/F1 10.91 Tf 51.55 0 TD[(.)-770(Use)-442(this)]TJ -323.17 -13.15 TD[(option)-334(to)-334(o)26(v)28(erride)-333(the)-335(default)-334(string)-334(recorded)-335(b)27(y)-333(y)26(our)-333(con\014guration's)-334(c)26(hoice)-333(of)]TJ 0 -13.15 TD[(host.)-438(This)-317(c)27(hoice)-316(do)-28(es)-317(not)-316(c)27(hange)-316(ho)27(w)-316(an)27(ything)-316(is)-317(actually)-316(con\014gured)-317(unless)-317({)]TJ 0 -13.15 TD[(build)-258(is)-259(also)-259(sp)-28(eci\014ed;)-284(it)-259(a\013ects)]TJ/F8 10.91 Tf 147.77 0 TD[(only)]TJ/F1 10.91 Tf 23.58 0 TD[(DejaGn)27(u)-258(pro)-27(cedures)-259(that)-259(compare)-259(the)-259(host)]TJ -171.35 -13.15 TD[(string)-435(with)-436(particular)-435(v)55(alues.)-750(The)-436(pro)-28(cedures)]TJ/F4 10.91 Tf 229.25 0 TD[(ishost)]TJ/F1 10.91 Tf 34.36 0 TD[(,)]TJ/F4 10.91 Tf 8.06 0 TD[(istarget)]TJ/F1 10.91 Tf 45.82 0 TD[(,)]TJ/F4 10.91 Tf 8.06 0 TD[(isnative)]TJ/F1 10.91 Tf 45.82 0 TD[(,)]TJ -371.37 -13.15 TD[(and)]TJ/F4 10.91 Tf 22.08 0 TD[(setup_xfail)]TJ/F1 10.91 Tf 67.5 0 TD[(are)-412(a\013ected)-413(b)27(y)-412(`)]TJ/F4 10.91 Tf 79.3 0 TD[(--host)]TJ/F1 10.91 Tf 34.36 0 TD[('.)-682(In)-413(this)-413(usage,)]TJ/F4 10.91 Tf 84.02 0 TD[(host)]TJ/F1 10.91 Tf 27.41 0 TD[(refers)-412(to)-413(the)]TJ -314.67 -13.15 TD[(mac)27(hine)-418(that)-420(the)-420(tests)-419(are)-420(to)-420(b)-28(e)-419(run)-420(on,)-441(whic)26(h)-418(ma)27(y)-419(not)-420(b)-28(e)-419(the)-420(same)-420(as)-419(the)]TJ/F4 10.91 Tf 0 -13.15 TD[(build)]TJ/F1 10.91 Tf 32.01 0 TD[(mac)27(hine.)-435(If)]TJ/F4 10.91 Tf 57.53 0 TD[(--build)]TJ/F1 10.91 Tf 43.46 0 TD[(is)-309(also)-309(sp)-28(eci\014ed,)-314(then)]TJ/F4 10.91 Tf 103.73 0 TD[(--host)]TJ/F1 10.91 Tf 37.73 0 TD[(refers)-309(to)-309(the)-309(mac)27(hine)]TJ -274.46 -13.15 TD[(that)-333(the)-333(tests)-333(wil,)-334(b)-28(e)-333(run)-333(on,)-334(not)-333(the)-333(mac)27(hine)-333(DejaGn)27(u)-332(is)-334(run)-333(on.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(--build)]TJ/F5 10.91 Tf 43.73 0 TD[(string)]TJ 13.87 -13.15 TD[(string)]TJ/F1 10.91 Tf 32.21 0 TD[(is)-358(a)-359(full)-359(con\014guration)-359(\\triple")-359(name)-359(as)-359(used)-359(b)27(y)]TJ/F4 10.91 Tf 230.34 0 TD[(configure)]TJ/F1 10.91 Tf 51.54 0 TD[(.)-521(This)-359(is)-359(the)]TJ -314.09 -13.15 TD[(t)27(yp)-26(e)-310(of)-309(mac)27(hine)-308(DejaGn)26(u)-308(and)-309(the)-309(to)-28(ols)-309(to)-310(b)-27(e)-310(tested)-309(are)-309(built)-309(on.)-437(F)83(or)-309(a)-309(normal)]TJ 0 -13.16 TD[(cross)-333(this)-333(is)-333(the)-334(same)-333(as)-333(the)-334(host,)-333(but)-333(for)-334(a)-333(canadian)-333(cross,)-334(they)-333(are)-333(sep)-28(erate.)]TJ/F4 10.91 Tf -57.6 -19.12 TD[(--name)]TJ/F5 10.91 Tf 38 0 TD[(name)]TJ 19.6 -13.15 TD[(name)]TJ/F1 10.91 Tf 30.68 0 TD[(is)-423(a)-423(name)-424(for)-423(the)-423(particular)-424(testing)-423(target)-424(mac)27(hine)-422(\(for)-424(cross)-423(testing\).)]TJ -30.68 -13.15 TD[(If)-350(the)-351(testing)-351(target)-351(has)-351(IP)-350(net)26(w)28(ork)-350(supp)-27(ort)-351(\(for)-351(example,)]TJ/F4 10.91 Tf 282.71 0 TD[(RPC)]TJ/F1 10.91 Tf 21.01 0 TD[(or)]TJ/F4 10.91 Tf 13.55 0 TD[(NFS)]TJ/F1 10.91 Tf 17.19 0 TD[(\),)-355(this)-350(is)]TJ -334.46 -13.16 TD[(the)-412(net)27(w)28(ork)-411(name)-413(for)-412(the)-412(target)-412(itself.)-682(\()]TJ/F5 10.91 Tf 199.72 0 TD[(name)]TJ/F1 10.91 Tf 30.56 0 TD[(is)]TJ/F8 10.91 Tf 11.83 0 TD[(not)-430(the)-430(c)50(on\014gur)51(ation)-429(string)]TJ/F1 10.91 Tf -242.11 -13.15 TD[(y)27(ou)-285(sp)-28(ecify)-286(as)-286(a)-286(target)-286(with)]TJ/F4 10.91 Tf 133.11 0 TD[(configure)]TJ/F1 10.91 Tf 51.55 0 TD[(;)-301(the)-286(`)]TJ/F4 10.91 Tf 27.62 0 TD[(--name)]TJ/F1 10.91 Tf 34.37 0 TD[(')-286(option)-286(names)-286(a)-286(particular)]TJ -246.65 -13.15 TD[(target,)-402(rather)-388(than)-389(describing)-388(a)-389(class)-389(of)-388(targets.\))-610(F)82(or)-387(targets)-389(that)-388(connect)-389(in)]TJ ET 0 g 0 G
+endstream
+endobj
+88 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F8 52 0 R
+>>
+endobj
+86 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 88 0 R
+>>
+endobj
+91 0 obj
+<<
+/Length 8100
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(12)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 57.6 -23.91 TD[(other)-273(w)26(a)28(ys,)-284(the)-274(meaning)-274(of)-274(the)]TJ/F5 10.91 Tf 147.84 0 TD[(name)]TJ/F1 10.91 Tf 29.05 0 TD[(string)-273(dep)-28(ends)-274(on)-274(the)-273(connection)-274(metho)-28(d.)]TJ -176.89 -13.15 TD[(See)-333(Section)-333(5.5)-333([Remote)-334(targets)-333(supp)-28(orted],)-333(page)-334(32.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(--name)]TJ/F5 10.91 Tf 38 0 TD[(string)]TJ/F1 10.91 Tf 19.6 -13.15 TD[(Sp)-27(ecify)-287(a)-286(net)26(w)28(ork)-285(name)-287(of)-286(testing)-287(target)-286(or)-287(its)-286(host.)-429(The)-287(particular)-286(names)-287(that)]TJ 0 -13.15 TD[(are)-271(meaningful)-271(with)-271(`)]TJ/F4 10.91 Tf 100.12 0 TD[(--name)]TJ/F1 10.91 Tf 34.36 0 TD[(')-271(will)-271(dep)-28(end)-271(on)-271(y)27(our)-271(site)-271(con\014guration,)-284(and)-271(on)-271(the)]TJ -134.48 -13.15 TD[(connection)-339(proto)-28(col:)-457(for)-340(example,)]TJ/F4 10.91 Tf 164.37 0 TD[(tip)]TJ/F1 10.91 Tf 20.89 0 TD[(connections)-339(require)-340(names)-340(from)-340(a)-339(serial)]TJ -185.26 -13.15 TD[(line)-286(con\014guration)-286(\014le)-286(\(usually)-286(called)-286(`)]TJ/F4 10.91 Tf 177.21 0 TD[(/etc/remote)]TJ/F1 10.91 Tf 63 0 TD[('\),)-295(while)]TJ/F4 10.91 Tf 41.49 0 TD[(telnet)]TJ/F1 10.91 Tf 37.49 0 TD[(connections)]TJ -319.19 -13.15 TD[(use)-333(IP)-333(hostnames.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(--objdir)]TJ/F5 10.91 Tf 49.45 0 TD[(path)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(Use)]TJ/F5 10.91 Tf 22.69 0 TD[(path)]TJ/F1 10.91 Tf 27.18 0 TD[(as)-491(the)-491(top)-492(directory)-491(con)26(taining)-490(an)27(y)-491(auxiliary)-491(compiled)-492(test)-491(co)-28(de.)]TJ -49.87 -13.15 TD[(This)-332(defaults)-332(to)-332(`)]TJ/F4 10.91 Tf 82.21 0 TD[(.)]TJ/F1 10.91 Tf 5.72 0 TD[('.)-444(Use)-332(this)-332(option)-332(to)-332(lo)-28(cate)-332(pre-compiled)-332(test)-333(co)-27(de.)-444(Y)82(ou)-331(can)]TJ -87.93 -13.16 TD[(normally)-333(prepare)-333(an)27(y)-333(auxiliary)-333(\014les)-333(needed)-334(with)]TJ/F4 10.91 Tf 234.43 0 TD[(make)]TJ/F1 10.91 Tf 22.9 0 TD[(.)]TJ/F4 10.91 Tf -314.93 -19.12 TD[(--outdir)]TJ/F5 10.91 Tf 49.45 0 TD[(path)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(W)83(rite)-297(output)-298(logs)-299(in)-298(directory)]TJ/F5 10.91 Tf 145.2 0 TD[(path)]TJ/F1 10.91 Tf 21.82 0 TD[(.)-432(The)-298(default)-298(is)-299(`)]TJ/F4 10.91 Tf 79.69 0 TD[(.)]TJ/F1 10.91 Tf 5.73 0 TD[(',)-305(the)-298(directory)-298(where)-298(y)27(ou)]TJ -252.44 -13.15 TD[(start)]TJ/F4 10.91 Tf 26.17 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(.)-450(This)-335(option)-336(a\013ects)-335(only)-335(the)-336(summary)-335(and)-336(the)-335(detailed)-335(log)-336(\014les)]TJ -66.26 -13.16 TD[(`)]TJ/F5 10.91 Tf 3.03 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.49 0 TD[(.sum)]TJ/F1 10.91 Tf 22.9 0 TD[(')-393(and)-393(`)]TJ/F5 10.91 Tf 32.22 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.49 0 TD[(.log)]TJ/F1 10.91 Tf 22.91 0 TD[('.)-624(The)-393(DejaGn)26(u)-392(debug)-393(log)-394(`)]TJ/F4 10.91 Tf 136.63 0 TD[(dbg.log)]TJ/F1 10.91 Tf 40.09 0 TD[(')-393(alw)27(a)28(ys)-393(app)-27(ears)]TJ -294.76 -13.15 TD[(\(when)-333(requested\))-333(in)-333(the)-334(lo)-28(cal)-333(directory)82(.)]TJ/F4 10.91 Tf -57.6 -19.12 TD[(--reboot)]TJ/F1 10.91 Tf 57.6 0 TD[(Reb)-27(o)-28(ot)-296(the)-295(target)-296(b)-28(oard)-296(when)]TJ/F4 10.91 Tf 146.95 0 TD[(runtest)]TJ/F1 10.91 Tf 43.31 0 TD[(initializes.)-431(Usually)82(,)-302(when)-296(running)-296(tests)]TJ -190.26 -13.16 TD[(on)-364(a)-364(separate)-364(target)-364(b)-28(oard,)-372(it)-364(is)-364(safer)-364(to)-364(reb)-28(o)-28(ot)-364(the)-364(target)-364(to)-364(b)-28(e)-364(certain)-364(of)-364(its)]TJ 0 -13.15 TD[(state.)-444(Ho)27(w)28(ev)27(er,)-332(when)-333(dev)27(eloping)-333(test)-333(scripts,)-333(reb)-28(o)-28(oting)-333(tak)26(es)-332(a)-333(lot)-334(of)-333(time.)]TJ/F4 10.91 Tf -57.6 -19.12 TD[(--srcdir)]TJ/F5 10.91 Tf 49.45 0 TD[(path)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(Use)]TJ/F5 10.91 Tf 22.07 0 TD[(path)]TJ/F1 10.91 Tf 26.56 0 TD[(as)-434(the)-435(top)-434(directory)-435(for)-434(test)-435(scripts)-435(to)-434(run.)]TJ/F4 10.91 Tf 220.43 0 TD[(runtest)]TJ/F1 10.91 Tf 44.83 0 TD[(lo)-27(oks)-435(in)-434(this)]TJ -313.89 -13.16 TD[(directory)-303(for)-303(an)27(y)-303(sub)-28(directory)-303(whose)-303(name)-304(b)-28(egins)-303(with)-303(the)-304(to)-28(olname)-303(\(sp)-28(eci\014ed)]TJ 0 -13.15 TD[(with)-366(`)]TJ/F4 10.91 Tf 28.24 0 TD[(--tool)]TJ/F1 10.91 Tf 34.36 0 TD[('\).)-543(F)82(or)-366(instance,)-374(with)-367(`)]TJ/F4 10.91 Tf 110.39 0 TD[(--tool)-333(gdb)]TJ/F1 10.91 Tf 55.18 0 TD[(',)]TJ/F4 10.91 Tf 10.15 0 TD[(runtest)]TJ/F1 10.91 Tf 44.09 0 TD[(uses)-366(tests)-366(in)-367(sub)-28(di-)]TJ -282.41 -13.15 TD[(rectories)-378(`)]TJ/F4 10.91 Tf 47.28 0 TD[(gdb.*)]TJ/F1 10.91 Tf 28.63 0 TD[(')-378(\(with)-378(the)-378(usual)-378(shell-lik)26(e)-377(\014lename)-378(expansion\).)-579(If)-379(y)27(ou)-377(do)-378(not)]TJ -75.91 -13.15 TD[(use)-416(`)]TJ/F4 10.91 Tf 22.78 0 TD[(--srcdir)]TJ/F1 10.91 Tf 45.82 0 TD[(',)]TJ/F4 10.91 Tf 10.82 0 TD[(runtest)]TJ/F1 10.91 Tf 44.63 0 TD[(lo)-27(oks)-416(for)-416(test)-416(directories)-416(under)-417(the)-416(curren)27(t)-415(w)27(orking)]TJ -124.05 -13.15 TD[(directory)83(.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(--strace)]TJ/F5 10.91 Tf 49.45 0 TD[(n)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(T)83(urn)-240(on)-240(in)26(ternal)-239(tracing)-241(for)]TJ/F4 10.91 Tf 131.12 0 TD[(expect)]TJ/F1 10.91 Tf 34.37 0 TD[(,)-259(to)]TJ/F5 10.91 Tf 18.18 0 TD[(n)]TJ/F1 10.91 Tf 8.68 0 TD[(lev)27(els)-239(deep.)-414(By)-240(adjusting)-241(the)-241(lev)27(el,)-258(y)27(ou)]TJ -192.35 -13.15 TD[(can)-256(con)26(trol)-255(the)-257(exten)26(t)-255(to)-257(whic)27(h)-256(y)26(our)-255(output)-257(expands)-257(m)27(ulti-lev)27(el)-255(Tcl)-257(statemen)26(ts.)]TJ 0 -13.15 TD[(This)-281(allo)27(ws)-281(y)27(ou)-281(to)-281(ignore)-282(some)-281(lev)26(els)-280(of)]TJ/F4 10.91 Tf 188.48 0 TD[(case)]TJ/F1 10.91 Tf 25.98 0 TD[(or)]TJ/F4 10.91 Tf 12.8 0 TD[(if)]TJ/F1 10.91 Tf 14.53 0 TD[(statemen)27(ts.)-426(Eac)27(h)-281(pro)-27(cedure)]TJ -241.79 -13.15 TD[(call)-333(or)-333(con)27(trol)-333(structure)-333(coun)27(ts)-333(as)-333(one)-333(\\lev)27(el".)]TJ 0 -16.14 TD[(The)-547(output)-547(is)-547(recorded)-547(in)-547(the)-547(same)-548(\014le,)-600(`)]TJ/F4 10.91 Tf 215.18 0 TD[(dbg.log)]TJ/F1 10.91 Tf 40.09 0 TD[(',)-600(used)-547(for)-547(output)-548(from)]TJ -255.27 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[('.)]TJ/F4 10.91 Tf -100.72 -19.13 TD[(--target)]TJ/F5 10.91 Tf 49.45 0 TD[(string)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(Use)-340(this)-341(option)-340(to)-341(o)27(v)28(erride)-340(the)-340(default)-341(setting)-340(\(running)-341(nativ)27(e)-340(tests\).)]TJ/F5 10.91 Tf 335.05 0 TD[(string)]TJ/F1 10.91 Tf 32.02 0 TD[(is)]TJ -367.07 -13.15 TD[(a)-316(full)-316(con\014guration)-316(\\triple")-317(name)]TJ/F6 6.97 Tf 159.02 3.96 TD[(1)]TJ/F1 10.91 Tf 7.92 -3.96 TD[(as)-316(used)-316(b)27(y)]TJ/F4 10.91 Tf 52.89 0 TD[(configure)]TJ/F1 10.91 Tf 51.55 0 TD[(.)-438(This)-317(option)-316(c)27(hanges)]TJ -271.38 -13.15 TD[(the)-469(con\014guration)]TJ/F4 10.91 Tf 87.85 0 TD[(runtest)]TJ/F1 10.91 Tf 45.21 0 TD[(uses)-469(for)-469(the)-470(default)-469(to)-28(ol)-469(names,)-504(and)-469(other)-470(setup)]TJ -133.06 -13.15 TD[(information.)-661(See)-406(section)-405(\\Using)]TJ/F4 10.91 Tf 160.04 0 TD[(configure)]TJ/F1 10.91 Tf 51.54 0 TD[(")-405(in)]TJ/F5 10.91 Tf 23.4 0 TD[(Cygn)27(us)-404(con\014gure)]TJ/F1 10.91 Tf 83.31 0 TD[(,)-423(for)-406(details)]TJ -318.29 -13.15 TD[(ab)-27(out)]TJ/F4 10.91 Tf 31.21 0 TD[(configure)]TJ/F1 10.91 Tf 55.18 0 TD[(names.)]TJ ET 18.00 -579.46 m 162.00 -579.46 l 162.00 -579.06 l 18.00 -579.06 l b BT/F6 6.97 Tf 23.02 -587.41 TD[(1)]TJ/F1 10.91 Tf 9.92 -3.96 TD[(Con\014guration)-333(triples)-333(ha)27(v)27(e)-332(the)-333(form)-334(`)]TJ/F5 10.91 Tf 175.31 0 TD[(cpu)]TJ/F4 10.91 Tf 16.97 0 TD[(-)]TJ/F5 10.91 Tf 5.72 0 TD[(v)27(endor)]TJ/F4 10.91 Tf 32.16 0 TD[(-)]TJ/F5 10.91 Tf 5.72 0 TD[(os)]TJ/F1 10.91 Tf 10.21 0 TD[('.)]TJ ET 0 g 0 G
+endstream
+endobj
+92 0 obj
+<<
+/F1 9 0 R
+/F5 31 0 R
+/F4 28 0 R
+/F6 46 0 R
+>>
+endobj
+90 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 92 0 R
+>>
+endobj
+96 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -958
+/Flags 68
+/FontBBox [-30 -958 1146 777]
+/FontName /CMSY9
+/ItalicAngle -14
+/XHeight 431
+/StemV 80
+/FontFile 95 0 R
+>>
+endobj
+97 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F11
+/FontDescriptor 96 0 R
+/BaseFont /UJKJVH+CMSY9
+/FirstChar 0
+/LastChar 127
+/Widths [799.38 285.49 799.38 513.89 799.38 513.89 799.38 799.38 799.38 799.38 799.38
+799.38 799.38 1027.77 513.89 513.89 799.38 799.38 799.38 799.38 799.38 799.38 799.38
+799.38 799.38 799.38 799.38 799.38 1027.77 1027.77 799.38 799.38 1027.77 1027.77
+513.89 513.89 1027.77 1027.77 1027.77 799.38 1027.77 1027.77 628.08 628.08 1027.77
+1027.77 1027.77 799.38 279.32 1027.77 685.18 685.18 913.57 913.57 0 0 570.98 570.98
+685.18 513.89 742.28 742.28 799.38 799.38 628.08 821.12 673.62 542.57 793.76 542.43
+736.33 610.91 871.05 562.72 696.6 782.16 707.93 1229.16 842.08 816.32 716.77 839.34
+873.88 622.37 563.16 642.26 632.06 1017.48 732.43 685 742 685.18 685.18 685.18 685.18
+685.18 628.08 628.08 456.79 456.79 456.79 456.79 513.89 513.89 399.69 399.69 285.49
+513.89 513.89 628.08 513.89 285.49 856.48 770.67 856.48 428.24 685.18 685.18 799.38
+799.38 456.79 456.79 456.79 628.08 799.38 799.38 799.38 799.38]
+>>
+endobj
+99 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-267 -250 1070 968]
+/FontName /CMR8
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 98 0 R
+>>
+endobj
+100 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F12
+/FontDescriptor 99 0 R
+/BaseFont /PLCKEA+CMR8
+/FirstChar 0
+/LastChar 127
+/Widths [663.55 885.43 826.4 736.82 708.34 795.85 767.37 826.4 767.37 826.4 767.37
+619.8 590.29 590.29 885.43 885.43 295.14 324.66 531.26 531.26 531.26 531.26 531.26
+795.85 472.23 531.26 767.37 826.4 531.26 958.69 1076.75 826.4 295.14 295.14 531.26
+885.43 531.26 885.43 826.4 295.14 413.2 413.2 531.26 826.4 295.14 354.17 295.14 531.26
+531.26 531.26 531.26 531.26 531.26 531.26 531.26 531.26 531.26 531.26 295.14 295.14
+295.14 826.4 501.74 501.74 826.4 795.85 752.09 767.37 811.12 722.58 693.07 833.52
+795.85 382.64 545.49 825.36 663.55 972.93 795.85 826.4 722.58 826.4 781.61 590.29
+767.37 795.85 795.85 1090.99 795.85 795.85 649.31 295.14 531.26 295.14 531.26 295.14
+295.14 531.26 590.29 472.23 590.29 472.23 324.66 531.26 590.29 295.14 324.66 560.77
+295.14 885.43 590.29 531.26 590.29 560.77 414.07 419.1 413.2 590.29 560.77 767.37
+560.77 560.77 472.23 531.26 1062.52 531.26 531.26 531.26]
+>>
+endobj
+101 0 obj
+<<
+/Length 3470
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(3:)-444(Using)]TJ/F4 10.91 Tf 86.45 0 TD[(runtest)]TJ/F1 10.91 Tf 334.64 0 TD[(13)]TJ/F4 10.91 Tf -421.09 -23.91 TD[(--verbose)]TJ 0 -13.15 TD[(-v)]TJ/F1 10.91 Tf 57.6 0 TD[(T)83(urns)-367(on)-367(more)-367(output.)-547(Rep)-27(eating)-368(this)-367(option)-368(increases)-367(the)-367(amoun)27(t)-367(of)-367(output)]TJ 0 -13.15 TD[(displa)27(y)28(ed.)-726(Lev)27(el)-427(one)-428(\(`)]TJ/F4 10.91 Tf 112.93 0 TD[(-v)]TJ/F1 10.91 Tf 11.46 0 TD[('\))-427(is)-428(simply)-427(test)-428(output.)-727(Lev)26(el)-426(t)27(w)27(o)-426(\(`)]TJ/F4 10.91 Tf 183.83 0 TD[(-v)-333(-v)]TJ/F1 10.91 Tf 26.55 0 TD[('\))-427(sho)27(ws)]TJ -334.77 -13.15 TD[(messages)-497(on)-498(options,)-539(con\014guration,)-538(and)-498(pro)-28(cess)-497(con)26(trol.)-936(V)82(erb)-27(ose)-497(messages)]TJ 0 -13.16 TD[(app)-27(ear)-342(in)-342(the)-342(detailed)-342(\(`)]TJ/F4 10.91 Tf 116.47 0 TD[(*.log)]TJ/F1 10.91 Tf 28.63 0 TD[('\))-341(log)-342(\014le,)-345(but)-342(not)-342(in)-341(the)-342(summary)-342(\(`)]TJ/F4 10.91 Tf 175.72 0 TD[(*.sum)]TJ/F1 10.91 Tf 28.64 0 TD[('\))-341(log)]TJ -349.46 -13.15 TD[(\014le.)]TJ/F4 10.91 Tf -57.6 -19.12 TD[(--version)]TJ 0 -13.15 TD[(-V)]TJ/F1 10.91 Tf 57.6 0 TD[(Prin)27(ts)-296(out)-296(the)-297(v)26(ersion)-295(n)26(um)28(b)-27(ers)-296(of)-297(DejaGn)26(u,)]TJ/F4 10.91 Tf 210.67 0 TD[(expect)]TJ/F1 10.91 Tf 37.61 0 TD[(and)-296(Tcl,)-305(and)-296(exits)-297(without)]TJ -248.28 -13.16 TD[(running)-333(an)27(y)-332(tests.)]TJ/F4 10.91 Tf -57.6 -19.12 TD[(-D0)]TJ 0 -13.15 TD[(-D1)]TJ/F1 10.91 Tf 57.6 0 TD[(Start)-281(the)-282(in)26(ternal)-281(Tcl)-282(debugger.)-427(The)-282(Tcl)-282(debugger)-282(supp)-28(orts)-282(breakp)-28(oin)27(ts,)-291(single)]TJ 0 -13.16 TD[(stepping,)-470(and)-443(other)-443(common)-443(debugging)-442(activities.)-774(\(See)]TJ/F5 10.91 Tf 277.57 0 TD[(A)-442(Debugger)-443(for)-443(Tcl)]TJ -277.57 -13.15 TD[(Applications)]TJ/F1 10.91 Tf 63.84 0 TD[(b)27(y)-332(Don)-333(Lib)-28(es.)]TJ/F6 6.97 Tf 67.03 3.96 TD[(2)]TJ/F1 10.91 Tf 4.47 -3.96 TD[(\))]TJ -135.34 -16.14 TD[(If)-303(y)27(ou)-303(sp)-27(ecify)-304(`)]TJ/F4 10.91 Tf 69.69 0 TD[(-D1)]TJ/F1 10.91 Tf 17.18 0 TD[(',)-309(the)]TJ/F4 10.91 Tf 27.9 0 TD[(expect)]TJ/F1 10.91 Tf 37.67 0 TD[(shell)-303(stops)-303(at)-304(a)-303(breakp)-28(oin)27(t)-303(as)-303(so)-28(on)-304(as)-303(DejaGn)27(u)]TJ -152.44 -13.15 TD[(in)27(v)28(ok)28(es)-332(it.)]TJ 0 -16.14 TD[(If)-369(y)26(ou)-369(sp)-27(ecify)-370(`)]TJ/F4 10.91 Tf 71.86 0 TD[(-D0)]TJ/F1 10.91 Tf 17.19 0 TD[(',)-379(DejaGn)27(u)-369(starts)-370(as)-369(usual,)-379(but)-370(y)26(ou)-368(can)-370(en)26(ter)-368(the)-370(debugger)]TJ -89.05 -13.15 TD[(b)27(y)-332(sending)-333(an)-334(in)27(terrupt)-332(\(e.g.)-445(b)27(y)-332(t)27(yping)]TJ/F11 8.97 Tf 190.73 0.4 TD[(h)]TJ ET 269.23 -231.58 m 281.94 -231.58 l 281.94 -231.18 l 269.23 -231.18 l b BT/F12 7.97 Tf 269.23 -238.31 TD[(C-c)]TJ ET 269.23 -240.15 m 281.94 -240.15 l 281.94 -239.75 l 269.23 -239.75 l b BT/F11 8.97 Tf 281.43 -237.91 TD[(i)]TJ/F1 10.91 Tf 3.58 -0.4 TD[(\).)]TJ ET 18.00 -611.91 m 162.00 -611.91 l 162.00 -611.51 l 18.00 -611.51 l b BT/F6 6.97 Tf 23.02 -619.85 TD[(2)]TJ/F1 10.91 Tf 9.92 -3.96 TD[(Distributed)-333(in)-333(P)27(ostScript)-333(form)-333(with)]TJ/F4 10.91 Tf 174.76 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(as)-333(the)-333(\014le)]TJ -212.76 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(expect/tcl-debug.ps)]TJ/F1 10.91 Tf 108.82 0 TD[('.)]TJ ET 0 g 0 G
+endstream
+endobj
+102 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F6 46 0 R
+/F11 97 0 R
+/F12 100 0 R
+>>
+endobj
+94 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 102 0 R
+>>
+endobj
+105 0 obj
+<<
+/Length 117
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(14)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ ET 0 g 0 G
+endstream
+endobj
+106 0 obj
+<<
+/F1 9 0 R
+>>
+endobj
+104 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 106 0 R
+>>
+endobj
+109 0 obj
+<<
+/Length 8271
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(4:)-444(Setting)]TJ/F4 10.91 Tf 93.36 0 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(defaults)-22611(15)]TJ/F2 17.22 Tf -137.09 -25.91 TD[(4)-562(Setting)]TJ/F10 17.22 Tf 86.31 0 TD[(runtest)]TJ/F2 17.22 Tf 68.46 0 TD[(defaults)]TJ/F1 10.91 Tf -139.83 -28.09 TD[(The)-513(site)-514(con\014guration)-514(\014le,)-558(`)]TJ/F4 10.91 Tf 140.58 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(',)-558(captures)-514(con\014guration-dep)-28(enden)27(t)-513(v)55(alues)-513(and)]TJ -201.34 -13.15 TD[(propagates)-386(them)-387(to)-387(the)-387(DejaGn)27(u)-386(test)-386(en)27(vironmen)27(t)-385(using)-387(Tcl)-387(v)55(ariables.)-604(This)-387(ties)-387(the)-386(De-)]TJ 0 -13.15 TD[(jaGn)27(u)-332(test)-333(scripts)-334(in)27(to)-332(the)]TJ/F4 10.91 Tf 129.68 0 TD[(configure)]TJ/F1 10.91 Tf 55.18 0 TD[(and)]TJ/F4 10.91 Tf 21.22 0 TD[(make)]TJ/F1 10.91 Tf 26.54 0 TD[(programs.)]TJ -217.68 -16.14 TD[(DejaGn)27(u)-332(supp)-28(orts)-334(more)-333(than)-334(one)-334(`)]TJ/F4 10.91 Tf 166.49 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-333(\014le.)-445(The)-334(m)27(ultiple)-333(instances)-334(of)-333(`)]TJ/F4 10.91 Tf 155.9 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')]TJ -428.97 -13.15 TD[(are)-326(loaded)-326(in)-326(a)-326(\014xed)-326(order)-326(built)-326(in)27(to)-326(DejaGn)27(u)-325(\(the)-326(more)-326(lo)-28(cal)-326(last\).)-442(The)-326(\014rst)-326(\014le)-326(loaded)-326(is)]TJ 0 -13.15 TD[(the)-333(optional)]TJ/F4 10.91 Tf 61.21 0 TD[(~/.dejagnurc)]TJ/F1 10.91 Tf 68.73 0 TD[(,)-333(then)-333(the)-333(lo)-28(cal)-334(\014les,)-333(and)-333(\014nally)-334(the)-333(global)-333(\014le.)]TJ -124.03 -16.14 TD[(1.)-660(There)-256(is)-256(am)-257(optional)-256(\\master")-257(`)]TJ/F4 10.91 Tf 164.41 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(',)-271(capturing)-257(con\014guration)-256(v)54(alues)-255(that)-257(apply)-256(to)]TJ -194.54 -13.15 TD[(DejaGn)27(u)-342(across)-342(the)-343(b)-28(oard,)-345(in)-343(eac)27(h)-342(con\014guration-sp)-28(eci\014c)-343(sub)-28(directory)-343(of)-342(the)-343(DejaGn)26(u)]TJ 0 -13.15 TD[(library)-364(directory)83(.)]TJ/F4 10.91 Tf 86.62 0 TD[(runtest)]TJ/F1 10.91 Tf 44.06 0 TD[(loads)-364(these)-364(v)55(alues)-363(\014rst.)-537(See)-364(App)-28(endix)-364(A)-364([Con\014guring)-364(and)]TJ -130.68 -13.15 TD[(Installing)-390(DejaGn)27(u],)-404(page)-391(49.)-617(The)-390(master)-391(`)]TJ/F4 10.91 Tf 211 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-390(con)27(tains)-390(the)-391(default)-391(v)55(alues)-390(for)]TJ -256.82 -13.15 TD[(all)-386(targets)-386(and)-387(hosts)-386(supp)-28(orted)-386(b)26(y)-385(DejaGn)27(u.)-603(This)-386(master)-387(\014le)-386(is)-387(iden)27(ti\014ed)-385(b)26(y)-385(setting)]TJ 0 -13.15 TD[(the)-298(en)27(vironmen)27(t)-297(v)54(ariable)]TJ/F4 10.91 Tf 121.35 0 TD[(DEJAGNU)]TJ/F1 10.91 Tf 43.35 0 TD[(to)-298(the)-299(name)-298(of)-299(the)-298(\014le.)-433(This)-299(is)-298(also)-299(refered)-299(to)-298(as)-299(the)]TJ -164.7 -13.16 TD[(\\global")-333(con\014g)-333(\014le.)]TJ -15.69 -16.14 TD[(2.)-660(An)27(y)-334(directory)-336(con)27(taining)-334(a)-336(con\014gured)-335(test)-336(suite)-335(also)-335(has)-336(a)-335(`)]TJ/F4 10.91 Tf 301.4 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(',)-335(capturing)-336(con-)]TJ -331.53 -13.15 TD[(\014guration)-325(v)55(alues)-324(sp)-28(eci\014c)-326(to)-325(the)-325(to)-28(ol)-325(under)-325(test.)-442(Since)]TJ/F4 10.91 Tf 258.6 0 TD[(runtest)]TJ/F1 10.91 Tf 43.64 0 TD[(loads)-325(these)-325(v)55(alues)-325(last,)]TJ -302.24 -13.15 TD[(the)-435(individual)-435(test)-436(con\014guration)-435(can)-436(either)-435(rely)-436(on)-435(and)-436(use,)-461(or)-435(o)27(v)27(erride,)-460(an)27(y)-434(of)-436(the)]TJ 0 -13.15 TD[(global)-333(v)55(alues)-333(from)-333(the)-333(\\master")-334(`)]TJ/F4 10.91 Tf 158.97 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[('.)]TJ -204.79 -16.14 TD[(Y)83(ou)-261(can)-261(usually)-261(generate)-262(or)-261(up)-28(date)-261(the)-262(testsuite)-261(`)]TJ/F4 10.91 Tf 232.76 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.81 0 TD[(')-261(b)27(y)-261(t)27(yping)-260(`)]TJ/F4 10.91 Tf 56.44 0 TD[(make)-333(site.exp)]TJ/F1 10.91 Tf 72.36 0 TD[(')]TJ -407.37 -13.15 TD[(in)-333(the)-333(test)-333(suite)-334(directory)83(,)-333(after)-333(the)-333(test)-334(suite)-333(is)-333(con\014gured.)]TJ -15.69 -16.14 TD[(3.)-660(Y)83(ou)-371(can)-373(also)-372(ha)27(v)28(e)-372(a)-372(\014le)-372(in)-372(y)26(our)-371(home)-372(directory)-372(called)]TJ/F4 10.91 Tf 280.51 0 TD[(.dejagnurc)]TJ/F1 10.91 Tf 57.28 0 TD[(.)-561(This)-372(gets)-372(loaded)]TJ -322.1 -13.15 TD[(\014rst)-410(b)-28(efore)-410(the)-410(other)-410(con\014g)-411(\014les.)-675(Usually)-410(this)-411(is)-410(used)-410(for)-410(p)-28(ersonal)-411(stu\013,)-429(lik)27(e)-410(setting)]TJ/F4 10.91 Tf 0 -13.15 TD[(all_flag)]TJ/F1 10.91 Tf 49.45 0 TD[(so)-333(all)-333(the)-333(output)-334(gets)-333(prin)27(ted,)-333(or)-333(v)27(erb)-27(osit)27(y)-333(lev)27(els.)]TJ -56.11 -19.13 TD[(Y)83(ou)-318(can)-318(further)-318(o)27(v)27(erride)-317(the)-318(default)-319(v)55(alues)-317(in)-319(a)-318(user-editable)-319(section)-318(of)-318(an)27(y)-318(`)]TJ/F4 10.91 Tf 365.18 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(',)]TJ -425.94 -13.15 TD[(or)-333(b)27(y)-332(setting)-334(v)55(ariables)-332(on)-334(the)]TJ/F4 10.91 Tf 143.52 0 TD[(runtest)]TJ/F1 10.91 Tf 43.72 0 TD[(command)-333(line.)]TJ/F2 13.09 Tf -187.24 -26.9 TD[(4.0.1)-562(Con\014g)-375(V)93(ariables)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(DejaGn)27(u)-380(uses)-381(a)-381(named)-381(arra)27(y)-380(in)-381(Tcl)-381(to)-381(hold)-381(all)-381(the)-381(info)-381(for)-382(eac)27(h)-380(mac)27(hine.)-587(In)-381(the)-381(case)]TJ -14.94 -13.15 TD[(of)-324(a)-324(canadian)-325(cross,)-326(this)-325(means)-324(host)-324(information)-325(as)-324(w)26(ell)-323(as)-324(target)-325(information.)-441(The)-325(named)]TJ 0 -13.15 TD[(arra)27(y)-405(is)-407(called)]TJ/F4 10.91 Tf 72.82 0 TD[(target_info)]TJ/F1 10.91 Tf 63 0 TD[(,)-424(and)-407(it)-407(has)-406(t)27(w)27(o)-405(indices.)-665(The)-406(follo)27(wing)-406(\014elds)-407(are)-406(part)-407(of)-406(the)]TJ -135.82 -13.15 TD[(arra)27(y)84(.)]TJ/F4 10.91 Tf 0 -19.13 TD[(name)]TJ/F1 10.91 Tf 57.6 0 TD[(The)-395(name)-396(of)-395(the)-396(target.)-631(\(mostly)-396(for)-395(error)-396(messages\))-395(This)-396(should)-396(also)-395(b)-28(e)-396(the)]TJ 0 -13.15 TD[(string)-273(used)-273(for)-273(this)-274(target's)-273(arra)27(y)83(.)-423(It)-274(should)-273(also)-273(b)-28(e)-273(the)-274(same)-273(as)-273(the)-273(link)26(er)-272(script)]TJ 0 -13.15 TD[(so)-411(w)26(e)-410(can)-412(\014nd)-412(them)-412(dynamically)82(.)-679(This)-412(should)-412(b)-27(e)-412(the)-412(same)-412(as)-412(the)-412(argumen)27(t)]TJ 0 -13.15 TD[(used)-333(for)]TJ/F4 10.91 Tf 41.61 0 TD[(push_target{})]TJ/F1 10.91 Tf 74.45 0 TD[(.)]TJ/F4 10.91 Tf -173.66 -19.13 TD[(ldflags)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-509(is)-510(the)-510(link)27(er)-509(\015ags)-510(required)-509(to)-510(pro)-28(duce)-510(a)-509(fully)-510(link)27(ed)-509(executable.)-974(F)83(or)]TJ/F4 10.91 Tf 0 -13.15 TD[(libgloss)]TJ/F1 10.91 Tf 49.45 0 TD[(supp)-27(orted)-334(targets)-333(this)-333(is)-334(usually)-333(just)-333(the)-334(name)-333(of)-333(the)-334(link)27(er)-332(script.)]TJ/F4 10.91 Tf -107.05 -19.13 TD[(config)]TJ/F1 10.91 Tf 57.6 0 TD[(The)-414(target)-415(canonical)-415(for)-415(this)-415(target.)-690(This)-415(is)-415(used)-415(b)27(y)-414(some)-415(init)-415(\014les)-415(to)-415(mak)27(e)]TJ 0 -13.15 TD[(sure)-333(the)-333(target)-333(is)-334(supp)-28(orted.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(cflags)]TJ/F1 10.91 Tf 57.6 0 TD[(The)-333(\015ags)-333(required)-333(to)-334(pro)-28(duce)-333(an)-333(ob)-56(ject)-333(\014le)-333(from)-334(a)-333(source)-333(\014le.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(connect)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-337(is)-338(the)-337(connectmo)-28(de)-337(for)-338(this)-337(target.)-458(This)-337(is)-338(for)-337(b)-28(oth)-337(IP)-338(and)-337(serial)-338(connec-)]TJ 0 -13.15 TD[(tions.)-444(T)27(ypically)-332(this)-334(is)-333(either)]TJ/F4 10.91 Tf 142.33 0 TD[(telnet)]TJ/F1 10.91 Tf 34.37 0 TD[(,)]TJ/F4 10.91 Tf 6.66 0 TD[(rlogin)]TJ/F1 10.91 Tf 34.37 0 TD[(,)-333(or)]TJ/F4 10.91 Tf 20.03 0 TD[(rsh)]TJ/F1 10.91 Tf 17.18 0 TD[(.)]TJ ET 0 g 0 G
+endstream
+endobj
+110 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F2 12 0 R
+/F10 78 0 R
+>>
+endobj
+108 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 110 0 R
+>>
+endobj
+113 0 obj
+<<
+/Length 6054
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(16)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F4 10.91 Tf 0 -23.91 TD[(target)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-310(is)-310(the)-310(hostname)-311(of)-310(the)-310(target.)-437(This)-310(is)-310(for)-311(TCP/IP)-310(based)-310(connections,)-315(and)]TJ 0 -13.15 TD[(is)-333(also)-333(used)-333(for)-334(v)27(ersion)-332(of)-334(tip)-333(that)-333(use)-334(/etc/remote.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(serial)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-333(is)-333(the)-333(serial)-334(p)-28(ort.)-444(This)-333(is)-334(t)27(ypically)-332(/dev/tt)27(y?)-444(or)-333(com?:.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(netport)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-334(is)-334(the)-334(IP)-334(p)-28(ort.)-446(This)-334(is)-334(commonly)-334(used)-334(for)-334(telneting)-334(to)-335(target)-334(b)-27(oards)-334(that)]TJ 0 -13.15 TD[(are)-309(connected)-310(to)-310(a)-310(terminal)-310(serv)27(er.)-435(In)-310(that)-310(case)-310(the)-310(IP)-310(p)-27(ort)-310(sp)-28(eci\014es)-310(the)-310(whic)27(h)]TJ 0 -13.15 TD[(serial)-333(p)-28(ort)-333(to)-333(use.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(baud)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-333(is)-333(the)-333(baud)-334(rate)-333(for)-333(a)-334(serial)-333(p)-28(ort)-333(connection.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(x10)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-340(is)-340(the)-340(parameters)-340(for)-341(an)-340(x10)-340(con)27(troller.)-464(These)-341(are)-340(simple)-340(devices)-340(that)-340(let)]TJ 0 -13.15 TD[(us)-333(p)-28(o)27(w)28(er)-332(cycle)-334(or)-333(reset)-333(a)-334(target)-333(b)-28(oard)-333(remotely)82(.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(fileid)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-333(is)-333(the)-333(\014leid)-334(or)-333(spa)27(wn)-333(id)-333(of)-333(of)-334(the)-333(connection.)]TJ/F4 10.91 Tf -57.6 -19.12 TD[(prompt)]TJ/F1 10.91 Tf 57.6 0 TD[(a)-333(glob)-333(st)27(yle)-333(pattern)-333(to)-333(recognize)-334(the)-333(prompt.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(abbrev)]TJ/F1 10.91 Tf 57.6 0 TD[(abbreviation)-333(for)-333(to)-28(ol)-333(init)-334(\014les.)]TJ/F4 10.91 Tf -57.6 -19.13 TD[(ioport)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-350(is)-350(the)-350(p)-28(ort)-350(for)-351(I/O)-350(on)-350(dual)-351(p)-27(ort)-351(systems.)-495(In)-350(this)-351(con\014guration,)-354(the)-350(main)]TJ 0 -13.15 TD[(serial)-351(p)-28(ort)]TJ/F4 10.91 Tf 52.95 0 TD[(0)]TJ/F1 10.91 Tf 9.57 0 TD[(is)-351(usually)-352(used)-352(for)-352(stdin)-352(and)-352(stdout,)-356(whic)26(h)-350(the)-352(second)-352(serial)-352(p)-28(ort)]TJ -62.52 -13.15 TD[(can)-333(b)-28(e)-333(used)-333(for)-334(debugging.)]TJ -42.66 -19.13 TD[(The)-302(\014rst)-303(index)-302(in)27(to)-302(the)-302(arra)26(y)-301(is)-303(the)-302(same)-303(v)55(alue)-302(as)-302(used)-303(in)-302(the)]TJ/F4 10.91 Tf 294.18 0 TD[(name)]TJ/F1 10.91 Tf 26.21 0 TD[(\014eld.)-434(This)-302(is)-303(usually)]TJ -335.33 -13.15 TD[(a)-359(short)-360(v)27(ersion)-359(of)-360(the)-359(name)-360(of)-360(the)-360(target)-359(b)-28(oard.)-524(F)83(or)-359(an)-360(example,)-366(here's)-360(the)-360(settings)-360(I)-359(use)]TJ 0 -13.15 TD[(for)-347(m)26(y)]TJ/F4 10.91 Tf 35.19 0 TD[(Motorola's)-347(IDP)]TJ/F1 10.91 Tf 82.05 0 TD[(b)-27(oard)-348(and)-348(m)27(y)]TJ/F4 10.91 Tf 71.11 0 TD[(Motorola)]TJ/F1 10.91 Tf 49.61 0 TD[(6U)-347(VME)]TJ/F4 10.91 Tf 46.83 0 TD[(MVME135-1)]TJ/F1 10.91 Tf 55.34 0 TD[(b)-27(oard.)-488(\(b)-28(oth)-348(m68k)]TJ -340.13 -13.15 TD[(targets\))]TJ/F9 9.96 Tf 0 -10.05 TD[(\013)]TJ ET 23.98 -310.52 m 450.40 -310.52 l 450.40 -310.12 l 23.98 -310.12 l b BT 456.38 -310.52 TD[(\010)]TJ ET 18.00 -570.92 m 18.40 -570.92 l 18.40 -316.25 l 18.00 -316.25 l b BT/F4 10.91 Tf 21.39 -328.9 TD[(#)-524(IDP)-525(board)]TJ 0 -12.45 TD[(set)-524(target_info\(idp,name\))-3675("idp")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,ldflags\))-2100("-Tidp.ld")]TJ 0 -12.46 TD[(set)-524(target_info\(idp,config\))-2625(m68k-unknown-aout)]TJ 0 -12.45 TD[(set)-524(target_info\(idp,cflags\))-2625("")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,connect\))-2100(telnet)]TJ 0 -12.46 TD[(set)-524(target_info\(idp,target\))-2625("s7")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,serial\))-2625("tstty7")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,netport\))-2100("wharfrat:1007")]TJ 0 -12.46 TD[(set)-524(target_info\(idp,baud\))-3675("9600")]TJ 0 -12.45 TD[(#)-524(MVME)-525(135)-525(board)]TJ 0 -12.45 TD[(set)-524(target_info\(idp,name\))-3675("mvme")]TJ 0 -12.46 TD[(set)-524(target_info\(idp,ldflags\))-2100("-Tmvme.ld")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,config\))-2625(m68k-unknown-aout)]TJ 0 -12.45 TD[(set)-524(target_info\(idp,cflags\))-2625("")]TJ 0 -12.46 TD[(set)-524(target_info\(idp,connect\))-2100(telnet)]TJ 0 -12.45 TD[(set)-524(target_info\(idp,target\))-2625("s8")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,serial\))-2625("tstty8")]TJ 0 -12.46 TD[(set)-524(target_info\(idp,netport\))-2100("wharfrat:1008")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,baud\))-3675("9600")]TJ ET 456.38 -570.92 m 456.77 -570.92 l 456.77 -316.25 l 456.38 -316.25 l b BT/F9 9.96 Tf 18 -577.15 TD[(\012)]TJ ET 23.98 -577.15 m 450.40 -577.15 l 450.40 -576.75 l 23.98 -576.75 l b BT 456.38 -577.15 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.39 TD[(DejaGn)27(u)-403(can)-404(use)-405(this)-404(information)-404(to)-405(switc)27(h)-403(b)-28(et)27(w)27(een)-403(m)27(ultiple)-403(targets)-405(in)-404(one)-405(test)-404(run.)]TJ -14.94 -13.15 TD[(This)-333(is)-333(done)-333(through)-334(the)-333(use)-333(of)-334(the)]TJ/F4 10.91 Tf 172.03 0 TD[(push_target)]TJ/F1 10.91 Tf 66.64 0 TD[(pro)-27(cedure,)-334(whic)27(h)-332(is)-334(discussed)-333(elsewhere.)]TJ -223.73 -16.14 TD[(This)-409(arra)27(y)-408(can)-409(also)-409(hold)-409(information)-409(for)-409(a)-409(remote)-409(host,)-428(whic)26(h)-408(is)-409(used)-409(when)-409(testing)-409(a)]TJ -14.94 -13.15 TD[(candain)-397(cross.)-639(In)-398(this)-398(case,)-414(the)-398(only)-398(thing)-398(di\013eren)27(t)-397(is)-398(the)-398(index)-397(is)-398(just)]TJ/F4 10.91 Tf 350.12 0 TD[(host)]TJ/F1 10.91 Tf 22.91 0 TD[(.)-638(Here's)-398(the)]TJ ET 0 g 0 G
+endstream
+endobj
+114 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F9 59 0 R
+>>
+endobj
+112 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 114 0 R
+>>
+endobj
+117 0 obj
+<<
+/Length 7261
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(4:)-444(Setting)]TJ/F4 10.91 Tf 93.36 0 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(defaults)-22611(17)]TJ -137.09 -23.91 TD[(settings)-348(I)-348(use)-349(to)-348(run)-348(tests)-349(on)-348(m)27(y)-348(NT)-348(mac)27(hine)-347(while)-349(running)-348(DejaGn)27(u)-348(on)-348(a)-348(Unix)-349(mac)27(hine.)]TJ 0 -13.15 TD[(\(in)-333(this)-333(case)-333(a)-334(Lin)27(ux)-332(b)-28(o)27(x\))]TJ/F9 9.96 Tf 0 -10.05 TD[(\013)]TJ ET 23.98 -33.16 m 450.40 -33.16 l 450.40 -32.76 l 23.98 -32.76 l b BT 456.38 -33.16 TD[(\010)]TJ ET 18.00 -95.22 m 18.40 -95.22 l 18.40 -38.89 l 18.00 -38.89 l b BT/F4 10.91 Tf 21.39 -52.44 TD[(set)-524(target_info\(host,name\))-3150("nt-host")]TJ 0 -12.46 TD[(set)-524(target_info\(host,config\))-2100("386-unknown-winnt")]TJ 0 -12.45 TD[(set)-524(target_info\(host,connect\))-1575("telnet")]TJ 0 -12.45 TD[(set)-524(target_info\(host,target\))-2100("ripple")]TJ ET 456.38 -95.22 m 456.77 -95.22 l 456.77 -38.89 l 456.38 -38.89 l b BT/F9 9.96 Tf 18 -101.44 TD[(\012)]TJ ET 23.98 -101.44 m 450.40 -101.44 l 450.40 -101.05 l 23.98 -101.05 l b BT 456.38 -101.44 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.39 TD[(There)-347(is)-347(more)-348(info)-347(on)-347(ho)27(w)-347(to)-347(use)-347(these)-348(v)55(ariables)-347(in)-347(the)-347(sections)-348(on)-347(the)-347(con\014g)-348(\014les.)-486(See)]TJ -14.94 -13.15 TD[(Chapter)-333(4)-333([Con\014guration)-333(Files],)-334(page)-333(18.)]TJ 14.94 -16.14 TD[(In)-419(the)-419(user)-420(editable)-419(second)-420(section)-419(of)-420(`)]TJ/F4 10.91 Tf 190.43 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(',)-440(y)26(ou)-418(can)-420(not)-419(only)-420(o)27(v)28(erride)-418(the)-420(con-)]TJ -251.19 -13.15 TD[(\014guration)-358(v)55(ariables)-358(captured)-358(in)-359(the)-358(\014rst)-359(section,)-365(but)-358(also)-359(sp)-27(ecify)-359(default)-358(v)54(alues)-357(for)-359(all)-358(the)]TJ/F4 10.91 Tf 0 -13.15 TD[(runtest)]TJ/F1 10.91 Tf 43.78 0 TD[(command)-337(line)-338(options.)-458(Sa)27(v)28(e)-337(for)-338(`)]TJ/F4 10.91 Tf 158 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[(',)-338(`)]TJ/F4 10.91 Tf 12.79 0 TD[(--help)]TJ/F1 10.91 Tf 34.36 0 TD[(',)-338(and)-338(`)]TJ/F4 10.91 Tf 34.05 0 TD[(--version)]TJ/F1 10.91 Tf 51.55 0 TD[(',)-338(eac)26(h)-336(com-)]TJ -374.62 -13.16 TD[(mand)-395(line)-395(option)-395(has)-395(an)-395(asso)-28(ciated)-395(Tcl)-395(v)55(ariable.)-629(Use)-395(the)-395(Tcl)]TJ/F4 10.91 Tf 303.88 0 TD[(set)]TJ/F1 10.91 Tf 21.49 0 TD[(command)-395(to)-395(sp)-27(ecify)-396(a)]TJ -325.37 -13.15 TD[(new)-427(default)-427(v)54(alue)-426(\(as)-427(for)-428(the)-427(con\014guration)-428(v)55(ariables\).)-726(The)-427(follo)27(wing)-427(table)-427(describ)-28(es)-427(the)]TJ 0 -13.15 TD[(corresp)-27(ondence)-445(b)-28(et)27(w)27(een)-444(command)-445(line)-445(options)-446(and)-445(v)55(ariables)-444(y)26(ou)-444(can)-445(set)-445(in)-445(`)]TJ/F4 10.91 Tf 380.12 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[('.)]TJ -425.94 -13.15 TD[(See)-333(Chapter)-333(3)-333([Running)-334(the)-333(T)82(ests],)-332(page)-333(9,)-334(for)-333(explanations)-333(of)-334(the)-333(command-line)-333(options.)]TJ/F8 10.91 Tf 23.96 -16.97 TD[(runtest)-2049(Tcl)]TJ 3.48 -13.15 TD[(option)-2049(variable)-4342(description)]TJ ET 18.00 -261.39 m 450.00 -261.39 l 450.00 -260.99 l 18.00 -260.99 l b BT/F4 10.91 Tf 40.91 -274.54 TD[(--all)-2574(all)]TJ ET 115.50 -274.54 m 118.94 -274.54 l 118.94 -274.07 l 115.50 -274.07 l b BT 118.94 -274.54 TD[(flag)]TJ/F1 10.91 Tf 63 0 TD[(displa)27(y)-332(all)-333(test)-334(results)-333(if)-333(set)]TJ/F4 10.91 Tf -146.76 -13.15 TD[(--baud)-2574(baud)]TJ/F1 10.91 Tf 146.76 0 TD[(set)-333(the)-333(default)-333(baud)-334(rate)-333(to)-333(something)]TJ 0 -13.15 TD[(other)-333(than)-333(9600.)]TJ/F4 10.91 Tf -163.94 -12.51 TD[(--connect)-2574(connectmode)]TJ/F1 10.91 Tf 163.94 0 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(rlogin)]TJ/F1 10.91 Tf 34.36 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(telnet)]TJ/F1 10.91 Tf 34.36 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(rsh)]TJ/F1 10.91 Tf 17.18 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(kermit)]TJ/F1 10.91 Tf 34.36 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[(',)]TJ -191.39 -13.15 TD[(or)-333(`)]TJ/F4 10.91 Tf 16.39 0 TD[(mondfe)]TJ/F1 10.91 Tf 34.37 0 TD[(')]TJ/F4 10.91 Tf -197.52 -14.24 TD[(--mail)-2574(mailing)]TJ ET 138.41 -340.74 m 141.85 -340.74 l 141.85 -340.27 l 138.41 -340.27 l b BT 141.85 -340.74 TD[(list)]TJ/F1 10.91 Tf 40.09 0 TD[(address)-333(list)-333(for)-333(mailing)-334(test)-333(output)]TJ/F4 10.91 Tf -146.76 -13.15 TD[(--name)-2574(targetname)]TJ/F1 10.91 Tf 146.76 0 TD[(net)27(w)28(ork)-332(name)-334(of)-333(testing)-333(target)-333(or)-334(its)]TJ 0 -13.15 TD[(host)]TJ/F4 10.91 Tf -158.21 -14.25 TD[(--outdir)-2574(outdir)]TJ/F1 10.91 Tf 158.21 0 TD[(directory)-333(for)-333(`)]TJ/F5 10.91 Tf 66.15 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.49 0 TD[(.sum)]TJ/F1 10.91 Tf 22.9 0 TD[(')-333(and)-333(`)]TJ/F5 10.91 Tf 30.91 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.49 0 TD[(.log)]TJ/F1 10.91 Tf 22.91 0 TD[(')]TJ/F4 10.91 Tf -338.06 -13.15 TD[(--objdir)-2574(objdir)]TJ/F1 10.91 Tf 158.21 0 TD[(directory)-333(for)-333(compiled)-333(binaries)]TJ/F4 10.91 Tf -158.21 -13.15 TD[(--reboot)-2574(reboot)]TJ/F1 10.91 Tf 158.21 0 TD[(reb)-27(o)-28(ot)-333(the)-334(target)-333(if)-333(set)-334(to)]TJ/F4 10.91 Tf 125.88 0 TD[("1")]TJ/F1 10.91 Tf 17.18 0 TD[(;)-333(do)-333(not)]TJ -143.06 -13.15 TD[(reb)-27(o)-28(ot)-333(if)-334(set)-333(to)]TJ/F4 10.91 Tf 74.94 0 TD[("0")]TJ/F1 10.91 Tf 20.82 0 TD[(\(the)-333(default\))]TJ/F4 10.91 Tf -253.97 -14.25 TD[(--srcdir)-2574(srcdir)]TJ/F1 10.91 Tf 158.21 0 TD[(directory)-333(of)-333(test)-333(sub)-28(directories)]TJ/F4 10.91 Tf -158.21 -13.15 TD[(--strace)-2574(tracelevel)]TJ/F1 10.91 Tf 158.21 0 TD[(a)-333(n)27(um)28(b)-27(er:)-500(Tcl)-333(trace)-334(depth)]TJ/F4 10.91 Tf -146.76 -13.15 TD[(--tool)-2574(tool)]TJ/F1 10.91 Tf 146.76 0 TD[(name)-333(of)-333(to)-28(ol)-333(to)-333(test;)-334(iden)27(ti\014es)-332(init,)-334(test)]TJ 0 -13.15 TD[(sub)-27(dir)]TJ/F4 10.91 Tf -163.94 -12.51 TD[(--verbose)-2574(verbose)]TJ/F1 10.91 Tf 163.94 0 TD[(v)27(erb)-26(osit)26(y)-332(lev)27(el.)-499(As)-334(option,)-333(use)-333(m)27(ultiple)]TJ 0 -13.15 TD[(times;)-333(as)-333(v)54(ariable,)-332(set)-333(a)-333(n)26(um)28(b)-27(er,)-333(0)-333(or)]TJ 0 -13.15 TD[(greater)]TJ/F4 10.91 Tf -158.21 -12.51 TD[(--target)-2574(target)]TJ ET 132.69 -525.76 m 136.12 -525.76 l 136.12 -525.29 l 132.69 -525.29 l b BT 136.12 -525.76 TD[(triplet)]TJ/F1 10.91 Tf 45.82 0 TD[(The)-333(canonical)-333(con\014guration)-333(string)-334(for)]TJ 0 -13.15 TD[(the)-333(target.)]TJ/F4 10.91 Tf -146.76 -12.5 TD[(--host)-2574(host)]TJ ET 121.23 -551.41 m 124.67 -551.41 l 124.67 -550.95 l 121.23 -550.95 l b BT 124.67 -551.41 TD[(triplet)]TJ/F1 10.91 Tf 57.27 0 TD[(The)-333(canonical)-333(con\014guration)-333(string)-334(for)]TJ 0 -13.16 TD[(the)-333(host.)]TJ/F4 10.91 Tf -152.49 -12.5 TD[(--build)-2574(build)]TJ ET 126.96 -577.07 m 130.40 -577.07 l 130.40 -576.60 l 126.96 -576.60 l b BT 130.4 -577.07 TD[(triplet)]TJ/F1 10.91 Tf 51.54 0 TD[(The)-333(canonical)-333(con\014guration)-333(string)-334(for)]TJ 0 -13.15 TD[(the)-333(build)-333(host.)]TJ ET 0 g 0 G
+endstream
+endobj
+118 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F9 59 0 R
+/F8 52 0 R
+/F5 31 0 R
+>>
+endobj
+116 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 118 0 R
+>>
+endobj
+121 0 obj
+<<
+/Length 5295
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(18)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 13.09 Tf 0 -23.91 TD[(4.0.2)-562(Master)-375(Con\014g)-375(File)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(The)-322(master)-323(con\014g)-322(\014le)-323(is)-322(where)-323(all)-322(the)-323(target)-322(sp)-28(eci\014c)-323(con\014g)-322(v)54(ariables)-321(get)-323(set)-322(for)-323(a)-322(whole)]TJ -14.94 -13.15 TD[(site)-427(get)-427(set.)-726(The)-427(idea)-427(is)-427(that)-428(for)-427(a)-427(cen)27(tralized)-426(testing)-428(lab)-427(where)-427(p)-28(eople)-427(ha)27(v)28(e)-427(to)-427(share)-427(a)]TJ 0 -13.15 TD[(target)-321(b)-27(et)26(w)28(een)-320(m)27(ultiple)-320(dev)27(elop)-27(ers.)-441(There)-321(are)-321(settings)-321(for)-321(b)-28(oth)-321(remote)-321(targets)-321(and)-321(remote)]TJ 0 -13.15 TD[(hosts.)-562(Here's)-373(an)-373(example)-373(of)-372(a)-373(Master)-373(Con\014g)-373(File)-372(\(also)-373(called)-373(the)-373(Global)-372(con\014g)-373(\014le\))-373(for)-373(a)]TJ/F8 10.91 Tf 0 -13.15 TD[(c)51(anadian)-333(cr)50(oss)]TJ/F1 10.91 Tf 69.57 0 TD[(.)-435(A)-307(canadian)-308(cross)-307(is)-307(when)-307(y)27(ou)-307(build)-307(and)-307(test)-307(a)-307(cross)-307(compiler)-308(on)-307(a)-307(mac)27(hine)]TJ -69.57 -13.15 TD[(other)-333(than)-333(the)-333(one)-334(it's)-333(to)-333(b)-28(e)-334(hosted)-333(on.)]TJ 14.94 -16.14 TD[(Here)-314(w)27(e)-313(ha)26(v)28(e)-313(the)-314(con\014g)-315(settings)-314(for)-314(our)-315(California)-314(o\016ce.)-438(Note)-314(that)-315(all)-314(con\014g)-314(v)54(alues)-313(are)]TJ -14.94 -13.15 TD[(site)-398(dep)-27(endan)26(t.)-638(Here)-398(w)27(e)-397(ha)26(v)28(e)-397(t)27(w)28(o)-398(sets)-398(of)-398(v)54(alues)-397(that)-398(w)27(e)-397(use)-399(for)-398(testing)-398(m68k-aout)-398(cross)]TJ 0 -13.15 TD[(compilers.)-628(As)-395(b)-28(oth)-394(of)-395(these)-395(target)-394(b)-28(oards)-395(has)-394(a)-395(di\013eren)27(t)-394(debugging)-395(proto)-28(col,)-410(w)27(e)-394(test)-394(on)]TJ 0 -13.15 TD[(b)-27(oth)-334(of)-333(them)-333(in)-334(sequence.)]TJ/F9 9.96 Tf 0 -9.44 TD[(\013)]TJ ET 23.98 -163.86 m 450.40 -163.86 l 450.40 -163.47 l 23.98 -163.47 l b BT 456.38 -163.86 TD[(\010)]TJ ET 18.00 -559.73 m 18.40 -559.73 l 18.40 -169.59 l 18.00 -169.59 l b BT/F4 10.91 Tf 21.39 -182.24 TD[(global)-524(CFLAGS)]TJ 0 -12.45 TD[(global)-524(CXXFLAGS)]TJ 0 -24.91 TD[(case)-524("$target_triplet")-525(in)-525({)]TJ 22.91 -12.45 TD[({)-524("native")-525(})-525({)]TJ 22.9 -12.45 TD[(set)-524(target_abbrev)-525(unix)]TJ -22.9 -12.46 TD[(})]TJ 0 -12.45 TD[({)-524("m68*-unknown-aout")-525(})-525({)]TJ 22.9 -12.45 TD[(set)-524(target_abbrev)-7875("rom68k")]TJ 0 -12.46 TD[(#)-524(IDP)-525(target)-10500(#)-525(IDP)-525(board)-525(with)-525(rom68k)-525(monitor)]TJ 0 -12.45 TD[(set)-524(target_info\(idp,name\))-3675("idp")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,ldflags\))-2100("-Tidp.ld")]TJ 0 -12.46 TD[(set)-524(target_info\(idp,config\))-2625(m68k-unknown-aout)]TJ 0 -12.45 TD[(set)-524(target_info\(idp,cflags\))-2625("")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,connect\))-2100(telnet)]TJ 0 -12.46 TD[(set)-524(target_info\(idp,target\))-2625("s7")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,serial\))-2625("tstty12")]TJ 0 -12.45 TD[(set)-524(target_info\(idp,netport\))-2100("truckin:1007")]TJ 0 -12.46 TD[(set)-524(target_info\(idp,baud\))-3675("9600")]TJ 0 -12.45 TD[(#)-524(MVME)-525(target)-9975(#)-525(Motorola)-525(MVME)-525(135)-525(with)-525(BUG)-525(monitor)]TJ 0 -12.45 TD[(set)-524(target_info\(mvme,name\))-3150("mvme")]TJ 0 -12.46 TD[(set)-524(target_info\(mvme,ldflags\))-1575("-Tmvme.ld")]TJ 0 -12.45 TD[(set)-524(target_info\(mvme,config\))-2100(m68k-unknown-aout)]TJ 0 -12.45 TD[(set)-524(target_info\(mvme,cflags\))-2100("")]TJ 0 -12.46 TD[(set)-524(target_info\(mvme,connect\))-1575(telnet)]TJ 0 -12.45 TD[(set)-524(target_info\(mvme,target\))-2100("s4")]TJ 0 -12.45 TD[(set)-524(target_info\(mvme,serial\))-2100("tstty8")]TJ 0 -12.46 TD[(set)-524(target_info\(mvme,netport\))-1575("truckin:1004")]TJ 0 -12.45 TD[(set)-524(target_info\(mvme,baud\))-3150("9600")]TJ -17.18 -12.45 TD[(})]TJ -28.63 -12.46 TD[(})]TJ ET 456.38 -559.73 m 456.77 -559.73 l 456.77 -169.59 l 456.38 -169.59 l b BT/F9 9.96 Tf 18 -565.96 TD[(\012)]TJ ET 23.98 -565.96 m 450.40 -565.96 l 450.40 -565.56 l 23.98 -565.56 l b BT 456.38 -565.96 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.39 TD[(In)-310(this)-311(case,)-316(w)27(e)-310(ha)27(v)28(e)-310(supp)-28(ort)-311(for)-311(sev)27(eral)-310(remote)-311(hosts)-311(for)-311(our)-311(m68k-aout)-311(cross)-311(compiler.)]TJ -14.94 -13.15 TD[(T)27(ypically)-341(the)-343(remote)-342(Unix)-343(hosts)-343(run)-342(DejaGn)27(u)-342(lo)-28(cally)82(,)-343(but)-343(w)27(e)-342(also)-342(use)-343(them)-343(for)-342(debugging)]TJ 0 -13.15 TD[(the)-291(testsuites)-292(when)-291(w)26(e)-290(\014nd)-292(problems)-292(in)-291(running)-292(on)-292(remote)-291(hosts.)-431(Exp)-28(ect)-291(w)26(on't)-290(run)-292(on)-292(NT,)]TJ 0 -13.15 TD[(so)-327(DejaGn)27(u)-326(is)-327(run)-327(on)-328(the)-327(lo)-28(cal)-327(build)-327(mac)27(hine,)-327(and)-328(it'll)-327(connect)-327(to)-327(the)-327(NT)-327(host)-328(and)-327(run)-327(all)]TJ 0 -13.15 TD[(the)-333(tests)-333(for)-333(this)-334(cross)-333(compiler)-333(on)-334(that)-333(host.)]TJ ET 0 g 0 G
+endstream
+endobj
+122 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F8 52 0 R
+/F9 59 0 R
+/F4 28 0 R
+>>
+endobj
+120 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 122 0 R
+>>
+endobj
+125 0 obj
+<<
+/Length 5912
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(4:)-444(Setting)]TJ/F4 10.91 Tf 93.36 0 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(defaults)-22611(19)]TJ/F9 9.96 Tf -108.29 -20.18 TD[(\013)]TJ ET 52.78 -6.23 m 450.40 -6.23 l 450.40 -5.83 l 52.78 -5.83 l b BT 456.38 -6.23 TD[(\010)]TJ ET 46.80 -367.53 m 47.20 -367.53 l 47.20 -11.96 l 46.80 -11.96 l b BT/F4 10.91 Tf 50.19 -27.4 TD[(case)-524("$host_triplet")-525(in)-525({)]TJ 22.91 -12.45 TD[("native")-524({)]TJ 0 -12.45 TD[(})]TJ 0 -12.46 TD[("i?86-*-linux*")-524({)-9975(#)-525(Linux)-525(host)]TJ 22.9 -12.45 TD[(set)-524(target_info\(host,name\))-3150("linux-host")]TJ 0 -12.45 TD[(set)-524(target_info\(host,config\))-2100($host_triplet)]TJ 0 -12.46 TD[(set)-524(target_info\(host,connect\))-1575(rlogin)]TJ 0 -12.45 TD[(set)-524(target_info\(host,target\))-2100(chinadoll)]TJ -22.9 -12.45 TD[(})]TJ 0 -12.46 TD[("i?86-*-winnt)-12074(#)-525(NT)-525(host)]TJ 22.9 -12.45 TD[(set)-524(target_info\(host,name\))-3150("nt-host")]TJ 0 -12.45 TD[(set)-524(target_info\(host,config\))-2100(i386-unknown-winnt)]TJ 0 -12.46 TD[(set)-524(target_info\(host,connect\))-1575(telnet)]TJ 0 -12.45 TD[(set)-524(target_info\(host,target\))-2100(ripple)]TJ -22.9 -12.45 TD[(})]TJ 0 -12.46 TD[("hppa*-hp-hpux*")-524({)-9450(#)-525(HP-UX)-525(host)]TJ 22.9 -12.45 TD[(set)-524(target_info\(host,name\))-3150("hpux-host")]TJ 0 -12.45 TD[(set)-524(target_info\(host,config\))-2100($host_triplet)]TJ 0 -12.46 TD[(set)-524(target_info\(host,connect\))-1575(rlogin)]TJ 0 -12.45 TD[(set)-524(target_info\(host,target\))-2100(slipknot)]TJ 0 -12.45 TD[(})]TJ -22.9 -12.46 TD[("sparc-sun-sunos*")-524({)-8400(#)-525(SunOS)-525(\(sun4\))]TJ 22.9 -12.45 TD[(set)-524(target_info\(host,name\))-3150("sunos-host")]TJ 0 -12.45 TD[(set)-524(target_info\(host,config\))-2100($host_triplet)]TJ 0 -12.46 TD[(set)-524(target_info\(host,connect\))-1575(rlogin)]TJ 0 -12.45 TD[(set)-524(target_info\(host,target\))-2100(darkstar)]TJ -22.9 -12.45 TD[(})]TJ -22.91 -12.46 TD[(})]TJ ET 456.38 -367.53 m 456.77 -367.53 l 456.77 -11.96 l 456.38 -11.96 l b BT/F9 9.96 Tf 46.8 -373.76 TD[(\012)]TJ ET 52.78 -373.76 m 450.40 -373.76 l 450.40 -373.36 l 52.78 -373.36 l b BT 456.38 -373.76 TD[(\011)]TJ/F2 13.09 Tf -438.38 -26.9 TD[(4.0.3)-562(Lo)-31(cal)-375(Con\014g)-375(File)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(It)-369(is)-370(usually)-369(more)-370(con)27(v)28(enien)27(t)-368(to)-370(k)27(eep)-369(these)-369(\\man)26(ual)-368(o)27(v)27(errides")-368(in)-370(the)-370(`)]TJ/F4 10.91 Tf 342.06 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-369(lo)-28(cal)]TJ -402.82 -13.15 TD[(to)-333(eac)27(h)-332(test)-334(directory)83(,)-333(rather)-333(than)-333(in)-334(the)-333(\\master")-333(`)]TJ/F4 10.91 Tf 247.24 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-333(in)-333(the)-333(DejaGn)26(u)-332(library)82(.)]TJ -278.12 -16.14 TD[(All)-411(lo)-28(cal)-411(`)]TJ/F4 10.91 Tf 48.37 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-411(usually)-411(\014les)-411(ha)26(v)28(e)-410(t)27(w)27(o)-410(sections,)-431(separated)-411(b)27(y)-410(commen)26(t)-410(text.)-678(The)]TJ -109.13 -13.15 TD[(\014rst)-263(section)-264(is)-264(the)-264(part)-264(that)-264(is)-264(generated)-264(b)27(y)]TJ/F4 10.91 Tf 205.04 0 TD[(make)]TJ/F1 10.91 Tf 22.91 0 TD[(.)-421(It)-264(is)-264(essen)27(tially)-263(a)-264(collection)-264(of)-264(Tcl)-264(v)55(ariable)]TJ -227.95 -13.15 TD[(de\014nitions)-360(based)-361(on)-361(`)]TJ/F4 10.91 Tf 102.23 0 TD[(Makefile)]TJ/F1 10.91 Tf 45.82 0 TD[(')-360(en)27(vironmen)27(t)-359(v)54(ariables.)-525(Since)-361(they)-361(are)-360(generated)-361(b)27(y)]TJ/F4 10.91 Tf 258.01 0 TD[(make)]TJ/F1 10.91 Tf 22.91 0 TD[(,)]TJ -428.97 -13.16 TD[(they)-298(con)27(tain)-297(the)-298(v)54(alues)-297(as)-298(sp)-28(eci\014ed)-298(b)27(y)]TJ/F4 10.91 Tf 184.16 0 TD[(configure)]TJ/F1 10.91 Tf 51.55 0 TD[(.)-432(\(Y)82(ou)-297(can)-298(also)-298(customize)-298(these)-299(v)55(alues)-297(b)27(y)]TJ -235.71 -13.15 TD[(using)-263(the)-263(`)]TJ/F4 10.91 Tf 48.83 0 TD[(--site)]TJ/F1 10.91 Tf 34.37 0 TD[(')-263(option)-263(to)]TJ/F4 10.91 Tf 51.64 0 TD[(configure)]TJ/F1 10.91 Tf 51.55 0 TD[(.\))-421(In)-263(particular,)-277(this)-263(section)-264(con)27(tains)-262(the)-263(`)]TJ/F4 10.91 Tf 196.76 0 TD[(Makefile)]TJ/F1 10.91 Tf 45.82 0 TD[(')]TJ -428.97 -13.15 TD[(v)55(ariables)-389(for)-390(host)-389(and)-390(target)-390(con\014guration)-390(data.)-614(Do)-390(not)-390(edit)-389(this)-390(\014rst)-390(section;)-418(if)-390(y)27(ou)-389(do,)]TJ 0 -13.15 TD[(y)27(our)-332(c)27(hanges)-333(are)-333(replaced)-333(next)-334(time)-333(y)27(ou)-332(run)]TJ/F4 10.91 Tf 216.55 0 TD[(make)]TJ/F1 10.91 Tf 22.9 0 TD[(.)]TJ -224.51 -16.14 TD[(The)-333(\014rst)-333(section)-333(starts)-334(with:)]TJ/F9 9.96 Tf -14.94 -7.32 TD[(\013)]TJ ET 23.98 -555.43 m 450.40 -555.43 l 450.40 -555.03 l 23.98 -555.03 l b BT 456.38 -555.43 TD[(\010)]TJ ET 18.00 -601.70 m 18.40 -601.70 l 18.40 -561.16 l 18.00 -561.16 l b BT/F4 10.91 Tf 21.39 -573.8 TD[(##)-524(these)-525(variables)-525(are)-525(automatically)-525(generated)-525(by)-525(make)-525(##)]TJ 0 -12.46 TD[(#)-524(Do)-525(not)-525(edit)-525(here.)-525(If)-525(you)-525(wish)-525(to)-525(override)-525(these)-525(values)]TJ 0 -12.45 TD[(#)-524(add)-525(them)-525(to)-525(the)-525(last)-525(section)]TJ ET 456.38 -601.70 m 456.77 -601.70 l 456.77 -561.16 l 456.38 -561.16 l b BT/F9 9.96 Tf 18 -607.92 TD[(\012)]TJ ET 23.98 -607.92 m 450.40 -607.92 l 450.40 -607.53 l 23.98 -607.53 l b BT 456.38 -607.92 TD[(\011)]TJ/F1 10.91 Tf -423.44 -18 TD[(In)-263(the)-263(second)-263(section,)-277(y)26(ou)-262(can)-263(o)27(v)28(erride)-263(an)27(y)-262(default)-263(v)54(alues)-262(\(lo)-28(cally)-263(to)-263(DejaGn)27(u\))-262(for)-264(all)-263(the)]TJ -14.94 -13.15 TD[(v)55(ariables.)-441(The)-327(second)-326(section)-327(can)-326(also)-327(con)27(tain)-326(y)27(our)-326(preferred)-326(defaults)-327(for)-326(all)-327(the)-326(command)]TJ ET 0 g 0 G
+endstream
+endobj
+126 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F9 59 0 R
+/F2 12 0 R
+>>
+endobj
+124 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 126 0 R
+>>
+endobj
+129 0 obj
+<<
+/Length 5100
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(20)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 0 -23.91 TD[(line)-347(options)-347(to)]TJ/F4 10.91 Tf 72.63 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(.)-485(This)-347(allo)27(ws)-346(y)26(ou)-346(to)-347(easily)-347(customize)]TJ/F4 10.91 Tf 180.98 0 TD[(runtest)]TJ/F1 10.91 Tf 43.88 0 TD[(for)-347(y)27(our)-346(preferences)]TJ -337.58 -13.15 TD[(in)-466(eac)26(h)-465(con\014gured)-467(test-suite)-467(tree,)-500(so)-467(that)-467(y)27(ou)-466(need)-467(not)-467(t)27(yp)-27(e)-467(options)-467(rep)-27(eatedly)-467(on)-467(the)]TJ 0 -13.15 TD[(command)-340(line.)-465(\(The)-341(second)-340(section)-340(ma)27(y)-340(also)-340(b)-28(e)-340(empt)27(y)83(,)-341(if)-341(y)27(ou)-339(do)-340(not)-341(wish)-340(to)-340(o)26(v)28(erride)-339(an)27(y)]TJ 0 -13.15 TD[(defaults.\))]TJ 14.94 -16.14 TD[(The)-333(\014rst)-333(section)-333(ends)-334(with)-333(this)-333(line:)]TJ/F9 9.96 Tf -14.94 -7.33 TD[(\013)]TJ ET 23.98 -72.88 m 450.40 -72.88 l 450.40 -72.48 l 23.98 -72.48 l b BT 456.38 -72.88 TD[(\010)]TJ ET 18.00 -96.66 m 18.40 -96.66 l 18.40 -78.61 l 18.00 -78.61 l b BT/F4 10.91 Tf 21.39 -91.25 TD[(##)-524(All)-525(variables)-525(above)-525(are)-525(generated)-525(by)-525(configure.)-525(Do)-525(Not)-525(Edit)-525(##)]TJ ET 456.38 -96.66 m 456.77 -96.66 l 456.77 -78.61 l 456.38 -78.61 l b BT/F9 9.96 Tf 18 -102.89 TD[(\012)]TJ ET 23.98 -102.89 m 450.40 -102.89 l 450.40 -102.49 l 23.98 -102.49 l b BT 456.38 -102.89 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.39 TD[(Y)83(ou)-335(can)-335(mak)27(e)-334(an)26(y)-334(c)27(hanges)-335(under)-335(this)-335(line.)-451(If)-335(y)27(ou)-335(wish)-335(to)-335(rede\014ne)-336(a)-335(v)54(ariable)-334(in)-335(the)-336(top)]TJ -14.94 -13.15 TD[(section,)-382(then)-373(just)-373(put)-373(a)-373(duplicate)-373(v)54(alue)-372(in)-373(this)-373(second)-373(section.)-563(Usually)-373(the)-373(v)54(alues)-372(de\014ned)]TJ 0 -13.15 TD[(in)-338(this)-338(con\014g)-338(\014le)-338(are)-338(related)-338(to)-338(the)-338(con\014guration)-338(of)-338(the)-338(test)-338(run.)-459(This)-338(is)-338(the)-338(ideal)-338(place)-338(to)]TJ 0 -13.15 TD[(set)-334(the)-335(v)55(ariables)]TJ/F4 10.91 Tf 81.1 0 TD[(host_triplet)]TJ/F1 10.91 Tf 68.73 0 TD[(,)]TJ/F4 10.91 Tf 6.68 0 TD[(build_triplet)]TJ/F1 10.91 Tf 74.45 0 TD[(,)]TJ/F4 10.91 Tf 6.69 0 TD[(target_triplet)]TJ/F1 10.91 Tf 80.18 0 TD[(.)-448(All)-334(other)-335(v)55(ariables)-334(are)]TJ -317.83 -13.15 TD[(to)-27(ol)-356(dep)-28(endan)27(t.)-511(ie)-355(for)-356(testing)-356(a)-355(compiler,)-362(the)-355(v)54(alue)-354(for)]TJ/F5 10.91 Tf 266.78 0 TD[(CC)]TJ/F1 10.91 Tf 20.57 0 TD[(migh)27(t)-354(b)-28(e)-356(set)-356(to)-355(a)-356(freshly)-356(built)]TJ -287.35 -13.15 TD[(binary)83(,)-332(as)-334(opp)-28(osed)-333(to)-333(one)-334(in)-333(the)-333(user's)-334(path.)]TJ/F2 13.09 Tf 0 -26.9 TD[(4.0.4)-562(P)30(ersonal)-374(Con\014g)-375(File)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(The)-494(p)-28(ersonal)-495(con\014g)-495(\014le)-495(is)-495(used)-495(to)-494(customize)]TJ/F4 10.91 Tf 228.62 0 TD[(runtest's)]TJ/F1 10.91 Tf 56.94 0 TD[(b)-27(eha)27(viour)-494(for)-495(eac)27(h)-494(p)-28(erson.)]TJ -300.5 -13.15 TD[(It's)-362(t)27(ypically)-361(used)-362(to)-362(set)-363(the)-362(user)-362(prefered)-362(setting)-362(for)-363(v)27(erb)-27(osit)27(y)84(,)-369(and)-362(an)27(y)-361(exp)-28(erimen)27(tal)-362(Tcl)]TJ 0 -13.16 TD[(pro)-27(cedures.)-445(My)-333(p)-28(ersonal)-333(`)]TJ/F4 10.91 Tf 125.06 0 TD[(~/.dejagnurc)]TJ/F1 10.91 Tf 68.73 0 TD[(')-333(\014le)-333(lo)-28(oks)-333(lik)27(e:)]TJ/F9 9.96 Tf -193.79 -9.74 TD[(\013)]TJ ET 23.98 -272.09 m 450.40 -272.09 l 450.40 -271.69 l 23.98 -271.69 l b BT 456.38 -272.09 TD[(\010)]TJ ET 18.00 -319.27 m 18.40 -319.27 l 18.40 -277.82 l 18.00 -277.82 l b BT/F4 10.91 Tf 21.39 -290.46 TD[(set)-524(all_flag)-525(1)]TJ 0 -12.46 TD[(set)-524(RLOGIN)-525(/usr/ucb/rlogin)]TJ 0 -12.45 TD[(set)-524(RSH)-525(/usr/ucb/rsh)]TJ ET 456.38 -319.27 m 456.77 -319.27 l 456.77 -277.82 l 456.38 -277.82 l b BT/F9 9.96 Tf 18 -325.5 TD[(\012)]TJ ET 23.98 -325.50 m 450.40 -325.50 l 450.40 -325.10 l 23.98 -325.10 l b BT 456.38 -325.5 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.38 TD[(Here)-299(I)-300(set)]TJ/F4 10.91 Tf 49.29 0 TD[(all_flag)]TJ/F1 10.91 Tf 49.09 0 TD[(so)-299(I)-300(see)-299(all)-300(the)-299(test)-300(cases)-299(that)-300(P)83(ASS)-299(along)-299(with)-300(the)-299(ones)-300(that)-299(F)110(AIL.)]TJ -113.32 -13.16 TD[(I)-398(also)-398(set)]TJ/F5 10.91 Tf 48.61 0 TD[(RLOGIN)]TJ/F1 10.91 Tf 49.54 0 TD[(and)]TJ/F4 10.91 Tf 21.92 0 TD[(RSH)]TJ/F1 10.91 Tf 21.53 0 TD[(to)-398(the)-398(BSD)-398(v)27(ersion.)-639(I)-398(ha)27(v)28(e)]TJ/F4 10.91 Tf 137.57 0 TD[(kerberos)]TJ/F1 10.91 Tf 50.16 0 TD[(installed,)-414(and)-398(when)-399(I)]TJ -329.33 -13.15 TD[(rlogin)-285(to)-286(a)-286(target)-286(b)-28(oard,)-295(it)-286(usually)-285(isn't)-286(supp)-28(orted.)-429(So)-285(I)-286(use)-286(the)-286(non)-286(secure)-286(v)27(ersions)-285(of)-285(these)]TJ 0 -13.15 TD[(programs)-333(rather)-333(than)-333(the)-334(default)-333(that's)-333(in)-334(m)27(y)-332(path.)]TJ ET 0 g 0 G
+endstream
+endobj
+130 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F9 59 0 R
+/F5 31 0 R
+/F2 12 0 R
+>>
+endobj
+128 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 130 0 R
+>>
+endobj
+133 0 obj
+<<
+/Length 8099
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(21)]TJ/F2 17.22 Tf 0 -25.91 TD[(5)-562(The)-375(DejaGn)30(u)-374(Implemen)31(tation)]TJ/F1 10.91 Tf 14.94 -28.09 TD[(DejaGn)27(u)-322(is)-324(en)27(tirely)-323(written)-323(in)]TJ/F4 10.91 Tf 146.79 0 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(,)-325(whic)27(h)-323(uses)-323(Tcl)-324(as)-324(a)-323(command)-324(language.)]TJ/F4 10.91 Tf 201.55 0 TD[(expect)]TJ/F1 10.91 Tf -397.64 -13.15 TD[(serv)27(es)-276(as)-277(a)-277(v)27(ery)-276(programmable)-278(shell;)-295(y)26(ou)-276(can)-277(run)-277(an)27(y)-276(program,)-289(as)-277(with)-277(the)-277(usual)-277(Unix)-277(com-)]TJ 0 -13.15 TD[(mand)-338(shells|but)-339(once)-338(the)-339(program)-338(is)-339(started,)-340(y)27(our)]TJ/F4 10.91 Tf 250.53 0 TD[(expect)]TJ/F1 10.91 Tf 38.06 0 TD[(script)-338(has)-339(fully)-338(programmable)]TJ -288.59 -13.15 TD[(con)27(trol)-254(of)-254(its)-255(input)-255(and)-255(output.)-418(This)-255(do)-28(es)-254(not)-255(just)-255(apply)-255(to)-255(the)-255(programs)-254(under)-255(test;)]TJ/F4 10.91 Tf 397.64 0 TD[(expect)]TJ/F1 10.91 Tf -397.64 -13.15 TD[(can)-307(also)-308(run)-308(an)27(y)-307(auxiliary)-307(program,)-313(suc)27(h)-307(as)]TJ/F4 10.91 Tf 210.55 0 TD[(diff)]TJ/F1 10.91 Tf 26.27 0 TD[(or)]TJ/F4 10.91 Tf 13.08 0 TD[(sh)]TJ/F1 10.91 Tf 11.45 0 TD[(,)-312(with)-308(full)-308(con)27(trol)-307(o)27(v)28(er)-307(its)-308(input)-307(and)]TJ -261.35 -13.15 TD[(output.)]TJ 14.94 -16.14 TD[(DejaGn)27(u)-435(itself)-437(is)-437(merely)-436(a)-437(framew)27(ork)-436(for)-436(the)-437(set)-436(of)-437(test)-437(suites)-436(distributed)-437(separately)]TJ -14.94 -13.15 TD[(for)-427(eac)27(h)]TJ/F7 10.91 Tf 43.3 0 TD[(gnu)]TJ/F1 10.91 Tf 25.04 0 TD[(to)-27(ol.)-728(F)82(uture)-426(releases)-428(of)]TJ/F7 10.91 Tf 119.85 0 TD[(gnu)]TJ/F1 10.91 Tf 25.04 0 TD[(to)-27(ols)-428(will)-428(include)-427(ev)26(en)-426(more)-428(tests,)-451(dev)26(elop)-26(ed)]TJ -213.23 -13.15 TD[(throughout)-333(the)-333(free)-333(soft)26(w)28(are)-332(comm)27(unit)27(y)84(.)]TJ/F4 10.91 Tf 14.94 -16.14 TD[(runtest)]TJ/F1 10.91 Tf 43.85 0 TD[(is)-344(the)-345(glue)-344(to)-345(tie)-344(together)-345(and)-345(manage)-344(the)-345(test)-344(scripts.)-479(The)]TJ/F4 10.91 Tf 289.3 0 TD[(runtest)]TJ/F1 10.91 Tf 43.85 0 TD[(program)]TJ -391.94 -13.15 TD[(is)-403(actually)-403(a)-403(simple)-404(Bourne)-403(shell)-403(script)-404(that)-403(lo)-28(cates)-403(a)-403(cop)27(y)-403(of)-403(the)]TJ/F4 10.91 Tf 324.38 0 TD[(expect)]TJ/F1 10.91 Tf 38.76 0 TD[(shell)-403(and)-403(then)]TJ -363.14 -13.15 TD[(starts)-333(the)-333(main)-333(Tcl)-334(co)-28(de,)]TJ/F4 10.91 Tf 124.09 0 TD[(runtest.exp)]TJ/F1 10.91 Tf 63 0 TD[(.)]TJ/F4 10.91 Tf 7.88 0 TD[(runtest.exp)]TJ/F1 10.91 Tf 66.64 0 TD[(itself)-333(has)-333(these)-333(essen)26(tial)-332(functions:)]TJ -255.7 -16.14 TD[(1.)-660(P)27(arse)-221(the)-223(command)-223(line)-223(options,)-244(load)-223(the)-223(library)-223(\014les,)-244(and)-223(load)-223(the)-222(default)-223(con\014guration)]TJ 15.69 -13.16 TD[(\014les.)]TJ -15.69 -16.13 TD[(2.)-660(Lo)-27(cating)-450(the)-450(individual)-450(test)-450(scripts.)]TJ/F4 10.91 Tf 200.12 0 TD[(runtest.exp)]TJ/F1 10.91 Tf 67.91 0 TD[(lo)-27(cates)-450(the)-450(tests)-450(b)26(y)-449(exploiting)-450(a)]TJ -252.34 -13.16 TD[(straigh)27(tforw)28(ard)-367(naming)-368(con)27(v)28(en)27(tion)-367(based)-368(on)-367(the)-368(string)-368(y)26(ou)-367(sp)-27(ecify)-368(with)-368(the)-368(`)]TJ/F4 10.91 Tf 373.01 0 TD[(--tool)]TJ/F1 10.91 Tf 34.36 0 TD[(')]TJ -407.37 -13.15 TD[(option.)]TJ -15.69 -16.14 TD[(3.)-660(Pro)27(viding)-290(an)-290(extended)-291(test)-291(en)27(vironmen)27(t,)-298(b)27(y)-290(de\014ning)-291(additional)-291(Tcl)-291(pro)-27(cedures)-291(b)-28(ey)27(ond)]TJ 15.69 -13.15 TD[(those)-333(already)-333(in)]TJ/F4 10.91 Tf 79.79 0 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(.)]TJ -129.84 -16.14 TD[(4.)-660(Lo)-27(cating)-264(target-dep)-28(enden)27(t)-263(functions,)-277(to)-264(standardize)-264(the)-263(test)-264(en)27(vironmen)28(t)-263(across)-264(a)-263(wide)]TJ 15.69 -13.15 TD[(v)55(ariet)28(y)-332(of)-334(test)-333(platforms.)]TJ/F2 14.35 Tf -21.6 -30.88 TD[(5.1)-562(Con)30(v)32(en)31(tions)-374(for)-375(using)-375(to)-31(ol)-375(names)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(DejaGn)27(u)-281(uses)-282(`)]TJ/F4 10.91 Tf 71.05 0 TD[($tool)]TJ/F1 10.91 Tf 28.64 0 TD[(',)-292(the)-282(name)-282(of)-282(the)-282(to)-28(ol)-282(under)-282(test,)-292(to)-282(tie)-282(together)-282(the)-282(testing)-282(con\014g-)]TJ -114.63 -13.15 TD[(uration)-346(in)-346(a)-347(straigh)27(tforw)28(ard)-346(but)-346(\015exible)-346(w)26(a)28(y)84(.)-483(If)-347(there)-346(is)-346(only)-347(one)-346(testsuite)-347(for)-346(a)-346(particular)]TJ 0 -13.16 TD[(application,)-333(then)-333(`)]TJ/F4 10.91 Tf 87.27 0 TD[($tool)]TJ/F1 10.91 Tf 28.64 0 TD[(')-333(is)-333(optional.)]TJ -100.97 -16.13 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[($tool)]TJ/F1 10.91 Tf 28.64 0 TD[(')-431(is)]TJ/F8 10.91 Tf 19.78 0 TD[(not)]TJ/F1 10.91 Tf 21.07 0 TD[(used)-431(to)-432(in)27(v)28(ok)28(e)-431(the)-431(to)-28(ol,)-456(since)-432(sites)-431(that)-432(run)-431(m)27(ultiple)-431(con\014gurations)-431(of)]TJ -87.46 -13.16 TD[(a)-513(particular)-514(to)-28(ol)-514(often)-514(call)-514(eac)27(h)-513(con\014guration)-514(b)27(y)-513(a)-514(di\013eren)27(t)-513(name.)]TJ/F4 10.91 Tf 346.03 0 TD[(runtest)]TJ/F1 10.91 Tf 45.7 0 TD[(uses)-513(the)]TJ -391.73 -13.15 TD[(con\014guration-dep)-27(enden)27(t)-452(v)55(ariables)-451(captured)-453(in)-452(`)]TJ/F4 10.91 Tf 230.49 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-452(to)-452(determine)-452(ho)27(w)-452(to)-452(call)-452(eac)27(h)]TJ -276.31 -13.15 TD[(to)-27(ol.)]TJ/F4 10.91 Tf 14.94 -16.14 TD[(runtest)]TJ/F1 10.91 Tf 43.94 0 TD[(uses)-352(to)-28(ol)-352(names)-352(to)-353(\014nd)-352(directories)-352(con)26(taining)-351(tests.)]TJ/F4 10.91 Tf 251.59 0 TD[(runtest)]TJ/F1 10.91 Tf 43.93 0 TD[(scans)-352(the)-352(source)]TJ -354.4 -13.15 TD[(directory)-249(\(sp)-28(eci\014ed)-249(with)]TJ/F4 10.91 Tf 116.77 0 TD[(--srcdir)]TJ/F1 10.91 Tf 45.82 0 TD[(\))-249(for)-250(all)-249(directories)-250(whose)-249(names)-250(start)-250(with)-249(the)-250(to)-27(ol)-250(name.)]TJ -162.59 -13.15 TD[(It)-441(is)-442(a)-442(common)-442(practice)-442(to)-441(put)-442(a)-442(p)-28(erio)-28(d)-441(after)-442(the)-442(to)-28(ol)-442(part)-441(of)-442(the)-442(name.)-770(F)82(or)-440(instance,)]TJ 0 -13.15 TD[(directories)-363(that)-363(start)-363(with)-363(`)]TJ/F4 10.91 Tf 131.81 0 TD[(g++.)]TJ/F1 10.91 Tf 22.91 0 TD[(')-363(con)27(tain)]TJ/F7 10.91 Tf 45.8 0 TD[(g)]TJ/F4 10.91 Tf 7 0 TD[(++)]TJ/F1 10.91 Tf 15.41 0 TD[(tests.)-533(T)82(o)-362(add)-363(a)-363(new)-363(test,)-371(just)-363(put)-363(it)-363(in)-363(an)27(y)]TJ -222.93 -13.15 TD[(directory)-273(\(create)-273(an)-273(en)27(tirely)-272(new)-273(directory)83(,)-284(if)-273(y)26(ou)-272(wish\))-273(whose)-273(name)-273(follo)27(ws)-272(this)-273(con)27(v)28(en)27(tion.)]TJ 14.94 -16.14 TD[(A)-272(test)-273(is)-273(an)27(y)-272(\014le)-272(in)-273(an)-273(appropriately)-273(named)-272(sub)-28(directory)-273(whose)-273(name)-272(ends)-273(in)-273(`)]TJ/F4 10.91 Tf 368.75 0 TD[(.exp)]TJ/F1 10.91 Tf 22.91 0 TD[(')-272(\(the)]TJ -406.6 -13.15 TD[(con)27(v)28(en)28(tional)-346(w)27(a)27(y)-346(of)-347(naming)]TJ/F4 10.91 Tf 136.96 0 TD[(expect)]TJ/F1 10.91 Tf 38.15 0 TD[(scripts\).)-485(These)-347(simple)-347(naming)-347(con)27(v)27(en)28(tions)-346(mak)27(e)-346(it)-347(as)]TJ -175.11 -13.15 TD[(simple)-298(as)-299(p)-28(ossible)-299(to)-299(install)-299(new)-299(tests:)-427(all)-299(y)27(ou)-298(m)27(ust)-298(do)-299(is)-299(put)-299(the)-298(test)-299(in)-299(the)-299(righ)27(t)-298(directory)82(.)]TJ/F4 10.91 Tf 14.94 -16.14 TD[(runtest)]TJ/F1 10.91 Tf 44.08 0 TD[(sorts)-365(the)-365(tests)-366(in)-365(eac)27(h)-365(sub)-27(directory)-366(b)27(y)-364(name)-366(\(using)-365(the)-365(Tcl)]TJ/F4 10.91 Tf 290.06 0 TD[(lsort)]TJ/F1 10.91 Tf 32.62 0 TD[(command\))]TJ -381.7 -13.15 TD[(and)-333(runs)-333(them)-333(in)-334(the)-333(resulting)-333(order.)]TJ ET 0 g 0 G
+endstream
+endobj
+134 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F7 49 0 R
+/F8 52 0 R
+>>
+endobj
+132 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 134 0 R
+>>
+endobj
+137 0 obj
+<<
+/Length 7809
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(22)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -23.91 TD[(5.2)-562(Initialization)-375(mo)-31(dule)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(The)-389(initialization)-389(mo)-28(dule)-390(\(or)-389(\\init)-390(\014le"\))-389(has)-389(t)26(w)28(o)-388(purp)-28(oses:)-557(to)-389(pro)27(vide)-389(to)-28(ol)-389(and)-390(target)]TJ -14.94 -13.15 TD[(dep)-27(enden)27(t)-334(pro)-27(cedures,)-334(and)-334(to)-335(start)-334(up)-334(an)-334(in)27(teractiv)28(e)-333(to)-28(ol)-334(to)-334(the)-334(p)-28(oin)27(t)-333(where)-334(it)-334(is)-334(ready)-334(to)]TJ 0 -13.15 TD[(op)-27(erate.)-443(The)-328(latter)-328(includes)-328(establishing)-328(comm)26(unications)-327(with)-328(the)-328(target.)-443(All)-328(the)-328(tests)-328(for)]TJ 0 -13.15 TD[(in)27(teractiv)28(e)-250(programs)-251(assume)-250(that)-251(the)-251(to)-28(ol)-251(is)-250(already)-251(running)-251(and)-251(comm)27(unicating.)-416(Initializa-)]TJ 0 -13.15 TD[(tion)-333(mo)-28(dules)-333(for)-333(non-in)27(teractiv)27(e)-332(programs)-333(ma)26(y)-332(only)-333(need)-334(to)-333(supply)-333(the)-334(supp)-27(ort)-334(functions.)]TJ 14.94 -16.14 TD[(Eac)27(h)-357(test)-358(suite)-358(directory)-358(m)27(ust)-357(con)27(tain)-358(\(in)-358(its)-358(`)]TJ/F4 10.91 Tf 223.83 0 TD[(config)]TJ/F1 10.91 Tf 34.36 0 TD[(')-358(sub)-27(directory\))-358(a)-358(separate)-359(initial-)]TJ -273.13 -13.15 TD[(ization)-299(mo)-28(dule)-300(for)-300(eac)27(h)-299(target.)-433(The)-300(appropriate)-300(init)-299(\014le)-300(is)-300(can)-300(b)-27(e)-300(named)-300(sev)27(eral)-299(w)27(a)27(ys.)-432(The)]TJ 0 -13.15 TD[(prefered)-373(name)-374(is)-374(the)]TJ/F8 10.91 Tf 102.8 0 TD[(os)]TJ/F1 10.91 Tf 15.01 0 TD[(part)-373(of)-374(the)-374(canonical)-374(con\014guration)-374(name)-374(with)]TJ/F4 10.91 Tf 225.89 0 TD[(.exp)]TJ/F1 10.91 Tf 26.99 0 TD[(as)-373(the)-374(su\016x.)]TJ -370.69 -13.15 TD[(An)-362(example)-363(w)26(ould)-362(b)-27(e)-363(that)-363(for)-363(an)]TJ/F4 10.91 Tf 165.02 0 TD[(m68k-coff)]TJ/F1 10.91 Tf 55.51 0 TD[(system,)-370(the)]TJ/F4 10.91 Tf 58.72 0 TD[(target_os)]TJ/F1 10.91 Tf 55.51 0 TD[(part)-362(w)26(ould)-362(b)-27(e)]TJ/F4 10.91 Tf 71.3 0 TD[(coff)]TJ/F1 10.91 Tf 22.91 0 TD[(.)]TJ -428.97 -13.15 TD[(The)-303(next)-304(w)27(a)28(y)-303(is)-303(for)-304(system)-303(where)-304(there)-303(are)-304(short)-304(\014lenames,)-309(or)-304(a)-303(shortcut)-304(is)-303(desired)-304(to)-304(refer)]TJ 0 -13.15 TD[(to)-334(the)-335(OS)-334(name)-335(for)-334(that)-335(target.)-448(This)-335(is)-334(uses)-335(the)-334(v)54(alue)-333(of)]TJ/F4 10.91 Tf 274.75 0 TD[($target_abbrev)]TJ/F1 10.91 Tf 83.83 0 TD[(rather)-334(than)-335(the)]TJ/F4 10.91 Tf -358.58 -13.15 TD[(target_os)]TJ/F1 10.91 Tf 51.55 0 TD[(.)]TJ -36.61 -16.14 TD[(The)-356(\014nal)-356(\014le)-356(lo)-27(ok)26(ed)-355(for)-356(is)-356(simply)-356(`)]TJ/F4 10.91 Tf 165.83 0 TD[(default.exp)]TJ/F1 10.91 Tf 63 0 TD[('.)-512(If)-356(there)-356(is)-356(only)-356(one)-356(op)-28(erating)-356(system)]TJ -243.77 -13.15 TD[(to)-275(supp)-28(ort,)-287(then)-276(this)-276(\014le)-276(can)-275(b)-28(e)-276(used.)-425(It's)-276(main)-276(purp)-28(ose)-275(is)-276(to)-276(o\013er)-276(some)-275(supp)-28(ort)-276(for)-276(new)-276(op-)]TJ 0 -13.15 TD[(erating)-301(systems,)-308(or)-302(for)-302(unsupp)-28(orted)-301(cross)-302(targets.)-434(The)-302(last)-301(\014le)-302(lo)-28(ok)27(ed)-301(for)-302(is)-301(`)]TJ/F4 10.91 Tf 362.94 0 TD[(unknown.exp)]TJ/F1 10.91 Tf 63 0 TD[('.)]TJ -425.94 -13.15 TD[(This)-428(is)-429(usually)-428(limited)-429(to)-428(error)-429(handling)-428(for)-429(unsupp)-27(orted)-429(targets.)-730(It's)-428(whole)-429(con)27(ten)28(ts)-428(is)]TJ 0 -13.15 TD[(t)27(ypically)84(.)]TJ/F9 9.96 Tf 0 -9.45 TD[(\013)]TJ ET 23.98 -258.91 m 450.40 -258.91 l 450.40 -258.51 l 23.98 -258.51 l b BT 456.38 -258.91 TD[(\010)]TJ ET 18.00 -292.72 m 18.40 -292.72 l 18.40 -264.64 l 18.00 -264.64 l b BT/F4 10.91 Tf 21.39 -277.28 TD[(perror)-524("Sorry,)-525(there)-525(is)-525(no)-525(support)-525(for)-525(this)-525(target")]TJ 0 -12.45 TD[(exit)-524(1)]TJ ET 456.38 -292.72 m 456.77 -292.72 l 456.77 -264.64 l 456.38 -264.64 l b BT/F9 9.96 Tf 18 -298.95 TD[(\012)]TJ ET 23.98 -298.95 m 450.40 -298.95 l 450.40 -298.55 l 23.98 -298.55 l b BT 456.38 -298.95 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.39 TD[(A)27(t)-376(the)-377(b)-28(eginning)-377(of)-377(the)-377(init)-377(\014le,)-389(y)27(ou)-376(m)27(ust)-376(\014rst)-378(determine)-377(the)-377(prop)-28(er)-377(executable)-377(name)]TJ -14.94 -13.15 TD[(of)-340(the)-340(to)-28(ol)-340(to)-341(execute,)-342(since)-340(the)-340(actual)-341(name)-340(of)-340(the)-341(to)-27(ol)-341(to)-340(b)-28(e)-340(tested)-341(m)27(y)-339(v)54(ary)-339(from)-340(system)]TJ 0 -13.15 TD[(to)-333(system.)-444(Here's)-334(an)-333(example)-333(for)-334(the)]TJ/F7 10.91 Tf 180.24 0 TD[(GNU)]TJ/F1 10.91 Tf 30.68 0 TD[(C)-333(compiler.)]TJ/F9 9.96 Tf -210.92 -9.44 TD[(\013)]TJ ET 23.98 -352.08 m 450.40 -352.08 l 450.40 -351.69 l 23.98 -351.69 l b BT 456.38 -352.08 TD[(\010)]TJ ET 18.00 -523.79 m 18.40 -523.79 l 18.40 -357.81 l 18.00 -357.81 l b BT/F4 10.91 Tf 21.39 -370.46 TD[(global)-524(AR)]TJ 0 -12.45 TD[(#)-524(look)-525(for)-525(the)-525(archiver)-525(ar)]TJ 0 -12.45 TD[(if)-524(![info)-525(exists)-525(AR])-525({)]TJ 22.91 -12.46 TD[(set)-524(AR)-525([findfile)-525($base_dir/../../binutils/ar)-525($base_dir/../../binutils/ar)-525([tr)]TJ -22.91 -12.45 TD[(ansform)-524(ar]])]TJ 22.91 -12.45 TD[(verbose)-524("AR)-525(defaulting)-525(to)-525($AR")-525(2)]TJ -22.91 -12.46 TD[(})]TJ 0 -12.45 TD[(})]TJ 0 -24.91 TD[(global)-524(CFLAGS)]TJ 0 -12.45 TD[(if)-524(![info)-525(exists)-525(CFLAGS])-525(then)-525({)]TJ 22.91 -12.45 TD[(set)-524(CFLAGS)-525("")]TJ -22.91 -12.46 TD[(})]TJ ET 456.38 -523.79 m 456.77 -523.79 l 456.77 -357.81 l 456.38 -357.81 l b BT/F9 9.96 Tf 18 -530.02 TD[(\012)]TJ ET 23.98 -530.02 m 450.40 -530.02 l 450.40 -529.62 l 23.98 -529.62 l b BT 456.38 -530.02 TD[(\011)]TJ/F1 10.91 Tf -423.44 -17.39 TD[(It)-330(is)-331(alw)27(a)28(ys)-330(a)-331(go)-27(o)-28(d)-331(idea)-330(to)-331(\014rst)-331(c)27(hec)28(k)-330(the)-330(v)54(ariable,)-330(and)-331(only)-330(set)-331(it)-331(if)-330(it)-331(has)-331(not)-330(y)27(et)-330(b)-28(een)]TJ -14.94 -13.15 TD[(de\014ned.)-444(Often)-333(the)-334(prop)-27(er)-334(v)55(alue)-333(of)]TJ/F4 10.91 Tf 166.73 0 TD[(AR)]TJ/F1 10.91 Tf 15.09 0 TD[(is)-333(set)-333(on)-333(the)-334(command)-333(line)-333(that)-334(in)27(v)28(ok)28(es)-333(`)]TJ/F4 10.91 Tf 196.85 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[('.)]TJ -403.82 -16.14 TD[(The)]TJ/F4 10.91 Tf 22.14 0 TD[(findfile)]TJ/F1 10.91 Tf 49.18 0 TD[(pro)-27(cedure)-308(tak)27(es)-306(as)-308(it's)-307(\014rst)-307(argumen)27(t)-307(a)-307(\014le)-307(name)-308(to)-307(lo)-28(ok)-307(for.)-436(The)-307(second)]TJ -86.26 -13.15 TD[(argumen)27(t)-293(is)-295(returned)-294(if)-295(the)-294(\014le)-295(is)-294(found,)-302(and)-295(the)-294(third)-295(argumen)27(t)-293(is)-295(returned)-294(if)-295(the)-294(\014le)-295(is)-294(not)]TJ 0 -13.15 TD[(found.)]TJ/F4 10.91 Tf 34.85 0 TD[(base_dir)]TJ/F1 10.91 Tf 49.45 0 TD[(is)-333(set)-333(in)27(ternally)-333(b)27(y)-332(DejaGn)27(u)-333(to)-333(the)-333(top)-334(lev)27(el)-332(directory)-334(of)-333(the)-333(ob)-56(ject)-333(tree.)]TJ -69.36 -16.14 TD[(The)]TJ/F4 10.91 Tf 23.9 0 TD[(transform)]TJ/F1 10.91 Tf 56.65 0 TD[(pro)-27(cedure)-468(tak)26(es)-467(as)-468(its)-468(argumen)27(t)-467(the)-468(nativ)27(e)-467(name)-468(of)-468(a)-468(to)-28(ol)-468(\(suc)27(h)-467(as)]TJ -95.49 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(gcc)]TJ/F1 10.91 Tf 17.18 0 TD[(')-434(for)-435(the)-435(compiler\),)-460(and)-435(returns)-435(the)-434(name)-435(as)-435(con\014gured)-435(for)-435(that)-434(to)-28(ol)-435(in)-435(the)-434(curren)26(t)]TJ ET 0 g 0 G
+endstream
+endobj
+138 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F8 52 0 R
+/F9 59 0 R
+/F7 49 0 R
+>>
+endobj
+136 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 138 0 R
+>>
+endobj
+141 0 obj
+<<
+/Length 8761
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(23)]TJ 0 -23.91 TD[(installation.)-440(\(F)83(or)-320(example,)-323(a)-321(cross-compiling)-321(v)27(ersion)-320(of)]TJ/F7 10.91 Tf 265.1 0 TD[(gnu)]TJ/F1 10.91 Tf 23.87 0 TD[(CC)-320(that)-321(generates)-321(MIPS)-321(co)-27(de)]TJ -288.97 -13.15 TD[(ma)27(y)-332(b)-28(e)-333(installed)-333(with)-334(a)-333(name)-333(lik)26(e)]TJ/F4 10.91 Tf 165.21 0 TD[(mips-idt-ecoff-gcc)]TJ/F1 10.91 Tf 103.09 0 TD[(.\))]TJ -253.36 -16.14 TD[(In)-372(a)-373(test)-373(running)-372(nativ)27(e,)-382(writing)-373(the)-372(Tcl)-373(co)-28(de)-372(for)-373(initialization)-373(is)-372(usually)-373(quite)-373(simple.)]TJ -14.94 -13.15 TD[(F)83(or)-238(cross)-238(con\014gurations,)-258(ho)27(w)28(ev)28(er,)-257(more)-238(elab)-28(orate)-238(instructions)-239(are)-238(usually)-239(needed)-238(to)-239(describ)-27(e)]TJ 0 -13.15 TD[(ho)27(w)-332(to)-333(talk)-334(to)-333(a)-333(remote)-334(target.)]TJ 14.94 -16.14 TD[(Eac)27(h)-333(initialization)-335(mo)-27(dule)-335(de\014nes)-334(up)-335(to)-334(four)-335(pro)-27(cedures)-335(with)-334(standard)-335(names)-334(and)-335(pur-)]TJ -14.94 -13.15 TD[(p)-27(oses.)-641(The)-399(names)-399(of)-399(these)-399(pro)-28(cedures)-399(b)-28(egin)-398(with)-399(`)]TJ/F4 10.91 Tf 248.73 0 TD[($tool)]TJ/F1 10.91 Tf 28.64 0 TD[(',)-415(the)-399(string)-399(that)-399(iden)27(ti\014es)-398(tests)]TJ -277.37 -13.15 TD[(for)-422(a)-423(particular)-423(to)-28(ol:)]TJ/F4 10.91 Tf 107.4 0 TD[($tool_start)]TJ/F1 10.91 Tf 63 0 TD[(,)]TJ/F4 10.91 Tf 7.89 0 TD[($tool_load)]TJ/F1 10.91 Tf 57.27 0 TD[(,)]TJ/F4 10.91 Tf 7.89 0 TD[($tool_exit)]TJ/F1 10.91 Tf 57.27 0 TD[(,)-445(and)]TJ/F4 10.91 Tf 30.08 0 TD[($tool_version)]TJ/F1 10.91 Tf 74.45 0 TD[(.)-713(F)83(or)]TJ -405.25 -13.16 TD[(example,)-306(the)-299(start)-300(pro)-28(cedure)-299(for)]TJ/F7 10.91 Tf 156.29 0 TD[(gdb)]TJ/F1 10.91 Tf 23.41 0 TD[(is)-299(called)]TJ/F4 10.91 Tf 41.14 0 TD[(gdb_start)]TJ/F1 10.91 Tf 51.54 0 TD[(.)-433(\(Since)-299(start)-300(pro)-28(cedures)-299(are)-300(used)]TJ -272.38 -13.15 TD[(di\013eren)27(tly)-305(for)-307(batc)27(h)-305(and)-307(in)27(teractiv)28(e)-306(to)-27(ols,)-312(ho)27(w)27(ev)28(er,)]TJ/F4 10.91 Tf 245.82 0 TD[(runtest)]TJ/F1 10.91 Tf 43.44 0 TD[(itself)-306(nev)27(er)-306(calls)-306(the)-306(start)-307(pro-)]TJ -289.26 -13.15 TD[(cedure.)-444(Init)-333(\014les)-334(for)-333(in)27(teractiv)28(e)-333(to)-27(ols)-334(are)-333(exp)-28(ected)-333(to)-334(end)-333(b)27(y)-332(running)-334(the)-333(start)-333(pro)-28(cedure.\))]TJ 14.94 -16.14 TD[(The)-411(initialization)-412(mo)-28(dule)-411(is)-412(also)-412(a)-411(go)-28(o)-28(d)-412(place)-411(to)-412(call)]TJ/F4 10.91 Tf 262.91 0 TD[(load_lib)]TJ/F1 10.91 Tf 50.31 0 TD[(to)-411(get)-412(an)27(y)-411(collections)]TJ -328.16 -13.15 TD[(of)-362(utilit)27(y)-361(pro)-28(cedures)-362(mean)26(t)-361(for)-362(a)-363(family)-362(of)-362(test)-363(cases,)-369(and)-362(to)-363(set)-362(up)-362(default)-363(v)55(alues)-361(for)-363(an)27(y)]TJ 0 -13.15 TD[(additional)-333(Tcl)-333(v)54(ariables)-332(needed)-333(for)-334(a)-333(sp)-28(eci\014c)-333(set)-333(of)-334(tests.)]TJ 14.94 -16.14 TD[(See)-439(Section)-440(5.4)-440([T)82(arget)-439(dep)-28(enden)27(t)-439(pro)-28(cedures],)-466(page)-440(31,)-467(for)-440(full)-440(descriptions)-440(of)-440(these)]TJ -14.94 -13.15 TD[(pro)-27(cedures.)]TJ/F2 14.35 Tf 0 -30.88 TD[(5.3)-562(DejaGn)30(u)-374(pro)-31(cedures)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(DejaGn)27(u)-430(pro)27(vides)-430(these)-431(Tcl)-431(pro)-28(cedures)-431(for)-430(use)-431(in)-431(test)-431(scripts.)-738(Y)83(ou)-430(can)-431(also)-431(use)-431(an)27(y)]TJ -14.94 -13.15 TD[(standard)]TJ/F4 10.91 Tf 45.54 0 TD[(expect)]TJ/F1 10.91 Tf 37.99 0 TD[(or)-332(Tcl)-332(function.)-445(These)-332(pro)-28(cedures)-332(are)-333(stored)-332(in)-333(libraries,)-332(whic)26(h)-331(DejaGn)27(u)]TJ -83.53 -13.15 TD[(loads)-343(at)-343(run)27(time.)-473(Here's)-343(explanation)-343(of)-343(the)-343(library)-344(pro)-27(cedures)-344(that)-343(get)-343(loaded)-343(at)-343(run)27(time.)]TJ 0 -13.15 TD[(All)-333(other)-333(librarys)-333(are)-334(optional,)-333(and)-333(need)-334(to)-333(b)-28(e)-333(loaded)-334(b)27(y)-332(the)-333(testsuite.)]TJ/F2 13.09 Tf 0 -26.9 TD[(5.3.1)-562(Core)-375(In)30(ternal)-374(Pro)-31(cedures)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(See)-333(Section)-334(2.4)-333([A)-334(POSIX)-333(conforming)-334(test)-333(framew)27(ork],)-333(page)-333(6,)-334(for)-333(more)-334(detailed)-333(expla-)]TJ -14.94 -13.15 TD[(nations)-333(of)-333(the)-333(test)-334(outcomes)-333(\(`)]TJ/F4 10.91 Tf 145.94 0 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(PASS)]TJ/F1 10.91 Tf 22.9 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(UNTESTED)]TJ/F1 10.91 Tf 45.82 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.27 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(UNSUPPORTED)]TJ/F1 10.91 Tf 63 0 TD[('\).)]TJ/F4 10.91 Tf -408.76 -22.12 TD[(perror)-333(")]TJ/F5 10.91 Tf 43.73 0 TD[(string)-418(n)26(um)28(b)-27(er)]TJ/F4 10.91 Tf 68.81 0 TD[(")]TJ/F1 10.91 Tf -54.94 -13.15 TD[(Declares)-299(a)-299(sev)27(ere)-298(error)-299(in)-299(the)-300(testing)-299(framew)27(ork)-298(itself.)]TJ/F4 10.91 Tf 260.23 0 TD[(perror)]TJ/F1 10.91 Tf 37.62 0 TD[(writes)-299(in)-299(the)-299(log)]TJ -297.85 -13.15 TD[(\014les)-356(a)-356(message)-357(b)-28(eginning)-356(with)-356(`)]TJ/F4 10.91 Tf 152.05 0 TD[(ERROR)]TJ/F1 10.91 Tf 28.63 0 TD[(',)-362(app)-27(ending)-357(the)-356(argumen)26(t)]TJ/F5 10.91 Tf 131.41 0 TD[(string)]TJ/F1 10.91 Tf 27.36 0 TD[(.)-513(If)-357(the)]TJ -339.45 -13.15 TD[(optional)]TJ/F5 10.91 Tf 41.92 0 TD[(n)27(um)28(b)-27(er)]TJ/F1 10.91 Tf 40.01 0 TD[(is)-287(supplied,)-296(then)-287(this)-287(is)-287(used)-287(to)-287(set)-288(the)-287(in)27(ternal)-286(coun)27(t)-286(of)-287(errors)]TJ -81.93 -13.15 TD[(to)-333(that)-333(v)54(alue.)]TJ 0 -16.14 TD[(As)-347(a)-348(side)-348(e\013ect,)]TJ/F4 10.91 Tf 79.59 0 TD[(perror)]TJ/F1 10.91 Tf 38.16 0 TD[(also)-347(c)26(hanges)-347(the)-348(e\013ect)-347(of)-348(the)-348(next)]TJ/F4 10.91 Tf 166.69 0 TD[(pass)]TJ/F1 10.91 Tf 26.7 0 TD[(or)]TJ/F4 10.91 Tf 13.53 0 TD[(fail)]TJ/F1 10.91 Tf 26.7 0 TD[(com-)]TJ -351.37 -13.15 TD[(mand:)-559(the)-390(test)-391(outcome)-391(b)-27(ecomes)-391(`)]TJ/F4 10.91 Tf 168.42 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.27 0 TD[(',)-405(since)-390(an)-391(automatic)-391(`)]TJ/F4 10.91 Tf 108.78 0 TD[(PASS)]TJ/F1 10.91 Tf 22.91 0 TD[(')-390(or)]TJ -357.38 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(')-356(cannot)-357(b)-28(e)-357(trusted)-356(after)-357(a)-357(sev)27(ere)-356(error)-357(in)-357(the)-357(test)-356(framew)26(ork.)-513(If)-357(the)-357(op-)]TJ -25.94 -13.15 TD[(tional)-339(n)26(umeric)-338(v)54(alue)-339(is)-339(`)]TJ/F4 10.91 Tf 114.92 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(',)-341(then)-340(there)-340(are)-339(no)-340(further)-340(side)-340(e\013ects)-340(to)-339(calling)-340(this)]TJ -120.65 -13.15 TD[(function,)-416(and)-400(the)-400(follo)27(wing)-399(test)-399(outcome)-400(do)-28(esn't)-400(b)-28(ecome)-399(`)]TJ/F4 10.91 Tf 282.77 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.27 0 TD[('.)-643(This)]TJ -340.04 -13.15 TD[(can)-333(b)-28(e)-333(used)-333(for)-334(errors)-333(with)-333(no)-334(kno)27(wn)-332(side)-333(e\013ects.)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(warning)-333(")]TJ/F5 10.91 Tf 49.45 0 TD[(string)-418(n)26(um)28(b)-27(er)]TJ/F4 10.91 Tf 68.81 0 TD[(")]TJ/F1 10.91 Tf -60.66 -13.15 TD[(Declares)-287(detection)-288(of)-288(a)-287(minor)-288(error)-288(in)-288(the)-287(test)-288(case)-288(itself.)]TJ/F4 10.91 Tf 272.07 0 TD[(warning)]TJ/F1 10.91 Tf 43.23 0 TD[(writes)-287(in)-288(the)]TJ -315.3 -13.15 TD[(log)-379(\014les)-380(a)-380(message)-380(b)-28(eginning)-380(with)-380(`)]TJ/F4 10.91 Tf 171.42 0 TD[(WARNING)]TJ/F1 10.91 Tf 40.09 0 TD[(',)-391(app)-28(ending)-380(the)-380(argumen)27(t)]TJ/F5 10.91 Tf 132.5 0 TD[(string)]TJ/F1 10.91 Tf 27.36 0 TD[(.)]TJ -371.37 -13.15 TD[(Use)]TJ/F4 10.91 Tf 22.19 0 TD[(warning)]TJ/F1 10.91 Tf 44.95 0 TD[(rather)-445(than)]TJ/F4 10.91 Tf 60.68 0 TD[(error)]TJ/F1 10.91 Tf 33.5 0 TD[(for)-445(cases)-445(\(suc)27(h)-444(as)-446(comm)27(unication)-444(failure)-445(to)]TJ -161.32 -13.15 TD[(b)-27(e)-489(follo)27(w)28(ed)-487(b)27(y)-488(a)-488(retry\))-488(where)-488(the)-489(test)-488(case)-488(can)-488(reco)27(v)27(er)-487(from)-488(the)-488(error.)-909(If)]TJ 0 -13.15 TD[(the)-367(optional)]TJ/F5 10.91 Tf 61.96 0 TD[(n)27(um)28(b)-27(er)]TJ/F1 10.91 Tf 40.88 0 TD[(is)-367(supplied,)-376(then)-368(this)-367(is)-368(used)-367(to)-368(set)-367(the)-368(in)27(ternal)-366(coun)26(t)-366(of)]TJ -102.84 -13.15 TD[(w)27(arnings)-332(to)-333(that)-334(v)55(alue.)]TJ ET 0 g 0 G
+endstream
+endobj
+142 0 obj
+<<
+/F1 9 0 R
+/F7 49 0 R
+/F4 28 0 R
+/F2 12 0 R
+/F5 31 0 R
+>>
+endobj
+140 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 142 0 R
+>>
+endobj
+145 0 obj
+<<
+/Length 8738
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(24)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 57.6 -23.91 TD[(As)-351(a)-352(side)-351(e\013ect,)]TJ/F4 10.91 Tf 79.76 0 TD[(warning_threshold)]TJ/F1 10.91 Tf 101.2 0 TD[(or)-351(more)-352(calls)-351(to)]TJ/F4 10.91 Tf 79.1 0 TD[(warning)]TJ/F1 10.91 Tf 43.92 0 TD[(in)-351(a)-352(single)-351(test)]TJ -303.98 -13.15 TD[(case)-369(also)-369(c)27(hanges)-369(the)-369(e\013ect)-369(of)-370(the)-369(next)]TJ/F4 10.91 Tf 191.81 0 TD[(pass)]TJ/F1 10.91 Tf 26.93 0 TD[(or)]TJ/F4 10.91 Tf 13.76 0 TD[(fail)]TJ/F1 10.91 Tf 26.94 0 TD[(command:)-516(the)-369(test)-369(out-)]TJ -259.44 -13.15 TD[(come)-416(b)-27(ecomes)-417(`)]TJ/F4 10.91 Tf 76.11 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.27 0 TD[(')-416(since)-416(an)-416(automatic)-416(`)]TJ/F4 10.91 Tf 106.71 0 TD[(PASS)]TJ/F1 10.91 Tf 22.91 0 TD[(')-416(or)-416(`)]TJ/F4 10.91 Tf 24.87 0 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(')-416(ma)27(y)-415(not)-416(b)-28(e)]TJ -310.78 -13.15 TD[(trust)27(w)28(orth)28(y)-449(after)-450(man)27(y)-449(w)27(arnings.)-792(If)-450(the)-450(optional)-450(n)27(umeric)-449(v)55(alue)-449(is)-449(`)]TJ/F4 10.91 Tf 336.18 0 TD[(0)]TJ/F1 10.91 Tf 5.72 0 TD[(',)-478(then)]TJ -341.9 -13.16 TD[(there)-352(are)-353(no)-353(further)-353(side)-353(e\013ects)-353(to)-353(calling)-352(this)-353(function,)-358(and)-353(the)-353(follo)27(wing)-352(test)]TJ 0 -13.15 TD[(outcome)-430(do)-27(esn't)-431(b)-27(ecome)-431(`)]TJ/F4 10.91 Tf 126.87 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.27 0 TD[('.)-734(This)-431(can)-430(b)-28(e)-430(used)-430(for)-430(errors)-430(with)-430(no)]TJ -184.14 -13.15 TD[(kno)27(wn)-332(side)-333(e\013ects.)]TJ/F4 10.91 Tf -57.6 -21.87 TD[(note)-333(")]TJ/F5 10.91 Tf 32.27 0 TD[(string)]TJ/F4 10.91 Tf 28.3 0 TD[(")]TJ/F1 10.91 Tf -2.97 -13.15 TD[(App)-27(ends)-374(an)-373(informational)-374(message)-373(to)-374(the)-374(log)-373(\014le.)]TJ/F4 10.91 Tf 246.12 0 TD[(note)]TJ/F1 10.91 Tf 26.98 0 TD[(writes)-373(in)-374(the)-373(log)-374(\014les)]TJ -273.1 -13.15 TD[(a)-431(message)-432(b)-27(eginning)-432(with)-432(`)]TJ/F4 10.91 Tf 133.2 0 TD[(NOTE)]TJ/F1 10.91 Tf 22.9 0 TD[(',)-456(app)-27(ending)-432(the)-432(argumen)27(t)]TJ/F5 10.91 Tf 134.89 0 TD[(string)]TJ/F1 10.91 Tf 27.37 0 TD[(.)-739(Use)]TJ/F4 10.91 Tf 33.13 0 TD[(note)]TJ/F1 10.91 Tf -351.49 -13.15 TD[(sparingly)83(.)]TJ/F4 10.91 Tf 50.52 0 TD[(verbose)]TJ/F1 10.91 Tf 43.76 0 TD[(should)-337(b)-27(e)-337(used)-338(for)-337(most)-337(suc)27(h)-336(messages,)-338(but)-337(in)-337(cases)-337(where)]TJ -94.28 -13.15 TD[(a)-333(message)-333(is)-333(needed)-334(in)-333(the)-333(log)-334(\014le)-333(regardless)-333(of)-334(the)-333(v)27(erb)-27(osit)27(y)-333(lev)27(el)-332(use)]TJ/F4 10.91 Tf 337.49 0 TD[(note)]TJ/F1 10.91 Tf 22.9 0 TD[(.)]TJ/F4 10.91 Tf -417.99 -21.88 TD[(pass)-333(")]TJ/F5 10.91 Tf 32.27 0 TD[(string)]TJ/F4 10.91 Tf 28.3 0 TD[(")]TJ/F1 10.91 Tf -2.97 -13.15 TD[(Declares)-305(a)-305(test)-306(to)-305(ha)26(v)28(e)-304(passed.)]TJ/F4 10.91 Tf 149.71 0 TD[(pass)]TJ/F1 10.91 Tf 26.24 0 TD[(writes)-305(in)-305(the)-306(log)-305(\014les)-306(a)-305(message)-306(b)-27(eginning)]TJ -175.95 -13.15 TD[(with)-295(`)]TJ/F4 10.91 Tf 27.47 0 TD[(PASS)]TJ/F1 10.91 Tf 22.91 0 TD[(')-295(\(or)]TJ/F4 10.91 Tf 23.45 0 TD[(XPASS)]TJ/F1 10.91 Tf 28.63 0 TD[(,)-303(if)-295(failure)-296(w)27(as)-295(exp)-28(ected\),)-303(app)-28(ending)-295(the)-296(argumen)27(t)]TJ/F5 10.91 Tf 241.55 0 TD[(string)]TJ/F1 10.91 Tf 27.36 0 TD[(.)]TJ/F4 10.91 Tf -428.97 -21.87 TD[(fail)-333(")]TJ/F5 10.91 Tf 32.27 0 TD[(string)]TJ/F4 10.91 Tf 28.3 0 TD[(")]TJ/F1 10.91 Tf -2.97 -13.15 TD[(Declares)-340(a)-340(test)-340(to)-341(ha)27(v)28(e)-339(failed.)]TJ/F4 10.91 Tf 146.67 0 TD[(fail)]TJ/F1 10.91 Tf 26.62 0 TD[(writes)-340(in)-340(the)-340(log)-341(\014les)-340(a)-340(message)-341(b)-27(eginning)]TJ -173.29 -13.15 TD[(with)-295(`)]TJ/F4 10.91 Tf 27.47 0 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(')-295(\(or)]TJ/F4 10.91 Tf 23.45 0 TD[(XFAIL)]TJ/F1 10.91 Tf 28.63 0 TD[(,)-303(if)-295(failure)-296(w)27(as)-295(exp)-28(ected\),)-303(app)-28(ending)-295(the)-296(argumen)27(t)]TJ/F5 10.91 Tf 241.55 0 TD[(string)]TJ/F1 10.91 Tf 27.36 0 TD[(.)]TJ/F4 10.91 Tf -428.97 -21.88 TD[(unresolved)-333(")]TJ/F5 10.91 Tf 66.64 0 TD[(string)]TJ/F4 10.91 Tf 28.29 0 TD[(")]TJ/F1 10.91 Tf -37.33 -13.15 TD[(Declares)-374(a)-375(test)-375(to)-375(ha)27(v)28(e)-374(an)-375(unresolv)27(ed)-374(outcome.)]TJ/F4 10.91 Tf 234.01 0 TD[(unresolved)]TJ/F1 10.91 Tf 61.37 0 TD[(writes)-374(in)-375(the)-375(log)]TJ -295.38 -13.15 TD[(\014le)-431(a)-432(message)-431(b)-28(eginning)-432(with)-431(`)]TJ/F4 10.91 Tf 151.84 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.28 0 TD[(',)-456(app)-27(ending)-432(the)-432(argumen)27(t)]TJ/F5 10.91 Tf 134.89 0 TD[(string)]TJ/F1 10.91 Tf 27.36 0 TD[(.)]TJ -371.37 -13.15 TD[(This)-384(usually)-385(means)-385(the)-384(test)-385(did)-385(not)-385(execute)-384(as)-385(exp)-28(ected,)-397(and)-385(a)-385(h)27(uman)-384(b)-28(eing)]TJ 0 -13.15 TD[(m)27(ust)-304(go)-305(o)27(v)27(er)-304(results)-305(to)-305(determine)-305(if)-306(it)-305(passed)-305(or)-305(failed)-306(\(and)-305(to)-305(impro)27(v)28(e)-305(the)-305(test)]TJ 0 -13.15 TD[(case\).)]TJ/F4 10.91 Tf -57.6 -21.87 TD[(untested)-333(")]TJ/F5 10.91 Tf 55.18 0 TD[(string)]TJ/F4 10.91 Tf 28.3 0 TD[(")]TJ/F1 10.91 Tf -25.88 -13.15 TD[(Declares)-265(a)-265(test)-265(w)27(as)-265(not)-265(run.)]TJ/F4 10.91 Tf 134.62 0 TD[(untested)]TJ/F1 10.91 Tf 48.71 0 TD[(writes)-265(in)-265(the)-265(log)-265(\014le)-266(a)-265(message)-265(b)-28(eginning)]TJ -183.33 -13.15 TD[(with)-353(`)]TJ/F4 10.91 Tf 28.1 0 TD[(UNTESTED)]TJ/F1 10.91 Tf 45.82 0 TD[(',)-358(app)-28(ending)-354(the)-353(argumen)27(t)]TJ/F5 10.91 Tf 131.27 0 TD[(string)]TJ/F1 10.91 Tf 27.36 0 TD[(.)-505(F)83(or)-353(example,)-359(y)27(ou)-352(migh)26(t)-352(use)]TJ -232.55 -13.16 TD[(this)-318(in)-318(a)-318(dumm)26(y)-317(test)-318(whose)-319(only)-318(role)-318(is)-319(to)-318(record)-318(that)-319(a)-318(test)-318(do)-28(es)-318(not)-319(y)27(et)-317(exist)]TJ 0 -13.15 TD[(for)-333(some)-333(feature.)]TJ/F4 10.91 Tf -57.6 -21.87 TD[(unsupported)-333(")]TJ/F5 10.91 Tf 72.36 0 TD[(string)]TJ/F4 10.91 Tf 28.3 0 TD[(")]TJ/F1 10.91 Tf -43.06 -13.15 TD[(Declares)-409(that)-410(a)-410(test)-410(case)-409(dep)-28(ends)-410(on)-410(some)-409(facilit)26(y)-408(that)-410(do)-28(es)-410(not)-409(exist)-410(in)-410(the)]TJ 0 -13.15 TD[(testing)-399(en)27(vironmen)27(t.)]TJ/F4 10.91 Tf 105.71 0 TD[(unsupported)]TJ/F1 10.91 Tf 67.36 0 TD[(writes)-399(in)-400(the)-399(log)-400(\014le)-399(a)-400(message)-400(b)-27(eginning)]TJ -173.07 -13.15 TD[(with)-333(`)]TJ/F4 10.91 Tf 27.88 0 TD[(UNSUPPORTED)]TJ/F1 10.91 Tf 63 0 TD[(',)-333(app)-28(ending)-333(the)-333(argumen)27(t)]TJ/F5 10.91 Tf 130.33 0 TD[(string)]TJ/F1 10.91 Tf 27.37 0 TD[(.)]TJ/F4 10.91 Tf -306.18 -21.88 TD[(get_warning_threshold)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(Returns)-333(the)-333(curren)27(t)-333(v)55(alue)-332(of)]TJ/F4 10.91 Tf 138.79 0 TD[(warning_threshold)]TJ/F1 10.91 Tf 97.36 0 TD[(.)-444(The)-333(default)-334(v)55(alue)-332(is)-334(3.)]TJ/F4 10.91 Tf -293.75 -21.87 TD[(set_warning_threshold)]TJ/F5 10.91 Tf 123.91 0 TD[(threshold)]TJ/F1 10.91 Tf -66.31 -13.15 TD[(Sets)-265(the)-266(v)54(alue)-264(of)]TJ/F4 10.91 Tf 79.54 0 TD[(warning_threshold)]TJ/F1 10.91 Tf 97.36 0 TD[(.)-421(A)-266(v)54(alue)-264(of)]TJ/F4 10.91 Tf 57.85 0 TD[(0)]TJ/F1 10.91 Tf 8.62 0 TD[(disables)-265(it:)-411(calls)-266(to)]TJ/F4 10.91 Tf 90.94 0 TD[(warning)]TJ/F1 10.91 Tf -334.31 -13.15 TD[(will)-333(not)-333(turn)-333(a)-334(`)]TJ/F4 10.91 Tf 76.39 0 TD[(PASS)]TJ/F1 10.91 Tf 22.91 0 TD[(')-333(or)-333(`)]TJ/F4 10.91 Tf 23.06 0 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(')-333(in)27(to)-332(an)-334(`)]TJ/F4 10.91 Tf 46.97 0 TD[(UNRESOLVED)]TJ/F1 10.91 Tf 57.27 0 TD[('.)]TJ/F4 10.91 Tf -307.11 -21.87 TD[(transform)-333(")]TJ/F5 10.91 Tf 60.91 0 TD[(to)-27(olname)]TJ/F4 10.91 Tf 44.55 0 TD[(")]TJ/F1 10.91 Tf -47.86 -13.15 TD[(Generates)-416(a)-416(string)-417(for)-416(the)-417(name)-416(of)-416(a)-417(to)-28(ol)-416(as)-416(it)-417(w)27(as)-415(con\014gured)-417(and)-416(installed,)]TJ 0 -13.16 TD[(giv)27(en)-300(its)-302(nativ)27(e)-301(name)-301(\(as)-302(the)-302(argumen)27(t)]TJ/F5 10.91 Tf 188.34 0 TD[(to)-27(olname)]TJ/F1 10.91 Tf 44.55 0 TD[(\).)-433(This)-302(mak)27(es)-301(the)-301(assumption)]TJ -232.89 -13.15 TD[(that)-528(all)-529(to)-27(ols)-529(are)-528(installed)-529(using)-528(the)-529(same)-528(naming)-529(con)27(v)28(en)27(tions:)-833(it)-529(extrap-)]TJ 0 -13.15 TD[(olates)-568(from)-569(the)-568(in)26(v)28(o)-27(cation)-568(name)-569(for)-568(`)]TJ/F4 10.91 Tf 192.49 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[('.)-1150(F)83(or)-568(example,)-627(if)-569(y)27(ou)-568(call)]TJ ET 0 g 0 G
+endstream
+endobj
+146 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+144 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 146 0 R
+>>
+endobj
+149 0 obj
+<<
+/Length 8937
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(25)]TJ/F4 10.91 Tf 57.6 -23.91 TD[(runtest)]TJ/F1 10.91 Tf 46.52 0 TD[(as)-589(`)]TJ/F4 10.91 Tf 19.23 0 TD[(m68k-vxworks-runtest)]TJ/F1 10.91 Tf 114.54 0 TD[(',)-653(the)-590(result)-590(of)-590(`)]TJ/F4 10.91 Tf 89.86 0 TD[(transform)-333("gcc")]TJ/F1 10.91 Tf 87.45 0 TD[(')-589(is)]TJ -357.6 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(m68k-vxworks-gcc)]TJ/F1 10.91 Tf 91.64 0 TD[('.)]TJ/F4 10.91 Tf -152.27 -22.12 TD[(ishost)-333(")]TJ/F5 10.91 Tf 43.73 0 TD[(host)]TJ/F4 10.91 Tf 20.29 0 TD[(")]TJ/F1 10.91 Tf -6.42 -13.15 TD[(T)83(ests)-223(for)-223(a)-224(particular)]TJ/F8 10.91 Tf 99.66 0 TD[(host)]TJ/F1 10.91 Tf 22.71 0 TD[(en)27(vironmen)28(t.)-407(If)-223(the)-224(curren)27(tly)-222(con\014gured)-224(host)-223(matc)27(hes)]TJ -122.37 -13.15 TD[(the)-367(argumen)27(t)-367(string,)-376(the)-367(result)-368(is)]TJ/F4 10.91 Tf 164.12 0 TD[(1)]TJ/F1 10.91 Tf 5.73 0 TD[(;)-384(otherwise)-368(the)-367(result)-368(is)]TJ/F4 10.91 Tf 117.44 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(.)]TJ/F5 10.91 Tf 8.99 0 TD[(host)]TJ/F1 10.91 Tf 24.31 0 TD[(m)27(ust)-366(b)-28(e)-368(a)]TJ -326.32 -13.15 TD[(full)-268(three-part)]TJ/F4 10.91 Tf 69.25 0 TD[(configure)]TJ/F1 10.91 Tf 54.48 0 TD[(host)-268(name;)-290(in)-269(particular,)-281(y)27(ou)-268(ma)27(y)-267(not)-269(use)-268(the)-269(shorter)]TJ -123.73 -13.15 TD[(nic)27(knames)-258(supp)-28(orted)-260(b)27(y)]TJ/F4 10.91 Tf 116.83 0 TD[(configure)]TJ/F1 10.91 Tf 54.38 0 TD[(\(but)-259(y)27(ou)-259(can)-260(use)-259(wildcard)-260(c)27(haracters,)-274(using)]TJ -171.21 -13.15 TD[(shell)-333(syn)27(tax,)-332(to)-334(sp)-27(ecify)-334(sets)-333(of)-334(names\).)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(istarget)-333(")]TJ/F5 10.91 Tf 55.18 0 TD[(target)]TJ/F4 10.91 Tf 28.75 0 TD[(")]TJ/F1 10.91 Tf -26.33 -13.15 TD[(T)83(ests)-437(for)-438(a)-438(particular)]TJ/F8 10.91 Tf 109.01 0 TD[(tar)51(get)]TJ/F1 10.91 Tf 32.72 0 TD[(en)27(vironmen)28(t.)-757(If)-438(the)-437(curren)26(tly)-436(con\014gured)-438(target)]TJ -141.73 -13.15 TD[(matc)27(hes)-374(the)-375(argumen)27(t)-374(string,)-386(the)-375(result)-375(is)]TJ/F4 10.91 Tf 207.28 0 TD[(1)]TJ/F1 10.91 Tf 5.73 0 TD[(;)-396(otherwise)-375(the)-375(result)-375(is)]TJ/F4 10.91 Tf 117.9 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(.)]TJ/F5 10.91 Tf 9.25 0 TD[(target)]TJ/F1 10.91 Tf -345.89 -13.15 TD[(m)27(ust)-384(b)-28(e)-385(a)-385(full)-385(three-part)]TJ/F4 10.91 Tf 124.46 0 TD[(configure)]TJ/F1 10.91 Tf 55.74 0 TD[(target)-385(name;)-410(in)-385(particular,)-398(y)26(ou)-384(ma)27(y)-384(not)]TJ -180.2 -13.15 TD[(use)-340(the)-341(shorter)-341(nic)26(knames)-340(supp)-27(orted)-341(b)26(y)]TJ/F4 10.91 Tf 194.47 0 TD[(configure)]TJ/F1 10.91 Tf 55.26 0 TD[(\(but)-340(y)26(ou)-340(can)-341(use)-341(wildcard)]TJ -249.73 -13.15 TD[(c)27(haracters,)-356(using)-353(shell)-353(syn)27(tax,)-357(to)-352(sp)-28(ecify)-353(sets)-352(of)-353(names\).)-503(If)-353(it)-352(is)-353(passed)-353(a)]TJ/F4 10.91 Tf 351.49 0 TD[(NULL)]TJ/F1 10.91 Tf -351.49 -13.15 TD[(string,)-333(then)-333(it)-333(returns)-334(the)-333(name)-333(of)-334(the)-333(build)-333(canonical)-334(con\014guration.)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(isbuild)-333(")]TJ/F5 10.91 Tf 49.45 0 TD[(host)]TJ/F4 10.91 Tf 20.3 0 TD[(")]TJ/F1 10.91 Tf -12.15 -13.15 TD[(T)83(ests)-356(for)-357(a)-357(particular)]TJ/F8 10.91 Tf 105.48 0 TD[(build)-379(host)]TJ/F1 10.91 Tf 50.88 0 TD[(en)27(vironmen)28(t.)-514(If)-357(the)-356(curren)26(tly)-356(con\014gured)-356(host)]TJ -156.36 -13.15 TD[(matc)27(hes)-423(the)-424(argumen)26(t)-423(string,)-447(the)-425(result)-424(is)]TJ/F4 10.91 Tf 211.17 0 TD[(1)]TJ/F1 10.91 Tf 5.73 0 TD[(;)-469(otherwise)-425(the)-424(result)-425(is)]TJ/F4 10.91 Tf 120.85 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(.)]TJ/F5 10.91 Tf 10.86 0 TD[(host)]TJ/F1 10.91 Tf -354.34 -13.15 TD[(m)27(ust)-445(b)-27(e)-446(a)-446(full)-446(three-part)]TJ/F4 10.91 Tf 127.77 0 TD[(configure)]TJ/F1 10.91 Tf 56.41 0 TD[(host)-445(name;)-502(in)-446(particular,)-474(y)27(ou)-445(ma)27(y)-445(not)]TJ -184.18 -13.15 TD[(use)-340(the)-341(shorter)-341(nic)26(knames)-340(supp)-27(orted)-341(b)26(y)]TJ/F4 10.91 Tf 194.47 0 TD[(configure)]TJ/F1 10.91 Tf 55.26 0 TD[(\(but)-340(y)26(ou)-340(can)-341(use)-341(wildcard)]TJ -249.73 -13.16 TD[(c)27(haracters,)-356(using)-353(shell)-353(syn)27(tax,)-357(to)-352(sp)-28(ecify)-353(sets)-352(of)-353(names\).)-503(If)-353(it)-352(is)-353(passed)-353(a)]TJ/F4 10.91 Tf 351.49 0 TD[(NULL)]TJ/F1 10.91 Tf -351.49 -13.15 TD[(string,)-333(then)-333(it)-333(returns)-334(the)-333(name)-333(of)-334(the)-333(build)-333(canonical)-334(con\014guration.)]TJ 0 -16.14 TD[(item)-376(is3w)27(a)28(y)]TJ/F4 10.91 Tf 60.69 0 TD[(")]TJ/F5 10.91 Tf 5.73 0 TD[(host)]TJ/F4 10.91 Tf 20.3 0 TD[(")]TJ/F1 10.91 Tf 9.83 0 TD[(T)83(ests)-375(for)-377(a)-376(canadian)-376(cross.)-574(This)-376(is)-376(when)-376(the)-377(tests)-376(will)-376(b)-28(e)]TJ -96.55 -13.15 TD[(run)-279(on)-279(a)-279(remotly)-280(hosted)-279(cross)-279(compiler.)-427(If)-279(it)-280(is)-279(a)-279(canadian)-279(cross,)-291(then)-279(the)-279(result)]TJ 0 -13.15 TD[(is)]TJ/F4 10.91 Tf 10.97 0 TD[(1)]TJ/F1 10.91 Tf 5.73 0 TD[(;)-333(otherwise)-333(the)-333(result)-334(is)]TJ/F4 10.91 Tf 115.39 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(.)]TJ/F4 10.91 Tf -195.42 -22.11 TD[(isnative)]TJ/F1 10.91 Tf 57.6 0 TD[(T)83(ests)-296(whether)-296(the)-297(curren)27(t)-296(con\014guration)-296(has)-297(the)-297(same)-296(host)-297(and)-297(target.)-432(When)-296(it)]TJ 0 -13.15 TD[(runs)-365(in)-365(a)]TJ/F8 10.91 Tf 47.19 0 TD[(native)]TJ/F1 10.91 Tf 33.52 0 TD[(con\014guration)-365(this)-365(pro)-27(cedure)-365(returns)-365(a)]TJ/F4 10.91 Tf 186.54 0 TD[(1)]TJ/F1 10.91 Tf 5.73 0 TD[(;)-380(otherwise)-365(it)-365(returns)]TJ -272.98 -13.16 TD[(a)]TJ/F4 10.91 Tf 9.09 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(.)]TJ/F4 10.91 Tf -72.42 -22.11 TD[(load_lib)-333(")]TJ/F5 10.91 Tf 55.18 0 TD[(library-\014le)]TJ/F4 10.91 Tf 50.07 0 TD[(")]TJ/F1 10.91 Tf -47.65 -13.15 TD[(Loads)-500(the)-500(\014le)]TJ/F5 10.91 Tf 73.55 0 TD[(library-\014le)]TJ/F1 10.91 Tf 55.52 0 TD[(b)27(y)-499(searc)27(hing)-499(a)-500(\014xed)-500(path)-500(built)-500(in)27(to)]TJ/F4 10.91 Tf 184.63 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(.)-944(If)]TJ -353.79 -13.15 TD[(DejaGn)27(u)-264(has)-265(b)-27(een)-265(installed,)-279(it)-265(lo)-27(oks)-265(in)-265(a)-265(path)-265(starting)-265(with)-265(the)-265(installed)-265(library)]TJ 0 -13.15 TD[(directory)83(.)-428(If)-286(y)27(ou)-285(are)-285(running)-286(DejaGn)26(u)-284(directly)-286(from)-286(a)-286(source)-286(directory)83(,)-295(without)]TJ 0 -13.16 TD[(\014rst)-440(running)-441(`)]TJ/F4 10.91 Tf 68.53 0 TD[(make)-333(install)]TJ/F1 10.91 Tf 66.63 0 TD[(',)-467(this)-441(path)-441(defaults)-441(to)-441(the)-441(curren)27(t)-440(directory)83(.)-766(In)]TJ -135.16 -13.15 TD[(either)-346(case,)-349(it)-347(then)-346(lo)-28(oks)-346(in)-347(the)-346(curren)27(t)-346(directory)-346(for)-346(a)-347(directory)-346(called)]TJ/F4 10.91 Tf 341.64 0 TD[(lib)]TJ/F1 10.91 Tf 17.18 0 TD[(.)-483(If)]TJ -358.82 -13.15 TD[(there)-411(are)-411(duplicate)-411(de\014nitions,)-431(the)-411(last)-411(one)-411(loaded)-411(tak)27(es)-411(precedence)-411(o)27(v)28(er)-410(the)]TJ 0 -13.15 TD[(earlier)-333(ones.)]TJ/F4 10.91 Tf -57.6 -22.11 TD[(setup_xfail)-333(")]TJ/F5 10.91 Tf 72.36 0 TD[(con\014g)]TJ/F1 10.91 Tf 32.45 0 TD[([)]TJ/F5 10.91 Tf 3.03 0 TD[(bugid)]TJ/F1 10.91 Tf 27.1 0 TD[(])]TJ/F4 10.91 Tf 3.03 0 TD[(")]TJ/F1 10.91 Tf -80.37 -13.15 TD[(Declares)-368(that)-369(the)-369(test)-369(is)-369(exp)-27(ected)-369(to)-369(fail)-369(on)-369(a)-369(particular)-369(set)-368(of)-369(con\014gurations.)]TJ 0 -13.16 TD[(The)]TJ/F5 10.91 Tf 22.64 0 TD[(con\014g)]TJ/F1 10.91 Tf 32.67 0 TD[(argumen)27(t)-352(m)27(ust)-352(b)-28(e)-353(a)-353(list)-353(of)-353(full)-353(three-part)]TJ/F4 10.91 Tf 202.84 0 TD[(configure)]TJ/F1 10.91 Tf 55.4 0 TD[(target)-353(name;)]TJ -313.55 -13.15 TD[(in)-325(particular,)-328(y)27(ou)-325(ma)27(y)-325(not)-326(use)-326(the)-326(shorter)-326(nic)27(knames)-325(supp)-28(orted)-326(b)27(y)]TJ/F4 10.91 Tf 322.86 0 TD[(configure)]TJ/F1 10.91 Tf -322.86 -13.15 TD[(\(but)-241(y)27(ou)-240(can)-241(use)-241(the)-241(common)-241(shell)-241(wildcard)-241(c)27(haracters)-241(to)-241(sp)-27(ecify)-241(sets)-241(of)-242(names\).)]TJ 0 -13.15 TD[(The)]TJ/F5 10.91 Tf 22.81 0 TD[(bugid)]TJ/F1 10.91 Tf 31.11 0 TD[(argumen)27(t)-367(is)-369(optional,)-377(and)-368(used)-369(only)-368(in)-369(the)-368(logging)-369(\014le)-368(output;)-386(use)]TJ -53.92 -13.15 TD[(it)-320(as)-320(a)-320(link)-320(to)-320(a)-320(bug-trac)27(king)-319(system)-320(suc)26(h)-319(as)]TJ/F7 10.91 Tf 213.74 0 TD[(gna)66(ts)]TJ/F1 10.91 Tf 34.58 0 TD[(\(see)-320(section)-320(\\Ov)27(erview")-319(in)]TJ/F5 10.91 Tf -248.32 -13.15 TD[(T)83(rac)28(king)-333(Bugs)-333(With)-333(GNA)82(TS)]TJ/F1 10.91 Tf 139.14 0 TD[(\).)]TJ ET 0 g 0 G
+endstream
+endobj
+150 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F8 52 0 R
+/F7 49 0 R
+>>
+endobj
+148 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 150 0 R
+>>
+endobj
+153 0 obj
+<<
+/Length 9059
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(26)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 57.6 -23.91 TD[(Once)-391(y)27(ou)-391(use)]TJ/F4 10.91 Tf 69.23 0 TD[(setup_xfail)]TJ/F1 10.91 Tf 63 0 TD[(,)-405(the)]TJ/F4 10.91 Tf 26.88 0 TD[(fail)]TJ/F1 10.91 Tf 27.18 0 TD[(and)]TJ/F4 10.91 Tf 21.85 0 TD[(pass)]TJ/F1 10.91 Tf 27.18 0 TD[(pro)-27(cedures)-392(pro)-27(duce)-392(the)-391(mes-)]TJ -235.32 -13.15 TD[(sages)-463(`)]TJ/F4 10.91 Tf 32.45 0 TD[(XFAIL)]TJ/F1 10.91 Tf 28.64 0 TD[(')-463(and)-464(`)]TJ/F4 10.91 Tf 33.75 0 TD[(XPASS)]TJ/F1 10.91 Tf 28.64 0 TD[(')-463(resp)-28(ectiv)27(ely)83(,)-495(allo)27(wing)-463(y)27(ou)-463(to)-464(distinguish)-464(exp)-27(ected)]TJ -123.48 -13.15 TD[(failures)-333(\(and)-333(unexp)-28(ected)-333(success!\))-445(from)-333(other)-333(test)-334(outcomes.)]TJ/F8 10.91 Tf 0 -16.14 TD[(Warning:)]TJ/F1 10.91 Tf 50.18 0 TD[(y)27(ou)-267(m)27(ust)-267(clear)-268(the)-268(exp)-28(ected)-268(failure)-268(after)-268(using)]TJ/F4 10.91 Tf 220.27 0 TD[(setup_xfail)]TJ/F1 10.91 Tf 65.92 0 TD[(in)-268(a)-268(test)]TJ -336.37 -13.15 TD[(case.)-438(An)27(y)-314(call)-315(to)]TJ/F4 10.91 Tf 83.33 0 TD[(pass)]TJ/F1 10.91 Tf 26.35 0 TD[(or)]TJ/F4 10.91 Tf 13.16 0 TD[(fail)]TJ/F1 10.91 Tf 26.35 0 TD[(clears)-314(the)-315(exp)-28(ected)-315(failure)-315(implicitly;)-321(if)-315(the)-315(test)]TJ -149.19 -13.15 TD[(has)-359(some)-360(other)-360(outcome,)-366(e.g.)-524(an)-359(error,)-367(y)27(ou)-359(can)-359(call)]TJ/F4 10.91 Tf 252.33 0 TD[(clear_xfail)]TJ/F1 10.91 Tf 66.92 0 TD[(to)-359(clear)-360(the)]TJ -319.25 -13.16 TD[(exp)-27(ected)-363(failure)-362(explicitly)82(.)-531(Otherwise,)-370(the)-362(exp)-28(ected-failure)-363(declaration)-362(applies)]TJ 0 -13.15 TD[(to)-333(whatev)27(er)-332(test)-334(runs)-333(next,)-333(leading)-334(to)-333(surprising)-333(results.)]TJ/F4 10.91 Tf -57.6 -22.11 TD[(clear_xfail)]TJ/F5 10.91 Tf 66.64 0 TD[(con\014g)]TJ/F1 10.91 Tf -9.04 -13.15 TD[(Cancel)-258(an)-258(exp)-28(ected)-258(failure)-258(\(previously)-258(declared)-258(with)]TJ/F4 10.91 Tf 248.65 0 TD[(setup_xfail)]TJ/F1 10.91 Tf 63 0 TD[(\))-258(for)-258(a)-258(partic-)]TJ -311.65 -13.15 TD[(ular)-323(set)-324(of)-324(con\014gurations.)-441(The)]TJ/F5 10.91 Tf 148.52 0 TD[(con\014g)]TJ/F1 10.91 Tf 32.35 0 TD[(argumen)27(t)-323(is)-323(a)-324(list)-324(of)-324(con\014guration)-324(target)]TJ -180.87 -13.16 TD[(names.)-745(It)-433(is)-434(only)-433(necessary)-434(to)-433(call)]TJ/F4 10.91 Tf 175.87 0 TD[(clear_xfail)]TJ/F1 10.91 Tf 67.73 0 TD[(if)-433(a)-434(test)-433(case)-434(ends)-433(without)]TJ -243.6 -13.15 TD[(calling)-333(either)]TJ/F4 10.91 Tf 65.49 0 TD[(pass)]TJ/F1 10.91 Tf 26.54 0 TD[(or)]TJ/F4 10.91 Tf 13.36 0 TD[(fail)]TJ/F1 10.91 Tf 22.91 0 TD[(,)-333(after)-333(calling)]TJ/F4 10.91 Tf 67 0 TD[(setup_xfail)]TJ/F1 10.91 Tf 63 0 TD[(.)]TJ/F4 10.91 Tf -315.9 -22.11 TD[(verbose)]TJ/F1 10.91 Tf 43.73 0 TD[([)]TJ/F4 10.91 Tf 3.03 0 TD[(-log)]TJ/F1 10.91 Tf 22.91 0 TD[(])-333([)]TJ/F4 10.91 Tf 9.69 0 TD[(-n)]TJ/F1 10.91 Tf 11.46 0 TD[(])-333([)]TJ/F4 10.91 Tf 9.69 0 TD[(--)]TJ/F1 10.91 Tf 11.46 0 TD[(])]TJ/F4 10.91 Tf 6.67 0 TD[(")]TJ/F5 10.91 Tf 5.72 0 TD[(string)]TJ/F4 10.91 Tf 28.3 0 TD[(")]TJ/F5 10.91 Tf 9.36 0 TD[(n)27(um)28(b)-27(er)]TJ/F1 10.91 Tf -104.42 -13.15 TD[(T)83(est)-452(cases)-452(can)-453(use)-453(this)-452(function)-453(to)-452(issue)-453(helpful)-452(messages)-453(dep)-28(ending)-452(on)-453(the)]TJ 0 -13.15 TD[(n)27(um)28(b)-27(er)-334(of)-333(`)]TJ/F4 10.91 Tf 55.19 0 TD[(--verbose)]TJ/F1 10.91 Tf 51.55 0 TD[(')-333(options)-334(on)-334(the)]TJ/F4 10.91 Tf 78.87 0 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(command)-333(line.)-446(It)-334(prin)27(ts)]TJ/F5 10.91 Tf 117.7 0 TD[(string)]TJ/F1 10.91 Tf -347.04 -13.16 TD[(if)-455(the)-456(v)54(alue)-454(of)-456(the)-456(v)55(ariable)]TJ/F4 10.91 Tf 137.14 0 TD[(verbose)]TJ/F1 10.91 Tf 45.06 0 TD[(is)-455(higher)-456(than)-456(or)-456(equal)-455(to)-456(the)-456(optional)]TJ/F5 10.91 Tf -182.2 -13.15 TD[(n)27(um)28(b)-27(er)]TJ/F1 10.91 Tf 36.09 0 TD[(.)-473(The)-343(default)-343(v)55(alue)-342(for)]TJ/F5 10.91 Tf 112.58 0 TD[(n)27(um)28(b)-27(er)]TJ/F1 10.91 Tf 40.62 0 TD[(is)-342(1.)-474(Use)-343(the)-343(optional)-343(`)]TJ/F4 10.91 Tf 110.25 0 TD[(-log)]TJ/F1 10.91 Tf 22.91 0 TD[(')-342(argumen)26(t)]TJ -322.45 -13.15 TD[(to)-370(cause)]TJ/F5 10.91 Tf 43.29 0 TD[(string)]TJ/F1 10.91 Tf 32.34 0 TD[(to)-370(alw)27(a)28(ys)-370(b)-27(e)-371(added)-370(to)-370(the)-371(log)-370(\014le,)-379(ev)26(en)-369(if)-370(it)-371(w)27(on't)-369(b)-28(e)-370(prin)26(ted.)]TJ -75.63 -13.15 TD[(Use)-340(the)-341(optional)-340(`)]TJ/F4 10.91 Tf 85.45 0 TD[(-n)]TJ/F1 10.91 Tf 11.45 0 TD[(')-340(argumen)27(t)-340(to)-340(prin)26(t)]TJ/F5 10.91 Tf 96.14 0 TD[(string)]TJ/F1 10.91 Tf 32.01 0 TD[(without)-340(a)-341(trailing)-340(newline.)-466(Use)]TJ -225.05 -13.15 TD[(the)-333(optional)-333(`)]TJ/F4 10.91 Tf 64.24 0 TD[(--)]TJ/F1 10.91 Tf 11.46 0 TD[(')-333(argumen)27(t)-332(if)]TJ/F5 10.91 Tf 65.48 0 TD[(string)]TJ/F1 10.91 Tf 31.94 0 TD[(b)-27(egins)-334(with)]TJ/F4 10.91 Tf 58.54 0 TD[(")]TJ/F1 10.91 Tf 5.73 0 TD[(-)]TJ/F4 10.91 Tf 3.64 0 TD[(")]TJ/F1 10.91 Tf 5.72 0 TD[(.)]TJ/F2 13.09 Tf -304.35 -29.89 TD[(5.3.2)-562(Remote)-375(Comm)30(unication)-374(Pro)-31(cedures)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(lib/remote.exp)]TJ/F1 10.91 Tf 80.19 0 TD[(')-432(de\014nes)-433(these)-433(functions,)-458(for)-433(establishing)-433(and)-433(managing)-433(comm)27(unica-)]TJ -98.16 -13.15 TD[(tions:)]TJ/F8 10.91 Tf 14.94 -16.14 TD[(Pr)51(o)51(c)51(e)51(dur)51(es)-469(to)-471(establish)-470(a)-471(c)50(onne)52(ction:)]TJ/F1 10.91 Tf 187.47 0 TD[(Eac)27(h)-454(of)-456(these)-456(pro)-28(cedures)-456(tries)-455(to)-456(establish)-456(the)]TJ -202.41 -13.15 TD[(connection)-338(up)-338(to)-338(three)-339(times)-338(b)-28(efore)-338(returning.)-460(W)83(arnings)-338(\(if)-338(retries)-338(will)-339(con)27(tin)28(ue\))-337(or)-339(errors)]TJ 0 -13.15 TD[(\(if)-463(the)-464(attempt)-464(is)-464(abandoned\))-464(rep)-28(ort)-464(on)-463(comm)26(unication)-463(failures.)-836(The)-464(result)-463(for)-464(an)26(y)-462(of)]TJ 0 -13.15 TD[(these)-334(pro)-28(cedures)-335(is)-334(either)]TJ/F4 10.91 Tf 124.88 0 TD[(-1)]TJ/F1 10.91 Tf 11.45 0 TD[(,)-335(when)-334(the)-335(connection)-335(cannot)-334(b)-28(e)-335(established,)-335(or)-334(the)-335(spa)27(wn)-334(ID)]TJ -136.33 -13.15 TD[(returned)-333(b)27(y)-332(the)]TJ/F4 10.91 Tf 78.24 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(command)]TJ/F4 10.91 Tf 49.7 0 TD[(spawn)]TJ/F1 10.91 Tf 28.64 0 TD[(.)]TJ -179.64 -16.14 TD[(It)-295(use)-295(the)-295(v)55(alue)-295(of)-295(the)]TJ/F4 10.91 Tf 106.35 0 TD[(connect)]TJ/F1 10.91 Tf 43.32 0 TD[(\014eld)-295(in)-295(the)]TJ/F4 10.91 Tf 53.9 0 TD[(target_info)]TJ/F1 10.91 Tf 66.22 0 TD[(arra)27(y)-294(\(w)27(as)]TJ/F4 10.91 Tf 52.92 0 TD[(connectmode)]TJ/F1 10.91 Tf 66.22 0 TD[(as)-295(the)]TJ -403.87 -13.15 TD[(t)27(yp)-26(e)-414(of)-413(connection)-413(to)-413(mak)26(e.)-683(Curren)27(t)-412(supp)-28(orted)-413(connection)-413(t)26(yp)-26(es)-414(are)-413(tip,)-433(k)27(ermit,)-432(telnet,)]TJ 0 -13.15 TD[(rsh,)-411(rlogin,)-412(and)-396(netdata.)-633(If)-396(the)]TJ/F4 10.91 Tf 156.25 0 TD[(--reboot)]TJ/F1 10.91 Tf 50.14 0 TD[(option)-396(w)27(as)-395(used)-396(on)-396(the)-396(run)26(test)-395(command)-396(line,)]TJ -206.39 -13.15 TD[(then)-333(the)-333(target)-333(is)-334(reb)-28(o)-27(oted)-334(b)-28(efore)-333(the)-333(connection)-334(is)-333(made.)]TJ/F4 10.91 Tf 0 -22.12 TD[(remote_open)]TJ/F5 10.91 Tf 66.64 0 TD[(t)27(yp)-26(e)]TJ/F8 10.91 Tf -9.04 -13.15 TD[(R)51(emote)-430(Conne)50(ction)-430(Pr)50(o)51(c)51(e)51(dur)51(e.)]TJ/F1 10.91 Tf 155.43 0 TD[(This)-412(is)-413(passed)]TJ/F8 10.91 Tf 73.15 0 TD[(host)]TJ/F1 10.91 Tf 24.77 0 TD[(or)]TJ/F8 10.91 Tf 14.24 0 TD[(tar)51(get)]TJ/F1 10.91 Tf 26.9 0 TD[(.)-682(Host)-413(or)-413(target)]TJ -294.49 -13.15 TD[(refers)-344(to)-345(whether)-344(it)-345(is)-345(a)-344(connection)-345(to)-345(a)-344(remote)-345(target,)-347(or)-345(a)-345(remote)-344(host.)-479(This)]TJ 0 -13.15 TD[(op)-27(ens)-379(the)-379(connection)-378(to)-379(the)-379(desired)-378(target)-379(or)-379(host)-378(using)-379(the)-379(default)-378(v)54(alues)-377(in)]TJ 0 -13.15 TD[(the)-270(con\014guration)-271(system.)-424(It)-270(returns)-271(that)]TJ/F4 10.91 Tf 194.81 0 TD[(spawn_id)]TJ/F1 10.91 Tf 48.78 0 TD[(of)-270(the)-271(pro)-28(cess)-271(that)-270(manages)]TJ -243.59 -13.15 TD[(the)-350(connection.)-497(This)-351(v)55(alue)-350(can)-350(b)-28(e)-351(used)-351(in)]TJ/F4 10.91 Tf 205.05 0 TD[(expect)]TJ/F1 10.91 Tf 38.19 0 TD[(or)]TJ/F4 10.91 Tf 13.55 0 TD[(exp_send)]TJ/F1 10.91 Tf 49.65 0 TD[(statemen)27(ts,)-354(or)]TJ -306.44 -13.15 TD[(passed)-282(to)-282(other)-282(pro)-28(cedures)-282(that)-282(need)-282(the)-282(connection)-283(pro)-27(cess's)-282(id.)-428(This)-282(also)-282(sets)]TJ 0 -13.16 TD[(the)]TJ/F4 10.91 Tf 18.79 0 TD[(fileid)]TJ/F1 10.91 Tf 38 0 TD[(\014eld)-333(in)-333(the)]TJ/F4 10.91 Tf 55.15 0 TD[(target_info)]TJ/F1 10.91 Tf 66.64 0 TD[(arra)27(y)84(.)]TJ ET 0 g 0 G
+endstream
+endobj
+154 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F8 52 0 R
+/F5 31 0 R
+/F2 12 0 R
+>>
+endobj
+152 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 154 0 R
+>>
+endobj
+157 0 obj
+<<
+/Length 8999
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(27)]TJ/F4 10.91 Tf 0 -23.91 TD[(remote_close)]TJ/F5 10.91 Tf 72.36 0 TD[(shellid)]TJ/F8 10.91 Tf -14.76 -13.15 TD[(shel)-51(lid)]TJ/F1 10.91 Tf 35.06 0 TD[(is)-350(v)55(alue)-350(returned)-350(b)27(y)-349(a)-351(call)-350(to)]TJ/F4 10.91 Tf 142.32 0 TD[(remote_open)]TJ/F1 10.91 Tf 63 0 TD[(.)-495(This)-350(closes)-350(the)-351(connection)]TJ -240.38 -13.15 TD[(to)-301(the)-302(target)-302(so)-302(resources)-301(can)-302(b)-28(e)-302(used)-302(b)27(y)-301(others.)-433(This)-302(parameter)-302(can)-302(b)-28(e)-301(left)-302(o\013)]TJ 0 -13.15 TD[(if)-333(the)]TJ/F4 10.91 Tf 28.79 0 TD[(fileid)]TJ/F1 10.91 Tf 38 0 TD[(\014eld)-333(in)-333(the)]TJ/F4 10.91 Tf 55.15 0 TD[(target_info)]TJ/F1 10.91 Tf 66.64 0 TD[(arra)27(y)-332(is)-333(set.)]TJ/F4 10.91 Tf -246.18 -22.12 TD[(telnet)]TJ/F5 10.91 Tf 38 0 TD[(hostname)-389(p)-28(ort)]TJ/F4 10.91 Tf -38 -13.15 TD[(rlogin)]TJ/F5 10.91 Tf 38 0 TD[(hostname)]TJ/F4 10.91 Tf -38 -13.15 TD[(rsh)]TJ/F5 10.91 Tf 20.82 0 TD[(hostname)]TJ/F8 10.91 Tf 36.78 -13.15 TD[(IP)-283(network)-284(pr)50(o)51(c)51(e)51(dur)51(es.)]TJ/F5 10.91 Tf 111.43 0 TD[(hostname)]TJ/F1 10.91 Tf 48.89 0 TD[(refers)-253(to)-253(the)-253(IP)-253(address)-253(or)-253(name)-253(\(for)-253(example,)]TJ -160.32 -13.15 TD[(an)-263(en)27(try)-263(in)-263(`)]TJ/F4 10.91 Tf 57.14 0 TD[(/etc/hosts)]TJ/F1 10.91 Tf 57.27 0 TD[('\))-263(for)-264(this)-263(target.)-421(The)-264(pro)-28(cedure)-263(names)-264(re\015ect)-263(the)-264(Unix)]TJ -114.41 -13.16 TD[(utilit)27(y)-338(used)-340(to)-340(establish)-339(a)-340(connection.)-464(The)-339(optional)]TJ/F5 10.91 Tf 249.36 0 TD[(p)-27(ort)]TJ/F1 10.91 Tf 24.28 0 TD[(is)-339(used)-340(to)-340(sp)-27(ecify)-340(the)]TJ -273.64 -13.15 TD[(IP)-383(p)-28(ort)-384(n)27(um)28(b)-27(er.)-596(The)-383(v)54(alue)-383(of)-383(the)]TJ/F4 10.91 Tf 169.71 0 TD[(netport)]TJ/F1 10.91 Tf 44.27 0 TD[(\014eld)-383(in)-384(the)]TJ/F4 10.91 Tf 56.81 0 TD[(target_info)]TJ/F1 10.91 Tf 67.18 0 TD[(arra)27(y)-382(is)]TJ -337.97 -13.15 TD[(used.)-712(\(w)26(as)]TJ/F4 10.91 Tf 58.27 0 TD[($netport)]TJ/F1 10.91 Tf 45.82 0 TD[(\))-422(This)-423(v)54(alue)-421(has)-423(t)26(w)28(o)-422(parts,)-445(the)-423(hostname)-423(and)-422(the)-423(p)-28(ort)]TJ -104.09 -13.15 TD[(n)27(um)28(b)-27(er,)-297(sep)-28(erated)-288(b)27(y)-287(a)]TJ/F8 10.91 Tf 114.01 0 TD[(:)]TJ/F1 10.91 Tf 3.35 0 TD[(.)-429(If)]TJ/F4 10.91 Tf 18.13 0 TD[(host)]TJ/F1 10.91 Tf 26.05 0 TD[(or)]TJ/F4 10.91 Tf 12.87 0 TD[(target)]TJ/F1 10.91 Tf 37.51 0 TD[(is)-288(used)-288(in)-288(the)]TJ/F4 10.91 Tf 65.43 0 TD[(hostname)]TJ/F1 10.91 Tf 48.96 0 TD[(\014eld,)-297(than)]TJ -326.31 -13.15 TD[(the)-333(con\014g)-333(arra)27(y)-333(is)-333(used)-333(for)-334(all)-333(information.)]TJ/F4 10.91 Tf -57.6 -22.11 TD[(tip)]TJ/F5 10.91 Tf 20.82 0 TD[(p)-27(ort)]TJ/F8 10.91 Tf 36.78 0 TD[(Serial)-314(line)-315(pr)50(o)51(c)51(e)51(dur)51(e.)]TJ/F1 10.91 Tf 103.69 0 TD[(Connect)-286(using)-287(the)-287(Unix)-287(utilit)27(y)]TJ/F4 10.91 Tf 147.22 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[(.)]TJ/F5 10.91 Tf 7.71 0 TD[(p)-27(ort)]TJ/F1 10.91 Tf 23.7 0 TD[(m)27(ust)-286(b)-27(e)-287(a)-287(name)]TJ -299.5 -13.16 TD[(from)-300(the)]TJ/F4 10.91 Tf 43.85 0 TD[(tip)]TJ/F1 10.91 Tf 20.46 0 TD[(con\014guration)-300(\014le)-300(`)]TJ/F4 10.91 Tf 85.98 0 TD[(/etc/remote)]TJ/F1 10.91 Tf 63 0 TD[('.)-433(Often,)-307(this)-300(is)-300(called)-301(`)]TJ/F4 10.91 Tf 109.23 0 TD[(hardwire)]TJ/F1 10.91 Tf 45.82 0 TD[(',)]TJ -368.34 -13.15 TD[(or)-301(something)-301(lik)27(e)-300(`)]TJ/F4 10.91 Tf 87.52 0 TD[(ttya)]TJ/F1 10.91 Tf 22.91 0 TD[('.)-433(This)-301(\014le)-302(holds)-301(all)-301(the)-301(con\014guration)-301(data)-301(for)-302(the)-301(serial)]TJ -110.43 -13.15 TD[(p)-27(ort.)-677(The)-410(v)54(alue)-409(of)-411(the)]TJ/F4 10.91 Tf 115.94 0 TD[(serial)]TJ/F1 10.91 Tf 38.84 0 TD[(\014eld)-410(in)-411(the)]TJ/F4 10.91 Tf 57.68 0 TD[(target_info)]TJ/F1 10.91 Tf 67.48 0 TD[(arra)27(y)-409(is)-411(used.)-676(\(w)26(as)]TJ/F4 10.91 Tf -279.94 -13.15 TD[($serialport)]TJ/F1 10.91 Tf 63 0 TD[(\))-289(If)]TJ/F4 10.91 Tf 17.84 0 TD[(host)]TJ/F1 10.91 Tf 26.06 0 TD[(or)]TJ/F4 10.91 Tf 12.89 0 TD[(target)]TJ/F1 10.91 Tf 37.53 0 TD[(is)-289(used)-290(in)-290(the)]TJ/F4 10.91 Tf 65.49 0 TD[(port)]TJ/F1 10.91 Tf 26.07 0 TD[(\014eld,)-298(than)-290(the)-289(con\014g)-290(arra)27(y)]TJ -248.88 -13.15 TD[(is)-333(used)-333(for)-333(all)-334(information.)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(kermit)]TJ/F5 10.91 Tf 38 0 TD[(p)-27(ort)-355(bps)]TJ/F8 10.91 Tf 19.6 -13.15 TD[(Serial)-414(line)-414(pr)50(o)51(c)51(e)51(dur)51(e.)]TJ/F1 10.91 Tf 108.04 0 TD[(Connect)-394(using)-395(the)-395(program)]TJ/F4 10.91 Tf 136.74 0 TD[(kermit)]TJ/F1 10.91 Tf 34.36 0 TD[(.)]TJ/F5 10.91 Tf 9.89 0 TD[(p)-27(ort)]TJ/F1 10.91 Tf 24.88 0 TD[(is)-394(the)-395(device)]TJ -313.91 -13.15 TD[(name,)-299(e.g.)-430(`)]TJ/F4 10.91 Tf 55.84 0 TD[(/dev/ttyb)]TJ/F1 10.91 Tf 51.55 0 TD[('.)]TJ/F5 10.91 Tf 10.75 0 TD[(bps)]TJ/F1 10.91 Tf 20.05 0 TD[(is)-291(the)-291(line)-291(sp)-28(eed)-291(to)-291(use)-291(\(in)-291(bits)-291(p)-28(er)-291(second\))-291(for)-291(the)]TJ -138.19 -13.15 TD[(connection.)-644(The)-400(v)54(alue)-399(of)-400(the)]TJ/F4 10.91 Tf 145.7 0 TD[(serial)]TJ/F1 10.91 Tf 38.73 0 TD[(\014eld)-400(in)-400(the)]TJ/F4 10.91 Tf 57.33 0 TD[(target_info)]TJ/F1 10.91 Tf 67.37 0 TD[(arra)27(y)-399(is)-400(used.)]TJ -309.13 -13.15 TD[(\(w)27(as)]TJ/F4 10.91 Tf 24.98 0 TD[($serialport)]TJ/F1 10.91 Tf 63 0 TD[(\))-311(If)]TJ/F4 10.91 Tf 18.32 0 TD[(host)]TJ/F1 10.91 Tf 26.31 0 TD[(or)]TJ/F4 10.91 Tf 13.13 0 TD[(target)]TJ/F1 10.91 Tf 37.76 0 TD[(is)-311(used)-312(in)-312(the)]TJ/F4 10.91 Tf 66.46 0 TD[(port)]TJ/F1 10.91 Tf 26.31 0 TD[(\014eld,)-316(than)-311(the)-312(con\014g)]TJ -276.27 -13.15 TD[(arra)27(y)-332(is)-333(used)-334(for)-333(all)-333(information.)]TJ/F8 10.91 Tf -57.6 -19.13 TD[(Pr)51(o)51(c)51(e)51(dur)51(es)-357(to)-357(manage)-358(a)-358(c)50(onne)51(ction:)]TJ/F4 10.91 Tf 0 -22.11 TD[(tip_download)]TJ/F5 10.91 Tf 72.36 0 TD[(spa)27(wnid)-371(\014le)]TJ/F1 10.91 Tf -14.76 -13.15 TD[(Do)27(wnload)-271(`)]TJ/F5 10.91 Tf 53.42 0 TD[(\014le)]TJ/F1 10.91 Tf 14.55 0 TD[(')-271(to)-272(the)-272(pro)-28(cess)]TJ/F5 10.91 Tf 74.14 0 TD[(spa)27(wnid)]TJ/F1 10.91 Tf 41.94 0 TD[(\(the)-271(v)54(alue)-271(returned)-272(when)-272(the)-272(connection)]TJ -184.05 -13.16 TD[(w)27(as)-453(established\),)-485(using)-455(the)]TJ/F4 10.91 Tf 137.08 0 TD[(~put)]TJ/F1 10.91 Tf 27.86 0 TD[(command)-454(under)]TJ/F4 10.91 Tf 83.28 0 TD[(tip)]TJ/F1 10.91 Tf 17.19 0 TD[(.)-808(Most)-454(often)-455(used)-454(for)]TJ -265.41 -13.15 TD[(single)-334(b)-28(oard)-335(computers)-335(that)-335(require)-335(do)27(wnloading)-334(programs)-335(in)]TJ/F7 10.91 Tf 298.99 0 TD[(asci)-22(i)]TJ/F1 10.91 Tf 28.62 0 TD[(S-records.)]TJ -327.61 -13.15 TD[(Returns)]TJ/F4 10.91 Tf 41.45 0 TD[(1)]TJ/F1 10.91 Tf 9.37 0 TD[(if)-333(an)-333(error)-333(o)-28(ccurs,)]TJ/F4 10.91 Tf 88.67 0 TD[(0)]TJ/F1 10.91 Tf 9.36 0 TD[(otherwise.)]TJ/F4 10.91 Tf -206.45 -22.11 TD[(exit_remote_shell)]TJ/F5 10.91 Tf 101 0 TD[(spa)27(wnid)]TJ/F1 10.91 Tf -43.4 -13.15 TD[(Exits)-376(a)-377(remote)-377(pro)-28(cess)-376(started)-377(b)27(y)-376(an)27(y)-376(of)-377(the)-376(connection)-377(pro)-28(cedures.)]TJ/F5 10.91 Tf 335.85 0 TD[(spa)27(wnid)]TJ/F1 10.91 Tf -335.85 -13.16 TD[(is)-333(the)-333(result)-333(of)-334(the)-333(connection)-333(pro)-28(cedure)-334(that)-333(started)-333(the)-334(remote)-333(pro)-28(cess.)]TJ/F4 10.91 Tf -57.6 -22.11 TD[(download)]TJ/F5 10.91 Tf 49.45 0 TD[(\014le)]TJ/F1 10.91 Tf 18.19 0 TD[([)]TJ/F5 10.91 Tf 6.67 0 TD[(spa)27(wnid)]TJ/F1 10.91 Tf 42.61 0 TD[(])]TJ -59.32 -13.15 TD[(After)-308(y)27(ou)-307(establish)-308(a)-308(connection)-309(to)-308(a)-308(target,)-313(y)27(ou)-308(can)-308(do)27(wnload)-307(programs)-308(using)]TJ 0 -13.15 TD[(this)-436(command.)]TJ/F4 10.91 Tf 79.73 0 TD[(download)]TJ/F1 10.91 Tf 50.59 0 TD[(reads)-436(in)]TJ/F5 10.91 Tf 43.56 0 TD[(\014le)]TJ/F1 10.91 Tf 19.32 0 TD[(\(ob)-55(ject)-437(co)-28(de)-437(in)-437(S-record)-437(format\))-437(and)]TJ -193.2 -13.15 TD[(writes)-325(it)-325(to)-325(the)-325(device)-326(con)27(trolling)-324(this)]TJ/F5 10.91 Tf 183.2 0 TD[(spa)27(wnid)]TJ/F1 10.91 Tf 38.55 0 TD[(.)-441(\(F)82(rom)-324(the)-325(p)-28(oin)27(t)-325(of)-325(view)-325(of)-325(the)]TJ -221.75 -13.16 TD[(target,)-333(the)-333(S-record)-333(\014le)-334(comes)-333(in)-333(via)-334(standard)-333(input.\))]TJ 0 -16.13 TD[(If)-419(y)27(ou)-418(ha)26(v)28(e)-418(more)-419(than)-420(one)-419(target)-419(activ)26(e,)-439(y)26(ou)-418(can)-419(use)-420(the)-419(optional)-419(argumen)26(t)]TJ/F5 10.91 Tf 0 -13.16 TD[(spa)27(wnid)]TJ/F1 10.91 Tf 42.15 0 TD[(to)-291(sp)-27(ecify)-292(an)-291(alternativ)27(e)-290(target)-292(\(the)-291(default)-291(is)-291(the)-291(most)-292(recen)27(tly)-290(estab-)]TJ -42.15 -13.15 TD[(lished)]TJ/F5 10.91 Tf 30.97 0 TD[(spa)27(wnid)]TJ/F1 10.91 Tf 38.55 0 TD[(.\))]TJ ET 0 g 0 G
+endstream
+endobj
+158 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F8 52 0 R
+/F7 49 0 R
+>>
+endobj
+156 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 158 0 R
+>>
+endobj
+161 0 obj
+<<
+/Length 7101
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(28)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 13.09 Tf 0 -23.91 TD[(5.3.3)-562(Utilit)30(y)-374(Pro)-31(cedures)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(lib/utils.exp)]TJ/F1 10.91 Tf 74.46 0 TD[(')-333(de\014nes)-333(these)-333(utilit)26(y)-332(pro)-28(cedures:)]TJ/F4 10.91 Tf -92.43 -22.11 TD[(getdirs)]TJ/F5 10.91 Tf 43.73 0 TD[(dir)]TJ/F4 10.91 Tf -43.73 -13.15 TD[(getdirs)]TJ/F5 10.91 Tf 43.73 0 TD[(dir)-405(pattern)]TJ/F1 10.91 Tf 13.87 -13.15 TD[(Returns)-237(a)-238(list)-238(of)-238(all)-238(the)-238(directories)-238(in)-238(the)-238(single)-238(directory)]TJ/F5 10.91 Tf 264.86 0 TD[(dir)]TJ/F1 10.91 Tf 16.74 0 TD[(that)-237(matc)26(h)]TJ/F5 10.91 Tf 54.59 0 TD[(pattern)]TJ/F1 10.91 Tf 35.18 0 TD[(.)]TJ -371.37 -13.16 TD[(If)-341(y)27(ou)-340(do)-341(not)-341(sp)-28(ecify)]TJ/F5 10.91 Tf 102.6 0 TD[(pattern)]TJ/F1 10.91 Tf 35.18 0 TD[(,)]TJ/F4 10.91 Tf 6.77 0 TD[(getdirs)]TJ/F1 10.91 Tf 43.82 0 TD[(assumes)-341(`)]TJ/F4 10.91 Tf 45.11 0 TD[(*)]TJ/F1 10.91 Tf 5.73 0 TD[('.)-467(Y)82(ou)-340(ma)27(y)-340(use)-341(the)-341(common)]TJ -239.21 -13.15 TD[(shell)-358(wildcard)-359(c)26(haracters)-358(in)]TJ/F5 10.91 Tf 134.97 0 TD[(pattern)]TJ/F1 10.91 Tf 35.18 0 TD[(.)-521(If)-359(no)-359(directories)-359(matc)27(h)-358(the)-359(pattern,)-365(then)]TJ -170.15 -13.15 TD[(a)]TJ/F4 10.91 Tf 9.09 0 TD[(NULL)]TJ/F1 10.91 Tf 26.55 0 TD[(string)-333(is)-333(returned.)]TJ/F4 10.91 Tf -93.24 -22.11 TD[(find)]TJ/F5 10.91 Tf 26.55 0 TD[(dir)-405(pattern)]TJ/F1 10.91 Tf 31.05 -13.15 TD[(Searc)27(h)-453(for)-455(\014les)-455(whose)-455(names)-455(matc)27(h)]TJ/F5 10.91 Tf 180.01 0 TD[(pattern)]TJ/F1 10.91 Tf 40.14 0 TD[(\(using)-454(shell)-455(wildcard)-455(c)27(haracters)]TJ -220.15 -13.15 TD[(for)-336(\014lename)-337(expansion\).)-456(Searc)27(h)-336(sub)-28(directories)-336(recursiv)26(ely)84(,)-337(starting)-337(at)]TJ/F5 10.91 Tf 334.25 0 TD[(dir)]TJ/F1 10.91 Tf 13.37 0 TD[(.)-455(The)]TJ -347.62 -13.16 TD[(result)-452(is)-452(the)-453(list)-452(of)-453(\014les)-452(whose)-452(names)-453(matc)27(h;)-511(if)-452(no)-453(\014les)-452(matc)27(h,)-482(the)-452(result)-452(is)]TJ 0 -13.15 TD[(empt)27(y)84(.)-580(Filenames)-378(in)-379(the)-378(result)-379(include)-379(all)-378(in)26(terv)28(ening)-377(sub)-28(directory)-379(names.)-580(If)]TJ 0 -13.15 TD[(no)-333(\014les)-333(matc)27(h)-333(the)-333(pattern,)-333(then)-334(a)]TJ/F4 10.91 Tf 164.64 0 TD[(NULL)]TJ/F1 10.91 Tf 26.54 0 TD[(string)-333(is)-333(returned.)]TJ/F4 10.91 Tf -248.78 -22.11 TD[(which)]TJ/F5 10.91 Tf 32.27 0 TD[(binary)]TJ/F1 10.91 Tf 25.33 -13.15 TD[(Searc)27(hes)-461(the)-463(execution)-463(path)-462(for)-463(an)-462(executable)-463(\014le)]TJ/F5 10.91 Tf 251.41 0 TD[(binary)]TJ/F1 10.91 Tf 30.63 0 TD[(,)-494(lik)26(e)-461(the)-463(the)-463(BSD)]TJ/F4 10.91 Tf -282.04 -13.16 TD[(which)]TJ/F1 10.91 Tf 33.34 0 TD[(utilit)27(y)84(.)-737(This)-431(pro)-28(cedure)-431(uses)-431(the)-431(shell)-431(en)27(vironmen)28(t)-430(v)55(ariable)-430(`)]TJ/F4 10.91 Tf 295.86 0 TD[(PATH)]TJ/F1 10.91 Tf 22.91 0 TD[('.)-737(It)]TJ -352.11 -13.15 TD[(returns)]TJ/F4 10.91 Tf 37.99 0 TD[(0)]TJ/F1 10.91 Tf 9.66 0 TD[(if)-360(the)-360(binary)-361(is)-360(not)-360(in)-361(the)-360(path,)-367(or)-361(if)-360(there)-360(is)-361(no)-360(`)]TJ/F4 10.91 Tf 237.76 0 TD[(PATH)]TJ/F1 10.91 Tf 22.91 0 TD[(')-360(en)27(vironmen)28(t)]TJ -308.32 -13.15 TD[(v)55(ariable.)-443(If)]TJ/F5 10.91 Tf 56.09 0 TD[(binary)]TJ/F1 10.91 Tf 35.21 0 TD[(is)-333(in)-333(the)-333(path,)-334(it)-333(returns)-333(the)-334(full)-333(path)-333(to)]TJ/F5 10.91 Tf 196.24 0 TD[(binary)]TJ/F1 10.91 Tf 30.64 0 TD[(.)]TJ/F4 10.91 Tf -375.78 -22.11 TD[(grep)]TJ/F5 10.91 Tf 26.55 0 TD[(\014lename)-389(regexp)]TJ/F4 10.91 Tf -26.55 -19.13 TD[(grep)]TJ/F5 10.91 Tf 26.55 0 TD[(\014lename)-389(regexp)]TJ/F4 10.91 Tf 78.85 0 TD[(line)]TJ/F1 10.91 Tf -47.8 -13.15 TD[(Searc)27(h)-385(the)-387(\014le)-386(called)]TJ/F5 10.91 Tf 104.47 0 TD[(\014lename)]TJ/F1 10.91 Tf 44.23 0 TD[(\(a)-386(fully)-387(sp)-27(eci\014ed)-387(path\))-386(for)-387(lines)-387(that)-386(con)27(tain)-386(a)]TJ -148.7 -13.15 TD[(matc)27(h)-410(for)-411(regular)-411(expression)]TJ/F5 10.91 Tf 142.72 0 TD[(regexp)]TJ/F1 10.91 Tf 31.24 0 TD[(.)-677(The)-411(result)-411(is)-411(a)-411(list)-411(of)-411(all)-411(the)-411(lines)-411(that)]TJ -173.96 -13.15 TD[(matc)27(h.)-574(If)-377(no)-377(lines)-377(matc)27(h,)-387(the)-377(result)-377(is)-377(an)-377(empt)26(y)-376(string.)-575(Sp)-28(ecify)]TJ/F5 10.91 Tf 313.81 0 TD[(regexp)]TJ/F1 10.91 Tf 35.68 0 TD[(using)]TJ -349.49 -13.15 TD[(the)-333(standard)-333(regular)-333(expression)-334(st)27(yle)-332(used)-334(b)27(y)-332(the)-334(Unix)-333(utilit)27(y)-332(program)]TJ/F4 10.91 Tf 341.39 0 TD[(grep)]TJ/F1 10.91 Tf 22.91 0 TD[(.)]TJ -364.3 -16.14 TD[(Use)-310(the)-311(optional)-311(third)-311(argumen)26(t)-309(`)]TJ/F4 10.91 Tf 160.11 0 TD[(line)]TJ/F1 10.91 Tf 22.91 0 TD[(')-310(to)-311(start)-311(lines)-311(in)-311(the)-311(result)-311(with)-311(the)-311(line)]TJ -183.02 -13.15 TD[(n)27(um)28(b)-27(er)-400(in)]TJ/F5 10.91 Tf 53.91 0 TD[(\014lename)]TJ/F1 10.91 Tf 39.4 0 TD[(.)-645(\(This)-400(argumen)27(t)-399(is)-400(simply)-401(an)-400(option)-400(\015ag;)-434(t)27(yp)-27(e)-400(it)-400(just)-400(as)]TJ -93.31 -13.16 TD[(sho)27(wn|`)]TJ/F4 10.91 Tf 43.39 0 TD[(line)]TJ/F1 10.91 Tf 22.91 0 TD[('.\))]TJ/F4 10.91 Tf -123.9 -22.11 TD[(diff)]TJ/F5 10.91 Tf 26.55 0 TD[(\014lename)-389(\014lename)]TJ/F1 10.91 Tf 31.05 -13.15 TD[(Compares)-373(the)-373(t)27(w)28(o)-372(\014les)-373(and)-373(returns)-373(a)-373(1)-373(if)-373(they)-373(matc)26(h,)-382(or)-373(a)-373(0)-373(if)-373(they)-373(don't.)-563(If)]TJ/F4 10.91 Tf 0 -13.15 TD[(verbose)]TJ/F1 10.91 Tf 43.73 0 TD[(is)-333(set,)-333(then)-333(it'll)-334(prin)27(t)-332(the)-334(di\013erences)-333(to)-333(the)-334(screen.)]TJ/F4 10.91 Tf -101.33 -22.12 TD[(slay)]TJ/F5 10.91 Tf 26.55 0 TD[(name)]TJ/F1 10.91 Tf 31.05 -13.15 TD[(This)-348(lo)-27(ok)-348(in)-349(the)-348(pro)-27(cess)-349(tab)-27(el)-348(for)]TJ/F5 10.91 Tf 163.49 0 TD[(name)]TJ/F1 10.91 Tf 29.86 0 TD[(and)-348(send)-348(it)-348(a)-348(unix)]TJ/F4 10.91 Tf 91.48 0 TD[(SIGINT)]TJ/F1 10.91 Tf 34.36 0 TD[(,)-351(killing)-348(the)]TJ -319.19 -13.15 TD[(pro)-27(cess.)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(absolute)]TJ/F5 10.91 Tf 49.45 0 TD[(path)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(This)-333(pro)-28(cedure)-333(tak)27(es)-332(the)-334(relativ)27(e)]TJ/F5 10.91 Tf 161.12 0 TD[(path)]TJ/F1 10.91 Tf 21.82 0 TD[(,)-333(and)-333(con)27(v)27(erts)-332(it)-333(to)-334(an)-333(absolute)-333(path.)]TJ/F4 10.91 Tf -240.54 -22.12 TD[(psource)]TJ/F5 10.91 Tf 43.73 0 TD[(\014lename)]TJ/F1 10.91 Tf 13.87 -13.15 TD[(This)-276(sources)-277(the)-276(\014le)]TJ/F5 10.91 Tf 96.52 0 TD[(\014lename)]TJ/F1 10.91 Tf 39.4 0 TD[(,)-287(and)-277(traps)-277(all)-276(errors.)-426(It)-276(also)-277(ignores)-277(all)-276(extraneous)]TJ -135.92 -13.15 TD[(output.)-444(If)-333(there)-334(w)27(as)-332(an)-333(error)-334(it)-333(returns)-333(a)-334(1,)-333(otherwise)-333(it)-334(returns)-333(a)-333(0.)]TJ ET 0 g 0 G
+endstream
+endobj
+162 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+160 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 162 0 R
+>>
+endobj
+165 0 obj
+<<
+/Length 6747
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(29)]TJ/F4 10.91 Tf 0 -23.91 TD[(prune)]TJ/F5 10.91 Tf 32.27 0 TD[(list)-355(pattern)]TJ/F1 10.91 Tf 25.33 -13.15 TD[(Remo)27(v)28(e)-386(elemen)27(ts)-386(of)-387(the)-387(Tcl)-387(list)]TJ/F5 10.91 Tf 158.02 0 TD[(list)]TJ/F1 10.91 Tf 14.61 0 TD[(.)-605(Elemen)27(ts)-386(are)-387(\014elds)-387(delimited)-387(b)27(y)-386(spaces.)]TJ -172.63 -13.15 TD[(The)-319(result)-320(is)-319(a)-320(cop)27(y)-319(of)]TJ/F5 10.91 Tf 109.86 0 TD[(list)]TJ/F1 10.91 Tf 14.61 0 TD[(,)-322(without)-319(an)26(y)-318(elemen)26(ts)-318(that)-320(matc)27(h)]TJ/F5 10.91 Tf 168.28 0 TD[(pattern)]TJ/F1 10.91 Tf 35.18 0 TD[(.)-439(Y)82(ou)-319(can)]TJ -327.93 -13.15 TD[(use)-333(the)-333(common)-333(shell)-334(wildcard)-333(c)27(haracters)-333(to)-333(sp)-28(ecify)]TJ/F5 10.91 Tf 251.85 0 TD[(pattern)]TJ/F1 10.91 Tf 35.18 0 TD[(.)]TJ/F4 10.91 Tf -344.63 -22.01 TD[(setenv)]TJ/F5 10.91 Tf 38 0 TD[(v)55(ar)-404(v)55(al)]TJ/F1 10.91 Tf 19.6 -13.15 TD[(Sets)-333(the)-333(v)54(ariable)]TJ/F5 10.91 Tf 82.82 0 TD[(v)55(ar)]TJ/F1 10.91 Tf 19.3 0 TD[(to)-333(the)-333(v)54(alue)]TJ/F5 10.91 Tf 60.3 0 TD[(v)55(al)]TJ/F1 10.91 Tf 13.64 0 TD[(.)]TJ/F4 10.91 Tf -233.66 -22 TD[(unsetenv)]TJ/F5 10.91 Tf 49.45 0 TD[(v)55(ar)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(Unsets)-333(the)-333(en)27(vironmen)27(t)-332(v)55(ariable)]TJ/F5 10.91 Tf 158.06 0 TD[(v)55(ar)]TJ/F4 10.91 Tf -215.66 -22 TD[(getenv)]TJ/F5 10.91 Tf 38 0 TD[(v)55(ar)]TJ/F1 10.91 Tf 19.6 -13.15 TD[(returns)-444(the)-445(v)54(alue)-444(of)]TJ/F5 10.91 Tf 101.96 0 TD[(v)55(ar)]TJ/F1 10.91 Tf 20.52 0 TD[(in)-444(the)-445(en)26(vironmen)28(t)-444(if)-445(it)-445(exists,)-472(otherwise)-445(it)-445(returns)]TJ/F4 10.91 Tf -122.48 -13.15 TD[(NULL)]TJ/F1 10.91 Tf 22.91 0 TD[(.)]TJ/F4 10.91 Tf -80.51 -22 TD[(runtest_file_p)]TJ/F5 10.91 Tf 83.82 0 TD[(run)27(tests)-373(testcase)]TJ/F1 10.91 Tf -26.22 -13.15 TD[(Searc)27(h)]TJ/F5 10.91 Tf 34.88 0 TD[(run)27(tests)]TJ/F1 10.91 Tf 42.13 0 TD[(for)]TJ/F5 10.91 Tf 16.7 0 TD[(testcase)]TJ/F1 10.91 Tf 41.34 0 TD[(and)-333(return)-334(1)-334(if)-334(found,)-334(0)-334(if)-334(not.)]TJ/F5 10.91 Tf 150.12 0 TD[(run)27(tests)]TJ/F1 10.91 Tf 42.12 0 TD[(is)-333(a)-334(list)-334(of)]TJ -327.29 -13.15 TD[(t)27(w)28(o)-327(elemen)26(ts.)-441(The)-329(\014rst)-328(is)-329(the)-328(pathname)-329(of)-328(the)-329(testsuite)-328(exp)-28(ect)-329(script)-328(running.)]TJ 0 -13.15 TD[(The)-317(second)-318(is)-318(a)-317(cop)26(y)-316(of)-318(what)-318(w)27(as)-317(on)-318(the)-317(righ)26(t)-316(side)-318(of)-318(the)]TJ/F4 10.91 Tf 274.86 0 TD[(=)]TJ/F1 10.91 Tf 9.2 0 TD[(if)-317(`)]TJ/F4 10.91 Tf 12.86 0 TD[(foo.exp="...")]TJ/F1 10.91 Tf 74.45 0 TD[(')]TJ -371.37 -13.15 TD[(w)27(as)-358(sp)-28(eci\014ed,)-366(or)-360(an)-359(empt)27(y)-359(string)-359(if)-360(no)-359(suc)26(h)-358(argumen)27(t)-359(is)-359(presen)26(t.)-522(This)-359(is)-360(used)]TJ 0 -13.15 TD[(b)27(y)-332(to)-28(ols)-333(lik)27(e)-333(compilers)-333(where)-333(eac)26(h)-332(testcase)-333(is)-334(a)-333(\014le.)]TJ/F4 10.91 Tf -57.6 -22 TD[(prune_system_crud)]TJ/F5 10.91 Tf 101 0 TD[(system)-333(text)]TJ/F1 10.91 Tf -43.4 -13.16 TD[(F)83(or)-320(system)]TJ/F5 10.91 Tf 55.49 0 TD[(system)]TJ/F1 10.91 Tf 32.55 0 TD[(,)-323(delete)-321(text)-321(the)-321(host)-322(or)-321(target)-321(op)-28(erating)-321(system)-321(migh)27(t)-320(issue)]TJ -88.04 -13.15 TD[(that)-230(will)-230(in)26(terfere)-229(with)-230(pattern)-231(matc)27(hing)-230(of)-230(program)-230(output)-231(in)]TJ/F5 10.91 Tf 291.96 0 TD[(text)]TJ/F1 10.91 Tf 19.09 0 TD[(.)-410(An)-230(example)]TJ -311.05 -13.15 TD[(is)-333(the)-333(message)-333(that)-334(is)-333(prin)27(ted)-333(if)-333(a)-333(shared)-334(library)-333(is)-333(out)-334(of)-333(date.)]TJ/F2 13.09 Tf -57.6 -29.73 TD[(5.3.4)-562(Cross)-375(target)-375(pro)-31(cedure)]TJ/F1 10.91 Tf 14.94 -23.07 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(lib/target.exp)]TJ/F1 10.91 Tf 80.19 0 TD[(')-333(de\014nes)-333(these)-333(utilit)26(y)-332(pro)-28(cedures:)]TJ/F4 10.91 Tf -98.16 -22.01 TD[(push_target)]TJ/F8 10.91 Tf 66.64 0 TD[(name)]TJ/F1 10.91 Tf -9.04 -13.15 TD[(This)-260(mak)27(es)-260(the)-261(target)-261(named)]TJ/F8 10.91 Tf 139.83 0 TD[(name)]TJ/F1 10.91 Tf 29.31 0 TD[(b)-27(e)-261(the)-261(curren)27(t)-260(target)-260(connection.)-421(The)-260(v)54(alue)]TJ -169.14 -13.15 TD[(of)]TJ/F8 10.91 Tf 12.39 0 TD[(name)]TJ/F1 10.91 Tf 30.08 0 TD[(is)-330(an)-331(index)-330(in)27(to)-330(the)]TJ/F4 10.91 Tf 96.27 0 TD[(target_info)]TJ/F1 10.91 Tf 66.6 0 TD[(arra)27(y)-329(and)-331(is)-330(set)-331(in)-330(the)-331(global)-330(con\014g)]TJ -205.34 -13.15 TD[(\014le.)]TJ/F4 10.91 Tf -57.6 -22 TD[(pop_target)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(This)-333(unsets)-333(the)-333(curren)26(t)-332(target)-333(connection.)]TJ/F4 10.91 Tf -57.6 -22 TD[(list_targets)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(This)-333(lists)-333(all)-333(the)-334(supp)-28(orted)-333(targets)-333(for)-334(this)-333(arc)27(hitecture.)]TJ/F4 10.91 Tf -57.6 -22 TD[(push_host)]TJ/F8 10.91 Tf 55.18 0 TD[(name)]TJ/F1 10.91 Tf 2.42 -13.15 TD[(This)-331(mak)27(es)-330(the)-331(host)-331(named)]TJ/F8 10.91 Tf 135.21 0 TD[(name)]TJ/F1 10.91 Tf 30.08 0 TD[(b)-27(e)-331(the)-331(curren)26(t)-330(remote)-331(host)-331(connection.)-444(The)]TJ -165.29 -13.15 TD[(v)55(alue)-350(of)]TJ/F8 10.91 Tf 40.99 0 TD[(name)]TJ/F1 10.91 Tf 30.3 0 TD[(is)-350(an)-351(index)-351(in)27(to)-350(the)]TJ/F4 10.91 Tf 97.38 0 TD[(target_info)]TJ/F1 10.91 Tf 66.82 0 TD[(arra)27(y)-350(and)-350(is)-351(set)-351(in)-351(the)-351(global)]TJ -235.49 -13.15 TD[(con\014g)-333(\014le.)]TJ/F4 10.91 Tf -57.6 -22 TD[(pop_host)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-333(unsets)-333(the)-333(curren)26(t)-332(host)-333(connection.)]TJ 0 -16.1 TD[(This)-344(in)27(v)28(ok)27(es)-343(the)-345(compiler)-344(as)-345(set)-344(b)27(y)]TJ/F4 10.91 Tf 172.34 0 TD[(CC)]TJ/F1 10.91 Tf 15.21 0 TD[(to)-344(compile)-344(the)-345(\014le)]TJ/F8 10.91 Tf 90.18 0 TD[(\014le)]TJ/F1 10.91 Tf 13.94 0 TD[(.)-477(The)-345(default)-344(op-)]TJ -291.67 -13.16 TD[(tions)-273(for)-274(man)27(y)-273(cross)-273(compilation)-274(targets)-274(are)]TJ/F8 10.91 Tf 209.44 0 TD[(guesse)51(d)]TJ/F1 10.91 Tf 38.96 0 TD[(b)27(y)-272(DejaGn)26(u,)-284(and)-274(these)-274(op-)]TJ -248.4 -13.15 TD[(tions)-294(can)-294(b)-27(e)-294(added)-295(to)-294(b)27(y)-293(passing)-294(in)-294(more)-294(parameters)-294(as)-294(argumen)27(ts)-293(to)]TJ/F4 10.91 Tf 331.28 0 TD[(compile)]TJ/F1 10.91 Tf 40.09 0 TD[(.)]TJ -371.37 -13.15 TD[(Optionally)83(,)-365(this)-360(will)-359(also)-360(use)-359(the)-360(v)55(alue)-359(of)-359(the)]TJ/F4 10.91 Tf 219.79 0 TD[(cflags)]TJ/F1 10.91 Tf 38.29 0 TD[(\014eld)-359(in)-359(the)-360(target)-359(con\014g)]TJ ET 0 g 0 G
+endstream
+endobj
+166 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F2 12 0 R
+/F8 52 0 R
+>>
+endobj
+164 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 166 0 R
+>>
+endobj
+169 0 obj
+<<
+/Length 6552
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(30)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 57.6 -23.91 TD[(arra)27(y)84(.)-463(If)-340(the)-340(host)-340(is)-339(not)-340(the)-340(same)-340(as)-340(the)-339(build)-340(mac)27(hines,)-341(then)-340(then)-340(compiler)-339(is)]TJ 0 -13.15 TD[(run)-333(on)-333(the)-333(remote)-334(host)-333(using)]TJ/F4 10.91 Tf 142.61 0 TD[(execute_anywhere)]TJ/F1 10.91 Tf 91.63 0 TD[(.)]TJ -234.24 -15.82 TD[(This)-370(pro)-27(duces)-370(an)-371(arc)27(hiv)28(e)-369(\014le.)-555(An)27(y)-369(parameters)-370(passed)-370(to)]TJ/F4 10.91 Tf 277.26 0 TD[(archive)]TJ/F1 10.91 Tf 44.13 0 TD[(are)-370(used)-370(in)]TJ -321.39 -13.15 TD[(addition)-453(to)-453(the)-453(default)-453(\015ags.)-803(Optionally)82(,)-482(this)-453(will)-453(also)-453(use)-453(the)-453(v)55(alue)-453(of)-453(the)]TJ/F4 10.91 Tf 0 -13.15 TD[(arflags)]TJ/F1 10.91 Tf 44.99 0 TD[(\014eld)-449(in)-450(the)-449(target)-450(con\014g)-449(arra)27(y)83(.)-792(If)-450(the)-449(host)-450(is)-449(not)-450(the)-449(same)-450(as)-450(the)]TJ -44.99 -13.15 TD[(build)-376(mac)27(hines,)-387(then)-377(then)-376(arc)26(hiv)28(er)-375(is)-377(run)-377(on)-377(the)-376(remote)-377(host)-377(using)]TJ/F4 10.91 Tf 328.58 0 TD[(execute_)]TJ -328.58 -13.15 TD[(anywhere)]TJ/F1 10.91 Tf 45.82 0 TD[(.)]TJ -45.82 -15.81 TD[(This)-325(generates)-326(an)-326(index)-326(for)-326(the)-326(arc)27(hiv)28(e)-325(\014le)-326(for)-326(systems)-326(that)-326(aren't)-326(POSIX)-326(y)27(et.)]TJ 0 -13.15 TD[(An)27(y)-332(parameters)-333(passed)-334(to)]TJ/F4 10.91 Tf 127.82 0 TD[(ranlib)]TJ/F1 10.91 Tf 38 0 TD[(are)-333(used)-333(in)-333(for)-334(the)-333(\015ags.)]TJ/F4 10.91 Tf -223.42 -21.15 TD[(execute_anywhere)]TJ/F8 10.91 Tf 95.27 0 TD[(cmd)-51(line)]TJ/F1 10.91 Tf -37.67 -13.15 TD[(This)-414(executes)-415(the)]TJ/F8 10.91 Tf 89.75 0 TD[(cmd)-51(line)]TJ/F1 10.91 Tf 42.7 0 TD[(on)-414(the)-415(prop)-28(er)-414(host.)-689(This)-414(should)-415(b)-28(e)-414(used)-415(as)-415(a)-414(re-)]TJ -132.45 -13.15 TD[(placemen)27(t)-362(for)-363(the)-363(Tcl)-363(command)]TJ/F4 10.91 Tf 158.01 0 TD[(exec)]TJ/F1 10.91 Tf 26.87 0 TD[(as)-363(this)-363(v)27(ersion)-362(utilizes)-363(the)-363(target)-363(con\014g)]TJ -184.88 -13.15 TD[(info)-281(to)-281(execute)-281(this)-281(command)-281(on)-281(the)-281(build)-281(mac)27(hine)-280(or)-282(a)-281(remote)-281(host.)-427(All)-281(con\014g)]TJ 0 -13.15 TD[(information)-339(for)-339(the)-340(remote)-339(host)-340(m)27(ust)-339(b)-27(e)-340(setup)-339(to)-340(ha)27(v)28(e)-339(this)-339(command)-340(w)27(ork.)-462(If)]TJ 0 -13.15 TD[(this)-285(is)-285(a)-285(canadian)-285(cross,)-295(\(where)-285(w)27(e)-284(test)-285(a)-286(cross)-285(compiler)-285(that)-285(runs)-285(on)-285(a)-285(di\013eren)26(t)]TJ 0 -13.15 TD[(host)-326(then)-327(where)-326(DejaGn)26(u)-325(is)-327(running\))-327(then)-326(a)-327(connection)-326(is)-327(made)-327(to)-326(the)-327(remote)]TJ 0 -13.15 TD[(host)-422(and)-422(the)-422(command)-422(is)-422(executed)-422(there.)-710(It)-422(returns)-422(either)]TJ/F8 10.91 Tf 293.73 0 TD[(REMOTERR)25(OR)]TJ/F1 10.91 Tf -293.73 -13.15 TD[(\(for)-354(an)-354(error\))-354(or)-354(the)-355(output)-354(pro)-27(duced)-355(when)-354(the)-354(command)-354(w)26(as)-353(executed.)-507(This)]TJ 0 -13.15 TD[(is)-333(used)-333(for)-333(running)-334(the)-333(to)-28(ol)-333(to)-334(b)-27(e)-334(tested,)-333(not)-333(a)-334(test)-333(case.)]TJ/F2 13.09 Tf -57.6 -25.92 TD[(5.3.5)-562(Debugging)-375(Pro)-31(cedures)]TJ/F1 10.91 Tf 14.94 -22.79 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(lib/debugger.exp)]TJ/F1 10.91 Tf 91.64 0 TD[(')-333(de\014nes)-333(these)-333(utilit)26(y)-332(pro)-28(cedures:)]TJ/F4 10.91 Tf -109.61 -21.14 TD[(dumpvars)]TJ/F8 10.91 Tf 49.45 0 TD[(expr)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(This)-387(tak)27(es)-386(a)-387(csh)-388(st)27(yle)-386(regular)-387(expression)-387(\(glob)-388(rules\))-387(and)-387(prin)27(ts)-387(the)-387(v)55(alues)-386(of)]TJ 0 -13.15 TD[(the)-333(global)-333(v)54(ariable)-332(names)-333(that)-334(matc)27(h.)-443(It)-334(is)-333(abbreviated)-333(as)]TJ/F4 10.91 Tf 282.06 0 TD[(dv)]TJ -339.66 -21.15 TD[(dumplocals)]TJ/F8 10.91 Tf 60.91 0 TD[(expr)]TJ/F1 10.91 Tf -3.31 -13.15 TD[(This)-387(tak)27(es)-386(a)-387(csh)-388(st)27(yle)-386(regular)-387(expression)-387(\(glob)-388(rules\))-387(and)-387(prin)27(ts)-387(the)-387(v)55(alues)-386(of)]TJ 0 -13.15 TD[(the)-333(lo)-28(cal)-333(v)55(ariable)-333(names)-333(that)-333(matc)26(h.)-443(It)-333(is)-334(abbreviated)-333(as)]TJ/F4 10.91 Tf 275.7 0 TD[(dl)]TJ/F1 10.91 Tf 11.45 0 TD[(.)]TJ/F4 10.91 Tf -344.75 -21.14 TD[(dumprocs)]TJ/F8 10.91 Tf 49.45 0 TD[(expr)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(This)-316(tak)27(es)-315(a)-317(csh)-316(st)27(yle)-315(regular)-317(expression)-316(\(glob)-316(rules\))-317(and)-316(prin)27(ts)-316(the)-316(b)-28(o)-27(dy)-317(of)-316(all)]TJ 0 -13.15 TD[(pro)-27(cs)-334(that)-333(matc)27(h.)-444(It)-333(is)-333(abbreviated)-334(as)]TJ/F4 10.91 Tf 185.7 0 TD[(dp)]TJ -243.3 -21.14 TD[(dumpwatch)]TJ/F8 10.91 Tf 55.18 0 TD[(expr)]TJ/F1 10.91 Tf 2.42 -13.15 TD[(This)-349(tak)27(es)-348(a)-349(csh)-349(st)26(yle)-348(regular)-349(expression)-349(\(glob)-349(rules\))-350(and)-349(prin)27(ts)-348(all)-349(the)-350(w)27(atc)28(h-)]TJ 0 -13.15 TD[(p)-27(oin)27(ts.)-444(It)-333(is)-334(abbreviated)-333(as)]TJ/F4 10.91 Tf 132.94 0 TD[(dw)]TJ/F1 10.91 Tf 11.45 0 TD[(.)]TJ/F4 10.91 Tf -201.99 -21.14 TD[(watchunset)]TJ/F8 10.91 Tf 60.91 0 TD[(var)]TJ/F1 10.91 Tf -3.31 -13.15 TD[(This)-262(breaks)-262(program)-262(execution)-263(when)-262(the)-262(v)54(ariable)]TJ/F8 10.91 Tf 234.51 0 TD[(var)]TJ/F1 10.91 Tf 19.23 0 TD[(is)-262(unset.)-421(It)-262(is)-262(abbreviated)]TJ -253.74 -13.15 TD[(as)]TJ/F4 10.91 Tf 13.39 0 TD[(wu)]TJ/F1 10.91 Tf 11.46 0 TD[(.)]TJ/F4 10.91 Tf -82.45 -21.14 TD[(watchwrite)]TJ/F8 10.91 Tf 60.91 0 TD[(var)]TJ/F1 10.91 Tf -3.31 -13.15 TD[(This)-326(breaks)-326(program)-326(execution)-326(when)-327(the)-326(v)55(ariable)]TJ/F8 10.91 Tf 239.4 0 TD[(var)]TJ/F1 10.91 Tf 19.93 0 TD[(is)-326(written.)-442(It)-326(is)-326(abbrevi-)]TJ -259.33 -13.15 TD[(ated)-333(as)]TJ/F4 10.91 Tf 37.64 0 TD[(ww)]TJ/F1 10.91 Tf 11.45 0 TD[(.)]TJ/F4 10.91 Tf -106.69 -21.15 TD[(watchread)]TJ/F8 10.91 Tf 55.18 0 TD[(var)]TJ/F1 10.91 Tf 2.42 -13.15 TD[(This)-301(breaks)-302(program)-302(execution)-301(when)-302(the)-302(v)55(ariable)]TJ/F8 10.91 Tf 237.53 0 TD[(var)]TJ/F1 10.91 Tf 19.66 0 TD[(is)-301(read.)-434(It)-302(is)-302(abbreviated)]TJ -257.19 -13.15 TD[(as)]TJ/F4 10.91 Tf 13.39 0 TD[(wr)]TJ/F1 10.91 Tf 11.46 0 TD[(.)]TJ ET 0 g 0 G
+endstream
+endobj
+170 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F8 52 0 R
+/F2 12 0 R
+>>
+endobj
+168 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 170 0 R
+>>
+endobj
+173 0 obj
+<<
+/Length 9272
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-333(The)-333(DejaGn)26(u)-332(Implemen)27(tation)-20437(31)]TJ/F4 10.91 Tf 0 -23.91 TD[(watchdel)]TJ/F8 10.91 Tf 49.45 0 TD[(watch)]TJ/F1 10.91 Tf 8.15 -13.15 TD[(This)-333(deletes)-333(a)-333(the)-334(w)27(atc)28(hp)-27(oin)27(t)-333(for)]TJ/F8 10.91 Tf 161.67 0 TD[(watch)]TJ/F1 10.91 Tf 27.04 0 TD[(.)-444(It)-333(is)-334(abbreviated)-333(as)]TJ/F4 10.91 Tf 103.79 0 TD[(wd)]TJ/F1 10.91 Tf 11.45 0 TD[(.)]TJ/F4 10.91 Tf -361.55 -21.59 TD[(print)]TJ/F8 10.91 Tf 32.27 0 TD[(var)]TJ/F1 10.91 Tf 25.33 0 TD[(This)-333(prin)27(ts)-332(the)-334(v)55(alue)-332(of)-334(the)-333(v)54(ariable)]TJ/F8 10.91 Tf 175.33 0 TD[(var)]TJ/F1 10.91 Tf 15.2 0 TD[(.)-444(It)-333(is)-334(abbreviated)-333(as)]TJ/F4 10.91 Tf 103.79 0 TD[(p)]TJ/F1 10.91 Tf 5.72 0 TD[(.)]TJ/F4 10.91 Tf -357.64 -21.58 TD[(quit)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-333(mak)27(es)-332(run)26(test)-332(exit.)-444(It)-334(is)-333(abbreviated)-333(as)]TJ/F4 10.91 Tf 216.73 0 TD[(q)]TJ/F1 10.91 Tf 5.73 0 TD[(.)]TJ/F4 10.91 Tf -280.06 -21.59 TD[(bt)]TJ/F1 10.91 Tf 57.6 0 TD[(This)-333(prin)27(ts)-332(a)-334(bac)27(ktrace)-332(of)-334(the)-333(executed)-333(Tcl)-334(commands.)]TJ/F2 14.35 Tf -57.6 -30.35 TD[(5.4)-562(T)93(arget)-374(dep)-31(enden)30(t)-374(pro)-31(cedures)]TJ/F1 10.91 Tf 14.94 -22.94 TD[(Eac)27(h)-398(com)27(bination)-399(of)-399(target)-400(and)-399(to)-28(ol)-400(requires)-399(some)-400(target-dep)-27(enden)26(t)-398(pro)-28(cedures.)-643(The)]TJ -14.94 -13.15 TD[(names)-258(of)-259(these)-259(pro)-27(cedures)-259(ha)27(v)27(e)-257(a)-259(common)-259(form:)-407(the)-259(to)-28(ol)-258(name,)-274(follo)27(w)28(ed)-258(b)27(y)-258(an)-259(underbar)-259(`)]TJ/F4 10.91 Tf 420.21 0 TD[(_)]TJ/F1 10.91 Tf 5.73 0 TD[(',)]TJ -425.94 -13.15 TD[(and)-288(\014nally)-289(a)-289(su\016x)-288(describing)-289(the)-289(pro)-27(cedure's)-289(purp)-28(ose.)-429(F)82(or)-288(example,)-297(a)-289(pro)-28(cedure)-289(to)-288(extract)]TJ 0 -13.15 TD[(the)-497(v)27(ersion)-496(from)]TJ/F7 10.91 Tf 87 0 TD[(gdb)]TJ/F1 10.91 Tf 25.55 0 TD[(is)-497(called)-497(`)]TJ/F4 10.91 Tf 48.49 0 TD[(gdb_version)]TJ/F1 10.91 Tf 63 0 TD[('.)-935(See)-498(Section)-497(5.2)-497([Initialization)-497(Mo)-28(dule],)]TJ -224.04 -13.15 TD[(page)-419(22,)-440(for)-420(a)-419(discussion)-419(of)-419(ho)27(w)-419(DejaGn)27(u)-418(arranges)-419(to)-420(\014nd)-419(the)-419(righ)27(t)-418(pro)-28(cedures)-419(for)-420(eac)27(h)]TJ 0 -13.15 TD[(target.)]TJ/F4 10.91 Tf 14.94 -15.97 TD[(runtest)]TJ/F1 10.91 Tf 44.72 0 TD[(itself)-423(calls)-424(only)-424(t)27(w)28(o)-423(of)-424(these)-424(pro)-27(cedures,)]TJ/F5 10.91 Tf 200.79 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_exit)]TJ/F1 10.91 Tf 33.26 0 TD[(and)]TJ/F5 10.91 Tf 22.2 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_version)]TJ/F1 10.91 Tf 45.82 0 TD[(;)-468(these)]TJ -399.55 -13.15 TD[(pro)-27(cedures)-334(use)-333(no)-333(argumen)27(ts.)]TJ 14.94 -15.96 TD[(The)-334(other)-334(t)27(w)28(o)-333(pro)-28(cedures,)]TJ/F5 10.91 Tf 129.58 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.92 0 TD[(_start)]TJ/F1 10.91 Tf 38.01 0 TD[(and)]TJ/F5 10.91 Tf 21.22 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_load)]TJ/F1 10.91 Tf 28.64 0 TD[(,)-334(are)-334(only)-334(called)-334(b)27(y)-333(the)-334(test)-334(suites)]TJ -270.22 -13.15 TD[(themselv)27(es)-410(\(or)-410(b)26(y)-410(testsuite-sp)-27(eci\014c)-411(initialization)-411(co)-28(de\);)-449(they)-411(ma)26(y)-409(tak)26(e)-410(argumen)27(ts)-410(or)-410(not,)]TJ 0 -13.15 TD[(dep)-27(ending)-334(on)-333(the)-333(con)27(v)27(en)28(tions)-332(used)-334(within)-333(eac)27(h)-332(test)-334(suite.)]TJ/F5 10.91 Tf 0 -21.59 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_start)]TJ/F1 10.91 Tf 38.69 -13.15 TD[(Starts)-236(a)-237(particular)-237(to)-28(ol.)-412(F)82(or)-236(an)-236(in)26(teractiv)28(e)-236(to)-28(ol,)]TJ/F5 10.91 Tf 224.07 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_start)]TJ/F1 10.91 Tf 36.95 0 TD[(starts)-236(and)-237(initializes)]TJ -279.93 -13.15 TD[(the)-308(to)-27(ol,)-314(lea)27(ving)-307(the)-308(to)-28(ol)-308(up)-309(and)-308(running)-308(for)-308(the)-308(test)-309(cases;)-316(an)-308(example)-309(is)]TJ/F4 10.91 Tf 351.49 0 TD[(gdb_)]TJ -351.49 -13.15 TD[(start)]TJ/F1 10.91 Tf 28.64 0 TD[(,)-463(the)-438(start)-438(function)-437(for)]TJ/F7 10.91 Tf 117 0 TD[(gdb)]TJ/F1 10.91 Tf 20.14 0 TD[(.)-757(F)82(or)-436(a)-438(batc)27(h)-437(orien)27(ted)-437(to)-28(ol,)]TJ/F5 10.91 Tf 143.24 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_start)]TJ/F1 10.91 Tf 39.14 0 TD[(is)]TJ -367.07 -13.15 TD[(optional;)-287(the)-266(recommended)-265(con)27(v)28(en)28(tion)-264(is)-266(to)-265(let)]TJ/F5 10.91 Tf 223.01 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_start)]TJ/F1 10.91 Tf 37.26 0 TD[(run)-265(the)-265(to)-28(ol,)-278(lea)26(ving)]TJ -279.18 -13.15 TD[(the)-448(output)-448(in)-449(a)-448(v)55(ariable)-448(called)]TJ/F4 10.91 Tf 155.74 0 TD[(comp_output)]TJ/F1 10.91 Tf 63 0 TD[(.)-789(T)82(est)-447(scripts)-448(can)-449(then)-448(analyze)]TJ -218.74 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[($comp_output)]TJ/F1 10.91 Tf 68.73 0 TD[(')-349(to)-349(determine)-350(the)-349(test)-350(results.)-492(An)-350(example)-349(of)-349(this)-350(second)-349(kind)]TJ -71.76 -13.15 TD[(of)-333(start)-333(function)-333(is)]TJ/F4 10.91 Tf 92.27 0 TD[(gcc_start)]TJ/F1 10.91 Tf 51.55 0 TD[(,)-333(the)-333(start)-333(function)-334(for)]TJ/F7 10.91 Tf 111.03 0 TD[(gcc)]TJ/F1 10.91 Tf 19.89 0 TD[(.)]TJ/F4 10.91 Tf -274.74 -15.96 TD[(runtest)]TJ/F1 10.91 Tf 42.52 0 TD[(itself)]TJ/F8 10.91 Tf 25.21 0 TD[(do)51(es)-255(not)-255(c)50(al)-50(l)]TJ/F5 10.91 Tf 60.7 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_start)]TJ/F1 10.91 Tf 34.37 0 TD[(.)-407(The)-222(initialization)-222(mo)-28(dule)-222(`)]TJ/F5 10.91 Tf 131.41 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.92 0 TD[(_init.exp)]TJ/F1 10.91 Tf 51.54 0 TD[(')]TJ -383.58 -13.15 TD[(m)27(ust)-383(call)]TJ/F5 10.91 Tf 48.14 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.92 0 TD[(_start)]TJ/F1 10.91 Tf 38.55 0 TD[(for)-384(in)27(teractiv)28(e)-383(to)-28(ols;)-410(for)-384(batc)27(h-orien)27(ted)-383(to)-28(ols,)-397(eac)27(h)-383(indi-)]TJ -105.61 -13.15 TD[(vidual)-444(test)-445(script)-445(calls)]TJ/F5 10.91 Tf 113.86 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_start)]TJ/F1 10.91 Tf 39.22 0 TD[(\(or)-444(mak)27(es)-444(other)-445(arrangemen)27(ts)-444(to)-444(run)-445(the)]TJ -171.99 -13.15 TD[(to)-27(ol\).)]TJ/F5 10.91 Tf -57.6 -21.59 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_load)]TJ/F1 10.91 Tf 38.69 0 TD[(Loads)-272(something)-272(in)26(to)-271(a)-273(to)-27(ol.)-425(F)83(or)-272(an)-272(in)27(teractiv)27(e)-271(to)-28(ol,)-285(this)-272(conditions)-272(the)-273(to)-28(ol)-272(for)]TJ 0 -13.15 TD[(a)-379(particular)-381(test)-380(case;)-403(for)-380(example,)]TJ/F4 10.91 Tf 172.74 0 TD[(gdb_load)]TJ/F1 10.91 Tf 49.96 0 TD[(loads)-379(a)-381(new)-380(executable)-380(\014le)-380(in)27(to)]TJ -222.7 -13.15 TD[(the)-263(debugger.)-421(F)82(or)-262(batc)27(h)-263(orien)27(ted)-262(to)-28(ols,)]TJ/F5 10.91 Tf 186.99 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.92 0 TD[(_load)]TJ/F1 10.91 Tf 31.51 0 TD[(ma)27(y)-262(do)-263(nothing|though,)-278(for)]TJ -237.42 -13.15 TD[(example,)-276(the)]TJ/F7 10.91 Tf 63.15 0 TD[(gcc)]TJ/F1 10.91 Tf 22.75 0 TD[(supp)-27(ort)-263(uses)]TJ/F4 10.91 Tf 62 0 TD[(gcc_load)]TJ/F1 10.91 Tf 48.67 0 TD[(to)-262(load)-262(and)-262(run)-262(a)-263(binary)-262(on)-262(the)-262(target)]TJ -196.57 -13.15 TD[(en)27(vironmen)28(t.)-674(Con)27(v)28(en)28(tionally)83(,)]TJ/F5 10.91 Tf 147.53 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_load)]TJ/F1 10.91 Tf 33.12 0 TD[(lea)27(v)28(es)-409(the)-410(output)-410(of)-410(an)26(y)-409(program)-410(it)]TJ -199.56 -13.15 TD[(runs)-414(in)-415(a)-414(v)54(ariable)-413(called)-415(`)]TJ/F4 10.91 Tf 125.46 0 TD[(exec_output)]TJ/F1 10.91 Tf 63 0 TD[('.)-688(W)83(riting)]TJ/F5 10.91 Tf 54.48 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.92 0 TD[(_load)]TJ/F1 10.91 Tf 33.16 0 TD[(can)-414(b)-28(e)-414(the)-415(most)]TJ -295.02 -13.15 TD[(complex)-297(part)-298(of)-298(extending)-298(DejaGn)27(u)-297(to)-298(a)-297(new)-298(to)-28(ol)-298(or)-298(a)-297(new)-298(target,)-305(if)-298(it)-298(requires)]TJ 0 -13.16 TD[(m)27(uc)28(h)-332(comm)27(unication)-333(co)-28(ding)-333(or)-333(\014le)-334(do)27(wnloading.)]TJ 0 -15.96 TD[(T)83(est)-332(scripts)-334(call)]TJ/F5 10.91 Tf 78.7 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_load)]TJ/F1 10.91 Tf 28.64 0 TD[(.)]TJ/F5 10.91 Tf -183.85 -21.58 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_exit)]TJ/F1 10.91 Tf 38.69 0 TD[(Cleans)-375(up)-375(\(if)-375(necessary\))-375(b)-28(efore)]TJ/F4 10.91 Tf 152.82 0 TD[(runtest)]TJ/F1 10.91 Tf 44.19 0 TD[(exits.)-569(F)82(or)-374(in)27(teractiv)28(e)-375(to)-27(ols,)-386(this)-375(usu-)]TJ -197.01 -13.15 TD[(ally)-425(ends)-425(the)-425(in)27(teractiv)28(e)-424(session.)-719(Y)82(ou)-424(can)-425(also)-425(use)]TJ/F5 10.91 Tf 252.61 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_exit)]TJ/F1 10.91 Tf 33.27 0 TD[(to)-425(remo)27(v)28(e)-424(an)27(y)]TJ -304.79 -13.15 TD[(temp)-27(orary)-334(\014les)-333(left)-333(o)27(v)27(er)-332(from)-333(the)-334(tests.)]TJ/F4 10.91 Tf 0 -15.97 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(calls)]TJ/F5 10.91 Tf 24.3 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_exit)]TJ/F1 10.91 Tf 28.64 0 TD[(.)]TJ ET 0 g 0 G
+endstream
+endobj
+174 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F8 52 0 R
+/F2 12 0 R
+/F7 49 0 R
+/F5 31 0 R
+>>
+endobj
+172 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 174 0 R
+>>
+endobj
+178 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 686.11
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-270 -250 1011 948]
+/FontName /CMB10
+/ItalicAngle 0
+/XHeight 444
+/StemV 80
+/FontFile 177 0 R
+>>
+endobj
+179 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F13
+/FontDescriptor 178 0 R
+/BaseFont /EUXRYM+CMB10
+/FirstChar 0
+/LastChar 127
+/Widths [600 833.34 777.78 700 666.67 783.34 722.22 777.78 722.22 777.78 722.22 583.34
+555.56 555.56 833.34 833.34 277.78 305.56 500 500 500 500 500 755.56 444.45 559.72
+722.22 777.78 500 905.56 1016.67 777.78 277.78 305.56 544.45 833.34 500 833.34 777.78
+277.78 388.89 388.89 500 777.78 277.78 333.33 277.78 500 500 500 500 500 500 500
+500 500 500 500 277.78 277.78 305.56 777.78 472.22 472.22 777.78 755.56 711.11 722.22
+766.67 655.56 627.78 786.11 783.34 397.22 516.67 783.34 600 950 783.34 750 683.34
+750 759.72 555.56 694.45 769.45 755.56 1033.34 755.56 755.56 611.11 280 544.45 280
+500 277.78 277.78 486.11 555.56 444.45 555.56 466.67 305.56 500 555.56 277.78 305.56
+527.78 277.78 833.34 555.56 500 555.56 527.78 427.78 394.45 390.28 555.56 527.78
+722.22 527.78 527.78 444.45 500 1000 500 500 500]
+>>
+endobj
+180 0 obj
+<<
+/Length 8736
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(32)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F5 10.91 Tf 0 -23.91 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_version)]TJ/F1 10.91 Tf 38.69 -13.15 TD[(Prin)27(ts)-408(the)-409(v)26(ersion)-408(lab)-28(el)-409(and)-410(n)27(um)28(b)-27(er)-409(for)]TJ/F5 10.91 Tf 198.32 0 TD[(to)-27(ol)]TJ/F1 10.91 Tf 18.49 0 TD[(.)-672(This)-409(is)-410(called)-409(b)27(y)-409(the)-409(DejaGn)27(u)]TJ -216.81 -13.15 TD[(pro)-27(cedure)-357(that)-357(prin)27(ts)-355(the)-357(\014nal)-357(summary)-356(rep)-28(ort.)-515(The)-356(output)-357(should)-357(consist)-356(of)]TJ 0 -13.15 TD[(the)-333(full)-333(path)-333(name)-334(used)-333(for)-333(the)-334(tested)-333(to)-28(ol,)-333(and)-334(its)-333(v)27(ersion)-332(n)26(um)28(b)-27(er.)]TJ/F4 10.91 Tf 0 -16.14 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(calls)]TJ/F5 10.91 Tf 24.3 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_version)]TJ/F1 10.91 Tf 45.82 0 TD[(.)]TJ -175.42 -19.13 TD[(The)-352(usual)-353(con)27(v)28(en)28(tion)-352(for)-352(return)-353(co)-28(des)-352(from)-353(an)27(y)-352(of)-352(these)-353(pro)-27(cedures)-353(\(although)-353(it)-352(is)-353(not)]TJ -14.94 -13.15 TD[(required)-296(b)27(y)]TJ/F4 10.91 Tf 57.13 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(\))-296(is)-296(to)-297(return)]TJ/F4 10.91 Tf 63.97 0 TD[(0)]TJ/F1 10.91 Tf 8.96 0 TD[(if)-296(the)-296(pro)-28(cedure)-296(succeeded,)]TJ/F4 10.91 Tf 131.32 0 TD[(1)]TJ/F1 10.91 Tf 8.96 0 TD[(if)-296(it)-296(failed,)-304(and)]TJ/F4 10.91 Tf 73.01 0 TD[(-1)]TJ/F1 10.91 Tf 14.69 0 TD[(if)-296(there)]TJ -398.13 -13.15 TD[(w)27(as)-332(a)-333(comm)26(unication)-332(error.)]TJ/F2 14.35 Tf 0 -30.89 TD[(5.5)-562(Remote)-375(targets)-375(supp)-31(orted)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(The)-400(DejaGn)27(u)-399(distribution)-400(includes)-400(supp)-28(ort)-400(for)-400(the)-400(follo)27(wing)-399(remote)-400(targets.)-645(Y)82(ou)-399(can)]TJ -14.94 -13.15 TD[(set)-384(the)-384(target)-385(name)-384(and)-385(the)-384(connect)-385(mo)-27(de)-385(in)-384(the)-385(`)]TJ/F4 10.91 Tf 246.58 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.81 0 TD[(')-384(\014le)-384(\(using)-385(the)-384(Tcl)-385(v)55(ariables)]TJ -292.39 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(targetname)]TJ/F1 10.91 Tf 57.27 0 TD[(')-428(and)-428(`)]TJ/F4 10.91 Tf 32.98 0 TD[(connectmode)]TJ/F1 10.91 Tf 63 0 TD[(',)-451(resp)-28(ectiv)27(ely\),)-451(or)-428(on)-428(the)]TJ/F4 10.91 Tf 129.44 0 TD[(runtest)]TJ/F1 10.91 Tf 44.76 0 TD[(command)-428(line)-428(\(using)]TJ -330.48 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(--name)]TJ/F1 10.91 Tf 34.36 0 TD[(')-333(and)-333(`)]TJ/F4 10.91 Tf 30.91 0 TD[(--connect)]TJ/F1 10.91 Tf 51.55 0 TD[('\).)]TJ/F7 10.91 Tf -119.85 -19.13 TD[(amd)]TJ/F13 10.91 Tf 25.28 0 TD[(29000,)-333(with)-333(UDI)-333(proto)-28(col)]TJ/F1 10.91 Tf 32.32 -13.15 TD[(Con\014gure)-314(DejaGn)27(u)-314(for)-315(target)-314(`)]TJ/F4 10.91 Tf 146.78 0 TD[(a29k-amd-udi)]TJ/F1 10.91 Tf 68.72 0 TD[('.)-438(\(Cygn)27(us)]TJ/F4 10.91 Tf 53.73 0 TD[(configure)]TJ/F1 10.91 Tf 54.98 0 TD[(also)-314(recog-)]TJ -324.21 -13.15 TD[(nizes)-398(the)-399(abbreviation)-398(`)]TJ/F4 10.91 Tf 114.05 0 TD[(udi29k)]TJ/F1 10.91 Tf 34.36 0 TD[('.\))-640(Then,)-415(to)-398(run)-399(tests,)-415(use)-398(the)]TJ/F4 10.91 Tf 153.04 0 TD[(runtest)]TJ/F1 10.91 Tf 44.44 0 TD[(target)]TJ -345.89 -13.15 TD[(name)-314(to)-314(sp)-28(ecify)-314(whether)-314(y)26(ou)-313(w)27(an)28(t)-314(to)-314(use)-314(a)-314(sim)26(ulator,)-317(or)-314(a)-314(particular)-315(hardw)27(are)]TJ 0 -13.15 TD[(b)-27(oard.)-741(The)-432(particular)-432(string)-432(to)-432(use)-432(with)-432(`)]TJ/F4 10.91 Tf 209.02 0 TD[(--name)]TJ/F1 10.91 Tf 34.36 0 TD[(')-431(will)-432(dep)-28(end)-432(on)-432(y)27(our)-431(UDI)]TJ -243.38 -13.16 TD[(setup)-415(\014le,)-437(`)]TJ/F4 10.91 Tf 54.81 0 TD[(udi_soc)]TJ/F1 10.91 Tf 40.09 0 TD[(')-415(\(if)-416(`)]TJ/F4 10.91 Tf 25.74 0 TD[(udi_soc)]TJ/F1 10.91 Tf 40.09 0 TD[(')-415(is)-416(not)-416(in)-416(y)27(our)-415(w)27(orking)-415(directory)82(,)-435(the)-416(en)27(vi-)]TJ -160.73 -13.15 TD[(ronmen)27(t)-334(v)55(ariable)-335(`)]TJ/F4 10.91 Tf 87.38 0 TD[(UDICONF)]TJ/F1 10.91 Tf 40.09 0 TD[(')-335(should)-335(con)27(tain)-335(a)-335(path)-335(to)-336(this)-335(\014le\).)-450(F)82(or)-334(example,)-336(if)]TJ -127.47 -13.15 TD[(y)27(our)-332(UDI)-333(setup)-334(\014le)-333(includes)-333(these)-334(lines:)]TJ/F9 9.96 Tf -57.6 -12.43 TD[(\013)]TJ ET 23.98 -328.05 m 450.40 -328.05 l 450.40 -327.65 l 23.98 -327.65 l b BT 456.38 -328.05 TD[(\010)]TJ ET 18.00 -365.20 m 18.40 -365.20 l 18.40 -333.78 l 18.00 -333.78 l b BT/F4 10.91 Tf 21.39 -347.33 TD[(iss)-1574(AF_UNIX)-1050(*)-1575(isstip)-525(-r)-525(/home/gnu/29k/src/osboot/sim/osboot)]TJ 0 -12.45 TD[(mon)-1574(AF_UNIX)-1050(*)-1575(montip)-525(-t)-525(serial)-525(-baud)-525(9600)-525(-com)-525(/dev/ttyb)]TJ ET 456.38 -365.20 m 456.77 -365.20 l 456.77 -333.78 l 456.38 -333.78 l b BT/F9 9.96 Tf 18 -371.42 TD[(\012)]TJ ET 23.98 -371.42 m 450.40 -371.42 l 450.40 -371.03 l 23.98 -371.03 l b BT 456.38 -371.42 TD[(\011)]TJ/F1 10.91 Tf -380.78 -20.38 TD[(Y)83(ou)-394(can)-396(use)-395(`)]TJ/F4 10.91 Tf 66.33 0 TD[(--name)-333(iss)]TJ/F1 10.91 Tf 55.18 0 TD[(')-395(to)-395(run)-395(tests)-396(on)-395(the)-395(sim)27(ulator,)-410(and)-396(`)]TJ/F4 10.91 Tf 180.67 0 TD[(--name)-333(mon)]TJ/F1 10.91 Tf 55.18 0 TD[(')-395(to)]TJ -357.36 -13.15 TD[(run)-382(tests)-383(on)-383(the)-383(29K)-383(hardw)26(are.)-592(See)-383(the)-383(man)27(ufacturer's)-382(man)27(uals)-382(for)-383(more)-383(in-)]TJ 0 -13.15 TD[(formation)-333(on)-333(UDI)-333(and)-334(`)]TJ/F4 10.91 Tf 113.52 0 TD[(udi_soc)]TJ/F1 10.91 Tf 40.09 0 TD[('.)]TJ -153.61 -16.14 TD[(The)-381(default)-381(connect)-381(proto)-28(col)-381(is)-381(`)]TJ/F4 10.91 Tf 158.46 0 TD[(mondfe)]TJ/F1 10.91 Tf 34.36 0 TD[(')-381(with)-381(either)-381(bac)27(k)-380(end.)]TJ/F4 10.91 Tf 116.42 0 TD[(mondfe)]TJ/F1 10.91 Tf 38.52 0 TD[(is)-381(the)]TJ -347.76 -13.15 TD[(only)-239(shell)-240(DejaGn)27(u)-239(supp)-28(orts)-240(for)-239(UDI)-240(targets.)]TJ/F4 10.91 Tf 214.55 0 TD[(mondfe)]TJ/F1 10.91 Tf 36.98 0 TD[(is)-239(an)]TJ/F7 10.91 Tf 24.08 0 TD[(amd)]TJ/F1 10.91 Tf 24.27 0 TD[(sp)-27(eci\014c)-240(monitor)]TJ -299.88 -13.15 TD[(program)-333(freely)-333(a)27(v)55(ailable)-332(from)]TJ/F7 10.91 Tf 144.06 0 TD[(amd)]TJ/F1 10.91 Tf 21.65 0 TD[(.)]TJ/F8 10.91 Tf -165.71 -16.14 TD[(Warning:)]TJ/F1 10.91 Tf 50.85 0 TD[(This)-347(target)-348(requires)]TJ/F7 10.91 Tf 98.57 0 TD[(gdb)]TJ/F1 10.91 Tf 23.93 0 TD[(v)27(ersion)-347(4.7.2)-348(\(or)-347(greater\).)-489(Earlier)-348(v)27(ersions)]TJ -173.35 -13.15 TD[(of)]TJ/F7 10.91 Tf 12.18 0 TD[(gdb)]TJ/F1 10.91 Tf 23.52 0 TD[(do)-310(not)-311(fully)-310(supp)-28(ort)-311(the)]TJ/F4 10.91 Tf 117.34 0 TD[(load)]TJ/F1 10.91 Tf 26.3 0 TD[(command)-310(on)-311(this)-310(target,)-316(so)-310(DejaGn)27(u)-310(has)]TJ -179.34 -13.15 TD[(no)-333(w)27(a)28(y)-333(to)-333(load)-333(executable)-334(\014les)-333(from)-333(the)-334(debugger.)]TJ/F13 10.91 Tf -57.6 -19.13 TD[(Motorola)-333(680x0)-333(b)-28(oards,)-333(a.out)-334(or)]TJ/F7 10.91 Tf 159.15 0 TD[(coff)]TJ/F13 10.91 Tf 28.7 0 TD[(ob)-55(ject)-333(format)]TJ/F1 10.91 Tf -130.25 -13.15 TD[(Con\014gure)-333(DejaGn)27(u)-332(for)-334(an)27(y)-332(remote)-334(target)-333(matc)27(hing)-332(`)]TJ/F4 10.91 Tf 252.17 0 TD[(m68k-*)]TJ/F1 10.91 Tf 34.36 0 TD[('.)]TJ/F8 10.91 Tf -286.53 -16.14 TD[(Warning:)]TJ/F1 10.91 Tf 53.35 0 TD[(Most)-462(`)]TJ/F4 10.91 Tf 32.07 0 TD[(m68k-*)]TJ/F1 10.91 Tf 34.36 0 TD[(')-462(con\014gurations)-462(run)-462(all)-463(tests)-462(only)-462(for)-463(nativ)27(e)-461(testing)]TJ -119.78 -13.15 TD[(\(when)-432(the)-432(target)-432(is)-433(the)-432(same)-432(as)-433(the)-432(host\).)-741(When)-433(y)27(ou)-431(sp)-28(ecify)-432(most)-433(of)-432(these)]TJ 0 -13.15 TD[(targets)-432(for)-432(a)-433(cross)-432(con\014guration,)-457(y)27(ou)-432(will)-432(only)-433(b)-27(e)-433(able)-432(to)-433(use)-432(tests)-432(that)-433(run)]TJ 0 -13.15 TD[(completely)-281(within)-282(the)-281(host)-282(\(for)-281(example,)-292(tests)-281(of)-282(the)-281(binary)-282(utilities)-281(suc)26(h)-280(as)-282(the)]TJ 0 -13.16 TD[(arc)27(hiv)28(er;)-332(or)-334(compiler)-333(tests)-333(that)-334(only)-333(generate)-333(co)-28(de)-333(rather)-334(than)-333(running)-333(it\).)]TJ 0 -16.14 TD[(T)83(o)-292(run)-293(a.out)-293(or)]TJ/F7 10.91 Tf 75.58 0 TD[(coff)]TJ/F1 10.91 Tf 28.26 0 TD[(binaries)-293(on)-293(a)-293(remote)-293(M68K,)-293(y)27(ou)-292(m)27(ust)-292(con\014gure)-293(DejaGn)26(u)]TJ -103.84 -13.15 TD[(for)-405(a)-405(particular)-406(target)-405(b)-28(oard.)-661(`)]TJ/F4 10.91 Tf 152.32 0 TD[(m68k-abug)]TJ/F1 10.91 Tf 51.55 0 TD[(')-405(is)-405(an)-406(example.)-660(\(In)-406(general)-405(for)-406(an)]TJ ET 0 g 0 G
+endstream
+endobj
+181 0 obj
+<<
+/F1 9 0 R
+/F5 31 0 R
+/F4 28 0 R
+/F2 12 0 R
+/F7 49 0 R
+/F13 179 0 R
+/F9 59 0 R
+/F8 52 0 R
+>>
+endobj
+176 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 181 0 R
+>>
+endobj
+184 0 obj
+<<
+/Length 7898
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(33)]TJ 57.6 -23.91 TD[(em)27(b)-26(edded)-397(en)27(vironmen)27(t,)-411(b)-28(ecause)-396(it)-397(do)-28(es)-396(not)-397(ha)27(v)28(e)-396(absolute)-397(addresses,)-412(a.out)-397(is)]TJ 0 -13.15 TD[(not)-273(a)-273(go)-28(o)-27(d)-274(c)27(hoice)-272(for)-273(output)-274(format)-273(in)-273(an)27(y)-272(case;)-294(most)-273(often)-273(S-records)-273(or)-273(Hex-32)]TJ 0 -13.15 TD[(are)-333(used)-333(instead.\))]TJ/F13 10.91 Tf -57.6 -19.13 TD[(Motorola)-333(68K)-333(MVME)-333(135)-334(b)-28(oard)-333(running)-333(ABug)-334(b)-27(o)-28(ot)-334(monitor)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(Con\014gure)-339(for)-340(`)]TJ/F4 10.91 Tf 69.59 0 TD[(m68k-abug-aout)]TJ/F1 10.91 Tf 80.19 0 TD[(')-339(or)-340(`)]TJ/F4 10.91 Tf 23.19 0 TD[(m68k-abug-coff)]TJ/F1 10.91 Tf 80.19 0 TD[(')-339(\(as)-340(a)-340(target\).)-463(This)-340(b)-28(o)-27(ot)]TJ -253.16 -13.15 TD[(monitor)-473(can)-474(only)-474(do)27(wnload)-473(S-records;)-544(therefore,)-509(the)-474(DejaGn)27(u)-473(tests)-474(for)-474(this)]TJ 0 -13.15 TD[(en)27(vironmen)28(t)-378(require)-379(a)-380(link)27(er)-378(command)-379(script)-379(to)-380(con)27(v)28(ert)-378(either)-380(output)-379(format)]TJ 0 -13.15 TD[(to)-333(S-records,)-333(setting)-333(the)-334(default)-333(addresses)-333(for)]TJ/F4 10.91 Tf 219.82 0 TD[(.text)]TJ/F1 10.91 Tf 28.64 0 TD[(,)]TJ/F4 10.91 Tf 6.66 0 TD[(.bss)]TJ/F1 10.91 Tf 22.91 0 TD[(,)-333(and)]TJ/F4 10.91 Tf 27.88 0 TD[(.data)]TJ/F1 10.91 Tf 28.64 0 TD[(.)]TJ -334.55 -16.14 TD[(With)-355(this)-355(con\014guration,)-361(the)-355(default)-355(for)-355(`)]TJ/F4 10.91 Tf 195.25 0 TD[(--connect)]TJ/F1 10.91 Tf 51.54 0 TD[(')-355(is)-355(`)]TJ/F4 10.91 Tf 21.15 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[('.)-510(`)]TJ/F4 10.91 Tf 14.66 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[(')-355(is)-355(the)-355(only)]TJ -316.96 -13.16 TD[(comm)27(unications)-422(proto)-28(col)-423(supp)-27(orted)-424(for)-423(connecting)-423(to)-423(`)]TJ/F4 10.91 Tf 267.91 0 TD[(m68k-abug-*)]TJ/F1 10.91 Tf 63 0 TD[(')-423(targets.)]TJ -330.91 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[(')-314(uses)-315(an)]TJ/F7 10.91 Tf 44.36 0 TD[(asci)-22(i)]TJ/F1 10.91 Tf 28.4 0 TD[(do)27(wnloader)-313(\(the)]TJ/F4 10.91 Tf 80.53 0 TD[(~put)]TJ/F1 10.91 Tf 26.34 0 TD[(command\))-314(to)-315(load)-314(S-records)-315(in)27(to)-314(the)]TJ -199.84 -13.15 TD[(target)-405(b)-28(oard.)-663(The)-406(`)]TJ/F4 10.91 Tf 97.05 0 TD[(--name)]TJ/F1 10.91 Tf 34.37 0 TD[(')-405(string)-406(m)26(ust)-405(b)-27(e)-406(a)-406(mac)26(hine)-405(name)-406(that)]TJ/F4 10.91 Tf 190.43 0 TD[(tip)]TJ/F1 10.91 Tf 21.61 0 TD[(under-)]TJ -343.46 -13.15 TD[(stands)-404(\(for)-405(example,)-423(on)-405(some)]TJ/F4 10.91 Tf 147.34 0 TD[(tip)]TJ/F1 10.91 Tf 21.59 0 TD[(implemen)27(tations)-404(it)-404(m)26(ust)-403(b)-28(e)-405(an)-405(en)27(try)-404(from)]TJ -168.93 -13.15 TD[(the)-333(initialization)-333(\014le)-333(for)]TJ/F4 10.91 Tf 116.7 0 TD[(tip)]TJ/F1 10.91 Tf 17.18 0 TD[(;)-333(this)-333(\014le)-333(is)-334(sometimes)-333(called)-333(`)]TJ/F4 10.91 Tf 143.27 0 TD[(/etc/remote)]TJ/F1 10.91 Tf 63 0 TD[('\).)]TJ -340.15 -16.14 TD[(See)-285(y)27(our)-285(system)-286(do)-28(cumen)27(tation)-284(for)-286(information)-286(on)-286(ho)27(w)-284(to)-286(create)-286(new)-286(en)27(tries)-284(in)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(/etc/remote)]TJ/F1 10.91 Tf 63 0 TD[('.)-578(\(Some)]TJ/F7 10.91 Tf 46.19 0 TD[(unix)]TJ/F1 10.91 Tf 27.5 0 TD[(systems)-378(are)-378(distributed)-378(with)-378(at)-378(least)-378(one)-378(default)]TJ -139.72 -13.15 TD[(en)27(try)-315(with)-316(a)-316(name)-316(resem)27(bling)-315(`)]TJ/F4 10.91 Tf 147.96 0 TD[(hardwire)]TJ/F1 10.91 Tf 45.82 0 TD[(';)-321(if)-316(y)27(our)-315(system)-316(has)-316(one,)-320(y)27(ou)-315(can)-316(edit)]TJ -193.78 -13.15 TD[(it,)-483(or)-454(mak)27(e)-452(a)-454(mo)-28(di\014ed)-453(cop)27(y)-453(with)-454(a)-453(new)-454(name.\))-805(When)-453(y)27(ou)-453(ha)27(v)28(e)-453(a)-453(w)26(orking)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(/etc/remote)]TJ/F1 10.91 Tf 63 0 TD[(')-356(en)27(try)]TJ/F5 10.91 Tf 35.68 0 TD[(abugtarget)]TJ/F1 10.91 Tf 51.55 0 TD[(,)-362(y)27(ou)-355(should)-356(b)-28(e)-356(able)-357(to)-356(t)27(yp)-27(e)-356(`)]TJ/F4 10.91 Tf 142.48 0 TD[(tip)]TJ/F5 10.91 Tf 20.82 0 TD[(abugtarget)]TJ/F1 10.91 Tf 51.78 0 TD[(',)]TJ -368.34 -13.15 TD[(and)-268(get)-268(the)-268(prompt)-268(`)]TJ/F4 10.91 Tf 97.19 0 TD[(135ABUG>)]TJ/F1 10.91 Tf 45.82 0 TD[(')-268(from)-268(the)-268(b)-28(oard.)-423(Use)-268(the)-268(same)]TJ/F5 10.91 Tf 149.32 0 TD[(abugtarget)]TJ/F1 10.91 Tf 54.71 0 TD[(string)]TJ -347.04 -13.15 TD[(with)-333(`)]TJ/F4 10.91 Tf 27.88 0 TD[(runtest)-333(--name)]TJ/F1 10.91 Tf 78.09 0 TD[('.)]TJ/F13 10.91 Tf -163.57 -19.13 TD[(Motorola)-333(IDP)-333(b)-28(oard)-333(running)-334(the)-333(rom68k)-333(b)-28(o)-28(ot)-333(monitor)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(This)-410(is)-411(the)-411(same)-411(in)-411(functionalit)27(y)-410(as)-411(the)-411(MVME)-411(b)-28(oard)-411(running)-411(the)]TJ/F4 10.91 Tf 330.92 0 TD[(BUG)]TJ/F1 10.91 Tf 21.66 0 TD[(b)-27(o)-28(ot)]TJ -352.58 -13.15 TD[(monitor.)-444(Only)-333(the)-334(monitor)-333(commands)-333(and)-334(the)-333(addresses)-333(are)-334(di\013eren)27(t.)]TJ/F13 10.91 Tf -57.6 -19.13 TD[(VxW)83(orks)-332(\(Motorola)-334(68K)-333(or)-333(In)26(tel)-332(960\))]TJ/F1 10.91 Tf 57.6 -13.15 TD[(Con\014gure)-392(DejaGn)26(u)-392(for)-393(either)-392(`)]TJ/F4 10.91 Tf 148.98 0 TD[(m68k-wrs-vxworks)]TJ/F1 10.91 Tf 91.64 0 TD[(')-392(\(abbreviated)-393(`)]TJ/F4 10.91 Tf 74.96 0 TD[(vxworks68)]TJ/F1 10.91 Tf 51.55 0 TD[('\))]TJ -367.13 -13.15 TD[(or)-229(`)]TJ/F4 10.91 Tf 15.26 0 TD[(i960-wrs-vxworks)]TJ/F1 10.91 Tf 91.64 0 TD[(')-229(\(abbreviated)-229(`)]TJ/F4 10.91 Tf 71.4 0 TD[(vxworks960)]TJ/F1 10.91 Tf 57.27 0 TD[('\).)-409(Since)-230(b)-28(oth)-229(targets)-230(supp)-27(ort)]TJ -235.57 -13.15 TD[(IP)-466(addressing,)-501(sp)-27(ecify)-467(the)-467(net)26(w)28(ork)-466(address)-467(\(for)-467(example,)-500(a)-467(host)-467(name)-467(from)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(/etc/hosts)]TJ/F1 10.91 Tf 57.27 0 TD[('\))-333(with)-333(`)]TJ/F4 10.91 Tf 38.79 0 TD[(--name)]TJ/F1 10.91 Tf 34.36 0 TD[('.)]TJ -133.45 -16.14 TD[(The)-388(default)-389(connect)-389(proto)-28(col)-389(is)-389(`)]TJ/F4 10.91 Tf 158.88 0 TD[(rlogin)]TJ/F1 10.91 Tf 34.37 0 TD[(',)-402(but)-389(y)27(ou)-388(can)-389(use)-389(an)26(y)-387(of)-389(`)]TJ/F4 10.91 Tf 129.61 0 TD[(--connect)]TJ -322.86 -13.15 TD[(rlogin)]TJ/F1 10.91 Tf 34.36 0 TD[(',)-333(`)]TJ/F4 10.91 Tf 12.73 0 TD[(--connect)-333(telnet)]TJ/F1 10.91 Tf 89.55 0 TD[(',)-333(or)-333(`)]TJ/F4 10.91 Tf 26.09 0 TD[(--connect)-333(rsh)]TJ/F1 10.91 Tf 72.36 0 TD[('.)]TJ -235.09 -16.14 TD[(T)83(est)-456(scripts)-457(need)-456(no)-457(sp)-28(ecial)-456(co)-28(de)-457(to)-457(load)-456(programs)-457(in)27(to)-456(these)-457(targets;)-518(since)]TJ 0 -13.15 TD[(VxW)83(orks)-452(supp)-28(orts)-452(NFS,)-453(all)-452(y)26(ou)-451(m)27(ust)-452(do)-453(is)-452(ensure)-453(test)-452(programs)-453(are)-453(on)-452(an)]TJ 0 -13.15 TD[(exp)-27(orted)-334(\014lesystem.)]TJ 0 -16.14 TD[(When)-362(y)27(ou)-362(compile)-362(for)-363(VxW)83(orks,)-369(use)-363(the)-362(link)27(er)-362(`)]TJ/F4 10.91 Tf 233.45 0 TD[(-r)]TJ/F1 10.91 Tf 11.45 0 TD[(')-362(option)-363(to)-362(mak)27(e)-362(the)-362(link)26(er)]TJ -244.9 -13.15 TD[(output)-274(relo)-28(catable|at)-275(least)-275(if)-274(y)26(ou)-273(w)26(an)28(t)-274(to)-274(use)-275(library)-275(routines.)-425(Man)27(y)-274(standard)]TJ 0 -13.15 TD[(C)-377(routines)-378(are)-377(included)-378(in)-377(VxW)82(orks;)-399(often)-377(no)-378(additional)-378(libraries)-377(are)-378(needed.)]TJ 0 -13.15 TD[(See)-333(y)27(our)-332(VxW)82(orks)-332(system)-334(do)-27(cumen)26(tation)-332(for)-333(additional)-334(details.)]TJ ET 0 g 0 G
+endstream
+endobj
+185 0 obj
+<<
+/F1 9 0 R
+/F13 179 0 R
+/F4 28 0 R
+/F7 49 0 R
+/F5 31 0 R
+>>
+endobj
+183 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 185 0 R
+>>
+endobj
+188 0 obj
+<<
+/Length 3782
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(34)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -23.91 TD[(5.6)-562(The)-375(\014les)-375(DejaGn)30(u)-374(reads)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(The)]TJ/F4 10.91 Tf 22.3 0 TD[(runtest)]TJ/F1 10.91 Tf 43.6 0 TD[(program)-321(used)-322(to)-322(in)27(v)28(ok)28(e)-321(DejaGn)27(u)-321(is)-322(a)-321(short)-322(shell)-322(script)-321(generated)-322(b)27(y)]TJ/F4 10.91 Tf 328.25 0 TD[(make)]TJ/F1 10.91 Tf -409.09 -13.15 TD[(during)-349(the)-350(con\014guration)-350(pro)-28(cess.)-495(Its)-350(main)-350(task)-350(is)-350(to)-350(read)-350(the)-350(main)-350(test)-350(framew)27(ork)-349(driv)27(er,)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(runtest.exp)]TJ/F1 10.91 Tf 63 0 TD[('.)]TJ -51.09 -16.14 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(runtest.exp)]TJ/F1 10.91 Tf 63 0 TD[(',)-333(in)-333(turn,)-333(reads)]TJ/F4 10.91 Tf 78.31 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(co)-27(de)-334(from)-333(certain)-333(other)-334(\014les,)-333(in)-333(this)-334(order:)]TJ -191.37 -16.14 TD[(1.)-660(Eac)27(h)-330(of)-331(the)-331(`)]TJ/F4 10.91 Tf 76.98 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.81 0 TD[(')-330(lo)-28(cal)-331(de\014nition)-331(\014les)-331(a)27(v)55(ailable.)-442(See)-331(Chapter)-331(4)-331([Setting)]TJ/F4 10.91 Tf 263.21 0 TD[(runtest)]TJ/F1 10.91 Tf -370.31 -13.15 TD[(defaults],)-333(page)-333(15,)-333(for)-334(details.)]TJ -15.69 -16.14 TD[(2.)-660(`)]TJ/F4 10.91 Tf 18.72 0 TD[(lib/utils.exp)]TJ/F1 10.91 Tf 74.45 0 TD[(',)-281(a)-269(collection)-269(of)-268(utilit)26(y)-267(pro)-28(cedures.)-423(See)-269(Section)-269(5.3)-268([DejaGn)26(u)-267(Builtins],)]TJ -77.48 -13.15 TD[(page)-333(23,)-333(for)-333(descriptions)-334(of)-333(these)-333(pro)-28(cedures.)]TJ -15.69 -16.14 TD[(3.)-660(`)]TJ/F4 10.91 Tf 18.72 0 TD[(lib/framework.exp)]TJ/F1 10.91 Tf 97.36 0 TD[(',)-452(a)-429(\014le)-428(of)-429(subroutines)-429(mean)27(t)-428(for)]TJ/F4 10.91 Tf 164.39 0 TD[(runtest)]TJ/F1 10.91 Tf 44.77 0 TD[(itself)-428(rather)-429(than)-429(for)]TJ -309.55 -13.15 TD[(general-purp)-27(ose)-334(use)-333(in)-333(b)-28(oth)]TJ/F4 10.91 Tf 135.94 0 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(and)-333(test)-333(suites.)]TJ -195.36 -16.14 TD[(4.)-660(`)]TJ/F4 10.91 Tf 18.72 0 TD[(debugger.exp)]TJ/F1 10.91 Tf 68.73 0 TD[(',)-525(Don)-487(Lib)-28(es')-487(Tcl)-487(Debugger.)-906(\(See)]TJ/F5 10.91 Tf 175.29 0 TD[(A)-486(Debugger)-488(for)-487(Tcl)-487(Applications)]TJ/F1 10.91 Tf -247.05 -13.15 TD[(b)27(y)-420(Don)-422(Lib)-28(es.)-709(This)-421(pap)-28(er)-422(is)-421(distributed)-422(with)]TJ/F4 10.91 Tf 228.72 0 TD[(expect)]TJ/F1 10.91 Tf 38.96 0 TD[(in)-421(P)27(ostScript)-421(form)-421(as)-422(the)-422(\014le)]TJ -267.68 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(expect/tcl-debug.ps)]TJ/F1 10.91 Tf 108.82 0 TD[('.\))]TJ -127.54 -16.14 TD[(5.)-660(`)]TJ/F4 10.91 Tf 18.72 0 TD[(lib/remote.exp)]TJ/F1 10.91 Tf 80.18 0 TD[(',)-249(a)-227(collection)-228(of)-228(subroutines)-228(mean)26(t)-227(for)-227(connecting)-228(to)-228(remote)-228(mac)26(hines.)]TJ -98.9 -16.14 TD[(6.)-660(`)]TJ/F4 10.91 Tf 18.72 0 TD[(lib/target.exp)]TJ/F1 10.91 Tf 80.18 0 TD[(',)-479(a)-451(collection)-450(of)-451(subroutines)-450(used)-451(for)-450(the)-450(con\014guration)-451(systems)-450(in)]TJ -83.21 -13.15 TD[(DejaGn)27(u.)-443(These)-333(pro)-28(cedures)-334(t)27(ypically)-332(manipulate)-333(or)-334(utilize)-333(the)-333(con\014guration)-334(system.)]TJ -15.69 -16.14 TD[(7.)-660(An)-380(initialization)-381(\014le)]TJ/F5 10.91 Tf 116.33 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.91 0 TD[(_init.exp)]TJ/F1 10.91 Tf 51.54 0 TD[(.)-585(See)-381(Section)-380(5.2)-381([Initialization)-380(mo)-28(dule],)-393(page)-380(22,)]TJ -171.09 -13.15 TD[(for)-333(more)-333(discussion)-333(of)-334(init)-333(\014les.)]TJ ET 0 g 0 G
+endstream
+endobj
+189 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+187 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 189 0 R
+>>
+endobj
+192 0 obj
+<<
+/Length 5629
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(35)]TJ/F2 14.35 Tf 0 -23.91 TD[(5.7)-562(The)-375(\014les)-375(DejaGn)30(u)-374(writes)]TJ/F4 10.91 Tf 14.94 -23.12 TD[(runtest)]TJ/F1 10.91 Tf 44.08 0 TD[(alw)27(a)28(ys)-364(writes)-365(t)26(w)28(o)-364(kinds)-365(of)-366(output)-365(\014les:)-508(summary)-365(logs)-366(and)-365(detailed)-365(logs.)-540(The)]TJ -59.02 -13.15 TD[(con)27(ten)28(ts)-332(of)-334(b)-27(oth)-334(of)-333(these)-333(are)-334(determined)-333(b)27(y)-333(y)27(our)-332(tests.)]TJ 14.94 -16.14 TD[(F)83(or)-404(troublesho)-27(oting,)-423(a)-404(third)-405(kind)-404(of)-405(output)-404(\014le)-405(is)-404(useful:)-587(use)-405(`)]TJ/F4 10.91 Tf 305.16 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[(')-404(to)-405(request)-404(an)]TJ -360.19 -13.15 TD[(output)-333(\014le)-333(sho)27(wing)-333(details)-333(of)-333(what)]TJ/F4 10.91 Tf 169.21 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(is)-333(doing)-333(in)27(ternally)83(.)]TJ/F2 13.09 Tf -207.21 -26.9 TD[(5.7.1)-562(Summary)-375(log)]TJ/F4 10.91 Tf 14.94 -23.11 TD[(runtest)]TJ/F1 10.91 Tf 44.35 0 TD[(alw)27(a)28(ys)-389(pro)-28(duces)-390(a)-391(summary)-390(output)-390(\014le)-391(`)]TJ/F5 10.91 Tf 197.61 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.49 0 TD[(.sum)]TJ/F1 10.91 Tf 22.91 0 TD[('.)-615(This)-390(summary)-391(sho)27(ws)-389(the)]TJ -298.3 -13.15 TD[(names)-384(of)-385(all)-385(test)-385(\014les)-385(run;)-410(for)-385(eac)27(h)-384(test)-385(\014le,)-398(one)-384(line)-385(of)-385(output)-385(from)-385(eac)27(h)]TJ/F4 10.91 Tf 358.83 0 TD[(pass)]TJ/F1 10.91 Tf 27.11 0 TD[(command)]TJ -385.94 -13.15 TD[(\(sho)27(wing)-429(status)-429(`)]TJ/F4 10.91 Tf 83.2 0 TD[(PASS)]TJ/F1 10.91 Tf 22.9 0 TD[(')-429(or)-430(`)]TJ/F4 10.91 Tf 25.17 0 TD[(XPASS)]TJ/F1 10.91 Tf 28.64 0 TD[('\))-429(or)]TJ/F4 10.91 Tf 26.37 0 TD[(fail)]TJ/F1 10.91 Tf 27.6 0 TD[(command)-429(\(status)-430(`)]TJ/F4 10.91 Tf 91.32 0 TD[(FAIL)]TJ/F1 10.91 Tf 22.91 0 TD[(')-429(or)-430(`)]TJ/F4 10.91 Tf 25.16 0 TD[(XFAIL)]TJ/F1 10.91 Tf 28.64 0 TD[('\);)-478(trailing)]TJ -381.91 -13.15 TD[(summary)-292(statistics)-293(that)-292(coun)26(t)-291(passing)-293(and)-292(failing)-293(tests)-293(\(exp)-27(ected)-293(and)-293(unexp)-27(ected\);)-307(and)-292(the)]TJ 0 -13.15 TD[(full)-286(pathname)-287(and)-286(v)27(ersion)-286(n)27(um)27(b)-26(er)-287(of)-286(the)-287(to)-28(ol)-286(tested.)-429(\(All)-287(p)-28(ossible)-286(outcomes,)-296(and)-287(all)-286(errors,)]TJ 0 -13.15 TD[(are)-391(alw)27(a)27(ys)-390(re\015ected)-392(in)-391(the)-392(summary)-392(output)-391(\014le,)-406(regardless)-392(of)-392(whether)-391(or)-392(not)-392(y)27(ou)-390(sp)-28(ecify)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(--all)]TJ/F1 10.91 Tf 28.64 0 TD[('.\))]TJ -16.73 -16.14 TD[(If)-444(an)27(y)-444(of)-444(y)27(our)-444(tests)-444(use)-444(the)-445(pro)-28(cedures)]TJ/F4 10.91 Tf 196.7 0 TD[(unresolved)]TJ/F1 10.91 Tf 57.27 0 TD[(,)]TJ/F4 10.91 Tf 8.18 0 TD[(unsupported)]TJ/F1 10.91 Tf 63 0 TD[(,)-472(or)]TJ/F4 10.91 Tf 22.76 0 TD[(untested)]TJ/F1 10.91 Tf 45.82 0 TD[(,)-472(the)]TJ -408.67 -13.15 TD[(summary)-333(output)-333(also)-333(tabulates)-334(the)-333(corresp)-28(onding)-333(outcomes.)]TJ 14.94 -16.14 TD[(F)83(or)-221(example,)-245(after)-222(`)]TJ/F4 10.91 Tf 90.76 0 TD[(runtest)-333(--tool)-333(binutils)]TJ/F1 10.91 Tf 127.55 0 TD[(',)-244(lo)-28(ok)-222(for)-222(a)-222(summary)-223(log)-222(in)-222(`)]TJ/F4 10.91 Tf 131.88 0 TD[(binutils.sum)]TJ/F1 10.91 Tf 68.72 0 TD[('.)]TJ -433.85 -13.15 TD[(Normally)83(,)]TJ/F4 10.91 Tf 51.15 0 TD[(runtest)]TJ/F1 10.91 Tf 44.62 0 TD[(writes)-415(this)-415(\014le)-416(in)-415(y)26(our)-414(curren)27(t)-415(w)27(orking)-414(directory;)-457(use)-415(the)-416(`)]TJ/F4 10.91 Tf 287.38 0 TD[(--outdir)]TJ/F1 10.91 Tf 45.82 0 TD[(')]TJ -428.97 -13.15 TD[(option)-333(to)-333(select)-333(a)-334(di\013eren)27(t)-332(directory)82(.)]TJ 0 -13.79 TD[(Here)-333(is)-333(a)-333(short)-334(sample)-333(summary)-333(log:)]TJ/F9 9.96 Tf 0 -9.44 TD[(\013)]TJ ET 23.98 -299.39 m 450.40 -299.39 l 450.40 -298.99 l 23.98 -298.99 l b BT 456.38 -299.39 TD[(\010)]TJ ET 18.00 -534.88 m 18.40 -534.88 l 18.40 -305.12 l 18.00 -305.12 l b BT/F4 10.91 Tf 21.39 -317.76 TD[(Test)-524(Run)-525(By)-525(rob)-525(on)-525(Mon)-525(May)-525(25)-525(21:40:57)-525(PDT)-525(1992)]TJ 91.63 -12.46 TD[(===)-524(gdb)-525(tests)-525(===)]TJ -91.63 -12.45 TD[(Running)-524(./gdb.t00/echo.exp)-525(...)]TJ 0 -12.45 TD[(PASS:)-1574(Echo)-525(test)]TJ 0 -12.46 TD[(Running)-524(./gdb.all/help.exp)-525(...)]TJ 0 -12.45 TD[(PASS:)-1574(help)-525(add-symbol-file)]TJ 0 -12.45 TD[(PASS:)-1574(help)-525(aliases)]TJ 0 -12.46 TD[(PASS:)-1574(help)-525(breakpoint)-525("bre")-525(abbreviation)]TJ 0 -12.45 TD[(FAIL:)-1574(help)-525(run)-525("r")-525(abbreviation)]TJ 0 -12.45 TD[(Running)-524(./gdb.t10/crossload.exp)-525(...)]TJ 0 -12.46 TD[(PASS:)-1574(m68k-elf)-525(\(elf-big\))-525(explicit)-525(format;)-525(loaded)]TJ 0 -12.45 TD[(XFAIL:)-1049(mips-ecoff)-525(\(ecoff-bigmips\))-525("ptype)-525(v_signed_char")-525(signed)]TJ 0 -12.45 TD[(C)-524(types)]TJ 91.63 -12.46 TD[(===)-524(gdb)-525(Summary)-525(===)]TJ -91.63 -12.45 TD[(#)-524(of)-525(expected)-525(passes)-525(5)]TJ 0 -12.45 TD[(#)-524(of)-525(expected)-525(failures)-525(1)]TJ 0 -12.46 TD[(#)-524(of)-525(unexpected)-525(failures)-525(1)]TJ 0 -12.45 TD[(/usr/latest/bin/gdb)-524(version)-525(4.6.5)-525(-q)]TJ ET 456.38 -534.88 m 456.77 -534.88 l 456.77 -305.12 l 456.38 -305.12 l b BT/F9 9.96 Tf 18 -541.11 TD[(\012)]TJ ET 23.98 -541.11 m 450.40 -541.11 l 450.40 -540.71 l 23.98 -540.71 l b BT 456.38 -541.11 TD[(\011)]TJ ET 0 g 0 G
+endstream
+endobj
+193 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F9 59 0 R
+>>
+endobj
+191 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 193 0 R
+>>
+endobj
+196 0 obj
+<<
+/Length 5683
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(36)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 13.09 Tf 0 -23.91 TD[(5.7.2)-562(Detailed)-375(log)]TJ/F4 10.91 Tf 14.94 -22.46 TD[(runtest)]TJ/F1 10.91 Tf 43.69 0 TD[(also)-329(sa)27(v)28(es)-328(a)-329(detailed)-330(log)-329(\014le)-329(`)]TJ/F5 10.91 Tf 137.78 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.49 0 TD[(.log)]TJ/F1 10.91 Tf 22.91 0 TD[(',)-330(sho)27(wing)-328(an)27(y)-328(output)-329(generated)-330(b)27(y)-328(tests)]TJ -237.81 -13.15 TD[(as)-328(w)27(ell)-328(as)-329(the)-329(summary)-329(output.)-442(F)82(or)-328(example,)-330(after)-328(`)]TJ/F4 10.91 Tf 249.11 0 TD[(runtest)-333(--tool)-333(binutils)]TJ/F1 10.91 Tf 127.55 0 TD[(',)-329(lo)-28(ok)-329(for)-328(a)]TJ -376.66 -13.16 TD[(detailed)-332(log)-332(in)-332(`)]TJ/F4 10.91 Tf 74.51 0 TD[(binutils.log)]TJ/F1 10.91 Tf 68.72 0 TD[('.)-444(Normally)83(,)]TJ/F4 10.91 Tf 60.93 0 TD[(runtest)]TJ/F1 10.91 Tf 43.71 0 TD[(writes)-332(this)-332(\014le)-332(in)-332(y)27(our)-331(curren)27(t)-332(w)27(orking)]TJ -247.87 -13.15 TD[(directory;)-333(use)-333(the)-333(`)]TJ/F4 10.91 Tf 90.12 0 TD[(--outdir)]TJ/F1 10.91 Tf 45.82 0 TD[(')-333(option)-333(to)-333(select)-334(a)-333(di\013eren)27(t)-333(directory)83(.)]TJ -135.94 -13.13 TD[(Here)-333(is)-333(a)-333(brief)-334(example)-333(sho)27(wing)-333(a)-333(detailed)-333(log)-334(for)]TJ/F7 10.91 Tf 239.91 0 TD[(g)]TJ/F4 10.91 Tf 6.99 0 TD[(++)]TJ/F1 10.91 Tf 15.09 0 TD[(tests:)]TJ/F9 9.96 Tf -261.99 -9.44 TD[(\013)]TJ ET 23.98 -94.45 m 450.40 -94.45 l 450.40 -94.05 l 23.98 -94.05 l b BT 456.38 -94.45 TD[(\010)]TJ ET 18.00 -516.74 m 18.40 -516.74 l 18.40 -100.18 l 18.00 -100.18 l b BT/F4 10.91 Tf 21.39 -112.82 TD[(Test)-524(Run)-525(By)-525(rob)-525(on)-525(Mon)-525(May)-525(25)-525(21:40:43)-525(PDT)-525(1992)]TJ 91.63 -24.91 TD[(===)-524(g++)-525(tests)-525(===)]TJ -91.63 -24.9 TD[(---)-524(Running)-525(./g++.other/t01-1.exp)-525(---)]TJ 45.81 -12.46 TD[(PASS:)-1574(operate)-525(delete)]TJ -45.81 -24.9 TD[(---)-524(Running)-525(./g++.other/t01-2.exp)-525(---)]TJ 45.81 -12.46 TD[(FAIL:)-1574(i960)-525(bug)-525(EOF)]TJ -45.81 -12.45 TD[(p0000646.C:)-524(In)-525(function)-525(`int)-1050(warn_return_1)-525(\(\)':)]TJ 0 -12.45 TD[(p0000646.C:109:)-524(warning:)-525(control)-525(reaches)-525(end)-525(of)-525(non-void)-525(function)]TJ 0 -12.46 TD[(p0000646.C:)-524(In)-525(function)-525(`int)-1050(warn_return_arg)-525(\(int\)':)]TJ 0 -12.45 TD[(p0000646.C:117:)-524(warning:)-525(control)-525(reaches)-525(end)-525(of)-525(non-void)-525(function)]TJ 0 -12.45 TD[(p0000646.C:)-524(In)-525(function)-525(`int)-1050(warn_return_sum)-525(\(int,)-525(int\)':)]TJ 0 -12.46 TD[(p0000646.C:125:)-524(warning:)-525(control)-525(reaches)-525(end)-525(of)-525(non-void)-525(function)]TJ 0 -12.45 TD[(p0000646.C:)-524(In)-525(function)-525(`struct)-525(foo)-525(warn_return_foo)-525(\(\)':)]TJ 0 -12.45 TD[(p0000646.C:132:)-524(warning:)-525(control)-525(reaches)-525(end)-525(of)-525(non-void)-525(function)]TJ 0 -24.91 TD[(---)-524(Running)-525(./g++.other/t01-4.exp)-525(---)]TJ 45.81 -12.45 TD[(FAIL:)-1574(abort)]TJ -45.81 -12.46 TD[(900403_04.C:8:)-524(zero)-525(width)-525(for)-525(bit-field)-525(`foo')]TJ 0 -12.45 TD[(---)-524(Running)-525(./g++.other/t01-3.exp)-525(---)]TJ 45.81 -12.45 TD[(FAIL:)-1574(segment)-525(violation)]TJ -45.81 -12.46 TD[(900519_12.C:9:)-524(parse)-525(error)-525(before)-525(`;')]TJ 0 -12.45 TD[(900519_12.C:12:)-524(Segmentation)-525(violation)]TJ 0 -12.45 TD[(/usr/latest/bin/gcc:)-524(Internal)-525(compiler)-525(error:)-525(program)-525(cc1plus)-525(got)]TJ 0 -12.46 TD[(fatal)-524(signal)]TJ 91.63 -24.9 TD[(===)-524(g++)-525(Summary)-525(===)]TJ -91.63 -24.91 TD[(#)-524(of)-525(expected)-525(passes)-525(1)]TJ 0 -12.45 TD[(#)-524(of)-525(expected)-525(failures)-525(3)]TJ 0 -12.46 TD[(/usr/ps/bin/g++)-524(version)-525(cygnus-2.0.1)]TJ ET 456.38 -516.74 m 456.77 -516.74 l 456.77 -100.18 l 456.38 -100.18 l b BT/F9 9.96 Tf 18 -522.97 TD[(\012)]TJ ET 23.98 -522.97 m 450.40 -522.97 l 450.40 -522.57 l 23.98 -522.57 l b BT 456.38 -522.97 TD[(\011)]TJ/F2 13.09 Tf -438.38 -24.94 TD[(5.7.3)-562(Logging)]TJ/F10 13.09 Tf 93.12 0 TD[(expect)]TJ/F2 13.09 Tf 45.33 0 TD[(in)31(ternal)-374(actions)]TJ/F1 10.91 Tf -123.51 -22.46 TD[(With)-360(the)-361(`)]TJ/F4 10.91 Tf 50.6 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[(')-360(option,)-368(y)27(ou)-359(can)-361(request)-361(a)-360(log)-361(\014le)-360(sho)26(wing)-359(the)-361(output)-360(from)]TJ/F4 10.91 Tf 292.01 0 TD[(expect)]TJ/F1 10.91 Tf -397.64 -13.15 TD[(itself,)-416(running)-400(in)-400(debugging)-400(mo)-28(de.)-644(This)-400(\014le)-400(\(`)]TJ/F4 10.91 Tf 225.06 0 TD[(dbg.log)]TJ/F1 10.91 Tf 40.09 0 TD[(',)-416(in)-400(the)-400(directory)-400(where)-400(y)27(ou)-399(start)]TJ/F4 10.91 Tf -265.15 -13.15 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(\))-333(sho)27(ws)-332(eac)26(h)-332(pattern)]TJ/F4 10.91 Tf 102.58 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(considers)-333(in)-333(analyzing)-333(test)-334(output.)]TJ -165.73 -15.49 TD[(This)-305(\014le)-306(re\015ects)-305(eac)27(h)]TJ/F4 10.91 Tf 102.88 0 TD[(send)]TJ/F1 10.91 Tf 26.24 0 TD[(command,)-311(sho)27(wing)-304(the)-306(string)-305(sen)26(t)-304(as)-306(input)-305(to)-306(the)-305(to)-28(ol)-306(under)]TJ -144.06 -13.15 TD[(test;)-333(and)-333(eac)27(h)]TJ/F4 10.91 Tf 70.06 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(command,)-333(sho)27(wing)-332(eac)26(h)-332(pattern)-333(it)-334(compares)-333(with)-333(the)-334(to)-27(ol)-334(output.)]TJ -93.12 -15.49 TD[(The)-333(log)-333(messages)-333(for)]TJ/F4 10.91 Tf 102.94 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(b)-27(egin)-334(with)-333(a)-333(message)-334(of)-333(the)-333(form)]TJ ET 0 g 0 G
+endstream
+endobj
+197 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F7 49 0 R
+/F9 59 0 R
+/F10 78 0 R
+>>
+endobj
+195 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 197 0 R
+>>
+endobj
+200 0 obj
+<<
+/Length 6757
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(5:)-444(The)-334(DejaGn)27(u)-332(Implemen)27(tation)-20326(37)]TJ/F4 10.91 Tf 28.8 -23.91 TD[(expect:)-524(does)-525({)]TJ/F5 10.91 Tf 80.18 0 TD[(to)-27(ol)-334(output)]TJ/F4 10.91 Tf 54.48 0 TD[(})-524(\(spawn_id)]TJ/F5 10.91 Tf 68.73 0 TD[(n)]TJ/F4 10.91 Tf 6.06 0 TD[(\))-524(match)-525(pattern)]TJ -209.45 -12.46 TD[({)]TJ/F5 10.91 Tf 5.73 0 TD[(exp)-27(ected)-334(pattern)]TJ/F4 10.91 Tf 80.63 0 TD[(}?)]TJ/F1 10.91 Tf -115.16 -16.14 TD[(F)83(or)-325(ev)27(ery)-325(unsuccessful)-325(matc)26(h,)]TJ/F4 10.91 Tf 145.84 0 TD[(expect)]TJ/F1 10.91 Tf 37.91 0 TD[(issues)-325(a)-326(`)]TJ/F4 10.91 Tf 42.44 0 TD[(no)]TJ/F1 10.91 Tf 11.46 0 TD[(')-325(after)-326(this)-326(message;)-328(if)-326(other)-325(patterns)-326(are)]TJ -237.65 -13.15 TD[(sp)-27(eci\014ed)-341(for)-341(the)-341(same)]TJ/F4 10.91 Tf 107.14 0 TD[(expect)]TJ/F1 10.91 Tf 38.09 0 TD[(command,)-342(they)-341(are)-341(re\015ected)-341(also,)-342(but)-341(without)-341(the)-341(\014rst)-340(part)]TJ -145.23 -13.15 TD[(of)-333(the)-333(message)-333(\(`)]TJ/F4 10.91 Tf 80.42 0 TD[(expect...match)-333(pattern)]TJ/F1 10.91 Tf 123.91 0 TD[('\).)]TJ -189.39 -16.14 TD[(When)]TJ/F4 10.91 Tf 32.05 0 TD[(expect)]TJ/F1 10.91 Tf 38.24 0 TD[(\014nds)-354(a)-355(matc)27(h,)-359(the)-354(log)-355(for)-354(the)-355(successful)-355(matc)27(h)-353(ends)-355(with)-355(`)]TJ/F4 10.91 Tf 281.12 0 TD[(yes)]TJ/F1 10.91 Tf 17.18 0 TD[(',)-359(follo)26(w)28(ed)]TJ -383.53 -13.15 TD[(b)27(y)-356(a)-356(record)-357(of)-357(the)]TJ/F4 10.91 Tf 90.13 0 TD[(expect)]TJ/F1 10.91 Tf 38.25 0 TD[(v)55(ariables)-356(set)-357(to)-356(describ)-28(e)-357(a)-357(successful)-356(matc)26(h.)-514(Here)-356(is)-357(an)-357(excerpt)]TJ -128.38 -13.15 TD[(from)-333(the)-333(debugging)-333(log)-334(for)-333(a)]TJ/F7 10.91 Tf 140.06 0 TD[(gdb)]TJ/F1 10.91 Tf 23.77 0 TD[(test:)]TJ/F9 9.96 Tf -163.83 -9.44 TD[(\013)]TJ ET 23.98 -116.74 m 450.40 -116.74 l 450.40 -116.34 l 23.98 -116.34 l b BT 456.38 -116.74 TD[(\010)]TJ ET 18.00 -440.32 m 18.40 -440.32 l 18.40 -122.47 l 18.00 -122.47 l b BT/F4 10.91 Tf 21.39 -136.02 TD[(send:)-524(sent)-525({break)-525(gdbme.c:34\\n})-525(to)-525(spawn)-525(id)-525(6)]TJ 0 -12.46 TD[(expect:)-524(does)-525({})-525(\(spawn_id)-525(6\))-525(match)-525(pattern)-525({Breakpoint.*at.*)-525(file)]TJ 5.72 -12.45 TD[(gdbme.c,)-524(line)-525(34.*\\\(gdb\\\))-525($}?)-525(no)]TJ -5.72 -12.45 TD[({.*\\\(gdb\\\))-524($}?)-525(no)]TJ 0 -12.46 TD[(expect:)-524(does)-525({})-525(\(spawn_id)-525(0\))-525(match)-525(pattern)-525({<return>}?)-525(no)]TJ 0 -12.45 TD[({\\\(y)-524(or)-525(n\\\))-525(}?)-525(no)]TJ 0 -12.45 TD[({buffer_full}?)-524(no)]TJ 0 -12.46 TD[({virtual}?)-524(no)]TJ 0 -12.45 TD[({memory}?)-524(no)]TJ 0 -12.45 TD[({exhausted}?)-524(no)]TJ 0 -12.46 TD[({Undefined}?)-524(no)]TJ 0 -12.45 TD[({command}?)-524(no)]TJ 0 -12.45 TD[(break)-524(gdbme.c:34)]TJ 0 -12.46 TD[(Breakpoint)-524(8)-525(at)-525(0x23d8:)-525(file)-525(gdbme.c,)-525(line)-525(34.)]TJ 0 -12.45 TD[(\(gdb\))-524(expect:)-525(does)-525({break)-525(gdbme.c:34\\r\\nBreakpoint)-525(8)-525(at)-525(0x23d8:)]TJ 0 -12.45 TD[(file)-524(gdbme.c,)-525(line)-525(34.\\r\\n\(gdb\))-525(})-525(\(spawn_id)-525(6\))-525(match)-525(pattern)]TJ 0 -12.46 TD[({Breakpoint.*at.*)-524(file)-525(gdbme.c,)-525(line)-525(34.*\\\(gdb\\\))-525($}?)-525(yes)]TJ 0 -12.45 TD[(expect:)-524(set)-525(expect_out\(0,start\))-525({18})]TJ 0 -12.45 TD[(expect:)-524(set)-525(expect_out\(0,end\))-525({71})]TJ 0 -12.46 TD[(expect:)-524(set)-525(expect_out\(0,string\))-525({Breakpoint)-525(8)-525(at)-525(0x23d8:)-525(file)]TJ 0 -12.45 TD[(gdbme.c,)-524(line)-525(34.\\r\\n\(gdb\))-525(})]TJ 0 -12.45 TD[(expect:)-524(set)-525(expect_out\(spawn_id\))-525({6})]TJ 0 -12.46 TD[(expect:)-524(set)-525(expect_out\(buffer\))-525({break)-525(gdbme.c:34\\r\\nBreakpoint)-525(8)]TJ 0 -12.45 TD[(at)-524(0x23d8:)-525(file)-525(gdbme.c,)-525(line)-525(34.\\r\\n\(gdb\))-525(})]TJ 45.81 -12.45 TD[(PASS:)-1574(70)-3150(0)-3675(breakpoint)-525(line)-525(number)-525(in)-525(file)]TJ ET 456.38 -440.32 m 456.77 -440.32 l 456.77 -122.47 l 456.38 -122.47 l b BT/F9 9.96 Tf 18 -446.54 TD[(\012)]TJ ET 23.98 -446.54 m 450.40 -446.54 l 450.40 -446.14 l 23.98 -446.14 l b BT 456.38 -446.54 TD[(\011)]TJ/F1 10.91 Tf -438.38 -17.39 TD[(This)-309(example)-310(exhibits)-310(three)-309(prop)-28(erties)-310(of)]TJ/F4 10.91 Tf 198.73 0 TD[(expect)]TJ/F1 10.91 Tf 37.74 0 TD[(and)-309(DejaGn)27(u)-309(that)-310(migh)27(t)-309(b)-28(e)-309(surprising)-310(at)]TJ -236.47 -13.15 TD[(\014rst)-333(glance:)]TJ/F3 10.91 Tf 8.95 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(Empt)27(y)-272(output)-274(for)-274(the)-273(\014rst)-274(attempted)-274(matc)27(h.)-424(The)-273(\014rst)-274(set)-274(of)-273(attempted)-274(matc)27(hes)-273(sho)27(wn)]TJ 0 -13.15 TD[(ran)-377(against)-377(the)-377(output)-377(`)]TJ/F4 10.91 Tf 116.54 0 TD[({})]TJ/F1 10.91 Tf 11.46 0 TD[('|that)-377(is,)-387(no)-378(output.)]TJ/F4 10.91 Tf 109.71 0 TD[(expect)]TJ/F1 10.91 Tf 38.47 0 TD[(b)-27(egins)-377(attempting)-377(to)-377(matc)26(h)]TJ -276.18 -13.15 TD[(the)-401(patterns)-401(supplied)-401(immediately;)-435(often,)-419(the)-401(\014rst)-401(pass)-401(is)-401(against)-402(incomplete)-401(output)]TJ 0 -13.15 TD[(\(or)-333(completely)-333(b)-28(efore)-333(all)-334(output,)-333(as)-333(in)-334(this)-333(case\).)]TJ/F3 10.91 Tf -12.65 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(In)27(tersp)-26(ersed)-446(to)-27(ol)-445(output.)-780(The)-445(b)-28(eginning)-445(of)-445(the)-445(log)-445(en)27(try)-445(for)-445(the)-445(second)-445(attempted)]TJ 0 -13.15 TD[(matc)27(h)-341(ma)26(y)-341(b)-28(e)-342(hard)-343(to)-343(sp)-27(ot:)-463(this)-343(is)-342(b)-28(ecause)-343(the)-342(prompt)-343(`)]TJ/F4 10.91 Tf 273.03 0 TD[(\(gdb\))]TJ/F1 10.91 Tf 32.27 0 TD[(')-342(app)-28(ears)-342(on)-343(the)-343(same)]TJ -305.3 -13.15 TD[(line,)-333(just)-333(b)-28(efore)-333(the)-334(`)]TJ/F4 10.91 Tf 99.79 0 TD[(expect:)]TJ/F1 10.91 Tf 40.09 0 TD[(')-333(that)-333(marks)-333(the)-334(b)-28(eginning)-333(of)-333(the)-334(log)-333(en)27(try)83(.)]TJ/F3 10.91 Tf -152.53 -16.14 TD[(\017)]TJ/F1 10.91 Tf 12.65 0 TD[(F)83(ail-safe)-342(patterns.)-472(Man)27(y)-342(of)-343(the)-342(patterns)-343(tested)-342(are)-343(fail-safe)-343(patterns)-342(pro)27(vided)-342(b)27(y)]TJ/F7 10.91 Tf 390.27 0 TD[(gdb)]TJ/F1 10.91 Tf -390.27 -13.15 TD[(testing)-471(utilities,)-506(to)-472(reduce)-471(p)-28(ossible)-471(indeterminacy)82(.)-858(It)-472(is)-471(useful)-472(to)-471(an)27(ticipate)-471(p)-28(oten-)]TJ 0 -13.15 TD[(tial)-484(v)55(ariations)-484(caused)-485(b)27(y)-483(extreme)-485(system)-484(conditions)-485(\()]TJ/F7 10.91 Tf 265.55 0 TD[(gdb)]TJ/F1 10.91 Tf 25.42 0 TD[(migh)27(t)-483(issue)-485(the)-484(message)]TJ ET 0 g 0 G
+endstream
+endobj
+201 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F7 49 0 R
+/F9 59 0 R
+/F3 21 0 R
+>>
+endobj
+199 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 201 0 R
+>>
+endobj
+204 0 obj
+<<
+/Length 2123
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(38)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ 21.6 -23.91 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(virtual)-333(memory)-333(exhausted)]TJ/F1 10.91 Tf 133.27 0 TD[(')-361(in)-361(rare)-361(circumstances\),)-368(or)-361(b)27(y)-360(c)27(hanges)-360(in)-361(the)-361(tested)-361(pro-)]TJ -136.3 -13.15 TD[(gram)-354(\(`)]TJ/F4 10.91 Tf 35.41 0 TD[(Undefined)-333(command)]TJ/F1 10.91 Tf 95.28 0 TD[(')-354(is)-355(the)-355(lik)27(eliest)-353(outcome)-355(if)-355(the)-354(name)-355(of)-355(a)-355(tested)-354(command)]TJ -130.69 -13.15 TD[(c)27(hanges\).)]TJ 0 -16.14 TD[(The)-355(pattern)-356(`)]TJ/F4 10.91 Tf 64.76 0 TD[({<return>})]TJ/F1 10.91 Tf 57.27 0 TD[(')-355(is)-356(a)-355(particularly)-356(in)27(teresting)-355(fail-safe)-355(to)-356(notice;)-367(it)-355(c)27(hec)27(ks)-354(for)]TJ -122.03 -13.15 TD[(an)-421(unexp)-28(ected)]TJ/F11 8.97 Tf 74.65 0.39 TD[(h)]TJ ET 117.16 -58.83 m 135.26 -58.83 l 135.26 -58.43 l 117.16 -58.43 l b BT/F12 7.97 Tf 117.16 -65.55 TD[(RET)]TJ ET 117.16 -67.40 m 135.26 -67.40 l 135.26 -67.00 l 117.16 -67.00 l b BT/F11 8.97 Tf 134.76 -65.16 TD[(i)]TJ/F1 10.91 Tf 8.18 -0.39 TD[(prompt.)-709(This)-421(ma)27(y)-421(happ)-28(en,)-443(for)-422(example,)-444(if)-421(the)-422(tested)-421(to)-28(ol)-422(can)]TJ -103.34 -13.15 TD[(\014lter)-333(output)-333(through)-333(a)-334(pager.)]TJ 0 -16.14 TD[(These)-317(fail-safe)-317(patterns)-318(\(lik)27(e)-316(the)-318(debugging)-317(log)-318(itself)-77(\))-318(are)-317(primarily)-318(useful)-317(while)-317(dev)26(el-)]TJ 0 -13.15 TD[(oping)-357(test)-357(scripts.)-516(Use)-357(the)]TJ/F4 10.91 Tf 131.49 0 TD[(error)]TJ/F1 10.91 Tf 32.54 0 TD[(pro)-27(cedure)-358(to)-357(mak)27(e)-356(the)-358(actions)-357(for)-357(fail-safe)-357(patterns)]TJ -164.03 -13.16 TD[(pro)-27(duce)-391(messages)-390(starting)-391(with)-390(`)]TJ/F4 10.91 Tf 158.86 0 TD[(ERROR)]TJ/F1 10.91 Tf 28.64 0 TD[(')-390(on)-391(the)]TJ/F4 10.91 Tf 42.47 0 TD[(runtest)]TJ/F1 10.91 Tf 44.35 0 TD[(standard)-390(output,)-405(and)-390(in)-391(the)]TJ -274.32 -13.15 TD[(detailed)-333(log)-333(\014le.)]TJ ET 0 g 0 G
+endstream
+endobj
+205 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F11 97 0 R
+/F12 100 0 R
+>>
+endobj
+203 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 205 0 R
+>>
+endobj
+208 0 obj
+<<
+/Length 6090
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(6:)-444(Ho)27(w)-333(T)83(o)-333(W)83(rite)-333(a)-333(T)82(est)-332(Case)-21861(39)]TJ/F2 17.22 Tf 0 -25.91 TD[(6)-562(Ho)30(w)-374(T)93(o)-374(W)93(rite)-374(a)-375(T)93(est)-374(Case)]TJ/F2 14.35 Tf 0 -42.83 TD[(6.1)-562(W)93(riting)-374(a)-375(test)-375(case)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(The)-338(easiest)-338(w)27(a)28(y)-337(to)-338(prepare)-339(a)-338(new)-338(test)-338(case)-338(is)-338(to)-338(base)-339(it)-338(on)-338(an)-338(existing)-338(one)-338(for)-338(a)-338(similar)]TJ -14.94 -13.15 TD[(situation.)-702(There)-419(are)-419(t)26(w)28(o)-418(ma)-56(jor)-419(categories)-419(of)-419(tests:)-617(batc)27(h)-418(or)-420(in)27(teractiv)28(e.)-701(Batc)26(h)-418(orien)27(ted)]TJ 0 -13.15 TD[(tests)-333(are)-333(usually)-333(easier)-334(to)-333(write.)]TJ 14.94 -16.14 TD[(The)]TJ/F7 10.91 Tf 21.56 0 TD[(gcc)]TJ/F1 10.91 Tf 22.66 0 TD[(tests)-253(are)-254(a)-254(go)-28(o)-28(d)-254(example)-253(of)-254(batc)26(h)-252(orien)26(ted)-253(tests.)-418(All)]TJ/F7 10.91 Tf 246.46 0 TD[(gcc)]TJ/F1 10.91 Tf 22.66 0 TD[(tests)-253(consist)-254(primarily)]TJ -328.28 -13.15 TD[(of)-387(a)-388(call)-388(to)-388(a)-388(single)-388(common)-388(pro)-28(cedure,)-401(since)-388(all)-388(the)-388(tests)-388(either)-388(ha)27(v)27(e)-386(no)-388(output,)-402(or)-388(only)]TJ 0 -13.15 TD[(ha)27(v)28(e)-429(a)-431(few)-431(w)27(arning)-429(messages)-431(when)-430(successfully)-431(compiled.)-736(An)27(y)-430(non-w)27(arning)-430(output)-430(is)-431(a)]TJ 0 -13.15 TD[(test)-331(failure.)-444(All)-332(the)-332(C)-332(co)-28(de)-332(needed)-332(is)-332(k)27(ept)-331(in)-332(the)-331(test)-332(directory)82(.)-443(The)-332(test)-332(driv)27(er,)-331(written)-332(in)]TJ/F4 10.91 Tf 0 -13.15 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(,)-302(need)-294(only)-295(get)-294(a)-295(listing)-294(of)-295(all)-294(the)-295(C)-294(\014les)-295(in)-294(the)-295(directory)82(,)-301(and)-294(compile)-295(them)-294(all)-295(using)]TJ -34.36 -13.15 TD[(a)-307(generic)-307(pro)-28(cedure.)-435(This)-308(pro)-27(cedure)-307(and)-308(a)-307(few)-307(others)-307(supp)-28(orting)-307(for)-307(these)-307(tests)-308(are)-307(k)27(ept)-306(in)]TJ 0 -13.15 TD[(the)-325(library)-325(mo)-28(dule)-325(`)]TJ/F4 10.91 Tf 95.55 0 TD[(lib/c-torture.exp)]TJ/F1 10.91 Tf 97.36 0 TD[(')-325(in)-325(the)]TJ/F7 10.91 Tf 37.92 0 TD[(gcc)]TJ/F1 10.91 Tf 23.43 0 TD[(test)-325(suite.)-441(Most)-325(tests)-326(of)-325(this)-325(kind)-325(use)]TJ -254.26 -13.15 TD[(v)27(ery)-332(few)]TJ/F4 10.91 Tf 43.67 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(features,)-333(and)-333(are)-333(co)-28(ded)-334(almost)-333(purely)-333(in)-334(Tcl.)]TJ -81.67 -16.14 TD[(W)83(riting)-332(the)-334(complete)-333(suite)-333(of)-334(C)-333(tests,)-333(then,)-334(consisted)-333(of)-333(these)-334(steps:)]TJ 5.91 -16.14 TD[(1.)-660(Cop)27(ying)-289(all)-290(the)-291(C)-290(co)-28(de)-290(in)27(to)-290(the)-290(test)-291(directory)83(.)-429(These)-291(tests)-290(w)27(ere)-290(based)-290(on)-290(the)-291(C-torture)]TJ 15.69 -13.15 TD[(test)-263(created)-264(b)26(y)-263(T)83(orb)-55(jorn)-264(Granlund)-264(\(on)-264(b)-27(ehalf)-264(of)-264(the)-264(F)82(ree)-263(Soft)27(w)28(are)-263(F)82(oundation\))-263(for)]TJ/F7 10.91 Tf 390.51 0 TD[(gcc)]TJ/F1 10.91 Tf -390.51 -13.15 TD[(dev)27(elopmen)28(t.)]TJ -15.69 -16.14 TD[(2.)-660(W)83(riting)-333(\(and)-333(debugging\))-333(the)-334(generic)]TJ/F4 10.91 Tf 193.33 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(pro)-27(cedures)-334(for)-333(compilation.)]TJ -231.33 -16.14 TD[(3.)-660(W)83(riting)-359(the)-360(simple)-360(test)-360(driv)27(er:)-497(its)-360(main)-360(task)-360(is)-359(to)-360(searc)26(h)-359(the)-359(directory)-360(\(using)-360(the)-360(Tcl)]TJ 15.69 -13.15 TD[(pro)-27(cedure)]TJ/F4 10.91 Tf 50.96 0 TD[(glob)]TJ/F1 10.91 Tf 26.84 0 TD[(for)-360(\014lename)-360(expansion)-361(with)-360(wildcards\))-361(and)-360(call)-361(a)-360(Tcl)-361(pro)-27(cedure)-361(with)]TJ -77.8 -13.15 TD[(eac)27(h)-332(\014lename.)-444(It)-334(also)-333(c)27(hec)27(ks)-332(for)-333(a)-334(few)-333(errors)-333(from)-334(the)-333(testing)-333(pro)-28(cedure.)]TJ -6.66 -19.13 TD[(T)83(esting)-412(in)27(teractiv)28(e)-412(programs)-412(is)-412(in)26(trinsically)-411(more)-413(complex.)-681(T)82(ests)-412(for)-412(most)-412(in)26(teractiv)28(e)]TJ -14.94 -13.15 TD[(programs)-333(require)-333(some)-333(trial)-334(and)-333(error)-333(b)-28(efore)-334(they)-333(are)-333(complete.)]TJ 14.94 -16.14 TD[(Ho)27(w)28(ev)28(er,)-465(some)-439(in)27(teractiv)28(e)-438(programs)-439(can)-439(b)-28(e)-439(tested)-439(in)-439(a)-438(simple)-439(fashion)-439(reminiscen)26(t)-438(of)]TJ -14.94 -13.15 TD[(batc)27(h)-378(tests.)-583(F)83(or)-379(example,)-391(prior)-379(to)-380(the)-379(creation)-379(of)-380(DejaGn)27(u,)-390(the)]TJ/F7 10.91 Tf 312.86 0 TD[(gdb)]TJ/F1 10.91 Tf 24.27 0 TD[(distribution)-379(already)]TJ -337.13 -13.15 TD[(included)-407(a)-408(wide-ranging)-407(testing)-408(pro)-28(cedure.)-667(This)-408(pro)-27(cedure)-408(w)27(as)-407(v)27(ery)-407(robust,)-426(and)-407(had)-408(al-)]TJ 0 -13.15 TD[(ready)-314(undergone)-315(m)27(uc)28(h)-314(more)-315(debugging)-314(and)-315(error)-315(c)27(hec)28(king)-314(than)-315(man)27(y)-314(recen)27(t)-313(DejaGn)26(u)-313(test)]TJ 0 -13.16 TD[(cases.)-685(Accordingly)83(,)-433(the)-413(b)-28(est)-414(approac)27(h)-413(w)27(as)-412(simply)-414(to)-414(encapsulate)-413(the)-414(existing)]TJ/F7 10.91 Tf 382.39 0 TD[(gdb)]TJ/F1 10.91 Tf 24.64 0 TD[(tests,)]TJ -407.03 -13.15 TD[(for)-355(rep)-27(orting)-356(purp)-27(oses.)-510(Thereafter,)-361(new)]TJ/F7 10.91 Tf 194.75 0 TD[(gdb)]TJ/F1 10.91 Tf 24.01 0 TD[(tests)-355(built)-355(up)-355(a)-355(family)-355(of)]TJ/F4 10.91 Tf 123.67 0 TD[(expect)]TJ/F1 10.91 Tf 38.24 0 TD[(pro)-27(cedures)]TJ -380.67 -13.15 TD[(sp)-27(ecialized)-334(for)]TJ/F7 10.91 Tf 71 0 TD[(gdb)]TJ/F1 10.91 Tf 23.77 0 TD[(testing.)]TJ -79.83 -16.14 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(gdb.t10/crossload.exp)]TJ/F1 10.91 Tf 120.28 0 TD[(')-333(is)-333(a)-333(go)-28(o)-28(d)-333(example)-334(of)-333(an)-333(in)26(teractiv)28(e)-332(test.)]TJ ET 0 g 0 G
+endstream
+endobj
+209 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F7 49 0 R
+/F4 28 0 R
+>>
+endobj
+207 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 209 0 R
+>>
+endobj
+212 0 obj
+<<
+/Length 10014
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(40)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -23.91 TD[(6.2)-562(Debugging)-375(a)-375(test)-375(case)]TJ/F1 10.91 Tf 0 -23.12 TD[(These)-333(are)-333(the)-333(kinds)-334(of)-333(debugging)-333(information)-334(a)27(v)56(ailable)-333(from)-333(DejaGn)27(u:)]TJ 5.91 -16.14 TD[(1.)-660(Output)-330(con)27(trolled)-329(b)26(y)-329(test)-330(scripts)-331(themselv)27(es,)-330(explicitly)-330(allo)27(w)28(ed)-330(for)-330(b)27(y)-330(the)-330(test)-330(author.)]TJ 15.69 -13.15 TD[(This)-252(kind)-252(of)-252(debugging)-252(output)-252(app)-28(ears)-252(in)-253(the)-252(detailed)-252(output)-252(recorded)-252(in)-252(the)-253(`)]TJ/F5 10.91 Tf 365.98 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.48 0 TD[(.log)]TJ/F1 10.91 Tf 22.91 0 TD[(')]TJ -407.37 -13.15 TD[(\014le.)-455(T)82(o)-336(do)-337(the)-337(same)-337(for)-337(new)-337(tests,)-338(use)-337(the)]TJ/F4 10.91 Tf 205.01 0 TD[(verbose)]TJ/F1 10.91 Tf 43.77 0 TD[(pro)-27(cedure)-337(\(whic)26(h)-336(in)-337(turn)-337(uses)-337(the)]TJ -248.78 -13.15 TD[(v)55(ariable)-328(also)-330(called)]TJ/F4 10.91 Tf 93.6 0 TD[(verbose)]TJ/F1 10.91 Tf 40.09 0 TD[(\))-329(to)-330(con)27(trol)-328(ho)26(w)-328(m)27(uc)27(h)-328(output)-330(to)-329(generate.)-443(This)-330(will)-330(mak)27(e)]TJ -133.69 -13.15 TD[(it)-328(easier)-328(for)-328(other)-328(p)-28(eople)-328(running)-328(the)-328(test)-329(to)-328(debug)-328(it)-328(if)-328(necessary)82(.)-442(Whenev)27(er)-327(p)-28(ossible,)]TJ 0 -13.15 TD[(if)-353(`)]TJ/F4 10.91 Tf 13.25 0 TD[($verbose)]TJ/F1 10.91 Tf 45.82 0 TD[(')-353(is)]TJ/F4 10.91 Tf 18.08 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(,)-358(there)-354(should)-353(b)-28(e)-354(no)-353(output)-354(other)-354(than)-353(the)-354(output)-354(from)]TJ/F4 10.91 Tf 271.73 0 TD[(pass)]TJ/F1 10.91 Tf 22.91 0 TD[(,)]TJ/F4 10.91 Tf 6.94 0 TD[(fail)]TJ/F1 10.91 Tf 22.91 0 TD[(,)]TJ/F4 10.91 Tf -407.37 -13.15 TD[(error)]TJ/F1 10.91 Tf 28.64 0 TD[(,)-370(and)]TJ/F4 10.91 Tf 28.6 0 TD[(warning)]TJ/F1 10.91 Tf 40.1 0 TD[(.)-533(Then,)-371(to)-363(whatev)27(er)-362(exten)27(t)-362(is)-363(appropriate)-363(for)-363(the)-364(particular)-363(test,)]TJ -97.34 -13.15 TD[(allo)27(w)-363(successiv)27(ely)-363(higher)-364(v)54(alues)-363(of)-364(`)]TJ/F4 10.91 Tf 170.44 0 TD[($verbose)]TJ/F1 10.91 Tf 45.82 0 TD[(')-364(to)-364(generate)-364(more)-364(information.)-537(Be)-364(kind)]TJ -216.26 -13.15 TD[(to)-333(other)-333(programmers)-333(who)-334(use)-333(y)27(our)-333(tests:)-444(pro)27(vide)-333(for)-333(a)-333(lot)-334(of)-333(debugging)-333(information.)]TJ -15.69 -16.14 TD[(2.)-660(Output)-293(from)-293(the)-293(in)26(ternal)-292(debugging)-293(functions)-293(of)-294(Tcl)-293(and)]TJ/F4 10.91 Tf 287.64 0 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(.)-431(There)-293(is)-293(a)-293(command)]TJ -306.31 -13.15 TD[(line)-329(options)-330(for)-329(eac)27(h;)-330(b)-28(oth)-329(forms)-330(of)-329(debugging)-330(output)-329(are)-330(recorded)-329(in)-330(the)-329(\014le)]TJ/F4 10.91 Tf 370.31 0 TD[(dbg.log)]TJ/F1 10.91 Tf -370.31 -13.15 TD[(in)-333(the)-333(curren)27(t)-333(directory)83(.)]TJ 0 -16.14 TD[(Use)-243(`)]TJ/F4 10.91 Tf 23.02 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[(')-243(for)-243(information)-244(from)-243(the)]TJ/F4 10.91 Tf 122.16 0 TD[(expect)]TJ/F1 10.91 Tf 37.02 0 TD[(lev)27(el;)-272(it)-244(generates)-243(displa)27(ys)-243(of)-243(the)]TJ/F4 10.91 Tf 153.75 0 TD[(expect)]TJ/F1 10.91 Tf -376.04 -13.15 TD[(attempts)-266(to)-267(matc)26(h)-265(the)-267(to)-28(ol)-267(output)-267(with)-267(the)-267(patterns)-267(sp)-28(eci\014ed)-266(\(see)-267(Section)-267(5.7.3)-267([Debug)]TJ 0 -13.15 TD[(Log],)-357(page)-353(36\).)-503(This)-353(output)-353(can)-353(b)-28(e)-353(v)27(ery)-352(helpful)-353(while)-353(dev)27(eloping)-352(test)-353(scripts,)-357(since)-353(it)]TJ 0 -13.15 TD[(sho)27(ws)-322(precisely)-323(the)-323(c)27(haracters)-322(receiv)26(ed.)-440(Iterating)-323(b)-27(et)26(w)28(een)-322(the)-323(latest)-323(attempt)-323(at)-323(a)-323(new)]TJ 0 -13.15 TD[(test)-347(script)-348(and)-348(the)-347(corresp)-28(onding)-348(`)]TJ/F4 10.91 Tf 165.6 0 TD[(dbg.log)]TJ/F1 10.91 Tf 40.09 0 TD[(')-347(can)-348(allo)27(w)-347(y)27(ou)-347(to)-347(create)-348(the)-348(\014nal)-347(patterns)]TJ -205.69 -13.15 TD[(b)27(y)-332(\\cut)-333(and)-334(paste".)-444(This)-333(is)-334(sometimes)-333(the)-333(b)-28(est)-334(w)27(a)28(y)-332(to)-334(write)-333(a)-333(test)-334(case.)]TJ 0 -16.14 TD[(Use)-486(`)]TJ/F4 10.91 Tf 25.67 0 TD[(--strace)]TJ/F1 10.91 Tf 45.82 0 TD[(')-486(to)-486(see)-486(more)-486(detail)-487(at)-486(the)-486(Tcl)-486(lev)26(el;)-561(this)-487(sho)27(ws)-485(ho)27(w)-486(Tcl)-486(pro)-28(cedure)]TJ -71.49 -13.15 TD[(de\014nitions)-484(expand,)-522(as)-485(they)-484(execute.)-898(The)-485(asso)-28(ciated)-484(n)27(um)27(b)-26(er)-485(con)27(trols)-484(the)-484(depth)-485(of)]TJ 0 -13.16 TD[(de\014nitions)-247(expanded;)-277(see)-248(the)-248(discussion)-247(of)-248(`)]TJ/F4 10.91 Tf 202.3 0 TD[(--strace)]TJ/F1 10.91 Tf 45.81 0 TD[(')-247(in)-248(Chapter)-248(3)-248([Running)-248(the)-248(T)82(ests],)]TJ -248.11 -13.15 TD[(page)-333(9.)]TJ -15.69 -16.14 TD[(3.)-660(Finally)83(,)-273(if)-259(the)-260(v)55(alue)-258(of)-259(`)]TJ/F4 10.91 Tf 123.47 0 TD[(verbose)]TJ/F1 10.91 Tf 40.09 0 TD[(')-259(is)-259(3)-259(or)-259(greater,)]TJ/F4 10.91 Tf 76.27 0 TD[(runtest)]TJ/F1 10.91 Tf 42.92 0 TD[(turns)-259(on)-259(the)]TJ/F4 10.91 Tf 60.09 0 TD[(expect)]TJ/F1 10.91 Tf 37.19 0 TD[(command)]TJ/F4 10.91 Tf -364.34 -13.15 TD[(log_user)]TJ/F1 10.91 Tf 45.82 0 TD[(.)-434(This)-304(command)-305(prin)27(ts)-303(all)]TJ/F4 10.91 Tf 127.56 0 TD[(expect)]TJ/F1 10.91 Tf 37.68 0 TD[(actions)-304(to)-304(the)]TJ/F4 10.91 Tf 68.2 0 TD[(expect)]TJ/F1 10.91 Tf 37.68 0 TD[(standard)-304(output,)-310(to)]TJ -316.94 -13.15 TD[(the)-333(detailed)-333(log)-333(\014le,)-334(and)-333(\(if)-333(`)]TJ/F4 10.91 Tf 136.67 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[(')-333(is)-333(on\))-333(to)-334(`)]TJ/F4 10.91 Tf 53.39 0 TD[(dbg.log)]TJ/F1 10.91 Tf 40.09 0 TD[('.)]TJ/F2 14.35 Tf -291.84 -30.88 TD[(6.3)-562(Adding)-375(a)-375(test)-375(case)-375(to)-375(a)-375(test)-375(suite)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(There)-357(are)-358(t)27(w)28(o)-357(sligh)27(tly)-357(di\013eren)27(t)-357(w)27(a)27(ys)-356(to)-358(add)-358(a)-358(test)-357(case.)-518(One)-358(is)-358(to)-357(add)-358(the)-358(test)-358(case)-357(to)]TJ -14.94 -13.16 TD[(an)-297(existing)-298(directory)83(.)-432(The)-297(other)-298(is)-297(to)-298(create)-297(a)-298(new)-297(directory)-298(to)-298(hold)-297(y)27(our)-297(test.)-432(The)-298(existing)]TJ 0 -13.15 TD[(test)-284(directories)-285(represen)26(t)-284(sev)27(eral)-284(st)27(yles)-284(of)-285(testing,)-295(all)-285(of)-285(whic)27(h)-284(are)-285(sligh)27(tly)-284(di\013eren)27(t;)-300(examine)]TJ 0 -13.15 TD[(the)-333(directories)-333(for)-333(the)-334(to)-28(ol)-333(of)-333(in)27(terest)-333(to)-333(see)-333(whic)26(h)-332(\(if)-333(an)26(y\))-332(is)-333(most)-334(suitable.)]TJ 14.94 -16.14 TD[(Adding)-347(a)]TJ/F7 10.91 Tf 47.89 0 TD[(gcc)]TJ/F1 10.91 Tf 23.68 0 TD[(test)-347(can)-348(b)-28(e)-347(v)27(ery)-347(simple:)-473(just)-348(add)-347(the)-348(C)-347(co)-28(de)-348(to)-348(an)27(y)-346(directory)-348(b)-28(eginning)]TJ -86.51 -13.15 TD[(with)-333(`)]TJ/F4 10.91 Tf 27.88 0 TD[(gcc.)]TJ/F1 10.91 Tf 22.91 0 TD[(')-333(and)-333(it)-333(runs)-334(on)-333(the)-333(next)-334(`)]TJ/F4 10.91 Tf 124.63 0 TD[(runtest)-333(--tool)-333(gcc)]TJ/F1 10.91 Tf 98.91 0 TD[('.)]TJ -259.39 -16.14 TD[(T)83(o)-288(add)-289(a)-289(test)-289(to)]TJ/F7 10.91 Tf 78.55 0 TD[(gdb)]TJ/F1 10.91 Tf 20.14 0 TD[(,)-297(\014rst)-289(add)-289(an)26(y)-288(source)-289(co)-27(de)-289(y)27(ou)-288(will)-289(need)-289(to)-289(the)-289(test)-289(directory)82(.)-429(Then)]TJ -113.63 -13.15 TD[(y)27(ou)-312(can)-313(either)-313(create)-314(a)-313(new)]TJ/F4 10.91 Tf 133.9 0 TD[(expect)]TJ/F1 10.91 Tf 37.78 0 TD[(\014le,)-317(or)-313(add)-313(y)27(our)-313(test)-313(to)-313(an)-313(existing)-314(one)-313(\(an)27(y)-312(\014le)-314(with)-313(a)]TJ -171.68 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(.exp)]TJ/F1 10.91 Tf 22.91 0 TD[(')-309(su\016x\).)-437(Creating)-310(a)-310(new)-310(`)]TJ/F4 10.91 Tf 122.32 0 TD[(.exp)]TJ/F1 10.91 Tf 22.91 0 TD[(')-309(\014le)-310(is)-310(probably)-310(a)-310(b)-28(etter)-310(idea)-310(if)-310(the)-310(test)-310(is)-310(signi\014can)27(tly)]TJ -171.17 -13.15 TD[(di\013eren)27(t)-395(from)-395(existing)-396(tests.)-632(Adding)-396(it)-396(as)-396(a)-395(separate)-396(\014le)-396(also)-396(mak)27(es)-395(upgrading)-396(easier.)-632(If)]TJ 0 -13.15 TD[(the)-365(C)-365(co)-28(de)-365(has)-365(to)-365(b)-28(e)-365(already)-365(compiled)-365(b)-28(efore)-365(the)-365(test)-365(will)-366(run,)-373(then)-365(y)27(ou'll)-364(ha)27(v)27(e)-364(to)-365(add)-365(it)]TJ 0 -13.15 TD[(to)-333(the)-333(`)]TJ/F4 10.91 Tf 35.15 0 TD[(Makefile.in)]TJ/F1 10.91 Tf 63 0 TD[(')-333(\014le)-333(for)-333(that)-334(test)-333(directory)82(,)-332(then)-333(run)]TJ/F4 10.91 Tf 179.27 0 TD[(configure)]TJ/F1 10.91 Tf 55.19 0 TD[(and)]TJ/F4 10.91 Tf 21.21 0 TD[(make)]TJ/F1 10.91 Tf 22.91 0 TD[(.)]TJ -361.79 -16.14 TD[(Adding)-333(a)-333(test)-333(b)26(y)-332(creating)-333(a)-334(new)-333(directory)-333(is)-334(v)27(ery)-332(similar:)]TJ -9.03 -16.14 TD[(1.)-660(Create)-360(the)-360(new)-360(directory)82(.)-523(All)-360(sub)-28(directory)-360(names)-360(b)-28(egin)-360(with)-360(the)-360(name)-361(of)-360(the)-360(to)-28(ol)-360(to)]TJ 15.69 -13.15 TD[(test;)-341(e.g.)]TJ/F7 10.91 Tf 45.77 0 TD[(g)]TJ/F4 10.91 Tf 6.99 0 TD[(++)]TJ/F1 10.91 Tf 15.15 0 TD[(tests)-338(migh)27(t)-338(b)-27(e)-339(in)-338(a)-339(directory)-338(called)-339(`)]TJ/F4 10.91 Tf 174.21 0 TD[(g++.other)]TJ/F1 10.91 Tf 51.55 0 TD[('.)-459(There)-339(can)-338(b)-28(e)-339(m)27(ultiple)]TJ -293.67 -13.15 TD[(test)-333(directories)-333(that)-333(start)-334(with)-333(the)-333(same)-334(to)-28(ol)-333(name)-333(\(suc)27(h)-333(as)-333(`)]TJ/F4 10.91 Tf 291.36 0 TD[(g++)]TJ/F1 10.91 Tf 17.19 0 TD[('\).)]TJ ET 0 g 0 G
+endstream
+endobj
+213 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F5 31 0 R
+/F4 28 0 R
+/F7 49 0 R
+>>
+endobj
+211 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 213 0 R
+>>
+endobj
+216 0 obj
+<<
+/Length 9135
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(6:)-444(Ho)27(w)-333(T)83(o)-333(W)83(rite)-333(a)-333(T)82(est)-332(Case)-21861(41)]TJ 5.91 -23.91 TD[(2.)-660(Add)-320(the)-320(new)-320(directory)-320(name)-320(to)-321(the)-320(`)]TJ/F4 10.91 Tf 190.51 0 TD[(configdirs)]TJ/F1 10.91 Tf 57.27 0 TD[(')-320(de\014nition)-320(in)-320(the)-320(`)]TJ/F4 10.91 Tf 89.12 0 TD[(configure.in)]TJ/F1 10.91 Tf 68.73 0 TD[(')-320(\014le)]TJ -389.94 -13.15 TD[(for)-285(the)-287(test)-286(suite)-286(directory)83(.)-428(This)-286(w)27(a)28(y)-285(when)]TJ/F4 10.91 Tf 204.37 0 TD[(make)]TJ/F1 10.91 Tf 26.02 0 TD[(and)]TJ/F4 10.91 Tf 20.7 0 TD[(configure)]TJ/F1 10.91 Tf 54.67 0 TD[(next)-285(run,)-296(they)-286(include)]TJ -305.76 -13.15 TD[(the)-333(new)-333(directory)82(.)]TJ -15.69 -16.14 TD[(3.)-660(Add)-333(the)-333(new)-334(test)-333(case)-333(to)-334(the)-333(directory)82(,)-332(as)-333(ab)-28(o)27(v)28(e.)]TJ 0 -16.14 TD[(4.)-660(T)83(o)-387(add)-389(supp)-27(ort)-389(in)-388(the)-388(new)-388(directory)-388(for)-389(con\014gure)-388(and)-388(mak)27(e,)-401(y)27(ou)-387(m)26(ust)-387(also)-388(create)-388(a)]TJ/F4 10.91 Tf 15.69 -13.15 TD[(Makefile.in)]TJ/F1 10.91 Tf 67.88 0 TD[(and)-447(a)]TJ/F4 10.91 Tf 32.8 0 TD[(configure.in)]TJ/F1 10.91 Tf 68.73 0 TD[(.)-787(See)-448(section)-448(\\What)-447(Con\014gure)-448(Do)-28(es")-448(in)]TJ/F5 10.91 Tf 205.78 0 TD[(Cygn)27(us)]TJ -375.19 -13.15 TD[(Con\014gure)]TJ/F1 10.91 Tf 46.7 0 TD[(.)]TJ/F2 14.35 Tf -68.3 -30.89 TD[(6.4)-562(Hin)30(ts)-374(on)-375(writing)-375(a)-375(test)-375(case)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(There)-305(ma)27(y)-305(b)-28(e)-305(useful)-306(existing)-305(pro)-28(cedures)-305(already)-306(written)-305(for)-306(y)27(our)-305(test)-305(in)-306(the)-305(`)]TJ/F4 10.91 Tf 366.82 0 TD[(lib)]TJ/F1 10.91 Tf 17.18 0 TD[(')-305(direc-)]TJ -398.94 -13.15 TD[(tory)-333(of)-333(the)-333(DejaGn)26(u)-332(distribution.)-444(See)-334(Section)-333(5.3)-333([DejaGn)26(u)-332(Builtins],)-333(page)-334(23.)]TJ 14.94 -16.14 TD[(It)-291(is)-292(safest)-291(to)-292(write)-291(patterns)-292(that)-291(matc)27(h)]TJ/F8 10.91 Tf 190.3 0 TD[(al)-51(l)]TJ/F1 10.91 Tf 16.01 0 TD[(the)-291(output)-292(generated)-291(b)27(y)-291(the)-291(tested)-292(program;)]TJ -221.25 -13.15 TD[(this)-254(is)-255(called)]TJ/F5 10.91 Tf 60.58 0 TD[(closure)]TJ/F1 10.91 Tf 32.82 0 TD[(.)-418(If)-255(a)-254(pattern)-255(do)-28(es)-255(not)-254(matc)26(h)-253(the)-255(en)27(tire)-254(output,)-271(an)27(y)-254(output)-254(that)-255(remains)]TJ -93.4 -13.15 TD[(will)-416(b)-28(e)-416(examined)-416(b)27(y)-416(the)]TJ/F8 10.91 Tf 122.71 0 TD[(next)]TJ/F4 10.91 Tf 25.41 0 TD[(expect)]TJ/F1 10.91 Tf 38.9 0 TD[(command.)-693(In)-416(this)-416(situation,)-437(the)-416(precise)-417(b)-28(oundary)]TJ -187.02 -13.15 TD[(that)-341(determines)-341(whic)26(h)]TJ/F4 10.91 Tf 110.36 0 TD[(expect)]TJ/F1 10.91 Tf 38.09 0 TD[(command)-341(sees)-341(what)-342(is)-341(v)26(ery)-340(sensitiv)27(e)-341(to)-341(timing)-342(b)-27(et)26(w)28(een)-340(the)]TJ/F4 10.91 Tf -148.45 -13.15 TD[(expect)]TJ/F1 10.91 Tf 39.03 0 TD[(task)-427(and)-427(the)-428(task)-427(running)-427(the)-428(tested)-427(to)-28(ol.)-726(As)-428(a)-427(result,)-451(the)-427(test)-428(ma)27(y)-426(sometimes)]TJ -39.03 -13.16 TD[(app)-27(ear)-388(to)-388(w)27(ork,)-400(but)-388(is)-388(lik)27(ely)-387(to)-388(ha)27(v)28(e)-387(unpredictable)-388(results.)-608(\(This)-388(problem)-387(is)-388(particularly)]TJ 0 -13.15 TD[(lik)27(ely)-360(for)-360(in)26(teractiv)28(e)-360(to)-27(ols,)-368(but)-361(can)-361(also)-361(a\013ect)-360(batc)26(h)-359(to)-28(ols|esp)-28(ecially)-361(for)-361(tests)-360(that)-361(tak)27(e)-360(a)]TJ 0 -13.15 TD[(long)-270(time)-271(to)-271(\014nish.\))-424(The)-270(b)-28(est)-271(w)27(a)27(y)-269(to)-271(ensure)-271(closure)-271(is)-271(to)-271(use)-270(the)-271(`)]TJ/F4 10.91 Tf 307.09 0 TD[(-re)]TJ/F1 10.91 Tf 17.18 0 TD[(')-270(option)-271(for)-271(the)]TJ/F4 10.91 Tf 73.37 0 TD[(expect)]TJ/F1 10.91 Tf -397.64 -13.15 TD[(command)-323(to)-323(write)-323(the)-323(pattern)-324(as)-323(a)-323(full)-323(regular)-324(expressions;)-326(then)-323(y)26(ou)-322(can)-323(matc)27(h)-322(the)-324(end)-323(of)]TJ 0 -13.15 TD[(output)-344(using)-345(a)-344(`)]TJ/F4 10.91 Tf 76.79 0 TD[($)]TJ/F1 10.91 Tf 5.73 0 TD[('.)-478(It)-344(is)-345(also)-344(a)-345(go)-28(o)-28(d)-344(idea)-345(to)-344(write)-345(patterns)-345(that)-344(matc)27(h)-344(all)-345(a)27(v)56(ailable)-344(output)]TJ -82.52 -13.15 TD[(b)27(y)-398(using)-399(`)]TJ/F4 10.91 Tf 48.16 0 TD[(.*\\)]TJ/F1 10.91 Tf 17.18 0 TD[(')-398(after)-399(the)-399(text)-399(of)-399(in)27(terest;)-431(this)-399(will)-399(also)-399(matc)27(h)-398(an)27(y)-398(in)27(terv)27(ening)-397(blank)-399(lines.)]TJ -65.34 -13.15 TD[(Sometimes)-356(an)-357(alternativ)27(e)-356(is)-357(to)-357(matc)27(h)-356(end)-357(of)-357(line)-357(using)-356(`)]TJ/F4 10.91 Tf 269.44 0 TD[(\\r)]TJ/F1 10.91 Tf 11.46 0 TD[(')-356(or)-357(`)]TJ/F4 10.91 Tf 23.57 0 TD[(\\n)]TJ/F1 10.91 Tf 11.46 0 TD[(',)-362(but)-357(this)-357(is)-357(usually)-357(to)-27(o)]TJ -315.93 -13.15 TD[(dep)-27(enden)27(t)-333(on)-333(terminal)-333(settings.)]TJ 14.94 -16.14 TD[(Alw)27(a)28(ys)-494(escap)-28(e)-495(punctuation,)-535(suc)26(h)-494(as)-495(`)]TJ/F4 10.91 Tf 186.48 0 TD[(\()]TJ/F1 10.91 Tf 5.73 0 TD[(')-495(or)-495(`)]TJ/F4 10.91 Tf 26.59 0 TD[(")]TJ/F1 10.91 Tf 5.73 0 TD[(',)-535(in)-495(y)27(our)-494(patterns;)-576(for)-496(example,)-535(write)]TJ -239.47 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(\\\()]TJ/F1 10.91 Tf 11.45 0 TD[('.)-448(If)-335(y)27(ou)-334(forget)-335(to)-335(escap)-27(e)-335(punctuation,)-335(y)26(ou)-333(will)-335(usually)-335(see)-335(an)-334(error)-335(message)-335(lik)27(e)-334(`)]TJ/F4 10.91 Tf 388.88 0 TD[(extra)]TJ -403.36 -13.15 TD[(characters)-333(after)-333(close-quote)]TJ/F1 10.91 Tf 156.18 0 TD[('.)]TJ -141.24 -16.14 TD[(If)-372(y)27(ou)-372(ha)27(v)28(e)-372(trouble)-373(understanding)-372(wh)27(y)-372(a)-373(pattern)-372(do)-28(es)-373(not)-372(matc)26(h)-371(the)-373(program)-372(output,)]TJ -14.94 -13.15 TD[(try)-496(using)-497(the)-496(`)]TJ/F4 10.91 Tf 73.61 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[(')-496(option)-497(to)]TJ/F4 10.91 Tf 59.29 0 TD[(runtest)]TJ/F1 10.91 Tf 40.09 0 TD[(,)-537(and)-496(examine)-497(the)-496(debug)-497(log)-497(carefully)83(.)-933(See)]TJ -213.08 -13.15 TD[(Section)-333(5.7.3)-333([Debug)-333(Log],)-334(page)-333(36.)]TJ 14.94 -16.14 TD[(Be)-304(careful)-305(not)-305(to)-304(neglect)-305(output)-305(generated)-305(b)27(y)-304(setup)-304(rather)-305(than)-305(b)27(y)-304(the)-304(in)26(teresting)-303(parts)]TJ -14.94 -13.15 TD[(of)-349(a)-349(test)-350(case.)-493(F)83(or)-349(example,)-353(while)-350(testing)]TJ/F7 10.91 Tf 201.56 0 TD[(gdb)]TJ/F1 10.91 Tf 20.13 0 TD[(,)-353(I)-349(issue)-350(a)-349(send)-350(`)]TJ/F4 10.91 Tf 78.38 0 TD[(set)-333(height)-333(0\\n)]TJ/F1 10.91 Tf 76 0 TD[(')-349(command.)]TJ -376.07 -13.15 TD[(The)-360(purp)-28(ose)-360(is)-360(simply)-361(to)-360(mak)27(e)-360(sure)]TJ/F7 10.91 Tf 176.31 0 TD[(gdb)]TJ/F1 10.91 Tf 24.06 0 TD[(nev)27(er)-359(calls)-360(a)-361(paging)-360(program.)-526(The)-360(`)]TJ/F4 10.91 Tf 173.42 0 TD[(set)-333(height)]TJ/F1 10.91 Tf 55.18 0 TD[(')]TJ -428.97 -13.15 TD[(command)-427(in)]TJ/F7 10.91 Tf 64.48 0 TD[(gdb)]TJ/F1 10.91 Tf 24.8 0 TD[(do)-27(es)-428(not)-427(generate)-428(an)27(y)-427(output;)-475(but)-427(running)]TJ/F8 10.91 Tf 215.41 0 TD[(any)]TJ/F1 10.91 Tf 22.64 0 TD[(command)-427(mak)27(es)]TJ/F7 10.91 Tf 84.54 0 TD[(gdb)]TJ/F1 10.91 Tf -411.87 -13.15 TD[(issue)-318(a)-319(new)-319(`)]TJ/F4 10.91 Tf 60.26 0 TD[(\(gdb\))]TJ/F1 10.91 Tf 32.27 0 TD[(')-318(prompt.)-440(If)-319(there)-319(w)27(ere)-318(no)]TJ/F4 10.91 Tf 128.04 0 TD[(expect)]TJ/F1 10.91 Tf 37.85 0 TD[(command)-318(to)-319(matc)26(h)-318(this)-319(prompt,)-322(the)]TJ -258.42 -13.15 TD[(output)-281(`)]TJ/F4 10.91 Tf 38.22 0 TD[(\(gdb\))]TJ/F1 10.91 Tf 32.27 0 TD[(')-281(b)-27(egins)-282(the)-281(text)-281(seen)-281(b)27(y)-280(the)-282(next)]TJ/F4 10.91 Tf 159.51 0 TD[(expect)]TJ/F1 10.91 Tf 37.43 0 TD[(command|whic)27(h)-280(migh)27(t)-280(mak)27(e)]TJ/F8 10.91 Tf 146.17 0 TD[(that)]TJ/F1 10.91 Tf -413.6 -13.16 TD[(pattern)-333(fail)-333(to)-333(matc)26(h.)]TJ 14.94 -16.13 TD[(T)83(o)-426(preserv)27(e)-426(basic)-426(sanit)27(y)83(,)-449(I)-426(also)-427(recommended)-426(that)-427(no)-427(test)-426(ev)27(er)-426(pass)-427(if)-426(there)-427(w)27(as)-425(an)26(y)]TJ -14.94 -13.16 TD[(kind)-373(of)-374(problem)-374(in)-373(the)-374(test)-374(case.)-566(T)83(o)-373(tak)27(e)-373(an)-374(extreme)-373(case,)-384(tests)-374(that)-374(pass)-373(ev)26(en)-372(when)-374(the)]TJ 0 -13.15 TD[(to)-27(ol)-381(will)-380(not)-381(spa)27(wn)-380(are)-380(misleading.)-586(Ideally)82(,)-391(a)-381(test)-380(in)-381(this)-380(sort)-381(of)-380(situation)-381(should)-380(not)-381(fail)]TJ 0 -13.15 TD[(either.)-453(Instead,)-337(prin)27(t)-336(an)-336(error)-336(message)-337(b)27(y)-335(calling)-336(one)-337(of)-336(the)-336(DejaGn)26(u)-335(pro)-28(cedures)]TJ/F4 10.91 Tf 389.97 0 TD[(error)]TJ/F1 10.91 Tf 32.3 0 TD[(or)]TJ/F4 10.91 Tf -422.27 -13.15 TD[(warning)]TJ/F1 10.91 Tf 40.09 0 TD[(.)]TJ ET 0 g 0 G
+endstream
+endobj
+217 0 obj
+<<
+/F1 9 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F2 12 0 R
+/F8 52 0 R
+/F7 49 0 R
+>>
+endobj
+215 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 217 0 R
+>>
+endobj
+220 0 obj
+<<
+/Length 3621
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(42)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -23.91 TD[(6.5)-562(Sp)-31(ecial)-375(v)61(ariables)-374(used)-375(b)31(y)-374(test)-375(cases)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(Y)83(our)-488(test)-489(cases)-489(can)-489(use)-489(these)-490(v)55(ariables,)-527(with)-489(con)27(v)27(en)28(tional)-488(meanings)-489(\(as)-489(w)27(ell)-488(as)-489(the)]TJ -14.94 -13.15 TD[(v)55(ariables)-332(sa)27(v)27(ed)-332(in)-333(`)]TJ/F4 10.91 Tf 90.45 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-333(see)-333(Chapter)-333(4)-334([Setting)]TJ/F4 10.91 Tf 116.46 0 TD[(runtest)]TJ/F1 10.91 Tf 43.72 0 TD[(defaults],)-333(page)-333(15\):)]TJ/F8 10.91 Tf -267.65 -15.44 TD[(These)-357(variables)-358(ar)50(e)-357(available)-357(to)-358(al)-51(l)-358(test)-358(c)50(ases.)]TJ/F4 10.91 Tf -28.8 -22.12 TD[(prms_id)]TJ/F1 10.91 Tf 57.6 0 TD[(The)-378(trac)27(king)-377(system)-379(\(e.g.)]TJ/F7 10.91 Tf 129.46 0 TD[(gna)66(ts)]TJ/F1 10.91 Tf 31.09 0 TD[(\))-378(n)27(um)28(b)-27(er)-378(iden)26(tifying)-377(a)-378(corresp)-28(onding)-378(bugre-)]TJ -160.55 -13.15 TD[(p)-27(ort.)-445(\(`)]TJ/F4 10.91 Tf 35.49 0 TD[(0)]TJ/F1 10.91 Tf 5.72 0 TD[(')-333(if)-333(y)27(ou)-333(do)-333(not)-333(sp)-28(ecify)-333(it)-334(in)-333(the)-333(test)-334(script.\))]TJ/F4 10.91 Tf -98.81 -22.11 TD[(bug_id)]TJ/F1 10.91 Tf 57.6 0 TD[(An)-307(optional)-308(bug)-307(id;)-316(ma)26(y)-306(re\015ect)-308(a)-307(bug)-308(iden)27(ti\014cation)-307(from)-308(another)-307(organization.)]TJ 0 -13.15 TD[(\(`)]TJ/F4 10.91 Tf 7.27 0 TD[(0)]TJ/F1 10.91 Tf 5.73 0 TD[(')-333(if)-333(y)27(ou)-333(do)-333(not)-333(sp)-28(ecify)-333(it.\))]TJ/F4 10.91 Tf -70.6 -22.12 TD[(subdir)]TJ/F1 10.91 Tf 57.6 0 TD[(The)-333(sub)-28(directory)-333(for)-333(the)-334(curren)27(t)-332(test)-333(case.)]TJ/F8 10.91 Tf -28.8 -18.43 TD[(These)-357(variables)-358(should)-358(never)-358(b)51(e)-357(change)50(d.)-459(They)-358(app)50(e)51(ar)-356(in)-358(most)-358(tests.)]TJ/F4 10.91 Tf -28.8 -22.12 TD[(expect_out\(buffer\))]TJ/F1 10.91 Tf 57.6 -13.15 TD[(The)-297(output)-297(from)-298(the)-297(last)-297(command.)-433(This)-297(is)-297(an)-298(in)27(ternal)-296(v)54(ariable)-296(set)-297(b)26(y)]TJ/F4 10.91 Tf 337.01 0 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(.)]TJ/F4 10.91 Tf -428.97 -22.12 TD[(exec_output)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(This)-349(is)-349(the)-349(output)-349(from)-349(a)]TJ/F5 10.91 Tf 126.33 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.92 0 TD[(_load)]TJ/F1 10.91 Tf 32.44 0 TD[(command.)-491(This)-349(only)-349(applies)-349(to)-349(to)-28(ols)-349(lik)26(e)]TJ/F7 10.91 Tf -177.69 -13.15 TD[(gcc)]TJ/F1 10.91 Tf 24.35 0 TD[(and)]TJ/F7 10.91 Tf 22.03 0 TD[(gas)]TJ/F1 10.91 Tf 23.13 0 TD[(whic)27(h)-407(pro)-28(duce)-408(an)-409(ob)-55(ject)-409(\014le)-408(that)-409(m)27(ust)-407(in)-409(turn)-408(b)-28(e)-408(executed)-409(to)]TJ -69.51 -13.15 TD[(complete)-333(a)-333(test.)]TJ/F4 10.91 Tf -57.6 -22.12 TD[(comp_output)]TJ/F1 10.91 Tf 57.6 -13.15 TD[(This)-398(is)-399(the)-399(output)-398(from)-399(a)]TJ/F5 10.91 Tf 129.58 0 TD[(to)-27(ol)]TJ/F4 10.91 Tf 18.92 0 TD[(_start)]TJ/F1 10.91 Tf 38.71 0 TD[(command.)-640(This)-399(is)-399(con)27(v)28(en)28(tionally)-398(used)]TJ -187.21 -13.15 TD[(for)-377(batc)27(h)-376(orien)26(ted)-376(programs,)-389(lik)27(e)]TJ/F7 10.91 Tf 162.4 0 TD[(gcc)]TJ/F1 10.91 Tf 24.01 0 TD[(and)]TJ/F7 10.91 Tf 21.69 0 TD[(gas)]TJ/F1 10.91 Tf 18.68 0 TD[(,)-388(that)-377(ma)26(y)-376(pro)-28(duce)-377(in)27(teresting)]TJ -226.78 -13.15 TD[(output)-333(\(w)27(arnings,)-332(errors\))-334(without)-333(further)-333(in)26(teraction.)]TJ ET 0 g 0 G
+endstream
+endobj
+221 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F8 52 0 R
+/F7 49 0 R
+/F5 31 0 R
+>>
+endobj
+219 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 221 0 R
+>>
+endobj
+224 0 obj
+<<
+/Length 6574
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(7:)-444(New)-334(T)83(o)-27(ols,)-333(T)82(argets,)-332(or)-334(Hosts)-20764(43)]TJ/F2 17.22 Tf 0 -25.91 TD[(7)-562(New)-375(T)93(o)-30(ols,)-375(T)92(argets,)-374(or)-375(Hosts)]TJ/F1 10.91 Tf 14.94 -28.09 TD[(The)-350(most)-350(common)-351(w)27(a)28(ys)-350(to)-350(extend)-351(the)-350(DejaGn)27(u)-350(framew)27(ork)-349(are:)-479(adding)-350(a)-351(suite)-350(of)-351(tests)]TJ -14.94 -13.15 TD[(for)-265(a)-266(new)-265(to)-28(ol)-266(to)-266(b)-27(e)-266(tested;)-288(adding)-266(supp)-28(ort)-265(for)-266(testing)-266(on)-265(a)-266(new)-265(target;)-289(and)-265(p)-28(orting)]TJ/F4 10.91 Tf 391.91 0 TD[(runtest)]TJ/F1 10.91 Tf -391.91 -13.15 TD[(to)-333(a)-333(new)-333(host.)]TJ/F2 14.35 Tf 0 -30.89 TD[(7.1)-562(W)93(riting)-374(tests)-375(for)-375(a)-375(new)-375(to)-31(ol)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(In)-426(general,)-450(the)-426(b)-28(est)-427(w)27(a)28(y)-426(to)-426(learn)-427(ho)27(w)-426(to)-426(write)-427(\(co)-27(de)-427(or)-427(ev)27(en)-425(prose\))-427(is)-426(to)-427(read)-427(some-)]TJ -14.94 -13.15 TD[(thing)-385(similar.)-602(This)-385(principle)-386(applies)-386(to)-385(test)-386(cases)-386(and)-385(to)-386(test)-386(suites.)-601(Unfortunately)82(,)-397(w)26(ell-)]TJ 0 -13.15 TD[(established)-479(test)-479(suites)-479(ha)27(v)28(e)-479(a)-479(w)27(a)28(y)-478(of)-480(dev)27(eloping)-478(their)-479(o)27(wn)-478(con)26(v)28(en)28(tions:)-735(as)-479(test)-480(writers)]TJ 0 -13.15 TD[(b)-27(ecome)-315(more)-315(exp)-28(erienced)-315(with)-315(DejaGn)27(u)-314(and)-315(with)-315(Tcl,)-319(they)-315(accum)27(ulate)-314(more)-315(utilities,)-319(and)]TJ 0 -13.15 TD[(tak)27(e)-332(adv)55(an)27(tage)-332(of)-333(more)-334(and)-333(more)-333(features)-334(of)]TJ/F4 10.91 Tf 216.82 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(and)-333(Tcl)-333(in)-333(general.)]TJ -239.88 -16.14 TD[(Insp)-27(ecting)-425(suc)27(h)-423(established)-425(test)-424(suites)-425(ma)27(y)-424(mak)27(e)-423(the)-425(prosp)-28(ect)-424(of)-425(creating)-424(an)-425(en)27(tirely)]TJ -14.94 -13.15 TD[(new)-342(test)-342(suite)-342(app)-28(ear)-342(o)27(v)28(erwhelming.)-470(Nev)27(ertheless,)-343(it)-342(is)-342(quite)-342(straigh)26(tforw)28(ard)-341(to)-342(get)-342(a)-342(new)]TJ 0 -13.15 TD[(test)-333(suite)-333(going.)]TJ 14.94 -16.14 TD[(There)-315(is)-315(one)-315(test)-315(suite)-316(that)-315(is)-315(guaran)27(teed)-314(not)-316(to)-315(gro)27(w)-314(more)-315(elab)-28(orate)-315(o)26(v)28(er)-314(time:)-435(b)-28(oth)-315(it)]TJ -14.94 -13.15 TD[(and)-377(the)-378(to)-28(ol)-378(it)-378(tests)-378(w)27(ere)-377(created)-378(expressly)-378(to)-378(illustrate)-378(what)-378(it)-378(tak)27(es)-377(to)-378(get)-378(started)-378(with)]TJ 0 -13.15 TD[(DejaGn)27(u.)-681(The)-413(`)]TJ/F4 10.91 Tf 79.14 0 TD[(example/)]TJ/F1 10.91 Tf 45.82 0 TD[(')-412(directory)-413(of)-412(the)-413(DejaGn)27(u)-412(distribution)-412(con)26(tains)-411(b)-28(oth)-413(an)-412(in)27(ter-)]TJ -124.96 -13.15 TD[(activ)27(e)-360(to)-27(ol)-361(called)]TJ/F4 10.91 Tf 85.44 0 TD[(calc)]TJ/F1 10.91 Tf 22.91 0 TD[(,)-367(and)-361(a)-361(test)-361(suite)-360(for)-361(it.)-527(Reading)-361(this)-361(test)-360(suite,)-368(and)-361(exp)-28(erimen)27(ting)]TJ -108.35 -13.15 TD[(with)-389(it,)-404(is)-389(a)-390(go)-27(o)-28(d)-390(w)27(a)28(y)-389(to)-389(supplemen)27(t)-389(the)-390(information)-389(in)-390(this)-389(section.)-613(\(Thanks)-390(to)-389(Rob)-28(ert)]TJ 0 -13.16 TD[(Lupton)-323(for)-324(creating)]TJ/F4 10.91 Tf 96.57 0 TD[(calc)]TJ/F1 10.91 Tf 26.44 0 TD[(and)-323(its)-324(test)-324(suite|and)-324(also)-323(the)-324(\014rst)-324(v)27(ersion)-323(of)-324(this)-324(section)-323(of)-324(the)]TJ -123.01 -13.15 TD[(man)27(ual!\))]TJ 14.94 -16.14 TD[(T)83(o)-344(help)-344(orien)27(t)-344(y)27(ou)-343(further)-345(in)-344(this)-345(task,)-347(here)-344(is)-345(an)-344(outline)-344(of)-345(the)-344(steps)-345(to)-344(b)-28(egin)-344(building)]TJ -14.94 -13.15 TD[(a)-333(test)-333(suite)-333(for)-334(a)-333(program)]TJ/F5 10.91 Tf 125.97 0 TD[(example)]TJ/F1 10.91 Tf 39.09 0 TD[(.)]TJ -159.15 -16.14 TD[(1.)-660(Create)-413(or)-414(select)-413(a)-414(directory)-413(to)-414(con)27(tain)-413(y)27(our)-413(new)-413(collection)-414(of)-413(tests.)-685(Change)-414(to)-414(that)]TJ 15.69 -13.15 TD[(directory)-333(\(sho)27(wn)-332(here)-334(as)]TJ/F4 10.91 Tf 120.82 0 TD[(testsuite)]TJ/F1 10.91 Tf 51.54 0 TD[(\):)]TJ/F4 10.91 Tf -143.56 -15.44 TD[(eg$)-524(cd)-525(testsuite/)]TJ/F1 10.91 Tf -44.49 -16.14 TD[(2.)-660(Create)-555(a)-555(`)]TJ/F4 10.91 Tf 67.83 0 TD[(configure.in)]TJ/F1 10.91 Tf 68.73 0 TD[(')-555(\014le)-555(in)-555(this)-555(directory)83(,)-610(to)-555(con)27(trol)-554(con\014guration-dep)-28(enden)27(t)]TJ -120.87 -13.15 TD[(c)27(hoices)-383(for)-384(y)26(our)-383(tests.)-597(So)-385(far)-384(as)-384(DejaGn)26(u)-383(is)-384(concerned,)-397(the)-385(imp)-27(ortan)26(t)-383(thing)-384(is)-385(to)-384(set)]TJ 0 -13.15 TD[(a)-375(v)55(alue)-375(for)-375(the)-376(v)55(ariable)]TJ/F4 10.91 Tf 116 0 TD[(target_abbrev)]TJ/F1 10.91 Tf 74.45 0 TD[(;)-396(this)-375(v)54(alue)-374(is)-376(the)-375(link)-376(to)-375(the)-376(init)-375(\014le)-376(y)27(ou)-374(will)]TJ -190.45 -13.15 TD[(write)-334(so)-27(on.)-448(\(F)83(or)-333(simplicit)26(y)84(,)-334(w)27(e)-333(assume)-334(the)-335(en)27(vironmen)28(t)-333(is)-334(Unix,)-335(and)-334(use)-334(`)]TJ/F4 10.91 Tf 352.26 0 TD[(unix)]TJ/F1 10.91 Tf 22.91 0 TD[(')-334(as)-334(the)]TJ -375.17 -13.15 TD[(v)55(alue.\))]TJ 0 -16.14 TD[(What)-303(else)-304(is)-303(needed)-304(in)-304(`)]TJ/F4 10.91 Tf 112.74 0 TD[(configure.in)]TJ/F1 10.91 Tf 68.73 0 TD[(')-303(dep)-28(ends)-304(on)-303(the)-304(requiremen)27(ts)-303(of)-303(y)26(our)-302(to)-28(ol,)-310(y)27(our)]TJ -181.47 -13.15 TD[(in)27(tended)-351(test)-352(en)26(vironmen)28(ts,)-356(and)-352(whic)27(h)]TJ/F4 10.91 Tf 189.42 0 TD[(configure)]TJ/F1 10.91 Tf 55.39 0 TD[(system)-352(y)27(ou)-351(use.)-502(This)-352(example)-352(is)-352(a)]TJ -244.81 -13.15 TD[(minimal)]TJ/F4 10.91 Tf 42.96 0 TD[(configure.in)]TJ/F1 10.91 Tf 72.9 0 TD[(for)-382(use)-383(with)-382(Cygn)27(us)-382(Con\014gure.)-592(\(F)83(or)-382(an)-383(alternativ)27(e)-381(based)-383(on)]TJ -115.86 -13.15 TD[(the)-340(FSF)]TJ/F4 10.91 Tf 42.88 0 TD[(autoconf)]TJ/F1 10.91 Tf 49.53 0 TD[(system,)-342(see)-340(the)]TJ/F4 10.91 Tf 75.89 0 TD[(calc)]TJ/F1 10.91 Tf 26.62 0 TD[(example)-340(distributed)-340(with)-341(DejaGn)27(u.\))-465(Replace)]TJ/F5 10.91 Tf -194.92 -13.15 TD[(example)]TJ/F1 10.91 Tf 43.34 0 TD[(with)-333(the)-333(name)-333(of)-334(y)27(our)-332(program:)]TJ ET 0 g 0 G
+endstream
+endobj
+225 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+223 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 225 0 R
+>>
+endobj
+228 0 obj
+<<
+/Length 3165
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(44)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F9 9.96 Tf 21.6 -20.18 TD[(\013)]TJ ET 45.58 -6.23 m 450.40 -6.23 l 450.40 -5.83 l 45.58 -5.83 l b BT 456.38 -6.23 TD[(\010)]TJ ET 39.60 -201.93 m 40.00 -201.93 l 40.00 -11.96 l 39.60 -11.96 l b BT/F4 10.91 Tf 42.99 -24.6 TD[(#)-524(This)-525(file)-525(is)-525(a)-525(shell)-525(script)-525(fragment)]TJ 0 -12.45 TD[(#)-524(for)-525(use)-525(with)-525(Cygnus)-525(configure.)]TJ 0 -24.91 TD[(srctrigger=")]TJ/F5 10.91 Tf 68.72 0 TD[(example)]TJ/F4 10.91 Tf 39.1 0 TD[(.0")]TJ -107.82 -12.45 TD[(srcname="The)-524(DejaGnu)]TJ/F5 10.91 Tf 120.27 0 TD[(example)]TJ/F4 10.91 Tf 45.43 0 TD[(tests")]TJ -165.7 -24.91 TD[(#)-524(per-host:)]TJ 0 -24.91 TD[(#)-524(per-target:)]TJ 0 -24.9 TD[(#)-524(everything)-525(defaults)-525(to)-525(unix)-525(for)-525(a)-525(target)]TJ 0 -12.46 TD[(target_abbrev=unix)]TJ 0 -24.9 TD[(#)-524(post-target:)]TJ ET 456.38 -201.93 m 456.77 -201.93 l 456.77 -11.96 l 456.38 -11.96 l b BT/F9 9.96 Tf 39.6 -208.16 TD[(\012)]TJ ET 45.58 -208.16 m 450.40 -208.16 l 450.40 -207.76 l 45.58 -207.76 l b BT 456.38 -208.16 TD[(\011)]TJ/F1 10.91 Tf -432.47 -17.39 TD[(3.)-660(Create)-301(`)]TJ/F4 10.91 Tf 53.55 0 TD[(Makefile.in)]TJ/F1 10.91 Tf 63 0 TD[(',)-307(the)-302(source)-301(\014le)-302(used)-301(b)27(y)]TJ/F4 10.91 Tf 117.53 0 TD[(configure)]TJ/F1 10.91 Tf 54.84 0 TD[(to)-301(build)-301(y)26(our)-300(`)]TJ/F4 10.91 Tf 68.07 0 TD[(Makefile)]TJ/F1 10.91 Tf 45.82 0 TD[('.)-433(Its)]TJ -387.12 -13.15 TD[(leading)-333(section)-333(should)-333(as)-334(usual)-333(con)27(tain)-333(the)-333(v)55(alues)-333(that)]TJ/F4 10.91 Tf 263.94 0 TD[(configure)]TJ/F1 10.91 Tf 55.18 0 TD[(ma)27(y)-332(o)27(v)28(erride:)]TJ/F9 9.96 Tf -319.12 -9.75 TD[(\013)]TJ ET 45.58 -248.45 m 450.40 -248.45 l 450.40 -248.05 l 45.58 -248.05 l b BT 456.38 -248.45 TD[(\010)]TJ ET 39.60 -446.58 m 40.00 -446.58 l 40.00 -254.18 l 39.60 -254.18 l b BT/F4 10.91 Tf 42.99 -266.82 TD[(srcdir)-524(=)-525(.)]TJ 0 -12.45 TD[(prefix)-524(=)-525(/usr/local)]TJ 0 -24.91 TD[(exec_prefix)-524(=)-525($\(prefix\))]TJ 0 -12.45 TD[(bindir)-524(=)-525($\(exec_prefix\)/bin)]TJ 0 -12.46 TD[(libdir)-524(=)-525($\(exec_prefix\)/lib)]TJ 0 -12.45 TD[(tooldir)-524(=)-525($\(libdir\)/$\(target_alias\))]TJ 0 -24.91 TD[(datadir)-524(=)-525($\(exec_prefix\)/lib/dejagnu)]TJ 0 -24.9 TD[(RUNTEST)-524(=)-525(runtest)]TJ 0 -12.46 TD[(RUNTESTFLAGS)-524(=)]TJ 0 -12.45 TD[(FLAGS_TO_PASS)-524(=)]TJ 0 -24.91 TD[(####)-524(host,)-525(target,)-525(site)-525(specific)-525(Makefile)-525(frags)-525(come)-525(in)-525(here.)]TJ ET 456.38 -446.58 m 456.77 -446.58 l 456.77 -254.18 l 456.38 -254.18 l b BT/F9 9.96 Tf 39.6 -452.81 TD[(\012)]TJ ET 45.58 -452.81 m 450.40 -452.81 l 450.40 -452.41 l 45.58 -452.41 l b BT 456.38 -452.81 TD[(\011)]TJ/F1 10.91 Tf -416.78 -17.38 TD[(This)-305(should)-306(b)-28(e)-306(follo)27(w)28(ed)-305(b)27(y)-305(the)-306(standard)-306(targets)-306(at)-306(y)27(our)-305(site.)-435(T)82(o)-305(b)-27(egin)-306(with,)-311(they)-306(need)]TJ 0 -13.16 TD[(not)-333(do)-333(an)27(ything|for)-333(example,)-333(these)-333(de\014nitions)-334(will)-333(do:)]TJ ET 0 g 0 G
+endstream
+endobj
+229 0 obj
+<<
+/F1 9 0 R
+/F9 59 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+227 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 229 0 R
+>>
+endobj
+232 0 obj
+<<
+/Length 3671
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(7:)-444(New)-334(T)83(o)-27(ols,)-333(T)82(argets,)-332(or)-334(Hosts)-20764(45)]TJ/F9 9.96 Tf 21.6 -20.18 TD[(\013)]TJ ET 45.58 -6.23 m 450.40 -6.23 l 450.40 -5.83 l 45.58 -5.83 l b BT 456.38 -6.23 TD[(\010)]TJ ET 39.60 -170.36 m 40.00 -170.36 l 40.00 -11.96 l 39.60 -11.96 l b BT/F4 10.91 Tf 42.99 -30.39 TD[(all:)]TJ 0 -24.9 TD[(info:)]TJ 0 -24.91 TD[(install-info:)]TJ 0 -24.91 TD[(install:)]TJ 0 -12.45 TD[(uninstall:)]TJ 0 -24.91 TD[(clean:)]TJ 45.82 -12.45 TD[(-rm)-524(-f)-525(*~)-525(core)-525(*.info*)]TJ ET 456.38 -170.36 m 456.77 -170.36 l 456.77 -11.96 l 456.38 -11.96 l b BT/F9 9.96 Tf 39.6 -176.59 TD[(\012)]TJ ET 45.58 -176.59 m 450.40 -176.59 l 450.40 -176.19 l 45.58 -176.19 l b BT 456.38 -176.59 TD[(\011)]TJ/F1 10.91 Tf -416.78 -17.39 TD[(It)-328(is)-328(also)-328(a)-328(go)-27(o)-28(d)-328(idea)-328(to)-328(mak)27(e)-327(sure)-328(y)26(our)-327(`)]TJ/F4 10.91 Tf 195.72 0 TD[(Makefile)]TJ/F1 10.91 Tf 45.82 0 TD[(')-328(can)-328(rebuild)-328(itself)-328(if)-328(`)]TJ/F4 10.91 Tf 102.83 0 TD[(Makefile.in)]TJ/F1 10.91 Tf 63 0 TD[(')]TJ -407.37 -13.15 TD[(c)27(hanges,)-332(with)-333(a)-334(target)-333(lik)27(e)-333(this)-333(\(whic)27(h)-332(w)26(orks)-332(for)-333(either)-334(Cygn)27(us)-332(or)-334(FSF)-333(Con\014gure\):)]TJ/F9 9.96 Tf 0 -10.05 TD[(\013)]TJ ET 45.58 -217.18 m 450.40 -217.18 l 450.40 -216.78 l 45.58 -216.78 l b BT 456.38 -217.18 TD[(\010)]TJ ET 39.60 -266.78 m 40.00 -266.78 l 40.00 -222.91 l 39.60 -222.91 l b BT/F4 10.91 Tf 42.99 -236.46 TD[(Makefile)-524(:)-525($\(srcdir\)/Makefile.in)-525($\(host_makefile_frag\))-525(\\)]TJ 74.45 -12.45 TD[($\(target_makefile_frag\))]TJ -28.63 -12.46 TD[($\(SHELL\))-524(./config.status)]TJ ET 456.38 -266.78 m 456.77 -266.78 l 456.77 -222.91 l 456.38 -222.91 l b BT/F9 9.96 Tf 39.6 -273.01 TD[(\012)]TJ ET 45.58 -273.01 m 450.40 -273.01 l 450.40 -272.61 l 45.58 -272.61 l b BT 456.38 -273.01 TD[(\011)]TJ/F1 10.91 Tf -416.78 -17.38 TD[(Y)83(ou)-363(also)-365(need)-364(to)-364(include)-364(t)26(w)28(o)-363(targets)-364(imp)-28(ortan)27(t)-364(to)-364(DejaGn)27(u:)]TJ/F4 10.91 Tf 296.54 0 TD[(check)]TJ/F1 10.91 Tf 28.64 0 TD[(,)-371(to)-365(run)-364(the)-364(tests,)]TJ -325.18 -13.15 TD[(and)]TJ/F4 10.91 Tf 21.3 0 TD[(site.exp)]TJ/F1 10.91 Tf 45.81 0 TD[(,)-342(to)-341(set)-341(up)-341(the)-341(Tcl)-341(copies)-341(of)-341(con\014guration-dep)-28(enden)27(t)-340(v)54(alues.)-466(The)]TJ/F4 10.91 Tf 314.65 0 TD[(check)]TJ/F1 10.91 Tf -381.76 -13.16 TD[(target)-333(m)27(ust)-332(run)-334(`)]TJ/F4 10.91 Tf 82.24 0 TD[(runtest)-333(--tool)]TJ/F5 10.91 Tf 81.73 0 TD[(example)]TJ/F1 10.91 Tf 39.7 0 TD[(':)]TJ/F9 9.96 Tf -203.67 -9.44 TD[(\013)]TJ ET 45.58 -326.14 m 450.40 -326.14 l 450.40 -325.74 l 45.58 -325.74 l b BT 456.38 -326.14 TD[(\010)]TJ ET 39.60 -374.53 m 40.00 -374.53 l 40.00 -331.87 l 39.60 -331.87 l b BT/F4 10.91 Tf 42.99 -344.51 TD[(check:)-524(site.exp)-525(all)]TJ 45.82 -12.46 TD[($\(RUNTEST\))-524($\(RUNTESTFLAGS\))-525($\(FLAGS_TO_PASS\))-525(\\)]TJ 22.9 -12.45 TD[(--tool)]TJ/F5 10.91 Tf 40.09 0 TD[(example)]TJ/F4 10.91 Tf 45.43 0 TD[(--srcdir)-524($\(srcdir\))]TJ ET 456.38 -374.53 m 456.77 -374.53 l 456.77 -331.87 l 456.38 -331.87 l b BT/F9 9.96 Tf 39.6 -380.76 TD[(\012)]TJ ET 45.58 -380.76 m 450.40 -380.76 l 450.40 -380.36 l 45.58 -380.36 l b BT 456.38 -380.76 TD[(\011)]TJ/F1 10.91 Tf -416.78 -17.99 TD[(The)]TJ/F4 10.91 Tf 23.09 0 TD[(site.exp)]TJ/F1 10.91 Tf 50.12 0 TD[(target)-394(should)-394(usually)-394(set)-395(up)-394(\(among)-394(other)-395(things!\))-627(a)-394(Tcl)-394(v)54(ariable)-393(for)]TJ -73.21 -13.15 TD[(the)-333(name)-333(of)-333(y)26(our)-332(program:)]TJ ET 0 g 0 G
+endstream
+endobj
+233 0 obj
+<<
+/F1 9 0 R
+/F9 59 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+231 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 233 0 R
+>>
+endobj
+236 0 obj
+<<
+/Length 5426
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(46)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F9 9.96 Tf 21.6 -20.18 TD[(\013)]TJ ET 45.58 -6.23 m 450.40 -6.23 l 450.40 -5.83 l 45.58 -5.83 l b BT 456.38 -6.23 TD[(\010)]TJ ET 39.60 -416.97 m 40.00 -416.97 l 40.00 -11.96 l 39.60 -11.96 l b BT/F4 10.91 Tf 42.99 -25.51 TD[(site.exp:)-524(./config.status)-525(Makefile)]TJ 45.82 -12.45 TD[(@echo)-524("Making)-525(a)-525(new)-525(config)-525(file...")]TJ 0 -12.46 TD[(-@rm)-524(-f)-525(./tmp?)]TJ 0 -12.45 TD[(@touch)-524(site.exp)]TJ 0 -24.91 TD[(-@mv)-524(site.exp)-525(site.bak)]TJ 0 -12.45 TD[(@echo)-524("##)-525(these)-525(variables)-525(are)-525(automatically\\)]TJ -40.1 -12.45 TD[(generated)-524(by)-525(make)-525(##")-525(>)-525(./tmp0)]TJ 40.1 -12.45 TD[(@echo)-524("#)-525(Do)-525(not)-525(edit)-525(here.)-525(If)-525(you)-525(wish)-525(to\\)]TJ -40.1 -12.46 TD[(override)-524(these)-525(values")-525(>>)-525(./tmp0)]TJ 40.1 -12.45 TD[(@echo)-524("#)-525(add)-525(them)-525(to)-525(the)-525(last)-525(section")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(host_os)-525(${host_os}")-525(>>)-525(./tmp0)]TJ 0 -12.46 TD[(@echo)-524("set)-525(host_alias)-525(${host_alias}")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(host_cpu)-525(${host_cpu}")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(host_vendor)-525(${host_vendor}")-525(>>)-525(./tmp0)]TJ 0 -12.46 TD[(@echo)-524("set)-525(target_os)-525(${target_os}")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(target_alias)-525(${target_alias}")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(target_cpu)-525(${target_cpu}")-525(>>)-525(./tmp0)]TJ 0 -12.46 TD[(@echo)-524("set)-525(target_vendor)-525(${target_vendor}")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(host_triplet)-525(${host_canonical}")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(target_triplet)-525(${target_canonical}">>./tmp0)]TJ 0 -12.46 TD[(@echo)-524("set)-525(tool)-525(binutils")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(srcdir)-525(${srcdir}")-525(>>)-525(./tmp0)]TJ 0 -12.45 TD[(@echo)-524("set)-525(objdir)-525(`pwd`")-525(>>)-525(./tmp0)]TJ 0 -12.46 TD[(@echo)-524("set)]TJ/F5 10.91 Tf 62.99 0 TD[(examplename)-581(example)]TJ/F4 10.91 Tf 110.59 0 TD[(")-524(>>)-525(./tmp0)]TJ -173.58 -12.45 TD[(@echo)-524("##)-525(All)-525(variables)-525(above)-525(are)-525(generated)-525(by\\)]TJ -40.1 -12.45 TD[(configure.)-524(Do)-525(Not)-525(Edit)-525(##")-525(>>)-525(./tmp0)]TJ 85.91 -12.46 TD[(@cat)-524(./tmp0)-525(>)-525(site.exp)]TJ -45.81 -12.45 TD[(@sed)-524(<)-525(site.bak)-525(\\)]TJ 40.09 -12.45 TD[(-e)-524('1,/^##)-525(All)-525(variables)-525(above)-525(are.*##/)-525(d')-525(\\)]TJ 0 -12.46 TD[(>>)-524(site.exp)]TJ -40.09 -12.45 TD[(-@rm)-524(-f)-525(./tmp?)]TJ ET 456.38 -416.97 m 456.77 -416.97 l 456.77 -11.96 l 456.38 -11.96 l b BT/F9 9.96 Tf 39.6 -423.2 TD[(\012)]TJ ET 45.58 -423.20 m 450.40 -423.20 l 450.40 -422.80 l 45.58 -422.80 l b BT 456.38 -423.2 TD[(\011)]TJ/F1 10.91 Tf -432.47 -18 TD[(4.)-660(Create)-333(a)-333(directory)-334(\(in)-333(`)]TJ/F4 10.91 Tf 126.39 0 TD[(testsuite/)]TJ/F1 10.91 Tf 57.27 0 TD[('\))-333(called)-333(`)]TJ/F4 10.91 Tf 44.85 0 TD[(config/)]TJ/F1 10.91 Tf 40.09 0 TD[(':)]TJ/F4 10.91 Tf -224.11 -15.44 TD[(eg$)-524(mkdir)-525(config)]TJ/F1 10.91 Tf -44.49 -16.14 TD[(5.)-660(Mak)27(e)-319(an)-320(init)-320(\014le)-320(in)-321(this)-320(directory;)-324(its)-320(name)-321(m)27(ust)-319(start)-320(with)-320(the)]TJ/F4 10.91 Tf 320.57 0 TD[(target_abbrev)]TJ/F1 10.91 Tf 77.94 0 TD[(v)55(alue,)]TJ -382.82 -13.15 TD[(so)-362(call)-363(it)-363(`)]TJ/F4 10.91 Tf 48.3 0 TD[(config/unix.exp)]TJ/F1 10.91 Tf 85.9 0 TD[('.)-532(This)-363(is)-363(the)-362(\014le)-363(that)-363(con)27(tains)-362(the)-363(target-dep)-27(enden)26(t)-361(pro-)]TJ -134.2 -13.15 TD[(cedures;)-365(fortunately)83(,)-359(most)-355(of)-354(them)-355(do)-354(not)-355(ha)27(v)28(e)-354(to)-354(do)-355(v)27(ery)-354(m)27(uc)28(h)-354(in)-354(order)-355(for)]TJ/F4 10.91 Tf 370.31 0 TD[(runtest)]TJ/F1 10.91 Tf -370.31 -13.15 TD[(to)-333(run.)]TJ 0 -16.14 TD[(If)]TJ/F5 10.91 Tf 10.9 0 TD[(example)]TJ/F1 10.91 Tf 43.33 0 TD[(is)-332(not)-333(in)27(teractiv)28(e,)-332(y)27(ou)-331(can)-333(get)-333(a)27(w)28(a)28(y)-332(with)-332(this)-333(minimal)-332(`)]TJ/F4 10.91 Tf 264.61 0 TD[(unix.exp)]TJ/F1 10.91 Tf 45.82 0 TD[(')-332(to)-333(b)-27(egin)]TJ -364.66 -13.15 TD[(with:)]TJ/F9 9.96 Tf 0 -7.32 TD[(\013)]TJ ET 45.58 -548.84 m 450.40 -548.84 l 450.40 -548.44 l 45.58 -548.44 l b BT 456.38 -548.84 TD[(\010)]TJ ET 39.60 -585.99 m 40.00 -585.99 l 40.00 -554.57 l 39.60 -554.57 l b BT/F4 10.91 Tf 42.99 -568.12 TD[(proc)-524(foo_exit)-525({})-525({})]TJ 0 -12.46 TD[(proc)-524(foo_version)-525({})-525({})]TJ ET 456.38 -585.99 m 456.77 -585.99 l 456.77 -554.57 l 456.38 -554.57 l b BT/F9 9.96 Tf 39.6 -592.22 TD[(\012)]TJ ET 45.58 -592.22 m 450.40 -592.22 l 450.40 -591.82 l 45.58 -591.82 l b BT 456.38 -592.22 TD[(\011)]TJ/F1 10.91 Tf -416.78 -17.39 TD[(If)]TJ/F5 10.91 Tf 10.95 0 TD[(example)]TJ/F1 10.91 Tf 43.38 0 TD[(is)-337(in)27(teractiv)28(e,)-337(ho)26(w)28(ev)28(er,)-337(y)27(ou)-337(migh)27(t)-336(as)-337(w)26(ell)-336(de\014ne)-337(a)-337(start)-338(routine)]TJ/F8 10.91 Tf 304.73 0 TD[(and)-361(invoke)]TJ -359.06 -13.15 TD[(it)]TJ/F1 10.91 Tf 11.64 0 TD[(b)27(y)-332(using)-333(an)-334(init)-333(\014le)-333(lik)26(e)-332(this:)]TJ ET 0 g 0 G
+endstream
+endobj
+237 0 obj
+<<
+/F1 9 0 R
+/F9 59 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F8 52 0 R
+>>
+endobj
+235 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 237 0 R
+>>
+endobj
+240 0 obj
+<<
+/Length 5208
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Chapter)-333(7:)-444(New)-334(T)83(o)-27(ols,)-333(T)82(argets,)-332(or)-334(Hosts)-20764(47)]TJ/F9 9.96 Tf 21.6 -20.18 TD[(\013)]TJ ET 45.58 -6.23 m 450.40 -6.23 l 450.40 -5.83 l 45.58 -5.83 l b BT 456.38 -6.23 TD[(\010)]TJ ET 39.60 -154.07 m 40.00 -154.07 l 40.00 -11.96 l 39.60 -11.96 l b BT/F4 10.91 Tf 42.99 -25.51 TD[(proc)-524(foo_exit)-525({})-525({})]TJ 0 -12.45 TD[(proc)-524(foo_version)-525({})-525({})]TJ 0 -24.91 TD[(proc)-524(foo_start)-525({})-525({)]TJ 11.45 -12.45 TD[(global)]TJ/F5 10.91 Tf 40.09 0 TD[(examplename)]TJ/F4 10.91 Tf -40.09 -12.46 TD[(spawn)-524($)]TJ/F5 10.91 Tf 40.09 0 TD[(examplename)]TJ/F4 10.91 Tf -40.09 -12.45 TD[(expect)-524({)]TJ 11.46 -12.45 TD[(-re)-524("")-525({})]TJ -11.46 -12.45 TD[(})]TJ -11.45 -12.46 TD[(})]TJ 0 -12.45 TD[(foo_start)]TJ ET 456.38 -154.07 m 456.77 -154.07 l 456.77 -11.96 l 456.38 -11.96 l b BT/F9 9.96 Tf 39.6 -160.29 TD[(\012)]TJ ET 45.58 -160.29 m 450.40 -160.29 l 450.40 -159.90 l 45.58 -159.90 l b BT 456.38 -160.29 TD[(\011)]TJ/F1 10.91 Tf -432.47 -17.39 TD[(6.)-660(Create)-333(a)-333(directory)-334(whose)-333(name)-333(b)-28(egins)-333(with)-334(y)27(our)-332(to)-28(ol's)-333(name,)-334(to)-333(con)27(tain)-333(tests:)]TJ/F4 10.91 Tf 44.49 -15.45 TD[(eg$)-524(mkdir)]TJ/F5 10.91 Tf 57.27 0 TD[(example)]TJ/F4 10.91 Tf 39.09 0 TD[(.0)]TJ/F1 10.91 Tf -140.85 -16.14 TD[(7.)-660(Create)-356(a)-357(sample)-357(test)-357(\014le)-357(in)-357(`)]TJ/F5 10.91 Tf 152.53 0 TD[(example)]TJ/F4 10.91 Tf 39.09 0 TD[(.0)]TJ/F1 10.91 Tf 11.46 0 TD[('.)-515(Its)-356(name)-357(m)27(ust)-356(end)-357(with)-357(`)]TJ/F4 10.91 Tf 133.69 0 TD[(.exp)]TJ/F1 10.91 Tf 22.91 0 TD[(';)-368(y)27(ou)-356(can)-357(use)]TJ -343.99 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(first-try.exp)]TJ/F1 10.91 Tf 74.45 0 TD[(')-326(T)82(o)-325(b)-28(egin)-327(with,)-328(just)-326(write)-327(there)-327(a)-326(line)-327(of)-326(Tcl)-327(co)-28(de)-326(to)-327(issue)-327(a)-326(message:)]TJ/F9 9.96 Tf -77.48 -9.74 TD[(\013)]TJ ET 45.58 -232.16 m 450.40 -232.16 l 450.40 -231.76 l 45.58 -231.76 l b BT 456.38 -232.16 TD[(\010)]TJ ET 39.60 -256.86 m 40.00 -256.86 l 40.00 -237.89 l 39.60 -237.89 l b BT/F4 10.91 Tf 42.99 -251.44 TD[(send_user)-524("Testing:)-525(one,)-525(two...\\n")]TJ ET 456.38 -256.86 m 456.77 -256.86 l 456.77 -237.89 l 456.38 -237.89 l b BT/F9 9.96 Tf 39.6 -263.08 TD[(\012)]TJ ET 45.58 -263.08 m 450.40 -263.08 l 450.40 -262.69 l 45.58 -262.69 l b BT 456.38 -263.08 TD[(\011)]TJ/F1 10.91 Tf -432.47 -18 TD[(8.)-660(Bac)27(k)-332(in)-333(the)-334(`)]TJ/F4 10.91 Tf 77.36 0 TD[(testsuite/)]TJ/F1 10.91 Tf 57.27 0 TD[(')-333(\(top)-333(lev)27(el\))-333(directory)83(,)-333(run)]TJ/F4 10.91 Tf -90.14 -15.44 TD[(eg$)-524(configure)]TJ/F1 10.91 Tf -28.8 -16.14 TD[(\(Y)83(ou)-383(ma)27(y)-383(ha)27(v)28(e)-383(to)-384(sp)-28(ecify)-384(more)-383(of)-384(a)-384(path,)-396(if)-384(a)-384(suitable)]TJ/F4 10.91 Tf 268.71 0 TD[(configure)]TJ/F1 10.91 Tf 55.74 0 TD[(is)-383(not)-384(a)27(v)55(ailable)-383(in)]TJ -324.45 -13.15 TD[(y)27(our)-332(execution)-333(path.\))]TJ -15.69 -16.14 TD[(9.)-660(Y)83(ou)-370(are)-371(no)27(w)-370(ready)-370(to)-371(triumphan)27(tly)-370(t)27(yp)-27(e)-371(`)]TJ/F4 10.91 Tf 219.54 0 TD[(make)-333(check)]TJ/F1 10.91 Tf 55.19 0 TD[(')-370(or)-371(`)]TJ/F4 10.91 Tf 23.87 0 TD[(runtest)-333(--tool)]TJ/F5 10.91 Tf 81.73 0 TD[(example)]TJ/F1 10.91 Tf 39.7 0 TD[('.)]TJ -404.34 -13.15 TD[(Y)83(ou)-332(should)-334(see)-333(something)-333(lik)26(e)-332(this:)]TJ/F9 9.96 Tf 0 -9.45 TD[(\013)]TJ ET 45.58 -364.55 m 450.40 -364.55 l 450.40 -364.15 l 45.58 -364.15 l b BT 456.38 -364.55 TD[(\010)]TJ ET 39.60 -485.53 m 40.00 -485.53 l 40.00 -370.27 l 39.60 -370.27 l b BT/F4 10.91 Tf 42.99 -382.92 TD[(Test)-524(Run)-525(By)-525(rhl)-525(on)-525(Fri)-525(Jan)-525(29)-525(16:25:44)-525(EST)-525(1993)]TJ 91.63 -24.9 TD[(===)]TJ/F5 10.91 Tf 22.91 0 TD[(example)]TJ/F4 10.91 Tf 45.43 0 TD[(tests)-524(===)]TJ -159.97 -24.91 TD[(Running)-524(./)]TJ/F5 10.91 Tf 57.27 0 TD[(example)]TJ/F4 10.91 Tf 39.09 0 TD[(.0/first-try.exp)-524(...)]TJ -96.36 -12.45 TD[(Testing:)-524(one,)-525(two...)]TJ 91.63 -24.91 TD[(===)]TJ/F5 10.91 Tf 22.91 0 TD[(example)]TJ/F4 10.91 Tf 45.43 0 TD[(Summary)-524(===)]TJ ET 456.38 -485.53 m 456.77 -485.53 l 456.77 -370.27 l 456.38 -370.27 l b BT/F9 9.96 Tf 39.6 -491.76 TD[(\012)]TJ ET 45.58 -491.76 m 450.40 -491.76 l 450.40 -491.36 l 45.58 -491.36 l b BT 456.38 -491.76 TD[(\011)]TJ/F1 10.91 Tf -416.78 -17.39 TD[(There)-391(is)-391(no)-392(output)-391(in)-392(the)-391(summary)82(,)-405(b)-28(ecause)-391(so)-392(far)-391(the)-392(example)-391(do)-28(es)-392(not)-391(call)-392(an)27(y)-390(of)]TJ 0 -13.15 TD[(the)-333(pro)-28(cedures)-333(that)-333(establish)-334(a)-333(test)-333(outcome.)]TJ -21.14 -16.14 TD[(10.)-660(Begin)-427(writing)-428(some)-428(real)-428(tests.)-728(F)82(or)-427(an)-428(in)27(teractiv)28(e)-427(to)-28(ol,)-451(y)26(ou)-427(should)-427(probably)-428(write)-428(a)]TJ 21.14 -13.15 TD[(real)-339(exit)-339(routine)-339(in)-339(fairly)-339(short)-339(order;)-341(in)-339(an)26(y)-338(case,)-340(y)27(ou)-338(should)-339(also)-339(write)-339(a)-339(real)-339(v)27(ersion)]TJ 0 -13.15 TD[(routine)-333(so)-28(on.)]TJ ET 0 g 0 G
+endstream
+endobj
+241 0 obj
+<<
+/F1 9 0 R
+/F9 59 0 R
+/F4 28 0 R
+/F5 31 0 R
+>>
+endobj
+239 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 241 0 R
+>>
+endobj
+244 0 obj
+<<
+/Length 6498
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(48)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -23.91 TD[(7.2)-562(Adding)-375(a)-375(target)]TJ/F1 10.91 Tf 14.94 -23.12 TD[(DejaGn)27(u)-522(has)-524(some)-523(additional)-523(requiremen)26(ts)-522(for)-523(target)-524(supp)-28(ort,)-570(b)-28(ey)27(ond)-523(the)-523(general-)]TJ -14.94 -13.15 TD[(purp)-27(ose)-424(pro)27(visions)-423(of)-423(Cygn)26(us)]TJ/F4 10.91 Tf 147.27 0 TD[(configure)]TJ/F1 10.91 Tf 51.55 0 TD[(.)]TJ/F4 10.91 Tf 10.83 0 TD[(runtest)]TJ/F1 10.91 Tf 44.71 0 TD[(m)27(ust)-422(activ)26(ely)-422(comm)27(unicate)-423(with)-424(the)]TJ -254.36 -13.15 TD[(target,)-322(rather)-319(than)-319(simply)-320(generating)-319(or)-319(managing)-320(co)-28(de)-319(for)-319(the)-320(target)-319(arc)27(hitecture.)-439(There-)]TJ 0 -13.15 TD[(fore,)-329(eac)27(h)-328(to)-28(ol)-328(requires)-329(an)-328(initialization)-329(mo)-28(dule)-328(for)-329(eac)27(h)-328(target.)-443(F)83(or)-328(new)-329(targets,)-329(y)27(ou)-328(m)27(ust)]TJ 0 -13.15 TD[(supply)-259(a)-259(few)-259(Tcl)-259(pro)-28(cedures)-259(to)-259(adapt)-259(DejaGn)27(u)-258(to)-259(the)-260(target.)-419(This)-259(p)-28(ermits)-259(DejaGn)27(u)-259(itself)-259(to)]TJ 0 -13.15 TD[(remain)-281(target)-282(indep)-28(enden)27(t.)-426(See)-282(Section)-282(5.2)-282([Initialization)-281(mo)-28(dule],)-292(page)-282(22,)-292(for)-282(a)-281(discussion)]TJ 0 -13.15 TD[(of)-333(the)-333(naming)-333(con)26(v)28(en)28(tions)-332(that)-334(enable)-333(DejaGn)27(u)-333(to)-333(lo)-28(cate)-333(and)-333(use)-334(init)-333(\014les.)]TJ 14.94 -16.14 TD[(Usually)-284(the)-284(b)-27(est)-284(w)26(a)28(y)-283(to)-284(write)-284(a)-284(new)-284(initialization)-284(mo)-28(dule)-284(is)-284(to)-284(edit)-284(an)-284(existing)-284(initializa-)]TJ -14.94 -13.15 TD[(tion)-337(mo)-28(dule;)-340(some)-338(trial)-337(and)-338(error)-338(will)-337(b)-28(e)-338(required.)-458(If)-337(necessary)82(,)-338(y)27(ou)-337(can)-337(use)-338(the)-338(`)]TJ/F4 10.91 Tf 388.88 0 TD[(--debug)]TJ/F1 10.91 Tf 40.09 0 TD[(')]TJ -428.97 -13.15 TD[(option)-333(to)-333(see)-333(what)-334(is)-333(really)-333(going)-334(on.)]TJ 14.94 -16.14 TD[(When)-324(y)26(ou)-323(co)-28(de)-325(an)-325(initialization)-325(mo)-27(dule,)-327(b)-28(e)-324(generous)-325(in)-325(prin)27(ting)-324(information)-325(con)27(trolled)]TJ -14.94 -13.15 TD[(b)27(y)-332(the)]TJ/F4 10.91 Tf 33.94 0 TD[(verbose)]TJ/F1 10.91 Tf 43.73 0 TD[(pro)-27(cedure)-334(\(see)-333(Section)-333(5.3)-334([DejaGn)27(u)-332(Builtins],)-334(page)-333(23\).)]TJ -62.73 -16.14 TD[(Most)-432(of)-433(the)-433(w)27(ork)-432(is)-433(in)-433(getting)-433(the)-433(comm)27(unications)-432(righ)27(t.)-742(Comm)26(unications)-432(co)-27(de)-433(\(for)]TJ -14.94 -13.15 TD[(sev)27(eral)-277(situations)-279(in)27(v)28(olving)-278(IP)-278(net)27(w)28(orks)-278(or)-278(serial)-279(lines\))-278(is)-279(a)27(v)56(ailable)-278(in)-278(a)-279(DejaGn)27(u)-278(library)-278(\014le,)]TJ 0 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(lib/remote.exp)]TJ/F1 10.91 Tf 80.18 0 TD[('.)-444(See)-333(Section)-334(5.3)-333([DejaGn)27(u)-332(Builtins],)-334(page)-333(23.)]TJ -68.27 -16.14 TD[(If)-331(y)27(ou)-331(susp)-28(ect)-332(a)-331(comm)26(unication)-330(problem,)-333(try)-331(running)-332(the)-332(connection)-332(in)27(teractiv)28(ely)-331(from)]TJ/F4 10.91 Tf -14.94 -13.15 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(.)-422(\(There)-266(are)-267(three)-266(w)27(a)28(ys)-266(of)-266(running)]TJ/F4 10.91 Tf 164.66 0 TD[(expect)]TJ/F1 10.91 Tf 37.27 0 TD[(as)-266(an)-266(in)26(teractiv)28(e)-265(in)26(terpreter.)-421(Y)83(ou)-266(can)-266(run)]TJ/F4 10.91 Tf -236.29 -13.15 TD[(expect)]TJ/F1 10.91 Tf 37.88 0 TD[(with)-322(no)-322(argumen)27(ts,)-324(and)-322(con)27(trol)-321(it)-322(completely)-323(in)27(teractiv)28(ely;)-325(or)-322(y)27(ou)-321(can)-323(use)-322(`)]TJ/F4 10.91 Tf 359.76 0 TD[(expect)]TJ -397.64 -13.15 TD[(-i)]TJ/F1 10.91 Tf 11.45 0 TD[(')-280(together)-280(with)-281(other)-280(command-line)-281(options)-280(and)-281(argumen)27(ts;)-297(or)-281(y)27(ou)-279(can)-281(run)-280(the)-281(command)]TJ/F4 10.91 Tf -11.45 -13.15 TD[(interpreter)]TJ/F1 10.91 Tf 66.35 0 TD[(from)-306(an)27(y)]TJ/F4 10.91 Tf 45.81 0 TD[(expect)]TJ/F1 10.91 Tf 37.71 0 TD[(pro)-27(cedure.)-436(Use)]TJ/F4 10.91 Tf 75.49 0 TD[(return)]TJ/F1 10.91 Tf 37.71 0 TD[(to)-306(get)-307(bac)27(k)-306(to)-307(the)-307(calling)-306(pro)-28(cedure)]TJ -263.07 -13.15 TD[(\(if)-355(an)26(y\),)-360(or)]TJ/F4 10.91 Tf 56.29 0 TD[(return)-333(-tcl)]TJ/F1 10.91 Tf 64.79 0 TD[(to)-355(mak)26(e)-355(the)-355(calling)-356(pro)-28(cedure)-356(itself)-356(return)-356(to)-356(its)-356(caller;)-367(use)]TJ/F4 10.91 Tf 288.01 0 TD[(exit)]TJ/F1 10.91 Tf -409.09 -13.16 TD[(or)-442(end-of-\014le)-442(to)-442(lea)27(v)28(e)]TJ/F4 10.91 Tf 109.02 0 TD[(expect)]TJ/F1 10.91 Tf 39.18 0 TD[(altogether.\))-770(Run)-442(the)-442(program)-442(whose)-442(name)-442(is)-442(recorded)-442(in)]TJ -148.2 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[($connectmode)]TJ/F1 10.91 Tf 68.73 0 TD[(',)-520(with)-482(the)-483(argumen)27(ts)-482(in)-482(`)]TJ/F4 10.91 Tf 130.76 0 TD[($targetname)]TJ/F1 10.91 Tf 63 0 TD[(',)-520(to)-482(establish)-483(a)-483(connection.)-892(Y)82(ou)]TJ -265.52 -13.15 TD[(should)-333(at)-333(least)-333(b)-28(e)-334(able)-333(to)-333(get)-334(a)-333(prompt)-333(from)-334(an)27(y)-332(target)-333(that)-334(is)-333(ph)27(ysically)-333(connected.)]TJ/F2 14.35 Tf 0 -30.88 TD[(7.3)-562(P)30(orting)-374(to)-375(a)-375(new)-375(host)]TJ/F1 10.91 Tf 14.94 -23.11 TD[(The)-472(task)-473(of)-473(p)-28(orting)-472(DejaGn)26(u)-472(is)-472(basically)-473(that)-473(of)-473(p)-28(orting)-472(Tcl)-473(and)]TJ/F4 10.91 Tf 331.76 0 TD[(expect)]TJ/F1 10.91 Tf 34.37 0 TD[(.)-862(Tcl)-473(and)]TJ/F4 10.91 Tf -381.07 -13.16 TD[(expect)]TJ/F1 10.91 Tf 34.36 0 TD[(,)-357(as)-352(distributed)-353(with)-352(DejaGn)27(u,)-356(b)-28(oth)-353(use)]TJ/F4 10.91 Tf 195.95 0 TD[(autoconf)]TJ/F1 10.91 Tf 45.81 0 TD[(;)-361(they)-353(should)-352(p)-28(ort)-353(automatically)]TJ -276.12 -13.15 TD[(to)-333(most)-333(Unix)-333(systems.)]TJ 14.94 -16.14 TD[(Once)-367(Tcl)-368(and)]TJ/F4 10.91 Tf 69.62 0 TD[(expect)]TJ/F1 10.91 Tf 38.38 0 TD[(are)-367(p)-28(orted,)-377(DejaGn)27(u)-367(should)-368(run.)-548(Most)-368(system)-368(dep)-28(endencies)-367(are)]TJ -122.94 -13.15 TD[(tak)27(en)-332(care)-333(of)-334(b)27(y)-332(using)]TJ/F4 10.91 Tf 108.88 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(as)-333(the)-333(main)-333(command)-334(shell.)]TJ ET 0 g 0 G
+endstream
+endobj
+245 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+>>
+endobj
+243 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 245 0 R
+>>
+endobj
+248 0 obj
+<<
+/Length 8496
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(App)-27(endix)-334(A:)-333(Installing)-333(DejaGn)27(u)-24351(49)]TJ/F2 17.22 Tf 0 -25.91 TD[(App)-31(endix)-375(A)-562(Installing)-375(DejaGn)30(u)]TJ/F1 10.91 Tf 14.94 -24.19 TD[(Once)-304(y)27(ou)-303(ha)26(v)28(e)-303(the)-304(DejaGn)26(u)-303(source)-304(unpac)26(k)28(ed)-303(and)-304(a)26(v)56(ailable,)-309(y)27(ou)-304(m)27(ust)-303(\014rst)-305(con\014gure)-304(the)]TJ -14.94 -13.16 TD[(soft)27(w)28(are)-370(to)-371(sp)-28(ecify)-371(where)-371(it)-371(is)-371(to)-370(run)-371(\(and)-371(the)-371(asso)-28(ciated)-371(defaults\);)-390(then)-371(y)27(ou)-370(can)-371(pro)-28(ceed)]TJ 0 -13.15 TD[(to)-333(installing)-333(it.)]TJ/F2 14.35 Tf 0 -28.54 TD[(A.1)-562(Con\014guring)-375(the)-375(DejaGn)30(u)-374(test)-375(driv)31(er)]TJ/F1 10.91 Tf 14.94 -22.34 TD[(It)-412(is)-412(usually)-412(b)-27(est)-412(to)-413(con\014gure)-412(in)-412(a)-412(directory)-412(separate)-412(from)-412(the)-412(source)-412(tree,)-432(sp)-27(ecifying)]TJ -14.94 -13.15 TD[(where)-328(to)-328(\014nd)-328(the)-329(source)-328(with)-328(the)-328(optional)-329(`)]TJ/F4 10.91 Tf 207.56 0 TD[(--srcdir)]TJ/F1 10.91 Tf 45.82 0 TD[(')-328(option)-328(to)]TJ/F4 10.91 Tf 53.77 0 TD[(configure)]TJ/F1 10.91 Tf 51.55 0 TD[(.)-442(DejaGn)27(u)-328(uses)]TJ -358.7 -13.15 TD[(the)-426(GNU)]TJ/F4 10.91 Tf 49.38 0 TD[(autoconf)]TJ/F1 10.91 Tf 50.48 0 TD[(to)-426(con\014gure)-427(itself.)-724(F)82(or)-426(more)-426(info)-427(on)-427(using)-426(auto)-28(conf,)-450(read)-427(the)-426(GNU)]TJ -99.86 -13.15 TD[(auto)-27(conf)-444(man)26(ual.)-775(T)82(o)-443(con\014gure,)-471(execute)-445(the)-444(`)]TJ/F4 10.91 Tf 224.24 0 TD[(configure)]TJ/F1 10.91 Tf 51.54 0 TD[(')-444(program,)-471(no)-444(other)-444(options)-444(are)]TJ -275.78 -13.15 TD[(required.)-444(F)82(or)-332(an)-333(example,)-333(to)-333(con\014gure)-333(in)-333(a)-333(sep)-28(erate)-333(tree)-333(for)-334(ob)-55(jects,)-333(execute)-333(the)-333(con\014gure)]TJ 0 -13.15 TD[(script)-333(from)-333(the)-333(source)-334(tree)-333(lik)27(e)-333(this:)]TJ/F4 10.91 Tf 28.8 -14.66 TD[(../dejagnu-1.3/configure)]TJ/F1 10.91 Tf -13.86 -15.36 TD[(DejaGn)27(u)-314(do)-27(esn't)-315(care)-315(at)-315(con\014g)-315(time)-314(if)-315(it's)-315(for)-315(testing)-315(a)-314(nativ)26(e)-314(system)-314(or)-315(a)-315(cross)-315(system.)]TJ -14.94 -13.16 TD[(That)-333(is)-333(determined)-333(at)-334(run)27(time)-332(b)26(y)-332(using)-333(the)-334(con\014g)-333(\014les.)]TJ 14.94 -15.36 TD[(Y)83(ou)-536(ma)27(y)-536(also)-537(w)27(an)27(t)-536(to)-537(use)-536(the)]TJ/F4 10.91 Tf 161.13 0 TD[(configure)]TJ/F1 10.91 Tf 57.4 0 TD[(option)-536(`)]TJ/F4 10.91 Tf 39.19 0 TD[(--prefix)]TJ/F1 10.91 Tf 45.82 0 TD[(')-536(to)-537(sp)-28(ecify)-537(where)-537(y)27(ou)]TJ -318.48 -13.15 TD[(w)27(an)28(t)-512(DejaGn)27(u)-512(and)-512(its)-513(supp)-28(orting)-513(co)-28(de)-512(installed.)-983(By)-513(default,)-557(installation)-513(is)-513(in)-513(sub)-28(di-)]TJ 0 -13.15 TD[(rectories)-430(of)-431(`)]TJ/F4 10.91 Tf 61.34 0 TD[(/usr/local)]TJ/F1 10.91 Tf 57.27 0 TD[(',)-455(but)-431(y)27(ou)-430(can)-431(select)-430(an)26(y)-430(alternate)-430(directory)]TJ/F5 10.91 Tf 221.96 0 TD[(altdir)]TJ/F1 10.91 Tf 31.58 0 TD[(b)27(y)-430(including)]TJ -372.15 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(--prefix=)]TJ/F5 10.91 Tf 51.55 0 TD[(altdir)]TJ/F1 10.91 Tf 26.87 0 TD[(')-294(on)-295(the)]TJ/F4 10.91 Tf 39.34 0 TD[(configure)]TJ/F1 10.91 Tf 54.76 0 TD[(command)-294(line.)-432(\(This)-294(v)54(alue)-293(is)-295(captured)-295(in)-294(the)-295(Mak)27(e\014le)]TJ -175.55 -13.15 TD[(v)55(ariables)]TJ/F4 10.91 Tf 45.24 0 TD[(prefix)]TJ/F1 10.91 Tf 38 0 TD[(and)]TJ/F4 10.91 Tf 21.21 0 TD[(exec_prefix)]TJ/F1 10.91 Tf 63 0 TD[(.\))]TJ -152.51 -15.36 TD[(Sa)27(v)28(e)-492(for)-492(a)-493(small)-493(n)27(um)28(b)-27(er)-493(of)-493(example)-492(tests,)-533(the)-493(DejaGn)27(u)-492(distribution)-492(itself)-493(do)-28(es)-493(not)]TJ -14.94 -13.15 TD[(include)-441(an)27(y)-441(test)-441(suites;)-496(these)-441(are)-442(a)27(v)56(ailable)-441(separately)82(.)-768(T)83(est)-441(suites)-441(for)-442(the)]TJ/F7 10.91 Tf 366.17 0 TD[(gnu)]TJ/F1 10.91 Tf 25.19 0 TD[(compiler)]TJ -391.36 -13.15 TD[(\(testing)-416(b)-28(oth)-416(GCC)-417(and)-417(G)]TJ/F4 10.91 Tf 127.18 0 TD[(++)]TJ/F1 10.91 Tf 11.45 0 TD[(\))-416(and)-417(for)-416(the)]TJ/F7 10.91 Tf 68.21 0 TD[(gnu)]TJ/F1 10.91 Tf 24.92 0 TD[(binary)-416(utilities)-417(are)-416(distributed)-417(in)-416(parallel)]TJ -231.76 -13.15 TD[(with)-329(the)-329(DejaGn)26(u)-328(distribution)-329(\(but)-330(pac)27(k)56(aged)-329(as)-329(separate)-330(\014les\).)-443(The)-329(test)-329(suite)-330(for)-329(the)]TJ/F7 10.91 Tf 411.62 0 TD[(gnu)]TJ/F1 10.91 Tf -411.62 -13.15 TD[(debugger)-342(is)-342(distributed)-342(in)-343(parallel)-342(with)-342(eac)26(h)-341(release)-342(of)-342(GDB)-343(itself,)-344(starting)-343(with)-342(GDB)-342(4.9.)]TJ 0 -13.15 TD[(After)-288(con\014guring)-289(the)-289(top-lev)26(el)-288(DejaGn)27(u)-288(directory)83(,)-297(unpac)27(k)-288(and)-289(con\014gure)-289(the)-289(test)-289(directories)]TJ 0 -13.15 TD[(for)-444(the)-444(to)-28(ols)-444(y)27(ou)-444(w)27(an)28(t)-443(to)-445(test;)-499(then,)-472(in)-445(eac)27(h)-443(test)-444(directory)82(,)-471(run)]TJ/F4 10.91 Tf 318.76 0 TD[(make)]TJ/F1 10.91 Tf 27.76 0 TD[(to)-444(build)-444(auxiliary)]TJ -346.52 -13.15 TD[(programs)-333(required)-333(b)27(y)-333(some)-333(of)-333(the)-334(tests.)]TJ/F2 14.35 Tf 0 -28.55 TD[(A.2)-562(Installing)-375(DejaGn)30(u)]TJ/F1 10.91 Tf 14.94 -22.34 TD[(T)83(o)-398(install)-398(DejaGn)26(u)-397(in)-399(y)27(our)-398(\014lesystem)-398(\(either)-399(in)-398(`)]TJ/F4 10.91 Tf 239.2 0 TD[(/usr/local)]TJ/F1 10.91 Tf 57.27 0 TD[(',)-414(or)-399(as)-399(sp)-27(eci\014ed)-399(b)27(y)-398(y)27(our)]TJ -311.41 -13.15 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(--prefix)]TJ/F1 10.91 Tf 45.82 0 TD[(')-333(option)-333(to)]TJ/F4 10.91 Tf 53.94 0 TD[(configure)]TJ/F1 10.91 Tf 51.54 0 TD[(\),)-333(execute)]TJ/F4 10.91 Tf -125.53 -14.66 TD[(eg$)-524(make)-525(install)]TJ/F1 10.91 Tf -28.8 -15.36 TD[(`)]TJ/F4 10.91 Tf 3.03 0 TD[(make)-333(install)]TJ/F1 10.91 Tf 66.64 0 TD[(')-333(do)-28(es)-333(these)-333(things)-334(for)-333(DejaGn)27(u:)]TJ -63.76 -15.36 TD[(1.)-660(Lo)-27(ok)-307(in)-306(the)-306(path)-307(sp)-28(eci\014ed)-306(for)-306(executables)-307(\(`)]TJ/F4 10.91 Tf 223.93 0 TD[($exec_prefix)]TJ/F1 10.91 Tf 68.73 0 TD[('\))-306(for)-306(directories)-307(called)-306(`)]TJ/F4 10.91 Tf 113.22 0 TD[(lib)]TJ/F1 10.91 Tf 17.18 0 TD[(')]TJ -407.37 -13.15 TD[(and)-333(`)]TJ/F4 10.91 Tf 24.24 0 TD[(bin)]TJ/F1 10.91 Tf 17.18 0 TD[('.)-444(If)-333(these)-334(directories)-333(do)-333(not)-334(exist,)-333(`)]TJ/F4 10.91 Tf 169.04 0 TD[(make)-333(install)]TJ/F1 10.91 Tf 66.63 0 TD[(')-333(creates)-333(them.)]TJ -292.78 -15.36 TD[(2.)-660(Create)-333(another)-333(directory)-334(in)-333(the)-333(`)]TJ/F4 10.91 Tf 171.87 0 TD[(lib)]TJ/F1 10.91 Tf 17.18 0 TD[(')-333(directory)83(,)-333(called)-333(`)]TJ/F4 10.91 Tf 89.16 0 TD[(dejagnu)]TJ/F1 10.91 Tf 40.09 0 TD[('.)]TJ -318.3 -15.36 TD[(3.)-660(Cop)27(y)-332(the)]TJ/F4 10.91 Tf 62.96 0 TD[(runtest)]TJ/F1 10.91 Tf 43.73 0 TD[(shell)-333(script)-333(in)27(to)-333(`)]TJ/F4 10.91 Tf 80.45 0 TD[($exec_prefix/bin)]TJ/F1 10.91 Tf 91.64 0 TD[('.)]TJ -278.78 -15.36 TD[(4.)-660(Cop)27(y)-221(all)-222(the)-222(library)-223(\014les)-222(\(used)-222(to)-222(supp)-28(ort)-222(the)-223(framew)27(ork\))-221(in)27(to)-221(`)]TJ/F4 10.91 Tf 306.93 0 TD[($exec_prefix/lib/dejagnu)]TJ/F1 10.91 Tf 137.46 0 TD[('.)]TJ -444.39 -15.36 TD[(5.)-660(Cop)27(y)-439(`)]TJ/F4 10.91 Tf 48.37 0 TD[(runtest.exp)]TJ/F1 10.91 Tf 63 0 TD[(')-440(in)27(to)-440(`)]TJ/F4 10.91 Tf 34.16 0 TD[($exec_prefix/lib/dejagnu)]TJ/F1 10.91 Tf 137.45 0 TD[('.)-765(This)-441(is)-440(the)-441(main)-440(Tcl)-441(co)-27(de)]TJ -267.29 -13.15 TD[(implemen)27(ting)-332(DejaGn)27(u.)]TJ -6.66 -17.57 TD[(Eac)27(h)-360(test)-360(suite)-361(collection)-361(comes)-361(with)-361(simple)-361(installation)-360(instructions)-361(in)-361(a)-361(`)]TJ/F4 10.91 Tf 358.76 0 TD[(README)]TJ/F1 10.91 Tf 34.36 0 TD[(')-360(\014le;)]TJ -408.06 -13.15 TD[(in)-489(general,)-530(the)-490(test)-490(suites)-490(are)-490(designed)-490(to)-489(b)-28(e)-490(unpac)27(k)27(ed)-489(in)-490(the)-490(source)-490(directory)-490(for)-490(the)]TJ 0 -13.16 TD[(corresp)-27(onding)-334(to)-27(ol,)-334(and)-333(extract)-333(in)26(to)-332(a)-333(directory)-334(called)-333(`)]TJ/F4 10.91 Tf 265.36 0 TD[(testsuite)]TJ/F1 10.91 Tf 51.55 0 TD[('.)]TJ ET 0 g 0 G
+endstream
+endobj
+249 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F4 28 0 R
+/F5 31 0 R
+/F7 49 0 R
+>>
+endobj
+247 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 249 0 R
+>>
+endobj
+252 0 obj
+<<
+/Length 117
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(50)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ ET 0 g 0 G
+endstream
+endobj
+253 0 obj
+<<
+/F1 9 0 R
+>>
+endobj
+251 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 253 0 R
+>>
+endobj
+257 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 611.11
+/Ascent 611.11
+/Descent -222.22
+/Flags 5
+/FontBBox [-6 -237 731 801]
+/FontName /CMTT9
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 256 0 R
+>>
+endobj
+258 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F14
+/FontDescriptor 257 0 R
+/BaseFont /BBAFZC+CMTT9
+/FirstChar 0
+/LastChar 127
+/Widths [524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99
+524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99 524.99]
+>>
+endobj
+260 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-259 -250 1036 969]
+/FontName /CMR9
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 259 0 R
+>>
+endobj
+261 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F15
+/FontDescriptor 260 0 R
+/BaseFont /GSDFLN+CMR9
+/FirstChar 0
+/LastChar 127
+/Widths [642.28 856.48 799.38 713.58 685.18 770.67 742.28 799.38 742.28 799.38 742.28
+599.53 570.98 570.98 856.48 856.48 285.49 314.04 513.89 513.89 513.89 513.89 513.89
+770.67 456.79 513.89 742.28 799.38 513.89 927.77 1041.97 799.38 285.49 285.49 513.89
+856.48 513.89 856.48 799.38 285.49 399.69 399.69 513.89 799.38 285.49 342.59 285.49
+513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 285.49
+285.49 285.49 799.38 485.34 485.34 799.38 770.67 727.93 742.28 785.03 699.38 670.83
+806.48 770.67 370.99 528.08 799.22 642.28 941.97 770.67 799.38 699.38 799.38 756.48
+570.98 742.28 770.67 770.67 1056.17 770.67 770.67 628.08 285.49 513.89 285.49 513.89
+285.49 285.49 513.89 570.98 456.79 570.98 457.17 314.04 513.89 570.98 285.49 314.04
+542.43 285.49 856.48 570.98 513.89 570.98 542.43 402 405.4 399.69 570.98 542.43 742.28
+542.43 542.43 456.79 513.89 1027.77 513.89 513.89 513.89]
+>>
+endobj
+263 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 68
+/FontBBox [-172 -250 1171 969]
+/FontName /CMTI9
+/ItalicAngle -14
+/XHeight 431
+/StemV 80
+/FontFile 262 0 R
+>>
+endobj
+264 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F16
+/FontDescriptor 263 0 R
+/BaseFont /PFWZRU+CMTI9
+/FirstChar 0
+/LastChar 127
+/Widths [643.84 839.52 787.05 710.5 682.11 762.97 734.58 787.05 734.58 787.05 734.58
+629.64 577.17 603.4 905.11 918.22 314.82 341.05 524.7 524.7 524.7 524.7 524.7 850.94
+472.23 550.93 734.58 734.58 524.7 906.19 1011.13 787.05 262.35 314.82 527.78 839.52
+786.08 839.52 787.05 314.82 419.76 419.76 524.7 787.05 314.82 367.29 314.82 524.7
+524.7 524.7 524.7 524.7 524.7 524.7 524.7 524.7 524.7 524.7 314.82 314.82 314.82
+787.05 524.7 524.7 787.05 762.97 722.54 734.58 775.01 696.31 670.07 794.15 762.97
+395.68 538.9 789.21 643.84 920.38 762.97 787.05 696.31 787.05 748.78 577.17 734.58
+762.97 762.97 1025.32 762.97 762.97 629.64 314.82 527.78 314.82 524.7 314.82 314.82
+524.7 472.23 472.23 524.7 472.23 314.82 472.23 524.7 314.82 314.82 472.23 262.35
+839.52 577.17 524.7 524.7 472.23 432.88 419.76 341.05 550.93 472.23 682.11 473.77
+498.46 419.76 524.7 1049.4 524.7 524.7 524.7]
+>>
+endobj
+266 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 68
+/FontBBox [-207 -250 1150 969]
+/FontName /CMSL9
+/ItalicAngle -9
+/XHeight 431
+/StemV 80
+/FontFile 265 0 R
+>>
+endobj
+267 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F17
+/FontDescriptor 266 0 R
+/BaseFont /HGHLSL+CMSL9
+/FirstChar 0
+/LastChar 127
+/Widths [642.28 856.48 799.38 713.58 685.18 770.67 742.28 799.38 742.28 799.38 742.28
+599.53 570.98 570.98 856.48 856.48 285.49 314.04 513.89 513.89 513.89 513.89 513.89
+829.32 456.79 513.89 742.28 799.38 513.89 927.77 1041.97 799.38 285.49 285.49 513.89
+856.48 513.89 856.48 799.38 285.49 399.69 399.69 513.89 799.38 285.49 342.59 285.49
+513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 513.89 285.49
+285.49 285.49 799.38 485.34 485.34 799.38 770.67 727.93 742.28 785.03 699.38 670.83
+806.48 770.67 370.99 528.08 799.22 642.28 941.97 770.67 799.38 699.38 799.38 756.48
+570.98 742.28 770.67 770.67 1056.17 770.67 770.67 628.08 285.49 513.89 285.49 513.89
+285.49 285.49 513.89 570.98 456.79 570.98 457.17 314.04 513.89 570.98 285.49 314.04
+542.43 285.49 856.48 570.98 513.89 570.98 542.43 402 405.4 399.69 570.98 542.43 742.28
+542.43 542.43 456.79 513.89 1027.77 513.89 513.89 513.89]
+>>
+endobj
+268 0 obj
+<<
+/Length 23119
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Index)]TJ 421.09 0 TD[(51)]TJ/F2 17.22 Tf -421.09 -25.91 TD[(Index)]TJ/F2 14.35 Tf 0 -119.73 TD[(-)]TJ/F14 8.97 Tf 0 -18.87 TD[(--all)]TJ/F15 8.97 Tf 26.61 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.68 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.92 0 TD[(10)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--baud)]TJ/F15 8.97 Tf 31.32 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.5 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.39 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--build)]TJ/F15 8.97 Tf 36.02 0 TD[(\()]TJ/F14 8.97 Tf 3.59 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.33 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 90.85 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.31 TD[(--connect)]TJ/F15 8.97 Tf 45.44 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 30.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.79 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--debug)]TJ/F15 8.97 Tf 36.02 0 TD[(\()]TJ/F14 8.97 Tf 3.59 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.33 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 90.85 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--help)]TJ/F15 8.97 Tf 31.32 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.5 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.39 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.31 TD[(--host)]TJ/F15 8.97 Tf 31.32 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.5 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.39 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--name)]TJ/F15 8.97 Tf 31.32 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.5 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.39 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--objdir)]TJ/F15 8.97 Tf 40.73 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.03 0 TD[(option\))]TJ/F16 8.97 Tf 31.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.32 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -13.31 TD[(--outdir)]TJ/F15 8.97 Tf 40.73 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.03 0 TD[(option\))]TJ/F16 8.97 Tf 31.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.32 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--reboot)]TJ/F15 8.97 Tf 40.73 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.03 0 TD[(option\))]TJ/F16 8.97 Tf 31.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.32 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--srcdir)]TJ/F15 8.97 Tf 40.73 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.03 0 TD[(option\))]TJ/F16 8.97 Tf 31.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.32 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -13.31 TD[(--strace)]TJ/F15 8.97 Tf 40.73 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.03 0 TD[(option\))]TJ/F16 8.97 Tf 31.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.32 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--target)]TJ/F15 8.97 Tf 40.73 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.03 0 TD[(option\))]TJ/F16 8.97 Tf 31.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.32 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--tool)]TJ/F15 8.97 Tf 31.32 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 31.5 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.39 0 TD[(10)]TJ/F14 8.97 Tf -197.81 -13.31 TD[(--tool)]TJ/F15 8.97 Tf 31.32 0 TD[(and)-342(naming)-343(con)28(v)28(en)29(tions)]TJ/F16 8.97 Tf 98.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 68.04 0 TD[(21)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--verbose)]TJ/F15 8.97 Tf 45.44 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 30.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.79 0 TD[(13)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(--version)]TJ/F15 8.97 Tf 45.44 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 30.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.79 0 TD[(13)]TJ/F14 8.97 Tf -197.81 -13.31 TD[(-b)]TJ/F15 8.97 Tf 12.49 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 30.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 115.7 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(-v)]TJ/F15 8.97 Tf 12.49 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 30.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 115.7 0 TD[(13)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(-V)]TJ/F15 8.97 Tf 12.49 0 TD[(\()]TJ/F14 8.97 Tf 3.58 0 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option\))]TJ/F16 8.97 Tf 30.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 115.7 0 TD[(13)]TJ/F2 14.35 Tf -197.81 -40.01 TD[(.)]TJ/F14 8.97 Tf 0 -18.87 TD[(.exp)]TJ/F16 8.97 Tf 20.5 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 181.92 0 TD[(1)]TJ/F2 14.35 Tf -202.42 -40 TD[(A)]TJ/F14 8.97 Tf 0 -18.87 TD[(absolute)]TJ/F17 8.97 Tf 40.73 0 TD[(path)]TJ/F16 8.97 Tf 19.43 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 137.65 0 TD[(28)]TJ -197.81 -13.3 TD[(adding)-342(a)-343(target)]TJ/F16 8.97 Tf 63.74 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.07 0 TD[(48)]TJ -197.81 -13.31 TD[(adding)-342(a)-343(test)-342(case)]TJ/F16 8.97 Tf 73.27 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 124.54 0 TD[(40)]TJ/F14 8.97 Tf -197.81 -13.3 TD[(all_flag)]TJ/F16 8.97 Tf 38.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 159.3 0 TD[(17)]TJ -197.81 -13.3 TD[(am)28(biguit)29(y)85(,)-341(required)-343(for)-343(POSIX)]TJ/F16 8.97 Tf 125.44 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 76.98 0 TD[(7)]TJ -202.42 -13.31 TD[(arc)28(hiv)29(e)-342(ob)-57(ject)-343(\014les)]TJ/F16 8.97 Tf 76.71 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.1 0 TD[(30)]TJ -197.81 -13.3 TD[(auxiliary)-342(\014les,)-343(building)]TJ/F16 8.97 Tf 94.25 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 108.17 0 TD[(3)]TJ -202.42 -13.3 TD[(auxiliary)-342(programs)]TJ/F16 8.97 Tf 77.24 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 120.57 0 TD[(49)]TJ -197.81 -13.31 TD[(auxiliary)-342(test)-343(programs)]TJ/F16 8.97 Tf 94.94 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 102.87 0 TD[(12)]TJ/F2 14.35 Tf 27.16 589.87 TD[(B)]TJ/F14 8.97 Tf 0 -15.91 TD[(baud)]TJ/F16 8.97 Tf 20.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 177.43 0 TD[(17)]TJ -197.81 -11.95 TD[(baud)-342(rate,)-343(sp)-28(ecifying)]TJ/F16 8.97 Tf 85.81 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112 0 TD[(11)]TJ -197.81 -11.96 TD[(bps,)-342(sp)-29(ecifying)]TJ/F16 8.97 Tf 60.2 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 137.61 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(bt)]TJ/F16 8.97 Tf 11.32 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 186.49 0 TD[(31)]TJ -197.81 -11.95 TD[(bug)-342(n)27(um)29(b)-28(er)]TJ/F16 8.97 Tf 50.42 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 147.39 0 TD[(42)]TJ -197.81 -11.96 TD[(bug)-342(n)27(um)29(b)-28(er,)-342(extra)]TJ/F16 8.97 Tf 76.7 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.11 0 TD[(42)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(bug_id)]TJ/F16 8.97 Tf 29.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.36 0 TD[(42)]TJ -197.81 -11.96 TD[(build)-342(con\014g)-343(name,)-342(c)27(hanging)]TJ/F16 8.97 Tf 115.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 82.45 0 TD[(11)]TJ -197.81 -11.95 TD[(build)-342(host)-343(con\014guration)-342(test)]TJ/F16 8.97 Tf 116.06 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.75 0 TD[(25)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(build_triplet)]TJ/F16 8.97 Tf 63.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.45 0 TD[(17)]TJ -197.81 -11.96 TD[(built)-342(in)-343(pro)-28(cedures,)-343(DejaGn)28(u)]TJ/F16 8.97 Tf 119.86 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.95 0 TD[(23)]TJ/F2 14.35 Tf -197.81 -31.93 TD[(C)]TJ/F15 8.97 Tf 0 -15.9 TD[(C)-342(torture)-343(test)]TJ/F16 8.97 Tf 58.53 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 139.28 0 TD[(39)]TJ -197.81 -11.96 TD[(canadian)-342(cross)-343(con\014guration)-342(test)]TJ/F16 8.97 Tf 133.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 64.04 0 TD[(25)]TJ -197.81 -11.96 TD[(cancelling)-342(exp)-29(ected)-342(failure)]TJ/F16 8.97 Tf 107.69 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 90.12 0 TD[(26)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(check)]TJ/F15 8.97 Tf 26.61 0 TD[(mak)28(e\014le)-342(target)]TJ/F16 8.97 Tf 62.62 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 113.19 0 TD[(3)]TJ/F14 8.97 Tf -202.42 -11.95 TD[(clear_xfail)]TJ/F17 8.97 Tf 54.85 0 TD[(con\014g)]TJ/F16 8.97 Tf 26.21 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.75 0 TD[(26)]TJ -197.81 -11.96 TD[(Closing)-342(a)-343(remote)-342(connection)]TJ/F16 8.97 Tf 116.04 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.77 0 TD[(27)]TJ -197.81 -11.96 TD[(command)-342(line)-343(option)-342(v)56(ariables)]TJ/F16 8.97 Tf 124.87 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 72.94 0 TD[(17)]TJ -197.81 -11.95 TD[(command)-342(line)-343(options)]TJ/F16 8.97 Tf 90.27 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.15 0 TD[(9)]TJ -202.42 -11.96 TD[(command)-342(line)-343(Tcl)-342(v)56(ariable)-342(de\014nition)]TJ/F16 8.97 Tf 150.47 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 47.34 0 TD[(10)]TJ -197.81 -11.96 TD[(comm)28(unications)-342(pro)-28(cedures)]TJ/F16 8.97 Tf 112.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 85.45 0 TD[(26)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(comp_output)]TJ/F16 8.97 Tf 54.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.52 0 TD[(42)]TJ -197.81 -11.95 TD[(comparing)-342(\014les)]TJ/F16 8.97 Tf 63 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.81 0 TD[(28)]TJ -197.81 -11.96 TD[(compile)-342(a)-343(\014le)]TJ/F16 8.97 Tf 55.03 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 142.78 0 TD[(29)]TJ -197.81 -11.96 TD[(con\014guration)-342(dep)-29(enden)28(t)-342(defaults)]TJ/F16 8.97 Tf 133.59 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 64.22 0 TD[(15)]TJ -197.81 -11.95 TD[(con\014guring)-342(DejaGn)27(u)]TJ/F16 8.97 Tf 85.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.45 0 TD[(49)]TJ -197.81 -11.96 TD[(connecting)-342(to)-343(target)]TJ/F16 8.97 Tf 84.37 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 113.44 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(connectmode)]TJ/F16 8.97 Tf 54.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.52 0 TD[(17)]TJ -197.81 -11.96 TD[(con)28(v)29(erting)-342(relativ)28(e)-342(paths)-343(to)-342(absolute)]TJ/F16 8.97 Tf 150.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 47.79 0 TD[(28)]TJ -197.81 -11.95 TD[(Core)-342(In)27(ternal)-341(Pro)-29(cedures)]TJ/F16 8.97 Tf 103.07 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 94.74 0 TD[(23)]TJ -197.81 -11.96 TD[(cross)-342(con\014guration)]TJ/F16 8.97 Tf 77.12 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.3 0 TD[(4)]TJ -202.42 -11.96 TD[(curren)28(t)-342(test)-342(sub)-29(directory)]TJ/F16 8.97 Tf 102.52 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.29 0 TD[(42)]TJ/F2 14.35 Tf -197.81 -31.93 TD[(D)]TJ/F14 8.97 Tf 0 -15.91 TD[(dbg.log)]TJ/F15 8.97 Tf 36.02 0 TD[(\014le)]TJ/F16 8.97 Tf 14.1 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 147.69 0 TD[(11)]TJ -197.81 -11.95 TD[(debug)-342(log)]TJ/F16 8.97 Tf 41.32 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 156.49 0 TD[(36)]TJ -197.81 -11.96 TD[(debug)-342(log)-343(for)-342(test)-343(cases)]TJ/F16 8.97 Tf 95.08 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 102.73 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(debugger.exp)]TJ/F16 8.97 Tf 58.82 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 138.99 0 TD[(30)]TJ -197.81 -11.95 TD[(debugging)-342(a)-343(test)-342(case)]TJ/F16 8.97 Tf 88.9 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 108.91 0 TD[(40)]TJ -197.81 -11.96 TD[(default)-342(options,)-343(con)28(trolling)]TJ/F16 8.97 Tf 111.04 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.77 0 TD[(17)]TJ -197.81 -11.96 TD[(defaults,)-342(option)]TJ/F16 8.97 Tf 64.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 133.66 0 TD[(17)]TJ -197.81 -11.96 TD[(defaults,)-342(setting)-343(in)-342(init)-343(\014le)]TJ/F16 8.97 Tf 107.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.83 0 TD[(23)]TJ -197.81 -11.95 TD[(DejaGn)28(u)-342(con\014guration)]TJ/F16 8.97 Tf 93.82 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.99 0 TD[(49)]TJ -197.81 -11.96 TD[(DejaGn)28(u)-342(test)-342(driv)27(er)]TJ/F16 8.97 Tf 81.81 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 120.61 0 TD[(9)]TJ -202.42 -11.96 TD[(DejaGn)28(u,)-342(the)-342(name)]TJ/F16 8.97 Tf 81 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.42 0 TD[(6)]TJ ET 0 g 0 G
+endstream
+endobj
+269 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F14 258 0 R
+/F15 261 0 R
+/F16 264 0 R
+/F17 267 0 R
+>>
+endobj
+255 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 269 0 R
+>>
+endobj
+272 0 obj
+<<
+/Length 23714
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(52)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F15 8.97 Tf 0 -32.23 TD[(Delete)-342(a)-343(w)28(atc)28(hp)-27(oin)27(t.)]TJ/F16 8.97 Tf 85.32 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.49 0 TD[(31)]TJ -197.81 -12.1 TD[(design)-342(goals)]TJ/F16 8.97 Tf 50.46 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 151.96 0 TD[(5)]TJ -202.42 -12.09 TD[(detailed)-342(log)]TJ/F16 8.97 Tf 49.52 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 148.29 0 TD[(36)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(diff)]TJ/F17 8.97 Tf 21.9 0 TD[(\014lename)-398(\014lename)]TJ/F16 8.97 Tf 72.39 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.52 0 TD[(28)]TJ -197.81 -12.1 TD[(directories)-342(matc)27(hing)-341(a)-343(pattern)]TJ/F16 8.97 Tf 124.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 73.43 0 TD[(28)]TJ -197.81 -12.09 TD[(directory)-342(names)-343(and)]TJ/F14 8.97 Tf 85.34 0 TD[(--tool)]TJ/F16 8.97 Tf 30.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 82.11 0 TD[(21)]TJ -197.81 -12.09 TD[(do)28(wnload)-342(a)-342(\014le)]TJ/F16 8.97 Tf 63.09 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.72 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -12.1 TD[(download)]TJ/F17 8.97 Tf 40.73 0 TD[(\014le)]TJ/F15 8.97 Tf 15.35 0 TD[([)]TJ/F17 8.97 Tf 5.63 0 TD[(spa)28(wnid)]TJ/F15 8.97 Tf 35.98 0 TD[(])]TJ/F16 8.97 Tf 4.81 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.31 0 TD[(27)]TJ -197.81 -12.09 TD[(do)28(wnload,)]TJ/F14 8.97 Tf 43.77 0 TD[(tip)]TJ/F16 8.97 Tf 15.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 138.28 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -12.1 TD[(dumplocals)]TJ/F16 8.97 Tf 50.14 0 TD[(expr)-202(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 147.67 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(dumprocs)]TJ/F16 8.97 Tf 40.73 0 TD[(expr)-241(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 157.08 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(dumpvars)]TJ/F16 8.97 Tf 40.73 0 TD[(expr)-241(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 157.08 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -12.1 TD[(dumpwatch)]TJ/F16 8.97 Tf 45.44 0 TD[(expr)-221(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 152.37 0 TD[(30)]TJ/F2 14.35 Tf -197.81 -32.75 TD[(E)]TJ/F14 8.97 Tf 0 -16.21 TD[(echo.exp)]TJ/F16 8.97 Tf 38.64 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 163.78 0 TD[(5)]TJ/F14 8.97 Tf -202.42 -12.09 TD[(ERROR)]TJ/F16 8.97 Tf 26.33 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 161.24 0 TD[(9,)-342(23)]TJ -187.57 -12.09 TD[(example)]TJ/F16 8.97 Tf 34.14 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.28 0 TD[(5)]TJ/F14 8.97 Tf -202.42 -12.1 TD[(exec_output)]TJ/F16 8.97 Tf 54.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.52 0 TD[(42)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(exec_prefix)]TJ/F15 8.97 Tf 51.78 0 TD[(,)-342(con\014gure)-343(options.)]TJ/F16 8.97 Tf 77.99 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 68.04 0 TD[(49)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(execute_anywhere)]TJ/F16 8.97 Tf 78.39 0 TD[(cmd)-52(line)-236(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 119.42 0 TD[(30)]TJ -197.81 -12.1 TD[(executing)-342(commands)-343(remotely)]TJ/F16 8.97 Tf 124.24 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 73.57 0 TD[(30)]TJ -197.81 -12.09 TD[(existing)-342(tests,)-343(running)]TJ/F16 8.97 Tf 90.72 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 111.7 0 TD[(3)]TJ -202.42 -12.1 TD[(exit)-342(co)-29(de)-342(from)]TJ/F14 8.97 Tf 61.21 0 TD[(runtest)]TJ/F16 8.97 Tf 34.01 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 107.2 0 TD[(9)]TJ -202.42 -12.09 TD[(exit)-342(pro)-29(cedure,)-342(tested)-343(to)-28(ols)]TJ/F16 8.97 Tf 111.72 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.09 0 TD[(31)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(exit_remote_shell)]TJ/F17 8.97 Tf 83.1 0 TD[(spa)28(wnid)]TJ/F16 8.97 Tf 33.81 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 80.9 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -12.1 TD[(exp)]TJ/F15 8.97 Tf 17.19 0 TD[(\014lename)-342(su\016x)]TJ/F16 8.97 Tf 59.53 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.09 0 TD[(21)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(expect)]TJ/F15 8.97 Tf 31.32 0 TD[(in)28(ternal)-342(tracing)]TJ/F16 8.97 Tf 63.48 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.01 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -12.1 TD[(expect)]TJ/F15 8.97 Tf 31.32 0 TD[(script)-342(names)]TJ/F16 8.97 Tf 53.52 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 117.58 0 TD[(1)]TJ/F14 8.97 Tf -202.42 -12.09 TD[(expect)]TJ/F15 8.97 Tf 31.32 0 TD[(scripting)-342(language)]TJ/F16 8.97 Tf 75.66 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.44 0 TD[(8)]TJ/F14 8.97 Tf -202.42 -12.09 TD[(expect_out\(buffer\))]TJ/F16 8.97 Tf 86.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 111.79 0 TD[(42)]TJ -197.81 -12.1 TD[(exp)-28(ected)-343(failure)]TJ/F16 8.97 Tf 66.06 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.51 0 TD[(9,)-342(25)]TJ -187.57 -12.09 TD[(exp)-28(ected)-343(failure,)-342(cancelling)]TJ/F16 8.97 Tf 111.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.66 0 TD[(26)]TJ/F2 14.35 Tf -197.81 -32.75 TD[(F)]TJ/F14 8.97 Tf 0 -16.21 TD[(FAIL)]TJ/F16 8.97 Tf 19.74 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 172.44 0 TD[(7,)-342(9)]TJ/F14 8.97 Tf -192.18 -12.09 TD[(fail)-342(")]TJ/F17 8.97 Tf 26.61 0 TD[(string)]TJ/F14 8.97 Tf 23.88 0 TD[(")]TJ/F16 8.97 Tf 5.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 141.81 0 TD[(24)]TJ -197.81 -12.1 TD[(failing)-342(test,)-343(exp)-28(ected)]TJ/F16 8.97 Tf 85.67 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.75 0 TD[(9)]TJ -202.42 -12.09 TD[(failing)-342(test,)-343(unexp)-28(ected)]TJ/F16 8.97 Tf 95.14 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 107.28 0 TD[(9)]TJ -202.42 -12.09 TD[(failure,)-342(exp)-29(ected)]TJ/F16 8.97 Tf 68.1 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.71 0 TD[(25)]TJ -197.81 -12.1 TD[(failure,)-342(POSIX)-343(de\014nition)]TJ/F16 8.97 Tf 102.87 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.55 0 TD[(7)]TJ -202.42 -12.09 TD[(\014lename)-342(for)-343(test)-342(\014les)]TJ/F16 8.97 Tf 85.58 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.23 0 TD[(21)]TJ -197.81 -12.09 TD[(\014les)-342(matc)27(hing)-341(a)-343(pattern)]TJ/F16 8.97 Tf 98.23 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.58 0 TD[(28)]TJ/F14 8.97 Tf -197.81 -12.1 TD[(find)]TJ/F17 8.97 Tf 21.9 0 TD[(dir)-414(pattern)]TJ/F16 8.97 Tf 46.35 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.56 0 TD[(28)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(findfile)]TJ/F16 8.97 Tf 38.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 159.3 0 TD[(22)]TJ -197.81 -12.1 TD[(\014nding)-342(\014le)-343(di\013erences)]TJ/F16 8.97 Tf 89.52 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 108.29 0 TD[(28)]TJ -197.81 -12.09 TD[(future)-342(directions)]TJ/F16 8.97 Tf 68.26 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.16 0 TD[(8)]TJ/F2 14.35 Tf 22.55 539.88 TD[(G)]TJ/F14 8.97 Tf 0 -17.74 TD[(gdb.t00/echo.exp)]TJ/F16 8.97 Tf 77.08 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.34 0 TD[(5)]TJ/F14 8.97 Tf -202.42 -12.79 TD[(get_warning_threshold)]TJ/F16 8.97 Tf 101.8 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 96.01 0 TD[(24)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(getdirs)]TJ/F17 8.97 Tf 36.02 0 TD[(dir)]TJ/F16 8.97 Tf 14.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 147.61 0 TD[(28)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(getdirs)]TJ/F17 8.97 Tf 36.02 0 TD[(dir)-414(pattern)]TJ/F16 8.97 Tf 45.83 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 115.96 0 TD[(28)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(getenv)]TJ/F17 8.97 Tf 31.32 0 TD[(v)57(ar)]TJ/F16 8.97 Tf 14.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 151.51 0 TD[(29)]TJ -197.81 -12.79 TD[(getting)-342(en)27(vironmen)29(t)-342(v)57(ariables)]TJ/F16 8.97 Tf 120.79 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.02 0 TD[(29)]TJ -197.81 -12.79 TD[(GNA)85(TS)-341(bug)-343(n)28(um)28(b)-27(er)]TJ/F16 8.97 Tf 85.42 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.39 0 TD[(42)]TJ -197.81 -12.79 TD[(Granlund,)-342(T)85(orb)-57(jorn)]TJ/F16 8.97 Tf 81.47 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.34 0 TD[(39)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(grep)]TJ/F17 8.97 Tf 21.9 0 TD[(\014lename)-398(regexp)]TJ/F16 8.97 Tf 64.47 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 111.44 0 TD[(28)]TJ/F14 8.97 Tf -197.81 -12.8 TD[(grep)]TJ/F17 8.97 Tf 21.9 0 TD[(\014lename)-398(regexp)]TJ/F14 8.97 Tf 66.6 0 TD[(line)]TJ/F16 8.97 Tf 19.72 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.59 0 TD[(28)]TJ/F2 14.35 Tf -197.81 -36.93 TD[(H)]TJ/F15 8.97 Tf 0 -17.73 TD[(help)-342(with)]TJ/F14 8.97 Tf 40.96 0 TD[(runtest)]TJ/F16 8.97 Tf 35.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.56 0 TD[(11)]TJ -197.81 -12.79 TD[(hin)28(ts)-342(on)-342(test)-343(case)-342(writing)]TJ/F16 8.97 Tf 103.28 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 94.53 0 TD[(41)]TJ -197.81 -12.8 TD[(host)-342(con\014g)-343(name,)-342(c)27(hanging)]TJ/F16 8.97 Tf 111.41 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.4 0 TD[(11)]TJ -197.81 -12.79 TD[(host)-342(con\014guration)-343(test)]TJ/F16 8.97 Tf 93.39 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.42 0 TD[(25)]TJ -197.81 -12.79 TD[(host,)-342(explained)]TJ/F16 8.97 Tf 63.12 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.69 0 TD[(49)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(host_triplet)]TJ/F16 8.97 Tf 58.82 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 138.99 0 TD[(17)]TJ/F2 14.35 Tf -197.81 -36.93 TD[(I)]TJ/F14 8.97 Tf 0 -17.74 TD[(ignoretests)]TJ/F16 8.97 Tf 54.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.52 0 TD[(17)]TJ -197.81 -12.79 TD[(init)-342(\014le)-343(name)]TJ/F16 8.97 Tf 55.03 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 142.78 0 TD[(22)]TJ -197.81 -12.79 TD[(init)-342(\014le,)-343(purp)-28(ose)]TJ/F16 8.97 Tf 67.87 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.94 0 TD[(22)]TJ -197.81 -12.79 TD[(initialization)]TJ/F16 8.97 Tf 51.56 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 146.25 0 TD[(22)]TJ -197.81 -12.79 TD[(input)-342(\014les)]TJ/F16 8.97 Tf 41.86 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 155.95 0 TD[(34)]TJ -197.81 -12.79 TD[(installed)-342(to)-29(ol)-342(name)]TJ/F16 8.97 Tf 80.03 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 117.78 0 TD[(24)]TJ -197.81 -12.79 TD[(installing)-342(DejaGn)27(u)]TJ/F16 8.97 Tf 77.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 120.63 0 TD[(49)]TJ -197.81 -12.79 TD[(in)28(ternal)-342(details)]TJ/F16 8.97 Tf 62.88 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.93 0 TD[(21)]TJ -197.81 -12.79 TD[(in)28(v)29(oking)]TJ/F16 8.97 Tf 36.7 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 165.72 0 TD[(9)]TJ -202.42 -12.79 TD[(IP)-342(net)27(w)29(ork)-342(pro)-28(cedures)]TJ/F16 8.97 Tf 93.58 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.23 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(isbuild)-342(")]TJ/F17 8.97 Tf 40.73 0 TD[(host)]TJ/F14 8.97 Tf 17.13 0 TD[(")]TJ/F16 8.97 Tf 6.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 133.77 0 TD[(25)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(ishost)-342(")]TJ/F17 8.97 Tf 36.02 0 TD[(host)]TJ/F14 8.97 Tf 17.13 0 TD[(")]TJ/F16 8.97 Tf 6.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 138.3 0 TD[(25)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(isnative)]TJ/F16 8.97 Tf 38.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 159.3 0 TD[(25)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(istarget)-342(")]TJ/F17 8.97 Tf 45.44 0 TD[(target)]TJ/F14 8.97 Tf 24.27 0 TD[(")]TJ/F16 8.97 Tf 6.79 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.31 0 TD[(25)]TJ/F2 14.35 Tf -197.81 -36.93 TD[(K)]TJ/F14 8.97 Tf 0 -17.74 TD[(kermit)]TJ/F17 8.97 Tf 31.32 0 TD[(p)-28(ort)-363(bps)]TJ/F16 8.97 Tf 36.61 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.88 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -12.79 TD[(kermit)]TJ/F15 8.97 Tf 28.25 0 TD[(,)-342(remote)-343(testing)-342(via)]TJ/F16 8.97 Tf 79.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.8 0 TD[(11)]TJ ET 0 g 0 G
+endstream
+endobj
+273 0 obj
+<<
+/F1 9 0 R
+/F15 261 0 R
+/F16 264 0 R
+/F14 258 0 R
+/F17 267 0 R
+/F2 12 0 R
+>>
+endobj
+271 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 273 0 R
+>>
+endobj
+276 0 obj
+<<
+/Length 24305
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Index)]TJ 421.09 0 TD[(53)]TJ/F2 14.35 Tf -421.09 -97.38 TD[(L)]TJ/F15 8.97 Tf 0 -18.59 TD[(last)-342(command)-343(output)]TJ/F16 8.97 Tf 89.12 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 108.69 0 TD[(42)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(lib/debugger.exp)]TJ/F16 8.97 Tf 76.95 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 120.86 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(lib/remote.exp)]TJ/F16 8.97 Tf 67.89 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.92 0 TD[(26)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(lib/target.exp)]TJ/F16 8.97 Tf 67.89 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.92 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(lib/utils.exp)]TJ/F16 8.97 Tf 63.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.45 0 TD[(28)]TJ -197.81 -13.18 TD[(Lib)-28(es,)-343(Don)]TJ/F16 8.97 Tf 46.08 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 156.34 0 TD[(8)]TJ -202.42 -13.18 TD[(list,)-342(pruning)]TJ/F16 8.97 Tf 50.83 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 146.98 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(list_targets)]TJ/F16 8.97 Tf 58.82 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 138.99 0 TD[(29)]TJ -197.81 -13.18 TD[(lists)-342(supp)-29(orted)-342(targets)]TJ/F16 8.97 Tf 90.89 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 106.92 0 TD[(29)]TJ -197.81 -13.18 TD[(load)-342(library)-343(\014le)]TJ/F16 8.97 Tf 63.63 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.18 0 TD[(25)]TJ -197.81 -13.18 TD[(load)-342(pro)-29(cedure,)-342(tested)-343(to)-28(ols)]TJ/F16 8.97 Tf 112.61 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 85.2 0 TD[(31)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(load_lib)-342(")]TJ/F17 8.97 Tf 45.44 0 TD[(library-\014le)]TJ/F14 8.97 Tf 42.27 0 TD[(")]TJ/F16 8.97 Tf 6.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.59 0 TD[(25)]TJ -197.81 -13.18 TD[(lo)-28(cal)-343(`)]TJ/F14 8.97 Tf 24.32 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(')]TJ/F16 8.97 Tf 5.23 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 130.6 0 TD[(19)]TJ -197.81 -13.18 TD[(log)-342(\014les,)-343(where)-342(to)-343(write)]TJ/F16 8.97 Tf 95.17 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 102.64 0 TD[(12)]TJ -197.81 -13.17 TD[(Lupton,)-342(Rob)-29(ert)]TJ/F16 8.97 Tf 64.26 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 133.55 0 TD[(43)]TJ/F2 14.35 Tf -197.81 -39.27 TD[(M)]TJ/F14 8.97 Tf 0 -18.6 TD[(make)]TJ/F15 8.97 Tf 21.9 0 TD[(builds)-342(part)-343(of)-342(tests)]TJ/F16 8.97 Tf 77.35 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 98.56 0 TD[(49)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(make)-342(check)]TJ/F16 8.97 Tf 46.88 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 155.54 0 TD[(3)]TJ -202.42 -13.17 TD[(master)-342(`)]TJ/F14 8.97 Tf 32.84 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(')]TJ/F16 8.97 Tf 5.33 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.98 0 TD[(18)]TJ -197.81 -13.18 TD[(Menapace,)-342(Julia)]TJ/F16 8.97 Tf 67.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.65 0 TD[(6)]TJ/F14 8.97 Tf -202.42 -13.18 TD[(mondfe)]TJ/F16 8.97 Tf 29.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.36 0 TD[(32)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(mondfe)]TJ/F15 8.97 Tf 28.24 0 TD[(,)-342(remote)-343(testing)-342(via)]TJ/F16 8.97 Tf 79.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.8 0 TD[(11)]TJ/F2 14.35 Tf -197.81 -39.27 TD[(N)]TJ/F15 8.97 Tf 0 -18.59 TD[(name)-342(\\DejaGn)27(u")]TJ/F16 8.97 Tf 72.03 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 130.39 0 TD[(6)]TJ -202.42 -13.18 TD[(name)-342(for)-343(remote)-342(test)-343(mac)28(hine)]TJ/F16 8.97 Tf 121.3 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 76.51 0 TD[(12)]TJ -197.81 -13.18 TD[(name)-342(transformations)]TJ/F16 8.97 Tf 89.81 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 108 0 TD[(24)]TJ -197.81 -13.18 TD[(name,)-342(initialization)-343(mo)-28(dule)]TJ/F16 8.97 Tf 111.9 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 85.91 0 TD[(22)]TJ -197.81 -13.18 TD[(naming)-342(con)27(v)29(en)29(tions)]TJ/F16 8.97 Tf 81.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.63 0 TD[(21)]TJ -197.81 -13.18 TD[(naming)-342(tests)-343(to)-342(run)]TJ/F16 8.97 Tf 81.22 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.59 0 TD[(10)]TJ -197.81 -13.18 TD[(nativ)28(e)-342(con\014guration)]TJ/F16 8.97 Tf 81.8 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 120.62 0 TD[(4)]TJ -202.42 -13.18 TD[(nativ)28(e)-342(con\014guration)-342(test)]TJ/F16 8.97 Tf 99.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 98.43 0 TD[(25)]TJ -197.81 -13.18 TD[(net)28(w)29(ork)-342(\(IP\))-343(pro)-28(cedures)]TJ/F16 8.97 Tf 99.34 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 98.47 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -13.18 TD[(NOTE)]TJ/F16 8.97 Tf 19.62 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 167.95 0 TD[(9,)-342(24)]TJ/F14 8.97 Tf -187.57 -13.18 TD[(note)-342(")]TJ/F17 8.97 Tf 26.61 0 TD[(string)]TJ/F14 8.97 Tf 23.88 0 TD[(")]TJ/F16 8.97 Tf 5.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 141.81 0 TD[(24)]TJ/F2 14.35 Tf 27.16 589.86 TD[(O)]TJ/F14 8.97 Tf 0 -15.9 TD[(objdir)]TJ/F16 8.97 Tf 29.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.36 0 TD[(17)]TJ -197.81 -11.96 TD[(ob)-57(ject)-342(directory)]TJ/F16 8.97 Tf 66.96 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 130.85 0 TD[(12)]TJ -197.81 -11.96 TD[(Op)-28(ening)-343(a)-342(remote)-343(connection)]TJ/F16 8.97 Tf 120.37 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.44 0 TD[(26)]TJ -197.81 -11.96 TD[(op)-28(erating)-343(principles)]TJ/F16 8.97 Tf 81.33 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.48 0 TD[(21)]TJ -197.81 -11.95 TD[(option)-342(defaults)]TJ/F16 8.97 Tf 62.87 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 134.94 0 TD[(17)]TJ -197.81 -11.96 TD[(option)-342(list,)]TJ/F14 8.97 Tf 46.64 0 TD[(runtest)]TJ/F16 8.97 Tf 34.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.02 0 TD[(9)]TJ -202.42 -11.96 TD[(options)]TJ/F16 8.97 Tf 30.07 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 172.35 0 TD[(9)]TJ -202.42 -11.96 TD[(options)-342(for)]TJ/F14 8.97 Tf 46.41 0 TD[(runtest)]TJ/F15 8.97 Tf 32.95 0 TD[(,)-342(common)]TJ/F16 8.97 Tf 41.24 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.82 0 TD[(4)]TJ -202.42 -11.95 TD[(options,)-342(Tcl)-343(v)56(ariables)-341(for)-343(defaults)]TJ/F16 8.97 Tf 137.36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 60.45 0 TD[(17)]TJ -197.81 -11.96 TD[(order)-342(of)-343(tests)]TJ/F16 8.97 Tf 54.97 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 142.84 0 TD[(21)]TJ -197.81 -11.96 TD[(Ousterhout,)-342(John)-343(K.)]TJ/F16 8.97 Tf 85.61 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.81 0 TD[(8)]TJ/F14 8.97 Tf -202.42 -11.95 TD[(outdir)]TJ/F16 8.97 Tf 29.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.36 0 TD[(17)]TJ -197.81 -11.96 TD[(output)-342(directory)]TJ/F16 8.97 Tf 68.11 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.7 0 TD[(12)]TJ -197.81 -11.96 TD[(output)-342(\014les)]TJ/F16 8.97 Tf 46.85 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 150.96 0 TD[(35)]TJ -197.81 -11.96 TD[(output,)-342(additional)]TJ/F16 8.97 Tf 75.9 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.91 0 TD[(13)]TJ -197.81 -11.95 TD[(o)28(v)29(erriding)-342(`)]TJ/F14 8.97 Tf 45.87 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(')]TJ/F16 8.97 Tf 5.35 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 108.93 0 TD[(15)]TJ -197.81 -11.96 TD[(o)28(v)29(erview)]TJ/F16 8.97 Tf 37.23 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 165.19 0 TD[(1)]TJ/F2 14.35 Tf -202.42 -31.93 TD[(P)]TJ/F14 8.97 Tf 0 -15.91 TD[(PASS)]TJ/F16 8.97 Tf 19.74 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 172.44 0 TD[(6,)-342(9)]TJ/F14 8.97 Tf -192.18 -11.96 TD[(pass)-342(")]TJ/F17 8.97 Tf 26.61 0 TD[(string)]TJ/F14 8.97 Tf 23.88 0 TD[(")]TJ/F16 8.97 Tf 5.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 141.81 0 TD[(24)]TJ -197.81 -11.95 TD[(path)-342(lo)-29(okup)]TJ/F16 8.97 Tf 50.54 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 147.27 0 TD[(28)]TJ -197.81 -11.96 TD[(pattern)-342(matc)27(h,)-341(directory)]TJ/F16 8.97 Tf 102.07 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.74 0 TD[(28)]TJ -197.81 -11.96 TD[(pattern)-342(matc)27(h,)-341(\014lenames)]TJ/F16 8.97 Tf 102.46 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.35 0 TD[(28)]TJ/F14 8.97 Tf -197.81 -11.95 TD[(perror)-342(")]TJ/F17 8.97 Tf 36.02 0 TD[(string)-428(n)27(um)29(b)-28(er)]TJ/F14 8.97 Tf 58.09 0 TD[(")]TJ/F16 8.97 Tf 5.49 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 98.21 0 TD[(23)]TJ -197.81 -11.96 TD[(p)-28(ersonal)-343(con\014g)-342(`)]TJ/F14 8.97 Tf 65.86 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(')]TJ/F16 8.97 Tf 4.07 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 90.22 0 TD[(20)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(pop_host)]TJ/F16 8.97 Tf 38.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 159.3 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(pop_target)]TJ/F16 8.97 Tf 49.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 148.05 0 TD[(29)]TJ -197.81 -11.95 TD[(p)-28(orting)-343(to)-342(a)-343(new)-342(host)]TJ/F16 8.97 Tf 89.52 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 108.29 0 TD[(48)]TJ -197.81 -11.96 TD[(POSIX)-342(conformance)]TJ/F16 8.97 Tf 84.94 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 117.48 0 TD[(6)]TJ/F14 8.97 Tf -202.42 -11.96 TD[(prefix)]TJ/F15 8.97 Tf 28.25 0 TD[(,)-342(con\014gure)-343(options)]TJ/F16 8.97 Tf 75.4 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 94.16 0 TD[(49)]TJ -197.81 -11.96 TD[(Prin)28(t)-342(a)-342(bac)27(ktrace)]TJ/F16 8.97 Tf 72.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.66 0 TD[(31)]TJ -197.81 -11.95 TD[(Prin)28(t)-342(global)-342(v)56(ariable)-342(v)56(alues)]TJ/F16 8.97 Tf 111.75 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.06 0 TD[(30)]TJ -197.81 -11.96 TD[(Prin)28(t)-342(lo)-28(cal)-343(v)56(ariable)-341(v)56(alue)]TJ/F16 8.97 Tf 102.89 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 94.92 0 TD[(30)]TJ -197.81 -11.96 TD[(Prin)28(t)-342(pro)-28(cedure)-343(b)-28(o)-29(dies)]TJ/F16 8.97 Tf 94.22 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.59 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(print)]TJ/F16 8.97 Tf 26.61 0 TD[(var)-293(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 171.2 0 TD[(31)]TJ -197.81 -11.95 TD[(Prin)28(t)-342(w)28(atc)29(hp)-28(oin)28(ts)]TJ/F16 8.97 Tf 73.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 124.63 0 TD[(30)]TJ -197.81 -11.96 TD[(Prin)28(ting)-342(v)57(ariable)-342(v)56(alues)]TJ/F16 8.97 Tf 97.79 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 100.02 0 TD[(31)]TJ -197.81 -11.96 TD[(PRMS)-342(bug)-343(n)28(um)28(b)-27(er)]TJ/F16 8.97 Tf 80.53 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 117.28 0 TD[(42)]TJ/F14 8.97 Tf -197.81 -11.95 TD[(prms_id)]TJ/F16 8.97 Tf 33.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 163.83 0 TD[(42)]TJ -197.81 -11.96 TD[(problem,)-342(detected)-343(b)28(y)-342(test)-342(case)]TJ/F16 8.97 Tf 124.65 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.77 0 TD[(9)]TJ/F14 8.97 Tf -202.42 -11.96 TD[(prune)]TJ/F17 8.97 Tf 26.61 0 TD[(list)-362(pattern)]TJ/F16 8.97 Tf 46.47 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 124.73 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(prune_system_crud)]TJ/F17 8.97 Tf 83.1 0 TD[(system)-342(text)]TJ/F16 8.97 Tf 49.52 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 65.19 0 TD[(29)]TJ -197.81 -11.95 TD[(pruning)-342(system)-343(output,)-342(examining)-343(program)-342(output)]TJ/F16 8.97 Tf 20.18 -11.96 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 177.63 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(psource)]TJ/F17 8.97 Tf 36.02 0 TD[(\014lename)]TJ/F16 8.97 Tf 36 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.79 0 TD[(28)]TJ/F14 8.97 Tf -197.81 -11.95 TD[(push_host)]TJ/F16 8.97 Tf 45.44 0 TD[(name)-193(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 152.37 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(push_target)]TJ/F16 8.97 Tf 54.85 0 TD[(name)-397(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 142.96 0 TD[(29)]TJ ET 0 g 0 G
+endstream
+endobj
+277 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F15 261 0 R
+/F16 264 0 R
+/F14 258 0 R
+/F17 267 0 R
+>>
+endobj
+275 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 277 0 R
+>>
+endobj
+280 0 obj
+<<
+/Length 22673
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(54)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -92.76 TD[(Q)]TJ/F14 8.97 Tf 0 -18.42 TD[(quit)]TJ/F16 8.97 Tf 20.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 177.43 0 TD[(31)]TJ -197.81 -13.11 TD[(Quiting)-342(DejaGn)27(u)]TJ/F16 8.97 Tf 71.9 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.91 0 TD[(31)]TJ/F2 14.35 Tf -197.81 -38.8 TD[(R)]TJ/F15 8.97 Tf 0 -18.42 TD[(ranlib)-342(a)-343(\014le)]TJ/F16 8.97 Tf 47.09 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 150.72 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -13.11 TD[(reboot)]TJ/F16 8.97 Tf 29.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.36 0 TD[(17)]TJ -197.81 -13.1 TD[(reb)-28(o)-29(oting)-342(remote)-343(targets)]TJ/F16 8.97 Tf 102.35 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.46 0 TD[(12)]TJ -197.81 -13.1 TD[(regular)-342(expression,)-343(\014le)-342(con)27(ten)29(ts)]TJ/F16 8.97 Tf 128.66 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 69.15 0 TD[(28)]TJ -197.81 -13.11 TD[(remote)-342(connection)-343(pro)-28(cedures)]TJ/F16 8.97 Tf 121.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 76.63 0 TD[(26)]TJ -197.81 -13.1 TD[(remote)-342(connection,)-343(ending)]TJ/F16 8.97 Tf 107.56 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 90.25 0 TD[(27)]TJ -197.81 -13.1 TD[(remote)-342(test)-343(mac)28(hine)-342(name)]TJ/F16 8.97 Tf 107.71 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 90.1 0 TD[(12)]TJ -197.81 -13.1 TD[(remote)-342(testb)-29(ed,)-342(connecting)-343(to)]TJ/F16 8.97 Tf 121.16 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 76.65 0 TD[(11)]TJ -197.81 -13.11 TD[(remote)-342(testing)]TJ/F16 8.97 Tf 59.55 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 138.26 0 TD[(32)]TJ -197.81 -13.1 TD[(remote)-342(testing)-343(via)]TJ/F14 8.97 Tf 76.11 0 TD[(kermit)]TJ/F16 8.97 Tf 30.62 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.08 0 TD[(11)]TJ -197.81 -13.1 TD[(remote)-342(testing)-343(via)]TJ/F14 8.97 Tf 76.11 0 TD[(mondfe)]TJ/F16 8.97 Tf 30.62 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.08 0 TD[(11)]TJ -197.81 -13.1 TD[(remote)-342(testing)-343(via)]TJ/F14 8.97 Tf 76.11 0 TD[(rlogin)]TJ/F16 8.97 Tf 30.62 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.08 0 TD[(11)]TJ -197.81 -13.11 TD[(remote)-342(testing)-343(via)]TJ/F14 8.97 Tf 76.11 0 TD[(rsh)]TJ/F16 8.97 Tf 17.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.68 0 TD[(11)]TJ -197.81 -13.1 TD[(remote)-342(testing)-343(via)]TJ/F14 8.97 Tf 76.11 0 TD[(telnet)]TJ/F16 8.97 Tf 30.62 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.08 0 TD[(11)]TJ -197.81 -13.1 TD[(remote)-342(testing)-343(via)]TJ/F14 8.97 Tf 76.11 0 TD[(tip)]TJ/F16 8.97 Tf 17.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.68 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(remote.exp)]TJ/F16 8.97 Tf 49.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 148.05 0 TD[(26)]TJ/F14 8.97 Tf -197.81 -13.11 TD[(remote_close)]TJ/F17 8.97 Tf 59.56 0 TD[(shellid)]TJ/F16 8.97 Tf 26.87 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 111.38 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(remote_open)]TJ/F17 8.97 Tf 54.85 0 TD[(t)28(yp)-28(e)]TJ/F16 8.97 Tf 20.96 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 122 0 TD[(26)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(rlogin)]TJ/F17 8.97 Tf 31.32 0 TD[(hostname)]TJ/F16 8.97 Tf 40.93 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.56 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(rlogin)]TJ/F15 8.97 Tf 28.24 0 TD[(,)-342(remote)-343(testing)-342(via)]TJ/F16 8.97 Tf 79.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.8 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.11 TD[(rsh)]TJ/F17 8.97 Tf 17.19 0 TD[(hostname)]TJ/F16 8.97 Tf 41.46 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 139.16 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(rsh)]TJ/F15 8.97 Tf 14.12 0 TD[(,)-342(remote)-343(testing)-342(via)]TJ/F16 8.97 Tf 80.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.4 0 TD[(11)]TJ -197.81 -13.1 TD[(running)]TJ/F16 8.97 Tf 33.25 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 169.17 0 TD[(9)]TJ -202.42 -13.1 TD[(running)-342(tests)]TJ/F16 8.97 Tf 54.95 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 147.47 0 TD[(3)]TJ/F14 8.97 Tf -202.42 -13.11 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(description)]TJ/F16 8.97 Tf 45.64 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 120.76 0 TD[(9)]TJ/F14 8.97 Tf -202.42 -13.1 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(exit)-342(co)-29(de)]TJ/F16 8.97 Tf 37.41 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 128.99 0 TD[(9)]TJ/F14 8.97 Tf -202.42 -13.1 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option)-342(defaults)]TJ/F16 8.97 Tf 62.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.5 0 TD[(17)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(runtest)]TJ/F15 8.97 Tf 36.02 0 TD[(option)-342(list)]TJ/F16 8.97 Tf 41.92 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 124.48 0 TD[(9)]TJ/F14 8.97 Tf -202.42 -13.11 TD[(runtest)]TJ/F15 8.97 Tf 32.95 0 TD[(,)-342(listing)-343(options)]TJ/F16 8.97 Tf 65 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.86 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(runtest)]TJ/F15 8.97 Tf 32.95 0 TD[(,)-342(most)-343(common)-342(options)]TJ/F16 8.97 Tf 96.25 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 73.22 0 TD[(4)]TJ/F14 8.97 Tf -202.42 -13.1 TD[(runtest)]TJ/F15 8.97 Tf 32.95 0 TD[(,)-342(v)56(ariable)-342(defns)-342(on)-343(cmdline)]TJ/F16 8.97 Tf 109.57 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 55.29 0 TD[(10)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(runtest.exp)]TJ/F16 8.97 Tf 54.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.52 0 TD[(21)]TJ/F14 8.97 Tf -197.81 -13.11 TD[(runtest_file_p)]TJ/F17 8.97 Tf 68.97 0 TD[(run)28(tests)-382(testcase)]TJ/F16 8.97 Tf 69.02 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 59.82 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -13.1 TD[(runtests)]TJ/F16 8.97 Tf 38.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 159.3 0 TD[(17)]TJ/F2 14.35 Tf 27.16 518.26 TD[(S)]TJ/F15 8.97 Tf 0 -18.53 TD[(searc)28(hing)-342(\014le)-342(con)27(ten)29(ts)]TJ/F16 8.97 Tf 90.06 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 107.75 0 TD[(28)]TJ -197.81 -13.15 TD[(selecting)-342(a)-343(range)-342(of)-343(tests)]TJ/F16 8.97 Tf 101.12 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.85 0 TD[(10,)-342(29)]TJ -182.97 -13.16 TD[(selecting)-342(tests)-343(for)-342(a)-343(to)-28(ol)]TJ/F16 8.97 Tf 98.41 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.4 0 TD[(10)]TJ -197.81 -13.15 TD[(serial)-342(do)27(wnload,)]TJ/F14 8.97 Tf 67.91 0 TD[(tip)]TJ/F16 8.97 Tf 16.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 113.14 0 TD[(27)]TJ -197.81 -13.15 TD[(serial)-342(line)-343(connection,)]TJ/F14 8.97 Tf 90.19 0 TD[(kermit)]TJ/F16 8.97 Tf 30.12 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.5 0 TD[(27)]TJ -197.81 -13.15 TD[(serial)-342(line)-343(connection,)]TJ/F14 8.97 Tf 90.19 0 TD[(tip)]TJ/F16 8.97 Tf 16.52 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.1 0 TD[(27)]TJ -197.81 -13.15 TD[(set)-342(curren)27(t)-341(host)]TJ/F16 8.97 Tf 64.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 133.36 0 TD[(29)]TJ -197.81 -13.15 TD[(set)-342(curren)27(t)-341(target)]TJ/F16 8.97 Tf 72.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.43 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -13.15 TD[(set_warning_threshold)]TJ/F17 8.97 Tf 101.93 0 TD[(threshold)]TJ/F16 8.97 Tf 39.92 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 55.96 0 TD[(24)]TJ/F14 8.97 Tf -197.81 -13.15 TD[(setenv)]TJ/F17 8.97 Tf 31.32 0 TD[(v)57(ar)-414(v)56(al)]TJ/F16 8.97 Tf 28.99 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 137.5 0 TD[(29)]TJ -197.81 -13.15 TD[(setting)-342(defaults)-343(for)-342(DejaGn)27(u)-341(v)56(ariables)]TJ/F16 8.97 Tf 155.01 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 42.8 0 TD[(15)]TJ -197.81 -13.15 TD[(setting)-342(en)27(vironmen)29(t)-342(v)57(ariables)]TJ/F16 8.97 Tf 120.3 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.51 0 TD[(29)]TJ -197.81 -13.15 TD[(setting)-342(up)-343(targets)]TJ/F16 8.97 Tf 72.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 125.04 0 TD[(22)]TJ/F14 8.97 Tf -197.81 -13.15 TD[(setup_xfail)-342(")]TJ/F17 8.97 Tf 59.56 0 TD[(con\014g)]TJ/F15 8.97 Tf 27.39 0 TD[([)]TJ/F17 8.97 Tf 2.56 0 TD[(bugid)]TJ/F15 8.97 Tf 22.88 0 TD[(])]TJ/F14 8.97 Tf 2.56 0 TD[(")]TJ/F16 8.97 Tf 5.97 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 76.89 0 TD[(25)]TJ/F14 8.97 Tf -197.81 -13.15 TD[(site.exp)]TJ/F16 8.97 Tf 38.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 159.3 0 TD[(15)]TJ -197.81 -13.15 TD[(`)]TJ/F14 8.97 Tf 2.56 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(')-342(for)-343(all)-342(of)-343(DejaGn)28(u)]TJ/F16 8.97 Tf 80.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.21 0 TD[(18)]TJ -197.81 -13.16 TD[(`)]TJ/F14 8.97 Tf 2.56 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(')-342(for)-343(eac)28(h)-342(p)-28(erson)]TJ/F16 8.97 Tf 67.9 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.69 0 TD[(20)]TJ -197.81 -13.15 TD[(`)]TJ/F14 8.97 Tf 2.56 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(')-342(for)-343(eac)28(h)-342(to)-28(ol)]TJ/F16 8.97 Tf 58.13 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.46 0 TD[(19)]TJ -197.81 -13.15 TD[(`)]TJ/F14 8.97 Tf 2.56 0 TD[(site.exp)]TJ/F15 8.97 Tf 37.66 0 TD[(',)-342(m)27(ultiple)]TJ/F16 8.97 Tf 44.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 113.44 0 TD[(15)]TJ/F14 8.97 Tf -197.81 -13.15 TD[(slay)]TJ/F17 8.97 Tf 21.9 0 TD[(name)]TJ/F16 8.97 Tf 24.1 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 151.81 0 TD[(28)]TJ -197.81 -13.15 TD[(sla)28(ying)-342(pro)-28(cesses)]TJ/F16 8.97 Tf 68.72 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.09 0 TD[(28)]TJ -197.81 -13.15 TD[(source)-342(directory)]TJ/F16 8.97 Tf 67.13 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 130.68 0 TD[(12)]TJ -197.81 -13.15 TD[(sourcing)-342(Tcl)-343(\014les)]TJ/F16 8.97 Tf 69.05 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 128.76 0 TD[(28)]TJ -197.81 -13.15 TD[(sp)-28(ecial)-343(v)56(ariables)]TJ/F16 8.97 Tf 67.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 130.3 0 TD[(42)]TJ -197.81 -13.15 TD[(sp)-28(ecifying)-343(target)-342(name)]TJ/F16 8.97 Tf 93.75 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.06 0 TD[(11)]TJ -197.81 -13.15 TD[(sp)-28(ecifying)-343(the)-342(build)-343(con\014g)-342(name)]TJ/F16 8.97 Tf 132.81 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 65 0 TD[(11)]TJ -197.81 -13.15 TD[(sp)-28(ecifying)-343(the)-342(host)-343(con\014g)-342(name)]TJ/F16 8.97 Tf 128.86 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 68.95 0 TD[(11)]TJ -197.81 -13.15 TD[(sp)-28(ecifying)-343(the)-342(target)-343(con\014guration)]TJ/F16 8.97 Tf 141.28 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 56.53 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -13.15 TD[(srcdir)]TJ/F16 8.97 Tf 29.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.36 0 TD[(17)]TJ -197.81 -13.15 TD[(standard)-342(conformance:)-457(POSIX)-342(1003.3)]TJ/F16 8.97 Tf 155.17 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 47.25 0 TD[(6)]TJ -202.42 -13.15 TD[(start)-342(pro)-29(cedure,)-342(tested)-343(to)-28(ols)]TJ/F16 8.97 Tf 115.86 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.95 0 TD[(31)]TJ -197.81 -13.16 TD[(starting)-342(in)27(teractiv)29(e)-342(to)-28(ols)]TJ/F16 8.97 Tf 101.85 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.96 0 TD[(22)]TJ -197.81 -13.15 TD[(starting)-342(the)-343(tcl)-342(debugger)]TJ/F16 8.97 Tf 102.34 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.47 0 TD[(13)]TJ/F14 8.97 Tf -197.81 -13.15 TD[(subdir)]TJ/F16 8.97 Tf 29.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.36 0 TD[(42)]TJ -197.81 -13.15 TD[(success,)-342(POSIX)-343(de\014nition)]TJ/F16 8.97 Tf 106.53 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 95.89 0 TD[(6)]TJ -202.42 -13.15 TD[(successful)-342(test)]TJ/F16 8.97 Tf 59.1 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.32 0 TD[(9)]TJ -202.42 -13.15 TD[(successful)-342(test,)-343(unexp)-28(ected)]TJ/F16 8.97 Tf 110.85 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.57 0 TD[(9)]TJ -202.42 -13.15 TD[(su\016x,)]TJ/F14 8.97 Tf 26.93 0 TD[(expect)]TJ/F15 8.97 Tf 31.32 0 TD[(scripts)]TJ/F16 8.97 Tf 27.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.4 0 TD[(1)]TJ -202.42 -13.15 TD[(summary)-342(log)]TJ/F16 8.97 Tf 54.42 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.39 0 TD[(35)]TJ ET 0 g 0 G
+endstream
+endobj
+281 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F14 258 0 R
+/F16 264 0 R
+/F15 261 0 R
+/F17 267 0 R
+>>
+endobj
+279 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 281 0 R
+>>
+endobj
+284 0 obj
+<<
+/Length 26944
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(Index)]TJ 421.09 0 TD[(55)]TJ/F2 14.35 Tf -421.09 -24.04 TD[(T)]TJ/F15 8.97 Tf 0 -15.91 TD[(target)-342(con\014guration)-343(test)]TJ/F16 8.97 Tf 99.14 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 98.67 0 TD[(25)]TJ -197.81 -11.96 TD[(target)-342(con\014guration,)-343(sp)-28(ecifying)]TJ/F16 8.97 Tf 128.09 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 69.72 0 TD[(12)]TJ -197.81 -11.95 TD[(target)-342(dep)-29(enden)28(t)-342(pro)-28(cedures)]TJ/F16 8.97 Tf 116.45 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 81.36 0 TD[(31)]TJ -197.81 -11.96 TD[(target)-342(mac)27(hine)-341(name)]TJ/F16 8.97 Tf 86.04 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 111.77 0 TD[(11)]TJ -197.81 -11.96 TD[(target,)-342(explained)]TJ/F16 8.97 Tf 68.87 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 128.94 0 TD[(49)]TJ/F14 8.97 Tf -197.81 -11.95 TD[(target.exp)]TJ/F16 8.97 Tf 49.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 148.05 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(target_triplet)]TJ/F16 8.97 Tf 67.89 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.92 0 TD[(17)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(targetname)]TJ/F16 8.97 Tf 49.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 148.05 0 TD[(17)]TJ -197.81 -11.96 TD[(targets)]TJ/F16 8.97 Tf 29.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 168.63 0 TD[(32)]TJ -197.81 -11.95 TD[(tcl)]TJ/F16 8.97 Tf 11.85 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 190.57 0 TD[(8)]TJ -202.42 -11.96 TD[(tcl)-342(debugger)]TJ/F16 8.97 Tf 51.06 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 146.75 0 TD[(13)]TJ -197.81 -11.96 TD[(Tcl)-342(v)56(ariables)-342(for)-342(option)-343(defaults)]TJ/F16 8.97 Tf 129.9 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 67.91 0 TD[(17)]TJ -197.81 -11.96 TD[(Tcl)-342(v)56(ariables,)-342(de\014ning)-342(for)]TJ/F14 8.97 Tf 106.08 0 TD[(runtest)]TJ/F16 8.97 Tf 35.42 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 56.31 0 TD[(10)]TJ/F17 8.97 Tf -197.81 -11.95 TD[(tclv)57(ar)]TJ/F14 8.97 Tf 23.45 0 TD[(=)]TJ/F17 8.97 Tf 4.7 0 TD[(v)57(alue)]TJ/F16 8.97 Tf 22.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 146.89 0 TD[(10)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(telnet)]TJ/F17 8.97 Tf 31.32 0 TD[(hostname)-398(p)-29(ort)]TJ/F16 8.97 Tf 62.04 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.45 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(telnet)]TJ/F15 8.97 Tf 28.24 0 TD[(,)-342(remote)-343(testing)-342(via)]TJ/F16 8.97 Tf 79.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.8 0 TD[(11)]TJ -197.81 -11.96 TD[(terminating)-342(remote)-343(connection)]TJ/F16 8.97 Tf 125.24 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 72.57 0 TD[(27)]TJ -197.81 -11.95 TD[(test)-342(case)-343(cannot)-342(run)]TJ/F16 8.97 Tf 82.37 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 120.05 0 TD[(9)]TJ -202.42 -11.96 TD[(test)-342(case)-343(messages)]TJ/F16 8.97 Tf 76.16 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 126.26 0 TD[(9)]TJ -202.42 -11.96 TD[(test)-342(case)-343(w)28(arnings)]TJ/F16 8.97 Tf 75.99 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 126.43 0 TD[(9)]TJ -202.42 -11.95 TD[(test)-342(case,)-343(debugging)]TJ/F16 8.97 Tf 81.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 115.83 0 TD[(40)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(declaring)-342(am)27(biguit)29(y)]TJ/F16 8.97 Tf 120.93 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 76.88 0 TD[(24)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(declaring)-342(failure)]TJ/F16 8.97 Tf 106.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 90.83 0 TD[(24)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(declaring)-342(no)-343(supp)-28(ort)]TJ/F16 8.97 Tf 124.94 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 72.87 0 TD[(24)]TJ -197.81 -11.95 TD[(test)-342(case,)-343(declaring)-342(no)-343(test)]TJ/F16 8.97 Tf 108.15 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.66 0 TD[(24)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(declaring)-342(success)]TJ/F16 8.97 Tf 110.63 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 87.18 0 TD[(24)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(ERR)28(OR)-342(in)]TJ/F16 8.97 Tf 85.82 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 111.99 0 TD[(23)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(exp)-28(ecting)-343(failure)]TJ/F16 8.97 Tf 107.99 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 89.82 0 TD[(25)]TJ -197.81 -11.95 TD[(test)-342(case,)-343(informational)-342(messages)]TJ/F16 8.97 Tf 134.2 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 63.61 0 TD[(24)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(W)114(ARNING)-342(in)]TJ/F16 8.97 Tf 98.85 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 98.96 0 TD[(23)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(W)114(ARNING)-342(threshold)]TJ/F16 8.97 Tf 128.99 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 68.82 0 TD[(24)]TJ -197.81 -11.96 TD[(test)-342(case,)-343(writing)]TJ/F16 8.97 Tf 71.48 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 126.33 0 TD[(39)]TJ -197.81 -11.95 TD[(test)-342(cases,)-343(debug)-342(log)]TJ/F16 8.97 Tf 84.95 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.86 0 TD[(11)]TJ -197.81 -11.96 TD[(test)-342(directories,)-343(naming)]TJ/F16 8.97 Tf 97.63 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 100.18 0 TD[(21)]TJ -197.81 -11.96 TD[(test)-342(\014lename)]TJ/F16 8.97 Tf 54.03 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.78 0 TD[(21)]TJ -197.81 -11.95 TD[(test)-342(output,)-343(displa)28(ying)-342(all)]TJ/F16 8.97 Tf 106.57 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.24 0 TD[(10)]TJ -197.81 -11.96 TD[(test)-342(programs,)-343(auxiliary)]TJ/F16 8.97 Tf 98.4 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.41 0 TD[(12)]TJ -197.81 -11.96 TD[(test)-342(suite)-343(distributions)]TJ/F16 8.97 Tf 93.44 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.37 0 TD[(49)]TJ -197.81 -11.96 TD[(test,)-342(failing)]TJ/F16 8.97 Tf 46.85 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 155.57 0 TD[(9)]TJ -202.42 -11.95 TD[(test,)-342(successful)]TJ/F16 8.97 Tf 60.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 142.04 0 TD[(9)]TJ -202.42 -11.96 TD[(test,)-342(unresolv)27(ed)-341(outcome)]TJ/F16 8.97 Tf 102.48 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.94 0 TD[(9)]TJ -202.42 -11.96 TD[(test,)-342(unsupp)-29(orted)]TJ/F16 8.97 Tf 72.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 129.66 0 TD[(9)]TJ -202.42 -11.96 TD[(tests,)-342(running)]TJ/F16 8.97 Tf 56.23 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 146.19 0 TD[(3)]TJ -202.42 -11.95 TD[(tests,)-342(running)-343(order)]TJ/F16 8.97 Tf 81.24 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 116.57 0 TD[(21)]TJ -197.81 -11.96 TD[(tests,)-342(running)-343(sp)-28(eci\014cally)]TJ/F16 8.97 Tf 104.7 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 78.27 0 TD[(10,)-342(29)]TJ -182.97 -11.96 TD[(TET)]TJ/F16 8.97 Tf 20.88 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 181.54 0 TD[(6)]TJ/F14 8.97 Tf -202.42 -11.96 TD[(tip)]TJ/F17 8.97 Tf 17.19 0 TD[(p)-28(ort)]TJ/F16 8.97 Tf 19.77 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 160.85 0 TD[(27)]TJ/F14 8.97 Tf -197.81 -11.95 TD[(tip)]TJ/F15 8.97 Tf 14.12 0 TD[(,)-342(remote)-343(testing)-342(via)]TJ/F16 8.97 Tf 80.29 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.4 0 TD[(11)]TJ/F14 8.97 Tf -197.81 -11.96 TD[(tip_download)]TJ/F17 8.97 Tf 59.56 0 TD[(spa)28(wnid)-380(\014le)]TJ/F16 8.97 Tf 51.08 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 87.17 0 TD[(27)]TJ/F14 8.97 Tf 27.16 555.85 TD[(tool)]TJ/F16 8.97 Tf 20.38 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 177.43 0 TD[(17)]TJ -197.81 -12.53 TD[(to)-28(ol)-343(command)-342(language)]TJ/F16 8.97 Tf 98.32 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.1 0 TD[(8)]TJ -202.42 -12.52 TD[(to)-28(ol)-343(initialization)]TJ/F16 8.97 Tf 71.8 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 126.01 0 TD[(22)]TJ -197.81 -12.53 TD[(to)-28(ol)-343(name,)-342(as)-343(installed)]TJ/F16 8.97 Tf 93.51 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.3 0 TD[(24)]TJ -197.81 -12.52 TD[(to)-28(ol)-343(names)-342(and)-343(naming)-342(con)27(v)29(en)28(tions)]TJ/F16 8.97 Tf 146.28 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 51.53 0 TD[(21)]TJ/F17 8.97 Tf -197.81 -12.53 TD[(to)-28(ol)]TJ/F14 8.97 Tf 15.96 0 TD[(_exit)]TJ/F16 8.97 Tf 25.65 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 156.2 0 TD[(31)]TJ/F17 8.97 Tf -197.81 -12.52 TD[(to)-28(ol)]TJ/F14 8.97 Tf 15.96 0 TD[(_load)]TJ/F16 8.97 Tf 25.65 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 156.2 0 TD[(31)]TJ/F17 8.97 Tf -197.81 -12.52 TD[(to)-28(ol)]TJ/F14 8.97 Tf 15.96 0 TD[(_start)]TJ/F16 8.97 Tf 30.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 151.67 0 TD[(31)]TJ/F17 8.97 Tf -197.81 -12.53 TD[(to)-28(ol)]TJ/F14 8.97 Tf 15.96 0 TD[(_version)]TJ/F16 8.97 Tf 39.25 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 142.6 0 TD[(32)]TJ/F14 8.97 Tf -197.81 -12.52 TD[(tracelevel)]TJ/F16 8.97 Tf 49.76 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 148.05 0 TD[(17)]TJ -197.81 -12.53 TD[(tracing)-342(Tcl)-343(commands)]TJ/F16 8.97 Tf 93.1 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 104.71 0 TD[(12)]TJ/F14 8.97 Tf -197.81 -12.52 TD[(transform)]TJ/F16 8.97 Tf 45.23 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 152.58 0 TD[(22)]TJ/F14 8.97 Tf -197.81 -12.53 TD[(transform)-342(")]TJ/F17 8.97 Tf 50.15 0 TD[(to)-28(olname)]TJ/F14 8.97 Tf 37.62 0 TD[(")]TJ/F16 8.97 Tf 6.48 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 103.56 0 TD[(24)]TJ -197.81 -12.52 TD[(transform)-342(to)-29(ol)-342(name)]TJ/F16 8.97 Tf 84.92 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.89 0 TD[(24)]TJ -197.81 -12.52 TD[(turning)-342(on)-343(output)]TJ/F16 8.97 Tf 75.66 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 122.15 0 TD[(13)]TJ/F2 14.35 Tf -197.81 -35.34 TD[(U)]TJ/F15 8.97 Tf 0 -17.15 TD[(unexp)-28(ected)-343(success)]TJ/F16 8.97 Tf 77.9 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 124.52 0 TD[(9)]TJ/F14 8.97 Tf -202.42 -12.52 TD[(UNRESOLVED)]TJ/F16 8.97 Tf 49.12 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 143.06 0 TD[(7,)-342(9)]TJ/F14 8.97 Tf -192.18 -12.53 TD[(unresolved)-342(")]TJ/F17 8.97 Tf 54.85 0 TD[(string)]TJ/F14 8.97 Tf 23.89 0 TD[(")]TJ/F16 8.97 Tf 6.64 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.43 0 TD[(24)]TJ -197.81 -12.52 TD[(unset)-342(curren)27(t)-341(host)]TJ/F16 8.97 Tf 76.11 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.7 0 TD[(29)]TJ -197.81 -12.53 TD[(unset)-342(curren)27(t)-341(target)]TJ/F16 8.97 Tf 81.86 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 115.95 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -12.52 TD[(unsetenv)]TJ/F17 8.97 Tf 40.73 0 TD[(v)57(ar)]TJ/F16 8.97 Tf 14.64 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 142.44 0 TD[(29)]TJ -197.81 -12.53 TD[(unsetting)-342(en)27(vironmen)29(t)-342(v)57(ariables)]TJ/F16 8.97 Tf 129.78 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 68.03 0 TD[(29)]TJ/F14 8.97 Tf -197.81 -12.52 TD[(UNSUPPORTED)]TJ/F16 8.97 Tf 53.65 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)]TJ/F15 8.97 Tf 138.53 0 TD[(7,)-342(9)]TJ/F14 8.97 Tf -192.18 -12.52 TD[(unsupported)-342(")]TJ/F17 8.97 Tf 59.56 0 TD[(string)]TJ/F14 8.97 Tf 23.88 0 TD[(")]TJ/F16 8.97 Tf 6.47 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 107.9 0 TD[(24)]TJ -197.81 -12.53 TD[(unsupp)-28(orted)-343(test)]TJ/F16 8.97 Tf 69.3 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 133.12 0 TD[(9)]TJ/F14 8.97 Tf -202.42 -12.52 TD[(UNTESTED)]TJ/F16 8.97 Tf 40.06 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 152.12 0 TD[(7,)-342(9)]TJ/F14 8.97 Tf -192.18 -12.53 TD[(untested)-342(")]TJ/F17 8.97 Tf 45.44 0 TD[(string)]TJ/F14 8.97 Tf 23.88 0 TD[(")]TJ/F16 8.97 Tf 6.99 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.5 0 TD[(24)]TJ -197.81 -12.52 TD[(un)28(tested)-342(prop)-28(erties)]TJ/F16 8.97 Tf 80.33 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 122.09 0 TD[(9)]TJ -202.42 -12.53 TD[(utilities,)-342(loading)-343(from)-342(init)-343(\014le)]TJ/F16 8.97 Tf 120.39 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 77.42 0 TD[(23)]TJ/F14 8.97 Tf -197.81 -12.52 TD[(utils.exp)]TJ/F16 8.97 Tf 45.23 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 152.58 0 TD[(28)]TJ/F2 14.35 Tf -197.81 -35.33 TD[(V)]TJ/F15 8.97 Tf 0 -17.16 TD[(v)57(ariables)-342(for)-343(all)-342(tests)]TJ/F16 8.97 Tf 85.48 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 112.33 0 TD[(42)]TJ -197.81 -12.52 TD[(v)57(ariables)-342(for)-343(option)-342(defaults)]TJ/F16 8.97 Tf 115.18 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 82.63 0 TD[(17)]TJ -197.81 -12.52 TD[(v)57(ariables)-342(of)-343(DejaGn)28(u,)-342(defaults)]TJ/F16 8.97 Tf 124.1 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 73.71 0 TD[(15)]TJ/F14 8.97 Tf -197.81 -12.53 TD[(verbose)]TJ/F16 8.97 Tf 33.98 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 163.83 0 TD[(17)]TJ/F14 8.97 Tf -197.81 -12.52 TD[(verbose)]TJ/F15 8.97 Tf 36.02 0 TD[([)]TJ/F14 8.97 Tf 2.56 0 TD[(-log)]TJ/F15 8.97 Tf 18.83 0 TD[(])-342([)]TJ/F14 8.97 Tf 8.19 0 TD[(-n)]TJ/F15 8.97 Tf 9.42 0 TD[(])-342([)]TJ/F14 8.97 Tf 8.19 0 TD[(--)]TJ/F15 8.97 Tf 9.42 0 TD[(])]TJ/F14 8.97 Tf 5.63 0 TD[(")]TJ/F17 8.97 Tf 4.7 0 TD[(string)]TJ/F14 8.97 Tf 23.89 0 TD[(")]TJ/F17 8.97 Tf 7.78 0 TD[(n)28(um)29(b)-28(er)]TJ/F16 8.97 Tf 33.31 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 29.87 0 TD[(26)]TJ/F14 8.97 Tf -197.81 -12.53 TD[(verbose)]TJ/F15 8.97 Tf 36.02 0 TD[(builtin)-342(function)]TJ/F16 8.97 Tf 63.54 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 98.25 0 TD[(26)]TJ -197.81 -12.52 TD[(v)28(ersion)-342(n)28(um)29(b)-28(ers)]TJ/F16 8.97 Tf 67.65 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 130.16 0 TD[(13)]TJ -197.81 -12.53 TD[(v)28(ersion)-342(pro)-28(cedure,)-343(tested)-342(to)-29(ols)]TJ/F16 8.97 Tf 124.82 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 72.99 0 TD[(32)]TJ -197.81 -12.52 TD[(VxW)85(orks,)-341(link)-343(with)-343(`)]TJ/F14 8.97 Tf 84.54 0 TD[(-r)]TJ/F15 8.97 Tf 9.42 0 TD[(')]TJ/F16 8.97 Tf 4.49 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 99.36 0 TD[(33)]TJ ET 0 g 0 G
+endstream
+endobj
+285 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F15 261 0 R
+/F16 264 0 R
+/F14 258 0 R
+/F17 267 0 R
+>>
+endobj
+283 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 285 0 R
+>>
+endobj
+288 0 obj
+<<
+/Length 5533
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(56)-25998(DejaGn)27(u)-333(T)83(esting)-333(F)83(ramew)27(ork)]TJ/F2 14.35 Tf 0 -31.59 TD[(W)]TJ/F14 8.97 Tf 0 -16.19 TD[(WARNING)]TJ/F16 8.97 Tf 35.4 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 152.17 0 TD[(9,)-342(23)]TJ/F14 8.97 Tf -187.57 -12.08 TD[(warning)-342(")]TJ/F17 8.97 Tf 40.73 0 TD[(string)-428(n)27(um)29(b)-28(er)]TJ/F14 8.97 Tf 58.08 0 TD[(")]TJ/F16 8.97 Tf 7.5 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 91.5 0 TD[(23)]TJ -197.81 -12.08 TD[(W)85(atc)29(h)-342(when)-342(a)-343(v)56(ariable)-342(is)-342(read)]TJ/F16 8.97 Tf 124.24 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 73.57 0 TD[(30)]TJ -197.81 -12.08 TD[(W)85(atc)29(h)-342(when)-342(a)-343(v)56(ariable)-342(is)-342(unset)]TJ/F16 8.97 Tf 128.49 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 69.32 0 TD[(30)]TJ -197.81 -12.09 TD[(W)85(atc)29(h)-342(when)-342(a)-343(v)56(ariable)-342(is)-342(written)]TJ/F16 8.97 Tf 136.67 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 61.14 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -12.08 TD[(watchdel)]TJ/F16 8.97 Tf 40.73 0 TD[(watch)-392(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 157.08 0 TD[(31)]TJ/F14 8.97 Tf -197.81 -12.08 TD[(watchread)]TJ/F16 8.97 Tf 45.44 0 TD[(var)-215(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 152.37 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -12.09 TD[(watchunset)]TJ/F16 8.97 Tf 50.14 0 TD[(var)-196(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 147.67 0 TD[(30)]TJ/F14 8.97 Tf -197.81 -12.08 TD[(watchwrite)]TJ/F16 8.97 Tf 50.14 0 TD[(var)-196(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 147.67 0 TD[(30)]TJ 27.16 119.74 TD[(What)-342(is)-343(New)]TJ/F16 8.97 Tf 54.92 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 147.5 0 TD[(3)]TJ/F14 8.97 Tf -202.42 -11.97 TD[(which)]TJ/F17 8.97 Tf 26.61 0 TD[(binary)]TJ/F16 8.97 Tf 28.42 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 142.78 0 TD[(28)]TJ -197.81 -11.97 TD[(writing)-342(a)-343(test)-342(case)]TJ/F16 8.97 Tf 76.22 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 121.59 0 TD[(39)]TJ/F2 14.35 Tf -197.81 -32 TD[(X)]TJ/F14 8.97 Tf 0 -15.93 TD[(XFAIL)]TJ/F16 8.97 Tf 26.46 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)]TJ/F15 8.97 Tf 165.72 0 TD[(6,)-342(9)]TJ -192.18 -11.97 TD[(XF)114(AIL,)-342(a)28(v)28(oiding)-341(for)-343(POSIX)]TJ/F16 8.97 Tf 115.55 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 86.87 0 TD[(6)]TJ/F14 8.97 Tf -202.42 -11.96 TD[(XFAIL)]TJ/F15 8.97 Tf 23.54 0 TD[(,)-342(pro)-29(ducing)]TJ/F16 8.97 Tf 48.27 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 126 0 TD[(25)]TJ/F14 8.97 Tf -197.81 -11.97 TD[(XPASS)]TJ/F16 8.97 Tf 25.04 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)]TJ/F15 8.97 Tf 177.38 0 TD[(9)]TJ/F14 8.97 Tf -202.42 -11.97 TD[(XPASS)]TJ/F15 8.97 Tf 23.54 0 TD[(,)-342(pro)-29(ducing)]TJ/F16 8.97 Tf 48.27 0 TD[(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)-171(.)-171(.)-172(.)]TJ/F15 8.97 Tf 126 0 TD[(25)]TJ ET 0 g 0 G
+endstream
+endobj
+289 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F14 258 0 R
+/F16 264 0 R
+/F15 261 0 R
+/F17 267 0 R
+>>
+endobj
+287 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 289 0 R
+>>
+endobj
+293 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 686.11
+/Ascent 694.44
+/Descent -194.44
+/Flags 68
+/FontBBox [-216 -250 1303 953]
+/FontName /CMBXTI10
+/ItalicAngle -14
+/XHeight 444
+/StemV 80
+/FontFile 292 0 R
+>>
+endobj
+294 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F18
+/FontDescriptor 293 0 R
+/BaseFont /LWIKPI+CMBXTI10
+/FirstChar 0
+/LastChar 127
+/Widths [697.77 944.44 885.55 806.66 767.77 896.1 826.66 885.55 826.66 885.55 826.66
+755.55 674.44 703.89 1044.72 1059.44 355.55 385 591.11 591.11 591.11 591.11 591.11
+948.88 532.22 665 826.66 826.66 591.11 1022.77 1140.54 885.55 296.66 386.11 620.55
+944.44 868.53 944.44 885.55 355.55 473.33 473.33 591.11 885.55 355.55 414.44 355.55
+591.11 591.11 591.11 591.11 591.11 591.11 591.11 591.11 591.11 591.11 591.11 355.55
+355.55 386.11 885.55 591.11 591.11 885.55 865.55 816.66 826.66 875.55 756.66 727.22
+895.27 896.1 471.66 610.55 894.99 697.77 1072.77 896.1 854.99 787.21 854.99 859.44
+649.99 796.1 880.83 865.55 1159.99 865.55 865.55 708.88 356.11 620.55 356.11 591.11
+355.55 355.55 591.11 532.22 532.22 591.11 532.22 400 532.22 591.11 355.55 355.55
+532.22 296.66 944.44 649.99 591.11 591.11 532.22 501.67 486.94 385 620.55 532.22
+767.77 560.55 561.66 490.55 591.11 1182.21 591.11 591.11 591.11]
+>>
+endobj
+295 0 obj
+<<
+/Length 12061
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 446.97 13.95 TD[(i)]TJ/F2 17.22 Tf -428.97 -25.91 TD[(T)93(able)-374(of)-375(Con)31(ten)31(ts)]TJ/F2 14.35 Tf 0 -41.04 TD[(1)-1124(What)-375(is)-375(DejaGn)30(u?)]TJ/F18 14.35 Tf 158.76 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F2 14.35 Tf 193.17 0 TD[(1)]TJ -351.93 -32.38 TD[(2)-1124(What)-375(is)-375(new)-375(in)-375(this)-375(release)-375(?)]TJ/F18 14.35 Tf 233.09 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F2 14.35 Tf 118.84 0 TD[(3)]TJ/F1 10.91 Tf -316.06 -16.44 TD[(2.1)-1000(Running)-333(existing)-333(tests)]TJ/F8 10.91 Tf 133.84 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 184.84 0 TD[(3)]TJ -318.68 -13.15 TD[(2.2)-1000(What)-333(do)-28(es)-333(a)-333(DejaGn)26(u)-332(test)-333(lo)-28(ok)-333(lik)26(e?)]TJ/F8 10.91 Tf 204.99 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 113.69 0 TD[(5)]TJ -318.68 -13.15 TD[(2.3)-1000(Design)-333(goals)]TJ/F8 10.91 Tf 86.93 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 231.75 0 TD[(5)]TJ -318.68 -13.15 TD[(2.4)-1000(A)-333(POSIX)-333(conforming)-334(test)-333(framew)27(ork)]TJ/F8 10.91 Tf 205.42 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 113.26 0 TD[(6)]TJ -318.68 -13.15 TD[(2.5)-1000(F)83(uture)-333(directions)]TJ/F8 10.91 Tf 108.32 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 210.36 0 TD[(8)]TJ -318.68 -13.15 TD[(2.6)-1000(Tcl)-333(and)-333(Exp)-28(ect)]TJ/F8 10.91 Tf 102.04 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 216.64 0 TD[(8)]TJ/F2 14.35 Tf -354.55 -29.09 TD[(3)-1124(Using)]TJ/F10 14.35 Tf 69.88 0 TD[(runtest)]TJ/F18 14.35 Tf 52.99 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F2 14.35 Tf 229.06 0 TD[(9)]TJ -351.93 -32.38 TD[(4)-1124(Setting)]TJ/F10 14.35 Tf 79.99 0 TD[(runtest)]TJ/F2 14.35 Tf 57.06 0 TD[(defaults)]TJ/F18 14.35 Tf 58.34 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F2 14.35 Tf 148.47 0 TD[(15)]TJ/F1 10.91 Tf -272.13 -16.44 TD[(4.0.1)-1000(Con\014g)-333(V)82(ariables)]TJ/F8 10.91 Tf 113.54 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 163.82 0 TD[(15)]TJ -277.36 -13.15 TD[(4.0.2)-1000(Master)-333(Con\014g)-333(File)]TJ/F8 10.91 Tf 124.23 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 153.13 0 TD[(18)]TJ -277.36 -13.15 TD[(4.0.3)-1000(Lo)-27(cal)-334(Con\014g)-333(File)]TJ/F8 10.91 Tf 118.05 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 159.31 0 TD[(19)]TJ -277.36 -13.15 TD[(4.0.4)-1000(P)27(ersonal)-332(Con\014g)-333(File)]TJ/F8 10.91 Tf 133.11 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 144.25 0 TD[(20)]TJ/F2 14.35 Tf -349.09 -29.09 TD[(5)-1124(The)-375(DejaGn)30(u)-374(Implemen)30(tation)]TJ/F18 14.35 Tf 240.1 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F2 14.35 Tf 103.76 0 TD[(21)]TJ/F1 10.91 Tf -307.99 -16.44 TD[(5.1)-1000(Con)27(v)28(en)28(tions)-332(for)-334(using)-333(to)-28(ol)-333(names)]TJ/F8 10.91 Tf 185.66 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 127.56 0 TD[(21)]TJ -313.22 -13.15 TD[(5.2)-1000(Initialization)-333(mo)-28(dule)]TJ/F8 10.91 Tf 127.46 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 185.76 0 TD[(22)]TJ -313.22 -13.15 TD[(5.3)-1000(DejaGn)27(u)-332(pro)-28(cedures)]TJ/F8 10.91 Tf 123.84 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 189.38 0 TD[(23)]TJ -277.36 -13.15 TD[(5.3.1)-1000(Core)-333(In)27(ternal)-332(Pro)-28(cedures)]TJ/F8 10.91 Tf 155.07 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 122.29 0 TD[(23)]TJ -277.36 -13.15 TD[(5.3.2)-1000(Remote)-333(Comm)27(unication)-332(Pro)-28(cedures)]TJ/F8 10.91 Tf 206.85 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 70.51 0 TD[(26)]TJ -277.36 -13.15 TD[(5.3.3)-1000(Utilit)27(y)-332(Pro)-28(cedures)]TJ/F8 10.91 Tf 123.34 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 154.02 0 TD[(28)]TJ -277.36 -13.15 TD[(5.3.4)-1000(Cross)-333(target)-333(pro)-28(cedure)]TJ/F8 10.91 Tf 144.41 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 132.95 0 TD[(29)]TJ -277.36 -13.16 TD[(5.3.5)-1000(Debugging)-333(Pro)-28(cedures)]TJ/F8 10.91 Tf 143.44 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 133.92 0 TD[(30)]TJ -313.22 -13.15 TD[(5.4)-1000(T)83(arget)-333(dep)-27(enden)26(t)-332(pro)-28(cedures)]TJ/F8 10.91 Tf 165.3 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 147.92 0 TD[(31)]TJ -313.22 -13.15 TD[(5.5)-1000(Remote)-333(targets)-333(supp)-28(orted)]TJ/F8 10.91 Tf 150.22 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 163 0 TD[(32)]TJ -313.22 -13.15 TD[(5.6)-1000(The)-333(\014les)-333(DejaGn)27(u)-333(reads)]TJ/F8 10.91 Tf 143.12 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 170.1 0 TD[(34)]TJ -313.22 -13.15 TD[(5.7)-1000(The)-333(\014les)-333(DejaGn)27(u)-333(writes)]TJ/F8 10.91 Tf 144.94 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 168.28 0 TD[(35)]TJ -277.36 -13.15 TD[(5.7.1)-1000(Summary)-333(log)]TJ/F8 10.91 Tf 98.34 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 179.02 0 TD[(35)]TJ -277.36 -13.15 TD[(5.7.2)-1000(Detailed)-333(log)]TJ/F8 10.91 Tf 92.79 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 184.57 0 TD[(36)]TJ -277.36 -13.15 TD[(5.7.3)-1000(Logging)]TJ/F4 10.91 Tf 74.7 0 TD[(expect)]TJ/F1 10.91 Tf 38 0 TD[(in)27(ternal)-332(actions)]TJ/F8 10.91 Tf 76.98 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 87.68 0 TD[(36)]TJ/F2 14.35 Tf -349.09 -29.09 TD[(6)-1124(Ho)30(w)-374(T)93(o)-374(W)92(rite)-374(a)-375(T)93(est)-374(Case)]TJ/F18 14.35 Tf 216.48 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F2 14.35 Tf 127.38 0 TD[(39)]TJ/F1 10.91 Tf -307.99 -16.44 TD[(6.1)-1000(W)83(riting)-333(a)-333(test)-333(case)]TJ/F8 10.91 Tf 117.52 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 195.7 0 TD[(39)]TJ -313.22 -13.15 TD[(6.2)-1000(Debugging)-333(a)-333(test)-334(case)]TJ/F8 10.91 Tf 132.45 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 180.77 0 TD[(40)]TJ -313.22 -13.15 TD[(6.3)-1000(Adding)-333(a)-333(test)-334(case)-333(to)-333(a)-334(test)-333(suite)]TJ/F8 10.91 Tf 185.22 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 128 0 TD[(40)]TJ -313.22 -13.15 TD[(6.4)-1000(Hin)27(ts)-332(on)-333(writing)-334(a)-333(test)-333(case)]TJ/F8 10.91 Tf 159.12 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 154.1 0 TD[(41)]TJ -313.22 -13.15 TD[(6.5)-1000(Sp)-27(ecial)-334(v)55(ariables)-332(used)-334(b)27(y)-332(test)-334(cases)]TJ/F8 10.91 Tf 195.13 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 118.09 0 TD[(42)]TJ ET 0 g 0 G
+endstream
+endobj
+296 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F18 294 0 R
+/F8 52 0 R
+/F10 78 0 R
+/F4 28 0 R
+>>
+endobj
+291 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 296 0 R
+>>
+endobj
+299 0 obj
+<<
+/Length 2800
+>>
+stream
+0 w 0 g 0 G BT/F1 10.91 Tf 18 13.95 TD[(ii)-26443(DejaGn)27(u)-332(T)82(esting)-332(F)82(ramew)28(ork)]TJ/F2 14.35 Tf 0 -23.91 TD[(7)-1124(New)-375(T)92(o)-30(ols,)-375(T)93(argets,)-374(or)-375(Hosts)]TJ/F18 14.35 Tf 233.2 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F2 14.35 Tf 110.66 0 TD[(43)]TJ/F1 10.91 Tf -307.99 -16.44 TD[(7.1)-1000(W)83(riting)-333(tests)-333(for)-333(a)-334(new)-333(to)-28(ol)]TJ/F8 10.91 Tf 159.4 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)]TJ/F1 10.91 Tf 153.82 0 TD[(43)]TJ -313.22 -13.15 TD[(7.2)-1000(Adding)-333(a)-333(target)]TJ/F8 10.91 Tf 102.9 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 210.32 0 TD[(48)]TJ -313.22 -13.15 TD[(7.3)-1000(P)27(orting)-332(to)-333(a)-334(new)-333(host)]TJ/F8 10.91 Tf 132.43 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 180.79 0 TD[(48)]TJ/F2 14.35 Tf -349.09 -29.09 TD[(App)-31(endix)-375(A)-1125(Installing)-375(DejaGn)31(u)]TJ/F18 14.35 Tf 240.03 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F2 14.35 Tf 103.83 0 TD[(49)]TJ/F1 10.91 Tf -307.99 -16.44 TD[(A.1)-1000(Con\014guring)-333(the)-333(DejaGn)27(u)-333(test)-333(driv)27(er)]TJ/F8 10.91 Tf 201.97 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F1 10.91 Tf 111.25 0 TD[(49)]TJ -313.22 -13.15 TD[(A.2)-1000(Installing)-333(DejaGn)27(u)]TJ/F8 10.91 Tf 119.26 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)]TJ/F1 10.91 Tf 193.96 0 TD[(49)]TJ/F2 14.35 Tf -349.09 -29.09 TD[(Index)]TJ/F18 14.35 Tf 44.26 0 TD[(.)-166(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)-166(.)-167(.)-167(.)]TJ/F2 14.35 Tf 299.6 0 TD[(51)]TJ ET 0 g 0 G
+endstream
+endobj
+300 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F18 294 0 R
+/F8 52 0 R
+>>
+endobj
+298 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 300 0 R
+>>
+endobj
+7 0 obj
+<<
+/Length1 2090
+/Length2 15387
+/Length3 533
+/Length 18010
+>>
+stream
+%!PS-AdobeFont-1.1: CMR10 1.00B
+%%CreationDate: 1992 Feb 19 19:54:52
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /PNKVMB+CMR10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 13 /fl put
+dup 14 /ffi put
+dup 33 /exclam put
+dup 34 /quotedblright put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 59 /semicolon put
+dup 63 /question put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 74 /J put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 89 /Y put
+dup 91 /bracketleft put
+dup 92 /quotedblleft put
+dup 93 /bracketright put
+dup 96 /quoteleft put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /endash put
+dup 124 /emdash put
+readonly def
+/FontBBox{-251 -250 1009 969}readonly def
+/UniqueID 5000793 def
+currentdict end
+currentfile eexec
+€SQM(ì(Ú0_«&(‚Óü§ˆ‚<U7þl=ڎ帗á|°'õÇ?Ûµk
+|%ü5µ_èó¬ûÿÌJ8-‚™ÌÓ}<êIڽʒ„zðV @N÷4°óÙ™4ü N` ¹Ï¸VÂ?•<Z/¾øX}Wt‡œ2NQü²(ˆ·O$P×@¹Ôó§¯cQ˜B"ƒÊÁ¶ÍDmÛËÙÛ›ÿˆ„NxLk÷8˜ÙE !ujsE|~bÁÒió½4âfÞü;^}Š/[ðþmÝ@Ðs‘ßO­J`Üâš+i+)ò:|fÞŽØ\ñøI!g5Q§èLÅÙ.îMϼå-.{µqB9“ùÀŒ1ZºÞ¼Js.„áBÓ¾åW‘ÍŠ£|Eš^kRiõx«£¾FA¡Ä b\ƒ%³ŽÀŽLž^í—jVPÙ‚OD›œ¡LNÉWp"•£š“ï“ö™¸ê°’ÃÁåæä6à©ú"Wl‰0«=ÈÂ]‚¶œÝøÿM¬úœT¾Õ£ª>¥±)þ–¾c(C¹¶¼‘¶X˜]µkÊ`îiÊ’Ï\‚ìæ.ÚÓáØ54ˆ"@ f¯e*ånЋ
+Q•{–ÄSí·Úå¯ý‘¤m“à¡3c
+¯z®–¥Xð‹a®ÇÇÖ[(‰»{™€ ÿî[¡šÉÎC{áÝüð¼¥g T;–D§‡&ÐÁ
+ûÕÛþwW†‘z¹ic˜~nü-?™úVì®d"W˜RVÌäïmoqÑ…‚p Twâ!Š7\¨<W+?—,QцCÎË„Ïvqt³ÀÈìi¿Ÿß¼Çí—ìgØxêMÚÈÊ¥"ýÆ“-÷!¸ø7«VµGÔy’A1 f’‘ÏŠFšxÖcŠ­|´F-‡tìsÑ„e•ÉL J‚3Í4òÙ/oùO”ýXï,çÕË!Y¹S3Œs„ËhÁy
+h¿¢ ™=Œ˜~¹j.ª,ÏØ8æªH¨žmÞóúá¡°x¾—‡pUj–ârZŒñ­FûR“‰
+Ž:íâkÔÇa½5a&ŸªÆýZeÿù!ò ™M­mZ’ÕyLòªRk!CÇ ¥„¢µ—ö˜$Ù0sËkV›¬ù] KB½$š½Ó튩è›'ˆó°x¨U{ÇCÁ*
+…?”r(ÃN’:‘3îÉÅ,bn)hÕO¤3¹p&6ûØ|]Äòx‡ƒP_BVÇz…\—¤ÞnáÔ||3é­"~×ñ 071¾¦ó]v@FîÓjÇXU©(LWsŠ¹…Þ§Ív|x
+‘ç@æàˆË“Ô:H‘E!Þ-¾•Nô¹V;S)õü¾é'ª#0šÒ.ù4›l­ç Ñ›”`@\Þ¸›ña{,)zõb”X#_Œ•õ¼D-ë³M¥Ò éf`Ξ\Ñš„ªTô+oÈ||°Ë¼$™PÓ§ÃSÖ‘×{ 1È@Èô:" ütœãL'‘Ýb| tu9cÒå—”ImU®ÉoýHêý²ŸŠ¼‘“-Õ°eëÚKï<rà—g!†bÅ»ú©9Þ¿™žŸhåÄæL»t©¡†çA4a†_ï°ˆ¯TuEÏwcÚd–˜cwµ‡ïÊ\žß"ìѪoH<J
+Ýþ9_ƒSM{å(^j }S¨©`í‰é½'¯Ë½¢;-˜v¨ØÏÌ)™Õ!àvσ‡ÕWq7l!P›•êÌürx…Þƒ·.“ð3„ˆ¼íÐòøêðs&¿—ÃrtYì‰ø–¤^=±Æ=G
+m¥õæƒI8螺%¨/'tãÊéñ¾!îŽ
+*¢Ú½ Ù0é¸édđîä[Y.N± 2ÈU+’O•_‘ì^g?öŒ*Iá÷‚~FÚ@H]r*­_'Ô›PŸ¸æ+¡Lª$±½/m¨ßŽRMÛBF¶ò’ÄlèÊí¯sauÄ—%T‹ï`ª‡Ç¸ýçÑùaʽ'ÌM;†ªEÛDQϸͿZ4v»Q“cHž²ß¥›0¬8(H™•×
+xÿÞþH]#
+s‹Ï›Výû‡(l‘´ÇA#÷…9 ’C—=S:'˜¾ ÖÔŠVŽrX¢Û'Éhg ÓÚ\vÛÀBšÝuž*´9 Íµž¾¥,º.“¢éìÒ-}Fàu/¾­äùŸÔg—DR´ë/³‰ÛUÕ׸²ÀýHO\c²Ï‰¢wnÎ8x…X³3T7ÞhÊvèEzðÐ…Ü?:¥KŽSv#eÞ£)Åv´lQ¶lo‹ñZ#‹¼UHý·ò]<ø÷_ˆèzÕ "*w嬃Mžd.Ñ)pd!Q鳂eD…‚Óa'/\¤jì}ñˆ›%ܵ€MOvâ2F}âã9´˜®¦klšùCþv$@!Ü´Z3_Ñ.ñv—r2ÕCT_ÿ3¥ÛZ¿ N¾Ñf¥Õ! j7Ý£2¹Ùñ>—ÿ(ƒª@ð[£N‹²>1õ¹V3©½×8>7=û¡¶-– pµùŒá|´h=-×þ†©
+ô÷=Y©I ÚR}é1f5NM¶MÏJJrÊ H:3Ù YC$IJ£© >9¶F¦6ãr¿Ó}²ä
+¾’f¶tâ1
+‰Ñíq*F'$1}Þý«çµ<5›®ù¨kö)æ’{*8³„uSmÞ§Ù¼k£NevU„6NR‘Okx“ÅBvm{#5^*¸î@}: ‚•ÎÞÔBü9÷HfONß 9 Œ‰^äA wp‡ì•vÄ¥Ú¥;3Iq¸#odÍià_â5:*ü0î$ù­€†¬×¢¹ R;á7…óˆx:©‘*È9h©(£¡~B
+uœ.æpÕŸÔ¢Ø8¤^
+‡^ˆá&—|VØŸS©\2Eucºa‹—4µ±Ô :jD3vÄ)«d=ÔµO½"u8¡·:ÌÁI•DÑ-Ȇ܀nÊj$âÍæk©…ˆhÊ'ƒØ9nUYP7ÎÈh¯Ž˜¥JzñM”ÜÁ» !hëï99bX:Sè™;"ý±Â˜½skR#ÑC¨ò£V5R÷ä>úP¾³öÑð úŽ±!Ʋ`íh…A„“®˜A“³w€ŒàE/ñìÝ-ɺHT8p(¨
+fPäÈ
+îÑv^Ë朲*4µ´åôbÿŸª6ù©Rpï“f€Ý´g°>Æ毽`YÝa‘òE¿¸ Í'DGÿF7HÂlí*DLIŽ(šŒ½¨ÄGÍ|¬©±A$t5þkñäE¼zà›ÆFŸÀ?–)Ëü©òÕÌ.”ÒŠ±Z„Ï!ê©-¾â‹
+bV®/U–B¤e À©Á0`Í­Ë¿i6˜|§òBd!‰ ‡YèòòUƼk{uO[¿ÝtT¿
+¹ïò*HÝàé>Æ)Å8ª°‚ÿ±'‹Í ¼0¾W±×Çé[ß‚µ¼b
+ß.d“aºƒ²B"=¯-Ým†0ºœ’ÝŸ<ȼ„Èè¤%oç_$n/`&³[é ›¬´^ç4H?ñ‘à ºU˜öáÍì«Åû
+Ãçúc/$=ÜŠ΋½
+/Ù®•Z‚uHÔ7HAY§ 0¶?ãˆd8Í'—„ÂHì÷(b²©\ ¤ÌÏè;œn¹¨Ys<Åøƒ]° TìkFñ.AÎÑ¡t £e¿¦3³ÑqQêÝôǃ éZ9øcwVêjå¤|×^àÃcìpWÄñÖ`Z’._”]^n£ºû%â|üÎ ÜrŽ¨T枌‹ˆ~4àü
+’ ²˜Õ©Z¦…4 4T‹‘šNQøaùÑæVˆÇ™8ÿg|úmÿm“I 1|Ö^˜÷ªBH«#+ááìýÑ^ +‡Ü>°â&7
+&j¿¦GOþ7:Ùœ„Y DÀgÄ6ÐÏ:PàŸ§ÈÙTk·ºvsG_О ø`­
+fä.&†÷þÇ{à[Ò#~]ŸU¦ÔžÃY1Pån:k*À TéºûŸïózAØêÞwv®óÍnÔÉ )‹»Y h.÷®lOÇÆaÌÊ`Ôåª>ÃÙÉV0zÒöD¦›Ôñáñ¦öS~çEµm±±ÐgÆOóvË°ïi†;ÿ1ÏJN”ø’¬!·HӌֵªX,f¾ûð „”LíÞØqîÊ=ÊèG3¡ö¼¡ê¶`nÏCÛN=Ê=C~ûÛMÌRö¡Éÿp¬ƒæV™Žç5¬ /{BéŠ|"s?÷G€¦Á«¸d•jlúo?¿ŸÝÈ
+UëÇ^»ÕsØeßÛÿ‘|Ü“©Üãf%d5m4Líéµ`¿ÎVÑ°$o·§jD¿s\S±h“‹ˆðJg^%ÿ¯ òÜ©FŸêËúý#’§>‘õ¦ÖY&¹-B%vä­ác剠ÁžWÉ߃ӥ²ðÖŹòXôzÁ­>™)µÕ€ý§æe ÷àuóüUN4zØ}ìÍ×]šPÉø‘G®=i¡P'Imˆ³·PHÌ85€ñ×ës^…yS(bŽÖóIõÁZƒ5K¯#!µ0MÖZŇ"¶Âá¾n4ugAu¶ÄÝ"8ŸH‘™ƒ„3/„d•Ï°XÖjŠo·TÞ0ؽ?½û·êÖ:V’ܼ±îÒ0»ÒÐ~ÞÅ
+—×xУîÞéT´g+w†§BœÍ!Iw ª<æë£h;ÁÆpgMç yáÈRôˆm;%K¤CZû¾ Üô)©ÿ. /žÐf[ãšXEcFF©“¤¡ƒÏsr-£\)&!žy¬ŒæÍÑ“µòg=Hè+
+ÛT¾Gø0¸«HÊ­ébpÃ)ÎÝN
+ë› ž#¬ÊLŠVÐëö;A†Ò#*t-÷‚i÷,ØÓ~›7ዱ°Ÿ+° úiÂ2´qðÙ:àwã±ÕÌÍÓM•h)¬‡S¨£×Ük4hÕ4kIi|Á4¥§Z{x ]¹ƒ]µ"À·¬ã2ºŠ‹0Ü•`{ì$9tÄü[²[/0rù 5 ¿ôΠ Ïg\e‰nô1]ÞÁÂéúôÕ
+œBƒYƒ¹
+è ô„—E‡N¶öJœ¡r¨?ûÛGÏXáÉ陯3m-4B¥¬xJê Ko£,°2›KinU°îîßzèE‡E.ÑMÄì7dà{o3O/Œòÿ³cHš{ÿÆ`™•"ó>„«kØ &Ž£ê" ÒPâf-îº.&]Š¨Ñ0Äb¥LѧWØ#åB”³HJ%l‘•K£êÿ[r òt Bq1é¼9²ò>Ü~ãieÑ•žo™Ë¶[¯M’òýO¶õ§‡Æ¡·-ûçnÒš€ ^Dð‘4ÆŠüúeÙC^¦¿OÉ‘é9cq* ˆèv&†LP–dH1Þáš2ò­EÈéûžæ+£t(Š|â4ÜæÁjÀ
+UßìSÄúIf‡âpõGUZ®¦¤ý_Tq’&å;1öºIöPÇÖã
+fªˆ·üïú”ÜS6sÓG/œSd_Gœáý£CÌC`K}Ï°¸­„P@ÂÿBDA$ˆ¯\QËÇüPå؈·Ùºýt¶ú<ÞÖˆ¬Di×òœ#=ìÿÀpZóV{X êÂ@]/w®”β6h‡žú}ðU~®µ
+.ŸÎ˜t<OÓ¤Iò¿T„º3+ÈÅÿô8ØOYeFe˜ÏhmÖ“8â…š„_P+ý ´}P“CbœRÖ¶œŠ­TyÛÇÖn¦·o‡ËÀD/‰Ûê°{Ã?V.có>ßX™Á*ú|Oú©‡gúï^‹ˆKSñh€n* T¤‹î‰„Ñ€Jzì~Òh§Í–Y±¨f¼JYFEdÄSÒº¯j"Ž(˜w†î=—ZݨŽùYоž/w;‡”º`W¨y-Su²€˸ÊXHÊ>͹®tìuÆ#Äl lÉócj³p¦®¶]"ÚK‚|ÑTñM¥~–¬Ir{Òû[Ïpܹ¬À†äþ¸hÝôXW¾2îWÿN_F)ÑŸ %ÇÌx“k*IM}P>>—øî\ªAß 3òI˜1ÑUïåGñ½ï §@<…V‚´¦æ(û§tíY»'EÐHkå×ÚGªxᢸ%ÐëfÚ垨Ôqz½š{$7/B“¤JšüpL€ta·6ÌLD¼øá±Yp`Ùux±/¯Ó.BöÑòbUT“«ŸŠE:º4q4çï2+ØÃz¦KˆÿÃÏyÝ|R!£¢"&õ.ª³~Ï•³íš‚ÄiDbAwi;­°,ÁØþ‘BXŒb=Å.¡QÒþ ¶vs¤-©·
+ØX]ÏYÃÊßYÔÎâK¦”¯û^ÅrA÷ªJ¤8
+›b·Ñ n³üo§¥GÙ㳸BËŒ-
+ô~¡ÙU'å@ëèd?l6ÆñÁÖf)íÇ>`ÚQÈ–_%g@µ·ìýîµWf“©} <dIIN2˜Ä¯ì<Äì›Õ¢¹jûÀ›Î"ÄèáTnëñ@0]a aXÇ„UrnnøÔ.¬Ñ9Œ¾Fñµøé»0Ñ.iÛqu»òóp$?é½(¬yga0=kàßCû´Fg®©ÿÉO!•Ns/ñ˜¥É”Ñz™Ò̱Q ®4–ÙlÊš`é¿eÝ XÍ~Áé/uÜÊ–{­ìtícß²‚—ÕÓK~kn^K¦n~ȃ(‡
+œ<p‡l5„Á'ðÛ ðM°iLpåÇðGcâã´Ù”uÈ0á?:›g5PR.ãëX» šˆ.NI™¨m¢×æZ¤Ú]‰$á“bð!·Â‡é†“nQC‰‡Ç£òYz-NdæùG%ህÜ|E®«Ü vHéÅWu–H£ÀÑ"¼Fq×Ä­xú‚±>hpÕÙèi¼UÆr:ˆ°­jKaû_¼Z:
+²:KÖv.èö3H´q]7\ôf´Ê«´­A L¸›‡YgZg~#=䞣QJP¶­‰²Hć ‚Þƒ \Aq„eL‘\7c¬;ªÉ%r·ÕÊãdv<ì`˜¯àßÛ ‚ÑèÛãíq5<¶ºu.ü¦i»OzìLÖÁ âð
+¸®n¢óÍŒûÜÌkiÈcäÆ';Øm³ªÞÎwHã2s§yqÉ¡ãœ~¬;«.×™Õ@cèÓI­H±!Si¡Y.Šüöç?ÅàÅ]ÐÛpóü¹Ž%;ài{e©$”Bw€Mk!Û…—œxËòEáÿ>Ì›@Iê~ˆ¶®¯³Â¢4‘ ìû£9äðfu ::•XƒÇ‚«¾`XßÂ"û‡Ð½´6ór;÷ÕCe`q˜ãý² GXIJà¼iHÆbmß5@(Êãèµ€˜ß2véMÌ\&“¾“išÙüjždAÉdd‹Z¸{c–t|°­`SêÀj—b.FÌÓ7lg+ý—5ÿp¸Œð9iMòYÑûK}g Œò [`CÓ–á̶ìiFfSÎÛr ä^kÅ*{нCg÷S§iö>Du*žî\j}+h9å©×_©t®¿X\%Q9.auw8{†ã
+ûÏ6èåqQï”L{ƒ½^i^ç"Se¡+´Ôxò¡p´:ÈÏSÒÀ”¢ ÅiÞ¸½
+ x-kÊB*¸ 9 r6±4Pú7oŽÞ'sãOŒ8»îW8*V9â¥S‹î„™ŸÎÖi®Ìr5nj:×=KhÐ*üÔ;ÌÛ,ŸJŠü™8ÖØeR¼XhÁtô"¾ŠÓj³ø¢.éŒìá¿Ö::Vß×b–Uÿ¶y¼ê&2Èá¶Ttž!x Ç`Ö7éåùža¥
+Ó ý[Ý›OÕð‘•æðLf6)|7gé“Â\;OÍåŸÇH†\ÎIzë²ùW
+/ Öë‡HI£¦
+º gÏ—¥(W
+ù‡¨?”VÄ1H ^ ^éë9Hùg^Núzxi\hŠ¶;oSdKÄÕã á%Àö¦bÎ= ßÒð2Ü ã¤Zš7–ÞíM"H H6
+* B×´4°`ÿ°¿¹m“ûKK„Ö*‚ÑåkÀŸû*q¢ËСÓóSYñ×ßûÈÿ1zÚ¿U‰RƒI{ŸW.)Ñ3G?'0Ž­ ÞŠ0À³Äñ¸‡™9mn;¹áw‘Ñax61ÝþÚlŠv÷SNðbx
+Ó`pÒóNBœÙ?†©EqØ!`˜jß5u3’Á$´A˨½Ì?.«Qí0h
+Õ)B‡Ò¨ïCœ(24æíB+H
+†Ò·è
+àq÷ÐEvFɺZ#4ªŠj
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+10 0 obj
+<<
+/Length1 1686
+/Length2 10475
+/Length3 533
+/Length 12694
+>>
+stream
+%!PS-AdobeFont-1.1: CMBX12 1.0
+%%CreationDate: 1991 Aug 20 16:34:54
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMBX12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /XOEAXU+CMBX12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 57 /nine put
+dup 63 /question put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 81 /Q put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+readonly def
+/FontBBox{-53 -251 1139 750}readonly def
+/UniqueID 5000769 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+hÌV°]ß¿ l0t¾ë9ܼ¢r¦æ)ûzê,[§ºå {L¥•ßx 5)—ì>ådß"Ÿ»Tsõè̱ÌSé§â™¨ê¢›iѶ"±ðÏüX)Hu–ÙPËQ pÜŸt;ëïDö®’úÎÅvX™œ‹ð`a`9bÀi^¸} Ú«eeW Šf é®ïŠå_q¸¼v9My)gäØ;nŒ=™‡ÕåLS¿+»2…[”ds´H3½x‡=øäÇæhÿÿ%ª»¤tK$ÖË‚${0RÌ]fóñ¼ø¥j?´FêX{ؾ0%vRÎà5bŠíßØ(;ZÒ‹€­$ؘ—
+È¡ã>T<äãÄžæ!ÅÎ>Šé0øcfɈ``hÙé#–ëõ³Û Eü= ÔpÇ¡M’»þ'½t³c¨Ž3¨é¨ZÃ!ç=Å+3;‘ pÅHs¤"-fà&¾m,ˆ•ŠpÁnå ð «—g^Ži"níP]6Â!¾ dtBDKð2_‰›¡^›Eù ÷=ÃIomàÝD¡yI¥(fÇ7t”¾ÿDA¼¤ü+ûryú)8ú›âÞv/ Ôp<NàCq.ûŸ‡E(· ›äð„Þ’-lf×öÿ–¤’3²9mœ¸[/õe‰:Ó¡ÛˆäiüìÕ[?­ý>P‘H9ÞåÕÒ¶?ƒè§•83ïâI*01O2⽚u*½¨vîø†ñ9îÎ)ã &¥§rqÈ”P¶ËC å65þÀà$Ë ¹7,ôØ~Çê»aZÉ~ï¯îZØUºK#»Ã½vX¢Ú½ŠCA—ùsý1!\„³˜Ç]òpPª~æN]Ï2Å´¢y¤Mmç®Í –«`¥ }¥™Q¿ErP96iÑínûºJæø´­ÞØmjˆê¶ñpýon]…øÀ xÈ&(©À’ÑýÍú ë¯#ŠWRÖ3©d|Y QsܳÛàŠú–½ý¹Süq§“è†6òòÁ„F9þëAÞ‡e@¯¥š#Âçi‹ä¦ÚFèw1<þ=‹±MøY#
+˜ßI6ŽÙž¢,ìXËKÝà?¼žH¨
+ åÀ§ÿ=µs8‚·ì0pcŸ±Q\ÿ0¥Ëlfýº’g«Éc˜Û›°²%Ù [a™“èS?ãh¸åõ/.ôPTõ„H½Ë²‚4Ǻ$
+õúG@Î…Gª=žüíž`͈ÃGÂ×Üï®^\SÁŒ³/¾Dà0fïòYl#*5y
+ªÂ•Ybý@4(–Š{Ò«¿ð¹ÌT€†"è÷¹ô3´1Šö<©)IáÌH,ûÉÉÌ”8‚S¢Yâ=×êM[wu¢ü‹­–UL²û9z
+È5„ºÖmðÒ,YðTjt.Ó§“êð¾'‹Þ8vd¡4_‹Ÿ )h9SõI£ MAÕZÄ2î£HÒÅ¥wF|•û
+…Â:ýqv2Ê—•)f-÷½)‡S~>Çpê’Äg{šºYÏIdU&Æ2»tÄF»©–¸™onûSÆ”ón§Ä–ºNÔtùn¿¾w}Ýä$T²ûŠ¥ôx± ¬-Ã&ôii.ý°·èØôŘÂÐhè˜}([ c¯øO€·pÚcÒ­ü`¢çQæa®vI1ñ‘ú”.ó7
+l‘l/ŽNdrÿê,m+êó¤ÕHÚó’*vS»ªP`­ÕE¶/5 çî.”NÚs.Ï|¤mm|ü6,çl$uz‰1;Äša;[ýÙgX)Ø@=à@’•´=«³dásmºçÈj¹'ïŸá5ѧþÿ¸…$œyåWäMÓEU
+rÿfþþ|saÚ ÊQ5¸AE¤Ý6—|Î1 ¡G|d+!Û;ÍHUß Ål2f1ʼnœ[Èový)ê
+‰=˜n}ªÍ§Ð
+9¦Mü3ÛhC_z @þOîõ¼çã†9ÖÝyTƒ•Ä'Œ€,„ŽYF¦YìúØêLPñ¸¡f¨€Z©ÑÜwj®ó†Í*›Ä˜AŒÀcž˜­z³²Áµ™oºŽåËéˆìåPk€Ãó‘×AâRæk§kÉZܯп’Mhn§ð2Éx#’…u©Bß­ÃÇÞ-¸Aª•0-RêDÇ%…’H W•&Sx<è–ÐÍ]ò“Ž¸õ9{a™XÞlÍ¢!ÿq—U%=Æß=œœg´–¬Å〛»U3X§ BrNÛ­^w»)ÛºSk¦cY²]à-î™ù4(A°£’@yJz
+‰µ²Af³‹×î¾{fÿµ
+ž©EÑ,I…£ÙÓÑTª?Éj¨Íÿc:Ñ$çrÜÑp=ØB²‰Vó‡hë*))ÕÕd?Ž.'ŠÅ„fÛ¡)5YÝ%µ1:]Âî°É°-í¬;¸}½@„Ûí½ÓÅ‹'ݲ9¨Ý’åß•}ðŠçeF-û›‹mÍ´ÓÑ0a4(ý¥e?¼fÙ5{]Í,ufÙ˜ëª<Žü§/_lQ¹Cf
+¼©HJÝáhÉQbSc·ëÀ_Ý9T*e ?éeec«ÿíJf®gÉ¥à¹ñ•ÊiFÎncû„pò\{ûâ3!ëÊÔ”úgrÐõ99§‚fhêºß[þ\ñdv%x!¦{®L£.@3@õHÁ5%j¡‡Ñ§¼Ës'Â"S8H}ˈ)8CãD*?üÿ¸ˆþw#YŠÛ6Ÿ==žñ†J3­±”ˆ¾ì*ã1é(pÌš- Ø•ˆ›@Lå oþlÊRìO·Ð›bèE”`¨ä!»Äée¿{
+ÏYèóg=ñ
+rñW§M”TW¶–?)aÀÙ|–;Ö¼FµŒ¦Å2NÕ“ÅþòÂI«{52 ‘‹Bê?åGç›ôÀA¿Ü(™Rˆ.õ “K O|î2†Æ„`?¾¨À±™˜¹6ÿèüÇ.N™°tžG ã$) .¹ÒJ5·ð¢ÍKý;;?“†=°WX+.cwÑêB…¬;&“^,ç¾@ÿnn–ƒ5œ´T‚à½Ö ë òî̧/Ÿ¨Ù®&cE·aô«Ì¾x/žN¥ŒÌ€Ww G9’˜šÚX‘8mQZs^ü-³]ÏÛÄ™CéCV2t;-$Ý$š ¤àÈÎw ™ŠŽ¥]Áu1^5Ô?²)U`óß½»{ÐÙÁ”6–î8ûÀO€K¹úþ4ãtý}«ËŒ8áÔ?;C9éé‰ Æ$]yV£·ˆžòÎŽ5@'òjßôi_£Îü ßÀ‘+m®F…?<T¤ÊËzÖ~ÐÇ6´ IÒŽµ `t—ˆÖð ;‡ÿÛ…
+îÉ…Cö•‰ƒk–fÔˆ›¯#Ÿ|:WÄt» W$w©Š#ˆ2Ñ?§ÉÈ~Ü‹”šïoµÒ'O’q¼þ¸úWXYÈ––$ƒUô €Ï˜²:4ò„
+bϾ&Šá¼à{GsJôJ#ñjèx7[ÊQ&œ™4Ä6›Ô_ؘÃȦ¹s§ÍŒ‚úÉßý*PJcö¸ßŽù.pX‰LôWM@.Âh7¬>#õ+"»……v_a 9ØP+Üù£Â ¦x#g¥9ÝBéÑ- o5
+W†­þ_î71 îr/m0É>aþu^
+è¦Í®¿gyŽ6?s¥ÅùÌØ°p®Th@lè?ÈÌ—ŸøL@Mä’ *2úÝB•D˜Ööü àu÷³á“AÜœ¿iòFÊÔcOZKúÃÛ÷ú8,HJ‡ó\@uiUä!ŽØΓ;Ux–M€fÞøÓ5z½é´–ë¦u´›ÊºGÆŠÌ´Šîb°ï.nR “{T\·h࣡Åw‹ê¤ér r—-^UÈ1°ªn¸%pºkGHÏú(¤–#ŽE›ÛuΛ/öP
+—÷%ÿ½B<žo
+•:cIÙ®ÄM²¢Â]T¿hG ~,à]ö Û†l,ôn5߉+{ª£ >r0¨U¾ZŠ…e§Šòž€£PxÿvGFàRl”füØú€Ç ç;ä' t™ï¾5§ÿ+ÿv0~Ø>Å–iY¸f X¤µ€ê­¦ü ¦:è£-)!ªÈ†´Bb_ÔÁkx
+,¡•ÞXESX]¥¹7d½
+¦¿³4‚`3Ꞻì…J±e¡ ž*>9R×·|j5~ïb‘ùæÜh3¾u ×w63òqð½TD?í¬]ÞWÜø)œ¢9™Ð³íX\Êl­×ºZn(x8 ¤2LdÄ'¦“ÄóIþz,í:í©§X`»X—¬`aOSEów¶²‚ºÍ16&'ÅëÝp~Ãé±¼¤wοb—:‘aN‰aØbümúd³Ó÷½]§©½üdÀÇõQèZ—óŒˆYBWÞy9Úi¢éCA&ÔpfÿxÿC
+«Ú/F /†)Ë‚jí>öÍ ùÞG¸ÔKB•Ê¹Ù×"X^ý9Áo] r=¶ÈÑÅt#¸Î:ýš¾CG¿( '‘½±¿"q…ç%ÎÇ D4×l¹Í{N‚˜o ”#²·œ°R*M‡à§¬sÇùg+rŽG >ÍöXŠ›­ö&JâÙ$Ý÷Æ–Ð¥#)øøñþ<'vÂÄ’6ÖãÔë9y¶wAqÅ€Ai‚+ŒQ?¢ÆQ©ÀîÆÙÃþ e}¶cVú/dT„’ˆÈÏe“µòõ=N}Ç
+
+f„1¾pRáن̯–a0ÓÁ{O^ N€’œn¶Ý¹È¦\nù
+ßÆ5⼮ŒÐ=¯«… ‚Õ5(à”ñÙ
+Žܨõœ³Ëü%óU\œ®xå¯Ê€æ]¨Þe»6*
+<[»!YÚßW°—À€\˜(‰çVc¼Hv”:Tð²ó©8”kvz·lp8YÃÕ
+å}ûEeÜbvúþ> Á•¾Êå˜O
+0õÐO¦©3Œ!û®|&õÉÂò ñ #*sƒYó…/ŸYÐù¦cŸøu† 8w7þá(d²òþ^=g’T¹¤(»_„ƒ8õÐCÓõÜ¥ª§W.ÎRÈ
+#òu\˜NÖî7Ô—ú™la—á¸Ññôч¹âXÙ4ñì™sƵ¤š3#¦&"g÷¦`ö‡¶#ñvT’uÈÒq¾ µáaàÇ|ˆôUø–P`*ö†¢Jï­šqxXR8ßH
+ê¯:a,9•€3µ‘‡ÓÀ‘
+§Ñž¢Y4§ÚqÉéóŸtÒY¿Ÿ•(ímÌœ[î;JÝ·´öÏîN©Ã—“jRéêÆ|žÒå áŒ‹Ãej}©„ñ@kî½Q@€èX{«LI<td#
+&ÜFœJOø")(È߬o’: ŒI–Râ¡xz1Ý7 o¶å#dmýõ.¸•·:=@£É
+W̃öã`<ú âJQ'eb­ˆ®$_æopö$/¼þPÐÁ9†ÄÛ Æù§Zo¥•g äöOå[†_)aÌå­ŒWá hè<1ÜzRôõ4„m З~ý)TÄܶõ—IuÓlJ‡_ÙèÕÓpŸ}šér,öœ¦×T*©÷!Ôض‘¾Z”ðºî£R?W’X{ãÎÝ7Y츕*3Ï9Î!ÁÌm¤ ;è 
+÷Í÷3®ëÕÛ2\BÈëxª¤Œç=وƂš§1_›6,þ›¤±™ –ëu½G›NgHµqöó—Ù6ëeœ— ¿§6‘æ•HËM%/<¥¦rµ¹ 6Gz$”.Ó—u׺å)í£Eì»)Ït¨ÀÈ9ØÓ7Ø駲njZ…Bã³46ÃQ‡u¯Ù3”,gÉ¢ã@~™ÜÿÕíÙ|eŠö9¦btY»@_VY*ówf I!»ÅAã[ìR†zrY-ީ׀͉k¨ð2VŽ˜A—ã?^WíôeÌmy'åTîðÕy E\™'‰Ð3`ƒEýºð“Ç·iêi¿*c„Pu>rœÎ¢ R®ÑP°$ppvéWÕ¨BºÞ {ÏJ–&Öwµ=ñn(YfKØF±¾ÆÁ.˜Âä'Ì +&%.¸¨øÈ»jç[­=H©•Ûû›à¶y%ó cKíû*ÃǵèʸO˜ç,&ºÆ~XθaMŽQ´¤lÕ‰‰ÓZQŸü$Àm"ºÄašÿ6@º2éÈÜ~>]Ã(kk½ËßÀ½ÏF/B-1'膆¯“ûVNŠ}*<.!W¦fß0<•Vµ½öÚ0Ò·‚_þ®ï—ÿDLdÂl`§Åk´Ý1ËÙGiB®¾Ê«RB¼ü?íëuT5G˜ãÊ謨i’ó7Ëé`|Î#¿Òö]OLæ°9<¡»õ†¸:¯† Ww3ÜשÚSTtž²Fð‰P•U•óßü¿Á†DGb{y¸+¯ÿ̆V•'BEÂÁ/ N,awÊ>¢ù”džÊ!}@c6Ëñê‰éVw¸,0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+19 0 obj
+<<
+/Length1 800
+/Length2 727
+/Length3 533
+/Length 2060
+>>
+stream
+%!PS-AdobeFont-1.1: CMSY10 1.0
+%%CreationDate: 1991 Aug 15 07:20:57
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSY10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.035 def
+/isFixedPitch false def
+end readonly def
+/FontName /ZRNQXX+CMSY10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 13 /circlecopyrt put
+dup 15 /bullet put
+readonly def
+/FontBBox{-29 -960 1116 775}readonly def
+/UniqueID 5000820 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÈÎÙ°š'Z²1NÏ‚“R‚oN—]ÎÎÇ+,󡈙ÌÞÙ5Ð; lƸ<ßO#¹¦ ´™v¬32cÉÜïͽL„í
+>ºW¹Šb3ÙéðÃðÌk,j›¢:ó‰æßÿNþÃÞÖ'lkäp<å7%–ô탴›¸só¦9Î
+†¶Ø1Œ¦â,Šñ;T×WoäÊZzù
+lôÄöÉ`‰ÊÕH&Iþoí Q=A6çZ$lR ]œŽvÒÒá«ùkÀ/´5hx Ʋû•÷üÄ1UêFŽÆ€ø,ŸŒoÖغâä$Élú›áƒ®HdÕà/;p3‡Q VÏEb–© Žxo‹TÁûáæ}#N
+öçÑ«¦wÙ&@g(;ÅÖ ÃGt`çE „*㡶Ymä÷4Ö6 mm8µCv/üdyù./“rô×0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+26 0 obj
+<<
+/Length1 2237
+/Length2 14365
+/Length3 533
+/Length 17135
+>>
+stream
+%!PS-AdobeFont-1.1: CMTT10 1.00B
+%%CreationDate: 1992 Apr 26 10:42:42
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /YSVNVS+CMTT10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 33 /exclam put
+dup 34 /quotedbl put
+dup 35 /numbersign put
+dup 36 /dollar put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 42 /asterisk put
+dup 43 /plus put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 59 /semicolon put
+dup 60 /less put
+dup 61 /equal put
+dup 62 /greater put
+dup 63 /question put
+dup 64 /at put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 74 /J put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 91 /bracketleft put
+dup 92 /backslash put
+dup 93 /bracketright put
+dup 94 /asciicircum put
+dup 95 /underscore put
+dup 96 /quoteleft put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /braceleft put
+dup 124 /bar put
+dup 125 /braceright put
+dup 126 /asciitilde put
+readonly def
+/FontBBox{-4 -235 731 800}readonly def
+/UniqueID 5000832 def
+currentdict end
+currentfile eexec
+€SQM(ì(Ú0_«&(‚Óü§ˆ‚<U7þl=ڎ帗á|°'õÇ?Ûµk
+|%ü5µ_èó¬ûÿÌJ8-‚™ÌÓ}<êIڽʒ„zðV @N÷4°óÙ™4ü N` ¹Ï¸VÂ?•<Z/¾øX}Wt‡œ2NQü²(ˆ·O$P×@¹Ôó§¯cQ˜B"ƒÊÁ¶ÍDmÛËÙÛ›ÿˆ„NxLk÷8˜ÙE !ujsF,V=QìïªÍ—2ñ,)1^K–#¥u,oE†ž ‘ &Dˆ|ê~0±Vv©%7Â:¨ Ã
+®Î‹¯žŸ3d<¦š[¨dÒ¡s"q©eù— r“ÜÞŒ?ö
+†¤ÓphPËÄT@ÜÒ/0raâöú£îjXùyɵê£&Å£knÀ3={@FÖ6F¢ïpdŒ7©Sùo®Ö&nÉ'Sëþ“ÀÌ·ÃÄ1MŸnT'L€F¨ÅÌ~ëæ%¿Y ?Ts>Ñ „`Ë“!¡ê¯4­Ï«˜e!½·Ë§*#S”/¾¤ Ñ¶~Í剦Zøç¥úK‡g*Õ_W׃ÆmáÑ
+¼ó%0i#€Ç0Ñ(4wzÆu…w°õ;bf5ÊÓ»ŽŸTú\¼Ë9O_²â%æ,á.Œy/[~#FˆÒªbzFp3ždc™ù”BBcåÁ/Ÿ=A¤DIa©xZ û§3ÿ*x’ÑdƒlÔ,X̸AÖ⥮0úÞ˜F­˜#`Ly›©—yüË¡Dt ¼ÇèW´³Þf’vb ðãDþ !_%wéÉ,jÐ/Ft ä*Åå©l<Vµ5ÿÖK¥SMÝsÀÆTûÖúôýüUß*7¡½Ôéس`Óéþ%cMpœ(žRJfßÃ<Úd 9ri½žËèJ}{“©}Å"¡kie·Õ×y
+04Ë>€˜Sq¥›8;ü\ëâÙ Cº],ì};—-2ª“+u lÈ49sû¹—-„g
+ÅÊÅеç\à!ù”“Î)®¼ Ëu‹°¤}úæÈÐu;ýs‰‘ ¸ ჆צúøŸëÄ­*ꈄëú‡~"Â" ¶ÐKÆݵA(N@
+"æ²x
+Æ[áÍ"êÓ£ªË+£Ú€V1Ë: /¤­a¯0V$±ˆ‡G0C[š¶·Òg ¿¨ß‚>j}¦3õ( HùÄž¶‘&æëŒSĬžT†e2¥G»Æœ uï&Ù¡ýŒ4¿Tˆo$*ü>öZ™–Óˤ5°õ^žç®Ž‚ˆp:èA{´ßÌï#î‡uN¿gAY6kû[ÚUÑíWÍ° mÿÇÑa
+†™ JÔœ;}s'¥¡{µí÷È­0RÂÀéþ Gfݶ…P#`ñ³?¨¹SÅjI´M-z5köÈÞØ Âám­53 ÒÎs¡‚:ÀÔz(¢SdUpÕ¸ŽÐ‹ÜÆcå‰?±–§|AЂ¼Rî?‘ZÚ§Õv*­ SS j_bƒåtN*O±¤àÉ R|ÛoÚA½Ûµ|Á³šÿ°<ã<Rªv:¥Ž±f*¬žitE!Õ™0#dXHòËéžC_¿Ö
+Ñ1[á%Dl…·«_r(¿J&fÈ`v
+®½é ¢ë7µæÖ©
+[‡­æ Môáßß¿§»µõ˜ð¾ÊàØ7òØ™²ó qwHf +êêÔV§Á;w.øvT*—
+<Ußwvo&I0Ìݤ[Tu‹¹ !ÜIJQKcŒ§.7¹á ™øñ5K±ö¿q7ˆÓd+ì;SÓgÃœ?˜PÄ™ŒüýƒŽ|·ð£«½kÿ[ÀÀ^wÕžs§ÞÜbžÖ‹àX(;þø®ˆÏ¸“JÞëüˆcN'ÚÊÏ4ñ,»t
+ùê E=ož&=_õr,|FÖ©,ý ƒŠk¨8BYzY4¢ Äë* a‡ÍØnÇÎm*%GaœPÍ ‚õ/áô¸+þ‡Ñ%·¯£\ ÖZ]¾ízÒ=Dêënlf#hFØ=¡ó’OÎÃ
+‘4iÎ’Öi8{ù½e©”úwøÄ‚ž$)R—¿ÇÓRÁÎÜ„ú9ð•šÄPÃZÊÃíÌÊaŒø•ÜƵ-…[š9‰(+Ï*sË]°øÐ}5åÈñO
+nj8)ج•³a«7ýG…퇵=kÈ0${¦õæ Mr*üªøÜYŒ­ x\±Í!N:Ö@üîo+æ„,Þ1ù3î>813Úq}ˆ`ΕÃ=é­¥?Yÿ——lò¯l_JNi7\¬!BuÕ©uN†èú3éÌo‹ïS—¦R¶¾ƒjpôl'{ÖÙÿ¢¬1|¯ƒ@H›ÙÜ/ÊŠÞÑVŒ³Düó¤—?G¯Çã^AzõŠ —³JÑ“JmhÛ"q;äV&¼šß# šú)ÎÙ_s‘,Qôù6—)ïG0{Så«ûË›íN6N5‚Œ½Ñ=áCWv8µägóïïBõ¸"·±£y¿á¡z=˜Ž6ŸþŒüI`³¼j!„Ì¥ôÞ×XÖ¯4&Õ—@üûêýHáäÈj-lI2åTØ$=Ó(`ô~î+ SÛpY,±Ó—+BMöT&ì¥Ðä(ù±2²zùDWUœÖÓÅ uùÉ<øc–ƒ!ðä ŒÁ9ð)X7Í:îa¨—3gìû5.Œìs¸M\Þ†ªž:ñí'‰üíΚl¦ßÅ.Îö^ß-ú›Ê7\±ë¼O®Œ£‚·2Dï€$-;:4¶pîùÕ}aa•Í5ùþ™…<ù\n'âן4ÆëVsi´P¸ß}RÐõ´Òb,¹¨¼@<s.¸ð#ù
+B4”ŽîŠ’UÄ…ä´~iµs,±øXWPrZÆEÌ‚½ ÞÒ“õ&´Ä54ùxSìIrœŸ¿ãOÉ}óñ©&È´ä¶Q€'eùAæ…þ+L;Z9cŠŸÃçŸ$ÚÌûÌ8!ÑJ³5¤öŸ¶æéöÑðß
+*tÌó[—UØìæ¸w†úäæ…"qZ.Jœ^ÊùǺº±tËÊÉôøœ‰]D\<MØUA »¢)¦_4!yC|€kÓþˆ®ž47ƦÊÑ Š<yw›‘ÄT!ôaï ¼µN[LÃ|GöW™‘ˆ%ðþz™¹áÚ“þ÷¹¯J°7æ]»Ì5{Žó–Âo;bWôñ1ñ¾‰ñú’§Ü9f¤YWTèìÆ?c ýÃjÎï“xYzgP>Käù-9 $†ö’µW<[x´bVlNˆv–&¿ü4â‘•_Ê9~)5áE§ùUšÀ j}¯%©úÔJ˜1kô"oªŠ À)u¯ä¨•i\w¦ íõßÞŠ©~?OMÑj”©ñÃ$’Ÿ„\ÃyÉgʅȧ¿`„ÆœçJDsøÔ9Æ »ÔÜ …R8ô9¬ù/y¯¾InÚnøõ%/Ô“ˆåpøÝgF˜'Oœ…Œ2í´‡è=¿E4y›Ü:Ú¯Jþñè°ÁP³ÃÿŸ°úÖZß-„†tN¢&Š“Ta>o5ý Ì[cµy^¬€ø4ÅûIíÍ‘Ž)Ó5g¶.Nd™ÿFàòín7Zòƒ•nK‡?¬¡ôÍ@Ç…«¹%(„d·+ç(€z|´én®3Žø¼ ôíõv›T:Q‘¯ÊâþQ¥T4Ú=Òø1`,µå”EÌx©EkÃiB^˼í^âÇhåü„ š5}ç¾,÷Lí´;“y]AõL3å" íu0·Ü„k—ç2z"æFÅÒZëÛ¥Î÷àï
+í€û_d=­„6É
+9§Úx†ksèçhØ©òUVzl‡Ø2¼ƒ>Òʹ4°cÍíõ#GT6,m8œÍô”&4ùô¡T B…H^‰ ˆ°°Lß…Ü¥,ví¯µÇs~7œ 2Ïdw@ˆËÛ~ôÉ„óŠu¾1[¦œŽý<B˜›¿2³;+ÙûØ­:U^V3îø-êEš&î}PÂÑUñå´[ ňÑê–A9Њæ–ˆŠ¦ËjW)æèT„ª:‘†Û YÔbý?”ÿ‰Ãz$,C€!‚ñp‰-U ¹¶ÙÂz—Ðç8¸‰¢~:°õ=´?ÄÞ„Aî¸ÃéàÀþ¶WpÏÝ —Cô' Ï—ÔÅ´—WR.‹íó@t<bE´æÁâ±ó%E3tµMàÓ–ß#‚°V.%‡”HxôZ¹1ÝxžàtCX…“’É‹m¿d5'´u×X‘°÷ÛPl½+Åt
+ÝoÇ÷r"³¡Hci†aN¥­ /ó,N1cEjÂÉãvu?çxò8ASîPL€5˜\m (ÜGk`Ë£ ¸—ŒÚ1É룣®ó&YtןtÆá.†×òkàp~QM€ cõ=Û‚Â<•AÞÖtçxø?0l<ßíZ?õ¦ÊÝBÊF7·Î¢5w!¢ÆöZÅvÌÿÞ£Rˆ Yñh½®ÐêÍ­õ“1½= Ø«ÏçŸåÒPXÏ/äYõcŽ]l<!E}Z(R¦¦ýt"§w8äú©ã ù€Ö°Ål‰w•œ¹÷ˆˆºÌ¤ªì°Oça:H-$
+šu[ +4qžÁñ5lÈ¥ýB¬„\…ÑlŸŸç¢Kè:”Ò×칋x}öœ¯+ ÏågnÜPzÅî+câÏÆ:aZ#Ë=ÔÞÍŠøES'Á­\£Œ~ø¥/Ù,8Ñî@wA‡—ç›0ö,CŠèu°÷îJ÷{S’™ Œ`äëƒj£šÆ9Åô­¾g:ÂÒ•¥)À‹ ëÑ£Òƒ{U?…ã±Å¦öè‚›n€਋ZŸ:*Yw.Ò…6¦4kZ[0μw-â¡ÏÑC3ûg¶n s&íâ|¸«K
+7+¢F>å°ævT§î.”Òn±,Û€–»À<Q« î‹ÿäonἈ}Þ¶] þ„xþŽk¬ÑÑ <ý; Ör#,?;ØE®‚¿´Ù«»Oœè ÉÐÅ»YŠá<S˜`éÆN*ZC·´=Ø÷öU%è0µŠÔngl×…lÈîM}²A}–Ö–ÆûôÕSÜÖÈ~ó}Ø™‚T[Ïʼn‘áf.i(åíóaNxúO“)©çSéËc­ZÉu@<­§ó®*)¸¸JJ>¯…•pucã±<¤'À;ÝI›.Éf Ìx¸=@#î(‡ó9qÇŽò!isÎ@ëGÙXY§Ð¥Íf‡É²ž¥œa°>~ÑÝ ³ðì¡EP1h»BÈâgMð®É¨æ<U‹t€NPøsŽ{ÏL
+8dÝxãœ'n*Õþ`Æ÷A•b<þsT[-|:÷[
+ÿcßMkºª†ÈoxjÄß[/Y6¤¥z"q1ëÀÈ…f>ÝNî­xÁRÁD¼“ÒZhfbp'šœ0s²`ãÔúóÇo^Äo%‹<¾\ìöˆ™h÷Œ'²ÖÞ¶ö¢¨ÚÎD½ s…í°àÞª¦¦“ælÝo¶òˆ©°$"Üz<pÕçM&–©óBðâßÂdc8,QpZ¾"y‹ çÙz8+Ä+X‰kà$@ã™|ÿSÀ(‡¸“Oû¾|…U0Néþ9
+ýhSESÏ"Zw‘¥MáWùyvÝ=Ý,ä9Rò’Ÿºÿ«hR·ÃÍÀ¹%£ñúŠé{^A²mç¾
+«gåIÖЂE t¦œtŒh9@1Õ…õÕ¬;U¡zqPÙ¿¨Ä¿iõ£èíÍ û6 ”ºà3M±Gv
+lS«Q,3ˆjuØU£¸‘°ùx¢ãâåòxåÝ\‚t<Ííg••yp…ÖŸŽ\ß\_À®£¯¨Ø"´&£¤Tý÷"”C8±Ë›Ì{FÑI1?Ž4À5ZñŒ…2tœ(¦Kßì/©òX6ÖÉ¢•Ì· ü7ž¦:âàèŸÎhónù2g{ÁÔ—À24ø‚ë;
+y%'šº–Ð#¯Ä<ÅÙ÷<üx*Ø Ž$ïÚNÇÙžª¼nÚçCK‹"Ô=Þ·tè °#TßÕ¾ûZ|®ÀžÕ–ÛÖ˯U –ÑÆÅPD ¿Pµ¥ƒ÷|ü‡q<k‘¿·œd{ £öé
+ ‚ÏÜ);˘yÌC^¶
+S*<],²
+ðÃè4ÅÞüÉäì"ŽÒ+X½Ýæ¥A¦“5,¥O|H1¦Y'0
+Óyy³~³l–¦,ãö€Iá¨ãåöÙT.¨’X"\I}ªçbh¡¢ð ý6zЪ<ÔN˧ðCz]Ÿ[­§Ëø®†¸º\Ä~©ªhJÈjÉÌO=äýô¯¨ÑDl;dº8hql²µtoñëaµ¤úï:…
+€iâÝ
+muYBÌuµf]É=Öf·é&éºÛ<Þ¶x²Â…µi¢÷Ͼ˜IT¦Jº©›*†AWïÖ@G¡‹[Õ‰"Óñ‹ØU“x *_»èG'M¦^DoÕ»ò÷+ªO6ÏÔojƒ¬e§Ûþ•gÜ}§‚¶¥p¸
+Îÿ'½k?ât$í:‡” ^´^þ6T›@W£™íƒ…[ù–¬‰ßGÁºªwq˳ÆÔæõöÌÔ ˜-EÊ-àÜdŽå£öU‚é·4Á%™‰’DvÇøs  IýÒà#G€M8DÔ,B¬•©,þòA¢¿˜02}
+8 晽󗨓½ '‡¿K$.§m˜«:÷{ˆwýV·Õ—ûÊ\Ÿ³!{KˆÆÝ7fä–±9¹Ts^d¥u.Œ‡7%ŸÝô°ô-ú]{N bô¹øwfüâ}ž±È ©÷DÝ3ÂË`%)Eù`cªLccÒÎöiPKL0þÕ¸F=ùÝ^ïŒwÆDãϨ÷vÊS)ç¹îÁýë›l/KRÍ µÈ2öjæÄCžs4:èIjÜÕqYnÄû$’–0°Bvjé
+¹úxågC[Ö!)è80*²€R´ô¹’ÃRBÌfãÔcጠ̾ŽÓ–‡ÁÒ]F?¾pÒ.#†²!–°Ê%ËU˜„jßy¤PIƒ«tüèBjN©¬GœD£ëÚ¯I7nÔp
+¡š"zjú’=¤æÖÊž)áÖŸ ´ÁUä€õïÊ8/½DŒ>¡$/šÀV€û@Ÿ}5Âñ2tùs½ÿͶÎdàº-L~Öñl¬Œº]ë>f{›6P„Þ@uH§6Ä”{»½k†\f5òž£7¢¸rv¡‰‹^ð
+­M…Úß…g¸ë_9ô=âå‹YÂÀÃ<OÍáß±•|Ý}¦ËÚ.*]E?QœÜ»Ç É›)úNxµÉ‡`pÑ#…ªøEÆ ql=¡Êo¾‘×5œ4);†ŒÉ*²+iÍbß!rÀH%ÓÎJ@SúÜ¡&–f"ö)o‚¬òU
+Þ“áÛÖ‡³?–%žý è«
+Ž?.@-ËsaŽ*r^YKÊ›©é._ò¼¶üem¶åƒ8ÎÛ;Kâ*ÝW?FëT[Ó4sp«¸òÀZ@ÆÕH‘ï;©µ×Rv«·bîý6¤"Ð2yªí^³ÕºPí3òŒšS¾€-ÓÊ ¢â[r‹“‰aK[á=×öÙ\¹ÖÙÚd>L¶ç¯ªÕÀ{²
+p’X‹:·¶k@m­1îÚuÄbÇx˜GžO-â3~PÍ…£êMYbØlï›5´FÄ 7z7¾`.;Ù§½T,Ø|IỚ!>¥²ÝDåѵìk<–ëKÛ>ÚW«¦,·ôUßÄqG$­å7,W¬ÁÒj}‹áóÚ¶úÜöóÈ’Ô§r€’*Ùw#Þ"z¬¸.â&óÜ»G,,u[j]¦“Û×õÍ´¨7½ÑÅÙë‰só´©4œ úꋲ*’b}J¨#?Œ¤¼f¾KVµžNß_ïöºAÐvÀ+)-±Sø8ØíùŽÁ}6™ò‰8íã²OK•ž–
+¯{ÖZ‚¢3È‚X¤m‘‹€T ÎÍJ*2›?ðâ¯C•cAKÍëñWïNc$7ŒqžÊèDc=B;ÉÝŸ"ØP:J-K
+8ˆðXñuÅ+ßaDÕ^îÎùtû¼-¦
+`¸?ƒÊ¹qÝÌV“]Ï{è·æœ«©ØMÚVÂ9{ ”P$­x†1£]ÚÖÿW‚«Äš÷8^ý†ÅP^ý# l-CD|†N¢R¶ÖÙ¯kFyc;†Ë¥Ò³)©"\>§¢’¬Ö~þ×Ò'K›•Ç#3YÌ+ï¹F1‹S"K”ØBA‰‘ƒï>s8Y×cÝAv”†ÿñÏ*ʸŠg:ôÒ/r£sSØèIŒ¶þBæÛi[“êËyµÛýUäbE¸7_/И³¯á4ÑÂ;†ÚR"xÑGS}‚hÂ%¿±—êÝi÷Î.|®@ñGç÷Ý5:)HNK¯møù)‹V?ñÎH%áÄ3˜þªj—8(›iÒˆJĸØk5ßåYGªOÕS·`ÙS ¹©á° ä”àØÂø²¤»$8”:G*JÍ8-dÖÍÿácŒ£$rW~A~ê*¹­úÝ“½XP§N GwÉú>=
+̓߄7m ÉBÕwÁÆИˆZ¯XÏŒûk‰wEÔ4y,üÍËB[GÓ9iä¸Õ9‡ñp¹·tu ÷µL΄týG6ŸÜmêÓfô‡ j¥®$ýõÂ`ú•Mg\Cs+o¤Ž8üeD°Á>SàŽ†A¢»Ì•ûòÂÊo'd“TŸî6|ÂaRœ‚ߣ„¬.RÜ¡²v6ˆËQÉßÔ&n$ïbB‡<ÿ] ¤üË0ŽÆš”¬øh½"ÀÈþÁHO¦ïQêC–ÒuüùG@™ëLa¢ï'yÂwŸÏ¶mÁèNiàOYx³¹sï)¬í£_ŠC„Þ?ÄQ¾?óµH¾}žFãQžá3¾v²³CÚ²Ÿb[Ó×O=7Vª ¾<bß nÚQ>2:ï#‚r24­ä‡òýkl›jtÿËZUÈd6PWz
+÷ú*ü< `‚˜¸ë”ÜÙ;µjtñÒ«ëÂV§©¨ôJkÚÇ)ì’`ó¶åÙ¥¥q•á[fj„<9Ñk1PY`QÃ]eu¿J÷["W°ç‡ ƒ•/¸ ¹
+\}¼enÔ…ý‡ô².ó€½_¿ºŸ
+Ç(¯¼Q4ÉÖÑUÁîÊŸYSt0,ëô!¸„œ„Üm~ý½1N/o¢K»f§’Dx}6Õº6ÆpušâTÖ=A‘Mhv}ø è
+dÖ@$mG Ûþ>áÙׇ ó2hòaØÇÆ÷]Ê௓aAÛd»¹5E ©p…"…Ó,ö«cKèÞ¤á j´ÐÄdCÞ
+̇˜³‚Yœ›Aq­„G´`Ä)]ãi,ámêè3LÙÜ«J¼ú1|[üˆ;õ>À¶  ÐÄŸ!
+¶¾M’UŸ¿‰-ûì&J>RxÙýÌpÍDÊF‚µ•‹—·S»ŒÞâxÖ·ð½µ÷}€®?ƒ¯ÊGP³¬T-žg?¥™¸|½ì À&—ü]†Ò^¾ç<„²d<WíâiÙ«2aû†IBT°âúªÚþ—‹Öà•¢¡1—Å‹^ºXÒè pÖaosìëtJÞ51æí6”²°‡à!j¶–ÈÀð4PÚAÕÔ<Ý‚ÝÐM³X'ºW7ÒÃÏP?Xú´Ú- Îá+‹E
+)”
+½¢5~1”2
+ÃHW„lg5«3šÔ1l"G ,Z©£½šÞ¶¶-çšû’­°Ïaîî0š™`?ùBúö58ßRkÊGhŽÙv!Ñk;d+
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+29 0 obj
+<<
+/Length1 1372
+/Length2 8931
+/Length3 533
+/Length 10836
+>>
+stream
+%!PS-AdobeFont-1.1: CMSL10 1.0
+%%CreationDate: 1991 Aug 20 16:40:20
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSL10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -9.46 def
+/isFixedPitch false def
+end readonly def
+/FontName /YXBGJA+CMSL10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 45 /hyphen put
+dup 58 /colon put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 73 /I put
+dup 76 /L put
+dup 78 /N put
+dup 79 /O put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 87 /W put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+readonly def
+/FontBBox{-62 -250 1123 750}readonly def
+/UniqueID 5000798 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÎ僥É99>'´~ ¤}(Jܤ—×r¼¨ÅC8ŽmÀÑâÄ”G@G ö^û7°…+§©  6Ð}¦¼µ) ¹µžþXw4z<^efªÓ2þo¼ÎÑAx‚*;Öxu&=k½ K¼öä‡î­`ñ»<ZvfÝ®¦Jk{ CŸ¢ˆ‹ŒÃ’2»ƒ÷iZºð& Õ$‹ždœØ
+ÐÂ;ºvÄVzÎà.5íûr©ËÝ’t@pÃY¥ƒ”DÌÿí2”è 2’áÒ«Í¡sß…™ZJeêÕ_¸ ÀÇ7XŸ¡ õ™Æ4à]€§ßûaC;½ºêš{’÷cXaÈ'}j– &ÆGEE }ô龍ö}›1L÷ñ%ë‹ôÂiì/Þ‰Zb\H2Á¡C¡J¾·˜â;YøŽ½¦e CZL]×¥H§Ö¢ú–ð™[ÀûÏ‘±¡ëq&©$²;³bix8X0 
+¶ª‚ ó7…÷ªEâgæëç×7ÞÓQÁÔéDs?ë0£æø{tÝÉ‹F°*RU9ÅJ~²]ì€uW¶ê”Ãm°É!a½7Ïô ²±η_kã Úëw€=X†¼F\–÷dÁ%N6þµŸLÁ<S$°¶ö„Èê·´å·*êÑ &: HÃËïٵቲžã5(¡è¯<”£¹ûxÐr¼”ª“q˜µ­…,½‚džÌ'ÌF ý˜/g‹‡Œc¤Ømr5SÅá#Z+`f~%…€º©ž.ð憣¾¿=Ù$®å#,öˆ>v¢q×
+oYãp§¯¼ªhؾŒÊU%W,ÛÔ >æF aHòÁ¦¡IT°ªýÕø_½
+k\i`+ Ý¥°i3u.S}xâAZÕÝá°ƒ¹rÒÒÛ¼nÙ¨
+êWz×#xÔ“Ž ¢;cn²]ï…,òìdi*_ƒþS/b
+ö €Ãýfx-$ ÍðÓ ‹j%DhéE[Ú®hëVqÙ9Z
+
+A®ÖjTž[îTpð¹ßõåRɦiK¢kGUYÀŽàêÂ*÷÷—u"ëJ_"%H7-«bÈÐü†œ\É̇lÍ¡–ÿíLï‚VK=<
+…™å&¾kϦ¡¶§Ù÷¥´çÅâ
+¹4€änÖ½¹ƒœ´cQêbq$ñÒ%UŸéX¿ÑpÀª˜÷Ø
+ýýK |v§”+ÝD_Œ}™AgUoÕ$~c>‡“n?»à“ÞÓ¢ÐtOl²S`1N{8´@Dpäw`ò¶HJCƒfY †ˆÝ*hdùÅ3‹[¶¡÷-0ˆß Áë[85¥D«Œ;O›7_æ\¶”YË%3Æ/“;&i—æßÄ jã¼²J-äJò…¡\79‘ 3HMžƒØ<9HªœIŽC忼úê&E7A™nÞz0¨‡Ì³¹àÁ—'·¹!‚¸B”/’ƒ¹ðÎpÁƒOÀº{ÍlÁ¸hÛ9Úò–ƒ×™³éÁpjŒJXä÷L™Ý~p¾Ö8þ$¯ñó)O\Q¢z"hÅm>.iJ ‡Cr|ÜÙR-&$DdC/U„m‘ž„aë(Þkz€sU`ó=Ò›à黡c‰àmØZíwò:ÝoS‡ŠQÎå/¬ãJïY0˜M[&Ò^ïÑ"ŸþÂ×B²qy’#>ç­%oÝÅ|ÝÆ1á‚à„‚ñÙ¸<ÐîµÁ–¢Ïþ>˜Äd>ru}#ƒ©|ík~yŠå©8·4ÝaÔúŒx’?·X@öÒÖgXéžÜ†Z^.0p6D³Þ‘êx‰<S)ì.E-¹‰K[ÃD}èérŠ.ožŽ Žá
+F_Û~jìóKÞûïæÊÖíI`Ò¯V‹?®Z¢f'Ä™DbËdØÊ=Ûéx=©"·æ/`æ3ô1v+,žù‘81{,Úû£Û¬7Ôÿ,Ñó‹ýà-¹;É0sëp¦¯dU˜bz€’¥4©Fu $Ì4BíêªæR*È-ûMOÒ¥üe嘳߷ñÑŸ…ð¨<u2:åñ(ÏhêBYˆZ©éç#'¯˜£4¶«tg̪WÄ
+³îm3¢ÅBº£m)qƒ´$ðìT Ž½.HíI^à%Ž´É¶ã{·ý뎡“nzu5¨Í¹ÇXw CÔÅU²kÏ~ˆAøÖ#(¢¡]²¼ýÒC“½‚zs‰ßJ·
+áí»}º÷ÐŽ}°Ô] «_¤¥j§.é=J—Àê”íØè„šï=7£Îm= a”§̧ÆýBõ£d<™%ña[Ìà]¯‰ž}éQ;¢R¢† Å+~N?Ϻ:ljé©nûŽÖÖvî‹Q£
+ÿü`¼Þšt³
+—„ÊJ²Ë©O~›ð‹
+zú2¼V˜®úèiFð‰”R;Xõó@2j(ÀÌ5!i¹ô–ÈHšVg{Ìà…âP¡˜Ý5µ7ŽÒŸ¡1‰Ø:ߪ uÿ^(&l¹Giðª8
+&æX=@éÐÍ †*¤óíVÚàU[˜TpŸWBÁÇ`ÿ°¿!©ªÏz ‰I¼Õ:èg/QJEèCH¥h·Ð,AfS,]Q"¼kZî—-0Ã{~—p„îò‹~öpp÷„Y‰š_…‰tÆ.“Á~ é{ñ‡†¡K-ÅÂOAЃ] l²ì:÷$t»§'°Ò çh–3ʨîƒ&\®¡A•¼¸~£‰ù9J­äÄ›Q¨
+Î4UAYÕV2µ÷±*ðÖ–>†Ø
+tîÉî6;­mk¨‰½9µy:\ØM%0ݦ¦rÀÔ!\CîÎÛ\ýQ]4»OiúG¨Í@:@¥x7ê…mR__õÃÚ Kpv…cü¦4³-¤·ËÙ¾ä¶E†}ç'Tv¶—ݦ8ëý¥ÿÖˆÒ>¶¥Ÿê³8“Îò¥÷[#îûQ©Ày¯SÞ*Ag ˆø$KÅþ¨üAÄ\$òíkàýÇ/ñ'J\øTŒ
+´À%3s»Â#®>ÀyØLõ”3ÝaZÞL\–ª~EÜgü\\HQJdÒ A9……¶ÏÕó¦´^½hU’÷áçá>b‘ò,G¬-Á‡X5ó}¦Êá4ái>²j€KÎF¹×’€È’;VQ«}ÑÜ[ãÝY_¸4%žÁ<ÂÌ©>…y`zÏÆ
+ý(¿¼‡I”z^ª¤G{Réa_Õɽ¢E±Üí¡õö„ýÙž(%O]ÂàŽ%ÃNÈ4°^•.‹ï
+_ÚO{‡ç¡…k§Ê‚À„¹K—H¡ËàQ;(<’Q€ -3Á˜¾a6Å›ÜXü°/;)KR8›
+/¦£ÌØývÆû˵Ÿû1;‡˜‚‹ÐÏØdÝ©HñÅäÜ.OÁÈ9Íâ¤17Ý©ƒ5¯#}Š¤§Õ‚º]ûkÑ«=`<…Ø‚]¢ŠÇ¦6=,¼ÿµ×Ê.ˆ,Æ3ƒ’si5öeþáô(¨hËèÅGœKôû7ÈXŽìÚ@†®¢bÂUÈ4ùÍC˜êÒ[‰4òE2¶ƒ2<!dÚäH“7PKk3_>ÜÃ"u…C¯útÉLÀf6â3ÕÆ+‘Ó>Š²ne…\zÍ„KDÎÞ„ˆ¹R’lã:ˆNN E$cìÈϦ4-Wã¥×epi°W fxžf©‹› A_Ï¡7`Û&ž”õð€_úпܙî8ü{²Õ:Æx ¡‡‹À`6Ó‡¯!Rå:N ñ½ƒ²ëyœSõYáÖ«ç9EšMõΞpo< øŠ Ñîê-Ärß'ÏÙ~G‚éùz¹.fD>¸èZ‹G}Í`ùÓ©¡1›æýrÝô4½%>¹iõÞ0bn ɬP\!/ÕÒƒZ#³ä”‚tv+³¦Aðiµ×»yjO‰µ=oKAìAïÓX¦ó+…kZ˜ýpÌ8zËâwÁ4’w[ Þ¨ž¢î_¸thÄ^ˆ^^)@î ’oB̤ê쨷à‹8'¨n³‹º+@|—˜¯³¦cÞåf ü™lƆGw‚OàˆÞà›!b¸ðÈrôpËS7æ2‡iߘCHªRé³G#®ò¥)ÇÚý™åà`ÊAÈ/|מÇqÝüÌGºgƒnÑ/€ ¢?iÖ+¸†¸„²n*àíkÞ}dÒLe°¦´çXò:»,Œí 4w{½tª!`J6^ì‡Ù‹¤¥Ì4FÞ¢=èS‘=aÈöÜ5 Ýx[èÔðf7Mþ‰¦’Ÿ¯o6t|åAÎ|ˆhGmA=É]ÚùùY O,I 5º=;°ã«©8y$s) é9Qÿé\½©‡*ø;`¹˜K ýÓ­Ê<ZŽ;‡ÿ-ºí¸£¬n¤—×EGã)•d¢Ò
+ˬÏ%ùÈÙx~xµCˆm–£ƒÈì¾'ïäð HI„em wȦšR(µÐkUΡ  %ÔNaã‚°°ØRƒG
+6í
+í‘äø `ÓÉ÷c™>óµý§I%·v›hšö'‰pK!¯ÉÍ‘É.ë?Ÿvþƒ†z^Æ ê
+DWRþ‚„ÂË_<Š$L¡¯©*x„Å¡M»îe˜Çk÷»X_wŒìô¦Aª‰¢KÁñ<‚wd–Gf·œ:Ë iêšm/‹±fp^Å©õËÀ ¼˜9*â4-u§ræ@º6 “%Ïs¥‚IÍÀ@G Éͨ¯^Uqáƨk˜tæî¢ê·K6.£€¬†¿ì•.Ï Ê9bêÅÈäuˆÓGggù']¼ÈÁÀ$™¿È–ÊÅe$6pò1ÐDß$Ë1û¾],užc´9­Äï (ÉÄs\÷݇[ÒãÅà èĈ§=Êƒåº ¶;&úR@èþÜS<›5—ŽJ©šƒËzK÷~}TNëý+Ä1³-ùÊn©ý¯ÂÚw™k1àÈˇäØ¿ÈÊŽ5ÖÊÆK¹)¦þè—\šò‡QJ„Ó:äÇ÷ƒ]Ã\q™¦&
+.<–®ÉwE®x´r×[ÉIþ(§·QâÙ%)þ#ɲù.ÓÍÞIóÃ#=,âUc1ÝDö๸@\*%c$õä»á$Õï?Ô´:ñ]½mƒ$䬼]Úì"CF
+Ît±uvàÎ ÓšG-@‹ÿ}€©¯ŸÒfiíìG¼Ðz—`'—7—#†<m´<I+tŠ±ËŽgö6 Ê’•—’U6«qr~õQ×ÚjÚ-2P „7äñI€XÝÌÑŽÃvÃq~l•r tj‡Iß„,‚Ÿ7UøpwõAzáëIœÿñ™˜”óyGBoè…E<ÜmTr›v¨ 5q?ˆhõ%REƒÕ€ü1tÑÙAÇÕÑQttà0_˜Ís
+IûqÔó鮈VºôºÁ´ÿÄʵiµ™O„üï:áɳ¿Oçæ£ÿûê"Ö?;¾ 0CCbÓÌ,zqe~ €2\øƒ÷HÖU9ë¢ïbµw„ŽÉ–Áÿ¤eËv_t1\ø6G¬ùð‰å3ÂÊ—–ÀŒ›ùcÇ ¬áAòJ=|ûƒ£¸ƒ]Z–O$‚’›r}•¯iÆÉ}Ìcn1§SÆ®J%üþ·Ý?bFR²‚ž9‘]îM‘Òtå‚×ܾ ãÇ"ºÉt½T“Vx†KçèYÚp”í,qX£Žå¬)ò°>ÛXÒÊ>͉ š€©ÁÀHŸc{•¢rÆ•L\+'Ñ^Æë+ÍH;iŽuÖRßÆ8èÜÓ_Zp¿‡‘y®èÆÛ¥± `:‹rL‚ßW«D^ù²–뫦Üðèå@ѳ|„¿ìP^Åë¶Åã‚œD?ãýÐ.’’aÉêÖÅ{úébÿF
+ÝꥹI °÷/LÃ’†ŒÆÏ“‚a‰3#¬KxÃÞdiŠ=3h²p„ÜÍ£ ÏýÄœââò‡àDïÑ-¶ªDOö ñ,ˆJ¼Ng"§…¡{@°Ä §V°ïEx
+Le·oB79¼ Ç¡¹Ô]= û’E’Ü&q—ÅÀ£ÌnMÍ<íÿ¨ÁþY8é-}¿MT'—2y´$É‚ÑUeQ„Ç%ƨ)ì
+häɹ{äÍ¥ä«UtþÔЈ™z²\Ƽ "ž)ìlrR…‚‹U†m9»à@ü¾O|_µ‚ue'.Cá¶ê¶Îj ‚,ì´U3Lwä‚æ^¤
+. 2*Ìj>1z1µö§#ˆôñ’t8¸v.¢þ²{;‹übCƒ¶ÓaÐÛÐë-§Ô'œ]-Éh¶ÒóÜÐ\âë渮&v/èhÉN6ÙHads£Ñë÷ò!bßY¬çf-—ÿäMC”ë¥=çòë.f$mÊîL£É´|꒭鉴äW[Ã!·¡Ïà¹Äø“˜ FÏúé¡ÿS …Mù ïÈK¦rCdÑyspLCÏQ#kBj<îñ¯e¥Uw««ÛD¡Êl¹–= @À ¡ý¨¯KååY™×
+\Š³íâÀËÈ[-µSR;ø”†Îó(·ëåäËɶdµoe\ÉE± êK’iî$‚SçØIãPðaŽòk~¥ÖI©˜›0‡æÝ×úáu¹Ìo)Æy2^~Kóœjh6»ÃU
+ ©nûïãþ
+}ó‘NÒ•;ÓDR‡êH"t€B—)>ãu¨ìÂaï¤]¸ö.d¥Í.}œ6Þþµ½Ò†èÎ2é\¬áªT˜lúÑe;^Þ¨©¡¨"l䌙~¬ÛŠL¾vÝåï9ÜîoL ¾`qî´ Uuˆ!©æÙ-°:UCë/p³$Pfö¦¶Ê”X²æ¸tsϵ,'ü#ýô…Æ-±‚[úƒA•à~WMä\ÂÀQ‡ø4ù1lk~%v—±õE÷x{§§Å‘¼Ýïléî>pOâ™Fj¨R'Ït?„…ôêUuPjh¤•0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+44 0 obj
+<<
+/Length1 794
+/Length2 1508
+/Length3 533
+/Length 2835
+>>
+stream
+%!PS-AdobeFont-1.1: CMR7 1.0
+%%CreationDate: 1991 Aug 20 16:39:21
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR7) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /AAPMXE+CMR7 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+readonly def
+/FontBBox{-27 -250 1122 750}readonly def
+/UniqueID 5000790 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+Ü?âÙñ^'Ë÷þ‹˜Ä \!ú‘àYòù“"þÖ?5šÉÚ—®Ãƒðgò>]ã1Qè
+ˆ«PþÚä¥Þ“Á®/Ü aP³rF ‡Ë#%¦ #I*㬓NîfZ‰Sýþ†¶çbQË%­ÉgÓйåâyá6«"´ÊQ –CB8:„ ïÓ–§(jÁ4ätÿ.xJÔw5†M¸El¾B3$.³´G÷­DMÁlûi«Q[<5yðèGH™×òƒ=¶çojØÉ$S/ZûÏÙ9TK·ÚP…ãpó¥mûÁzIÃsBkÆÙN‚šŒ¿ÿš%Éâ‚:êç9ð ©ŸŽ`” $ãÄ…*iÖSͱzØì/@|K’gQR–Gйòaã•dÇŸ ×š§ÊóÐ…VÆoí«ÂxpÊü
+Nhi"ØxOªÔN&m6*fÎUòÑפ™µÚUfŠN¡ãu,±W8½wØæœr„»AX.kxB«`ò‹¶Q.ÞXp5“7äݬ³ƒkT0Ñ$þЛžè†ÉΒĘ~™äÅî`ûútÈ“/.Jr–^4O:/‹RLSè{Ö[€‚³ˆ‹‹/®÷p²`|Å
+é)´¦à5C9aı«žÛ²Yi|"CÕš‹Iœ£,ûóràë`«=¡ß(Ê9Â;ïÁëç€≯ cWAͽJfþ¨ìÑ•«F/ú‚MñU¼¢hÉÛ¤Y8áȱpî\#ZÙPŒÍN¨º.Œ™lÅC¬5Ž)5"Cu³Ÿήp¶Ö{—9m€YÀ–*8§-"oOõd*8°‚={Øí´T%€mUûPí!†¥Ÿ+4Fš&–× ~©õkëJÏT…*À7ãæÎÔkÈ èž½pfÚs•×p>føX'€[­)óqn©2òÇ:ét
+É‹Ÿæ’‹ðl{è[ƒßHq§½JËèoŽj‡
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+47 0 obj
+<<
+/Length1 1031
+/Length2 4023
+/Length3 533
+/Length 5587
+>>
+stream
+%!PS-AdobeFont-1.1: CMCSC10 1.0
+%%CreationDate: 1991 Aug 18 17:46:49
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMCSC10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /NVUTVS+CMCSC10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 71 /G put
+dup 78 /N put
+dup 85 /U put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 105 /i put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 120 /x put
+readonly def
+/FontBBox{14 -250 1077 750}readonly def
+/UniqueID 5000772 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÎ僥É99>'´~ ¤}(Jܤ—×r¼¨ÅC8ŽmÀÑâÄ”G@G ö^û7°…+§©  6Ð}¦¼µ) ¹µžþXw4z<^efªÓ2þo¼ÎÑAx‚*;Öxu&=k½ K¼öä‡î­`ñ»<ZvfÝ®¦Jk{ CŸ¢ˆ‹ŒÃ’2»ƒ÷iZºð& Õ$‹ždœØ
+ÒBqËì‚¥ÊPðY…´4ìÙE1´¦Qµ³¯Ëe ±QWsz¤8oRÊò­½\b¿;\ÊGR ˆN»á²Ÿ•IN(]ê/áXÁZ§DÍÚ
+I«¢ê·¥FÞEÖÁYé{Ö] Þì'h…Ë—,$´Ó±¢Ô½sñ½™‹Rújô~¾k;lêUk 0>”Ô…`"ü’©³v?À þW†ŽKº˜wyçJ%X©íÖžAeLþ¥ì%”aƒC•C£,‚¿³§».ù…×Jíe
+b½ÌMÜÒa”©›$mm oÎ{—ŸÄê7™p¼lâð•ÃÉï^ ào2ž®ç’#„›D1è2Wq’(ã–È€ºêì>Íô#N†8DžãØV0Æ«…ÈP0
+MHÎÁT¨#ïv£üùü´—ãlä+tEª¨âç8VÓÖ‹4h6æõ È:íP­Ñºxê°øq®¢ÛYŠœîËÄ_Ás®\»ží# 9‘úrOâðÿ÷:„sœ‚Ñùè+¯Rñ+ý6  3›‰fPâpÕƒÕ©àkOëyé÷.¸ñp®¥¦l28ïO-ôœ?I_Þ,C<¨ÇSbãîDnxì‡H*ZkòiK9wàÑ–kÒV‡Ú£€–ÇðóO×Þ)íU0î`7YrËr©î L[|e'Ž2*¤äðáQi’íÓ/GjÑÃ(—øÖ#=l±:…S¿q™jÂ6cñàz™±Ï@×÷QQ9í ²‰óF.*VÞ§ÿò™Á¼+êÌÞƒŽ…4Ç4Ê\óžø¦åÄ&Ø•UрėՂnLÆÑÂl|ø’Ât§L¦oJ¾ÿ…†¶TŸþpÚ‹O’We3
+؃Ñâj "ol1pà¹yªVo–lQ
+V©©ŽU»k{ÝmûÐ ®Ü‚dõ¯:ÅCï€FÂÎ-_9w 4¹÷¡$’½€tG®k;•u¯žàý”H¶è—R,¯K7€Ç$¨R­.9ÅrE-d´xÍà,¬ÝcÇýŽWiÉógWq­åän  `͹!vDhY¾gmúrgÑ7s”þt ’ÈnõŒV%û¨³6N?¾o±›ÐúEÍÝÚ¼©'*/•¸]–\J²¡Õ5û†çGäXì´b6³#g6ØøÖSZÝ™\I SÝsÔïlÜ‹ŒT„4S(½ÔÏ@˜Q¿ížØS”¹ 4¨êˆ,š¹ˆQ†É+§0
+rÆüW„“í|Ät'ÈÉÏ4=ŠsÐgH:äƒ@å÷ïËë`BZP™èŒ{NÅ1xv×]›¥€“'#ÿ|.Ô½
+ü”o‘ù…*­“Ê—¬a$ÝÓþg))\߆žåc32Bu”BDŸ›,.}ìQ¬!º0wF4dt¡<5f6šÚ|à7r>0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+50 0 obj
+<<
+/Length1 1312
+/Length2 9001
+/Length3 533
+/Length 10846
+>>
+stream
+%!PS-AdobeFont-1.1: CMTI10 1.00B
+%%CreationDate: 1992 Feb 19 19:56:16
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00B) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTI10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /OXLDNK+CMTI10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 44 /comma put
+dup 46 /period put
+dup 58 /colon put
+dup 67 /C put
+dup 69 /E put
+dup 73 /I put
+dup 77 /M put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 87 /W put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+readonly def
+/FontBBox{-163 -250 1146 969}readonly def
+/UniqueID 5000828 def
+currentdict end
+currentfile eexec
+€SQM(ì(Ú0_«&(‚ÓÿÒ&”{ed›S>µé㨊‡þ˜y¦‡• &öGÖà‹ñM˜>ÑÔ¨Ê-¨Ù…ùD.¹õ¶í—¬|3áãj;ô`ÓLä_1‡—ËñŽ8‰Lô¬8ëHÒOã¾{ꤣs‹H1þYÖÙÎ.Fkbœ{¢ùÎ>Ë¢ô;Áb¥ wÊ(‚¤*ýÎÃô·[]c༎]ÉRWvmŽ¤g­œºô{æyu€Ìíh„³¦pÉO߀ý
+N›[ü!¿ Õ1âeåÿÀTÝNÐ×NÊ ç–pAŸ’à;ËþìóUMf–öòžÑZ% ‘þz‹n¥0GÙ{¥dXšeÊa‘)ñâjÿæÂ/ 8TŒã~ûnž›`µZœ´EO×Çù//”7–‡«Y5¹F¥D‘§sœ’iàñûH±)‚í³½QþeitÛŠ}©/OCÜk6im†Ò6 ³a‘ÛŸêré‚ËÅ8/iÚ7|é@ˆ¢§aµo9„g Wó]ÀÃwà,‰Èrâ.:\q#Í'ìÍÈs’©ýö;´·dœüSï“<etL¸œ»Ô7ƒõ±Õ‹
+½Ü™ìüÄL”VR¡›Šüÿl˜½È~jy
+`ªØ÷¤ËŒ¿ø«>Á ‹mɵ~|·á¶fE˜mÆÉsopzϦ‡àJ‹Ô‰¤“9EûwR/Mò¥dyýN¡tvqà2EºÒvcÜ2­å‘ìW¡AK2¾>ÜVÖãTÏ”Áד©¾àdliÄí"_A<úsù) Ð¼ì•kü)ú{P ¿ãŸ†CŸÒEFRÀ!=3e븣c-3Š…Ò+¿™ÔâjøõéßÔdÉÏ$ûY¢õÐŒæi v„ƒQI(«‚?3^=^æ¬x ~‚ ÷Ó®ôg«á“þkT¥ãcÇyZ»>fêˆ=¦
+?׳ÐYŒÔàÓ¬Û¢ì—á´ˆýtË_ÌÐú/èv4v+¶*„0&ENøaט›fmµGNð‡;@ó²QZ #ú¾6A\e_&V¯Vzc¶ðdc"P槾ç­å¤þj¦Ï…“½ó6ýÃøk˜ú½ÄÿÜû– (¬Ì8ë&ÏJË.»C×(â=+:÷
+À‰LM}Í3ˆÿ7ÏO¶w?ÂêÃè) • ~›RýÕªòB€õ ¹Œ–S#:"\$/dêtß&u³lÈ<³ß!ÁxÓ~4,tgœN®æ¾ÿd´[™ŠÊÊ ð„¼Ükà]9ÊŠ+èb·y%hLtyÁò»š¹L‘9ißóµâêÌ@!‰bM‘g^ôºLZwÔ³glHÔð€
+~
+qèC\€D¸µßßQ3ôèpT7ìЮúRši—FržÌIæµÿð[Òû]/R' –kH ‚Ûþˆ©[µšt€"Sxh\’¹…¶D ^º>ÚÐPÇ‚!¹¡sÙ#ÁÕࡘ̷m&Pùs;ãX\û[1ëBÍ»ÔRF`èNÜ…kÍÛA[k{ÐÏ %
+ÑŸMAAËÃ/Êw:™GDæ¸z;`yxõýqÎ&­â/âÙz¶¨V¢3úÓ…JúmAaCfÙ:ñ}y³óüÝ9[9Iì騺݋ÞúrÍr‰ èû6!J¯|§À,£1.ã[Ú?‹<v#¼p~LŸmn>¡£2wñ÷ãòt¿ZIsÈù§ªNoBKçÿ—wˆñZ0Iü0úyU=«Öœ¬â ,¸ÓÞW5¸`ê“4gÑU|Ú›šîKC³p ¯“Æ¥tÍÐþDà”м§!”ÄJQlGµ(Z³Ž«
+¥j*²¸·%ò5ôW¼çBg$;¦¼‘ƒœIÅÿjrÞ¼Û*9d§©âàÔÊèÛÝÎ~Ÿm‰²Û‹›Sq^S6x¼ªÔå…©Òì%;v§W™LšÃB•k)æ²h¾¯ööïêv¿îˆf ûýÑa˜T‘9h "ÌælžZù|
+η#ªnÄ‘xma§¼ë ÍÔyÇç¿*õg¢(þfuÄâq»@ØUÏçA²¾a°³}d ÄÒ¹ïlŒ¾­ûÙö\¯Ë“ª:”°È0V·ÙåQaô
+:ºv Bô¬}£Ê´óڈ׮U‘”“”QÉÀ¨Ñ7:S¢J#øËpïvŒ&/YŒÔ äÒtïcÙ?Už2Kn‚:ù—,, ¢D?­¤ç2ÇÎXëB…÷QÐ
+/‹K7RqSR^e7#~U ÍÓN[UYPN7n—£u¯)Jñ;ö>³9ÆÈ”À©ÔÒªðMÆ
+"ëˆ6Š¶•œéHå2$€O6?t²A—qØ&Úüõl.®ý¤µDp ºÈ&¹ J»MÜŽê±fo2Þ}êέQ{™QŸ2àÌû§èYÐà
+˜²ç"bæGùÒÙ*ÌN»×†v £Y…Óí@´à'­£I3'ÐìÇ2)¿(}ÅÕ5×¥R)í×^¾9Í_«4øý:Í•ø.œÈè ™8Õ#QÖŸÚýêBf«S ²Ú ÅćAâÒîi>‚áÊ ôIÿt«
+ª#ì7–ƘB؉Ål7ýcI‹¼~“hö‚Ýüpª±2…ø²[eT_^CöÚ€ë'ñø¶q@³ Õ:SùÐí6èÔØN±É*¯ß >yø±n£ÜOm¬- ™z àZö´¹+â×?x«
+Ø çd_ˆÍAÂVü,­ òّȵó4Î9“C­£Cy3=qèIRÀýiËBð¼¸qû~Ò =ÌÅüSªÏf'š{¿æw'Ð%¯!'ð¹çìpžr–€=@ý…üÁ›1¦ÿ¿Sâœni×––Ë"Õ%6x³öH pŒ]ú#
+´$ D9ûű³Öß!Îr&Y«Á’/lä®/\äV®iéŸCNbÚ­­ñ·ä´ÒY”]ÐSv0‘ ¸‘-µÖó NƯµ]ï#Þ]X8KÛß©÷H¯É­!°Ñ:·rˆB–[éÛê—@©`ž!Ãìï x̺ÔqÎS¹…Åà ‰U`-&¥V;ÆrëÄÂØ,®€ 7˜›xõ IÓR4=óÕµøx-_áZÏèðFXëŸÓò„Ô VK´oÞB0 IDÎEðxBN9'*}hrG-š^©â *û*ûÊTA¨µ}Lä‚Ëל
+ù&Óà‡[v'ƒÖ^To°Õw âšâÞZÁ–j
+É.ê({@×YÇ“¢çåë¸@‚ò© ¡³­—¿ËŽç´xóG}© ˆú*UjLÉaÔÖéëûB%lÙWá3‰¬ ‹3¿èdW[x X¸>¤rBÐ×Øàk3Ëi*ˆCÚžíçl03A¾´ 1T9 ñ•v^u„mEY|Yà³3|Û<E›½Ñ~‡1¿h‘“·ÒU@ú†:z…Pß×MÇ0ªŠ±&šƒ±×Áæb¦á Àltæ?(?}K®›µÚK ƒ)º©=zZKœÙÄÊ‹zÔT‡“m‡»d,J^<¡S›Å¡]/&Û™-mܸíÎwwålPRž5³n§ê•<iȈµu÷.1½ëF¯˜¡Q=êKUïÃOÀ;!ÌðíÖ‚zÃÕûX«üIËlpӜ½]þô…x§vŠ›SCf,·nŒášP¿›72HcÆxâUƲ÷€,è䢥ôï€èFª|o
+œë ¾ëë5ôP"³7$ïÓ¤”ˆ.›n'¶©yWp -Ëȧ"ÞC9ìLsDÃ/ÝX³¤œß缯
+ô(T{‡"|/–4cˆ
+r!Ï›Q¥ÿ}ˆá_lÉÚUÞ0.qùu!w$¦â¶øØ(&Ÿo»·*ãBv”ÚWàšÞ—ÏTgÔ%RÿVF7A2·Ä˜d¸6LyÆl¡";]õH ק£¨X© ÆhxOxbï#üÿŒ¿0`ã£Åʳ—õL³Á|€þû¼XžàGÒÍ
+½:”ü@×ÆG;R¶TcéÃ*­p$%ã:ìjqã=W(uHÁXm‚s¥B,¹,uLo?j€ä)
+ îëNVÉÌá|¯®hÐJ &ŠÊŠüiWÓb˜EWeÆÕ1½Í^(ú“̈þ„Å›PËO>à/››æü°¦‰Ëé6Fî\ejb¹\JëJžlSŠöÝGÌ0cÍG›£j¥‘>°0­p²¶›±FíÎßµÄPTü1s!kYÿkèÚ'>Dttiø´bûÈ9>Èò—cÖxf$ÚÕ?$ E;‘³ø´Ð”öw„Kò½[G’wÎX¾>q-–T‰EªÛI§t=.~/îè0ÚÉàCx"<TAÁ`Ò ç·:øàU™RgD›‹–ïæ OÙeÀê˾µŽè=.…þüúf±6dï¡ÙhEÚ$ ™Ø:öÕ?øª ËÚK [×Sä#É
+&âÇ
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+57 0 obj
+<<
+/Length1 815
+/Length2 1173
+/Length3 533
+/Length 2521
+>>
+stream
+%!PS-AdobeFont-1.1: LCIRCLE10 1.00
+%%CreationDate: 1992 Oct 23 20:21:59
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.00) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (LCIRCLE10) readonly def
+/FamilyName (LaTeX) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /BMCYBZ+LCIRCLE10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 8 /a8 put
+dup 9 /a9 put
+dup 10 /a10 put
+dup 11 /a11 put
+readonly def
+/FontBBox{-2000 -2000 2040 2040}readonly def
+/UniqueID 5011942 def
+currentdict end
+currentfile eexec
+€4y‚«9BÙ0ài§ H1uÉšFQ}
+d7Â‚Õ K¶£•ÀË@Eì¡‹¶`ò{+Z°Vg®|Ãç¡öHÞ¡Š'Ð ƒ8fd]â^ÍšÀé.(KŠù9W>zí ½Î4•íç¬#äÞ5^²¤ýxÖ¡ua˜Æ“tñ±æ
+ƒjûçc¶g´;EÈW Šþa“MÏ.¤· DÈeöOv^YµÑY„né8o1ï"xÙPÄ1îY¬?¡½6¨ÌäÍ?Avý‘ƒ›ˆ©ó 6 iK[ðfš*a×+ føhBØAÚ”~˜‹¶®X³É²hÀ¢3-„?þ[ë3^©~©L—³[<²=@Òëí¬Nbfó8«WÑ檢E͵¿¢óóÿ³îíMÄàZ7EWG°õíDF¼àµå;Üâ¨>.H?h¨3fA‚ßs<îõ妅Ρ6€&ÖË /—a¶DôZOi_lv4®<í{úÓʼ@ÆXÓC¶ÏeÀ« LÇË –^Ö¯±¼ÎˆØšÞRàÿŽárò*+²_•üÎìøóÍ›–*eû€zà$çùÌ€^Ì;wMĽž@Zÿã:¢¸ MÒùù–¶¤©€µ¤ñ궉5,gE“'ä¬ÞjVwzÀ€-ÂÓE#Tf(¿4 ¸K’ɤù9Èz²Çq¤Î¸¯>°E+nhjþbˆÊ0`5¼îIíÛ å3"[ W–Yʺ)…·•ÐÍð9jK&—ÿ¬>³1צÓT`ÓÒÞ†bà>ûü9É¿<\\C©BÖxOZaÜá³¥+óŸ·¼¨gÇl‚• –7„)ÎCá¹ìŠ=.úª$n›ö6-ê¾[%|‡e ò™¶EfsÜ‘#œ´‡Ôhb*öÑáf=q€Nmò´¾Ø'@ûU
+²CUž×Ìcél‘ê6{‹™¢í²sPQKX[äà›¤XÀÉ!kC2¡
+ ¤;ní0dç>1þÛ0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+76 0 obj
+<<
+/Length1 881
+/Length2 2369
+/Length3 533
+/Length 3783
+>>
+stream
+%!PS-AdobeFont-1.1: CMTT12 1.0
+%%CreationDate: 1991 Aug 20 16:45:46
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /QZZRHI+CMTT12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 99 /c put
+dup 101 /e put
+dup 110 /n put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 120 /x put
+readonly def
+/FontBBox{-1 -234 524 695}readonly def
+/UniqueID 5000833 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+²ìN/OçPÏšiPdXè‰baÀ±Â“¤*¨}äéøjLœöŸºq‘ø®Q
+L¥‹o=à'öro2t=Îs•ÂÆóÂÞíÜúŽí}¥mÖ¼Þ3Ÿ÷¦”vIä2^Éa²ß­Ò­Fñ‡ûÖ>ìbÂo´jfj ˆc‚Üë©÷ÎÝdÝÈ¢ñ_ã@v dÄoëÑôÜ7®Þ è¯ËŽJÚ - TºÊ[ç(«‹ó/× )ªò}eŠhôT¤¿8oc"MÇð¨bOk†1šN/Ñxõ–ó² °2ê(ÁW¦ŠiúÒ¼ˆˆXÒ(l Nða¼ 1Eò£~¾À?QÞ|Ú4Í—~°—X³¤–ôšt'žóÆ2-ÅIEùPbÅózQÏ~¯Eò³cK-}ì;)ó[fÍ0 à–öƪ+ðLJ“aÁŸ<g¢“oü ñäi€²›õ@GÅñúHæv§O¤43„ø¤›(¹Fá« ’Þ[¿Bd@­#Pl¸2ÞÆMa†œ³Mé$ÒÂn@K}½›å[œ Zã \Òx­»Iß„í-sŽ]œ;šÁž,å6l–dO[=>êXœ®ÛXoÙ¸ôß2ì‘›t4Õ»å~‰.°8V}õ¸¯ Ú^’Ejó``’æ×ýÕ¡4<=ŒØSÄ…Ã7ÄH®¦O1ø‡'V–£'.
+à«°Û…Z<“Ûbgß3¾4£E¨4ÀõpïÄæ­›ý5?$ø–æ
+Ð/aûÍkž›ÑhÙ¥*!£Õg…ÉÆ‹îýB¼Œ©Ö×æÃðÝ/iQÍÆ5«Ä Öô®Ò\—çi/Bꬵ0Yˆ\‘Œ’›¦””¾A!9Âôç1X%Ô<ØΊ\óËc¿¿7ÕéæöÛ&ÇŒgŸ¾Ç3Øu‹ãäÑÔ@“¾ÞZõ'Ò0´}Ë| +<s}m„h1+ËëüN9’™T>R«A¤6Šˆyvøí§Œvq¤^—óõ£”eüéŒûÕ N[9Þë;!1môž5?:lé‚Q厬ø¬W›å&ò<_JôüKÂQ…Š¬-jAR­îIcœÉÿQíJ<¦wPb´©fŽÛŸHg 7du–×zNºðFª”iÓÊL ϡ¨*9#‚½3¿ÑSQ*ú1!¬OHC]V¾gn3e@LAäA>ŽÅÚ
+9`œ;ÛQ z[Ò&óÉä1¹#œ,1÷—Çh=šuÎ ;Ý —ƒ )û5x8
+Âõ}!vg|õgÉ—æ_¸¬¨F•3°Yó1â§ü¸WЦürŸ4ß`áÜÜq㤴²@§Òe+b'y&Ýeº“ ì(t“¦Ä~~ ¬Ì<ßbYßûf^pš1àö·,à¿ÍTÞ…›”çÊ^Ù©®(˜b\Ä„ÿéÄ –ÅO>Í‚Ñý7pŸèXçD1†ÆëÍ$Qù#©‰Æ1JªîÆK¿î_ã¤.~fG “– Á¯àx—(zaÄ.J ÿ\6ûÔ°öë1»4¡î†Mt‘0+´ÑôÛ ýzšMÏÑ}§·»k“A>hKD7^ ng•Ý“ Ú£ö€ v&é¯ÀÚ9aÿcr
+ MP:àðØ_€ntßå?1ˆtNJ s vKi56ˆœÆëqµT•¥©X$Ѫ%u§™Ï†ÄKo"Ò&Ìÿ¦ù¦9«˜]†G.IS¡Z mÄCÈ{= Äô]Ò’ÓÞAŸ{'3¢0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+95 0 obj
+<<
+/Length1 810
+/Length2 784
+/Length3 533
+/Length 2127
+>>
+stream
+%!PS-AdobeFont-1.1: CMSY9 1.0
+%%CreationDate: 1991 Aug 15 07:22:27
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSY9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.035 def
+/isFixedPitch false def
+end readonly def
+/FontName /UJKJVH+CMSY9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 104 /angbracketleft put
+dup 105 /angbracketright put
+readonly def
+/FontBBox{-30 -958 1146 777}readonly def
+/UniqueID 5000819 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÈÎÙ°š'Z²1NÏ‚“R‚oN—]ÎÎÇ+,󡈙ÌÞÙ5Ð; lƸ<ßO#¹¦ ´™v¬32cÉÜïͽL„í
+&PÒáâ‰ÿ®É@Яçò”ÁÄXiѬ;Ïâ®M§$"T•ñüŸì`b‰1onqšJâýEî†Ýðz€é¦&»CÍýªÍ ‹ˆý™¯ ²k\Új?¨ZÏ΋^볈T7ŒìÿÚÅ&QOéû(®b‰º”*>·Œ:ÿ€Œô¥í¾(1·Zzî f°T—¾ö³ËÁˆæ%º€‘°¥ýÁ“Ùi²h[½6*Ïõ>&µN}ï­û“+P]žªööVxOÈ2Í]ÐÈ×ÀK­#&ßþ/h ­oÐo€oÿ?f„o#FK$âb¶·Dä¸õ4®Í—§?uûʈ¶ý”ÇEL8Ë%I¡™²òr ßÍÜóTƒ{LÒ°>Ë5—1r˜Ns@cç)B+±Ñ1Rˆ­7qÚ³ÏññÌ:¨L°;´ Ǚ՗p+ÜRRì£È^dîÁ+™bÊõIÅÞÚåãœæ®ÚÉÜßn.gŽµþ ÅËA¦¢Ø·µ®±RƒŒ|E™3çý /#<Öü/qè<î¸D|©41phP)34›«ÓVWÃCÜÃø0U(&Þ©/>#Y0”Aúb ­“=ÿbÉŸNh*Ès ë¬ßèÛzÉ'ɲßi¡ÖTM*3VБ\ÖöfC7±ÑÝîIý/hiù¿â.š†ûpú8š4ÄÅa©Z|6¡Ì’'‡jnXã@9+جìÖl¹Šš¯v0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+98 0 obj
+<<
+/Length1 833
+/Length2 1926
+/Length3 533
+/Length 3292
+>>
+stream
+%!PS-AdobeFont-1.1: CMR8 1.0
+%%CreationDate: 1991 Aug 20 16:39:40
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR8) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /PLCKEA+CMR8 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 45 /hyphen put
+dup 67 /C put
+dup 69 /E put
+dup 82 /R put
+dup 84 /T put
+dup 99 /c put
+readonly def
+/FontBBox{-36 -250 1070 750}readonly def
+/UniqueID 5000791 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+:–|¬p§£[ˆµC#´\zC)‡“Œkí­;r­c‘‹nZ E~ N¼ K EAóEì6zè\©½$VŠÓ¹ø _t æÄ#ijÜÎm¤ÑÈšVÐxàÐâòb¡6@ mäNã†l4qûXþßZ;w)Ee½×&}9¥Nqqu-½æ:Á›´³é^µþg9 ®MžÔצtCõ]άٖÁõà#Éå¡Œ¾ìà #v:ˆÍ×Í8çNHI^ÇúR9ØŠË<‚buF›h
+ÙCH+ò¤­
+í@ºëi #;­6´Ê--§2)VÇuÑRe5
+›°Œ1L –5P|J~ç;¶yÙ0àZHa)ï’ê-%êP½}ÖEr7CLLª)”CðzžØ rŽ#%^ð±œJ§ÎÝåÔ- (XomMj›Tw±™ËE½HË}ŧäê‹8„£_|€¤ŽszÅ-–äVÄDá@ßN!ŸDH;Û«ÚÛÉè'GœÂcTíðî{Ði‚LÌÚŠœÝªˆþuÞKñŸëâÇB·ØâUºàTZSÈC>Mõú[hMÈ}󀘟-ãºO;™Ì~y=Ù¬M… -ЫUoßçºË&¢³)þ‡*¶mC4¦¨VœÊ~izøw˜=°x{^³2H# *Ƕ?dEn÷‘SÕž!D«(§¸õ“¸ºÈU´‰R‡v˶®XÒ)€sñÞ$ÜÝáÃk ×ëó÷¶²Ž€è¬´"Ó8‘Z¹ÃÖ]R±‚§Ï#ú0Q'i~T±—ìÒxùKpýóÕyª(Ž±*<’ǯÑéÂY$Ôak7e3턱¯ê vY´–ï=[ûKß©¡n¿PsY~Ð)¯,Â#‰ò¸d…Uàž¿ª1ߦղ%9-ÓRµt³>ŠœwÏód$´Kðèr½v“mÍîí¿20/ZÓµ=x8d…ºÂw‡Âitç‹ (ú/±¬$>è]–Sm—¬‰˜ÞKŸˆbwÝâ¦%£‘=“’='ÀÒ>ÈZÉy\¿’q¥*ÙFÄ­)Šâ;RsQ{ý±µ¬|šTôè¿Žév¼ !&.’çî­YÙè¡ x€cï]ùZäŠ>¥`›Qâ.o]þ™,5n‰wo““Ô€…béÒMGü&¢kéê F[(±&¤~áæq7øVÕxÝH#m
+Û¶KjîK¢FÉNgÃ…ô¬0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+177 0 obj
+<<
+/Length1 1442
+/Length2 7792
+/Length3 533
+/Length 9767
+>>
+stream
+%!PS-AdobeFont-1.1: CMB10 1.0
+%%CreationDate: 1991 Aug 20 16:34:36
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMB10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /EUXRYM+CMB10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 44 /comma put
+dup 46 /period put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 53 /five put
+dup 54 /six put
+dup 56 /eight put
+dup 57 /nine put
+dup 65 /A put
+dup 66 /B put
+dup 68 /D put
+dup 69 /E put
+dup 73 /I put
+dup 75 /K put
+dup 77 /M put
+dup 80 /P put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 119 /w put
+dup 120 /x put
+readonly def
+/FontBBox{-62 -250 1011 750}readonly def
+/UniqueID 5000761 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+‹s ’za§q=Ì)W’)Þ;+êÿàæÅt±ªºA²µiïÿ†)ú>©Tç½ ÁÌWc(½å¿ÙJìöb° #Õú“›; Øtœ]¢Uû§àÉoMKs*Þ¥Ø÷¹}LŒO
+g­¿5¬ÖrÚwÿ*Ñ.7|x ÐÃ96_•‡LÁÿMKÐHªÀô &Ï5åGn?ø$I©Á· Aýz¡ƒÐÊO\t¦CÀN
+
+éìÂÞ¿÷š
+†KòDª.;ÉþÍ ‹øçð oö;eÚZH, áE¸£E˜'¤3(_ÐXKÁ¤3¾|*‚Éá­ÿ™8ª‰û×ÎÊ®V2\Æ«8G/ªþäMÄ[È=¤*b¡â8mòŒ ÎàûÑ¡™÷ú
+*åÙœù.¶Ä2BÍõ‡5n¥˜ZV2ø
+îH—(9Ýv6gMõäÇ؈)ÁÀ7- ›óc.]ùˆýZÍY<
+}À89AéCôí6]F‹aÆ¿d=ÕÖÞÑ°^(oˆK(̹"ê?yÆT!LŒB…Û˜øÓ1ä:(ää•ßìë©5IsÈÍú#c¿-™öQ#§¬ü°×ynkó$Ë(Hê
+„jpÓyÔ
+Ç™8q¥±šm‚»me3ÝÝ®ßE®ó³Àñ•œ¹F··è5(” Û//dõõ ò«"O.› >&ëêy²¡6i *5>D¶¾ù‰ûÝD—|ÚSÑ÷ëKãsŽùâ+D®Š«›ó¤Z™òùö樒`1“5"®?ÄRk“XÇkëPöÚòDKßΡäQRaDî#±Ë›%Ûäžk‡Í`âµwäsÅ;cwÓ¸Ls¯‹ãá“z&†då£:M;EÃ*(SO¼Ùw6•ë,16´%ÁTÁE1ÈhT´‹Ç‚gÙ-k›8ëx-ÌeÊAÙ.UÎCßr¦§ÞCpÑ+û•>$ÂïLŒè–=I—ñxÕ2IÙûÁÑðh)eÙrÝÚ-Í I0“t‚7 Þ–ê¥÷*•fæ(Çó©'‚™ªK ^%Ô"(–SÚ¸¹foU'¹cÃ^ØaáÛöí¿œ<þÛ8Ç=k©¸þk‚ Hm“¯I^ð²Ò¡?GV!dÙK%àÒãmvªˆe•6¬…~OVª‘IN€4Îíâ)æÂ3½q¼?Z€lVºm'@9¾ö_èÂèáñ›K)C€•ŸÊìVÓß•ï½gÑ’Ÿa0ý]G0‘Û©ô¼‹¤ÐþàvÍ°E%~“)¼Ž# /6µµåêè{Âö~Û'áLãín"õ}ÍWq»©w¸ª\Fkw †3¬Å)^ã2Ù!pm†fÙ.€wvÅËQŠØ—?3‰•(1x$EÒ—ïú4-úŠÍ~°„…\›Z0‹p% 0ÄP³ðvÅF&É÷èTVÌxµ¾4¼/sªüσ¯¨;…e|5¡yÐàî«‘ §ç Ýw!NñZsU.?ÁÊ».òrü-gÞÝ·¬7ù¡×´5ÊJ…¾Æš–øÙgr'Ëšmw3ø—IÈ’õ¡€zÊ_ÎcÁàÇ‚|VUh…{5V^É4©êçü€öà ÔKEó“…åù y””¦ë¢Q‘H#Îõ…p¤GrÎdà8a}}Wno'„¬3—)Í1µ-qÛ”º`°‘¡ÆÁ."ÌðÝa>÷ÀV»Ý¶Í”¾Q6G¢QÉX#Ö½ NGk».ÆQó̽x·èQO^Ð<û6«Ù]Æë^õ»Tõ ùñ.5Ø "Á.ʾ›8àûÀ:™U·wT¿¹„vXä@§)†=ߟ˜*6°áiD8póG
+ä,!MªÓk…«íƒh5÷D¸ÁR­ 3>ïê6E>ô>½j^RÓÞ,þ GÕ5Í>¾'½N39ãˆ;Ïí8àH C»>±´zĺîM¹N\k|rVÉwý5/*k‡Hfª d¡NÔû‘avçœUõ£
+·‰a^´Rz¢b{eŸ4ïYƺ?Ã;ÅnFˆ“€ ¸šÔUģZÉ«X©^ÊDi߀ïã
+wt¶ ¥›¶pŽ„ 9È9f¿¤ȶUP´ÑÞõ©ø'H)D3Áà•ü×U"bFM<èæ4Íø+ÝðGºÚ'zL#¢™}#ÅÒX྄´6<˜˜D<f¡®ù«Ú\!;6lßÑ{"^607Þ[Œ徚‚…f °ø>)Ï“3IÊ?G³ÍzEõw+‰ç$"9Ý¡/KGºýéD?¡Çv¾Ž~6Zj»#|´‘,/9À×Ú4¯X¸I¨ÔBÍVÂõJš)ίJs6ò‰^a]3ª~”ÊÚYÿ•Vl°ð± › ƒp”oLcGf;Ä;>ö¾³¹ØY¿ñ|¯mÚÆxŠ¹ÇQ¼QŽ¿ú飺å-ŠñóûW-!æM—ˆ„% püh!È­ŠÎRv¼ñŸ2Ít
+^h­Öèø®=oÜŠõ?@îÍ.×l©>šŠBWLTÜßœx·î˜ZP>’ Ùy¶nÚ&¾û6[ýŠ™­¯k«538¬Ó•pAÁ`…¤…÷§
+lYfè+ªíHeÊ‘l~G÷}1•f€/]8G£ðR YQÀë4²ápMƒ$Ðöp¡6éK 9vú,.¦kÉX9ùßÀ"2úZ}5³TïteY©ß”;{TŽdB˜ØyäS:JnEÌÊïËÚ¿³<8æZX=Z¸ã-“@& G
+¹À÷”xÕî° IÌŸøO@6ƒ«²’I÷-~ÂÈ×ú:™ÄÃð!$l9X½:›é¼°û±e|y¤þ"ZÐ-©Jþ[• ¢~Mõ =+® ½LŠ\×H
+¾mŸÅ/¢z¨7¼ˆfud6¦J4ð¬E›ùWp$ãL·(n ×V‚Ö³Fï_m0‚ÚÒÂŽÏÁ‡)¾œÚ,~Ïzß‘ißU^v覶{{C¤5àG1"ôò‰­›$ë²HR}Y:­qú(á ˜z³zË´ucGKóé#œí
+ǽ«Ûó>߯ȡFØÑƽIˆÙ
+åñ€ï·Î´;—äôƒôÌí»ÇBdÏ–ŽLçÞ9ërö‰˜C`A9»õ ŒCÕ×vÉ3Ì
+
+· ††ú„ï3*)L˜Ü„9“uõ†²µme ÒuÌ7:Gè üýªÙ`–Ä›ÝüÏìÌbØJ¬V&Å06-{sÓ]ò·í*C–3
+·§`0þ&y
+"‹D«ª}Pøû‹½ÉBºJÏÀB:ß>:}"Òý¥8 dÎÏ+ÇšhH~Ý6ÝI¡÷C]áÑ% 5ÎÄQ=x¶»ª–Ìzyk‰0™?¥;c™Š‰Ë§#š†wÅ­gJ¦3­A‡1ý2JŠÕhŽÍ2k6QwÈa&‘Q€æãÛQ@‰£¢ @1Þ³]zÿCŠ[+¿+jœ$‡^a;c9O¤;&NI›¥=ÛÃ`¤½Å‚½5† ƒä•íÜ2vÚ‡èšî°ØÜFJÁÎ,g w8ž9ÿm’ã¾°€NÔÑ(¦MÏ4!Òwÿ~š ž¿ô$£c÷ä^ÚN^›êÔ };•?iÍÀº4l6ŽÈñ:Œ­
+©"GÕ¸³k/ëÕhë%Þä ¿çlª–ãÔÜeéÒÆÁ÷xiÎKHÄ!ve°!¸UCwù” ’ã)ˆûàÛIz$ºdÔð®¥1ï°œpº\tlZÑ6h:ì¿<U•BÅà“ìã j¡©FBá0^q“°†)tYýéj9>°^ü‡LŠ¡ÒR°}øÞ6f6-æ4°¤´ÛtÁ}ò÷nYFn¨ÃXéwÐæíÓj纸p‹áò3¾6xH¦>€”˜,)[5¾x¸gÇÑÞþᮂÐð¦{OTÖÿ³I{èãjèÖ¤H´ò&R¤[;e¶6êÇÛæ;ÏŸ6qb±M­w-þ›Õ‘Q˜%ôß<÷'c®3äðt· Œ¬€~cë `q
+˜ö£âAÉ‘š ¡Ö3ÒºùPÂ术ŽÌ$3Ý/¦s¡\M­ä¾ž“0Bì/siÙ­¤ëÆ$Ý\Œ‘v"¡ƒfl^»0\«÷zˆÈçBIPœZÖI"ëH‡
+1 5ÝûXÜ%åÍ2Öy¨‡¡3Cß^Z4A°FmðÌ¢ï‡9Hž1Ïdé]f ©´˜è÷Î ÔAm¬Ãa-¨¸•2Xì$¸¢ÛnTf’ÙD™fÞó®ô ™Øîžå§í©b·¼¥3¸;~<Òˆ cªßGŸmŽ¤BAÉ-’²Vê¶íôX›«`»N)âç¡à¹ †7Óµš8Œå<99wH˜aÆåø^kß:”a8§}æqOÀª¯ FÍDXÊ,<þƒcf
+Å`v€Õœµv@ð¶OÇ¡òUl±`‡ÑdÇ…)Ñþ0þBC¸Ð½¯­MË‘píg :„g5XëØ­­!œž¼¯¨W‹/Ðä’Ñ& k(ìÿMíîJ\“vH; GÍ =å¹È*…ÕƒÉmt¥xàãä~×^6¥aD|nÉsŒ­¥ô
+¥NÄòצÚø6­Û‡>XšÚXï ¯¨M@šë å;u&Š»n ):Ô µËN°Ùn#8[>€#"i·¤udž”.¾¯y¼|ʦ•©Ö‘woÁ¿¥¡éµÉMJ‹bkmga±=¯‚âp"ÔMí•jXÁ«­7=0pwëZ`9®1Ù“ó$ øLÙyÍ÷þ%ðMuÁû`w\9áõq¤SAC"ðv1
+qgûjRÃ9ª[Á[XÏ»7}ÝYõ
+Oô¤ûÀæ[ÜU6‘ŽÎ×O½¤L•cŒ‚• \àmwk4Œq}}Vl«¶j êb…œÒ1nnÎbÕŸ‡ŠY­Tõ¿*Š!ÒaŠÄí©)¬À©Ñf7è¹»C†9–™›Çê‘N8îùeòå/¡~}:F‚ã\æªhwL Fsòα‡ŽŠî
+ <‚M2æV¢d ³±í·z_VúÂó2-ÐühÇ_~¢„SÌ×Q
+€°@çÃýƆ
+|fñ°àñÙ³½ð [ "ìË-¶JöiVs„žù
+ÚH¸UÁ»Ah0‰›#[¡óUõ —|ü’È` -×Í
+AâR±X|G‡2°FEìhÐ"½@–ì3CW*Vß>„ƒ`kÄèÀ”|¡žúdšUó'…°ísŸÕêd3]º ÌÜæ
+S
+v6՞ɜ€ú\êÊýƒO?¤M•FÕÄÓ¯ø¦n’5Ï9xTŸY2PÝ9î¿„÷!Ü”«qf[Û(sZz@q èy'„Gu4~æ?Ñ£dæN{û-"#}/ÇôW•ÎàšP…Wèî/¯¸›ÝnƒÌâÉOÕ\Ï¿åíÄeˆmü¦‚ÄGÕbá÷OC™Ärk-hÐo’†E"õP ãùMãnUX<´u(þ¬‚¬BVWZš`ì{öÝ |ƒœ)4ØéFv;\ .ÂáÕñ³FËDëçæ­nB.ëüêÙd¿uE¥†—w×ñÚò¹óŠÀÝèÛ±·gÛ^¤ò
+HèúÃ*z­,pøàœ:0ÙÕû¨å‘—OØÔZ L ŸCp†Au}±ëûe$íz=ˆÝÁn´µ…¦¨>é›^‡ÕuÌGC?°X/Â)“6xý‚)D,WûԤ߸É`ÿ ÁÔY6FnwK"û½Žö÷_½ðS’µJR¤¤‘kè³€˜Ô‰~6»ÿ^Qÿ¤ÓQüo±ö²Ësç í‰èµØ38¥ýÚ±I]MÕˆO)näØ)BE5¢7oÅ2<ª¯énêl #_Äažª~ Z¦Q¡ñuã2Z+ò-ÅQÝÍaå~ßÀÕ¿ñ´×Áƒv¿V–¥Ÿ„[LÁ²}·—GVÍt‡Øob•Å/êM³@ƒÌó¿yÈùâ?jç~)en4lÓÕ€§?¹÷aÕ¾—ˆ­JS«S¯oØââ^¼m»<0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+256 0 obj
+<<
+/Length1 1534
+/Length2 8105
+/Length3 533
+/Length 10172
+>>
+stream
+%!PS-AdobeFont-1.1: CMTT9 1.0
+%%CreationDate: 1991 Aug 20 16:46:24
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /BBAFZC+CMTT9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 34 /quotedbl put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 61 /equal put
+dup 65 /A put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 73 /I put
+dup 76 /L put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 95 /underscore put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+readonly def
+/FontBBox{-6 -233 542 698}readonly def
+/UniqueID 5000831 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+ÀC(Ì)5Å>âr?æ5z)†?lG{> t+0¤Áï«2MgƒáËǪÿ© s—Sx¹Þ¼Óöª¶&£a¾€hÆÝ +䧻ôï¢Â6¿~%VÁ{Y#×°üm_êt<Uò»÷.Ša™[Ö=q …¸ÝZƒÙsv¤® †»ž„Æ@Å-
+•³]HϯÖëãÖëØŒŒ©>@aG@§|Dky-”VBJ]Uº—ù}ÍÕ¸9ö! RÑZfaÓ¬'džs$íèƒX›9åÑRy0 ËZëg¤MÐaGãCkÛ²‚Î=)£±ßÇ+ÙBøË3v´á,ÿS§“Ù54lë*ü4(Í“Æqì%,Þ4V™š¯tªP…Ú£^çSýÂÇØ>ÂÞÚ«±¸›™äËR‚œ¿´Z(okó«ÞÜËÜë¯i”±à}ð ºGòûöl`(& µ¼<»½·¼»íœ2#6¢òäùT ]HyÓÙvâ„ŠÜ…·cÃTè~¤™˜Å × w"Uƞ呼6På"†æ÷šÖ2Þ9ÿ›@÷%øæà+t‰)Ýy¸ü.{v ªðŸ?
+Å”ˆ°ÒÔ©\%΃
+R#Ö¦4ôq÷7»!KÖ±†|ÏÑiN†YZÂÓÅ×ïüÔw=½¸BLtð &SY…qÃõÙq&q èµUüÈù¯Å€œÇîa1æbãÓn= g¡ˆ´&B›DRÓòã?¥4<ÍÔŽ01‰¢WèšÓÑRo³÷²$9g/±-Ì8’;U^Z¸Ð§ðN…–ÉópÂÉÿô³ðìï0À/ËÓ(ÐúkG! xìÁýÆÉz~)°qTg",¿Ìg—öÜ9jÂw®Ñ¯ã$ü±¢Å¾¬§JŸÇ%5g2جµØ™*åε¯V«¹NCšá—G4·¬ÿ]²RtÔV¼)<¤ÙFFüU šbщí_Æ7dŠ'{'ø“3QÒÌu›y4õíOö0²î“–¤(84#>r ~ ä8•G3,Ý] líøÿ=<eüðüæI<¬E¿x¾‘*eé€9&N OSnñÎð×»Úw]»iœh Šc‘jg0ýKå>™?VK~vžÍû/¨÷3Z/E1¤úv]ÂöàÉ·ºÞ!ãP¡
+öMw4I"Ou½ýçvºâÉ„ZÖ¨×q®Ó'žK“ÌÂ>C;KX5îA•pÚ:µ[ªí# Q²KÉ|ˆj!8œ S„SÝîü ­ÈRUÙ×r¸?zžû.¢p¹%BW÷oL\Ê© <yU°qõë ®,¯:îÆüc·6ƒ¹s_Úò"º0,U˜éýðîOtÒ”¢è
+@øé1Ðçá«SËïºúè¿ œKËÈÌ1Ä¿¶SÊ6>°cv´ª¤=l_ÆD!S'ŽW“ÝžÿñÏõ†Ò’O4HËþ‡·5:ëåjçhýe¯»9¢¶¸¿Ü’j‘%·RIMÎ2>8b º¾†j’ºªâ)Lh¯ì5ªßÁ‘‘'ã÷8€PÕÂŒcÓö2@ãQŒç’TÀÙÖÓð}/o”‚yÖ¾Ø^?Ëæ²
+‚Ôs&Û÷ƒ¬É3¶¡>°.O"išš5|…éîhƒ%ã;“¼ëR6.&HzD‹ú ”ªÓtø×£¿˜.âŽ]x3 ¢óÐ.p®QÎT:q÷ È®Îc«Q*\zG†~u„i,öþ¿> ®`?2nÄþlBÐþ Dé<e«Â¯Íw¼ÉqpfŠÙ$¾1’Y™ºf½5Iöf”<‡ñ’°õû¢ÁF 2E‡Å3…¦Z$©]˜;é_[”)Ÿ%|T©¯^N ¹ü½Ñ;´‹6|AÞûu‹5iÎmj7Ùæ2Ö—eÊèe8ìeå÷Ñ€¨2©F’qàvËÔe•g‘£ÍB}ÈÓü8™62i¡&Rü5ÌQ±n†è¯˜(°P›Ã
+ÉuØЧ‡’r¦°eMVÀçx›‡93ösÓüH·BVZïâcRøü‡¯(s”£)"»ÜnÔ7¸Gdà“ã‰v¿ß@›ŠØüãZžÇØÅШÈQ5ë·âþ
+Ø‘É>&/TÙ'xiù •*«&wäöÍßBb £E -(*ÐÅÛÔTEݾÀû©_Qñ¢ø¬â=LÀŸÓ&i˜‚.Å|ŸM—_D‡ƒ^£¶+Oæðû4CùÖ%6»Gpqwkn>žò.kÌâ\1²ìÄä[J€ô†!çÆÕW@ðW¿o”sW gv75Ÿˆ¿´,ɽ̄¾SyUuÓN¾éëÔG°-Lónv¥p‡MióØŸëØU¾„¥®UàÜŸHĬÌ)p Å$20#F å½Ñp/Y±[=á¦yäãb̧ìaC@÷
+³q°°÷ s-³FÌ<©†þ€[é]'ª[~'˜¨E'l¨§çÁNJng&W!« :}ŒM] <.¡âð§*°Àt¯Ñÿ6:†QßÕNnqtãÖíÜôÇi£Ø¾£À·2੤ƩÔçÈJæãLi:à!:¹0Á)K÷Ð8sø'ß&Œ¡d) .li?4~”÷Gz¶Ó#Pwd°]Sq$Þ=ÚÄrpÔý,/În0ïæŸÁ¿¿¼‘Èúg"*ïõ<Ø(xtà®üh6!]ÔšÇ ŽNã\å¨u1ÅLÿñ6Aȯ$þž<Al!À‹§R%|¹HYÔ­o­ cnmn+S Ç¾}æ‘ígY'ôhù„·^z®Ïžß ú<é˜mŸ„mH˜ÊðsÖhЄ Û†Î`¼lš£-ñÙ¾8@õ¦£Ë÷œò¡7ÿý:Ek´Äß^¨N Š¤3ˆ'•åŒ¤Ìš¸z;r> 礲†ÚãgŠ¬W9jºRttvf­ I¯¨ ¨èO¦9
+kü‡°B ÐzP1‹XÃ’]‰bRH„ùò58õæ0,
+¬C[M¨ÝÕåML6V?(e°£iÒáî$?…åjÂì=˜CœœüÑú3Ž¤b²ñ>£í¡Zyàz1Ÿº 7&–ÍRá o‰Ná°usk5“}¡*¯rï!á÷r~õB>‰›ÙI(¦lн
+=–¥
+gOÏÈh«Í{aÏv.ÁÍœ4Ðø›Iã÷|ºã^QlþÙLçÌ;õŒ‡Ü®$+`Âl ¸Ù̦†1s†ß þ[Õ®Ú„?œsš¥z’¯ç§‹
+BjSÿÆÝŸW~? ƒ=}U·ÎÜïÉÎû5ø­Æ†ôäË5±uw]ýoo¼¿¯îm„öÆykÓÔy¶#
+’l½wTûÀÑ;ϳJÙÿûÒm’Ð"1¶®ý”‹éö¡ÙaR–Oø$lÖ`LÎh%÷¹þV[•æÊ2Кå´`©¨”næµÝôL×Ë”
+¢ñ03kt´ g;®ö¹Qr Vy¨&„Ù!b$•]“¥zItžŠ9æzÉ%>/I/‡-bRå.OõoÜ TEm%½Ð½¸·Ü9r­ñHÃ^'RäÏAciÛÿ&,Ê™À¢fVÀÖ"œìð–8‚Ïà*u±e ëœáê·ÿ€—]~ÅÙÇñbcë^_Ô€‰M4æîõѨ‘D«™èyû‚‡^\ÿhoꑺaEcKøK¯x>o¬.&PÎòVS.Ù­|ÌZs.5÷ÔxÿâÒl¥ÕŸ@Z …I”sd ƨh±§¹»wû:›tTt*ðÑý»ÞK']–ÆåÐ@)Þ{«•œ áðY5挠(<AâÖ}—“'#ÜêA‰kü8{í(zGMŽ÷‹’{a£± )Å"µŸÓè
+ÊTƒDˆ,rö0@3\Ç¿D‚ô¯bLªc¢ Ý«KÏDZeÞ,†%^ÿw.hq:”|6›ÒýµûÏÌjÆÂx_Fä>i.~CÀš ð*ß©Ú°…-ÖFæx3jsaÃÈR—´=ÄÝýr·%µÌ-dsÏUјè†TGg â£0èc! ¿¯Í~¢VÁ`~ú[m‚UŸoõ<
+@)§œçËf뼕VÁáíå3v1>Ç#º/ ÕZkqTCrûÕ`
+ÀÀÞG[¬¿ÀÃ_Ø"³›Ñ*²qUØòüÁ+b jàÄšh"a xæ[úxΆÊCü%¬¼vžcD«ª·SÓÞVuªó0¢©"™ùLjÕˆ“>á¹Pó†ìåŠGJ°dH¤)ÖÜ~ÐúÕ,¾×õbÿ!ŒÛÑTϦÐ1r<Ìu÷4»ƒ¾°g ‰õ¥IŠÚÁí‚ûTëÆy¹ÏîØíÀ$Þ~%ïO¾ÈÀJ&‰T³åÕd+n5î«Ù––êK¨ßÞmÕ9b*ýd+ ü£…†&åH^ØW0—šµ?%'Ŷ)”ÿa¬·´ï"®tb<ío³ŽU-΢†àœlCh]lN
+¢¤FxñÅ?ÉYé­nvD, â(ËÓDÎ0g¸ Á‚4/y´âÚ½oB42Æ
+ù®!Éë1rps]È'ôÖþÂ飔u?— @ÞØÙ"Ç¢ój‘®›­Ÿÿèœ ø‘*(Ï\S‚¡9Ù<¯á#K8õ‹ iWpìc’µ<c®òBd!Ê{$9@š&GªSZHYêèmŸÓôúu}$-ÑJÔà.ç9¡©‚òî¨@'
+'ó às-“H:ãÅ:óª%}ªì¼û
++
+îSU3Ëái<\¡x’ÁgǬ#Àj1¡¯*!4ä5æ̓·@òØvéÍ(™aôÝ¡¶o ň³EÁ°ã8iâþ FóŒR×Ú’k *rªÁzQd×ø¼´nq UňI`Ú!k7Â}ŠßµÏºhÔ¾\’¼ñVªÆˆ.¡ový3´Ð½¥ 7eû³ïI±kÆÔ[–ád˜áÓW¥Q¤oç|þŒšBz õQJ¯áJ¶ŽÙLjHÞÐ[€'ÁÛÜØå·gÄÁ_ª¥
+¶˜ ~jîðÊ b±y×ÙEëͦ¯Qºê{;'WøtnJðN>–²ÚI/o®t@Ž¡nÅ0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+259 0 obj
+<<
+/Length1 1886
+/Length2 12514
+/Length3 533
+/Length 14933
+>>
+stream
+%!PS-AdobeFont-1.1: CMR9 1.0
+%%CreationDate: 1991 Aug 20 16:39:59
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /GSDFLN+CMR9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 14 /ffi put
+dup 34 /quotedblright put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 44 /comma put
+dup 46 /period put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 65 /A put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 73 /I put
+dup 74 /J put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 81 /Q put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 86 /V put
+dup 87 /W put
+dup 88 /X put
+dup 91 /bracketleft put
+dup 92 /quotedblleft put
+dup 93 /bracketright put
+dup 96 /quoteleft put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+readonly def
+/FontBBox{-39 -250 1036 750}readonly def
+/UniqueID 5000792 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+,`1 þùêþÊ¥þàü?HòiUõ€ŸŽð¿uÇî6çH(XRÐœ½:…“‡V”ÅQ‚jSsl( jB¥”5’¬"؃{Upéox·†Bx4õ1ÃEò3«ä:ÏSÍƽûõWˆ¼ð‚hê="
+á-@;q…ÃÜÁÒñþ缦°äëÿž¤óˆãjÉhʶý½2!À!ÔUš9mBLº•¾BEGž4÷AmìïÖ£5&ñqV
+×ÕÓèøòsé´@Tá0;Ð22c-… "’®
+ 8P',têï7áXBûåÊÌw™“ÿç>ê¹x<8»PyŒD ¡ûpc´g4œ¸ðD/˜ÏÉ¡/½'6 £›Ð";Þßüß’NȆÐï+|¸eÚ"|Û³uV@–nŽeâyk½Èc¦B›Ër€’!$¹6ÌKd& ñ‰Æ» D•\Ðöê”sÁRjû¿ë#ZåÑq67+#;$Êæ¼$ÿ4°ü[<QÝs /±/ÿ#½ D„z5C¥溘p§†YQv‰xOCñ¬:CÄnµIss-`ÍÇÈ”;³:v%‡òüN
+ %£aÔRZˆ]“
+jæŸsKJÔËcÞ•C'ëªF‰F"G>¼½ç-.죽õ7h4†3)ÿÆöŸQïüÈÇç!$¹÷@¾ 6-pÕN®öÄcJ¤ b=±—7¢-L+Q\‡½ä—ÎûÅ ©œi1¶»­<†H+Ýþõ
+7àé:À#›§ F²OØÅRçÉ€´
+uæ‚u®ÿ¾ˆT?¶uç÷tAS%Kõ%îrÃè"æµCÍ9ÀB ìˆ&|…ËÀ/½5ô,²¼–›_X:b9ÀxÝ<Å7óÝZ¼áÍþæ „‚#ߊí#½{Ô[‘ð†(»“L>?òÎP'#7ºâùFAÐSÆG7¨èô;_,“‹•}:'ùEîC,[À>ùg=³TüI®È«¢×ieO*d"Ÿ7ê¤sõŽØž|:Š¸ABèœÑ{šºÂðn«ñûœÄúˆ©Õò?Æî0Ã_¹®±Bæ‚)Ù™ÚmXG©~)cáxò7tÁ”[±ƒE©:Õ°tÞˆÔϳ%yÝ!‚›âðOSj%µ (…ØÅ)Õè†JW'CÜÅôºhâ>ÌïH, pŒn@3÷J)T¿[ÊS»‰\Hbd¿~÷sàˆƒ±cË2ÝhÉÖ{cåC'7J¢Ü9€¾_±AßcWràwGÅOî®ÆŸª'Õ2?œªªr]3Jˆ½l!˜ê”ú¡Ô˜a“_íu5,ëü³”#?ß™*¹ÉœMé˜ÎMždÑKO½Þ]Žã‘Ž>Ä4®–çÁ YÀÄ1Ÿ¦½Æ—wÉk¯.O ðY%¬+ÈMŠˆdøôHqÖŒç4x¥@ ‹ WìµºÍ¾Ü ³¬ï†î 5ûÉ™V´lÑÝZѾeÄL6b4 Û¢•t:V*ÑrÔ-éAóÒ„)ÎUr¹x7ïûÈP?ð€2þÂÄõ)ÕÉiª׳~j-pu“ß3 ¦ûK®€5η¤Or¨Ùby=áãû?·ó­Z­»øŒesÂúbø26Ä+ødâ‰Ê ª8¼bž‚fûñ{Ú+\´øOÿ;!䆿æ/Øò?yÁõŸPWÎj0™Zž‹¸xL;[?‚+ê­­Œî`ötW ,ý¡þ„EËxä½àå^Æ:DkÄÉ›
+1ëð2ó‘ÍD wižÂ ñmÍÿýTàsYö0×í>n¢Hn
+@l,¤hÞ¢ýuú©ˆ‹* ñ†j÷–Ùì‡T&•ïXßö*Cù_=£i½°¤”“D:Wª/pô×!8;¹Á
+L@–Ë<ÙõO˜Þ`ƒQpèxA¹
+Ï5CÚ¿ “øÁå™
+V>>²ˆ"q¡ž Oâk/ƒÆâPš•š…U‰‰¡¢qŠ» ÄßHï¸ÇÆÔà«0*$HŒǶ`9^êֻŷ;퇬Ùwöâ×
+#1l.^-T[i>ù"19£93²P5ÓқˡVÉ=¾s^­abÉ­Ï&‰Ò×j¨ŽG” D1x?\=óˆ£ ,gÕ…-Š9ýÝ“3y¤Qcµ_M{=ÇUxQ—âÆ$4DЋž‡ÚEîHÚµ,[tr…uNÖçMõ$«Ï4žÇi•öcv;IÙÒ£D"›¤*mn}Óˆ‰^ƨ‰C9 ¶·õéGȨpä\%Ä®ìåºÕ?øzö=‚„+D§#&©æ"GI]l¿×òÕíB¹- ~@»ÇYÆ–¡Wúä9 &Ngœ~xΫ7fÉiòQÝ^p'bXAú¨ç2±K˜ƒž¸%ïëo´¦½îx;â80‹¸ ¸Sùþà•°óMWó‡cÆ÷¸È@ºY^ ¶AG=–¨)éS™—±0ÛÄa¶µZq9hªo¾Ø+“±ðHókZN²’pqveúØnHû—.0ŠŽ õº¿Ô
+„Òz"±€~ð$+ô½
+L< /iOg~œð|¢Æ{ù(X,MW ©ªh„ðÑa˜u ‘N
+ï> ®ù!àSIiÓVðŠIó%Œ< -PÇŸ³²¶Ä”¶vw
+àà¶VpÎS6¤WÚzN¹FžÑêÑ-Á¡°pŸ­!æ¸^Á&}˜­|íÊmí”H*Ž>Tõeÿd¯•‹’Xñ®$! u >°ª÷¯6­({¥#f÷<g¿,EKvŽÄB¼çpÆÌÀÁК$÷±ñÑAH±Ýó€wàÊÍÑMŒ¯¼‚$¨wÒLšC"ìg¿_æÇ÷ò-‘â“Çñ3î".ÔU³fKq£S1â|d2×Å“/{¼ç’€ØÁätû<uÎÞ–EÏ…`×g ”·•^ÐÄH¶jâ0!äõL=lú ßN%bf´÷UKOÎ[®? )Hê¼¥³ÌŒõ4:< O 1ŸuÝRðˆnÕ/Ú¼ã£T} FVÏÚy?Mºô´¶”%ìvrȱ¹8=NÕ¢*SQC@|ÀCùÝŒ—‘Ž
+Ý=þïØ©r2®ÑN¾§=!”šI}tÊ…ß_þZ‚…èMä“5yCñ}ê—üÕ¶ héFƒÛ ´ÀÂ’»KHêú R<îWPjH›—îÁ0|§êJh¢…Èì‹ØU|gÏw&³9ÕÆxŠ>®$ÔæŠFŠ˜³ä-:)W»ÛÛÎ
+8¢ÔR¸‡À²<ྥŒôp΢k§8LÂæ[^û‡Q)ñ XIJ-Ѳ(Ôùœ‘Y¸"¯Í´Èæy€ô¨Àg »×?cŸ?;¡.
+ägì&å·8&’ŒžÚIŽø7½\_ÒGPÁN}ÅÒôܶs½n:ëÚ Ê¤ú½ gÓr Ò„€ Z‚œuØþH[’%; zA/Ž(憫Ì}¿·ÿ½Ó”¥™#ôDÆ 3ÜnƒÊ#$ò²)×UMPLÓµJ°`›‘Ù, äXká;Ôw|I—2NPÎgQù2ÂIT£©‰bGT¡Õ:ööÌ
+î­xlí3'ؽ6O3øç/÷^D™µ¯NŠÞ Yã-BÁ} <íó~Š7gyì^JHQ3›Fx?\òfN­Ž&óO}w‘F»XàežàÃœ»·¾¯ 7ÃÑYª1ÊO'FC~yÛgøˆTÏ.|Ô%Àà[5ì«ôŒß(×WŒ³ò7}ÂYãÇø7 óÙ!Ú•µ¢NI–Ò“’lï:õ…n7€Èk“ Ã`?+‹ò %éÈ虲Õrnƒãˆ†'C¬£?a¼fžëÃ5OÝ6¹¸ï]‘ê~iè<Gƒ+ÑT1ƒBÑ?Az
+<ÈÿX_èÃì<Õ–•‰Çkns À~æ’"àÿŠ•0$ÅÑ8À;tO‡HȨÿ?ôà¨zx‚× ?ýGC½ºUÐ yïº)̪¾R“k.æ])Û=±g#‘‰eCâNmÝHZbñ|† *¥å“ÊŽÿ-ëkåsà¤ÃÑÉ¿)µ×yÍà®a¿d§\\òîœì°îw'xñuÄPßÚCl}ñëi׈øÿîó( ÛûljN°ÐÊÆ‘EO yKspçƒßÙÀyjƒÇ8‡úÄÓUt«JD0®Í¢]«âµ4êfïe˜-ßà¦t>p§£")øíÿG,õÕMôd‘’ÄN. ùq½ÛXæÐäèmçGD¯Q°ØÞ@Ä’”êŠ\·ÎyâÐ Èš„ÈÙ4²‹Å¤
+Ä«÷j,ïéØ°ÿ€•eцóçUZõæø4?æ fL¤ô)¸UGFÕzµ~„“_%åÎxÎìÁŸ½êçœØ'çZXë{ fÂßÂTV+Ç¿JÀœ3\ìF¤ŒƒËfŒŠaö>€N:Ýýv¾wºpÔåNî+žo*$a{HP ¾Öã[6c¶ƒûmöÃy¼œÕ$Jß™€¢h:Ÿy:ÉSÛ™™5Ô7%Ñ :¾Ù_÷nËë£nš} ¶…oï›zvßénÝòTGyõø¥s·ƒ´ëøp–~/ ½5¥oI,þ|>pö‹Æ}v4-ìw»³½Aövú‹À!²QÈ> µ®G­€dÄϯ;.†=a%¡IVl‡Ÿûp™±ïÂV¢¥j\íSÎW•ah£_µö'±¶eš¸wQŒšìiÛì—ô“|p0'¶B+ï[3TDõ¥!7ˆ(K‘~[;bÒÆdúð©&?²¤x£Å“Á
+µqDs–òŠW)Õi«案¶±¡›ß,Ë5øhzyû-WþËótÎjXÄe¯uÉ °•~9.¦Œg˵ Šë£Všx°âó½±ñš
+®6­æ'Mõ>*&DzM¶#Qü^šJ<Ì¥»QôngOpÇ:syà+fvžM‚µbþeóÚKû
+»àÓ`IÉîy`@ô‡úDŒîÇ35 ½ä} 0w¸Mß×Òiëaàܬ¹…©ø%GÊt8UPëè€Ãì89­ÚJ3Ó¼g·´QšŠ
+=^2?wð¤¤Îâ«mdì-DêÝŠ\2ø3M\°4-(DêR~ä±
+ÀάýaƒU&é…†Pýrzc‘ž„|™ \¼˜³n­²µ{‰š._OÂ/y³ÖôU¡/Y É
+½4BÜ·\øSb]@_{)¶dÓOH·ÜÂó#õ =(0$ñxµûŠÚ’Y×@2ÅÊ0} ªHWüij1˜í
+׊•§$Þu\º5’`PÌǃ5YÙ¼:ľÅ<ªDÏûÉŽ¸í¾RâîÚ'7¨ËÒØ'EÚk¥ìÂ.áŽ+\T±Çn‹È›˜9²ÞãV½'å…Ê«'ƒÉŒhPËy¢éË`N¿^-ej…B÷î5ªò˜a&è‚×y=õpÂwÚYÑ@SPÄ÷7#Wš‘daâÒün okG(ë•Ìª+âÁf­ãä^ŠQkü÷Ÿ), Ñ9 `ËkË¥s0õ7ãç2åsüáþðé˜|="{¢á¢s.Qþí><k*Ù
+x;Çѯ ie¼ÎC|å
+Ø’òµgl·öþ½
+”dã%W¡Àïª4À"`Ó+µF6zò\7C*¡éìF¢óœ‹gHY M©Ó|¿ê{´a2[QFæýî¢m—¶ãª@L7jñ1 fÖO€3¬7Ÿã·Î¡òwsêò‡q¥‡£ü¾;wƒÿ‹4·@ýI6—&é½¥³†‹®Æ[Á&Îøºä4;u—‹¯,&oÁ?Dþn8¹‚‹! v³:l¨Wó'ÁQPð^•èõé
+4m„Û’QH;¢ð H¦È¹ö&‰ö,s×S‹)/XÄ!)ùúx£=2`u¥õ½ ”òQNz¦;ãžð”8z^ÈG»„Ê3û—‡ †åŒú`Ã{ÖÙNÎcLL>­W¿ÜhÀ7æd@a÷rÛ%”,´ûG(Ö¢8»0™¹Ñ•Óû¶fº@¥Ñ"ó%´®¸g*
+næ£
+~-]z{9â\=î‹ #ŸoòvÇ•vpõÀs(ð¨€Øåò‰Ò·ZV¢]ÐÈ
+…üjÞa«,Nò„Á«u4T81Wøxßœ0rÞ»¡Dªºýu‰çG}EWL‡Ä˜Ž}&yƒ
+JVc’Wó[ŒŸðò ðÙ'¶G’9>Œ`ÔÈ-AW²Ü)žCj¬k‰Ô§`;¡š\p(0Ï°+>B4‘$ôE«Ct]òR?¾EØ*Œñö…”K—þ×9<.åwîM7 ƒ:¤­ŸªÐ åqÀæÔ7Hãö ™«¨½T.øTaçþ^ƒjã{j~˜Wð#äöûʘ00g«~¤x@qä­F\vÊ¢U2h㻶J©%Èz{ã‹ø’{6O­ÄM äìCã`¶L… ÎÔþÍ]@ä¡(ŠdWªˆ:§”¦ØÈ1”x¶pÅøÜ‹,Ìó’Kt.ñT›9ìQa+@6Nÿ²Œä¿ó“0&‡—!æå.†ÖNLFE·#êŠkl½wÆß~ÒÏRE™ÈI»Pisþð@ÔB2Fï‘Œ’›¦””¾Fû/ÜÈbÙ/ÒzXaÞ{]=÷ó}7v¥ÆØ<ªú€³ö¯­¼°_mñ‡¥¤ó$ôã·ÜŸiƒCý#\²eôõIÎvW™ré+ãÂï•Ó€JŒë_<%åí}Æ «'&·ÕŽqò€ëš‹|¸~@SÕXZÃD®øjîˆLg*„kt¯J Ÿ6™ 3ýRd]¢¢Ó³D„Xp苘 ¥‹œ¡.b ùËø«j4B " ­šö­Cñ€ ˆ¨c®½Ù}i½I3Ǚܗ·Á®Jæó‹$‹ðW9ý|A†ÁÅ—MËl>ÚH¨à?ÿÖl~CTÚÃSÕòÜ*(%
+½’ëˆ *>á×q~µ×êò„ŽxGÉêýB”·¢ÑŠ‚Ow·wª®óýâ0`…o ˆëŠvoÙ$4úoÁ¸W›KÀNÅšH„,PP>ö‡$“ÐçílŒ‘µËµ”¡üaÿ/ëtö(^ÄÂI<b~Ü-ßm·w'#¸®ì<Ï…c§¯kÙܦ6õ¼I´&®¹š^{°fzh&‘DñîÁ°3ctò#þ÷#ÿy$íf_ p¦O œŸ¿ü)ˆ&¢ÉWÂÀ´ Æa@s3‹ ¡û´:%þ÷j‰IÅ&Ã$Pm®~Õ?„&kŸTx}ÍçæV³£X%}F¸ª¾„:£Ÿb‘‹M(!ù"yOB¶<` ¢[ ¬™Ø€¢
+LDƃJªAìZ”ðÙ*z€.0Œº7ØÏPúíµ¤†ç2ÜãÉcai.À…nÅ#ûð‚ü)0ççÓ´]!È•—¾ÝÙ>ÿD@¼<ÂÑ÷)šTrñîu<JBj.Ð'hjE":ÇèlaÒ].Œ_W«$¨?çlûú²]|ê ›Ã·Õjí‚áãÕX%„Q}Âri‘@’ Òx -vô¨eÞ°£<
+ËœºIïA2ç"¨¼ñË­ðå
+ƒ<Èä‰B—”5ó
+Ö}ÿûì»aÓI
+èVÀ@aNñötë‡B©*·CÛYÌuÀ>Óßõ½y—rAÜ"IÖZdHéü²›pøEÁ-£–€€^qÚM5\ÌBÜHðlÞÄøÞ¾,Àz0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+262 0 obj
+<<
+/Length1 994
+/Length2 4088
+/Length3 533
+/Length 5615
+>>
+stream
+%!PS-AdobeFont-1.1: CMTI9 1.0
+%%CreationDate: 1991 Aug 18 21:08:07
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTI9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /PFWZRU+CMTI9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 46 /period put
+dup 97 /a put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 112 /p put
+dup 114 /r put
+dup 116 /t put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+readonly def
+/FontBBox{-35 -250 1148 750}readonly def
+/UniqueID 5000827 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÎ僥É99>'´~ ¤}(Jܤ—×r¼¨ÅC8ŽmÀÑâÄ”G@G ö^û7°…+§©  6Ð}¦¼µ) ¹µžþXw4z<^efªÓ2þo¼ÎÑAx‚*;Öxu&=k½ K¼öä‡î­`ñ»<ZvfÝ®¦Jk{ CŸ¢ˆ‹ŒÃ’2»ƒ÷iZºð& Õ$‹ždœØ
+ ãGí¯Nw|0;J=§®Q@ÎúŠ†i°µQinMÕL bêôʇwßÑܬb(ŒÿøIÔ¡BËÅú ®ð9ãÍìnÞU£úë°Óî¹åaýè‰]NÿØa
+!±î™ ƒmuÊŠßVÎ8»Eúš”Iû—í3óhi#}o›‹¦çÝÙ²Âå:õn(ÂÜŠä8i§#fz´‡!,0éŒkåÉ*§
+b\ãOÎvâÌx¶|WžxÈð:D Î|#—óH+‡+BVªÀëÛü²Ó˜nHcsì¶ì™Š¤?$gb—¨¢¸´ÿ­ Àƒ>?Ùö4ê0k$‚&ÇÕF¡tv²&#,n”öÀÌãË°ô¼Ø?7•7äúð¦­Ýø‰&;k×~ïU`m.äH?ËÈÒGà,àÈE9Ñäl¶/9%ƒxÀ¥
+¸ÔF?¥X–_P•Jñœ»A€à(ŽD)
+4GpûDû)n6°±cÅ+ÒÀÂëHD©xöáñ d-Üžj!—·lb
+?=Š¿häXìÉúü=ÆÑÒmí{B!½“Ñ`Å
+^XV‰j?ÊsÙÊ7Wxi@×k©ÕëH1A?þ)©ó“Š‘¯Žˆ«ÍXýD » Ï)vïºu•ÝäÑöV¿S5 ÿÔUcˆjGŸÒ–9ˆyrP<ú 6‚e܆‰V:ì–SŒ ž;\^ì{¾EÅ;o-’|i—"ŠË¤oú^Z³°ÔÚkÆÆ‘—Ð+Ž§Í÷§vÑçZŽDO[ EÌ[oäxM2N¿¡+0cvŽhCþžù3#Â×$}(ÛTTà"ÎOlæªQÔxÆQ^M4·åøLD™TbôNFë¬<e0°hº÷/g÷©®§v—bƒ´ó¼·K+/ ïoKðÈGì'µp~ T µÇ][A…àú.­‚mT´òìX^(5É´C®®_åæ´BòõÒ­@ºyn`NÓ6ƒƒ ùÃßpŠžxbÜƃ¯Ÿ½þ“Ø¥H›“ZpzGM#9¾„=Âg‹Ü‹î¼;V'm‡Kûð%ß®¹.fZJ q•H¤1Ù¿O¤°™Óà[?k4j
+˜Ð–ÎŒüuFupÞÃÆÚ¸Fw¼«ÀBj‡;=bÎå‚$îÁ¢ªö|¨I(nSJ߃–&@`õ»NÉñJ‡ì¢Œ%ÕpØ„„ÁäÈqê‡è|é™Ê6|¡ †Å6Ç£s¨GòW‚YÙrö‡×Ê„0Gµ›n x»’
+0®*›&1Áó:HfR ôT½÷Ò#’w#™ýV-/Šjy‡Í0éÃ3—»~õ™X bh+)‰Yr{NÉC²ØíUnss@°å>Ú*¸¬ê ÞQZÕc£ÿ8Ê©¹¬Ïáåà¶(°äÙ¯ `ü o|áê7Ûk¬·ŒcIWRáŽE¦Z6»°ÒH¾ @âPg¢Bw›¬Uµ®û4¹TŸ¿Á€/Ù uW}é*„tã¡ÈQÂX¦KQ™ÒãÀÁ3-Jb+U9Þzo.Ø#‡¥ã¯RãVVRnb):È8â` I)b£Xó6î¡\<^~ÓyZÚ$E[Ñ0?C3§q®K‡@Zéz?×?´c`?Ða
+†*÷µgÙ»£ýMÅNà²zÐñ) #•gF缩zÇ•ÝÐ
+â¡ê b¾L«ì!è‹e;— 9dÒ~B.‚‘Ñ`S¿ ¹šc/
+Ç»¾eëë&/‘@þ*ñÌ5AଖHcø°RP†ÌTôËGQ/œs‘Ë}âÈ9¤Æý¢ààØ%9`—¶Óˆ!¥Ž®Q×=öäJi‡y¿4ªù*¢N6Š’ÃGn4‰ð
+ý–¤ÜÄx®AnQ13tY½í†¿ØקÛÈÄ“UºF9ãylu?ÒlŠd!r›ÎáxDå6ñ?ÁÝCäöxDûDA˜@«Åܯª#Û¾3þ×ÅØÉ-w.ªøšÒB+²;_£¤£I{îrG
+‘¾.jé
+8šÃ­Ó¾‹ÃÁž‡”bÅú›;ÚrBXó¾ùÛˆ«ÃG8˜"Þ¨q„S,c¬j`oñX$V¹ª$fhÙ‚ûYT.4MðÕ—ý¡¡v¯¥œèT©Sf¤·ˆ¹2w0¢eŸoÏ€‡píÐ^Ïd§²¨¥­”öç ¤çbÁˆá^SÏ=yAt£¥™ ¯BMôÞßЇMŽž\Óp–Ä5aÌ£˜úÏm¡Ç…ŸK¶8ÖœØ`å[^
+2ï¾G¹^M&;#­Ô)9 Þ‘ƒFˆ¶Ã¤ýµDØiBÛ«%i Ú=˜ÞÁé Ú!Qç¯+Î)}Ot”xæ>÷ßÆT@1E¡¨F æ-_Aæ 8€KPI×?œ¿‹}Mg,Ñ8<.G/êLÝR V^Õá€rP“µ@åÃi\_1©¸±ƒó×XŽ½\_@9ú¥5’ßÀYî3±GU!x™ìÆX}iz“L‰ˆ’dšF¿¸:ñ×}Õ6R0‹ÏCªeZé±¥Š @¦c•–y^ô#èMî)¬“C#ù„M=y¼ü,k
+´ƒ‹,›ÇûK:¿ Rj˜8XOÔÌ.Ӊ‘YÒ5ý2¥^ … ãÛ½»ôsùý(<A‘Ã}scõ`yØ’ÁlB…ZÇš¥”ü(1²Z0ÿ1½$¤tzD*Š“™—à ãÒ°²‰w±˜lÀù°´¤8œïiúQ]°þÐÏ,!ÄY{¨:†
+Ç)íÊŽcXÙéM®N|ös Á1º¨b®5ÞéÈÒÔÕl‚6ÐsAàÀÓ‚&ÒÏ“,ôEàÔ7ÂÜS/³0[o“àZ¸rÆýmÛÓ½AÈ^©zÛW›¯}`A-7P¨<ƒ— 4 t… u'˲èjéK³(fàS«_Ë~æWn´ËkBƒVÅ<‡Û³ÉR¯¾îôÖCí1\¼¹Y!ÞZº/”æýW½OFË¥Lç÷‚ÖÓ¡—,B±!R Ž{¿åe‹¿9Dk)¡ÚÚ0¾º9O?,z€÷+ILž›K» ²kÁó˜±jQÔ‰“ìt™æm¿žëÞ•x›1¼èvÛ«<šã0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+265 0 obj
+<<
+/Length1 1097
+/Length2 5221
+/Length3 533
+/Length 6851
+>>
+stream
+%!PS-AdobeFont-1.1: CMSL9 1.0
+%%CreationDate: 1991 Aug 20 16:41:23
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSL9) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -9.46 def
+/isFixedPitch false def
+end readonly def
+/FontName /HGHLSL+CMSL9 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 45 /hyphen put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+readonly def
+/FontBBox{-61 -250 1150 750}readonly def
+/UniqueID 5000797 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÎ僥É99>'´~ ¤}(Jܤ—×r¼¨ÅC8ŽmÀÑâÄ”G@G ö^û7°…+§©  6Ð}¦¼µ) ¹µžþXw4z<^efªÓ2þo¼ÎÑAx‚*;Öxu&=k½ K¼öä‡î­`ñ»<ZvfÝ®¦Jk{ CŸ¢ˆ‹ŒÃ’2»ƒ÷iZºð& Õ$‹ždœØ
+ÐÅÎ’ Љ0â†>©+¼m»ÙlOaŠƒA{FÜÄÂ&ÃS´mÍ=Ü­Íe²ú…ˆ@Ä ±Õî·zÐûý´IVžó±Šü½i}Cn¡¼24½
+îÁªÆ꤇6WV-
+»jp\¥ƒ£D¬Òé™o,7La‡XÙëÖ‡Ïûy¬qó¦ûQ÷ ¾Ðå9Œöbݯb±Ý€Dö‡Ý@+†7UNe„Pý…Q\sö5):ÞÅMÐmì Y¤››î“ô7mð ï[rg8o"„p,_iؽѣG
+ßÄŽ J»àÓúíE1 ¡àmŒ•¬`‰ñ/‚ïã”Òÿ4ýqŠ8'V,B— ³ß„GãNH8ìÌvŠR¬b¶§9LUB¡_¾¥üJ”0B·üé„?Â{&©Ã)­<ºXÿHF‰:5jdU®z+YW”Õ2wÄØdñ·dËú5 [×å’ ð¯LÚq o WÏ(K ÷˜üšÍ@`pU¤j¥&Áÿ]8*Ñ^¹oWü¹ÁÜƯ̫ _GNÓšYÍ¡üi½UÊ7¹²SgÃÉѯ½¤góüÛèÝüÛìÿOà9Aòê2ß:Š:ê…¾µ¡ŸnƒXÆîêêŸóœ˜ƒòú—Ý7óU"“´=£—dZOþøû SZòwg5†þp–-z_^j;8É¿æ$Tíj¯· Î"q9šzpseѵ’¯õ6‘/W2 Å…A ýðã #3ü™3½Nc¿Éþ'å¨#½îMhd[° Q·V|ªb™.Ñ©æz$[mN¾çùçO¾à’Ï@’†›·ÑB¡„¾T±’ZÐ`š% ñ·wÐ`M) \=ý^od‘•5<(˜é–#Ç|œ/èÉH”CL«½R7pÖ0¦Í u¹WH™0K¸¼9¯˜{M2ûš¿àn_¡le½r?œ>'iµüú±tì†Úg6šC L‰clcªôY'¾ÃË29™ŠUp]¬"7tS—“
+è^g2›inÉU¤¤O–N‘Ê.Ö"¯œÅ+?ltwyèÕppêE}G?Èí2:‰]ÈO€Ò^ÌO ÇÒ=¹)*CSC÷âÞð„®—Ñ‡)
+l±,{Žt1`½Çdôî†Íï|ÖÖ_¤fTJKtPfüêÍ“«Øôå eHÐïĽ,š” ë_wÁi€¥ LwµIi×ÙÏxº{<ñ0Hõ™úë¼zýÜj”:ÍW!Nìè·®ä!hU”Tn¶Úý÷Ìr‚J·Þûè¿oçp¦‚05f¨Š¿€[©¬¥oE~6–²ãG«=ñéŒÎNM挬8:™AGˆqIEäè•g8çÛ—ÚD½¿ sÁ6ß-æÓ’En.›Ù¼é‚`SÑ“AÓ­ÏÜ!ý÷'>!woW•bÀw«œÝ{%:”CX%3Ô,Nµ¦(”ª¤ØMÃø'g_aG±Bû¬~’ìžX¶Ëïnû‡w¤YÕ/”og®ˆ èCQkêöà0‚ËÙ¿]©¤è©…)e×Ôq»‘µ6ÓXU@0f&Rˆ±Êì
+2M
+ܽ¸ˆ¡B–0R+º‹£»z~ç Ɔžˆé¹ÿ ¯lkv
+™³Ž¥'DÅ3ˆÇKZaqż6œN䮡*Ã*IšÊ2/$ŽúMTm-1”ë vú¯¼ÏIÑ!›j¨²f”q`€Cý£.ÙG¬M%æÐA|hÓŠ€¬6÷”ŸØ’ƒO¶‹G²Uì6ÖäÔ!›ï†úð9ÐuÇ bš(2 6Ñ8°’ž‚A„v뼡p9ÿ“‚§-r†žñ¸|Aå^–ê³o¤ñx¢¨‚ÇZ¾
+ïº+ÛÝ ïš“ºÿR{9ÍZL¡ç‘¤Úæ
+Ï_Ší[€æú!Á#\ú* f78D?<d¤ÕûËúù„ZtÌB­3T0L‚fø6_žòk:|—~*û¡ )åmó†.æ½lŠ«ýïóø¿
+u¨¨jÎÒÆ
+É÷‘ãî›3«†±ï}1.¶ª<›ÅQ ‰Íð=²@'uªçÄ´±Æ´´=Û*¥Ÿ*‹¡RÜDžÌºŠýËÉC„œ:ãA‰>z–¡Þ¶é̳QtwIZ½R¾EU —GQpOšxÖqt•|2:„x³®Óáèõ&
+®Lq:|ÒÁïs1Moõ\N”£Ow<Í{‘Ë ¹+}Û½-ƒ=Ÿ%¯
+Jñ™TÁðÛ™Û€O ÜO˨qЃ #X«¬§uñïç$€µ_¸T$¶árFU¾dåÏv tŸÛ¯c@ô®¢ç0î§/ì!BãL¼^‚Ø8¥ˆ¿Snä^^¿üµ&M €•/¾*aôTЋ,ŽùGIzXtMb«¬šÎ&k'ljÝ“2ÎÉ ±¤BoK^‘±
+̽“ÓH¦~þ{]ŽN©Š rèiÁçÊr£5z:“'Â99$TR³Ék#ºeì_„i|œ01dŸi/dEsàáÎÓqïD¢¸¾•Ê† v<8¶;d¨ÿ2q¢°ÔήMZ+äÔ^/URì'—ýîÞãbÖ÷-„A4ðg‚©1  9Tim¼ˆ
+Æ0KkP“ÚÃ>Æ•{Àl<?Ú¯P¿¬x'?ž]ß¾®0qˆ ;Ó~ÿ“5*”ŸZ,"D%$%X8¤àÌz6xkY]™UÀæJm‘Á¾UGiŸ\-Pîá@ÂC±«z, 6qFBè'ÿ —ˆ,_×qV|éòEÍ /M¨ñŸ+*6‰j ƒ!õwz¯ø$£F x·p…f-Wå>|^ÕñÃa¬Pæ/‰S[,#^W ôÐ}$îSrK(Nc?•þ¬}3ì°†F56ää£Ë/È°«ãÒŠÒ÷‰4²ÞØÀisªâcÖÛÛyÞÔA¥€¿-<Í[0þ×ÀQA…hC|rrZ@Öß„%O$æN9î™ÐX=³£‡‚›Awà/}礖=¸d•Ã§Ø»ÕÁ™>ýxû¤{q•sخۧý+
+Iu>÷Uõæˆ~á `.û2‚åÏÖtʼn4¡‘íΚ«\› €<\v¡õÌ3¦ÑrËøNõ±vœHà?V¿‡ƒ^ÍR^¯Á·ìÕýµ ÚEª†5µ»c~Ó àP¸98¨'-,¬¾X!Jfò40»¡„·
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+292 0 obj
+<<
+/Length1 778
+/Length2 1052
+/Length3 533
+/Length 2363
+>>
+stream
+%!PS-AdobeFont-1.1: CMBXTI10 1.0
+%%CreationDate: 1991 Aug 18 17:46:30
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMBXTI10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /LWIKPI+CMBXTI10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 46 /period put
+readonly def
+/FontBBox{-29 -250 1274 754}readonly def
+/UniqueID 5000771 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÎ僥É99>'´~ ¤}(Jܤ—×r¼¨ÅC8ŽmÀÑâÄ”G@G ö^û7°…+§©  6Ð}¦¼µ) ¹µžþXw4z<^efªÓ2þo¼ÎÑAx‚*;Öxu&=k½ K¼öä‡î­`ñ»<ZvfÝ®¦Jk{ CŸ¢ˆ‹ŒÃ’2»ƒ÷iZºð& Õ$‹ždœÛ©‘L¸Ö×sÖyüÃF>›õÀ{ŠY»T€+õ¹ô"Œ‹‹j“õËnLìíóíLEÔ6§«[¥gô¡’PÖ {-µíZQ¢Í5)Ñà4Œ·¤ÉdÔ¤j˜`B<!(èþ¦ÂþÓ.Ã$É8¿Êœ >F”;4ïóS¦PH¤zg17g› ?UÕAXqž1ÐÔÓûì[¯D¾¹ñwÞ-€<žÿ§¿‰½p>€[£š?ª?­·Ò°¶q^D%5'?¬ÚÀq•€o’ç‰h/ŸfÞ
+ÉÌÊsQíiqvjaøÒ¡»¯ãÕé
+¥9¿µ__hXž!ÿÆZ!V_8Ÿo çø—‡`ÔÀ%d72Ý›r€ æsúÆ­WD|êó°sÐ46FéÞ@¶ŸGU‘Y
+H†ñ˜µy¥gêëô(gâša£‘µÜ-rpL.f¦eµV]гi‘‹Ú$p
+Þyß
+4ø§áJIo·ö ¸^p$ÉEI‡Ù¨ÿà«°’Õ žÅ³7zSÇϾ• B*ª:·r‹Ï}Ä*vIÊ=«=˼C‡ÆËY-Œ““SOæÚvjéÓO4ÕÑFÛÂ}Á;®3R© û}-ÚîsõöG5&íE·ã;šÙ=¶½ÚšµnøÒ` d¿ öòéu±;>_!0]ëÜÑËnC¨ÁØå`DIê¦búz†¸„ º¸]寷~4lA’HÐ-äFXá¿]ûü³®ÝÈGÀZÒl¥ÌÜÓ¯Ë
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+1 0 obj
+<<
+/Creator ( TeX output 1999.09.19:2152)
+/Producer (dvipdfm \(null\), Copyright \251 1998, by Mark A. Wicks)
+/CreationDate (D:19990919215248+00'00')
+>>
+endobj
+5 0 obj
+<<
+/Type /Page
+/Resources 6 0 R
+/Contents [13 0 R 4 0 R 14 0 R 15 0 R]
+/Parent 302 0 R
+>>
+endobj
+17 0 obj
+<<
+/Type /Page
+/Resources 18 0 R
+/Contents [13 0 R 4 0 R 22 0 R 15 0 R]
+/Parent 302 0 R
+>>
+endobj
+24 0 obj
+<<
+/Type /Page
+/Resources 25 0 R
+/Contents [13 0 R 4 0 R 32 0 R 15 0 R]
+/Parent 302 0 R
+>>
+endobj
+302 0 obj
+<<
+/Type /Pages
+/Count 3
+/Kids [5 0 R 17 0 R 24 0 R]
+/Parent 301 0 R
+>>
+endobj
+34 0 obj
+<<
+/Type /Page
+/Resources 35 0 R
+/Contents [13 0 R 4 0 R 36 0 R 15 0 R]
+/Parent 303 0 R
+>>
+endobj
+38 0 obj
+<<
+/Type /Page
+/Resources 39 0 R
+/Contents [13 0 R 4 0 R 40 0 R 15 0 R]
+/Parent 303 0 R
+>>
+endobj
+42 0 obj
+<<
+/Type /Page
+/Resources 43 0 R
+/Contents [13 0 R 4 0 R 53 0 R 15 0 R]
+/Parent 303 0 R
+>>
+endobj
+55 0 obj
+<<
+/Type /Page
+/Resources 56 0 R
+/Contents [13 0 R 4 0 R 60 0 R 15 0 R]
+/Parent 303 0 R
+>>
+endobj
+303 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [34 0 R 38 0 R 42 0 R 55 0 R]
+/Parent 301 0 R
+>>
+endobj
+62 0 obj
+<<
+/Type /Page
+/Resources 63 0 R
+/Contents [13 0 R 4 0 R 64 0 R 15 0 R]
+/Parent 304 0 R
+>>
+endobj
+66 0 obj
+<<
+/Type /Page
+/Resources 67 0 R
+/Contents [13 0 R 4 0 R 68 0 R 15 0 R]
+/Parent 304 0 R
+>>
+endobj
+70 0 obj
+<<
+/Type /Page
+/Resources 71 0 R
+/Contents [13 0 R 4 0 R 72 0 R 15 0 R]
+/Parent 304 0 R
+>>
+endobj
+74 0 obj
+<<
+/Type /Page
+/Resources 75 0 R
+/Contents [13 0 R 4 0 R 79 0 R 15 0 R]
+/Parent 304 0 R
+>>
+endobj
+304 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [62 0 R 66 0 R 70 0 R 74 0 R]
+/Parent 301 0 R
+>>
+endobj
+81 0 obj
+<<
+/Type /Page
+/Resources 82 0 R
+/Contents [13 0 R 4 0 R 83 0 R 15 0 R]
+/Parent 305 0 R
+>>
+endobj
+85 0 obj
+<<
+/Type /Page
+/Resources 86 0 R
+/Contents [13 0 R 4 0 R 87 0 R 15 0 R]
+/Parent 305 0 R
+>>
+endobj
+89 0 obj
+<<
+/Type /Page
+/Resources 90 0 R
+/Contents [13 0 R 4 0 R 91 0 R 15 0 R]
+/Parent 305 0 R
+>>
+endobj
+93 0 obj
+<<
+/Type /Page
+/Resources 94 0 R
+/Contents [13 0 R 4 0 R 101 0 R 15 0 R]
+/Parent 305 0 R
+>>
+endobj
+305 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [81 0 R 85 0 R 89 0 R 93 0 R]
+/Parent 301 0 R
+>>
+endobj
+301 0 obj
+<<
+/Type /Pages
+/Count 15
+/Kids [302 0 R 303 0 R 304 0 R 305 0 R]
+/Parent 3 0 R
+>>
+endobj
+103 0 obj
+<<
+/Type /Page
+/Resources 104 0 R
+/Contents [13 0 R 4 0 R 105 0 R 15 0 R]
+/Parent 307 0 R
+>>
+endobj
+107 0 obj
+<<
+/Type /Page
+/Resources 108 0 R
+/Contents [13 0 R 4 0 R 109 0 R 15 0 R]
+/Parent 307 0 R
+>>
+endobj
+111 0 obj
+<<
+/Type /Page
+/Resources 112 0 R
+/Contents [13 0 R 4 0 R 113 0 R 15 0 R]
+/Parent 307 0 R
+>>
+endobj
+307 0 obj
+<<
+/Type /Pages
+/Count 3
+/Kids [103 0 R 107 0 R 111 0 R]
+/Parent 306 0 R
+>>
+endobj
+115 0 obj
+<<
+/Type /Page
+/Resources 116 0 R
+/Contents [13 0 R 4 0 R 117 0 R 15 0 R]
+/Parent 308 0 R
+>>
+endobj
+119 0 obj
+<<
+/Type /Page
+/Resources 120 0 R
+/Contents [13 0 R 4 0 R 121 0 R 15 0 R]
+/Parent 308 0 R
+>>
+endobj
+123 0 obj
+<<
+/Type /Page
+/Resources 124 0 R
+/Contents [13 0 R 4 0 R 125 0 R 15 0 R]
+/Parent 308 0 R
+>>
+endobj
+127 0 obj
+<<
+/Type /Page
+/Resources 128 0 R
+/Contents [13 0 R 4 0 R 129 0 R 15 0 R]
+/Parent 308 0 R
+>>
+endobj
+308 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [115 0 R 119 0 R 123 0 R 127 0 R]
+/Parent 306 0 R
+>>
+endobj
+131 0 obj
+<<
+/Type /Page
+/Resources 132 0 R
+/Contents [13 0 R 4 0 R 133 0 R 15 0 R]
+/Parent 309 0 R
+>>
+endobj
+135 0 obj
+<<
+/Type /Page
+/Resources 136 0 R
+/Contents [13 0 R 4 0 R 137 0 R 15 0 R]
+/Parent 309 0 R
+>>
+endobj
+139 0 obj
+<<
+/Type /Page
+/Resources 140 0 R
+/Contents [13 0 R 4 0 R 141 0 R 15 0 R]
+/Parent 309 0 R
+>>
+endobj
+143 0 obj
+<<
+/Type /Page
+/Resources 144 0 R
+/Contents [13 0 R 4 0 R 145 0 R 15 0 R]
+/Parent 309 0 R
+>>
+endobj
+309 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [131 0 R 135 0 R 139 0 R 143 0 R]
+/Parent 306 0 R
+>>
+endobj
+147 0 obj
+<<
+/Type /Page
+/Resources 148 0 R
+/Contents [13 0 R 4 0 R 149 0 R 15 0 R]
+/Parent 310 0 R
+>>
+endobj
+151 0 obj
+<<
+/Type /Page
+/Resources 152 0 R
+/Contents [13 0 R 4 0 R 153 0 R 15 0 R]
+/Parent 310 0 R
+>>
+endobj
+155 0 obj
+<<
+/Type /Page
+/Resources 156 0 R
+/Contents [13 0 R 4 0 R 157 0 R 15 0 R]
+/Parent 310 0 R
+>>
+endobj
+159 0 obj
+<<
+/Type /Page
+/Resources 160 0 R
+/Contents [13 0 R 4 0 R 161 0 R 15 0 R]
+/Parent 310 0 R
+>>
+endobj
+310 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [147 0 R 151 0 R 155 0 R 159 0 R]
+/Parent 306 0 R
+>>
+endobj
+306 0 obj
+<<
+/Type /Pages
+/Count 15
+/Kids [307 0 R 308 0 R 309 0 R 310 0 R]
+/Parent 3 0 R
+>>
+endobj
+163 0 obj
+<<
+/Type /Page
+/Resources 164 0 R
+/Contents [13 0 R 4 0 R 165 0 R 15 0 R]
+/Parent 312 0 R
+>>
+endobj
+167 0 obj
+<<
+/Type /Page
+/Resources 168 0 R
+/Contents [13 0 R 4 0 R 169 0 R 15 0 R]
+/Parent 312 0 R
+>>
+endobj
+171 0 obj
+<<
+/Type /Page
+/Resources 172 0 R
+/Contents [13 0 R 4 0 R 173 0 R 15 0 R]
+/Parent 312 0 R
+>>
+endobj
+312 0 obj
+<<
+/Type /Pages
+/Count 3
+/Kids [163 0 R 167 0 R 171 0 R]
+/Parent 311 0 R
+>>
+endobj
+175 0 obj
+<<
+/Type /Page
+/Resources 176 0 R
+/Contents [13 0 R 4 0 R 180 0 R 15 0 R]
+/Parent 313 0 R
+>>
+endobj
+182 0 obj
+<<
+/Type /Page
+/Resources 183 0 R
+/Contents [13 0 R 4 0 R 184 0 R 15 0 R]
+/Parent 313 0 R
+>>
+endobj
+186 0 obj
+<<
+/Type /Page
+/Resources 187 0 R
+/Contents [13 0 R 4 0 R 188 0 R 15 0 R]
+/Parent 313 0 R
+>>
+endobj
+190 0 obj
+<<
+/Type /Page
+/Resources 191 0 R
+/Contents [13 0 R 4 0 R 192 0 R 15 0 R]
+/Parent 313 0 R
+>>
+endobj
+313 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [175 0 R 182 0 R 186 0 R 190 0 R]
+/Parent 311 0 R
+>>
+endobj
+194 0 obj
+<<
+/Type /Page
+/Resources 195 0 R
+/Contents [13 0 R 4 0 R 196 0 R 15 0 R]
+/Parent 314 0 R
+>>
+endobj
+198 0 obj
+<<
+/Type /Page
+/Resources 199 0 R
+/Contents [13 0 R 4 0 R 200 0 R 15 0 R]
+/Parent 314 0 R
+>>
+endobj
+202 0 obj
+<<
+/Type /Page
+/Resources 203 0 R
+/Contents [13 0 R 4 0 R 204 0 R 15 0 R]
+/Parent 314 0 R
+>>
+endobj
+206 0 obj
+<<
+/Type /Page
+/Resources 207 0 R
+/Contents [13 0 R 4 0 R 208 0 R 15 0 R]
+/Parent 314 0 R
+>>
+endobj
+314 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [194 0 R 198 0 R 202 0 R 206 0 R]
+/Parent 311 0 R
+>>
+endobj
+210 0 obj
+<<
+/Type /Page
+/Resources 211 0 R
+/Contents [13 0 R 4 0 R 212 0 R 15 0 R]
+/Parent 315 0 R
+>>
+endobj
+214 0 obj
+<<
+/Type /Page
+/Resources 215 0 R
+/Contents [13 0 R 4 0 R 216 0 R 15 0 R]
+/Parent 315 0 R
+>>
+endobj
+218 0 obj
+<<
+/Type /Page
+/Resources 219 0 R
+/Contents [13 0 R 4 0 R 220 0 R 15 0 R]
+/Parent 315 0 R
+>>
+endobj
+222 0 obj
+<<
+/Type /Page
+/Resources 223 0 R
+/Contents [13 0 R 4 0 R 224 0 R 15 0 R]
+/Parent 315 0 R
+>>
+endobj
+315 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [210 0 R 214 0 R 218 0 R 222 0 R]
+/Parent 311 0 R
+>>
+endobj
+311 0 obj
+<<
+/Type /Pages
+/Count 15
+/Kids [312 0 R 313 0 R 314 0 R 315 0 R]
+/Parent 3 0 R
+>>
+endobj
+226 0 obj
+<<
+/Type /Page
+/Resources 227 0 R
+/Contents [13 0 R 4 0 R 228 0 R 15 0 R]
+/Parent 317 0 R
+>>
+endobj
+230 0 obj
+<<
+/Type /Page
+/Resources 231 0 R
+/Contents [13 0 R 4 0 R 232 0 R 15 0 R]
+/Parent 317 0 R
+>>
+endobj
+234 0 obj
+<<
+/Type /Page
+/Resources 235 0 R
+/Contents [13 0 R 4 0 R 236 0 R 15 0 R]
+/Parent 317 0 R
+>>
+endobj
+317 0 obj
+<<
+/Type /Pages
+/Count 3
+/Kids [226 0 R 230 0 R 234 0 R]
+/Parent 316 0 R
+>>
+endobj
+238 0 obj
+<<
+/Type /Page
+/Resources 239 0 R
+/Contents [13 0 R 4 0 R 240 0 R 15 0 R]
+/Parent 318 0 R
+>>
+endobj
+242 0 obj
+<<
+/Type /Page
+/Resources 243 0 R
+/Contents [13 0 R 4 0 R 244 0 R 15 0 R]
+/Parent 318 0 R
+>>
+endobj
+246 0 obj
+<<
+/Type /Page
+/Resources 247 0 R
+/Contents [13 0 R 4 0 R 248 0 R 15 0 R]
+/Parent 318 0 R
+>>
+endobj
+250 0 obj
+<<
+/Type /Page
+/Resources 251 0 R
+/Contents [13 0 R 4 0 R 252 0 R 15 0 R]
+/Parent 318 0 R
+>>
+endobj
+318 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [238 0 R 242 0 R 246 0 R 250 0 R]
+/Parent 316 0 R
+>>
+endobj
+254 0 obj
+<<
+/Type /Page
+/Resources 255 0 R
+/Contents [13 0 R 4 0 R 268 0 R 15 0 R]
+/Parent 319 0 R
+>>
+endobj
+270 0 obj
+<<
+/Type /Page
+/Resources 271 0 R
+/Contents [13 0 R 4 0 R 272 0 R 15 0 R]
+/Parent 319 0 R
+>>
+endobj
+274 0 obj
+<<
+/Type /Page
+/Resources 275 0 R
+/Contents [13 0 R 4 0 R 276 0 R 15 0 R]
+/Parent 319 0 R
+>>
+endobj
+278 0 obj
+<<
+/Type /Page
+/Resources 279 0 R
+/Contents [13 0 R 4 0 R 280 0 R 15 0 R]
+/Parent 319 0 R
+>>
+endobj
+319 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [254 0 R 270 0 R 274 0 R 278 0 R]
+/Parent 316 0 R
+>>
+endobj
+282 0 obj
+<<
+/Type /Page
+/Resources 283 0 R
+/Contents [13 0 R 4 0 R 284 0 R 15 0 R]
+/Parent 320 0 R
+>>
+endobj
+286 0 obj
+<<
+/Type /Page
+/Resources 287 0 R
+/Contents [13 0 R 4 0 R 288 0 R 15 0 R]
+/Parent 320 0 R
+>>
+endobj
+290 0 obj
+<<
+/Type /Page
+/Resources 291 0 R
+/Contents [13 0 R 4 0 R 295 0 R 15 0 R]
+/Parent 320 0 R
+>>
+endobj
+297 0 obj
+<<
+/Type /Page
+/Resources 298 0 R
+/Contents [13 0 R 4 0 R 299 0 R 15 0 R]
+/Parent 320 0 R
+>>
+endobj
+320 0 obj
+<<
+/Type /Pages
+/Count 4
+/Kids [282 0 R 286 0 R 290 0 R 297 0 R]
+/Parent 316 0 R
+>>
+endobj
+316 0 obj
+<<
+/Type /Pages
+/Count 15
+/Kids [317 0 R 318 0 R 319 0 R 320 0 R]
+/Parent 3 0 R
+>>
+endobj
+3 0 obj
+<<
+/Type /Pages
+/Count 60
+/Kids [301 0 R 306 0 R 311 0 R 316 0 R]
+/MediaBox [0 0 612 792]
+>>
+endobj
+13 0 obj
+<<
+/Length 1
+>>
+stream
+
+endstream
+endobj
+15 0 obj
+<<
+/Length 1
+>>
+stream
+
+endstream
+endobj
+4 0 obj
+<<
+/Length 18
+>>
+stream
+1 0 0 1 72 720 cm
+endstream
+endobj
+321 0 obj
+<<
+>>
+endobj
+322 0 obj
+null
+endobj
+323 0 obj
+<<
+>>
+endobj
+2 0 obj
+<<
+/Type /Catalog
+/Pages 3 0 R
+/Outlines 321 0 R
+/Threads 322 0 R
+/Names 323 0 R
+>>
+endobj
+xref
+0 324
+0000000000 65535 f
+0000635516 00000 n
+0000644549 00000 n
+0000644206 00000 n
+0000644414 00000 n
+0000635684 00000 n
+0000002827 00000 n
+0000492409 00000 n
+0000000009 00000 n
+0000000212 00000 n
+0000510513 00000 n
+0000001127 00000 n
+0000001334 00000 n
+0000644314 00000 n
+0000002253 00000 n
+0000644364 00000 n
+0000002784 00000 n
+0000635789 00000 n
+0000005701 00000 n
+0000523302 00000 n
+0000002891 00000 n
+0000003097 00000 n
+0000004056 00000 n
+0000005658 00000 n
+0000635896 00000 n
+0000011564 00000 n
+0000525453 00000 n
+0000005766 00000 n
+0000005970 00000 n
+0000542683 00000 n
+0000006627 00000 n
+0000006836 00000 n
+0000007757 00000 n
+0000011499 00000 n
+0000636092 00000 n
+0000011828 00000 n
+0000011629 00000 n
+0000011796 00000 n
+0000636199 00000 n
+0000016838 00000 n
+0000011893 00000 n
+0000016784 00000 n
+0000636306 00000 n
+0000027653 00000 n
+0000553613 00000 n
+0000016903 00000 n
+0000017108 00000 n
+0000556540 00000 n
+0000018141 00000 n
+0000018349 00000 n
+0000562220 00000 n
+0000019385 00000 n
+0000019595 00000 n
+0000020607 00000 n
+0000027566 00000 n
+0000636413 00000 n
+0000035295 00000 n
+0000573160 00000 n
+0000027718 00000 n
+0000027921 00000 n
+0000028507 00000 n
+0000035186 00000 n
+0000636617 00000 n
+0000044452 00000 n
+0000035360 00000 n
+0000044354 00000 n
+0000636724 00000 n
+0000052587 00000 n
+0000044517 00000 n
+0000052511 00000 n
+0000636831 00000 n
+0000056512 00000 n
+0000052652 00000 n
+0000056436 00000 n
+0000636938 00000 n
+0000065186 00000 n
+0000575773 00000 n
+0000056577 00000 n
+0000056781 00000 n
+0000057823 00000 n
+0000065109 00000 n
+0000637142 00000 n
+0000074715 00000 n
+0000065251 00000 n
+0000074650 00000 n
+0000637249 00000 n
+0000083844 00000 n
+0000074780 00000 n
+0000083779 00000 n
+0000637356 00000 n
+0000092126 00000 n
+0000083909 00000 n
+0000092061 00000 n
+0000637463 00000 n
+0000098283 00000 n
+0000579648 00000 n
+0000092191 00000 n
+0000092396 00000 n
+0000581866 00000 n
+0000093436 00000 n
+0000093641 00000 n
+0000094669 00000 n
+0000098192 00000 n
+0000637768 00000 n
+0000098551 00000 n
+0000098349 00000 n
+0000098518 00000 n
+0000637878 00000 n
+0000107009 00000 n
+0000098618 00000 n
+0000106942 00000 n
+0000637988 00000 n
+0000113238 00000 n
+0000107076 00000 n
+0000113183 00000 n
+0000638191 00000 n
+0000120696 00000 n
+0000113305 00000 n
+0000120619 00000 n
+0000638301 00000 n
+0000126188 00000 n
+0000120763 00000 n
+0000126111 00000 n
+0000638411 00000 n
+0000132286 00000 n
+0000126255 00000 n
+0000132220 00000 n
+0000638521 00000 n
+0000137583 00000 n
+0000132353 00000 n
+0000137506 00000 n
+0000638732 00000 n
+0000145879 00000 n
+0000137650 00000 n
+0000145802 00000 n
+0000638842 00000 n
+0000153896 00000 n
+0000145946 00000 n
+0000153808 00000 n
+0000638952 00000 n
+0000162854 00000 n
+0000153963 00000 n
+0000162777 00000 n
+0000639062 00000 n
+0000171767 00000 n
+0000162921 00000 n
+0000171712 00000 n
+0000639273 00000 n
+0000180901 00000 n
+0000171834 00000 n
+0000180824 00000 n
+0000639383 00000 n
+0000190157 00000 n
+0000180968 00000 n
+0000190080 00000 n
+0000639493 00000 n
+0000199353 00000 n
+0000190224 00000 n
+0000199276 00000 n
+0000639603 00000 n
+0000206640 00000 n
+0000199420 00000 n
+0000206574 00000 n
+0000639914 00000 n
+0000213584 00000 n
+0000206707 00000 n
+0000213507 00000 n
+0000640024 00000 n
+0000220322 00000 n
+0000213651 00000 n
+0000220256 00000 n
+0000640134 00000 n
+0000229802 00000 n
+0000220389 00000 n
+0000229714 00000 n
+0000640337 00000 n
+0000239919 00000 n
+0000585250 00000 n
+0000229869 00000 n
+0000230077 00000 n
+0000231018 00000 n
+0000239807 00000 n
+0000640447 00000 n
+0000248016 00000 n
+0000239986 00000 n
+0000247937 00000 n
+0000640557 00000 n
+0000251984 00000 n
+0000248083 00000 n
+0000251918 00000 n
+0000640667 00000 n
+0000257810 00000 n
+0000252051 00000 n
+0000257733 00000 n
+0000640878 00000 n
+0000263713 00000 n
+0000257877 00000 n
+0000263613 00000 n
+0000640988 00000 n
+0000270678 00000 n
+0000263780 00000 n
+0000270590 00000 n
+0000641098 00000 n
+0000272990 00000 n
+0000270745 00000 n
+0000272921 00000 n
+0000641208 00000 n
+0000279266 00000 n
+0000273057 00000 n
+0000279200 00000 n
+0000641419 00000 n
+0000289478 00000 n
+0000279333 00000 n
+0000289401 00000 n
+0000641529 00000 n
+0000298821 00000 n
+0000289545 00000 n
+0000298733 00000 n
+0000641639 00000 n
+0000302650 00000 n
+0000298888 00000 n
+0000302562 00000 n
+0000641749 00000 n
+0000309410 00000 n
+0000302717 00000 n
+0000309344 00000 n
+0000642060 00000 n
+0000312761 00000 n
+0000309477 00000 n
+0000312695 00000 n
+0000642170 00000 n
+0000316618 00000 n
+0000312828 00000 n
+0000316552 00000 n
+0000642280 00000 n
+0000322241 00000 n
+0000316685 00000 n
+0000322164 00000 n
+0000642483 00000 n
+0000327635 00000 n
+0000322308 00000 n
+0000327569 00000 n
+0000642593 00000 n
+0000334308 00000 n
+0000327702 00000 n
+0000334253 00000 n
+0000642703 00000 n
+0000343001 00000 n
+0000334375 00000 n
+0000342924 00000 n
+0000642813 00000 n
+0000343270 00000 n
+0000343068 00000 n
+0000343237 00000 n
+0000643024 00000 n
+0000371577 00000 n
+0000595111 00000 n
+0000343337 00000 n
+0000343542 00000 n
+0000605378 00000 n
+0000344585 00000 n
+0000344792 00000 n
+0000620407 00000 n
+0000345833 00000 n
+0000346044 00000 n
+0000626115 00000 n
+0000347056 00000 n
+0000347266 00000 n
+0000348308 00000 n
+0000371481 00000 n
+0000643134 00000 n
+0000395508 00000 n
+0000371644 00000 n
+0000395412 00000 n
+0000643244 00000 n
+0000420030 00000 n
+0000395575 00000 n
+0000419934 00000 n
+0000643354 00000 n
+0000442920 00000 n
+0000420097 00000 n
+0000442824 00000 n
+0000643565 00000 n
+0000470081 00000 n
+0000442987 00000 n
+0000469985 00000 n
+0000643675 00000 n
+0000475830 00000 n
+0000470148 00000 n
+0000475734 00000 n
+0000643785 00000 n
+0000489354 00000 n
+0000633060 00000 n
+0000475897 00000 n
+0000476111 00000 n
+0000477148 00000 n
+0000489263 00000 n
+0000643895 00000 n
+0000492342 00000 n
+0000489421 00000 n
+0000492274 00000 n
+0000637668 00000 n
+0000636003 00000 n
+0000636520 00000 n
+0000637045 00000 n
+0000637571 00000 n
+0000639814 00000 n
+0000638098 00000 n
+0000638631 00000 n
+0000639172 00000 n
+0000639713 00000 n
+0000641960 00000 n
+0000640244 00000 n
+0000640777 00000 n
+0000641318 00000 n
+0000641859 00000 n
+0000644106 00000 n
+0000642390 00000 n
+0000642923 00000 n
+0000643464 00000 n
+0000644005 00000 n
+0000644481 00000 n
+0000644504 00000 n
+0000644526 00000 n
+trailer
+<<
+/Size 324
+/Root 2 0 R
+/Info 1 0 R
+>>
+startxref
+644648
+%%EOF
diff --git a/contrib/bluegnu2.0.3/doc/dejagnu.ps b/contrib/bluegnu2.0.3/doc/dejagnu.ps
new file mode 100644
index 0000000..78471ab
--- /dev/null
+++ b/contrib/bluegnu2.0.3/doc/dejagnu.ps
@@ -0,0 +1,6690 @@
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.85 Copyright 1999 Radical Eye Software
+%%Title: dejagnu.dvi
+%%Pages: 60
+%%PageOrder: Ascend
+%%BoundingBox: 0 0 596 842
+%%DocumentPaperSizes: a4
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips -f dejagnu.dvi
+%DVIPSParameters: dpi=600, compressed
+%DVIPSSource: TeX output 1999.09.19:2152
+%%BeginProcSet: texc.pro
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3
+1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx
+0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx
+sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{
+rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp
+gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B
+/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{
+/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{
+A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy
+get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse}
+ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp
+fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17
+{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add
+chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{
+1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop}
+forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+TeXDict begin 39158280 55380996 1000 600 600 (dejagnu.dvi)
+@start
+%DVIPSBitmapFont: Fa cmtt12 14.4 6
+/Fa 6 118 df<EC1FF891B57E010314E0010F14F84980017F8090B7FC48D9F80F1380DA
+C00113C048496C13E04848C7123F4848EC1FF049140F484815F81607484815FCA2484814
+03A24915FEA200FF1501A290B7FCA517FCA290CAFC7FA2127FA27F123F6D15FCA26C6CEC
+01FE7F6C6C14036C6C14076DEC0FFC6C6D131F6C01E0EB7FF86C9039FC03FFF06DB612E0
+6D15C06D158001071500010114FC6D6C13E0020790C7FC2F3679B43E>101
+D<ED07FC3B3FFF803FFF804891B512E0B500C38002C78002CF806C01DF806C9038FFF80F
+D8003F9038C003FFED00014A7F4A815C177F5CA25CA35CB3A8003FB5D8C07FB51280486E
+B612C0B66C15E0A36C4A15C06C4A6C14803B347FB33E>110 D<EE07FE263FFFF890387F
+FFC0484AB512E0B5D8FC0714F05D4B14F86C5C6C91387FFC0FD80003EBFFC002FD903800
+07F0DAFFFEEB03E003F890C7FC5D5DA25D5DA292C9FCA25CA45CB3A3003FB612FC4881B7
+FCA37E6C5D35347CB33E>114 D<903901FFF00F011F9038FE1F8090B612BF000315FF5A
+5A5A393FFE003F01F01307D87FC0130190C8FC5A48157FA47EEE3F00D87FC091C7FC13F0
+EA3FFE381FFFF06CEBFFC06C14FE6C6E7EC615E0013F14F8010780D9003F7F02007F0307
+1380030013C0003EED3FE0007F151F48150F17F06D1407A37FA26D140F6D15E0161F01FC
+EC3FC06D14FF9026FFC00F138091B612005E485D013F5C6D14E0D8FC0714802778007FF8
+C7FC2C3677B43E>I<147C14FC497EAD003FB712FC5AB87EA36C5EA2260001FEC9FCB3A6
+173FA2EF7F80A76E14FF6D16006F5A9238C007FE91387FF01F92B55A6E5C6E5C6E5C6E14
+80020149C7FC9138003FF031437DC13E>I<263FFF80EB7FFF4892B5FCB56C4880A36C80
+6C81D8003FEC007FB3AC17FFA25E5E80011F140F6E5B02FE90B612806DB812C06D17E083
+010114FE6DDAF83F13C0023F01E01480020790C9FC3B347FB23E>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fb cmbxti10 14.4 1
+/Fb 1 47 df<13FCEA03FF000F13804813C05AA25AA2B5FCA31480A214006C5A6C5A6C5A
+EA0FE0121271912B>46 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fc cmsl9 9 23
+/Fc 23 122 df<ED1FE0913801FFF8913807F01E91381F80074A485A02FEEB3F80495A5C
+4948140013074A131E93C7FCA3130F5CA5011F147C000FB612FCA339001F80031501133F
+02005BA415035B017E5CA4150713FE495CA4150F1201495CA40003141F3A7FFFC3FFFEA2
+B5FC29357EB42B>12 D<387FFFF8A4B512F015057D921A>45 D<EB07FCEB3FFF9038F80F
+C03901C003E0D803F07F6D6C7EA248486C7E12035BC8FCA21401A2EC7FF8EB07FFEB3FE1
+EBFF013803F803EA0FF0D81FE05BEA3FC01380007F1560EB000748ECE0C05A140FA2141F
+007F90383BE180EC73E33A1F81E1FF00390FFF81FE3901FE007823237CA126>97
+D<137EEA1FFE5B123F1201A2120012015BA512035BA50007137F9038E1FFC09038E781F0
+9038FE00FC01F8137E49133E4848133FED1F805BA216C0A2121F5BA4153F003F158090C7
+FCA3ED7F00A24814FE007E5C4A5A007F13035D397B8007C039F1C01F8026E0E07EC7FC38
+C07FF838001FC0223578B32B>I<ECFF80010713E090381F807890383E001C01FC137C48
+4813FE485A0007EB01FCEBE000484813F8001F1400A2485AA2127F90C8FCA45A5AA3127E
+A2007F1430A26C147015E06C6C13C0380FC0033907E007003803F03E3800FFF8EB1FC01F
+237CA122>I<167EED1FFE16FC153F1501A416F8A41503A216F0A4150714FE903907FFC7
+E090381F81E790387E007749133F4848131F4848130F484814C0120F485AA24848131FA2
+007F158090C7FCA3153F5A481500A3127E5DA2157E6C14FE14016C13036C6C487E2607C0
+0E13F03803E07C3800FFF090393F80FC0027357BB32B>I<EB03FCEB0FFF90383E0FC090
+38FC03E0D801F813F03803F001D807E013F8380FC000121F5B123F48C7FCA312FEB6FCA2
+48C8FCA35AA51560127E15E0003EEB01C0003FEB03806CEB0700380F800E3807E07C3801
+FFF038003F801D237BA122>I<163C91387F01FF903901FFE3CF903907C1FF0F90391F80
+FC1F90393F007C0E017EEB3E005B153F485AA35D157E5BA25D6D5B0000495A90387C03E0
+9038FE0FC02601CFFFC7FC380383F80180C8FCA21207A37F90B57E6C14F015FC6C804880
+380F800048C7EA3F80003E141F48140F12FC5AA3151F16006C143E007C5C6C5C6CEB03F0
+3907E01FC00001B5C7FC38003FF028337FA126>103 D<EB01F8137F5C13FF1307A21303
+13075CA5130F5CA5011F13FE913883FF8091388F07E0EC9C0302B813F014F0EB3FE014C0
+1480A2140015075B017E14E0A4150F13FE4914C0A4151F1201491480A40003143F3A7FFF
+C7FFFCA2B5FC26347EB32B>I<EB0380EB0FC0EB1FE0A314C0A2EB070090C7FCAA131FEA
+07FFA3C67EA3137EA513FE5BA512015BA512035BA41207B5FCA313337EB215>I<EB03F0
+13FF14E0A2130FA21307130F14C0A5131F1480A5133F1400A55B137EA513FE5BA512015B
+A512035BA41207B51280A2140014347EB315>108 D<90260F80FFEB07F82603FF839038
+C01FFE48903A8F03E0781F913B9C01F0E00F8026007FB8D9F9C013C0D93FF0EBFB8002E0
+EBFF0002C05B02805BA202005BA2490103141F017E4A1480A501FE0107143F494A1400A5
+0001020F5C494A137EA40003021F14FE3D7FFFC3FFFE1FFFF0A2B500C75C3C217EA041>
+I<90380F80FE3A03FF83FF804890388F07E0EC9C0326007FB813F0EB3FF014E014C01480
+A2140015075B017E14E0A4150F13FE4914C0A4151F1201491480A40003143F3A7FFFC7FF
+FCA2B5FC26217EA02B>I<14FF010713C090381F81F090383E00F80178133C4848133E48
+487FA248481480120F4848130FED1FC0123F90C7FCA25AA400FEEC3F80A31600007E5C15
+7EA25D003E5C003F495A6C495A6C6C485A6C6C485A2603F03EC7FC3800FFF8EB3FC02223
+7CA126>I<903803E07F9039FFE1FFC0489038E781F09138FE00FC26000FF8137E6D5A49
+487F17805C161F17C0A2131F5CA4163F013F158091C7FCA2167F17005E495C017E495A5E
+017F13034B5A9039FF800FC06E485A9026FCE07EC7FCEC7FF8EC1FC091C9FC1201A25BA4
+1203A25B487EB512C05CA22A3080A02B>I<90383E03E03907FE1FF8143C000FEB71FC38
+007EE1EB7FC1EC81F815F091C7FCA2137EA213FE5BA512015BA512035BA41207B512C0A3
+1E217EA01E>114 D<903807F83890383FFF7890387C07F03801E0013803C00048481370
+A2120F90C712607FA26D130013F0EBFF806C13F86C13FE6C7F6C1480013F13C013019038
+001FE0140F003013071403A2007014C0A21278EC0780127CEC0F0000FE131E38F7807C38
+E1FFF038C07F801D237EA11E>I<13065BA4131CA25BA2137813F812011203485A381FFF
+FEB5FCA23803F000A212075BA5120F5BA5121FEB8018A41438003F13301300A214706C13
+60EB80E0380F81C0EBC3803803FF00EA00FC172F7AAD1E>I<D801F0131F007FEB07FF00
+FF5BA2000F1300000780A249137EA415FE120F495BA41401121F01805BA41403123F4948
+5AA2140F6C131F819039807FFF80380FC0E73803FFC7C6903807E000212279A02B>I<3A
+7FFF803FFCA2B538007FF8D807F8EB1FC06C48EB0F00150E150C7F00015C153815306D5B
+12005D140101FE5BD97E03C7FCA21406137F6D5A141C141814B0131F14E0A25C130F5C91
+C8FCA2130626217A9F29>I<3C7FFF1FFF80FFF0A2B5028113E03C0FF003FC007F800007
+6D48EB3E00171C0003010014185FA24A6C5B13F80001D9037C5BA20206495AA291260C7E
+03C7FCD800FC5C9138183E060238130E0230130C9138703F18EB7E604A6C5AA2D97F805B
+16E0D93F005B150F013E5CA2013C91C8FC131C0118130634217A9F37>I<3B03FFFC0FFF
+C014F85A3B003FE007F800010FEB03E0ED0780010791C7FC903803F00E6E5A01015B6E5A
+01005BEC7FC05D6EC8FC81141F4A7E4A7E14E7903801C7F0EB038390380701F8010E7FEB
+1C00497F0178137ED801F8137F00074A7E267FFC0113FC00FF5BA22A207F9F29>I<90B5
+EB7FF8A248EDFFF026000FF0EB3F806D48EB1E00161C6E13180103143816305E8001015C
+15015E6E48C7FC13001506150EECFE0CEC7E18A25D147F6E5A15E05D5D141F92C8FCA214
+0E140CA25C143814305CA25CEA3C01007C5BD8FC03C9FC5B130EEA701CEA7878EA3FE0EA
+0F802D30819F29>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fd cmti9 9 16
+/Fd 16 121 df<121C127F12FFA412FE12380808778718>46 D<EB03F0EB0FF890383E1C
+6090387C0FF0EBF807EA01F0EA03E00007EB03E0EA0FC0A2381F800715C0EA3F00A2140F
+481480127EA2141F00FE14005A1506EC3F07EC3E0F150E147E007C141EECFE1CEB01FCD8
+3C03133C393E07BE38391F0E1E783907FC0FF03901F003C0202278A027>97
+D<14FCEB07FF90381F078090383E03C0EBFC013801F8033803F0073807E00F13C0120F39
+1F80070091C7FC48C8FCA35A127EA312FE5AA4007C14C0EC01E0A2EC03C06CEB0F80EC1F
+006C137C380F81F03803FFC0C648C7FC1B2278A023>99 D<ED0FC0EC03FFA21680EC001F
+A31600A25DA2153EA2157EA2157CA215FCA2903803F0F8EB0FF8EB3E1DEB7C0F496C5AEA
+01F0EA03E000071303D80FC05BA2381F8007A2D83F005BA2140F5A007E5CA2141F12FE48
+91C7FC1506EC3F075DEC3E0E147E007C141EECFE1CEB01FCD83C03133C393E07BE38391F
+0E1E783907FC0FF03901F003C0223578B327>I<EB03F8EB0FFEEB3E0F9038F807803801
+F003EA03E0EA07C0120FEA1F801407D83F0013005C007E133EEB03F8387FFFE04848C7FC
+00FCC8FCA45AA4EC0180EC03C0A2007CEB0780EC1F00003C133E6C13F8380F03E03807FF
+80D801FCC7FC1A2277A023>I<EB0FC0EA03FFA25CEA001FA391C8FCA25BA2133EA2137E
+A2137CA213FCA29038F83F80ECFFE03901FBE0F09038FF80F8EC007849137C485A5B5BA2
+484813FC5D5BA2000F13015D1380A2001F13035DEB0007EDC0C048ECC1E0020F13C0003E
+1481A2007E1483ED0380007C1407160000FC140E151E48EB07F80070EB01F023357BB327
+>104 D<EB0180EB07E0A2130FEB07C0EB038090C7FCABEA01F0EA03FCEA0F1E120E121C
+123C1238EA783E1270A2137EEAF07CEA60FCC65AA212015BA212035BA2000713C0EBC1E0
+000F13C01381A21383EB038013071400130E131EEA07F8EA01F013337AB118>I<133FEA
+07FF5A13FEEA007EA3137CA213FCA213F8A21201A213F0A21203A213E0A21207A213C0A2
+120FA21380A2121FA21300A25AA2123EA2127EA2127C1318EAFC1C133CEAF838A2137813
+7012F013F0EAF8E01279EA3FC0EA0F00103579B314>108 D<2703C003F8137F3C0FF00F
+FE01FFC03C1E783C1F07C1E03C1C7CF00F8F01F03B3C3DE0079E0026383FC001FC7FD97F
+805B007001005B5E137ED8F0FC90380FC00100E05FD860F8148012000001021F13036049
+1400A200034A13076049013E130FF081800007027EEC83C0051F138049017C1403A2000F
+02FC1407053E130049495CEF1E0E001F01015D183C010049EB0FF0000E6D48EB03E03A22
+7AA03F>I<3903C007F0390FF01FFC391E787C1E391C7CF01F393C3DE00F26383FC01380
+EB7F8000781300EA707EA2D8F0FC131F00E01500EA60F8120000015C153E5BA20003147E
+157C4913FCEDF8180007153C0201133801C013F0A2000F1578EDE070018014F016E0001F
+ECE1C015E390C7EAFF00000E143E26227AA02B>I<011E137C90387F81FF9039F3C387C0
+9039E3EF03E03901E1FE01D9C1FC13F0EBC3F8000313F0018314F814E0EA078713070003
+13C01200010F130316F01480A2011F130716E01400A249EB0FC0A2013EEB1F80A2017EEB
+3F00017F133E5D5D9038FF81F09038FDC3E09038F8FF80027EC7FC000190C8FCA25BA212
+03A25BA21207A25BB5FCA325307FA027>112 D<3903C00FC0390FF03FF0391E78F07839
+1C7DE03C393C3FC0FC00381380EB7F00007814F8D8707E13701500EAF0FC12E0EA60F812
+001201A25BA21203A25BA21207A25BA2120FA25BA2121FA290C8FC120E1E227AA020>
+114 D<1303EB0F80A3131FA21400A25BA2133EA2137EA2137C387FFFF8A2B5FC3800F800
+A21201A25BA21203A25BA21207A25BA2120FA25B1460001F13F014E01300130114C01303
+001E1380EB07005BEA0F1EEA07F8EA01E015307AAE19>116 D<01F01338D803FC13FCEA
+0F1E120E121C123C0038147CEA783E0070143CA2137ED8F07C1338EA60FCC65A15780001
+14705BA215F0000314E05BA2EC01C0A2EBC003158014071500EBE00EA26C6C5A3800F878
+EB7FE0EB1F801E227AA023>118 D<D801F01538D803FC010E13FCD80F1E131E000E143E
+121C123C0038027E137CD8783E137C0070163CA2017E13FCD8F07C491338EA60FCC65A02
+01147800014A137013F0A2020314F0000316E001E05BA2160117C001C013C00207EB0380
+A29039E00FE0071700021F130E3A01F03DF01E3A00F878F83C90393FF03FF090390FC00F
+C02E227AA033>I<011F137C90387FC1FF3A01E1E787803A03C0F703C0903880FE0FEA07
+004813FC000E1580001E9038F80700001C91C7FC1301003C5B1218120013035CA31307A2
+5C1506010F130F150E14800038141ED87C1F131C00FC143C1538013F5B39F07FC0E03970
+F3C3C0393FE1FF80260F807EC7FC22227CA023>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fe cmr9 9 71
+/Fe 71 123 df<91393FE00FE0903A01FFF83FF8903A07E01EF83C903A1F800FF07E903A
+3F001FE0FE017E133F4914C0485A1738484890381F8000ACB812C0A33B03F0001F8000B3
+A7486C497EB50083B5FCA32F357FB42D>11 D<EC1FE0ECFFFC903803F01E90390FC00780
+EB1F8090393F000FC0017E131F5BA2485AED0F8092C7FCA9ED0FC0B7FCA33901F8001F15
+0FB3A6486CEB1FE0267FFFC1B5FCA328357FB42B>I<DA1FE013FF9126FFFC0713E0903B
+03F01E1F80F0903B0FC0077E003CD91F805B90273F001FF8137E017E4A13FE495CA24848
+5C030F147C95C7FCA9187EB912FEA33B01F8000FC000187EB3A6486C496C13FF297FFFC1
+FFFE0F13F8A33D357FB440>14 D<003C13F0387E01F838FF03FCA2EB83FEA2EA7F81383D
+80F600011306A40003130EEB000CA248131C00061318000E1338000C1330001C13704813
+E0387001C00060138017177EB326>34 D<123C127EB4FCA21380A2127F123D1201A41203
+1300A25A1206120E120C121C5A5A126009177AB315>39 D<14C01301EB0380EB0F00130E
+5B133C5B5BA2485A485AA212075B120F90C7FC5AA2121E123EA3123C127CA55AB0127CA5
+123C123EA3121E121FA27E7F12077F1203A26C7E6C7EA213787F131C7F130FEB0380EB01
+C01300124A79B71E>I<12C07E1270123C121C7E120F6C7E6C7EA26C7E6C7EA27F137813
+7C133C133EA2131E131FA37F1480A5EB07C0B0EB0F80A514005BA3131E133EA2133C137C
+137813F85BA2485A485AA2485A48C7FC120E5A123C12705A5A124A7CB71E>I<123C127E
+B4FCA21380A2127F123D1201A412031300A25A1206120E120C121C5A5A126009177A8715
+>44 D<123C127E12FFA4127E123C08087A8715>46 D<EB0FE0EB7FFCEBF83E3903E00F80
+3907C007C0EB8003000F14E0391F0001F0A24814F8A2003E1300007E14FCA500FE14FEB2
+007E14FCA56CEB01F8A36C14F0A2390F8003E03907C007C0A23903E00F803900F83E00EB
+7FFCEB0FE01F347DB126>48 D<13075B5B137FEA07FFB5FC13BFEAF83F1200B3B3A2497E
+007FB51280A319327AB126>I<EB3FC0EBFFF0000313FC380F80FF391E007F80001CEB3F
+C048EB1FE048130F15F00060130712FC6C14F87E1403A3007E1307123CC7FC15F0A2140F
+15E0EC1FC0A2EC3F801500147E5C495A5C495A495A495A49C7FC133E133C4913185B485A
+48481330485A48C7FC001C1470001FB512F05A5AB612E0A31D327CB126>I<EB1FE0EBFF
+FC4813FF3907E03F80390F001FC0001EEB0FE0001CEB07F0123F018013F8140313C01380
+A2381F0007C7FC15F0A2EC0FE015C0141FEC3F80EC7E00EB01F8EB7FE014FCEB003FEC1F
+C0EC0FE0EC07F015F8140315FC140115FEA3127EB4FCA415FC48130312780070EB07F86C
+14F0003C130F001FEB1FE0390FE03F800003B51200C613FCEB1FE01F347DB126>I<EC01
+C0A214031407A2140F141FA2143F147F146F14CF1301EB038F140F1307130E130C131C13
+381330137013E013C0EA0180120313001206120E120C5A123812305A12E0B71280A3C738
+0FC000A94A7E0107B51280A321337EB226>I<000C14C0380FC00F90B5128015005C5C14
+F014C0D80C18C7FC90C8FCA9EB0FC0EB7FF8EBF07C380FC03F9038001F80EC0FC0120E00
+0CEB07E0A2C713F01403A215F8A41218127E12FEA315F0140712F8006014E01270EC0FC0
+6C131F003C14806CEB7F00380F80FE3807FFF8000113E038003F801D347CB126>I<14FE
+903807FF80011F13E090383F00F0017C13703901F801F8EBF003EA03E01207EA0FC0EC01
+F04848C7FCA248C8FCA35A127EEB07F0EB1FFC38FE381F9038700F809038E007C039FFC0
+03E0018013F0EC01F8130015FC1400A24814FEA5127EA4127F6C14FCA26C1301018013F8
+000F14F0EBC0030007EB07E03903E00FC03901F81F806CB51200EB3FFCEB0FE01F347DB1
+26>I<1230123C003FB6FCA34814FEA215FC0070C7123800601430157015E04814C01401
+EC0380C7EA07001406140E5C141814385CA25CA2495A1303A3495AA2130FA3131F91C7FC
+A25BA55BA9131C20347CB126>I<EB0FE0EB7FFC90B5FC3903F01F803907C007C0390F00
+03E0000EEB01F0001E1300001C14F8003C1478A3123EA2003F14F86D13F0EBC001D81FF0
+13E09038F803C0390FFE07803907FF0F006C13DE6C13F87EEB3FFE8001F713C0D803E313
+E0D8078013F0390F007FF8001E131F003EEB07FC003C1303481301EC007E12F848143EA2
+151EA37E153C1278007C14787E6C14F0390F8003E03907F01FC00001B5120038007FFCEB
+1FE01F347DB126>I<EB0FE0EB7FF8EBFFFE3803F83F3907E00F80390FC007C0D81F8013
+E0EC03F0EA3F0048EB01F8127EA200FE14FC1400A415FEA5007E1301A2127F7E1403EA1F
+80000F13073807C00E3803E01C3801F03838007FF090381FC0FC90C7FC1401A215F8A215
+F01403001F14E0383F800715C0140FEC1F809038003F00001C137E381F01FC380FFFF000
+0313C0C690C7FC1F347DB126>I<123C127E12FFA4127E123C1200B0123C127E12FFA412
+7E123C08207A9F15>I<15E0A34A7EA24A7EA34A7EA3EC0DFE140CA2EC187FA34A6C7EA2
+02707FEC601FA202E07FECC00FA2D901807F1507A249486C7EA301066D7EA2010E80010F
+B5FCA249800118C77EA24981163FA2496E7EA3496E7EA20001821607487ED81FF04A7ED8
+FFFE49B512E0A333367DB53A>65 D<DA03FE130C91393FFF801C91B512E0903A03FE01F8
+3C903A0FF0003C7CD91FC0EB0EFCD97F80130701FEC7120348481401000315005B484815
+7C485A173C485A171C123F5B007F160CA390C9FC481600AB7E6D150CA3123F7F001F161C
+17186C7E17386C6C15306C6C15706D15E012016C6CEC01C0D97F80EB0380D91FC0EB0F00
+D90FF0131ED903FE13FC0100B512F0023F13C0DA03FEC7FC2E377CB437>67
+D<B77E16F016FE3A01FE0001FF00009138003FC0EE0FE0707E707E707E707E177E177FEF
+3F80A2EF1FC0A3EF0FE0A418F0AA18E0A3171F18C0A21880173F18005F17FE5F4C5AEE07
+F04C5AEE3FC000014AB45AB748C7FC16F8168034337EB23B>I<B812C0A3D803FCC7127F
+0001150FEE03E01601A21600A21760A403061330A41700150EA2151E157E90B512FEA390
+38FC007E151E150EA21506170CA3171892C7FCA41738A21770A217F01601160316070003
+157FB812E0A32E337DB234>I<B81280A3D803FCC7FC0001151FEE07C01603A21601A216
+00A41760150CA31700A2151CA2153C15FC90B5FCA3EBFC00153C151CA2150CA592C8FCAB
+487EB512FEA32B337DB232>I<DA03FE130C91393FFF801C91B512E0903A03FE01F83C90
+3A0FF0003C7CD91FC0EB0EFCD97F80130701FEC7120348481401000315005B4848157C48
+5A173C485A171C123F5B007F160CA390C9FC4893C7FCAA0303B512E07E7F92390003FE00
+705A123F7F121FA26C7E7F12076C7E7F6C6C14036C7E6D6C1307D91FC0EB0E7CD90FF0EB
+1C3CD903FEEBF81C0100B5EAF00C023F01C0C7FCDA03FEC8FC33377CB43C>I<B512FEA3
+000113006C5AB3B3A7487EB512FEA317337EB21C>73 D<017FB5FCA39038003FE0EC1FC0
+B3B1127EB4FCA4EC3F805A0060140000705B6C13FE6C485A380F03F03803FFC0C690C7FC
+20357DB227>I<B500FE903807FFF8A3000190C7000113006C48EC00FC17F04C5A4C5A4C
+C7FC160E5E5E5E5E4B5A4B5A4BC8FC150E5D5D15F84A7E14034A7EEC0EFF5C4A6C7E4A6C
+7EECE01FD9FFC07F4A6C7E4A6C7E5B6F7E6F7EA26F7E707EA2707E707E160F83707E707E
+A283486C913807FF80B500FE013F13FCA336337EB23C>I<B512FEA3D803FEC9FC6C5AB3
+A9EE0180A416031700A45EA25E5E5E5E16FE00031407B7FCA329337DB230>I<D8FFFC92
+3801FFF86D5DA20003EFFE00D801BFED06FCA3D99F80140CA2D98FC01418A3D987E01430
+A2D983F01460A3D981F814C0A3D980FCEB0180A2027EEB0300A36E1306A26E6C5AA36E6C
+5AA36E6C5AA26E6C5AA36E6C5AA3913800FD80A2037FC7FCA3486C133ED80FF04B7EB501
+1C90387FFFF8A33D337CB246>I<D8FFFE91381FFFF87F80C6030013006E143CD9DFE014
+18EBCFF0A2EBC7F8EBC3FCA2EBC1FEEBC0FF6E7EA26E7E6E7EA26E7E6E7E6E7EA26E7E6E
+7EA2ED7F80ED3FC0ED1FE0A2ED0FF0ED07F8A2ED03FCED01FEED00FFA2EE7F98EE3FD8A2
+EE1FF8160F1607A216031601A2486C1400D807F81578B500C01438A2171835337EB23A>
+I<EC07FC91387FFFC0903901FC07F0903907E000FCD90F80133E013FC76C7E017E6E7E49
+6E7E48486E7E48486E7EA248486E7E000F8249157E001F167FA24848ED3F80A2007F17C0
+A290C9121FA24817E0AB6C17C06D153FA3003F17806D157FA2001F17006D5D000F5E6C6C
+4A5AA26C6C4A5A00015E6C6C4A5A017E4A5A6D4A5AD91FC0017FC7FCD907E013FC903901
+FC07F09039007FFFC0DA07FCC8FC33377CB43C>I<B612FEEDFFC016F03A03FC0007FC00
+01EC00FE167FEE3F80EE1FC017E0160FA217F0A617E0A2EE1FC0A2EE3F80EE7F0016FEED
+07F890B65A168001FCC9FCB3A2487EB512F8A32C337DB234>I<EC07FC91387FFFC09039
+01FC07F0903907E000FC4948137E013FC7EA1F80017E6E7E496E7E48486E7E0003824914
+0148486E7E000F8249157E001F167FA24848ED3F80A2007F17C0A390C9121F4817E0AB6C
+17C0A26D153FA2003F1780A26D157F001F1700A2270FE001F013FE0007D907FC5B9039F0
+0E0E013B03F80C0703F8000190391C0383F03B00FC180187E0017EECCFC0013FECDF8090
+271F9C00FFC7FCD907EC13FC902701FE07F013609038007FFF913807FC7091C7007813E0
+A2EE7C01EE7E0393387F07C0EE3FFFA21880821800705A705AEE01F033447CB43C>I<B6
+12FCEDFF8016F03A01FE0007FC0000EC01FEED007F707E707E83160F83A65FA24C5AA24C
+5A047EC7FC4B5AED0FF090B612C093C8FC9039FE001FC0ED07F06F7E6F7E150082167E16
+7FA583A5180C17C0A2043F131C486C1618B500FEEB1FE0040F1338933807F070C93801FF
+E09338003F8036357EB239>I<90381FE00390387FFC0748B5FC3907F01FCF390F8003FF
+48C7FC003E80814880A200788000F880A46C80A27E92C7FC127F13C0EA3FF013FF6C13F0
+6C13FF6C14C06C14F0C680013F7F01037F9038003FFF140302001380157F153FED1FC015
+0F12C0A21507A37EA26CEC0F80A26C15006C5C6C143E6C147E01C05B39F1FC03F800E0B5
+12E0011F138026C003FEC7FC22377CB42B>I<007FB712FEA390398007F001D87C00EC00
+3E0078161E0070160EA20060160600E01607A3481603A6C71500B3AB4A7E011FB512FCA3
+30337DB237>I<B500F0903803FFF8A3D807FEC8EA7FC06C48ED1F000001161E6D151C00
+001618A26D15386D1530A26D6C5CA26E14E0011F5DA26D6C495AA28001074AC7FCA26D6C
+1306A28001015CA26E131C01001418806E5BA2ED8070023F1360A26E6C5AA215E1020F5B
+A2DA07F3C8FCA215FBEC03FEA36E5AA26E5AA31570A235357EB23A>86
+D<B5D8F007B539800FFFF0A3000390C7273FF000011300D801FC6E48EB007C1A386D140F
+00001930836D020715706D1860A26E496C14E0013F60A26ED919FC1301011F60A26ED930
+FE1303010F95C7FCA26ED9607F5B01071706A26E9039C03F800E0103170CA2913BFC0180
+1FC01C01011718A2913BFE03000FE03801001730A2DAFF06EB07F0027F5EA2038CEB03F8
+023F5EA203D8EB01FC021FEDFD80A203F0EB00FF020F93C8FCA24B800207157EA24B143E
+0203153CA24B141C020115184C357FB24F>I<267FFFFC90B512C0A3000101E090381FF8
+0026007F80EB0FC0013F6E5A6E91C7FC6D6C130E010F140C6E5B6D6C133801035C6E1360
+6D6C13E06D6C485A5EDA7F83C8FCEC3FC715C6EC1FECEC0FFC5D14076E7EA26E7E815C6F
+7E9138063FC0140E4A6C7E9138180FF0EC380702707F91386003FCECC0010101804A6C7E
+49C77E4981010E6E7E010C6E7E131C496E7E01786E7E13FCD807FEEC1FFEB56C90B512F8
+A335337EB23A>I<EAFFF0A4EAF000B3B3B3ADEAFFF0A40C4B79B715>91
+D<0003130C48131C000E133848137000181360003813E0003013C0EA700100601380A2EA
+E00300C01300A400DE137800FF13FCEB83FEA2EA7F81A2383F00FC001E1378171774B326
+>I<EAFFF0A41200B3B3B3AD12FFA40C4B7FB715>I<12035A120E5A121812381230127012
+60A212E05AA412DEB4FC1380A2127FA2EA3F00121E09177BB315>96
+D<EB7F803803FFF0380F80FC381C003E003F133F6D6C7E6E7EA26E7EEA1F00C7FCA4EB01
+FF131FEBFF873803FC07EA0FF0EA1FC0EA3F80127F13004815C05AA3140FA26C131F6C13
+3B3A3F8071F180391FC1E1FF2607FFC013003900FE003C22237DA126>I<EA03F012FFA3
+12071203AEEC3F80ECFFE09038F3C0F89038F7007E01FE7F49EB1F8049EB0FC05BED07E0
+16F0A2150316F8AA16F0150716E0A2ED0FC07F6DEB1F8001ECEB3F0001CF137C90388381
+F8903801FFE0C76CC7FC25357EB32B>I<EB07F8EB3FFF9038FC07C03901F000E03903E0
+03F03807C007120FEA1F80123F90380003E04890C7FCA2127E12FEAA127FA26C14187F00
+1F14386D1330000F14706C6C13E03903F001C03900FC0F8090383FFE00EB07F01D237EA1
+22>I<153FEC0FFFA3EC007F81AEEB07F0EB3FFCEBFC0F3901F003BF3907E001FF48487E
+48487F8148C7FCA25A127E12FEAA127E127FA27E6C6C5BA26C6C5B6C6C4813803A03F007
+BFFC3900F81E3FEB3FFCD90FE0130026357DB32B>I<EB0FE0EB7FFCEBF83F3903F00F80
+D807E013C0390FC007E0381F800315F0EA3F0014014814F8127EA212FEA2B6FCA248C8FC
+A5127E127FA26C1418A26C6C1338000F14306D13706C6C13E03901F003C03900FC0F00EB
+3FFEEB07F01D237EA122>I<EB01FCEB07FF90381F078090383E0FC0EB7C1F13FCEA01F8
+A20003EB070049C7FCACB512F0A3D803F0C7FCB3A7487E387FFFE0A31A357FB417>I<15
+1F90391FC07F809039FFF8E3C03901F07FC73907E03F033A0FC01F83809039800F800000
+1F80EB00074880A66C5CEB800F000F5CEBC01F6C6C48C7FCEBF07C380EFFF8380C1FC000
+1CC9FCA3121EA2121F380FFFFEECFFC06C14F06C14FC4880381F0001003EEB007F4880ED
+1F8048140FA56C141F007C15006C143E6C5C390FC001F83903F007E0C6B51280D91FFCC7
+FC22337EA126>I<EA03F012FFA312071203AEEC1FC0EC7FF09038F1E0FC9038F3807C90
+38F7007E13FE497FA25BA25BB3486CEB7F80B538C7FFFCA326347EB32B>I<EA0780EA0F
+C0EA1FE0A4EA0FC0EA0780C7FCAAEA07E012FFA3120F1207B3A6EA0FF0B5FCA310337EB2
+15>I<EB03C0EB07E0EB0FF0A4EB07E0EB03C090C7FCAAEB03F013FFA313071303B3B012
+38127C00FE13E0130714C0130F007C138038381F00EA1FFCEA07F0144384B217>I<EA03
+F012FFA312071203AF913803FFE0A36E1300EC00F8EC01E05D4A5A020FC7FC141C5C5C14
+F0EBF3F8EBF7FC13FEEBFC7EEBF87F496C7E141F6E7E8114076E7E8114016E7E81486CEB
+FF80B500C313F0A324347EB329>I<EA07E012FFA3120F1207B3B3A7EA0FF0B5FCA31034
+7EB315>I<2703F01FE013FF00FF90267FF80313C0903BF1E07C0F03E0903BF3803E1C01
+F02807F7003F387FD803FE1470496D486C7EA2495CA2495CB3486C496C487EB53BC7FFFE
+3FFFF0A33C217EA041>I<3903F01FC000FFEB7FF09038F1E0FC9038F3807C3907F7007E
+EA03FE497FA25BA25BB3486CEB7F80B538C7FFFCA326217EA02B>I<EB07F0EB3FFE9038
+FC1F803901F007C03903C001E000078048486C7E48C7127CA248147E003E143E007E143F
+A300FE1580A8007E1500A36C147EA26C147C6D13FC6C6C485A00075C3903F007E03900FC
+1F80D93FFEC7FCEB07F021237EA126>I<3903F03F8000FFEBFFE09038F3C0F89038F700
+7ED807FE7F6C48EB1F804914C049130F16E0ED07F0A3ED03F8A9150716F0A216E0150F16
+C06D131F6DEB3F80160001FF13FC9038F381F89038F1FFE0D9F07FC7FC91C8FCAA487EB5
+12C0A325307EA02B>I<903807F00390383FFC07EBFC0F3901F8038F3807E001000F14DF
+48486CB4FC497F123F90C77E5AA25A5AA9127FA36C6C5B121F6D5B000F5B3907E003BF39
+03F0073F3800F81EEB3FF8EB0FE090C7FCAAED7F8091380FFFFCA326307DA029>I<3803
+E07C38FFE1FF9038E38F809038E71FC0EA07EEEA03ECA29038FC0F8049C7FCA35BB2487E
+B512E0A31A217FA01E>I<EBFF06000713CE381F00FE003C133E48131E140E5A1406A27E
+A200FE90C7FC6C7EEA7FFC383FFFC014F0000F7F6C7FC67FEB0FFF1300EC3F8000C0131F
+140F6C1307A37E15006C5B6C130E6C5B38F7807838E1FFE038C07F8019237EA11E>I<13
+30A51370A313F0A21201A212031207381FFFFEB5FCA23803F000AF1403A814073801F806
+A23800FC0EEB7E1CEB1FF8EB07E0182F7FAD1E>I<D803F0133F00FFEB0FFFA30007EB00
+7F000380B35DA35D12016D4813800000903803BFFC90387E073FEB1FFED907F813002622
+7EA02B>I<B5EBFFF0A3D80FF0EB3F800007EC1F000003140E150C6D131C00011418A26C
+6C5BA26D1370017E1360137F6D5BA290381F8180A214C3010F90C7FCA2EB07E6A214FE6D
+5AA26D5AA36D5AA2146024217E9F29>I<B53A1FFF81FFF0A33C07F801FC003F8001F049
+EB1E0000030100141C816C6C017C1318A26D017E1338000002FE1330A290267E01FF5B15
+9F168090263F030F5BA216C0903A1F8607C180A202C613E390260FCC0390C7FCA2D907FC
+13F6ECF80116FE6D486C5AA36D481378A36D48133034217F9F37>I<B53801FFF8A32603
+FE0013806C48EB7C0000001478017E1370017F5B90383F81C090381F8380D90FC3C7FCEB
+07E614FE6D5A6D5A6D7E80805B9038039F809038071FC09038060FE0EB0C0790381C03F0
+496C7E01707FEBF000000180000FECFF8026FFFC0313FCA326207F9F29>I<3A7FFF807F
+F8A33A07F8001FC00003EC0F800001EC070015066C6C5BA26D131C017E1318A26D5BA2EC
+8070011F1360ECC0E0010F5BA2903807E180A214F3010390C7FC14FBEB01FEA26D5AA314
+78A21430A25CA214E05CA2495A1278D8FC03C8FCA21306130EEA701CEA7838EA1FF0EA0F
+C025307F9F29>I<003FB512F0A2EB000F003C14E00038EB1FC00030EB3F800070137F15
+00006013FE495A13035CC6485A495AA2495A495A49C7FC153013FE485A12035B48481370
+485A001F14604913E0485A387F000348130F90B5FCA21C207E9F22>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ff cmtt9 9 51
+/Ff 51 122 df<00101320007C13F838FE01FCAAEAFC00007C13F8A900381370161778AE
+27>34 D<EB01C0EB03E0130F131FEB3FC0EB7F80EBFE00485A5B1203485A5B485AA2485A
+A248C7FCA3127EA45AAC127EA47EA36C7EA26C7EA26C7E7F6C7E12017F6C7EEB7F80EB3F
+C0EB1FE0130F1303EB01C0133A73B327>40 D<127012F812FE7E6C7E6C7EEA0FE06C7E12
+037F6C7E1200137EA27FA2EB1F80A3EB0FC0A4EB07E0ACEB0FC0A4EB1F80A3EB3F00A213
+7EA25B1201485A5B1207485AEA3FC0485A48C7FC5A12F81270133A7AB327>I<007FB512
+F8B612FCA46C14F81E067C9927>45 D<121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A0A72
+8927>I<1538157C15FCA2140115F8140315F0140715E0140F15C0141F1580143F1500A2
+5C147E14FE5C13015C13035C13075C130F5CA2131F5C133F91C7FC5B137E13FE5B12015B
+12035BA212075B120F5B121F5B123F90C8FC5A127E12FE5AA25A12781E3A7CB327>I<EB
+07E0EB3FFC497E90B5FC4814803903FC3FC03907F00FE0390FE007F0EBC003391F8001F8
+A248C712FCA2003E147C007E147EA3007C143E00FC143FAC007E147EA46C14FCA2EB8001
+001F14F8EBC003000F14F0EBE0073907F00FE03903FC3FC06CB512806C14006D5A6D5AEB
+07E020307DAE27>I<007FB512FEB7FCA4003F14FEC9FCA6003FB512FEB7FCA46C14FE20
+127D9F27>61 D<EB03F0497EA2497EA4143CEB1F3EA5EB3F3FA3EB3E1FA2017E7FA4496C
+7EA548486C7EA390B5FCA24880A3EBF003A248486C7EA4000F803A7FFC0FFF8000FF15C0
+6D5A497E007F1580222F7EAE27>65 D<387FFFFC14FFB612C06C80813907E00FF81407EC
+01FC6E7EA2157E157F811680151FA316C0150FABED1F80A3153F1600A25D15FEA24A5A4A
+5A140F007FB55A5DB65A6C91C7FC14FC222E7FAD27>68 D<007FB61280B712C0A37E3907
+E0000FA6ED078092C7FCA4EC07804A7EA390B5FCA5EBE00FA36E5A91C8FCA4ED03C0ED07
+E0A7007FB6FCB7FCA36C15C0232E7FAD27>I<007FB61280B712C0A37E3907E0000FA6ED
+078092C7FCA4EC07804A7EA390B5FCA5EBE00FA36E5A91C8FCAC387FFF80B57EA36C5B22
+2E7EAD27>I<903807F03890381FFC7C90387FFFFC90B5FC5A3803FC1F3807F00F380FE0
+07EBC003001F13011380123F90C7FCA2127EA2157892C7FC5AA8EC1FFF4A1380A3007E6D
+1300EC00FCA36C1301A21380121FEBC003120FEBE0073807F00F3803FC1F6CB5FC7EEB7F
+FE90381FFC78D907F0C7FC21307DAE27>I<007FB512E0B612F0A36C14E039001F8000B3
+B2007FB512E0B612F0A36C14E01C2E7BAD27>73 D<387FFFC080B5FC7E5CD803F0C8FCB3
+AAED0780ED0FC0A7007FB6FCA2B7FC7E1680222E7FAD27>76 D<3A7FF003FFE0486C4813
+F0A213FC007F6D13E000079038003E0013DEA313CFA3148013C714C0A213C314E0A213C1
+14F0A3EBC0F8A31478147CA2143C143EA2141E141F140FA3EC07BEA3EC03FEEA7FFCEAFF
+FE1401A26C486C5A242E7FAD27>78 D<EBFFFC0007EBFF80001F14E0A24814F0EBC00F39
+7F8007F8EB0003007E1301A348EB00FCB3A76C1301007E14F8A3007F1303EB8007393FE0
+1FF090B5FC6C14E0A200071480C6EBFC001E307CAE27>I<007FB5FCB612E081816C8039
+07E003FEEC00FF81ED3F80151F16C0150FA6151F1680153FED7F005DEC03FE90B55A5D5D
+5D92C7FC01E0C8FCADEA7FFEB5FCA36C5A222E7FAD27>I<387FFFF0B512FE6E7E816C80
+3907E01FF014076E7E1401811400A514015D14034A5A141F90B55A5D5DA281EBE01F6E7E
+14076E7EA816F0EDF1F8A4397FFE01FBB5EBFFF08016E06C48EB7FC0C8EA1F00252F7FAD
+27>82 D<90387FC0E03901FFF1F0000713FF5A5AEA3FE0EB801F387F000F007E130712FE
+5A1403A3EC01E06C90C7FC127E127FEA3FC013F86CB47E6C13F86C13FE6CEBFF80C614C0
+010F13E0010013F0140FEC07F81403140115FC1400127812FCA46CEB01F8A26C13039038
+8007F09038F01FE090B5FC15C0150000F85B38701FF81E307CAE27>I<007FB61280B712
+C0A439FC03F00FA60078EC0780000091C7FCB3AB90B512C04880A36C5C222E7EAD27>I<
+3A7FFE01FFF8B54813FCA36C486C13F83A07E0001F80B3AB6D133F00031500A26D5B0001
+147E6D13FE6C6C485A90387F87F814FF6D5B010F13C06D5BD901FEC7FC262F80AD27>I<
+3A7FFC03FFE06D5A00FF15F0007F15E0497E3A07E0007E00A46C6C5BA4EBF80100015CA4
+6C6C485AA490387E07E0A56D485AA4011F5B149FA3010F90C7FCA5EB07FEA46D5AA26D5A
+242F7FAD27>I<D87FE0EB7FE0486CEBFFF0A36C48EB7FE0001FC7EA0F80A76C6CEB1F00
+A614F0EB81F83907C3FC3EA4149CEBC79EA30003143CA301E7137CEBEF9FA2140FA20001
+1478A49038FE07F8A300005CA2EBFC0390387801E0242F7FAD27>I<393FFC1FFE387FFE
+3F815D383FFC1F3903F00FE001F85B1201EBFC1F00005CEBFE3F017E90C7FCEB7F7FEB3F
+7E14FE6D5AA26D5AA26D5AA21303130780130F80131F80EB3F7E147F497E017E7F141F01
+FC7F140FD801F87F14071203496C7E120701E07F3A7FFC0FFF8000FF15C06D5A497E007F
+1580222E7EAD27>I<007FB512F8B612FCA46C14F81E067C7E27>95
+D<3803FFC0000F13F04813FC4813FF811380EC1FC0381F000F000480C71207A2EB0FFF13
+7F0003B5FC120F5A383FFC07EA7FC0130012FE5AA46C130F007F131FEBC0FF6CB612806C
+15C07E000313F1C69038807F8022207C9F27>97 D<EA7FE0487EA3127F1203A914FF01F3
+13C090B512F08181EC81FE49C67E49EB3F8049131F16C049130FA216E01507A6150F16C0
+7F151F6DEB3F80157F6DEBFF009038FF83FEECFFFC5D5D01F313C02601E0FEC7FC232E7F
+AD27>I<EB0FFF017F13C048B512E04814F05A380FF807EA1FE0393FC003E09038800080
+48C8FC127EA212FE5AA67E127EA2007F14F0393F8001F813C0381FE003390FF80FF06CB5
+FC6C14E06C14C06C6C1300EB0FF81D207B9F27>I<EC3FF04A7EA3143F1401A9EB0FE1EB
+7FFD48B5FC5A5A380FF83F381FE00F383FC007EB8003EA7F00007E1301A212FE5AA67E00
+7E1303A2127F6C1307EB800F381FE01F380FF03F6CB612C06C15E06C13FD38007FF9D91F
+E013C0232E7EAD27>I<EB0FF8EB3FFE90B51280000314C04814E0390FFC0FF0391FE003
+F8EBC001D83F8013FC48C7FC127E157E12FEB612FEA415FC00FCC8FC7E127E127F6C143C
+6D137E6C7E01F013FE390FFC07FC6CB5FC000114F86C14F0013F13C0903807FE001F207D
+9F27>I<EC1FF0ECFFF84913FC4913FE5BEB0FF014C0011F137CEC8000A6007FB512F0B6
+12F8A36C14F039001F8000B3A4003FB512C04814E0A36C14C01F2E7EAD27>I<153F9039
+1FC0FF80D97FF313C048B612E05A4814EF390FF07F873A1FC01FC3C0EDC000EB800F4848
+6C7EA66C6C485AEBC01FA2390FF07F8090B5C7FC5C485BEB7FF0EB1FC090C9FCA27F6CB5
+FC15E015F84814FE4880EB8001007EC7EA3F80007C140F00FC15C0481407A46C140F007C
+1580007F143F6C6CEB7F009038F807FF6CB55A000714F86C5CC614C0D90FFCC7FC23337E
+A027>I<EA7FE0487EA3127F1203A9147F9038F1FFC001F713F090B5FC8114C1EC01FCEB
+FE005B5BA25BB03A7FFF83FFE0B500C713F0A36C018313E0242E7FAD27>I<130F497E49
+7EA46D5A6DC7FC90C8FCA7383FFF80487FA37EEA000FB3A4007FB512F0B6FC15F815F07E
+1D2F7BAE27>I<143C147E14FFA4147E143C1400A73801FFFE4813FFA37EC7123FB3B014
+7E1238007C13FE38FE01FC1303B512F814F06C13E06C13803807FE0018407CAE27>I<EA
+7FE07F12FF127FA21201A991383FFFC04A13E0A36E13C0913803F8004A5A4A5A4A5A4A5A
+02FFC7FCEBF1FEEBF3FCEBF7F8EBFFFC8080143F496C7E496C7E01F87FEBF0076E7E6E7E
+816E7E157E3A7FFFC1FFF002C313F8B512E36C13C316F0252E80AD27>I<387FFF80B57E
+A37EEA000FB3B2007FB512F8B612FCA36C14F81E2E7CAD27>I<397F07C01F3AFF9FF07F
+C09039FFF9FFE091B57E7E3A0FFC7FF1F89038F03FC001E0138001C01300A3EB803EB03A
+7FF0FFC3FF486C01E3138001F913E701F813E36C4801C313002920819F27>I<387FE07F
+39FFF1FFC001F713F090B5FC6C80000313C1EC01FCEBFE005B5BA25BB03A7FFF83FFE0B5
+00C713F0A36C018313E024207F9F27>I<EB1FE0EB7FF83801FFFE487F481480390FF03F
+C0391FC00FE0393F8007F0EB00034814F8007E1301A248EB00FCA76C1301007E14F8A200
+7F1303393F8007F0A2391FE01FE0390FF03FC06CB512806C14006C5B38007FF8EB1FE01E
+207C9F27>I<387FE0FFD8FFF313C090B512F0816C800003EB81FE49C67E49EB3F804913
+1F16C049130FA216E01507A6150F16C07F151F6DEB3F80157F6DEBFF009038FF83FEECFF
+FC5D5D01F313C0D9F0FEC7FC91C8FCAC387FFF80B57EA36C5B23317F9F27>I<90380FF0
+3C90383FFE7E90B5FC000314FE5A380FFC1F381FE007EBC003383F800148C7FC127EA200
+FE147E5AA67E007E14FEA2007F1301EA3F80EBC003381FE007380FF81F6CB5FC7E6C147E
+38007FFCEB0FF090C7FCAC91381FFFF8A24A13FC6E13F8A226317E9F27>I<397FFC03FC
+39FFFE0FFF023F13804A13C0007F90B5FC39007FFE1F14F89138F00F809138E002004AC7
+FC5CA291C8FCA2137EAD007FB57EB67EA36C5C22207E9F27>I<9038FFF3800007EBFFC0
+121F5A5AEB803F38FC000F5AA2EC07806C90C7FCEA7F8013FC383FFFF06C13FC000713FF
+00011480D8000F13C09038003FE014070078EB03F000FC1301A27E14036CEB07E0EBE01F
+90B512C01580150000FB13FC38707FF01C207B9F27>I<133C137EA8007FB512F0B612F8
+A36C14F0D8007EC7FCAE1518157EA415FE6D13FC1483ECFFF86D13F06D13E0010313C001
+0013001F297EA827>I<397FE01FF8486C487EA3007F131F00031300B21401A21403EBFC
+0F6CB612E016F07EEB3FFE90390FF87FE024207F9F27>I<3A7FFC0FFF80486C4813C0A3
+6C486C13803A07C000F800EBE00100035CA2EBF00300015CA2EBF80700005CA390387C0F
+80A36D48C7FCA3EB3F3FEB1F3EA214FE6D5AA36D5AA26D5A22207E9F27>I<3A7FFE07FF
+E000FF15F06D5A497E007F15E03A0F80001F00A36D5B0007143EA414F0EBC1F83903E3FC
+7CA4EBE79EA200011478A301F713F8A2EBFF0F6C5CA3EBFE0790387C03E024207F9F27>
+I<393FFC1FFF486C5A168016006C487E3901F807E06C6C485A4A5A017E90C7FC6D5AEB1F
+7E5C6D5A13076D5A5C80497E130F497E143EEB3E3FEB7E1F90387C0F8001F87F00016D7E
+3803F0033A7FFE1FFF80A2B54813C06C486C1380A222207E9F27>I<3A7FFC0FFF80486C
+4813C0A36C486C13803A07E000F800000313015D13F00001130301F85B1200A26D485A13
+7CA290387E0F80133EA2011F90C7FC5CA2130F149E14BE130714FC1303A25C1301A25CA2
+13035CA213075C1208EA3E0F007F5B131FD87E7FC8FCEA7FFE6C5A5B6C5AEA07C022317E
+9F27>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fg cmtt12 13.14 5
+/Fg 5 121 df<EC3FFF49B512E0010714F8011F8049805B90B7FC48EBE001481300485A
+EA0FF8496D5A4848147C93C7FC485A5B127F90CAFCA35A5AA97E7EA27F123F6D141F6DEC
+3F80121F6C7E01FC147F6C6CECFF006C6C6C5A6C9038F00FFE91B55A6C6C5C6D5C6D5C01
+071480010149C7FC9038003FF0293278B038>99 D<EC3FE0903801FFFC010713FF011F14
+C04980498090B67E489038E03FFC4890380007FE48481301D80FF86D7E49804848158049
+143F003F16C049141F127F90C8FC17E0160F5A90B7FCA617C048CAFC7E7EA27FA26C7EEE
+07C06C6CEC0FE07F6C7ED807FE141F6DEC3FC06C01C013FF6CD9FC0713806C90B612006D
+5C6D5C010F5C010314E001001480DA1FFCC7FC2B327AB038>101
+D<ED3FC03A3FFE01FFF8267FFF0713FEB5001F7F4A804A806C90B67E6C02C07F3B007FFE
+001FF802F86D7E4A13034A6D7E5C707E4A80188091C8123FA318C0171FA9173F6E1580A2
+177FA26EECFF00A26E495A6E13034C5A6E495A02FE133F6E6CB45A92B55A6E5C6E5C6E91
+C7FC6E13FC020313F09138007F8092C9FCB0383FFFFE487FB67EA36C91C9FC6C5B32487F
+AF38>112 D<EB01E0497E1307AB003FB712804816C0B8FCA46C1680260007F0C8FCB3A4
+EE03E0EE07F0A66E130F17E06D6C131F6EEB3FC0903901FF81FF92B512806D15006E5B6E
+5B6E13F002075B020190C7FC2C3D7DBB38>116 D<3B3FFFE007FFFC486D487FB56C487F
+A36C496C5B6C496C5B28007F8000FEC7FC013F495A6D6C485A6D6C485AEB07F04B5A6D6C
+485AD901FC5B903800FE3F4BC8FCEC7FFE6E5A141F6E5A5D6E5A814A7E141F4A7E157EEC
+7E7F4A7E01016D7E02F87F49486C7E0107130749486C7E02C07F011F6D7E49486C7E49C7
+FC167F277FFFE003B5FCB56C481480A56C496C1400312F7DAE38>120
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fh cmb10 10.95 45
+/Fh 45 121 df<147814F81301EB03F0EB07E0EB0FC0A2EB1F80133FEB7F00A213FEA248
+5A1203A25B1207A2485AA3121F5BA2123FA4485AA612FFB3A2127FA66C7EA4121FA27F12
+0FA36C7EA212037FA212016C7EA2137FA2EB3F80131FEB0FC0A2EB07E0EB03F0EB01F813
+001478155A78C323>40 D<127012F87E127E7E6C7EA26C7E7F6C7EA26C7EA26C7E7FA212
+007FA2EB7F80A314C0133FA214E0A4EB1FF0A614F8B3A214F0A6EB3FE0A414C0A2137F14
+80A3EBFF00A25B1201A25B485AA2485AA2485A5B485AA248C7FC127E5A5A1270155A7BC3
+23>I<EA0FC0EA1FE0EA3FF0EA7FF8EAFFFCA313FEA3127F123F121FEA0FDEEA001EA213
+3E133CA2137CA2137813F813F01201EA03E0EA07C0A2EA0F80EA1F00121E120C0F207B8D
+19>44 D<EA0FC0EA1FE0EA3FF0EA7FF8EAFFFCA6EA7FF8EA3FF0EA1FE0EA0FC00E0E7B8D
+19>46 D<EB01FE90380FFFC0013F13F090B512FC48EB87FE3903FE01FF48486C1380A248
+48EB7FC0001F15E049133FA2003F15F0A3007F15F8A500FF15FCB3A3007F15F8A6003F15
+F0A36C6CEB7FE0A2000F15C06D13FF000715806C6C4813003901FF87FE6CEBFFFC013F13
+F06D5BD901FEC7FC263D7DBB2D>48 D<143C147CEB01FC1307131FEA03FFB5FCA4EAFC1F
+1200B3B3A8007FB6FCA5203C7ABB2D>I<EB0FFC90387FFF8048B512E04814F84880390F
+F07FFE391F801FFF48486C1380387FC00701E014C0486C6C13E013F88016F0A4EA7FF0EA
+3FE0EA1FC0EA0700C7FC16E05CA216C04A1380A24A13005D4A5A5D4A5A5D4A5A4A5A4990
+C7FC5CEB03F8903907F001F0EB0FE014C090391F8003E0EB3F00137E5B491307485A48B6
+FC4815C05AA25A5A5AB7FC1680A4243C7CBB2D>I<EB0FFC90383FFFC090B512F0488039
+03F83FFC3907E00FFED80FC07F486C6C138013F801FC14C0123F13FEA5EA1FFC1680EA0F
+F8D803E01400C75A5D5D4A5A5DEC7FE090381FFFC092C7FC15C015F09038003FF8EC0FFE
+816E1380A216C06E13E0A316F0EA0FC0EA1FE0EA3FF0EA7FF8EAFFFCA416E0A2495A007F
+15C013F0263FC00F13801600391FF83FFE6CB55A6C5C000114E06C6C1380D90FFCC7FC24
+3D7CBB2D>I<000E1407D80F80133F9038F801FF90B6FC5D5DA25D5D5D158092C7FC14FC
+14F00180C8FCA9EB87FE90389FFFC090B512F0819038FC0FFC9038F007FE9038C003FF01
+80148016C0497EC714E0A416F0A21207EA1FC0EA3FE0EA7FF012FF13F8A316E013F0A26C
+484813C01380D87E0014806C491300391FC00FFE390FF03FFC6CB55A6C5C6C14C06C91C7
+FCEB1FF8243D7CBB2D>53 D<EC3FE0903801FFF801077F011F7F90383FF07F90397FC01F
+809038FF807F48EB00FF484913C048485AA2EA0FFCA2121FA2003F6D1380496C1300157E
+007F91C7FCA314309038F9FF80D8FFFB13E090B512F881EC07FE496C7E496C1380A216C0
+A201F814E0A316F0A6127FA5123F16E0A2121F16C0EA0FFC168000075B01FE14003903FF
+0FFE6CEBFFFC6C5C013F5B6D13C0D903FEC7FC243D7CBB2D>I<EB07FE90381FFFC0017F
+13F090B57E3901FE0FFC3903F803FE48486C7E000F6D1380A2485AED7FC0123FA37FA27F
+7F6DEBFF806D7E6E13006C13F1ECFBFE6CEBFFFC5D6C14E0A26C14F86C806C8081481580
+5AD807FB14C0EA0FF048486C13E0003F131F497E007F010313F08000FF7F49137F153FA2
+151FA416E06C7E153F6D14C0003F147F6D14803A1FF801FF00390FFE07FE6CB55A6C5CC6
+5C013F13C0D907FEC7FC243D7CBB2D>56 D<EB07FE90383FFF8090B512E0488048EB0FF8
+48486C7E48486C7E001F80497E003F1580A2127F16C0A212FF16E0A516F0A6127FA3003F
+5BA2121FA26C6C5A6C6C5A6CB6FC7E38007FFDD91FF913E0EB00C11401A3D807E014C0EA
+0FF0486C5AD83FFC1480A316004A5AA249485AD81FF05B9038E03FF0000F495A90B55A6C
+5C6C91C7FCC613FCEB3FE0243D7CBB2D>I<ED07804B7E4B7EA34B7EA34B7EA34B7EA34A
+7FA34A7FA24A8015CFA2020F801587A2021F801503A2023F80EC3E01A2027E80EC7C00A2
+4A6D7EA20101814A133FA20103814A7FA249B77EA34982A29138800007011F8291C77EA2
+496E7F133EA2496E7FA201FC8249157FB500F0013FB512FCA53E3F7DBE45>65
+D<B712FEEEFFE017F817FE83C69026F0001F1380040713C07013E0A27013F0A28218F8A7
+18F05EA218E05E18C04C1380041F1300EE7FFC91B612F017C017F817FE913AF00007FF80
+7013C07013E07013F018F8177F18FCA318FEA3173F177FA418FCA217FF18F85E18F04C13
+E0160FB912C018005F17F01780373E7CBD41>I<B712FCEEFFC017F017FC17FFC69026F0
+003F7F04077F040113F082717E717E717E170F84831980A219C083A219E0A519F0A483A5
+5FA419E0A519C0A25F1980A24D1300A24D5A4D5A177F4D5A4C5B04075B043F5BB9C7FC5F
+17F817C004FCC8FC3C3E7CBD46>68 D<B812FEA483C69038F8003F16071601828383A2EF
+1F80A3170FED01F0A3EF07C0A3150394C7FCA21507151F91B5FCA5ECF81F1507150318F8
+A21501EF01F0A592C71203A218E0A21707A2170F171F18C0173F17FF1603161FB9FCA218
+80A3353D7CBC3C>I<B612F8A5C6EBF800B3B3B0B612F8A51D3E7DBD24>73
+D<B600F890B512F8A5C601F8C73803F8004D5A4D5A4D5A4D5A4DC7FC17FE4C5A4C5A4C5A
+4C5A4C5A4C5A4CC8FC16FE4B5A4B5A4B5A4B5A151F4B7E4B7EA24B7E14F902FB7F91B6FC
+15DF039F7F158F030F7F4A6C7F4A7E02F880816F7F83167F83707E82848284707F828482
+84707F177F84B6D8F80FB512FCA53E3E7CBD47>75 D<B500FC93B512F86E5DA36E5DC6F1
+F800A26FEC07BFA301FD6DEC0F3FA201FC6D141EA36E6C143CA36E6C1478A36E6C14F0A2
+6E6CEB01E0A36E6CEB03C0A36E9038800780A36E9038C00F00A26EEBE01EA36F6C5AA36F
+6C5AA36F6C5AA26FB45AA36F5BA36F5BA36F90C7FCA26F5AB500FC033FB512F8A2167CA2
+16384D3E7CBD56>77 D<B712F816FF17E08317FCC6D9F0007FEE1FFF7013808218C08218
+E0A318F0A818E0A318C05E18804C13005EEEFFFE91B612F85F17C04CC7FC02F8C9FCB3A4
+B612F8A5343E7CBD3E>80 D<B600F890B512F8A5C601F8C8EAF800B3B3A5017F150160A2
+80013F1503606D6C1407010F4B5A6E4A5A6D6D133F6D6D01FFC7FC6D9038F807FE6D6CB5
+5A6E5C020F14E0020314809126003FFCC8FC3D3F7CBD46>85 D<B600F0010FB5FCA5C601
+F8C8EA1F00A26E5D017F163EA26E157E013F167C6E15FC6D5EA26F13016D5EA26D6D495A
+A26F13076D5EA26F130F6D5E816D4BC7FCA26F5B027F143EA26F137E023F147C6F13FC6E
+5CA216816E5CA216C36E5C16E76E5CA216FF6E5CA36E91C8FCA26F5AA36F5AA36F5AA26F
+5AA36F5AA2403F7EBD45>I<B600E0B6D8F007B51280A500019026F0000101F8C73807C0
+0070160F6C6D6184177F6D6C4EC7FC84173F6D6C183E177F846E187E6D92B5147C856F17
+FC6D4A5E05F77F03C016016D02035E05E313E003E016036D02075E05C113F003F016076D
+61DC0F8013F803F8160F6D6193391F007FFC03FC161F027F95C8FC4C14FE043E013F5BDA
+3FFE163E047E14FF047C6D137EDA1FFF167C04FC15FC4C7F6E5FA24C7F6E5FA24C7F6E5F
+A24C7F6E5FA24C7F6E5FA293C8127FA26F93C9FC037E81033E153E593F7EBD5E>I<EB0F
+FE90387FFFC048B512F04814FC3907FC0FFE48486C7E6D6C7F486C7E82A26E7FA36C5A6C
+5AEA01E0C8FC5C49B5FC131F90B6FC000313F84813C0481300EA1FFC485A127F5B12FF5B
+A45CA26C6C5A16F83B3FF807BFFF80391FFC1F3F390FFFFE1F6C497E0001EBF80326003F
+E0C8FC292B7EA92C>97 D<13FFB5FCA512077EAF4AB4FC020F13E0023F13F891B57E9138
+FE07FFDAF8011380DAE00013C05C4AEB7FE017F0A3EE3FF8A317FCAC17F8A3EE7FF0A217
+E06E13FF17C06E481380DAF80313009138FE0FFE9039FC7FFFFC496C13F0496C13C0C7D8
+03FEC7FC2E407FBE33>I<EB03FF011F13E0017F13F890B57E48EB83FE3903FE01FF0007
+5B4848481380121F13F8123FA2127F496C13006E5AEC007800FF91C7FCAC127FA27F003F
+EC07C0A26C6C130F16806C6C131F000715006C6C137F6CEBC1FE6CEBFFFC6D13F0011F5B
+010390C7FC222B7DA928>I<16FF92B5FCA5150781AFEB01FF011F13E3017F13FB90B7FC
+4813C148EB003F48487F48487F001F805B123FA2485AA312FFAC127FA36C7EA3001F5C6C
+6C5B00074A13806D4913FC2603FF83B5FCC690B6FC6D13F7011F13C7903A03FE07FC002E
+407DBE33>I<49B47E010F13F0013F7F90B512FE48EBC3FF48010013804848EB7FC04848
+133F001F15E05B003FEC1FF0A2485A150F16F8A212FFA290B6FCA401F0C8FCA5127FA37F
+003F15F8A26C6C1301000F15F06D13036C6CEB07E06C9038800FC06C9038F07F806C6CB5
+12006D5B010F13F8010013C0252B7EA92A>I<EC1FF8ECFFFE01077F491480D91FF813C0
+D93FE013E0EB7FC1EBFF81481301A348486C13C0ED7F80ED3F0092C7FCAAB6FCA5000390
+C8FCB3ACB6FCA523407EBF1C>I<D907FE13FC90393FFFC3FE90B5EAF7FF4891B5128048
+130F3907FC03FE3A0FF801FF7F001FEDFF00496C13BE1680003F81A7001F5DA26D5A000F
+92C7FC6C6C485A3903FF0FFCECFFF8485CD80F3F13C0D907FEC8FC90CAFC5AA27FA213E0
+90B512F015FF6C15C0826C816C8182120F4881393FE0003FD87F80EB07FF150148C7FC81
+A56D5B007F5D6D13036C6C495AD81FF8EB1FF86CB4EBFFF06C90B55A000115806C6C49C7
+FC010713E0293D7EA82D>I<13FFB5FCA512077EAFED7FE0913801FFF802077F4A7F9138
+1FC3FFDA3E031380147CEC780102F014C014E0A214C0A31480B3A4B5D8FE1F13FFA5303F
+7EBE33>I<EA01F8487E487E487E481380A66C13006C5A6C5A6C5AC8FCA913FFB5FCA512
+077EB3ABB512F8A515407EBF19>I<EC1F80EC3FC0EC7FE0ECFFF04913F8A66D13F0EC7F
+E0EC3FC0EC1F8091C7FCA9EC07F8EB0FFFA5EB003F141FB3B3A2EA1F80EA3FC0EA7FE0EA
+FFF015F0143FA2EC7FE015C0397FE0FF80D83FC113006CB45A6C5B6C13F0C613801D5387
+BF1C>I<13FFB5FCA512077EB092B512E0A592380FE0004B5A4B5A4BC7FC15FE4A5A4A5A
+4A5A4A5A4A5A143FECFFE0A28181A2ECDFFCEC8FFE140F6E7E6E7FA26E7F6E7FA26F7E6F
+7EA26F7E6F7EB539FC7FFFF8A52D3F7FBE30>I<13FFB5FCA512077EB3B3AFB512FCA516
+3F7EBE19>I<01FFD97FE0EB3FF0B52601FFF8EBFFFC0207D9FC037F4A6D487F91281FC3
+FF0FE17FDA3E03D99F017F0007017C14BE6CD97801EBBC0002F002F88002E05CA202C05C
+A302805CB3A4B5D8FE1FD9FF0FEBFF80A549297EA84C>I<01FFEB7FE0B53801FFF80207
+7F4A7F91381FC3FFDA3E0313800007137C6CEB780102F014C014E0A214C0A31480B3A4B5
+D8FE1F13FFA530297EA833>I<49B47E010F13F0013F13FC90B6FC48018113803A03FE00
+7FC04848EB3FE0000F15F049131F001F15F8A24848EB0FFCA2007F15FEA400FF15FFAB00
+7F15FEA3003F15FC6D131F001F15F8A26C6CEB3FF0000715E06C6CEB7FC03A01FF81FF80
+6C90B51200013F13FC010F13F001011380282B7EA92D>I<9038FF01FFB5000F13E0023F
+13F891B57E9138FE0FFFDAF80313800003D9E00113C014C04A6C13E017F0167FA217F8A2
+163F17FCACEE7FF8A317F016FF17E0804B13C06E481380DAF80713009138FE0FFE91B55A
+02BF13F0029F13C0DA83FEC7FC0280C8FCACB512FEA52E3B7FA833>I<3901FE07F800FF
+EB0FFE91383FFF804A13C0EC7C7F9138F8FFE03807FFF06C5B5CA2ED7FC09138803F80ED
+1F0092C7FCA291C8FCB3A3B6FCA523297FA827>114 D<90387FE1E03803FFFB4813FF5A
+381FE07F383F801F387F000F007E130712FE1403A27EA26DC7FC13F013FF6C13F014FC6C
+13FF15806C14C07E6C14E0000114F06C7E010313F8EB003F140F0078130712F814037EA3
+6C14F06C1307A29038800FE09038F03FC090B51280150000F813FC38E03FF01D2B7DA924
+>I<131FA65BA55BA25BA25A5A5A001FEBFFC0B6FCA4000790C7FCB3EC03E0A97EEC87C0
+A26CEBCF806C13FF6D1300EB1FFEEB07F81B3B7EB923>I<D9FF80EB7FC0B5EB7FFFA500
+0714036C80B3A55DA35D7E4B13E0DAC01E13FF6CEBE07E6DB45A6D5B010F13E001010180
+1300302A7EA833>I<B500E1B53887FFF8A50007903B801FF0003F006C6F133E150F02C0
+157E6C4A6C137CA26C01E05D4B7EA2D97FF04A5AED7FFF157DD93FF84A5A03FD138303F8
+1387D91FFCECC7C014FD9238F07FCFD90FFFECEF80A29238E03FFF6D93C7FCA24B7E6D5D
+A2ED800F6D5DA2ED00076D5DA24A1303027E5C027C13013D287EA742>119
+D<3B7FFFFC7FFFE0A5C69039E007E0004B5A90387FF01FD93FF85B4BC7FC90381FFC7EEB
+0FFE5D6D6C5A7F5D6D5B7FA26E7E143F814A7E14FF81497FEB03F301078002E17FEB0FC0
+49487F6F7E90383F003F017E806F7EB500E0B512F8A52D287FA730>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fi cmbx12 13.14 37
+/Fi 37 122 df<923807FFE092B512FC020714FF021F81027F9038007FC0902601FFF0EB
+0FE04901C0497E4990C7487ED90FFC147F011F824A14FF495AA2137F5CA2715A715A715A
+EF078094C8FCA7EF07FCB9FCA526007FF0C7123F171FB3B3A2003FB5D8E00FB512F8A53D
+4D7ECC44>12 D<EA07E0EA1FF8EA3FFCEA7FFEA2B5FCA6EA7FFEA2EA3FFCEA1FF8EA07E0
+1010778F22>46 D<EC0FFC91B512C0010714F8498090393FFC0FFF90267FE0017F49486C
+7F48496D7E4890C76C7E49141F000782000F8249140F001F82A3003F824980A2007F1780
+A600FF17C0B3A4007F1780A6003F17006D5CA2001F5EA3000F5E6D141F00075E6D143F6C
+5E6C6D495A6C6D495A90267FF0035B90263FFC0F90C7FC010FB512FC6D5C010014C0DA0F
+FCC8FC32487BC63D>48 D<15F014011407141F147FEB03FF137FB6FCA313FC1380C7FCB3
+B3B2007FB712E0A52B4777C63D>I<ECFFF80107EBFF80013F14F090B612FC4881480101
+EBFF802707F8003F13C0D80FE0010F13E0D81F806D13F0003F80D87FF06D13F86D15FC6D
+7F00FF16FE6D147FA217FF82A36C5A6C5A6C5A6C5AC95A17FEA3EEFFFCA24B13F817F05D
+17E04B13C017804B13004B5A4B5A5EED7FE04B5A4A5B4A90C7FCEC07FC4A5A4A5A4B131F
+EC3F804AC7FC14FE4948143E495AEB07E0495A4948147E49C8FC017E15FE90B7FC4816FC
+5A5A5A5A5A5AB8FC17F8A430477AC63D>I<EC3FFE0103B512E0010F14FC013F14FF9026
+7FE01F7F9026FF000713E0D801FC6D7FD803F07F486C6D7FD80FFE817F486D80167FA380
+5C16FF7E91C75B6C5A6C5AD80020495B90C75C5D5F4B5B5F031F90C7FCED3FFC4AB45A49
+B512E0168016E016FC90C7EA3FFF030713C06F7F6F7F6F7F83707E83A2701380A318C0EA
+07E0EA1FF8487E487EA2B5FCA31880A25E491600127F494A5A6C485D01E05B001F4A5BD8
+0FFC495B2707FFC03F13C06C90B65AC64BC7FC013F14F8010714E09026007FFEC8FC3248
+7BC63D>I<EE07E0160FA2161F163F167F16FFA25D5D5DA25D5D5DA2157D15FDEC01F915
+F1EC03E11407EC0FC1EC1F811501143F147E14FC14F8EB01F01303EB07E014C0EB0F8013
+1FEB3F00133E5B13FC485A485A5B1207485A485A90C7FC123E127E5AB912FCA5C80003EB
+E000AD023FB612FCA536487DC73D>I<D8038015E001E0140301FC143F9039FFE003FF91
+B612C017801700A25E5E16F05E5E93C7FC15FC15F001E790C8FC01E0C9FCAAEC1FFC01E1
+B512C001E714F001EF14FC9039FFE01FFFDA0007138001FC6D13C001F06D13E04915F049
+7F17F8C913FC167F17FEA417FFA3EA0FC0EA3FF0487EA2487EA317FEA34914FF6C4815FC
+5B018015F86CC74813F07F6C6C4913E0D80FF04913C0D807FC011F13806CB46CB512006C
+90B512FC6C5D013F14C0010F91C7FC010113F030487AC63D>I<121F7F7F13FE90B812E0
+A45A18C0188018005F5FA25F485E90C8EA07E0007E4B5A5F007C151F4CC7FC167E5E485D
+15014B5A4B5AC8485A4B5AA24BC8FC157EA25D1401A24A5A1407A24A5AA2141FA24A5AA2
+147FA314FFA3495BA45BA55BAA6D5BA26D90C9FCEB007C334B79C93D>55
+D<93261FFF80EB01C00307B500F81303033F02FE13074AB7EAC00F0207EEE03F021F903A
+FE007FF87F027F01E0903807FCFF91B5C70001B5FC010301FC6E7E4901F0151F4901C081
+4949814990C97E494882494882485B48197F4A173F5A4A171F5A5C48190FA2485B1A07A2
+5AA297C7FC91CDFCA2B5FCAD7EA280A2F207C07EA36C7FA26C190F6E18807E6E171F6C1A
+006E5F6C193E6C6D177E6D6C5F6D6C4C5A6D6D15036D6D4B5A6D01F04B5A6D01FCED3FC0
+010001FFEDFF806E01E0D903FEC7FC021F01FEEB3FFC020790B612F002015EDA003F92C8
+FC030714FCDB001F13804A4D79CB59>67 D<B912F0F0FF8019F019FC19FFD8001F902680
+000114C0DD001F7F060713F806017F726C7E737E737F737F737F8587737F8587A2747EA3
+8786A21C80A51CC0A586A462A51C80A51C00A26263A2631AFF636163614F5B634F5B073F
+90C7FC4F5A4F5A06035B061F5B4DB512C0BBC8FC19FC19F0198006F0C9FC524B7CCA5E>
+I<BBFCA41A80D8001F01C0C7FC181F18038484197F193F191F1AC0190FA31907A4171FF1
+03E0A496C7FCA25FA25F5F5E160792B6FCA5EDC0071601828383A283A794C9FCB1B8FCA5
+434A7CC94D>70 D<B712FEA5D8000FEBE000B3B3B3ABB712FEA5274B7DCA2E>73
+D<B8FCA5D8001F01C0C9FCB3B3A4193EA4197E197CA519FCA31801A2F003F8A21807180F
+181F183F187FEF01FF1707173FBA12F0A53F4B7BCA4A>76 D<B600E04DB612806F5FA26F
+5FA2D8001F09FCC7FC6FEF0F7FA2DABFFE171EA2DA9FFF173CA3028F6D1678A202876D16
+F0A202836DED01E0A302816DED03C0A202806DED0780A26F6CED0F00A36F6C151EA26F6C
+5DA26F6D5CA26F6D5CA36F6D495AA26F6D495AA26F6D495AA3706C49C7FCA2706C131EA2
+706C5BA3706D5AA2706D5AA270EBE1E0A370EBF3C0A270EBFF80A27190C8FCA2715AA371
+5AA2715A497EB600F06D480103B71280A3715A715A694B7BCA74>I<B912C018FCF0FF80
+19F085D8001F902680000713FE05007F063F1380060F13C07213E01AF0841AF8A27213FC
+A31AFEA81AFCA34E13F8A21AF0601AE04E13C0063F138095B51200050713FC92B75A19E0
+96C7FC18F803C0CAFCB3ABB712FCA5474B7BCA54>80 D<B9FC18F8F0FF8019E019F8D800
+0F9026C0000713FE9439007FFF80061F7F727F727F727F84868684A286A862A24E5BA262
+4E5B4E5B4E5B4E5B95B5C8FC050713FC92B712F0198006FCC9FC18FF9226C0003F13C005
+0713F0717F717F717F187F85727FA28486A786A71C3E86A28474137E72157C726D13FCB7
+00FC6D9038FE01F872EBFF8373EBFFF0071F14E007031480CD383FFE00574C7CCA5C>82
+D<DA7FFCEB01C00103B5EAC003011FECF00749ECFC0F90B7121F48D9E00F13BF4890C713
+FFD807FC141F4848804848140382484880177F485A173F171F12FFA2170F7FA217077F7F
+7F6D92C7FC6D7E6C13F014FF15F86CECFF8016F86C15FF6C16C0836C826C826C826C8201
+3F816D1680010716C01300020F15E01400030714F0ED007F160F16037013F882177F1278
+00F8163FA3171FA27E18F0A27EA26CEE3FE07F18C001E0157F6DEDFF8001FC160001FF14
+0302E0EB0FFED97FFEEB3FFC486CB612F0D8FC0F5DD8F803158048C66C49C7FC48010313
+F0354D79CB44>I<B700F8023FB512F8A5D8001F01C0C9380FE000745AB3B3AD6D180F63
+811A1F6D96C7FC626D7F1A7E6D7F6D606E6C4B5A6E6CED07F06E6C4B5A6E01C0EC3FC06E
+01F049B45A020101FF011F90C8FC6E91B55A033F15F8030715E0030092C9FC040713F055
+4C7CCA5E>85 D<B700F00203B6FCA5D8001F01E0C93803FC00745A6D61811A036D6D5F1A
+076D6D5F1A0F6D616F161FA26D6D94C7FC626E6D153E1A7E6E177C7015FC6E5F8219016E
+6D5D19036E5F7014076E5F82190F6E6D5D191F6E6D92C8FC616F153E83197E6F6D137C19
+FC6F6D5B18016F5DEFF003A26F01F85B18076F01FC5B180F6F5DEFFE1F6F92C9FC17FF60
+7013BE18FE705BA2705BA3705BA2705BA2705BA3705BA27090CAFCA2177EA2584C7ECA5D
+>I<ECFFFC010FEBFFC0017F14F090B612FC489038803FFE3B03FC0007FF80486C6D7F6D
+7F486D6C7F83167F83A2707E6C90C7FC6C5A6C5AC9FCA5ED1FFF021FB5FC49B6FC130F01
+3FEBC03F9038FFFE00000313F04813C04890C7FC485A485AA2485AA2485AA4167FA26D14
+FF007F15EF6D01017F6C6C903907CFFF806C6CD90F8F13FE6C9038E07F076C9038FFFE03
+00014A7ED8003F9038F0007F0103018090C7FC37347CB23C>97 D<EB7FC0B5FCA512037E
+B3ED07FF037F13E002C1B512FC02C714FF9126CFF80F7F9126DFC0017F02FFC77F4AEC3F
+F002F8814A6E7E717E4A81831980A37113C0A319E0AC19C0A35F1980A219005F606E141F
+6E5D4D5A6E4A5A02BF4A5A91261FC0035B9027FE0FF01F5B496CB548C7FCD9F80114F849
+6C6C13E0C8D80FFEC8FC3B4D7CCB44>I<91380FFF8091B512F8010314FF010F15804948
+C613C0D97FF8EB1FE0D9FFE0EB3FF04849137F4849EBFFF84890C7FCA2485A121FA24848
+EC7FF0EE3FE0EE1FC0007F92C7FC5BA212FFAC127FA27FA2123FA26C6C153EA26C6C157E
+177C6C6D14FC6C6D14F86C6D13036C6DEB07F0D97FFCEB1FE06DB4EBFFC0010F90B51200
+01035C010014F0020F13802F347CB237>I<EF1FF0EE3FFFA51600177FB3EC0FFF91B512
+E0010314F8010F14FC013FEB01FF903A7FF8003FFFD9FFE0130F48497F48497F4890C77E
+48815B121F5B123FA2127F5BA312FFAC127FA36C7EA3121F6D5C120F6C6C5C6C6D5B6C5D
+6C01E0013F7F6D6C49EBFFE090393FFE03FE6DB512F801075C0100148091261FFC00EBC0
+003B4D7CCB44>I<EC0FFF91B512F0010314FC010F14FF90263FFE077F90267FF0007F49
+486D7E4801806D7E486F7E4890C7120F484881707E121F491403003F82A2127F5B701380
+A212FFA390B8FCA401F8CAFCA5127FA27FA2123FA26C6CED0F80A26C6C151F6C17006E5C
+6C6D147E6C6D5C6C6D495AD93FFCEB07F0903A1FFF803FE0010790B55A010192C7FC6D6C
+13FC020713C031347DB238>I<DA7FFCEB0FE00103B538807FF8010F9138E1FFFC013F02
+FB13FE903A7FF01FFFF39026FFC007138348D90001130348168348486DEBC1FCEFC0F800
+0FEEE00049147F001F82A9000F5E6D14FF00075EA26C6C495B6C93C7FC6C9038C007FE91
+38F01FFC4890B55A01EF14E0D803C314809026C07FFCC8FC000790CAFCA47FA27F13FC90
+B612FCEEFFC06C16F817FE6C8218806C17C06D16E00003B812F0120FD81FFCC7000F13F8
+D83FF0140049153F4848ED1FFC00FF160F491507A56D150F007F17F86D151F6C6CED3FF0
+6C6CED7FE0D80FFE913801FFC06C6C6C010713806C01F8017F1300C690B612FC013F15F0
+01071580D9003F01F0C7FC37497DB13D>103 D<13FCEA03FF487F487FA2487FA66C5BA2
+6C5B6C90C7FCEA00FC90C8FCABEB7FC0B5FCA512037EB3B3A2B61280A5194D7BCC22>
+105 D<EB7FC0B5FCA512037EB3B3B3AAB61280A5194C7BCB22>108
+D<90287FC001FFC0EC7FF0B5010F01FC0103B5FC033F6D010F804B6D4980DBFE07902680
+3F817F9126C1F801903AC07E007FF00003D9C3E0DAE0F8806C9026C78000D9F1E06D7E02
+CFC7EBF3C002DEEDF780DD7FFF6E7E02FC93C7FC4A5DA24A5DA34A5DB3AAB6D8C03FB5D8
+F00FB512FCA55E327BB167>I<903A7FC001FFC0B5010F13F8033F7F4B13FFDBFE077F91
+38C1F00300039026C3E0017F6CD9C78080ECCF0014DE02DC6D7F14FC5CA25CA35CB3AAB6
+D8C07FEBFFE0A53B327BB144>I<913807FF80027F13F80103B6FC010F15C090261FFE01
+7F903A7FF0003FF849486D7E480180EB07FE4890C76C7E4817804980000F17C048486E13
+E0A2003F17F0A249157F007F17F8A400FF17FCAB007F17F8A46C6CEDFFF0A2001F17E0A2
+6C6C4A13C0A26C6C4A13806C6D4913006C5E6C01E0EB1FFC6D6C495A903A3FFE01FFF001
+0FB612C0010392C7FCD9007F13F80207138036347DB23D>I<90397FC007FFB5017F13E0
+02C1B512FC02C714FF9126CFF80F7F9126DFC0037F000301FFC77F6C496E7E02F8814A6E
+7E717E4A81831980A28319C0A37113E0AC19C05FA319805F19005F606E143F6E5D4D5A6E
+4A5A02FF495BDBC0075B9126EFF01F5B02E7B548C7FC02E114F8DAE07F13E0DB0FFEC8FC
+92CAFCAFB612C0A53B477CB144>I<9039FF803FE0B5EBFFF8028113FE02837FDA87E113
+80EC8F830003D99F0713C06C139E14BCA214F8A24A6C13806F13006F5A4A90C7FCA45CB3
+A8B612E0A52A327CB132>114 D<903907FF8070017FEBF1F048B6FC1207380FFC01391F
+E0003F4848130F491307127F90C71203A2481401A27FA27F01F090C7FC13FCEBFFC06C13
+FEECFFE06C14FC6C806CECFF806C15C06C15E06C15F06C7E011F14F8010114FCEB000FEC
+007FED1FFE0078140F00F8140715037E1501A27E16FC7E15036D14F86D13076D14F001F8
+EB1FE001FFEBFFC04890B51280486C1400D8F81F13FCD8E00313C027347CB230>I<14F8
+A51301A41303A21307A2130FA2131F133F137F13FF1203000F90B512F0B7FCA426007FF8
+C7FCB3A7167CAA013F14F880A290391FFE01F0010F1303903907FF87E06DEBFFC06D1480
+6D6C1300EC0FFC26467EC430>I<D97FE0EC3FF0B5EC7FFFA5000315016C81B3AC5EA25E
+A25E7E6EEB0F7F017F021E7F6E017CEBFFE090393FFE01F86DB512F0010714E0010114C0
+9027003FFE00EBC0003B337BB144>I<007FB500C090387FFFE0A5C601F0C73803F8006E
+5D017F5E6E1407013F5E80170F011F5E6E141F6D93C7FC6F5B6D153E6F137E6D157C6F13
+FCA26D6D5B16016D5DEDF803027F5CEDFC07023F5CEDFE0F021F5C15FF161F6E91C8FC16
+BF6E13BE16FE6E5BA26E5BA36E5BA26F5AA26F5AA26F5AA393C9FC5D153E157E157CD81F
+8013FC486C5B387FE001D8FFF05B14035D14074A5A49485A007F133F4948CAFC383F81FE
+381FFFF86C5B6C13C0C648CBFC3B477EB041>121 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fj cmr8 8 6
+/Fj 6 100 df<B512C0A412047F9018>45 D<DA1FF013C09138FFFE01903903F00F8390
+390F8001E3013FC71277017C143F4848141F4848140F48481407A248481403121F491401
+123F90C8FC481500A300FE1600AB127F17C0A27E7F001F15016D1580120F6C6C1403EE07
+006C6C14066C6C140ED8007C5C013F147890390F8001E0903903F00FC0902600FFFEC7FC
+EC1FF02A2F7CAD33>67 D<B712FEA23903F800010001EC003E828282A282A31780160115
+18A293C7FCA31538157815F890B5FCA2EBF800157815381518A21760A392C712C0A41601
+17801603A21607160F163F0003913801FF00B8FCA22B2D7EAC30>69
+D<B612C015FC3903F8007F0001EC0FC06F7E6F7E6F7E82150082A55E15015E4B5A4B5A4B
+5A037FC7FC90B512FC15F09038F800FC153E6F7E150F826F7EA582A5170316F815031707
+486C903801FC0EB539F000FE1CEE3FF8C9EA07E0302E7DAC34>82
+D<007FB712F8A29039000FC003007C150000701638A200601618A200E0161CA248160CA5
+C71500B3A94A7E011FB512E0A22E2D7EAC33>84 D<EB1FE0EB7FFC3801F01E3803E00739
+07C01F80EA0F80EA1F005A003EEB0F00007E90C7FCA2127C12FCA9127EA215C07E6C1301
+01801380380FC0033907E007003801F03E38007FF8EB1FC01A207E9E1F>99
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fk cmsy9 9 2
+/Fk 2 106 df<EB0180EB03C01307A21480130FA2EB1F00A2131E133EA25BA2137813F8
+A2485AA25B1203A2485AA25B120FA248C7FCA2121E123EA25AA2127812F8A41278127CA2
+7EA2121E121FA26C7EA212077FA26C7EA212017FA26C7EA21378137CA27FA2131E131FA2
+EB0F80A2130714C0A21303EB0180124A79B71E>104 D<126012F07EA21278127CA27EA2
+121E121FA26C7EA212077FA26C7EA212017FA26C7EA21378137CA27FA2131E131FA2EB0F
+80A2130714C0A41480130FA2EB1F00A2131E133EA25BA2137813F8A2485AA25B1203A248
+5AA25B120FA248C7FCA2121E123EA25AA2127812F8A25A1260124A7CB71E>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fl cmtt12 17.28 6
+/Fl 6 118 df<ED7FF00203B5FC021F14E0027F14F849B67E4915FF010F824982498249
+EBC01F9027FFFE00037F4801F801007F48496E7E02C0143F48496E7E4890C8120F491507
+001F8349815B003F18804981A2127F4917C08312FF90B9FCA71980190001C0CBFC7F127F
+A37F123F7FA26C6C163F6DEE7F806C6CEEFFC0A26C6D5C14E06C6D4A13806C01FC5C6C6D
+021F130090267FFFC05B6D9039F801FFFE6D90B65A6D5E6D5E6D5E01005E023F92C7FC02
+0F14FC020114E09126001FFEC8FC3A4179BF4A>101 D<EE1FFC263FFFF090B57E48D9F8
+0714E0DAFC1F14F8B5498092B67E14FD6C90B8FC856CEDE01FD8000FDA00077F03FC7F4B
+7F4B7F4B815D4B147FA292C8FCA25CA45CB3AC003FB690B612F848038115FCA2B700C315
+FEA36C038115FCA26C030015F8473F7FBE4A>110 D<EF0FFE003FB591B512C048DA8003
+14F0B6D8C00F14F8043F14FC93B6FC03C115FE15C36C14C76C02CFEBF80FC701DF13C092
+B5380007FC04FCEB03F84CEB01F004E090C7FC5E5E93C9FC5DA25DA25DA25DA25DA45DB3
+A6003FB712F84882B8FC83A35F7E6C5E3F3F7BBE4A>114 D<913A1FFF800F800103B5EA
+F81F011F9138FF3FC0017F15FF48B8FC5A5A5A5A48EBE00049C7121FD87FF880491403D8
+FFC080A25B82A37FEF7F806C7E01F892C7FC13FE383FFFC06C13FE6CEBFFF86CECFFE06C
+15FC6CEDFF806C6C15F0011F81010315FED9007F8002011580DA000F14C0DB003F13E016
+07040113F0D83F809138007FF8007F163F486CED1FFC170F7F1707A27FA26D150FA27F6D
+ED1FF86D157F02C0ECFFF06E130302FC013F13E091B712C0A2188001BF1600019F15FC01
+0F15F0010315C0267E007F49C7FC007C010713E0364176BF4A>I<EC0FC04A7E4A7EAF00
+3FB812FC4883BAFCA56C5F6C5FC7D83FF0C9FCB3ABF00FC0F01FE0F03FF0A76F147FA2F0
+FFE06E6C5B6F4913C06F5B6ED9E03F138093B61200806E5D6E15F86E5D6F5C6F1480030F
+01FCC7FC030013C03C507DCE4A>I<263FFFF049B57E486D49806E82B55CA36C81A26C81
+D8000F91C7127FB3B118FFA35F5F6E5C5F6E5C6D6D137FDBF003B612F86D90B812FCA26D
+18FE7F6E4A7E6E02FC14FC6EECE03F0207DA801F13F89126007FF8C9FC473F7FBD4A>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fm lcircle10 10 4
+/Fm 4 12 df<EA7FC0EAFFFEEBFFE06C13FCC66CB4FC010313C09038003FF0EC07FCEC01
+FE9138007F80ED1FC0ED07F06F7EED00FC167E82707E707E707E707E1601707E83177C83
+A2831880170FEF07C0A2170318E0A2170118F0A2170018F8A21878A4187CA2183CA71818
+3636B28364>8 D<1818183CA7187CA21878A418F8A218F01701A218E01703A218C01707
+A2EF0F80171F1800173EA25F17FC5F4C5A16034C5A4C5A4C5A4CC7FC167E5EED03F84B5A
+ED1FC0ED7F80DA01FEC8FCEC07FCEC3FF0903803FFC0017F90C9FC387FFFFCB512E049CA
+FCEA7FC03636B2B564>I<126012F0A77EA21278A3127CA2123C123EA2121E121FA27E7F
+A26C7E7F12036C7EA26C7E7F137E133E7F806D7E6D7E6D7E6D7E6D7E147F6E7EEC0FC0EC
+07F0EC03FCEC00FFED7FC0ED1FF8ED07FF030113FC9239007FFFF8040F13FC1601933800
+07F8363680B564>I<EF07F8933801FFFC160F047F13F8923901FFFC00030790C7FCED1F
+F8ED7FC04BC8FCEC03FCEC07F0EC0FC0EC3F804AC9FC14FC495A495A495A495A495A91CA
+FC133E137E5B5B485AA2485A12075B485AA290CBFC5AA2121E123EA2123C127CA21278A3
+12F8A25AA712603636808364>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fn cmti10 10.95 37
+/Fn 37 122 df<933807FF80043F13E09338FE00F8DB01F0133EDB07E0130E4B48131F4C
+137F031F14FF4BC7FCA218FE157E1878180015FE5DA31401A25DA414030103B712F0A218
+E0903A0003F000070207140F4B14C0A3171F020F15805DA2173F1800141F5D5F177EA214
+3F92C712FE5FA34A1301027EECF81CA3160302FEECF03C4A1538A21878187013014A0101
+13F018E0933800F1C0EF7F804948EC1F0094C7FCA35C1307A2001E5B127F130F00FF5BA2
+49CAFC12FEEAF81EEA703CEA7878EA1FF0EA07C0385383BF33>12
+D<EA01E0EA07F8120FA2EA1FFCA4EA0FF8EA0798EA001813381330A21370136013E013C0
+1201EA0380EA07001206120E5A5A5A5A5A0E1C7A891C>44 D<120FEA3FC0127FA212FFA3
+1380EA7F00123C0A0A77891C>46 D<131EEB3F80137FEBFFC05AA214806C13005B133C90
+C7FCB3120FEA3FC0127FA212FFA35B6CC7FC123C122777A61C>58
+D<9339FF8001C0030F13E0033F9038F803809239FF807E07913A03FC001F0FDA0FF0EB07
+1FDA1FC0ECBF00DA7F806DB4FC4AC77E495AD903F86E5A495A130F4948157E4948157C49
+5A13FF91C9FC4848167812035B1207491670120FA2485A95C7FC485AA3127F5BA312FF5B
+A490CCFCA2170FA2170EA2171E171C173C173817786C16706D15F04C5A003F5E6D140300
+1F4B5A6D4AC8FC000F151E6C6C5C6C6C14F86C6C495A6C6CEB07C090397FC03F8090261F
+FFFEC9FC010713F0010013803A4272BF41>67 D<49B812F8A390260003FEC7121F18074B
+14031801F000F014075DA3140F5D19E0A2141F4B1338A2EF7801023F027013C04B91C7FC
+A217F0027F5CED80011603160F91B65AA3ED001F49EC07805CA3010392C8FC5CF003804C
+13070107020E14005C93C75A180E010F161E4A151C183CA2011F5E5C60A2013F15014A4A
+5A1707017F150F4D5A4A147F01FF913807FF80B9FCA295C7FC3D3E7BBD3E>69
+D<49B6FC5BA2D9000313005D5DA314075DA3140F5DA3141F5DA3143F5DA3147F5DA314FF
+92C7FCA35B5CA313035CA313075CA3130F5CA3131F5CA3133F5CA2137FA25C497EB67EA3
+283E7BBD23>73 D<49B5933807FFFC496062D90003F0FC00505ADBBF805E1A771AEF1407
+033F923801CFE0A2F1039F020FEE071F020E606F6C140E1A3F021E161C021C04385BA2F1
+707F143C023804E090C7FCF001C0629126780FE0495A02705FF00700F00E0114F002E003
+1C5BA2F03803010116704A6C6C5D18E019070103ED01C00280DA03805BA2943807000F13
+070200020E5C5FDB03F8141F495D010E4B5CA24D133F131E011CDAF9C05CEEFB80197F01
+3C6DB4C7FC013895C8FC5E01784A5C13F8486C4A5CD807FE4C7EB500F04948B512FE16E0
+1500563E7BBD52>77 D<EEFFC0030713F892383F80FE9238FC003FDA03F0EB0F804A486D
+7EDA1F80804AC76C7E027E6E7E4A81494814004948811307495A4948157F133F5C49C9FC
+4917805B1201485AA212075B000F17FFA25B121F190048485DA448484B5AA34D5AA25B4D
+5A12FF60171F60007F163F604D5AA24DC7FC5F003F15014C5A6D5D001F4B5A4C5A6C6C4A
+5A4C5A6C6C4AC8FC000315FC6C6C495A6C6CEB07E0017FEB1F8090261FC07EC9FC903807
+FFF801001380394273BF46>79 D<49B77E18F018FC903B0003FE0003FEEF00FF4BEC7F80
+F03FC00207151F19E05DA2020F16F0A25DA2141FF03FE05DA2023F16C0187F4B1580A202
+7FEDFF00604B495A4D5A02FF4A5A4D5A92C7EA3FC04CB4C7FC4990B512FC17E04ACAFCA2
+1303A25CA21307A25CA2130FA25CA2131FA25CA2133FA25CA2137FA25C497EB67EA33C3E
+7BBD3E>I<49B612FCEFFF8018F0903B0003FE000FF8EF03FE4BEB00FF8419800207ED3F
+C05DA219E0140F5DA3021FED7FC05DA2F0FF80143F4B15004D5A60027F4A5A4B495A4D5A
+EF3F8002FF02FEC7FC92380007F892B512E01780499038000FE04A6D7E707E707E010381
+4A130083A213075CA25E130F5C5F1603131F5CA3013F020714404A16E05F017F160119C0
+4A01031303496C1680B6D8800113079438FE0F009338007E1ECAEA3FFCEF07F03B407BBD
+42>82 D<92390FF001C0ED7FFE4AB5EA0380913907F80FC791390FC003EF91391F8001FF
+4AC71300027E805C495A4948143EA2495AA2010F153C5CA3011F1538A38094C7FC80A214
+FC6DB4FC15F015FE6DEBFFC06D14F06D14FC6D80143F020F7F020180EC001F150303007F
+167F163FA2161FA212075A5F120EA2001E153F94C7FCA2163E003E157E167C003F15FC4B
+5A486C5C4B5A6D495AD87DE0EB1F80D8F8F849C8FC017F13FE39F03FFFF8D8E00F13E048
+C690C9FC32427ABF33>I<48B9FCA25A903AFE001FF00101F89138E0007FD807E0163E49
+013F141E5B48C75BA2001E147FA2001C4B131C123C003814FFA2007892C7FC12704A153C
+00F01738485CC716001403A25DA21407A25DA2140FA25DA2141FA25DA2143FA25DA2147F
+A25DA214FFA292C9FCA25BA25CA21303A25CEB0FFE003FB67E5AA2383D71BC41>I<277F
+FFFE01B500FC90B512E0B5FCA20003902680000790C7380FFC006C90C701FCEC07F04972
+5A04035EA26350C7FCA20407150EA2040F5D1A3C041F153862163B6216734F5A6D14E303
+014B5A6C15C303034BC8FC1683DB0703140E191E030E151C61031C7F61ED380161157003
+F04A5A15E002014B5A15C0DA03804AC9FC60DA0700140E60140E605C029C5D14B8D97FF8
+5D5C715A5C4A5DA24A92CAFC5F91C7FC705A137E5F137C5F137801705D53406EBD5B>87
+D<147E49B47E903907C1C38090391F80EFC090383F00FF017E137F4914804848133F485A
+A248481400120F5B001F5C157E485AA215FE007F5C90C7FCA21401485C5AA21403EDF038
+5AA21407EDE078020F1370127C021F13F0007E013F13E0003E137FECF3E1261F01E313C0
+3A0F8781E3803A03FF00FF00D800FC133E252977A72E>97 D<EB1FC0EA0FFF5CA2EA003F
+A291C7FCA25BA2137EA213FEA25BA21201A25BA21203A25B147E3907F1FF809038F783E0
+9038EF01F013FE390FF800F8A24913FC49137C485A157E5B15FE123FA290C7FCA2481301
+15FC127EA2140300FE14F85AA2EC07F0A215E048130F15C0141F15800078EB3F00127C14
+7E003C5B383E01F8381E03E06C485A6CB4C7FCEA01F81F4076BE2A>I<EC1FE0ECFFF890
+3803F03E903807C00F90381F8007D93F001380017E131F49137F485A485A000715005B00
+0F147E484890C7FCA2485AA3127F90C9FCA35A5AA6481403007E5C5D151E003E5C5D6C5C
+EC03E0390F800F802603E07EC7FC3801FFF838003FC0212977A72A>I<EE3F80ED1FFF17
+00A2ED007FA2167EA216FEA25EA21501A25EA21503A25EA21507A25E147E903801FF8F90
+3807C1CF90391F80EFC090383F00FF017E137F5B48486D5A485AA2485A000F92C7FC5B00
+1F5CA24848137EA215FE127F90C75AA214015A485CA2140316384814F0A2140716789138
+0FE070127C021F13F0007E013F5B003E137FECF3E1261F01E35B3A0F8781E3802703FF00
+FFC7FCD800FC133E294077BE2E>I<EC3F80903801FFE0903807E0F890381F803CEB3E00
+01FC131E485A485A12074848133E49133C121F4848137C15F8EC03F0397F000FE0ECFF80
+B5EAFC0014C048C8FCA45AA61506150E151E007C143C15786C14F0EC01E06CEB07C0390F
+801F003807C0FC3801FFF038007F801F2976A72A>I<167C4BB4FC923807C78092380F83
+C0ED1F87161FED3F3FA2157EA21780EE0E004BC7FCA414015DA414035DA30103B512F8A3
+90260007E0C7FCA3140F5DA5141F5DA4143F92C8FCA45C147EA414FE5CA413015CA4495A
+A4495AA4495A121E127F5C12FF49C9FCA2EAFE1EEAF83C1270EA7878EA3FE0EA0F802A53
+83BF1C>I<EC03F0EC0FFC91383E0E1C9138FC077E903901F003FE1303903807E001D90F
+C013FCEB1F80A2EB3F004914F8137E01FE1303A2484814F0A2150712034914E0A2150F12
+074914C0A2151FA216805B153F1203ED7F006D5BA200015B0000495A9038F80F7E90387C
+1EFEEB1FF8903807E0FC90C7FC1401A25DA21403A25D001C1307007F5C48130F5D4A5A4A
+C7FC48137E00F85B387C03F0381FFFC0D803FEC8FC273B7CA72A>I<EB01FC13FF5CA213
+03A25CA21307A25CA2130FA25CA2131FA25CA2133FA291C8FCEC03F890387F0FFE91383E
+0F80D97E7813C0ECE007D9FFC013E014801400A2485A5BA25B0003140F16C05BA2000714
+1F16805BA2000F143F16005B5D001F147EEDFE074913FCA2003F0101130FEDF80E130016
+1E48ECF01CA2007E1538A200FE1570020013E048EC7FC00038EC1F0028407ABE2E>I<14
+78EB01FCA21303A314F8EB00E01400AD137C48B4FC38038F80EA0707000E13C0121E121C
+EA3C0F1238A2EA781F00701380A2EAF03F140012005B137E13FE5BA212015BA212035B14
+38120713E0000F1378EBC070A214F0EB80E0A2EB81C01383148038078700EA03FEEA00F8
+163E79BC1C>I<EB01FC13FF5CA21303A25CA21307A25CA2130FA25CA2131FA25CA2133F
+A291C8FCED03E049EB0FF8ED3C3C017EEB707CEDE1FC9038FE01C1EC03839038FC070314
+0E0001011C13F891383800E0494813001460000313E0EBF9C0EBF78001FEC8FC1207EBFF
+E0EBE7F8EBE0FE000F137F6E7EEBC01F6E7E121F16701380A2003F15F0021F13E0010013
+80A248148116C0007EEB0F83168000FE14879138078F0048EB03FE0038EB00F826407ABE
+2A>107 D<EB07F0EA03FF14E0A2EA000FA214C0A2131FA21480A2133FA21400A25BA213
+7EA213FEA25BA21201A25BA21203A25BA21207A25BA2120FA25BA2121FA25BA2123FA290
+C7FCA25A1307127EA2EAFE0F130E12FCA2131E131CA2EA7C381378EA3C70EA1FE0EA0780
+144079BE17>I<D801F0D93F80137F3D07FC01FFE003FFC03D0F3E07C1F80F83F03D0E1F
+0F00FC1E01F8001E011C90387C3800001C49D97E707F003C01F05C0038157F4A5C26783F
+C05C12704A91C7FC91C7127E00F003FE1301494A5CEA007EA20301140301FE5F495CA203
+031407000160495C180F03075D0003051F13E0494A1480A2030FEC3F810007F001C0495C
+A2031F91383E0380120F494AEC0700A2033F150E001FEF1E1C4991C7EA0FF80007C7000E
+EC03E0432979A74A>I<D801F0EB3F803A07FC01FFE03A0F3E07C1F83A0E1F0F00FC001E
+011C137C001C49137E003C13F012385C38783FC012705C91C7FC00F015FE495CEA007EA2
+150101FE5C5BA2150300015D5B15075E0003020F13704914C0A2031F13F00007ED80E05B
+1681EE01C0120F49EC0380A2EE0700001FEC0F0E49EB07FC0007C7EA01F02C2979A733>
+I<EC1FC0ECFFF8903803F07C90380FC01FEB1F8090393F000F80017E14C0491307484814
+E0485A12075B000F15F0485AA2485AA2ED0FE0127F90C7FCA2151F4815C05AA2ED3F80A2
+ED7F00A248147E007C5C007E13015D4A5A003E495A6C495A4A5A260F803EC7FC3807C0FC
+3801FFF038003F80242977A72E>I<903903E001F890390FF807FE903A1E7C1E0F80903A
+1C3E3C07C0013C137801389038E003E0EB783F017001C013F0ED80019038F07F0001E015
+F8147E1603000113FEA2C75AA20101140717F05CA20103140F17E05CA20107EC1FC0A24A
+1480163F010F15005E167E5E131F4B5A6E485A4B5A90393FB80F80DA9C1FC7FCEC0FFCEC
+03E049C9FCA2137EA213FEA25BA21201A25BA21203A2387FFFE0B5FCA22D3A80A72E>I<
+D801F013FC3A07FC07FF803A0F3E0F03C0260E1F1C13E0001EEB380F001C1370003CEBE0
+1F123814C0D8783F14C00070903880070092C7FC91C8FC12F05BEA007EA313FE5BA31201
+5BA312035BA312075BA3120F5BA3121F5B0007C9FC232979A726>114
+D<EC7F80903801FFE0903807C0F890381F003C013E131C013C131E017C133E49137E15FE
+A2000114FCA215706D13007FEBFFC014FC6C13FF15806D13C06D13E0010F13F01300140F
+14071403120C123F387F80011403D8FF0013E0A300FCEB07C000F0EB0F8012700078EB1F
+006C133C381F01F83807FFE0C690C7FC1F297AA725>I<EB01C0EB03F01307A25CA2130F
+A25CA2131FA25CA2133FA291C7FCA2007FB51280B6FC1500D8007EC7FC13FEA25BA21201
+A25BA21203A25BA21207A25BA2120FA25BA2121F141C1380A2003F133C1438EB00781470
+14F05C495AEA1F03495A6C48C7FCEA07FCEA01F0193A78B81E>I<137C48B4141C26038F
+80137EEA0707000E7F001E15FE121CD83C0F5C12381501EA781F007001805BA2D8F03F13
+03140000005D5B017E1307A201FE5C5B150F1201495CA2151F0003EDC1C0491481A2153F
+1683EE0380A2ED7F07000102FF13005C01F8EBDF0F00009038079F0E90397C0F0F1C9039
+1FFC07F8903907F001F02A2979A731>I<017CEB01C048B4EB07F038038F80EA0707000E
+01C013F8121E001C1403EA3C0F0038EC01F0A2D8781F130000705BA2EAF03F91C712E012
+005B017E130116C013FE5B1503000115805BA2ED07001203495B150EA25DA25D15780001
+14706D5B0000495A6D485AD97E0FC7FCEB1FFEEB03F0252979A72A>I<017C167048B491
+387001FC3A038F8001F8EA0707000E01C015FE001E1403001CEDF000EA3C0F0038177C15
+07D8781F4A133C00701380A2D8F03F130F020049133812005B017E011F14784C137013FE
+5B033F14F0000192C712E05BA2170100034A14C049137E17031880A2EF070015FE170E00
+010101141E01F86D131C0000D9039F5BD9FC076D5A903A3E0F07C1E0903A1FFC03FFC090
+2703F0007FC7FC372979A73C>I<903903F001F890390FFC07FE90393C1E0E0F9026780F
+1C138001F0EBB83FD801E013F89039C007F07FEA0380000714E0D9000F140048151C000E
+4AC7FCA2001E131FA2C75BA2143F92C8FCA35C147EA314FE4A131CA30101143C001E1538
+003F491378D87F811470018314F000FF5D9039077801C039FE0F7C033A7C0E3C07802778
+3C1E1EC7FC391FF80FFC3907E003F029297CA72A>I<137C48B4143826038F8013FCEA07
+07000E7F001E1401001C15F8EA3C0F12381503D8781F14F000701380A2D8F03F13070200
+13E012005B017E130F16C013FE5B151F1201491480A2153F000315005BA25D157EA315FE
+5D00011301EBF8030000130790387C1FF8EB3FF9EB07E1EB00035DA21407000E5CEA3F80
+007F495AA24A5AD8FF0090C7FC143E007C137E00705B387801F0383803E0381E0FC06CB4
+C8FCEA03F8263B79A72C>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fo cmcsc10 10.95 19
+/Fo 19 121 df<DB1FF8EB01804AB5EA8003020FECE007913A3FF803F80F9139FF80007C
+4948C7EA1E1FD907FCEC0FBFD90FF0EC07FF49488049488049488049C9127F4848163F12
+0349161F12074848160FA2485A1807123F5B1803127FA34993C7FC12FFAB0407B512FE12
+7F7FDC000113C09438007F80123FA27F121FA26C7EA26C7E12037F6C7E7E6D6C15FF6D7E
+6D6C5C6D7ED907FCEC03DFD901FFEC0F8F6D01C0EB3F07913A3FF801FC03020FB5EAF001
+020102C0C7FC9126001FFCC8FC3F427ABF4D>71 D<B56C91387FFFFC8080D8007F030313
+806E913800FE006E157C1838EB77FCEB73FE80137101707F6E7EA26E7E6E7EA26E7E6E7E
+A26E7E6E7EA26E7F6F7EA26F7E6F7EA26F7E6F7E8215036F7E6F1380A2EE7FC0EE3FE0A2
+EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF7013B8A2EF7FF8173FA2171F170F1707A21703
+01F81501487ED807FF1500B500F81578A218383E3E7BBD4A>78 D<B600C090387FFFFCA3
+000101E0C70003138026007F80913800FE00187C1838B3B3A4013F16786E1570A218F001
+1F5E6E1401010F5E6D6C1403606D6C14076D6C4AC7FC6D6C141E027F147C91393FC001F8
+91390FF00FE00203B55A020049C8FCED1FF03E407BBD4A>85 D<EC01E0A24A7EA34A7EA3
+4A7EA24A7E141CA2EC3CFFEC387FA24A6C7EA34A6C7EA2010180ECC00FA249486C7EA349
+486C7EA24980010E1301010FB5FC4980A2011CC7FC49147FA20178810170143FA201F081
+49141F1201486C811207486CEC3FF8D8FFFE49B512C0A332317DB038>97
+D<B612FEEDFFC016F03A03FC0007F86C48EB01FE1500167F1780163F17C0A61780167F17
+0016FE4B5AED07F0ED7FE090B6128016F09039F80001FC6F7EEE7F80163FEE1FC017E016
+0F17F0A617E0161FA2EE3FC0EE7F80923801FF00486CEB07FEB712F85E93C7FC2C2F7CAE
+35>I<DA0FF81330DA7FFF13700103B5EAC0F090390FFC03F190391FE000F9D97F80133F
+01FEC7121F4848140F48481407485A000F1503491401121F491400123F5B127F1770A248
+C9FC1700AA6C6C1570A3123F6D15F0121F6D15E0000F15016D15C0000715036C6C15806C
+6C14076C6CEC0F00D97F80133ED91FE05B90390FFC03F00103B55AD9007F1380DA0FF8C7
+FC2C317BAF36>I<B612FEEDFFE016F83A03FE0007FC6C48EB00FFEE3F80707E707E707E
+707E160183160083A2177FA41880AA1800A317FEA34C5A5F16034C5A5FEE1FC04C5A04FF
+C7FC486CEB07FEB712F816E093C8FC312F7DAE39>I<B81280A3D803FEC7FC6C48EC1FC0
+160F16071603A21601A317E0ED0E00A31700A2151E153E157E90B512FEA39038FC007E15
+3E151E150EA21738A392C71270A417F0A2EE01E0A216031607161F486C14FFB812C0A32D
+2F7DAE33>I<B8FCA33903FE00016C489038003F80161F160F1607A21603A317C0160115
+0EA293C7FCA3151E153E157E90B512FEA39038FC007E153E151E150EA592C8FCAA487EB5
+12FCA32A2F7DAE31>I<DA0FF81360DAFFFE13E00103EBFF8190390FF807E390393FC000
+F34948137F01FEC7123F4848141F4848140F48481407120F491403485A003F1501A25B00
+7F1500A348C9FC1700A8031FB5FCA26C7E9238001FF0EE0FE0123F7FA26C7E120F7F1207
+6C7E6C7E6C6C141FD97F80133FD93FE0137B90390FFC03F10103B512E00100EC8060DA0F
+FCC7FC30317BAF3A>I<B512F8A33803FE006C5AB3B3A3487EB512F8A3152F7DAE1B>105
+D<D8FFFE923807FFF0A3D803FF92380FFC006C5FD9DF80141DA3D9CFC01439A2D9C7E014
+71A3D9C3F014E1A2D9C1F8EB01C1A3D9C0FCEB0381A2027EEB0701A36E130EA291381F80
+1CA391380FC038A2913807E070A3913803F0E0A3913801F9C0A2913800FF80A3486CEB7F
+00487E486C013E497EB5008091B512F0A2151C3C2F7CAE44>109
+D<D8FFFC91387FFFC07F7F0001923807FC006E6D5A6E6D5AD9DFE06D5AA2EBCFF0EBC7F8
+EBC3FCA2EBC1FEEBC0FF6E7EA26E7E6E7EA26E7E6E7E6E7EA26E7E6E7EED7F80A2ED3FC0
+ED1FE0ED0FF0A2ED07F8ED03FCA2ED01FEED00FF167FA2163F161F160F487E486C140748
+6C1403B56C1301A21600322F7DAE38>I<EC1FF891B5FC903907F00FE090390FC003F001
+3FC712FC017E147E49804848EC1F804848EC0FC04848EC07E0000F16F0491403001F16F8
+491401003F16FCA2007F16FE90C9FCA34816FFAA6C6CEC01FEA3003F16FCA26D1403001F
+16F86C6CEC07F0A26C6CEC0FE0000316C06C6CEC1F806C6CEC3F00017E147E6D5C90390F
+C003F0903907F00FE00100B5C7FCEC1FF830317BAF3A>I<B612FEEDFFC016F03A03FE00
+07FC6C48EB01FEED007FEE3F80A2EE1FC0A217E0A617C0A2EE3F80A2EE7F00ED01FCED07
+F890B612E0168001FCC9FCB2487EB512F8A32B2F7DAE33>I<90383FC00C9038FFF81C00
+03EBFE3C390FE03FFC381F8007EB0003003E1301481300157C5A153CA36C141CA27E6C14
+006C7E13E013FE383FFFE06C13FE6CEBFF806C14E0000114F06C6C13F8010F13FC1300EC
+07FE14011400157F153F12E0151FA37EA2151E6C143E6C143C6C147C6C14F89038C001F0
+39FBF807E000F1B512C0D8E07F130038C007FC20317BAF2A>115
+D<007FB712F8A39039801FF0073A7E000FE00000781678A20070163800F0163CA348161C
+A5C71500B3A8EC3FF8011FB512F0A32E2E7CAD36>I<B500F890387FFFC0A3D803FEC738
+07FC006C486E5A705A705AB3AB000015016D5D1603017E5D017F14076D6C49C7FC131F6D
+6C133ED907F05B903903FC03F00100B55A023F1380DA07FCC8FC32307DAE38>I<3B7FFF
+F001FFFEA30003D9C00013E0C649EB7F80017F027EC7FC167C6D6C13786D6C5B6D6C5B15
+016D6C485AD903FC5B15076D6C48C8FC903800FF1EEC7F9C15BCEC3FF86E5AA2140F6E7E
+14034A7E4A7EEC1EFF141C91383C7F804A6C7E14709138F01FE049486C7E49486C7E1480
+01076D7E49486C7E130E011E6D7E496E7E017C6E7E13FC000382D80FFEEC7FF8B549B512
+C0A3322F7DAE38>120 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fp cmr7 7 3
+/Fp 3 52 df<13381378EA01F8121F12FE12E01200B3AB487EB512F8A215267BA521>49
+D<13FF000313E0380E03F0381800F848137C48137E00787F12FC6CEB1F80A4127CC7FC15
+005C143E147E147C5C495A495A5C495A010EC7FC5B5B903870018013E0EA018039030003
+0012065A001FB5FC5A485BB5FCA219267DA521>I<13FF000313E0380F01F8381C007C00
+30137E003C133E007E133FA4123CC7123E147E147C5C495AEB07E03801FF8091C7FC3800
+01E06D7E147C80143F801580A21238127C12FEA21500485B0078133E00705B6C5B381F01
+F03807FFC0C690C7FC19277DA521>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fq cmsl10 10.95 42
+/Fq 42 122 df<EEFF80030F13F092383FC0789238FE001CDA03F8130E4A48133FDA1FE0
+13FF4A5A4B5AEC7F005C5CEE00FE010115784A1400A513035CA4EE01FC0007B7FC17F8A2
+3A0007F0000F1607A2130F4A14F0A4160F131F4A14E0A4161F133F4A14C0A4163F137F91
+C71380A4167F5B491500A31201486C903801FF80B5D8F83F13FC5DA230407EBF33>12
+D<007FB5FCA2B512FEA418067C961E>45 D<13F0EA01FC1203EA07FEA313FCA2EA03F8EA
+01E0C7FCB3121EEA3F80EA7FC012FFA41380EA7F00123C0F2778A619>58
+D<17E016011603831607A2160FA2161F83163FA2167F167716F7EEE7FCED01E316C31503
+16831507EE03FEED0F01150E151E151C153C03387FED7800157015F05D4A4880177F4A5A
+A24AC7FCA2020E81173F5C021FB6FC5CA20270C7EA3FE0171F5CA2495AA2494881170F49
+C8FCA2130EA24982013C1507A2137CD801FE4B7E2607FF80EC3FFEB500F00107B512FC19
+F85E3E417DC044>65 D<013FB7FC18E018FC903B007FE00007FE6E48903801FF80943800
+7FC05DF03FE0F01FF0A3027F16F892C8FCA54A16F04A153F19E0187F19C0F0FF8001014B
+13004A4A5A4D5AEF1FF04D5ADC03FFC7FC49B612F8EFFF8002F8C7EA3FE0EF0FF0EF07FC
+717E010715014A81711380A319C0130F5CA5011F4B13805C19005F601707013F4B5A4A4A
+5A4D5A4D5A017F913801FF8001FF020F90C7FCB812FC17F094C8FC3D3E7DBD40>I<DCFF
+C01338030F01F01378037F01FC13F0913A01FF803F01913A07FC000781DA1FE0EB03C3DA
+7FC0EB01E74AC812FF4948ED7FE0D907FC153F495A4948151F495A4948150F494816C018
+074890C9FC485AA2485A000F1880491603121FA248481607A295C7FC485AA412FF5BA75B
+A2181C183C1838A27F007F1778187018F0003F5F6D150160001F16036C6C4B5A95C7FC6C
+6C5D6C6C151E6C6C5D6C6C15F86D6C495A6D6CEB07C0D91FF0EB1F80D907FE01FEC8FC01
+01B512F86D6C13E0DA07FEC9FC3D4276BF42>I<013FB7FC18E018F8903B007FF0000FFE
+6E48EB01FF9438007FC04B6E7E180F85727E727E147F4B6E7EA2727EA302FF178092C9FC
+A54918C05CA41A8013034A5DA41A0013074A5DA261A24E5A130F4A5E180F61181F61011F
+4C5A5C4E5A4EC7FC4D5A4D5A013F4B5A4A4A5AEF3FE0EF7F80017F4A48C8FC01FFEC1FFC
+B812F0178004FCC9FC423E7DBD45>I<013FB812F8A39026007FF0C7127F6E48140F1803
+4B14011800A31978147F4B1570A502FF143892C7FCA3190017784915704A14F016011603
+160F91B6FC495DA29138FC001F16071603160101075D5CA2197019F019E0010F4A5A4A90
+C7120119C0A218031980011F16075CF00F00A260181E013F163E4A157E4D5A1703017F15
+0F01FFEDFFF8B9FCA2603D3E7DBD3E>I<013FB812E0A3903A007FF000016E48EB003F18
+0F4B14071803A31801147F4B15C0A514FF92C71270A395C7FC17F0495D5C160116031607
+161F49B65AA39138FC003F160F160701075D4A1303A5010F4AC8FC5C93C9FCA4131F5CA5
+133F5CA3137FEBFFF0B612F8A33B3E7DBD3B>I<4BB46C1370031F01F013F0037F9038FC
+01E0913A03FF807E03913A0FF8000F83DA1FE0EB07C7DA7F80EB01EF4AC812FFD903FE16
+C04948157F4948153F495A4948151F495A4948168091C9120F5A485AA2485A000F180049
+82121FA248485EA295C7FC485AA412FF5BA6043FB512E05BA29339001FFC00715AA2607F
+127FA2171F123F6D5EA2121F7F000F163F6C7E6C6C4B5A7F6C6C15FF6C6DEB01EFD93FC0
+EB07C7D91FF0EB1F87D907FE9038FE03800101B5EAF8016D6C01E0C8FCDA07FEC9FC3C42
+76BF47>I<011FB512FC5BA29039003FF8006E5AA25DA5143F5DA5147F5DA514FF92C7FC
+A55B5CA513035CA513075CA5130F5CA5131F5CA3133F497E007FB512F0A2B6FC263E7EBD
+21>73 D<013FB512FEA25E9026007FF8C8FCEC3FE0A25DA5147F5DA514FF92C9FCA55B5C
+A513035CA513075CA21838A21870130F5CA218E0A3011F15014A15C01703A21707EF0F80
+013F151F4A143F177FEFFF00017F140301FF143FB9FC5FA2353E7DBD39>76
+D<90263FFFE0023FB5FC6F16FEA29026003FF8020313C0021F030013004A6C157C023B16
+3C6F15381439810238167802787FDA707F157082153F82031F15F002F07FDAE00F5D8215
+078203031401010180DAC0015D82811780047F1303010315C04A013F5C17E0161F17F004
+0F1307010715F891C7000791C7FC17FC160317FE04015B4915FF010E6E130E188E177F18
+CEEF3FDE011E16FE011C6F5AA2170FA21707133C01386F5A133C017C150113FE2607FF80
+1400B512FC18705C483E7DBD44>78 D<923803FF80031F13F09238FE01FE913903F0003F
+DA0FC0EB1FC0DA3F80EB07E0027EC76C7E49486E7E49488149486E7E4948157F495A013F
+17804948ED3FC049C9FCA24848EE1FE012035B000718F05B120FA2485A19F8123F5BA212
+7FA219F04848163FA5F07FE0A35BF0FFC0A219805F19007F4D5A127F4D5A60003F160F6D
+5E001F4C5A4D5A6C6C4B5A95C7FC6C6C15FE00034B5A6C6C4A5A6C6C4A5A017FEC1FC06D
+6C495AD90FE001FEC8FC903903F807F80100B512C0DA0FFCC9FC3D4276BF47>I<013FB6
+12F017FF18E0903B007FF0003FF86E48EB07FCEF01FE4B6D7EF07F8019C0183F19E0147F
+4B15F0A502FFED7FE092C8FCA219C0F0FF80A2494B13004A5D4D5AEF0FF04D5AEF7F8001
+03DA07FEC7FC91B612F017809139FC0007E0EE03F8EE00FC0107814A147F717EA284A213
+0F5CA484011F157F5CA41902013F17075CA2F0F00F017F170E496C143FB600E0011F131C
+94380FF83C4B01071378CA3801FFE09438003F8040407DBD43>82
+D<9239FF8003800207EBF007021F9038FC0F0091387F00FE02FCEB1F1FD903F0EB07BF49
+486DB4FC49487F4A6D5A49C8FC49157E133E137E173E49153CA57F1738A26D92C7FC8080
+80EB7FFEECFFE06D13FEEDFFC06D14F06D14FC010380010080143F020380DA003F7F1503
+1500707E163F161FA2160F121CA31607160F003C5EA35F003E151F94C7FC007E5D007F15
+3E6D5C16FC01E0495AD87DF0495AD8FCFCEB0FC03AF87F803F8027F01FFFFEC8FCD8E007
+13F839C0007FC031427BBF33>I<0007B912F0A33C0FFE000FF8003F01F0160F01C04A13
+034848160190C7FC121EF000E048141F5E1238A212781270153F5E5AA3C81600157F5EA5
+15FF93C9FCA55C5DA514035DA514075DA5140F5DA3141FEC7FFC0003B7FCA33C3D76BC42
+>I<B600E090B512FC4B15F8A2000101C0C7000F13006C49EC03FCEF01F091C9FC60A317
+015A495EA417031203495EA4170712074993C7FCA45F120F49150EA4171E121F49151CA4
+173C123F491538A31778177017F05F001F15015F16036D4A5A000F93C8FC5E6C6C141E6C
+6C5C000115F86C6C495A017FEB07C090393FC03F8090260FFFFEC9FC010313F89038007F
+C03E4073BD44>I<B6017FB5D88007B512804A1A00A2000701C0010101E0C713F06C90C8
+0180EC3FC06C48735A99C7FC057F150E1B1E6D191C6C1A3C1B3805FF15787214705E636E
+EB03BF017F4E5AEE073F505A040E7F051F4AC8FC161C6E170E013F143862167804706D5B
+EEF00F04E05D90381FE00104C015F003035E0480140106F85B9226070007130302F05F01
+0F010E150797C9FC5D190E4BEB03FC616E5A01075F5D61DAF9C014FE05015BECFB8002FF
+6F5A7F92C75CA24A93CAFC835C606D5A605C604A15781870594074BD5D>87
+D<EC7FC0903803FFF890380FC07E90383E003F496D7E01FF6D7E82A248140782A26C5A13
+7890C7120FA25EA2EC03FF147F903807FF1FEB1FE0D97F805B3801FE00EA03F8485A4848
+133F485A003F5D49EC81C048C7FCA2157F48ED03804814FFA2007F5B913903BF07009038
+80073F3A3FC00E1F8E260FE03C13FC3A03FFF00FF83A007FC003E02A2A7CA82D>97
+D<EB3F80EA1FFFA3C6FC137FA291C9FCA55B5BA512015BA4EC07F80003EB3FFF9039F8F8
+0FC09039FBE003E09039FF8001F891C77E5B4848147E49147F5B821780A2120F5B17C0A3
+167F001F16805BA4EEFF00123F5B4B5AA24B5A5E007F4A5AA24B5A6D495A4BC7FCD87CE0
+137E39F87001F839F03C07E039E00FFF80260003FCC8FC2A4077BE33>I<EC1FF0ECFFFE
+903903F01F8090390FC003C0D93F0013E0017E130F49131F000115F04848EB3FE0485AA2
+4848EB1FC0001FEC0F004990C7FC123FA2485AA412FF90C9FCA96CEC0380150716006C6C
+5B151E001F5C6C6C5B6C6C5B6C6C485A3901F80F8026007FFEC7FCEB0FF0242A7AA828>
+I<EE03F8ED01FFA3ED000F1607A217F0A4160FA217E0A4161FA217C0A491380FF03FECFF
+FC902603F81F138090390FC007BF90391F8003FF90387E0001497F0001157F4848150048
+5A120F5B001F5D485A5E5B127FA2150112FF90C75BA41503A25EA37E1507A26C4A5A7F00
+1F141F6C6C133F6C6CEBFFF83B03F001EFFFC03900F80F8F90383FFE0FD90FF0EBE0002D
+407ABE33>I<EC3FE0903801FFF8903807E07E90380F801F90393F000F80017E14C049EB
+07E0485A12034848EB03F0485AA2121F5B123FA248481307A290B6FCA2D8FF80C8FC90C9
+FCA87EED01C015036C15806D1307001FEC0F006D131E000F5C6C6C5B6C6C485A3900FC07
+C0D93FFFC7FCEB07F8242A7BA828>I<ED07F0ED3FFCEDFC1E913803F03F4A48B4FC4A48
+1380141FEC3F81DA7F0113008102FE137C93C7FCA213015CA513035CA50007B512F8A326
+0007F0C8FCA3130F5CA5131F5CA5133F5CA5137F91C9FCA55B5BA4EA03FF007F13FEB5FC
+A229407DBF1C>I<177C913907F803FE91393FFE0F8F9139FC0F9C3F903901F007F89039
+07E003E0D90FC013F0011F903801F80C02801400133FD97F007FA315035B495CA3017E49
+5A5E150F6D5C6D495A90263F803EC7FCECC0FC903871FFF09038E07F8091C9FC485AA47F
+A27F90B512F8EDFF806C15E016F86D8048B6FC3A07E0000FFED80F801300003FC8127F00
+3E815A00FC815AA25E163EA25E6C15FC007C4A5A6C4A5A6CEC0FC0D80FC0013FC7FC3903
+F801FCC6B512F0010F90C8FC303D7FA82D>I<147FEB3FFFA313017FA25CA513015CA513
+035CA4ED07F80107EB1FFF9139F0781FC09138F1E00F9139F38007E0ECF70002FE14F049
+5A5CA25CA24A130F131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B4915
+00A300015D486C491380B5D8F87F13FCA32E3F7DBE33>I<1478EB01FE130314FFA25B14
+FE130314FCEB00F01400ACEB03F8EA01FF14F0A2EA001F130FA314E0A5131F14C0A5133F
+1480A5137F1400A55B5BA4EA03FF007F13F0A2B5FC183E7DBD1A>I<147FEB3FFFA31301
+7FA25CA513015CA513035CA501070103B5FC02F014FEA26F13F06F1380EEFE00010F14F8
+4A485AED03C04B5A031FC7FC153E011F13784A5AECC3E0ECC7F0ECCFF814FF497F14F9EC
+E1FE14C04A7E4A7E4980017E133F82151F82150F01FE8049130782A2000181486C49B4FC
+B5D8F03F13F04B13E0A2303F7EBE30>107 D<143FEB1FFF5BA213017FA214FEA5130114
+FCA5130314F8A5130714F0A5130F14E0A5131F14C0A5133F1480A5137F1400A55B5BA4EA
+03FF007F13F8A2B5FC183F7DBE1A>I<902707F007F8EB03FCD803FFD91FFF90380FFF80
+913CE0781FC03C0FE09126E1E00FEBF0073E001FE38007E1C003F090260FE700EBE38002
+EEDAF70013F802FC14FE02D85C14F84A5CA24A5C011F020F14074A4A14F0A5013F021F14
+0F4A4A14E0A5017F023F141F91C74914C0A549027F143F4992C71380A300014B147F486C
+496DEBFFC0B5D8F87FD9FC3F13FEA347287DA74C>I<903907F007F8D803FFEB1FFF9139
+E0781FC09138E1E00F3B001FE38007E090380FE70002EE14F014FC14D814F85CA24A130F
+131F4A14E0A4161F133F4A14C0A4163F137F91C71380A4167F5B491500A300015D486C49
+1380B5D8F87F13FCA32E287DA733>I<EC0FF0ECFFFE903903F01F8090390FC007C049C6
+6C7E013E6D7E01FC6D7E48488049147C0003157E485A000F157F5B121FA2485AA2007F16
+80A2170048C85AA54B5AA25E5A6C4A5A7E4B5A5E6C140F6C6C5C4B5A6C6C013EC7FC6C6C
+5B6C6C485A3900FC0FE090383FFF80D90FF8C8FC292A7BA82D>I<91387F01FE903A7FFF
+0FFFC09139FE3E03F09238F801F8903A01FFE000FE4B137F6D497F4990C713804A15C04A
+141FA218E0A20103150F5C18F0A3171F010716E05CA3173F18C0130F4A147F1880A2EFFF
+004C5A011F5D16034C5A6E495AEE1FC06E495AD93FDC017EC7FC91388F01F8913883FFE0
+028090C8FC92C9FC137FA291CAFCA45BA25BA31201487EB512F8A3343A81A733>I<9039
+07F01F80D803FFEB7FE09138E1E1F09138E387F839001FE707EB0FE614EE02FC13F002D8
+13E09138F801804AC7FCA25C131FA25CA4133F5CA5137F91C8FCA55B5BA31201487EB512
+FEA325287EA724>114 D<9138FF81C0010713E390381F807F90397C003F8049131F4848
+130F5B00031407A248481400A27FA27F6D90C7FCEBFF8014FC6C13FF6C14C015F06C6C7F
+011F7F13079038007FFE1403140100381300157EA2123C153E157E007C147CA2007E1478
+15F8007F495A4A5A486C485A26F9E01FC7FC38E0FFFC38C01FE0222A7DA824>I<EB0380
+A4130791C7FCA25BA25BA2133EA2137E13FE12011207001FB512C0B6FCA2D801FCC7FCA3
+12035BA512075BA5120F5BA41407001F130E13C0A4141E141C1380A26D5AA2000F5B14F0
+3807E1E03801FF80D8007EC7FC1A3978B723>I<01FE147F00FFEC7FFF4914FEA2000714
+0300031401A34914FCA4150312074914F8A41507120F4914F0A4150F121F4914E0A2151F
+A3153F4914C0157F15FFEC01DF3A0FC003BFE09138073FFF3803F01E3801FFF826003FE0
+1380282977A733>I<B539E007FFF05D17E02707FE000313006C48EB01FC6F5A5E00014A
+5A5EA24B5A6D1307000092C7FC5D150E6D5B7F5DA25D1480013F5B14815D14C3011F5B02
+C7C8FCA214CE14EEEB0FFCA25CA26D5A5CA25CA26D5A2C2878A630>I<B500C3B53803FF
+FCA204FE14F8290FFE003FE00013C0D807F86D48EB7F000003173E183C150F18386D5E00
+01141F705B153F4D5A15776D4B5A0000ECE7F04DC7FCEC01C3170E9038FF0383017F5D91
+380703F85FEC0E01021E5CD93F9C14F002BC6D5A02B813FDDAF8005B4A13FF5F6D5A94C8
+FC5C4A137E167C6DC7FC1678010E14383E2878A642>I<48B539C07FFFC0A33C000FFE00
+3FF8006D48EB1FE0010315800101023EC7FC6E133C01005C027F5B6F5A91383F81C0EDC3
+80DA1FC7C8FC15EFEC0FFE6E5A5D140381A24A7E140FEC1E7F023C7FEC383F02707FECE0
+1F010180903803C00F49486C7ED90F007F491303017E80D801FE80D807FF497EB5D8803F
+13F8A332277FA630>I<90B539E007FFF05E18E0902707FE000313006D48EB01FC705A5F
+01014A5A5F16036E5C0100140794C7FC160E805E805E1678ED8070023F13F05EED81C015
+C191381FC38015C793C8FC15EF15EEEC0FFCA25DA26E5AA25DA26E5A5DA24AC9FC5C140E
+141E141C5C121C003F5B5A485B495A130300FE5B4848CAFCEA701EEA783CEA3FF0EA0FC0
+343A80A630>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fr cmtt10 10.95 88
+/Fr 88 127 df<121C127FEAFF80B3EA7F00B2123EC7FCA8121C127FA2EAFF80A3EA7F00
+A2121C09396DB830>33 D<00101304007C131F00FEEB3F80A26C137FA248133FB2007E14
+00007C7F003C131E00101304191C75B830>I<903907C007C0A2496C487EA8011F131FA2
+02C05BA3007FB7FCA2B81280A36C16006C5D3A007F807F80A2020090C7FCA9495BA2003F
+90B512FE4881B81280A36C1600A22701FC01FCC7FCA300031303A201F85BA76C486C5AA2
+29387DB730>I<1438147C14FCA4EB03FF011F13E090B512FC4880000780481580261FFE
+FD13C09039F0FC3FE0D83FC0131FD87F80EB0FF001001307007E15F800FE14035A1507A3
+6CEC03F0A2007F91C7FC138013C0EA3FF0EA1FFE13FF6C13FF6C14E0000114F86C6C7F01
+1F7F01037F0100148002FD13C09138FC7FE0151FED0FF015070018EC03F8127E1501B4FC
+A35AA26CEC03F07E01801307ED0FE0D83FC0131F01F0EB7FC0D81FFEB512806CB612006C
+5C6C5CC614F0013F13C0D907FEC7FCEB00FCA5147C143825477BBE30>I<EA07C0EA0FF0
+EA1FF8A213FCA213FE120F1207EA007EA513FE13FCA2120113F81203EA07F0120FEA1FE0
+127FEAFFC013801300127C12380F1D70B730>39 D<141E147F14FF5BEB03FEEB07FCEB0F
+F0EB1FE0EB3FC0EB7F80EBFF00485A5B12035B485A120F5BA2485AA2123F5BA2127F90C7
+FCA412FEAD127FA47F123FA27F121FA26C7EA27F12076C7E7F12017F6C7EEB7F80EB3FC0
+EB1FE0EB0FF0EB07FCEB03FEEB01FF7F147F141E184771BE30>I<127812FE7E7F6C7E6C
+7EEA0FF06C7E6C7E6C7E6C7EEB7F80133F14C0131FEB0FE014F01307A2EB03F8A214FC13
+01A214FE1300A4147FAD14FEA4130114FCA2130314F8A2EB07F0A2130F14E0EB1FC0133F
+1480137FEBFF00485A485A485A485AEA3FE0485A485A90C7FC5A1278184778BE30>I<14
+E0497E497EA60038EC0380007EEC0FC0D8FF83EB3FE001C3137F9038F3F9FF267FFBFB13
+C06CB61280000FECFE00000314F86C5C6C6C13C0011F90C7FC017F13C048B512F0488000
+0F14FE003FECFF80267FFBFB13C026FFF3F913E09038C3F87F0183133FD87E03EB0FC000
+38EC0380000091C7FCA66D5A6D5A23277AAE30>I<143EA2147FAF007FB7FCA2B81280A3
+6C1600A2C76CC8FCAF143EA229297DAF30>I<EA03E0EA0FF0EA1FF813FCEA3FFEA213FF
+A27EA27E1203EA007FA2137E13FEEA01FC1203EA07F8EA3FF0127FEAFFE0EA7F80130012
+3C1019708B30>I<007FB612F0A2B712F8A36C15F0A225077B9E30>I<120FEA3FC0EA7FE0
+A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C0C6E8B30>I<16F01501ED03F8A21507A2ED0FF0
+A2ED1FE0A2ED3FC0A2ED7F80A2EDFF00A24A5AA25D1403A24A5AA24A5AA24A5AA24A5AA2
+4A5AA24AC7FCA2495AA25C1303A2495AA2495AA2495AA2495AA2495AA249C8FCA2485AA2
+5B1203A2485AA2485AA2485AA2485AA2485AA248C9FCA25AA2127CA225477BBE30>I<14
+FE903807FFC0497F013F13F8497F90B57E48EB83FF4848C6138049137F4848EB3FC04848
+EB1FE049130F001F15F0491307A24848EB03F8A290C712014815FCA400FEEC00FEAD6C14
+016C15FCA36D1303003F15F8A26D1307001F15F0A26D130F6C6CEB1FE0A26C6CEB3FC06C
+6CEB7F806D13FF2601FF8313006CEBFFFE6D5B6D5B010F13E06D5BD900FEC7FC273A7CB8
+30>I<EB03C0497EA2130FA2131FA2133F137F13FF1203123FB5FCA213EF138FEA7E0F12
+00B3B0003FB512F84814FCB612FEA26C14FC6C14F81F3977B830>I<EB07FC90383FFFC0
+90B512F00003804814FE4880261FF80F1380263FE00113C09038C0007F4848EB3FE090C7
+121FED0FF04814075A6C15F81503A3127E1218C8FCA2150716F0150F16E0151F16C0153F
+ED7F8015FF4A13005DEC07FC4A5A4A5A4A5A4A5A4A5A4990C7FC495A495AEB0FF0EB3FE0
+495A495A4890C8FC4848EB01F04848EB03F8485AEA1FE048B6FCB7FCA37E6C15F025397B
+B830>I<EB03FF013F13E090B512F84814FE4880481580260FFE0113C09038F0007F4848
+EB1FE0150F16F01507A26C5A6C5AC8FC150F16E0A2151FED3FC0157FEDFF800207130090
+3807FFFE495B5D8115FF6D1480D9000113C09138003FE0ED1FF0ED07F8150316FC150116
+FE1500A21218127EB4FCA2150116FC4814036C15F86C6C13076DEB1FF0D83FF0133F3A1F
+FE01FFE06CB612C06C15806CECFE00C65C013F13F001031380273A7CB830>I<EC03FC4A
+7E140F141FA2143F147F157E14FEA2EB01FCEB03F8A2EB07F0A2EB0FE0EB1FC0A2EB3F80
+A2EB7F0013FEA2485A485AA2485AA2485A485AA2485AA248C7FC12FEB8FC1780A46C1600
+C8007EC7FCAA91387FFFFE91B6FCA46E5B29397DB830>I<000FB612804815C05AA31680
+0180C8FCAEEB83FF019F13C090B512F015FC8181D9FE0313809039F0007FC049133F0180
+EB1FE06CC7120F000E15F0C81207A216F81503A31218127EA2B4FC150716F048140F6C15
+E06C141F6DEB3FC06D137F3A3FE001FF80261FFC0F13006CB55A6C5C6C5C6C14E06C6C13
+80D90FFCC7FC25397BB730>I<EC0FF8EC7FFF49B51280010714E0131F4914F090387FF8
+0F9039FFC007F84813803803FE005B485A4848EB03F0ED01E0484890C7FC5B123F5BA212
+7FEB000C903803FFE0010F13F8D8FF3F13FE48B6FCB7128016C09039FE007FE001F8EB1F
+F001E0130F49EB07F8ED03FC5B90C7120116FE1500A37EA46C7E15016D14FC121F6D1303
+000FEC07F86D130F6C6CEB1FF06DEB3FE03A03FF81FFC06C90B512806C15006D5B011F13
+F8010713E001011380273A7CB830>I<127CB712FC16FEA416FC48C7EA0FF816F0ED1FE0
+007CEC3FC0C8EA7F80EDFF00A24A5A4A5A5D14075D140F5D4A5AA24A5AA24AC7FCA25C5C
+13015CA213035CA213075CA4495AA6131F5CA96D5A6DC8FC273A7CB830>I<49B4FC011F
+13F0017F13FC90B57E0003ECFF804815C048010113E03A1FF8003FF049131FD83FC0EB07
+F8A24848EB03FC90C71201A56D1303003F15F86D13076C6CEB0FF06C6CEB1FE0D807FCEB
+7FC03A03FF83FF806C90B512006C6C13FC011F13F0497F90B512FE48802607FE0013C0D8
+0FF8EB3FE0D81FE0EB0FF04848EB07F8491303007F15FC90C712014815FE481400A66C14
+016C15FC6D1303003F15F86D1307D81FF0EB1FF06D133F3A0FFF01FFE06C90B512C06C15
+80C6ECFE006D5B011F13F0010190C7FC273A7CB830>I<49B4FC010F13E0013F13F890B5
+7E4880488048010113803A0FFC007FC0D81FF0EB3FE04848131F49EB0FF048481307A290
+C7EA03F85A4815FC1501A416FEA37E7E6D130315076C7E6C6C130F6D133FD80FFC13FF6C
+B6FC7E6C14FE6C14F9013FEBE1FC010F138190380060011400ED03F8A2150716F0150F00
+0F15E0486C131F486CEB3FC0157FEDFF804A1300EC07FE391FF01FFC90B55A6C5C6C5C6C
+1480C649C7FCEB3FF0273A7CB830>I<120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0
+EA0F00C7FCAF120FEA3FC0EA7FE0A2EAFFF0A4EA7FE0A2EA3FC0EA0F000C276EA630>I<
+EA03C0EA0FF0EA1FF8A2EA3FFCA4EA1FF8A2EA0FF0EA03C0C7FCAFEA03C0EA0FF0121F13
+F8123F13FCA3121FA2120F12031200120113F8120313F01207EA1FE0123FEA7FC0EAFF80
+EA7F00127E12380E3470A630>I<16F01503ED07F8151F157FEDFFF014034A13C0021F13
+8091383FFE00ECFFF8495B010713C0495BD93FFEC7FC495A3801FFF0485B000F13804890
+C8FCEA7FFC5BEAFFE05B7FEA7FF87FEA1FFF6C7F000313E06C7F38007FFC6D7E90380FFF
+806D7F010113F06D7FEC3FFE91381FFF80020713C06E13F01400ED7FF8151F1507ED03F0
+1500252F7BB230>I<007FB7FCA2B81280A36C16006C5DCBFCA7003FB612FE4881B81280
+A36C1600A229157DA530>I<1278127EB4FC13C07FEA7FF813FEEA1FFF6C13C000037F6C
+13F86C6C7EEB1FFF6D7F010313E06D7F9038007FFC6E7E91380FFF806E13C0020113F080
+ED3FF8151F153FEDFFF05C020713C04A138091383FFE004A5A903801FFF0495B010F1380
+4990C7FCEB7FFC48485A4813E0000F5B4890C8FCEA7FFE13F8EAFFE05B90C9FC127E1278
+252F7BB230>I<EB1FFE90B512E0000314F8000F14FE4880481580267FF80313C09038C0
+007F48C7121F16E0150FA3127E151F0018EC7FC0C812FF020313804A13004A5AEC1FF84A
+5AEC7FC04A5A92C7FC495AA2495A5CA213075CA86D5A90C9FCA8EB01C0EB07F0A2497EA3
+6D5AA2EB01C023397AB830>I<EC1FE0ECFFF8010313FE010F7F4914804914C090397FF0
+3FE09038FF800F4890380007F0D803FC13033A07F801FBF89038F007FF380FE01F4A13FC
+EA1FC0495A003FEBFF0F903800FE07903901FC03FE007FEBF801EA7E03ECF000A2EAFE07
+00FC49137EAA00FE6D13FED87E0314FCA2ECF801D87F0114F8003FEBFC03903900FE07F0
+903880FF0F001F90387FFFE06D6C13C0EA0FE06E13803A07F007FE009038F801F86C6CC7
+127C6CB414FE6CEB800390387FF01F6DB512FC6D14F86D14E0010314C00100EBFE00EC1F
+F0273A7CB830>I<147F4A7EA2497FA4497F14F7A401077F14E3A3010F7FA314C1A2011F
+7FA490383F80FEA590387F007FA4498049133F90B6FCA34881A39038FC001F0003814913
+0FA4000781491307A2D87FFFEB7FFFB56CB51280A46C496C130029397DB830>I<007FB5
+12F0B612FE6F7E82826C813A03F8001FF815076F7E1501A26F7EA615015EA24B5A1507ED
+1FF0ED7FE090B65A5E4BC7FC6F7E16E0829039F8000FF8ED03FC6F7E1500167FA3EE3F80
+A6167F1700A25E4B5A1503ED1FFC007FB6FCB75A5E16C05E6C02FCC7FC29387EB730>I<
+91387F803C903903FFF03E49EBFC7E011F13FE49EBFFFE5B9038FFE07F48EB801F3903FE
+000F484813075B48481303A2484813015B123F491300A2127F90C8FC167C16005A5AAC7E
+7EA2167C6D14FE123FA27F121F6D13016C6C14FCA26C6CEB03F86D13076C6CEB0FF03901
+FF801F6C9038E07FE06DB512C06D14806D1400010713FC6D13F09038007FC0273A7CB830
+>I<003FB512E04814FCB67E6F7E6C816C813A03F8007FF0ED1FF8150F6F7E6F7E15016F
+7EA2EE7F80A2163F17C0161FA4EE0FE0AC161F17C0A3163F1780A2167F17005E4B5A1503
+4B5A150F4B5AED7FF0003FB65A485DB75A93C7FC6C14FC6C14E02B387FB730>I<007FB7
+FCB81280A47ED803F8C7123FA8EE1F0093C7FCA4157C15FEA490B5FCA6EBF800A4157C92
+C8FCA5EE07C0EE0FE0A9007FB7FCB8FCA46C16C02B387EB730>I<003FB712804816C0B8
+FCA27E7ED801FCC7121FA8EE0F8093C7FCA5153E157FA490B6FCA69038FC007FA4153E92
+C8FCAE383FFFF8487FB5FCA27E6C5B2A387EB730>I<02FF13F00103EBC0F8010F13F101
+3F13FD4913FF90B6FC4813C1EC007F4848133F4848131F49130F485A491307121F5B123F
+491303A2127F90C7FC6F5A92C8FC5A5AA892B5FC4A14805CA26C7F6C6D1400ED03F8A27F
+003F1407A27F121F6D130F120F7F6C6C131FA2D803FE133F6C6C137FECC1FF6C90B5FC7F
+6D13FB010F13F30103EBC1F0010090C8FC293A7DB830>I<3B3FFF800FFFE0486D4813F0
+B56C4813F8A26C496C13F06C496C13E0D803F8C7EAFE00B290B6FCA601F8C7FCB3A23B3F
+FF800FFFE0486D4813F0B56C4813F8A26C496C13F06C496C13E02D387FB730>I<007FB6
+FCB71280A46C1500260007F0C7FCB3B3A8007FB6FCB71280A46C1500213879B730>I<49
+B512F04914F85BA27F6D14F090C7EAFE00B3B3123C127EB4FCA24A5A1403EB8007397FF0
+1FF86CB55A5D6C5C00075C000149C7FC38003FF025397AB730>I<383FFFF8487FB57EA2
+6C5B6C5BD801FCC9FCB3B0EE0F80EE1FC0A9003FB7FC5AB8FCA27E6C16802A387EB730>
+76 D<D83FF8ECFFE0486C4913F0486C4913F8A2007F16F06C6C4913E00007160001EF14
+BFEC800FA39039E7C01F3FA4ECE03F01E3133EA2ECF07EA201E1137CA2ECF8FCA201E013
+F8A214FDEC7DF0A3147FEC3FE0A3EC1FC0A2EC070091C7FCADD83FFC903801FFE0486C49
+13F0B54913F8A26C486D13F06C486D13E02D387FB730>I<D83FFC90381FFF80486C4913
+C0B54913E0A26C6D6C13C06C6E13800003913801F800EBF7C0A3EBF3E0A314F013F1A214
+F8A213F014FCA2147C147EA2143E143FA2141FA21581A2140F15C1A2140715E1A2140315
+F1A21401A215F91400A3157DA3153FEA3FFF481380B5EAC01FA26CEB800F6C496C5A2B38
+7EB730>I<90383FFFE048B512FC000714FF4815804815C04815E0EBF80001E0133FD87F
+80EB0FF0A290C71207A44815F8481403B3A96C1407A26C15F0A36D130FA26D131F6C6CEB
+3FE001F813FF90B6FC6C15C06C15806C1500000114FCD8003F13E0253A7BB830>I<007F
+B512F0B612FE6F7E16E0826C813903F8003FED0FFCED03FE15016F7EA2821780163FA616
+7F17005EA24B5A1503ED0FFCED3FF890B6FC5E5E16804BC7FC15F001F8C9FCB0387FFFC0
+B57EA46C5B29387EB730>I<003FB57E4814F0B612FC15FF6C816C812603F8017F913800
+3FF0151F6F7E15071503821501A515035E1507150F4B5A153F4AB45A90B65A5E93C7FC5D
+8182D9F8007FED3FE0151F150F821507A817F8EEF1FCA53A3FFF8003FB4801C0EBFFF8B5
+6C7E17F06C496C13E06C49EB7FC0C9EA1F002E397FB730>82 D<90390FF803C0D97FFF13
+E048B512C74814F74814FF5A381FF80F383FE001497E4848137F90C7123F5A48141FA215
+0FA37EED07C06C91C7FC7F7FEA3FF0EA1FFEEBFFF06C13FF6C14E0000114F86C80011F13
+FF01031480D9003F13C014019138007FE0151FED0FF0A2ED07F8A2007C140312FEA56C14
+0716F07F6DEB0FE06D131F01F8EB3FC001FF13FF91B51280160000FD5CD8FC7F13F8D8F8
+1F5BD878011380253A7BB830>I<003FB712C04816E0B8FCA43AFE003F800FA8007CED07
+C0C791C7FCB3B1011FB5FC4980A46D91C7FC2B387EB730>I<3B7FFFC007FFFCB56C4813
+FEA46C496C13FCD803F8C7EA3F80B3B16D147F00011600A36C6C14FE6D13016D5CEC8003
+90393FE00FF890391FF83FF06DB55A6D5C6D5C6D91C7FC9038007FFCEC1FF02F3980B730
+>I<D87FFE90380FFFC0B54913E06E5AA24A7E6C486D13C0D807F0903801FC00A26D1303
+00035DA46C6C495AA46C6C495AA46D131F6D5CA3EC803F013F5CA46D6C48C7FCA490380F
+E0FEA401075B14F1A301035BA314FB01015BA314FFA26D5BA46E5A6E5A2B397EB730>I<
+D83FFC903801FFE0486C4913F000FF16F8A2007F16F06C486D13E0D81FC09038001FC000
+0F1680A76D143F00071600A7000390380F803E9039F01FC07EEC3FE0A3EC7FF0A2147D00
+01157CA29039F8FDF8FCA314F8A300005D01F913FCA2ECF07CA201FD137DA2017D5CECE0
+3DA3017F133FA2ECC01FA2013F5CA2EC800F6D486C5A2D397FB730>I<3A3FFF01FFF848
+01837F02C77FA202835B6C01015B3A01FC007F806D91C7FC00005C6D5BEB7F01EC81FCEB
+3F8314C3011F5B14E7010F5B14FF6D5BA26D5BA26D5BA26D90C8FCA4497FA2497FA2815B
+81EB0FE781EB1FC381EB3F8181EB7F0081497F49800001143F49800003141F4980000714
+0FD87FFEEB7FFFB590B5128080A25C6C486D130029387DB730>I<007FB5FCB61280A415
+0048C8FCB3B3B3A5B6FC1580A46C140019476DBE30>91 D<127CA212FEA27EA26C7EA26C
+7EA26C7EA26C7EA26C7EA26C7EA212017FA26C7EA26D7EA26D7EA26D7EA26D7EA26D7EA2
+6D7EA2130180A26D7EA26E7EA26E7EA26E7EA26E7EA26E7EA26E7EA2140181A26E7EA2ED
+7F80A2ED3FC0A2ED1FE0A2ED0FF0A2ED07F8A21503A2ED01F0150025477BBE30>I<007F
+B5FCB61280A47EC7123FB3B3B3A5007FB5FCB6FCA46C140019477DBE30>I<1307EB1FC0
+EB7FF0497E000313FE000FEBFF80003F14E0D87FFD13F039FFF07FF8EBC01FEB800F38FE
+0003007CEB01F00010EB00401D0E77B730>I<007FB612F0A2B712F8A36C15F0A225077B
+7D30>I<1338137CEA01FE12031207EA0FFC13F0EA1FE013C0EA3F8013005A127EA212FE
+5AA5EAFFC013E013F0127FA2123FA2EA1FE0EA07C00F1D70BE30>I<EB3FFC48B57E4814
+E04880488048809038F00FFE9038E001FF806F7E6C48133F6C4880C8121FA491B5FC130F
+137F48B6FC12075A48EBC01F383FFC00EA7FE0138048C7FC5AA46C143FA26C6C137F9038
+C001FF263FF80FEBFFC06CB712E0A2000714F76C14C3C6020013C0D93FF090C7FC2B2A7C
+A830>I<EA3FFC487E12FFA2127F123F1200AAEC03FE91381FFF80027F13E091B57E90B6
+12FC82ECFE079138F001FF4A6C13804A137F4AEB3FC091C7121F4915E0160FA217F01607
+A8160FA217E07F161F6EEB3FC0A26EEB7F806E13FFDAF00313009138FC0FFE91B55A5E49
+5CD97E7F13C0D93C1F90C7FC90380003FC2C3980B730>I<ECFFE0010713FC011F7F017F
+7F90B612804815C048EB807F3907FC003F485A485A49EB1F804848EB0F004990C7FC127F
+90C9FCA25A5AA87E7EA27F003FEC07C06DEB0FE06C7E6D131F6C6C14C0D807FE133F9039
+FFC0FF806C90B5FCC615006D5B011F13F801075B01011380232A7AA830>I<913801FFE0
+4A7F5CA28080EC0007AAEB03FE90381FFF874913E790B6FC5A5A481303380FFC00D81FF0
+133F49131F485A150F4848130790C7FCA25AA25AA87E6C140FA27F003F141F6D133F6C7E
+6D137F390FF801FF2607FE07EBFFC06CB712E06C16F06C14F76D01C713E0011F010313C0
+D907FCC8FC2C397DB730>I<49B4FC010713E0011F13F8017F7F90B57E48804801811380
+3A07FC007FC04848133FD81FE0EB1FE0150F484814F0491307127F90C7FCED03F85A5AB7
+FCA516F048C9FC7E7EA27F003FEC01F06DEB03F86C7E6C7E6D1307D807FEEB1FF03A03FF
+C07FE06C90B5FC6C15C0013F14806DEBFE00010713F8010013C0252A7CA830>I<EDFF80
+020713E0021F13F05C4A13F891B5FC491387903803FE079138FC03F0903907F800C04A13
+00A8003FB612C04815E0B7FCA36C15C0260007F0C7FCB3A9003FB512FE4880B71280A26C
+15006C5C25397DB830>I<D903FC13FF90261FFF8713C04913DF90B712E05A5A2607FE07
+138F903AF801FE07C048486C6CC7FCA2497F001F8149133FA56D137F000F92C7FC6D5BA2
+6C6C485AEBFE0790B55A5D485C15C001DF5BD9C3FCC8FC01C0C9FCA37F7F6CB512F015FF
+6C15C04815F0488148813A3FE0001FFE0180130148C8127F007E8100FE168048151FA56C
+153F007FED7F006D5C6C6C495A01F013076CB4EB7FFC6C90B55A6C5D000115C06C6C91C7
+FC011F13FC010113C02B3E7DA730>I<EA3FFC487E12FFA2127F123F1200AAEC01FE9138
+0FFF80023F13E091B57E90B67EA29138FE07FCECF8039138E001FE14C0EC8000A291C7FC
+A25BB3A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F3880B7
+30>I<14E0EB03F8A2497EA36D5AA2EB00E091C8FCA9381FFFF8487F5AA27E7EEA0001B3
+A9003FB612C04815E0B7FCA27E6C15C023397AB830>I<EC01C0EC07F0A2EC0FF8A3EC07
+F0A2EC01C091C7FCA990B512F04814F8A47EEB0003B3B3A5EC07F0A2123C007EEB0FE0B4
+131FEC3FC0147F90B512806C14005C6C5B000F13F0000313C01D4E7CB830>I<EA7FF848
+7EA4127F1200AB0203B512804A14C017E0A217C06E14809139001FE0004B5A4B5A4BC7FC
+4A5A4A5AEC0FF84A5A4A5A4A5A4A5A01FD7F90B57E8114F7ECE3F8ECC1FCEC81FEEC00FF
+497F496D7E6F7E826F7E15076F7E6F7E3B7FFFF81FFFE0B56C4813F017F8A217F06C496C
+13E02D387FB730>I<387FFFF8B57EA47EEA0001B3B3A8007FB612F0B712F8A46C15F025
+387BB730>I<02FC137E3B7FC3FF01FF80D8FFEF01877F90B500CF7F15DF92B57E6C010F
+13872607FE07EB03F801FC13FE9039F803FC01A201F013F8A301E013F0B3A23C7FFE0FFF
+07FF80B548018F13C0A46C486C01071380322881A730>I<EC01FE3A3FFC0FFF80267FFE
+3F13E000FF90B57E90B67E7E6C9038FE07FCC6EBF8039138E001FE14C0EC8000A291C7FC
+A25BB3A23B3FFFF81FFFF8486D4813FCB500FE14FEA26C01FC14FC6C496C13F82F2880A7
+30>I<49B4FC010F13E0013F13F8497F90B57E0003ECFF8014013A07FC007FC04848EB3F
+E0D81FE0EB0FF0A24848EB07F8491303007F15FC90C71201A300FEEC00FEA86C14016C15
+FCA26D1303003F15F86D13076D130F6C6CEB1FF06C6CEB3FE06D137F3A07FF01FFC06C90
+B512806C15006C6C13FC6D5B010F13E0010190C7FC272A7CA830>I<EC03FE3A3FFC1FFF
+80267FFE7F13E000FF90B57E90B612FC6C816CEBFE07C69038F001FF4A6C13804A137F4A
+EB3FC091C7121F4915E0160FA217F01607A8160FA217E07F161F6EEB3FC0A26EEB7F806E
+13FFDAF00313009138FC0FFE91B55A5E495C6E13C0021F90C7FCEC03FC91C9FCAD383FFF
+F8487FB57EA26C5B6C5B2C3C80A730>I<49B413F8010FEBC1FC013F13F14913FD48B6FC
+5A481381390FFC007F49131F4848130F491307485A491303127F90C7FC15015A5AA77E7E
+15037FA26C6C1307150F6C6C131F6C6C133F01FC137F3907FF01FF6C90B5FC6C14FD6C14
+F9013F13F1010F13C1903803FE0190C7FCAD92B512F84A14FCA46E14F82E3C7DA730>I<
+ED07F83A3FFF803FFF486DB51280B512C302CF14C06C13DF6C9038FFFC3FD8001F13E092
+38801F809238000F004A90C7FC5C5C5CA25CA45CAF003FB512FC4880B7FCA26C5C6C5C2A
+287EA730>I<90381FFC1E48B5129F000714FF5A5A5A387FF007EB800100FEC7FC4880A4
+6C143E007F91C7FC13E06CB4FC6C13FC6CEBFF806C14E0000114F86C6C7F01037F903800
+0FFF02001380007C147F00FEEC1FC0A2150F7EA27F151F6DEB3F806D137F9039FC03FF00
+90B6FC5D5D00FC14F0D8F83F13C026780FFEC7FC222A79A830>I<EB0780497E131FA900
+3FB612E04815F0B7FCA36C15E026001FC0C7FCB216F8ED01FCA5ECE003010FEB07F814F0
+9138FC1FF06DB512E06D14C016806D14009038007FFCEC1FF026337EB130>I<D83FFCEB
+3FFC486C497E00FF14FFA2007F147F003F143F00001400B3A41501A2150315076D130F90
+3A7FC07FFFF891B612FC6D15FE7F6D4913FC6D9038F87FF8010001C0C7FC2F2880A630>
+I<3B3FFFC07FFF80486DB512C0B515E0A26C16C06C496C13803B01F80003F000A26D1307
+00005DA26D130F017E5CA2017F131F6D5CA2EC803F011F91C7FCA26E5A010F137EA2ECE0
+FE01075BA214F101035BA3903801FBF0A314FF6D5BA36E5A6E5A2B277EA630>I<3B3FFF
+C01FFFE0486D4813F0B515F8A26C16F06C496C13E0D807E0C7EA3F00A26D5C0003157EA5
+6D14FE00015DEC0F80EC1FC0EC3FE0A33A00FC7FF1F8A2147DA2ECFDF9017C5C14F8A301
+7E13FBA290393FF07FE0A3ECE03FA2011F5C90390F800F802D277FA630>I<3A3FFF81FF
+FC4801C37FB580A26C5D6C01815BC648C66CC7FC137FEC80FE90383F81FC90381FC3F8EB
+0FE3ECE7F06DB45A6D5B7F6D5B92C8FC147E147F5C497F81903803F7E0EB07E790380FE3
+F0ECC1F890381F81FC90383F80FE90387F007E017E137F01FE6D7E48486D7E267FFF80B5
+FCB500C1148014E3A214C16C0180140029277DA630>I<3B3FFFC07FFF80486DB512C0B5
+15E0A26C16C06C496C13803B01FC0003F000A2000014076D5C137E150F017F5C7F151FD9
+1F805BA214C0010F49C7FCA214E00107137EA2EB03F0157C15FCEB01F85DA2EB00F9ECFD
+F0147D147FA26E5AA36E5AA35DA2143F92C8FCA25C147EA2000F13FE486C5AEA3FC1EBC3
+F81387EB8FF0EBFFE06C5B5C6C90C9FC6C5AEA01F02B3C7EA630>I<001FB612FC4815FE
+5AA316FC90C7EA0FF8ED1FF0ED3FE0ED7FC0EDFF80003E491300C7485A4A5A4A5A4A5A4A
+5A4A5A4A5A4990C7FC495A495A495A495A495A495A4948133E4890C7127F485A485A485A
+485A485A48B7FCB8FCA46C15FE28277DA630>I<ED3FF0913803FFF8140F5C147F16F091
+38FFF00092C7FC495A5CB3A21303495A133F383FFFF0B55A5C91C8FC14C080003F7F3800
+3FF813076D7E1301B3A2806D7E15F091387FFFF016F8141F8014039138003FF025477BBE
+30>I<127CA212FEB3B3B3AD127CA207476CBE30>I<EA7FE0EAFFFE6D7E8014F07EC66C7E
+13076D7E1301B3A2806D7E15E091387FFFE06E13F8801407141F5C4A13E09138FFE00092
+C7FC495A5CB3A21303495A137F387FFFF0B5FC14C05C49C8FCEA7FE025477BBE30>I<01
+7C133848B4137C48EB80FE4813C14813C348EBEFFC397FEFFFF0D8FF8713E0010713C048
+6C1380D87C0113003838007C1F0C78B730>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fs cmbx12 17.28 40
+/Fs 40 121 df<EA01FCEA07FF4813804813C04813E04813F014F8B5FCA214FCA314FEA2
+7EA27E7E6C13BE6C133EEA01FCC7FCA2147E147CA314FC14F8A2130114F01303A2EB07E0
+A2EB0FC0A2EB1F80EB3F005B13FE485A485A485A485A5B6C5A6CC7FC173174942D>44
+D<16F04B7E1507151F153FEC01FF1407147F010FB5FCB7FCA41487EBF007C7FCB3B3B3B3
+007FB91280A6395E74DD51>49 D<913801FFF8021FEBFFC091B612F8010315FF010F16C0
+013F8290267FFC0114F89027FFE0003F7F4890C7000F7F48486E7FD807F86E148048486E
+14C048486E14E048486F13F001FC17F8486C816D17FC6E80B56C16FE8380A219FFA283A3
+6C5BA26C5B6C90C8FCD807FC5DEA01F0CA14FEA34D13FCA219F85F19F04D13E0A294B512
+C019804C14004C5B604C5B4C5B604C13804C90C7FC4C5A4C5A4B13F05F4B13804B90C8FC
+4B5AED1FF84B5A4B5A4B48143F4A5B4A48C8FC4A5A4A48157E4A5A4A5AEC7F8092C9FC02
+FE16FE495A495A4948ED01FCD90FC0150749B8FC5B5B90B9FC5A4818F85A5A5A5A5ABAFC
+A219F0A4405E78DD51>I<92B5FC020F14F8023F14FF49B712C04916F0010FD9C01F13FC
+90271FFC00077FD93FE001017F49486D8049C86C7F484883486C6F7F14C0486D826E806E
+82487FA4805CA36C5E4A5E6C5B6C5B6C495E011FC85A90C95CA294B55A614C91C7FC604C
+5B4C5B4C5B4C5B047F138092260FFFFEC8FC020FB512F817E094C9FC17F817FF91C7003F
+13E0040713F8040113FE707F717F7113E085717FA2717F85A285831A80A31AC0EA03FCEA
+0FFF487F487F487FA2B57EA31A80A34D14005C7E4A5E5F6C495E49C8485BD81FF85F000F
+5ED807FE92B55A6C6C6C4914806C01F0010791C7FC6C9026FF803F5B6D90B65A011F16F0
+010716C001014BC8FCD9001F14F0020149C9FC426079DD51>I<F01F804E7E187F18FFA2
+5F5F5F5FA25F5F5FA294B5FC5E5E5EA25E5EEE3FBFEE7F3FA216FEED01FCED03F8ED07F0
+A2ED0FE0ED1FC0ED3F8016005D15FE4A5A4A5AA24A5A4A5A4A5A4A5AA24AC7FC14FE495A
+5C1303495A495A495A5C133F49C8FC13FE485AA2485A485A485A5B121F485A48C9FC12FE
+BCFCA6CA6CEBC000B1037FB8FCA6485E7CDD51>I<01C0EE01C0D801F8160F01FF167F02
+F0EC07FFDAFF8090B5FC92B7128019006060606060606095C7FC17FC5F17E0178004FCC8
+FC16E09026FC3FFCC9FC91CBFCADED3FFE0203B512F0020F14FE023F6E7E91B712E001FD
+D9E00F7F9027FFFE00037F02F801007F02E06EB4FC02806E138091C8FC496F13C04917E0
+7113F0EA00F090C914F8A219FC83A219FEA419FFA3EA03F0EA0FFC487E487E487FA2B57E
+A319FEA35C4D13FC6C90C8FC5B4917F8EA3FF001804B13F06D17E0001F5E6C6C17C06D4B
+1380D807FC92B512006C6C4A5B6C6C6C01075B6C01E0011F5BD97FFE90B55A6DB712C001
+0F93C7FC6D15FC010115F0D9003F1480020301F0C8FC406078DD51>I<EE1FFF0303B512
+E0031F14F892B612FE0203814AD9FC037F021F9039C0007FC04A90C7EA1FE0DAFFFC6E7E
+494914074949EC7FF8494914FF49495B4949497F4990C7FC495D5C13FF485BA25A4A6E5B
+5A715B48496E5B725A4894C8FCA35AA35C48913801FFE0030F13FE033F6D7E4B14E092B6
+12F89126E1FE037FB53AE3F0007FFEDAE7E06D7EDAEFC06D7F4B6D7F02FFC76C7F4A8271
+7F4A82A24A828385A24A1780A54A17C0A37EA77EA47E6E1780A27EA21A007E4D5B7E6E5E
+7E6E5E6C4C5B6D7E013F4B5B6D6C4A5B6D01C0495B6D6D90B5C7FC6DD9FC0713FC6D90B6
+5A6D5E023F15C0020F92C8FC020114F8DA001F1380426079DD51>I<EA07E0120F7F13FC
+EBFFFC91B912F8A45AA21AF01AE01AC01A801A00A248606161616101E0C9123F01804C5A
+48CA485A4D90C7FC60007E4C5A17074D5A4D5A4D5A485F4D5A17FF4C90C8FCC9485A5F4C
+5A160F4C5A5F163F4C5A16FF5F5D94C9FC5D5D5E150FA24B5AA2153FA24B5AA215FFA34A
+5BA25CA35CA44A5BA45CA65CAD6E5BA26E5BDA03FECAFC6E5A456377E051>I<91380FFF
+F849B612C0010F15F8013F15FE496F7E2701FFF80080480180011F13F0D807FCC700077F
+D80FF080484882003F8301F880486C827FB5178080A76C90C7FC4C14006C5A6C5AD807F0
+4A5BC95C5E4C5B604C5B4C138093B5C7FC4B13FC5F4B13E05F4B5B4B90C8FC5E5E4B5A5E
+4B5AA25E4B5AA293C9FCA215FEA35DAE5D92CAFCABEC01FCEC07FF4A7F023F13E0A24A7F
+A291B57EA76E5BA26E5BA2020F13806E90C9FCEC01FC396577E44C>63
+D<F00FE04E7EA24E7EA34E7EA24E7EA34D7FA24D80A24D80A34D80A24D80A34D80A2DD7F
+BF7FA2181F05FF8017FE04016D7FA24D7E04038217F804076D80A24D7E040F8217E0041F
+6D80A24D7F043F825F047F6E7FA294C77E4C825E03016F7FA24C800303845E03076F80A2
+4C80030F845E031F6F80A24C81033F845E037F707F93B9FCA292BA7EA24A85A203FCC912
+070203865D020771805D86020F864B82021F865D87023F864B83027F8692CBFC874A864A
+840101875C496C728090381FFFC0B700E092B812FEA66F647BE37A>65
+D<4DB5ED03C0057F02F014070407B600FE140F047FDBFFC0131F4BB800F0133F030F05FC
+137F033F9127F8007FFE13FF92B6C73807FF814A02F0020113C3020702C09138007FE74A
+91C9001FB5FC023F01FC16074A01F08291B54882490280824991CB7E4949844949844949
+8449865D49498490B5FC484A84A2484A84A24891CD127FA25A4A1A3F5AA348491A1FA448
+99C7FCA25CA3B5FCB07EA380A27EA2F50FC0A26C7FA37E6E1A1F6C1D80A26C801D3F6C6E
+1A00A26C6E616D1BFE6D7F6F4E5A7F6D6D4E5A6D6D4E5A6D6D4E5A6D6E171F6D02E04D5A
+6E6DEFFF806E01FC4C90C7FC020F01FFEE07FE6E02C0ED1FF8020102F8ED7FF06E02FF91
+3803FFE0033F02F8013F1380030F91B648C8FC030117F86F6C16E004071680DC007F02F8
+C9FC050191CAFC626677E375>67 D<BB12E0F2FF801BF01BFE757E1CF0D800010280C700
+0780DF007F13FE080F6D7E0801807480093F7F090F13FC757F757F877580767F8A88767F
+8A888AA2767FA28A881F80A37614C0A41FE0A5881FF0B05214E0A51FC0A4521480A31F00
+6466A2525BA2525BA2525B666499B55A515C5191C7FC515B515B515B097F5B50B512C008
+075C083F91C8FC0707B512FCBD12F01CC051C9FC1BF81B8008E0CAFC6C627AE17C>I<4D
+B5ED03C0057F02F014070407B600FE140F047FDBFFC0131F4BB800F0133F030F05FC137F
+033F9127F8007FFE13FF92B6C73807FF814A02F0020113C3020702C09138007FE74A91C9
+001FB5FC023F01FC16074A01F08291B54882490280824991CB7E49498449498449498449
+865D49498490B5FC484A84A2484A84A24891CD127FA25A4A1A3F5AA348491A1FA44899C8
+FCA25CA3B5FCB07E071FB812F880A37EA296C70001ECC000A26C7FA37E807EA26C80A26C
+80A26C807F6D7F816D7F7F6D7F6D6D5F6D14C06D6E5E6E7F6E01FC5E020F01FF5E6E02C0
+ED7FEF020102F8EDFFC76E02FF02071383033F02FC013F1301030F91B638FC007F03014D
+131F6F6C04E01307040704801301DC007F02F8CAFC050191CBFC6D6677E37F>71
+D<B96C90B91280A6D8000102C0C9000102C0C7FCB3B3A293BBFCA604C0C91201B3B3A6B9
+6C90B91280A671627AE17E>I<B912E0A6C702E0C7FCB3B3B3B3AEB912E0A633627CE13C>
+I<B700E0040FB7128082828282A2D800016EDC000101FCC7FC719338001FC08383A28302
+FD808302FC80816F7F6F806F8084816F806F806F8084707F827080708085708082708070
+8085717F83718071807180868371807180727F8672808472807280877280847280737F87
+731480857314C07314E01CF07314F8857314FC7413FE7413FF1D9F867414DF7414FF86A2
+86868787A287878787A28787888888A288888890261FFFC084B712F8881D7F1D3F1D1F77
+5A71627AE17E>78 D<DBFFFCEC01E0020FD9FFE01303027F02FC130749B7130F0107EEC0
+1F011F16F049D9C007EBF83F4948C7383FFE7FD9FFF8020FB5FC4801E014014849804849
+153F91C97E484882001F834982003F83845B007F187FA2193FA200FF181FA27F190FA27F
+A26D17078080806C01F893C7FC80ECFF8015F86CECFFC016FC6CEDFFE017FE6CEEFFE018
+F86C17FE6C717E6C846C846D17F86D836D836D8313036D18806D6C17C0020F17E01401DA
+000F16F01500040715F8EE007F1703050014FC183F84060713FE84A2007C8300FC83A219
+7FA3193F7EA31AFC7EA27F1AF86D177F7F1AF06D17FF6D18E06D5E01FF18C06E4B138002
+E04B130002F84B5A02FFED3FFC01CF01E0ECFFF8018301FF010F5B010191B65A6D6C5E48
+011F93C7FC48010315FC48D9003F14E048020149C8FC476677E35A>83
+D<001FBEFCA64849C79126E0000F148002E0180091C8171F498601F81A0349864986A249
+1B7FA2491B3F007F1DC090C9181FA4007E1C0FA600FE1DE0481C07A5CA95C7FCB3B3B3A3
+021FBAFCA663617AE070>I<B96C023FB612FEA6D8000102C0CA0007EBF000E2007FC7FC
+B3B3B3AA656D63A2821C01806570170380525A6E7F6E4F5A70171F6E626E6D4D5A6E6D17
+7F525A6E6E030390C8FC033F01E04B5A6F6DED1FFC6F01FCED7FF80303D9FF80903803FF
+E06F02F8017F5B6F6C90B7C9FC041F5E040716F8040016C0050F4ACAFCDD003F13C06F64
+7AE17C>I<B800F8011FB80203B7FCA6D8000F91C9000102E0CAEBFE006D72F20FF07072
+715A230F6D73627072171F6D6A708277173F6D7397C7FC70846B6E72197E707217FE6E72
+6170855118016E6870731503636E68704C6E15076E68718451180F6EDE7E7F607172151F
+6E06FE61714B7E08016F153F6E4E6C95C8FC71840803616F4D6C177E7102076F15FE6F66
+714B7E080F7013016F4D6C5F7185081F18036F4D6C5F71023F7013076F94C75F72845018
+0F6F047E6E5E7272131F1AFE6F4C6E5EDEE00171133F6F4C6E93C9FC06F084070361704B
+6E157E06F87213FE1907704B6E5DDEFC0F1881704B6E5D06FE19C1071F18C3704B6E5DDE
+FF3F18E7706407BFC9FC07FF18FF704A705CA3704A705CA27099CAFC4F82A27149705BA3
+7149705BA27149705BA37149705BA37190CB5BA27148725AA37148725A714872CBFCA063
+7DE1A7>87 D<913803FFFE027FEBFFF00103B612FE010F6F7E4916E090273FFE001F7FD9
+7FE001077FD9FFF801017F486D6D7F717E486D6E7F85717FA2717FA36C496E7FA26C5B6D
+5AEB1FC090C9FCA74BB6FC157F0207B7FC147F49B61207010F14C0013FEBFE004913F048
+B512C04891C7FC485B4813F85A5C485B5A5CA2B55AA45FA25F806C5E806C047D7F6EEB01
+F96C6DD903F1EBFF806C01FED90FE114FF6C9027FFC07FC01580000191B5487E6C6C4B7E
+011F02FC130F010302F001011400D9001F90CBFC49437CC14E>97
+D<903807FF80B6FCA6C6FC7F7FB3A8EFFFF8040FEBFF80047F14F00381B612FC038715FF
+038F010014C0DBBFF0011F7FDBFFC001077F93C76C7F4B02007F03F8824B6F7E4B6F1380
+4B17C0851BE0A27313F0A21BF8A37313FCA41BFEAE1BFCA44F13F8A31BF0A24F13E0A24F
+13C06F17804F1300816F4B5A6F4A5B4AB402075B4A6C6C495B9126F83FE0013F13C09127
+F00FFC03B55A4A6CB648C7FCDAC00115F84A6C15E091C7001F91C8FC90C8000313E04F65
+7BE35A>I<F17FF8050FB5FCA6EF000F8484B3A892380FFF804AB512F8020F14FE023FEC
+FF8391B712E301039138807FF3499039F8000FFB011F01E00103B5FC494913004990C87E
+49488148498148834A815A485BA2485BA25AA3485BA4B5FCAE7EA46C7FA37EA26C7FA26C
+5F806C5F6C6D5D6C6D5D017F93B5FC6D6C6C0103806D6D49806D01F0D91FF7EBFFFE6D90
+39FE01FFE7010190B612876D6CECFE07021F14F8020314E09127003FFE00ECC0004F657B
+E35A>100 D<92380FFFC04AB512FC020FECFF80023F15E091B712F80103D9FE037F4990
+39F0007FFF011F01C0011F7F49496D7F4990C76C7F49486E7F48498048844A804884485B
+727E5A5C48717EA35A5C721380A2B5FCA391B9FCA41A0002C0CBFCA67EA380A27EA27E6E
+160FF11F806C183F6C7FF17F006C7F6C6D16FE6C17016D6C4B5A6D6D4A5A6D01E04A5A6D
+6DEC3FE0010301FC49B45A6D9026FFC01F90C7FC6D6C90B55A021F15F8020715E0020092
+C8FC030713F041437CC14A>I<EE3FFC0307B51280033F14C04AB612F0020715F84A9038
+F03FFC4AEB807F913A7FFE00FFFE4A5A4B4813FF4913F05B4913E0A24913C0A27013FE49
+49EB7FFCEF3FF8EF1FF0EF07C094C7FCB0B812C0A6D8001F01C0C8FCB3B3B0007FB612FC
+A638657CE431>I<F107F8DB7FFEEC3FFE020FB5D8F001B5FC027FDAFE03148049B7128F
+49DCDFFD13C0010FD9F00FEBFFC149D9800114014990C7EBFC0349486E6C7E4948EC3FFF
+48496E018113800780130048F0C03E97C7FC48496E7FA34884A96C60A36C6D4A5BA26C60
+A26C6D4A90C8FC6D6C4A5A6D6C4A5A6D6D485BDBF00F5B4990B612C060D97C7F4AC9FCD9
+FC0F14F09126007FFECAFC92CCFC1201A47FA27F8014F091B77E18FE6CEFFFC019F06D17
+FC19FF6D846D846D846D84013F8490BAFC0003854801E0C712014890C9000F7F48481601
+4848EE007F4848717E8512FF5B85A56D5F007F616D173F003F616D177F6C6C4D5A6C01C0
+03035B6C6D4B5B6C01F8031F5BC601FF92B5C7FC6D01F8011F5B011F90B712F8010717E0
+010094C8FC020F15F0DA003F01FCC9FC4A607CC151>I<903807FF80B6FCA6C6FC7F7FB3
+A8EF1FFF94B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FDB83F86D7F
+DB87F07FDB8FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8F007B7
+1280A651647BE35A>I<EB0FE0EB3FF8497E48B5FCA24880A24880A76C5CA26C91C7FCA2
+38007FFC6D5AEB0FE090C9FCAF903807FF80007FB5FCA6C6FC7F7FB3B3AEB712C0A62265
+7BE42C>I<ED01FCED07FF4B1380033F13E0A24B13F0A292B512F8A76F13F0A26F13E0A2
+030F13806F1300ED01FC92C8FCAFEEFFF8021FB5FCA6EC000F8181B3B3B3AAEA07F0EA1F
+FC487E487EB56C4813F0A317E05D17C05D17806C4948130049495A6C48495A261FFE0313
+F06CB65A6C158000014AC7FC6C6C13F8010713802D8288E431>I<903807FF80B6FCA6C6
+FC7F7FB3B3B3B3ADB712E0A623647BE32C>108 D<902607FF80D91FFFEEFFF8B691B500
+F00207EBFF80040702FC023F14E0041F02FF91B612F84C6F488193267FE07F6D4801037F
+922781FE001F9027E00FF0007FC6DA83F86D9026F01FC06D7F6DD987F06D4A487F6DD98F
+C0DBF87EC7804C6D027C80039FC76E488203BEEEFDF003BC6E4A8003FC04FF834B5FA24B
+5FA24B94C8FCA44B5EB3B2B7D8F007B7D8803FB612FCA67E417BC087>I<902607FF80EB
+1FFFB691B512F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FC6DA83F86D7F
+6DD987F07F6DD98FC0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8F0
+07B71280A651417BC05A>I<923807FFE092B6FC020715E0021F15F8027F15FE494848C6
+6C6C7E010701F0010F13E04901C001037F49496D7F4990C87F49486F7E49486F7E48496F
+13804819C04A814819E048496F13F0A24819F8A348496F13FCA34819FEA4B518FFAD6C19
+FEA46C6D4B13FCA36C19F8A26C6D4B13F0A26C19E06C6D4B13C0A26C6D4B13806C6D4B13
+006D6C4B5A6D6D495B6D6D495B010701F0010F13E06D01FE017F5B010090B7C7FC023F15
+FC020715E0020092C8FC030713E048437CC151>I<902607FF80EBFFF8B6010FEBFF8004
+7F14F00381B612FC038715FF038F010114C09227BFF0003F7FC6DAFFC0010F7F6D91C76C
+7F6D496E7F03F86E7F4B6E7F4B17804B6F13C0A27313E0A27313F0A21BF885A21BFCA385
+1BFEAE4F13FCA41BF861A21BF0611BE0611BC06F92B512801B006F5C6F4A5B6F4A5B03FF
+4A5B70495B04E0017F13C09226CFFC03B55A03C7B648C7FC03C115F803C015E0041F91C8
+FC040313E093CBFCB3A3B712F0A64F5D7BC05A>I<D90FFFEB0FFCB690383FFF8093B512
+E04B14F04B14F8923907FC7FFC92390FE0FFFEC6EC1F806DD93F0113FF6D133E157E157C
+15F8A215F07013FEA24BEB7FFCEF3FF8EF0FE04B90C7FCA55DB3B0B712F8A638417BC042
+>114 D<913A3FFF8007800107B5EAF81F011FECFE7F017F91B5FC48B8FC48EBE0014890
+C7121FD80FFC1407D81FF0801600485A007F167F49153FA212FF171FA27F7F7F6D92C7FC
+13FF14E014FF6C14F8EDFFC06C15FC16FF6C16C06C16F06C826C826C826C82013F168001
+0F16C01303D9007F15E0020315F0EC001F1500041F13F81607007C150100FC81177F6C16
+3FA2171F7EA26D16F0A27F173F6D16E06D157F6D16C001FEEDFF806D0203130002C0EB0F
+FE02FCEB7FFC01DFB65A010F5DD8FE0315C026F8007F49C7FC48010F13E035437BC140>
+I<EC07E0A6140FA5141FA3143FA2147FA214FF5BA25B5B5B5B137F48B5FC000F91B512FE
+B8FCA5D8001F01E0C8FCB3AFEF0FC0AC171F6D6D1480A2173F6D16006F5B6D6D137E6D6D
+5B6DEBFF836EEBFFF86E5C020F14C002035C9126003FFCC7FC325C7DDA3F>I<902607FF
+C0ED3FFEB60207B5FCA6C6EE00076D826D82B3B3A260A360A2607F60183E6D6D147E4E7F
+6D6D4948806D6DD907F0ECFF806D01FFEB3FE06D91B55A6E1500021F5C020314F8DA003F
+018002F0C7FC51427BC05A>I<B70081B600FC0103B512FCA6C66C0180C701FCC8381FFE
+006F6FED03F86D047F5F856F6E16076D646F70140F6D705F866F6E161F6D646F4A6D143F
+6D99C7FC4E7F6F616D1B7E6F4A6D14FE6D6395B57E7001FC15016E62DCC0016E13036EDB
+F87F5D05038004E0496C14076E62DCF007ED800F6E4B6C5D050F15C004F8496C141F6E62
+DCFC1FEDE03F6E4B6C92C8FC053F15F004FE496C5C6E197E7048EDF8FE6E027E6D5C05FE
+15FC4D6D13FD6F601BFF6F496E5BA24D806F60A26F496E5BA24D806F60A26F496E90C9FC
+A294C87E6F5FA26F486F5A047C6F5A6E417DBF75>119 D<007FB600C0017FB512F8A6D8
+001F01F8C70007EBF0006D040190C7FC6D6D5D6D6D4A5A6D6D4A5A70495A6D4C5A6E7F6E
+6D495A6E6D495A7049C8FC6E4A5A6E6D485A6E6D485A6E13FFEF8FF06EEC9FE06FEBFFC0
+6F5C6F91C9FC5F6F5B816F7F6F7F8481707F8493B57E4B805D4B80DB0FF37FDB1FE17F04
+C080153F4B486C7F4B486C7F4A486D7F4A486D7F4A5A4B6D7F020F6E7F4A486D7F4A486D
+804A5A4AC86C7F49486F7F4A6F7F0107707FEB3FFFB600F049B7FCA650407EBF55>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ft cmsy10 10.95 2
+/Ft 2 16 df<EE7FFE0307B512E0033F14FC92B7FC0203D9C00313C0DA0FFCC7EA3FF0DA
+3FE0EC07FCDA7F80EC01FED901FEC9EA7F80D903F8EE1FC0D907E0EE07E04948707E4948
+707E49CB7E017E187E498449844848F00F8000031AC04918074848F003E0A24848F001F0
+A248CD12F8A2001E1A78003E1A7CA2003C1A3C007C1A3EA200781A1EA300F81A1FA2481A
+0FAB6C1A1FA200781A1EA3007C1A3EA2003C1A3C003E1A7CA2001E1A78001F1AF8A26C6C
+F001F0A26C6CF003E0A26C6CF007C06D180F00011A806C6CF01F006D60017E187E6D606D
+6C4C5A6D6C4C5A6D6C4C5AD903F8EE1FC0D901FEEE7F809026007F80DA01FEC7FCDA3FE0
+EC07FCDA0FFCEC3FF0913B03FFC003FFC0020090B6C8FC033F14FC030714E09226007FFE
+C9FC50557BC05B>13 D<EB0FFCEB3FFF90B512C0000314F04880488048804880A2481580
+A3B712C0AA6C1580A36C1500A26C5C6C5C6C5C6C5CC614C0013F90C7FCEB0FFC22227BA7
+2D>15 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fu cmbx12 14.4 61
+/Fu 61 123 df<EEFFFC031FEBFF804AB612E0020781021F9038C00FF8913A7FFE0003FC
+DAFFF0EB00FE4949EB03FF4901805B4990C7487F49485CA2495A4D7F013F6F5B5CA37190
+C7FC715AEF01F894C9FCA90403B512C0BAFCA526003FFCC7120783B3B3A6003FB5D8FC03
+B612C0A542547DD34B>12 D<EA07F0EA1FF8487E487E7FB5FC1480A314C0A37EA27E7EEA
+07F3EA0003A213071480A3130F1400A25B131E133E133C137C5BA2485A485A485A485A48
+C7FC121E120C1228769025>44 D<B712F0AB240B7F9F2D>I<EA07F0487E487E487E487E
+B51280A76C13006C5A6C5A6C5A6C5A1111769025>I<157815FC14031407141F14FF130F
+0007B5FCB6FCA2147F13F0EAF800C7FCB3B3B3A6007FB712FEA52F4E76CD43>49
+D<EC3FFE0103B512E0010F14FC013F14FF90B712C048D9C07F7F2703FE000F13F8D807F8
+01037FD80FE06D7F48486D7F48488001F01680486C6E13C07F486C6E13E07FA27013F0A5
+6C5AA26C5AEA0FF0EA03C0C914E05EA218C05E1880A24C13005F4C5A4B5B5F4B5B5F4B5B
+4B90C7FC4B5A5E4B5AED7FE04B5A4A5B4A48C8FC4A5A5D4A48EB01F04A5AEC3F804AC7FC
+02FEEC03E0495A495A495A495AD91F80140749C8FC013E150F017FB7FC90B812C05A5A5A
+5A5A5A5AB9FC1880A4344E79CD43>I<91380FFFC091B512FC0107ECFF80011F15E09026
+3FF8077F9026FF800113FC4848C76C7ED803F86E7E491680D807FC8048B416C080486D15
+E0A4805CA36C17C06C5B6C90C75AD801FC1680C9FC4C13005FA24C5A4B5B4B5B4B13C04B
+5BDBFFFEC7FC91B512F816E016FCEEFF80DA000713E0030113F89238007FFE707E701380
+7013C018E07013F0A218F8A27013FCA218FEA2EA03E0EA0FF8487E487E487EB57EA318FC
+A25E18F891C7FC6C17F0495C6C4816E001F04A13C06C484A1380D80FF84A13006CB44A5A
+6CD9F0075BC690B612F06D5D011F1580010302FCC7FCD9001F1380374F7ACD43>I<177C
+17FEA2160116031607160FA2161F163F167FA216FF5D5DA25D5DED1FBFED3F3F153E157C
+15FCEC01F815F0EC03E01407EC0FC01580EC1F005C147E147C5C1301495A495A5C495A13
+1F49C7FC133E5B13FC485A5B485A1207485A485A90C8FC123E127E5ABA12C0A5C96C48C7
+FCAF020FB712C0A53A4F7CCE43>I<D80380150ED807E0157E01FEEC03FED9FFF0137F91
+B65A5F5F5F5F5F94C7FC5E5E16F016C093C8FC15F801E190C9FC01E0CAFCABEC0FFF027F
+13F001E3B512FE01E76E7E9026FFF8077FDAC0017F49C713F8496E7E49143F4981496E7E
+6C481680C9FC18C08218E0A418F0A3EA0FE0487E487E487E487EA418E0A35B6C484A13C0
+5B491680003EC85A003F17006C6C4A5A6D5D6C6C4A5AD807F8495BD803FE01075B2701FF
+C03F5B6C90B65A013F4AC7FC6D14F8010314C09026007FF8C8FC344F79CD43>I<ED0FFF
+92B512E0020780021F14FC91397FFE03FE903A01FFF0007F4901C0EB3F804990C7121F49
+48EC7FC0494814FF49484913E049485B01FF5C485BA2485B5AA2486F13C04A6D1380486F
+1300177E94C7FC5AA291CAFC5AA21508913801FFF8020713FFB54814C04A14F04AC66C7E
+023C6D7E4A6D7E4A6D7E7013804A15C0A24A15E07013F05C18F8A491C714FCA37EA67EA4
+6C17F880A27E18F06C5D18E06C6D15C07E6E4913806C6D15006D6C495A6D6CEB7FFC6DB4
+48485A6D90B55A010315C0010092C7FC023F13FC020713C0364F7ACD43>I<121F7F7FEB
+FF8091B81280A45A1900606060A2606060485F0180C86CC7FC007EC95A4C5A007C4B5A5F
+4C5A160F4C5A484B5A4C5A94C8FC16FEC812014B5A5E4B5A150F4B5AA24B5AA24B5A15FF
+A24A90C9FCA25C5D1407A2140FA25D141FA2143FA4147F5DA314FFA55BAC6D5BA2EC3FC0
+6E5A395279D043>I<91380FFF8091B512F8010314FE010F6E7E4901037F90267FF8007F
+4948EB3FF048496D7E484980486F7E484980824817805A91C714C05A7013E0A218F0B5FC
+A318F8A618FCA46C5DA37EA25E6C7F6C5DA26C5D6C7F6C6D137B6C6D13F390387FF80301
+1FB512E36D14C30103028313F89039007FFE03EC00401500A218F05EA3D801F816E0487E
+486C16C0487E486D491380A218005E5F4C5A91C7FC6C484A5A494A5A49495B6C48495BD8
+03FC010F5B9027FF807FFEC7FC6C90B55A6C6C14F06D14C0010F49C8FC010013F0364F7A
+CD43>57 D<91B5FC010F14F8017F14FF90B712C00003D9C00F7F2707FC00017FD80FE06D
+7F48486E7E48C87FD87FE06E7E7F7F486C1680A66C5A18006C485C6C5AC9485A5F4B5B4B
+5B4B5B4B5B4B90C7FC16FC4B5A4B5A16C04B5A93C8FC4A5A5D14035D5D14075DA25D140F
+A25DAB91CAFCAAEC1FC04A7EECFFF8497FA2497FA76D5BA26D5BEC3FE06E5A315479D340
+>63 D<171F4D7E4D7EA24D7EA34C7FA24C7FA34C7FA34C7FA24C7FA34C8083047F80167E
+8304FE804C7E03018116F8830303814C7E03078116E083030F814C7E031F81168083033F
+8293C77E4B82157E8403FE824B800201835D840203834B800207835D844AB87EA24A83A3
+DA3F80C88092C97E4A84A2027E8202FE844A82010185A24A820103854A82010785A24A82
+010F855C011F717FEBFFFCB600F8020FB712E0A55B547BD366>65
+D<BA12C019FEF1FFC01AF01AFCD8000701F0C7000313FFDE007F7F737F070F7F737F8785
+87858785A287A84F5BA263616361634F5B4F5B077F90C7FC4E485A060713F892B812E097
+C8FC861AF003F0C7000313FE9539003FFF80070F13E0737F07017F87737F747E1C807413
+C0A27413E0A31CF0A386A362A31CE0A2621CC0A250138097B5FC1C004F5B19074F5B073F
+13F04EB55ABC128098C7FC1AF81AC007F8C8FC54527CD160>I<932601FFFCEC01C0047F
+D9FFC013030307B600F81307033F03FE131F92B8EA803F0203DAE003EBC07F020F01FCC7
+383FF0FF023F01E0EC0FF94A01800203B5FC494848C9FC4901F882494982494982494982
+4949824990CA7E494883A2484983485B1B7F485B481A3FA24849181FA3485B1B0FA25AA2
+98C7FC5CA2B5FCAE7EA280A2F307C07EA36C7FA21B0F6C6D1980A26C1A1F6C7F1C006C6D
+606C6D187EA26D6C606D6D4C5A6D6D16036D6D4C5A6D6D4C5A6D01FC4C5A6D6DEE7F806D
+6C6C6C4BC7FC6E01E0EC07FE020F01FEEC1FF80203903AFFE001FFF0020091B612C0033F
+93C8FC030715FCDB007F14E0040101FCC9FC525479D261>I<BA7E19FCF1FF801AF01AFC
+D8000701F0C7000F13FF060014C0071F7F070713F807017F737F747E747F747F86747F74
+7F8886888688A2757EA31D8087A21DC0A51DE0A387A963A31DC0A51D80A2631D00A3515A
+A2646264505B6264505B505B5090C7FCF2FFFE4F5B07075B071F5B96B512C0060F91C8FC
+BB5A1AF01AC007FCC9FC19805B527CD167>I<BC1280A5D8000701F8C7000114C0F0001F
+19071901851A7F1A3F1A1FA2F20FE0A21A07A31A03A318F81BF01A01A497C7FC1701A317
+031707170F177F92B6FCA59238F8007F170F170717031701A317001B3EA31B7CA395C8FC
+A21BFCA21BF8A21A01A31A031BF01A071A0FA21A1F1A3FF27FE0F101FF1907191F0603B5
+FCBCFCA21BC0A34F517CD058>I<BB12FEA5D8000701F8C700077FF0007F191F19078585
+8586861B80A21A1FA31A0FA41BC006F81307A497C7FCA31701A317031707170F177F92B6
+FCA59238F8007F170F170717031701A31700A795C9FCB3B812F8A54A517CD055>I<9326
+01FFFCEC01C0047FD9FFC013030307B600F81307033F03FE131F92B8EA803F0203DAE003
+EBC07F020F01FCC7383FF0FF023F01E0EC0FF94A01800203B5FC494848C9FC4901F88249
+49824949824949824949824990CA7E494883A2484983485B1B7F485B481A3FA24849181F
+A3485B1B0FA25AA298C8FC5CA2B5FCAE6C057FB712E0A280A36C94C7003FEBC000A36C7F
+A36C7FA27E6C7FA26C7F6C7FA26D7E6D7F6D7F6D6D5E6D7F6D01FC93B5FC6D13FF6D6C6D
+5C6E01F0EC07FB020F01FEEC1FF10203903AFFF001FFE0020091B6EAC07F033FEE001F03
+0703FC1307DB007F02E01301040149CAFC5B5479D26A>I<B8D8C003B8FCA5D8000701F8
+C9001FEBE000B3AE92BAFCA503F8C9121FB3B1B8D8C003B8FCA560527CD169>I<B812C0
+A5D8000701F8C7FCB3B3B3B2B812C0A52A527CD132>I<B800C091B612F8A5D8000701F8
+C90003EBF8009738007F8051C7FC505AF203F8F20FF0505A505A505A50C8FCF101FCF107
+F84F5A4F5A4F5A4F5A07FEC9FCF003FC4E5A4E5A4E5A4E5A4E5ADD01FECAFC4D5A4D5A4D
+5A4D7E173F4D7E4C487E4C7F5E4C804C804C80EEFF7F9226F9FE3F7FDBFBFC809226FFF8
+1F7F4C7EDCC0077F0480804C7E4B6D804B6D804B8284727F727F8684727F727F87847280
+87737F85737F87737F85737F88857380747F888697B512FCB800C0013FECFFFEA55F527C
+D169>75 D<B812F8A5D8000701F8CAFCB3B3A91A7CA41AFC1AF8A51901A31903A219071A
+F0190FA2191F193F197F19FF180360183F4DB5FCBB12E0A546527CD151>I<B600FC073F
+B512FE6F61A26F96B6FCA2D80007F5C00070EF01EFA202EF6DEF03CFA202E76DEF078FA2
+02E36DEF0F0FA202E16D171EA302E06D173CA26F6C1778A26F6C17F0A26F6DED01E0A26F
+6DED03C0A36F6DED0780A26F6DED0F00A26F6D151EA26F6D5DA3706C5DA2706C5DA2706D
+495AA2706D495AA2706D495AA3706D49C7FCA2706D131EA2706D5BA2716C5BA3716C5BA2
+71EB81E0A271EBC3C0A271EBE780A27101FFC8FCA3715BA2715BA2725AA2725AA2D93FFC
+6F5AB74DB712FEA2725AA2725A77527CD180>I<B600FC93B7FC8181A282D800076E9239
+003FFC0070EE07E08282A28202EF7F02E77F02E380A202E18002E0806F7F6F7F6F7FA26F
+7F6F7F6F806F80A26F80707F707F707F707FA2707F7080708070808583717F717F717F71
+7FA27114807114C07114E07213F07213F8A27213FC7213FE7213FF721487A27214C77214
+E77313F77313FF85A285858585A28586868686A286868686A2D93FFC187FB7173F1B1F1B
+0F1B07755A60527CD169>I<93380FFFC00303B6FC031F15E092B712FC0203D9FC0013FF
+020F01C0010F13C0023F90C7000313F0DA7FFC02007F494848ED7FFE4901E0ED1FFF4949
+6F7F49496F7F4990C96C7F49854948707F4948707FA24849717E48864A83481B804A8348
+1BC0A2481BE04A83A2481BF0A348497113F8A5B51AFCAF6C1BF86E5FA46C1BF0A26E5F6C
+1BE0A36C6D4D13C0A26C6D4D1380A26C1B006C6D4D5A6E5E6C626D6C4C5B6D6D4B5B6D6D
+4B5B6D6D4B5B6D6D4B5B6D6D4B90C7FC6D6D4B5A6D01FF02035B023F01E0011F13F0020F
+01FC90B512C0020390B7C8FC020016FC031F15E0030392C9FCDB001F13E0565479D265>
+I<BAFC19F819FF1AE086D8000701F0C7001F13FC060113FF726C13807313C0070F13E01B
+F0857313F81BFCA27313FEA41BFFA81BFEA31BFC61A21BF84F13F04F13E0614F13C04F13
+004E485A061F5B92B812F01AC04FC7FC19E003F8CBFCB3AEB812C0A550527CD15C>I<93
+380FFFC00303B6FC031F15E092B712FC0203D9FC0013FF020F01C0010F13C0023F90C700
+0313F0DA7FFC02007F902601FFF0ED3FFE49496F7E49496F7F49496F7F4990C96C7F4948
+707F4948707F01FF854A177F48864849717EA24849711380A2481BC04A83481BE0A24A83
+481BF0A3481BF8A291CB7EA3B51AFCAF6C1BF8A26E5FA36C1BF0A36C6D4D13E0A36C1BC0
+6E5F6C1B806E5F6CDB01FE16006C6D902607FF80495A4C13E06C6D013F6D495A017F9126
+7F03F85C6D6C90277C00FC015B6D6C49D97E035B6D01806E485B6D6D48D91F8F5B6D01E0
+039F90C7FC6D01F06EB45A6DD9FCF85DDA3FFF6E13F0020F6D4913C0020301FF90B5C8FC
+020091B512FC031F180C0303181EDB001FEBE3FE93C7EA01FF74133E74137E7413FEF2F8
+077290B5FC1CFCA285A21CF8A2851CF07314E0A27314C0731480731400735B9638007FF8
+F21FE0576A79D265>I<B912F0F0FF8019F819FF1AC0D8000701F0C714F0060F7F060113
+FE727F737F737F85737F87A2737FA387A863A2616363A24F5B4F5B4F90C8FC4F5A06035B
+060F13F095B512C092B8C9FC19F819E019F89226F0000313FE9439007FFF80727F727F72
+7F727F727F8684A28684A787A71D1C75133EA38575137E73157C7513FC731401B86C6D90
+38F803F807039038FE07F07390B512E0736C14C0080F1400CEEA7FFC5F537CD164>I<91
+260FFF80130791B500F85B010702FF5B011FEDC03F49EDF07F9026FFFC006D5A4801E0EB
+0FFD4801800101B5FC4848C87E48488149150F001F824981123F4981007F82A28412FF84
+A27FA26D82A27F7F6D93C7FC14C06C13F014FF15F86CECFF8016FC6CEDFFC017F06C16FC
+6C16FF6C17C06C836C836D826D82010F821303010082021F16801400030F15C0ED007F04
+0714E01600173F050F13F08383A200788200F882A3187FA27EA219E07EA26CEFFFC0A27F
+6D4B13806D17006D5D01FC4B5A01FF4B5A02C04A5A02F8EC7FF0903B1FFFC003FFE0486C
+90B65AD8FC0393C7FC48C66C14FC48010F14F048D9007F90C8FC3C5479D24B>I<003FBC
+1280A59126C0003F9038C0007F49C71607D87FF8060113C001E08449197F49193F90C817
+1FA2007E1A0FA3007C1A07A500FC1BE0481A03A6C994C7FCB3B3AC91B912F0A553517BD0
+5E>I<B800C00103B612FCA5D8000701F8CAEBF000F31F80B3B3B11B3FA26D97C7FC8163
+7F1B7E6D6D17FE505A6E7E505A6E6D15076E4D5A6E6D4B5A6E6D4B5A6E01F84B5A6E6DDA
+03FFC8FC6E6CB46CEB0FFE6F9039F001FFF8030F90B65A030316C0DB007F92C9FC040F14
+F8DC007F13805E537CD167>I<B700FE031FB512FEA5D8001F01F0CA383FFE00F307F06D
+626F170F6D62811B1F6D6D601B3F6D97C7FC6F5F6D197E821BFE6E6D5E1A016E6D5E1A03
+6E60701507A26E6D5E1A0F6E6D5E1A1F6E6070153FA26E6D93C8FC626E6E147E1AFE6F5E
+711301A26F6D5C19036F6D5C19076F5E71130FA26F6D5C191F6F6D5C193F6F93C9FC715B
+A26FEC807E19FE706D5A18C1705C18E3705C18F318F770EBFFE0A2705CA2705CA37091CA
+FCA2705BA2715AA3715AA2715AA2715A715A5F537DD166>I<B700FC017FB600FE91B612
+F0A5D8003F01C0C8001F01E0C9EBF8006F71EE0FC06D7161876F1C1F6D7196C7FC6F8373
+606D1E3E6F836D7160876F1CFC6D666F4B801F016D66704A806E525A88704A17076E059F
+5F70021F80080F160F6E6570023F806EDC3E074CC8FC8870027E5F6EDC7C03163E7002FC
+804F6C167E6E1C7C700101814F6C16FC6E745B70010317016E4C6D5D060716C00580496D
+14036F63DDC00F16E04F6D14076F07F05BDDE01F170F6F92C76C5D1DF8DDF03E6E141F6F
+98C9FCDDF87E16FC067C6E5C6FF1FE3EDDFCFC177E6F4A6E147C1DFFDDFFF06E14FC6F62
+A24E816F62A270496F5BA24E817061A295C97E7061A270487090CAFCA37048705AA24D16
+01040360A27048705A84537DD18B>I<003FB7D88003B7FCA5D8000749C8000701F8C7FC
+6D6D9238007F806D6E93C8FC7015FE6D17016E6D5D704A5A6E16076E6D4A5A6E6D5D4F5A
+6E6D143F6E6D4A5A7191C9FC6E16FE6EECC00171485A6F5D6F6D485A6FEBF80F71485A6F
+5D6F6D485AEFFF7F6F4ACAFC6F5C6F5CA2705B705B8482707F707FA2707F7080855E4C80
+855E4C80DC3FCF7F058F7FEE7F074C6C7FDB01FE814C7E4B486C8003076E7F4B48814C7F
+4B486D7F033F824C7F4BC76C7F4B6E7F4A5A4B6E804A486E800207844A48814B6F7F4A48
+83023F824A486F7F92C96C7F02FE840101830103718090263FFFC084B76C0103B712F8A5
+5D527CD166>I<EC7FFF0107B512F0013F14FE90B77E48D9E00F7F2703FE000113F0486C
+6D7F6EEB3FFC48826E131F83707FA36C496D7FA26C90C7FC6C5AC9FCA6037FB5FC020FB6
+FC91B7FC01071487013FEBF0074913803901FFFC004813F0485B485B485B4890C7FC5A5B
+A2485AA45EA26D5C007F151D163D6C6C02797F6C6D01F113F86C9026C003E1EBFFE06C90
+26F81FC014F06C90B5487EC6ED001F011F01FC010713E0010101E090C8FC3C387CB641>
+97 D<EB3FF0B5FCA51203C6FCB3A4923801FFE0030F13FE033FEBFFC092B612F002F301
+017F913AF7F8003FFEDAFFE0EB0FFF03806D7F92C76C7F4A6E7F4A824A6E7FA2727EA285
+A28584A31A80AC1A00A44E5AA36118FF616E4A5BA26E4A5B6E4A5B6F495BDACFC04990C7
+FCDA87F0EB7FFC913A03FE03FFF849C6B612E0496D148049011F01FCC8FC90C7000313C0
+41547BD24B>I<913801FFF8021FEBFF8091B612F0010315FC010F9038C00FFE903A1FFE
+0001FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2486F138091C7FC486F130070
+5A4892C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C6D15C07E6E140F6CEE1F806C
+6DEC3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0010390B55A01001580023F49
+C7FC020113E033387CB63C>I<4DB47E0407B5FCA5EE001F1707B3A4913801FFE0021F13
+FC91B6FC010315C7010F9038E03FE74990380007F7D97FFC0101B5FC49487F4849143F48
+4980485B83485B5A91C8FC5AA3485AA412FFAC127FA36C7EA37EA26C7F5F6C6D5C7E6C6D
+5C6C6D49B5FC6D6C4914E0D93FFED90FEFEBFF80903A0FFFC07FCF6D90B5128F0101ECFE
+0FD9003F13F8020301C049C7FC41547CD24B>I<913803FFC0023F13FC49B6FC010715C0
+4901817F903A3FFC007FF849486D7E49486D7E4849130F48496D7E48178048497F18C048
+8191C7FC4817E0A248815B18F0A212FFA490B8FCA318E049CAFCA6127FA27F7EA218E06C
+EE01F06E14037E6C6DEC07E0A26C6DEC0FC06C6D141F6C6DEC3F806D6CECFF00D91FFEEB
+03FE903A0FFFC03FF8010390B55A010015C0021F49C7FC020113F034387CB63D>I<ED3F
+FC0203B5FC020F14C0023F14E09139FFF81FF0499038C03FF849EB807F49903800FFFC49
+5A495AA2495AA2EE7FF8495AEE3FF0EE0FC093C7FCAEB712E0A526007FF8C8FCB3B3A700
+7FB512FEA52E547CD329>I<DA3FFF14FF0103B5D8F00713C0010FDAFC1F13E0013FECFF
+7F90267FFC0F9038FF9FF09026FFE001EBF83F48496C13E0484990387FF01F4890C7D83F
+F813E0489338FC0FC0F0078048486E6CC7FCA2003F82A9001F5EA26C6C4A5AA26C5E6C6D
+495A6C6D495A6C6D485BDAFC0F5B4890B6C8FCD803EF14FC01C314F02607C03F90C9FC91
+CBFCA2120FA37FA213F813FE90B7FC6C16F817FF18C06C836C836C836D828448B9FC1207
+4848C700031480D81FF8EC003F4848150748486F13C083485A83A56D5D007F18806D5D00
+3F18006C6C4B5AD80FFEED1FFC6C6C6CEC7FF86C01E049485A6C01FE011F5B6C6CB71280
+010F03FCC7FC010115E0D9000F01FCC8FC3C4F7CB543>I<EB3FF0B5FCA51203C6FCB3A4
+EE1FFC93B512C0030314F0030F8092391FE07FFC92393F001FFE037C8003F07FDAF1E081
+ECF3C0DAF7807F8502FFC7FC5CA25CA45CB3ACB6D8F807B612C0A542537BD24B>I<137F
+497E000313E0487FA2487FA76C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA512017E
+B3B3A6B612E0A51B547BD325>I<157FEDFF80020313E04A13F0A24A13F8A76E13F0A26E
+13E002001380ED7F0092C7FCADED1FF891B5FCA51401EC007FB3B3B1EA0780EA1FE0487E
+487E486C13FF16F0A216E05C16C04A13806C4848130049485A003F495A000FB512F06C5C
+0001148026001FFCC7FC256C87D329>I<EB3FF0B5FCA51203C6FCB3A54CB512F8A59339
+003FFE00EF1FF0EF3FC04D5A4DC7FCEE03FEEE07F84C5A4C5AEE7FC04CC8FC4B5A4B5AED
+0FF8ED1FE04B7E4B7EECF1FF02F37F02F77F91B6FC83159F030F7F02FE80DAF8077F4A7E
+6F7F6F7F83707E82707F84707F707F82707F84707F177F717E4D13C0B6D8F003B6FCA540
+537CD247>I<EB3FF0B5FCA512017EB3B3B3B1B612F0A51C537BD225>I<D93FF0D91FFCED
+FFE0B591B500C0010713FE030302F0011F6D7E030F6E017F8092271FE07FFCD9FF037F92
+2A3F001FFE01F8007F0003027C9126FF03E080C602F06DD90780137FDAF1E0038FC77FDA
+F3C0159EDAF7806D01BC143F07FC8102FFC75C4A5EA24A5EA44A5EB3ACB6D8F807B6D8C0
+3FB512FEA567367BB570>I<D93FF0EB1FFCB591B512C0030314F0030F8092391FE07FFC
+92393F001FFE0003027C80C602F07FDAF1E081ECF3C0DAF7807F8502FFC7FC5CA25CA45C
+B3ACB6D8F807B612C0A542367BB54B>I<913801FFE0021F13FE91B612C0010315F0010F
+9038807FFC903A1FFC000FFED97FF86D6C7E49486D7F48496D7F48496D7F4A147F488348
+90C86C7EA24883A248486F7EA3007F1880A400FF18C0AC007F1880A3003F18006D5DA26C
+5FA26C5F6E147F6C5F6C6D4A5A6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0F
+FF807FFC6D90B55A010015C0023F91C8FC020113E03A387CB643>I<903A3FF001FFE0B5
+010F13FE033FEBFFC092B612F002F301017F913AF7F8007FFE0003D9FFE0EB1FFFC60280
+6D7F92C76C7F4A824A6E7F4A6E7FA2717FA285187F85A4721380AC1A0060A36118FFA261
+5F616E4A5BA26E4A5B6E4A5B6F495B6F4990C7FC03F0EBFFFC9126FBFE075B02F8B612E0
+6F1480031F01FCC8FC030313C092CBFCB1B612F8A5414D7BB54B>I<90397FE003FEB590
+380FFF80033F13E04B13F09238FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE780
+14EF150014EE02FEEB3FFC5CEE1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>
+114 D<903903FFF00F013FEBFE1F90B7FC120348EB003FD80FF81307D81FE0130148487F
+4980127F90C87EA24881A27FA27F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15
+F06C816C816C81C681013F1580010F15C01300020714E0EC003F030713F015010078EC00
+7F00F8153F161F7E160FA27E17E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE90
+39FFC00FFC6DB55AD8FC1F14E0D8F807148048C601F8C7FC2C387CB635>I<143EA6147E
+A414FEA21301A313031307A2130F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3
+A9EE07C0AB011FEC0F8080A26DEC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B
+020313802A4D7ECB34>I<D93FF8913801FFC0B50207B5FCA50003ED001FC61607B3AE5F
+A35FA2017F5D173B177B6D6C14F3DC01E313F06D6CD907C3EBFFC0903A0FFFC03F836D90
+B51203010114FE6D6C13F8020701E091C7FC42377BB54B>I<B600F00107B5FCA5000101
+F8C8EA7FE06C6DED3F00A2017F163E6E157E013F167C6E15FC6D5E6F13016D5E8117036D
+5E6F13076D5E6F130F6D5E6F131F6D93C7FC815F6E6C133E177E023F147C6F13FC6E5C16
+816E5C16C3A26EEBE3E016E76E5C16FF6E5CA26E91C8FCA26F5AA36F5AA26F5AA26F5AA2
+6F5A6F5A40367DB447>I<B6D8E07FB5D8C003B512C0A5000101F0C701F0C7381FF8006E
+027FED07E06C715DA26E023F150F017F705DA26E181F013F4B6C92C7FC6E606D70143E94
+B5FC6F177E6D4A6E137C03C001F315FC6D715B160303E001E114016D020702E05B03F013
+C06D71485A160F03F8D9807F13076D05F85B93381F003F03FC160F027F4902FC5BDBFE3E
+011F131F023F04FE90C8FC167EDBFF7C010F5B6E01FCECFF3E4C6D137E6E5FA24C7F6E5F
+4C7F6E5FA24C7F6E5F4C147FA26E5F93C8123F6F5EA2033E6FC9FC5A367DB461>I<007F
+B500F090387FFFFEA5C66C48C7000F90C7FC6D6CEC07F86D6D5C6D6D495A6D4B5A6F495A
+6D6D91C8FC6D6D137E6D6D5B91387FFE014C5A6E6C485A6EEB8FE06EEBCFC06EEBFF806E
+91C9FCA26E5B6E5B6F7E6F7EA26F7F834B7F4B7F92B5FCDA01FD7F03F87F4A486C7E4A48
+6C7E020F7FDA1FC0804A486C7F4A486C7F02FE6D7F4A6D7F495A49486D7F01076F7E4948
+6E7E49486E7FEBFFF0B500FE49B612C0A542357EB447>I<B600F00107B5FCA5C601F8C8
+EA7FE06EED3F00A26D6C153E187E013F167C6E15FC6D5E6F13016D5E6F13036D5E811707
+6D6D5C170F6D6D5C171F6D93C7FC6F5B027F143E6F137E023F147C6F13FCA26E6D5A1681
+6EEBC1F016C36E5C16E76E5C16FF6E5CA26E91C8FCA36F5AA26F5AA26F5AA26F5AA26F5A
+A35E150F5E151F93C9FC5DD81FC0133E486C137E486C137C486C13FC5D14015D14034A5A
+6C48485A49485A263FC07FCAFCEB81FE6CB45A6C13F000035BC690CBFC404D7DB447>I<
+001FB8FC1880A3912680007F130001FCC7B5FC01F0495B495D49495B495B4B5B48C75C5D
+4B5B5F003E4A90C7FC92B5FC4A5B5E4A5B5CC7485B5E4A5B5C4A5B93C8FC91B5FC495B5D
+4949EB0F805B495B5D495B49151F4949140092C7FC495A485E485B5C485E485B4A5C4849
+5B4815074849495A91C712FFB8FCA37E31357CB43C>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fv cmr10 10.95 82
+/Fv 82 125 df<4AB4EB0FE0021F9038E03FFC913A7F00F8FC1ED901FC90383FF03FD907
+F090397FE07F80494801FF13FF4948485BD93F805C137F0200ED7F00EF003E01FE6D91C7
+FC82ADB97EA3C648C76CC8FCB3AE486C4A7E007FD9FC3FEBFF80A339407FBF35>11
+D<4AB4FC021F13C091387F01F0903901FC0078D907F0131C4948133E494813FF49485A13
+7F1400A213FE6F5A163893C7FCAA167FB8FCA33900FE00018182B3AC486CECFF80007FD9
+FC3F13FEA32F407FBF33>I<4AB47E021F13F791387F00FFEB01F8903807F001EB0FE0EB
+1FC0EB3F80137F14008101FE80AEB8FCA3C648C77EB3AE486CECFF80007FD9FC3F13FEA3
+2F407FBF33>I<4AB4ECFF80021FD9C00F13E0913B7F01F03F80F8903C01F80078FE003C
+D907F0D93FF8130E49484948131F49484948EB7F804948484913FF137F02005CA201FE92
+C7FC6FED7F0070141C96C7FCAAF13F80BBFCA3C648C76CC7FC197F193FB3AC486C4A6CEB
+7FC0007FD9FC3FD9FE1FB5FCA348407FBF4C>I<121EEA7F80EAFFC0A9EA7F80ACEA3F00
+AC121EAB120CC7FCA8121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A4179C019>33
+D<001E130F397F803FC000FF137F01C013E0A201E013F0A3007F133F391E600F30000013
+00A401E01370491360A3000114E04913C00003130101001380481303000EEB070048130E
+0018130C0038131C003013181C1C7DBE2D>I<121EEA7F8012FF13C0A213E0A3127FEA1E
+601200A413E013C0A312011380120313005A120E5A1218123812300B1C79BE19>39
+D<1430147014E0EB01C0EB03801307EB0F00131E133E133C5B13F85B12015B1203A2485A
+A2120F5BA2121F90C7FCA25AA3123E127EA6127C12FCB2127C127EA6123E123FA37EA27F
+120FA27F1207A26C7EA212017F12007F13787F133E131E7FEB07801303EB01C0EB00E014
+701430145A77C323>I<12C07E12707E7E121E7E6C7E7F12036C7E7F12007F1378137CA2
+7FA2133F7FA21480130FA214C0A3130714E0A6130314F0B214E01307A614C0130FA31480
+A2131F1400A25B133EA25BA2137813F85B12015B485A12075B48C7FC121E121C5A5A5A5A
+145A7BC323>I<121EEA7F8012FF13C0A213E0A3127FEA1E601200A413E013C0A3120113
+80120313005A120E5A1218123812300B1C798919>44 D<B512FEA617067F961E>I<121E
+EA7F80A2EAFFC0A4EA7F80A2EA1E000A0A798919>I<ED0180ED03C01507A21680150FA2
+16005DA2151E153EA2153C157CA2157815F8A25D1401A25D1403A25D1407A25D140FA24A
+C7FCA2141E143EA2143C147CA2147814F8A25C1301A25C1303A25C1307A25C130FA291C8
+FC5BA2131E133EA25BA2137813F8A25B1201A25B1203A25B1207A25B120FA290C9FC5AA2
+121E123EA2123C127CA2127812F8A25A1260225B7BC32D>I<EB01FE90380FFFC090383F
+03F090387C00F849137C48487F48487F4848EB0F80A2000F15C04848EB07E0A3003F15F0
+A290C712034815F8A64815FCB3A26C15F8A56C6CEB07F0A3001F15E0A36C6CEB0FC0A26C
+6CEB1F80000315006C6C133E6C6C5B017C5B90383F03F090380FFFC0D901FEC7FC263F7D
+BC2D>I<EB01C013031307131F137FEA07FFB5FC139FEAF81F1200B3B3ACEB7FF0B612F8
+A31D3D78BC2D>I<EB07FC90383FFF8090B512E03903F01FF83907C007FC390F0001FE00
+1E6D7E001C1580003CEC7FC05AED3FE01270B4FC6DEB1FF07FA56C5A6CC7FC120CC813E0
+153FA216C0157F168015FF16004A5A5D4A5A4A5A5D4A5A4A5A4AC7FC147E147C5C495A49
+5A495A495A49C71270133E133C5B4914E0485A485A485A48C7120148B6FCA25A4815C0B7
+FCA3243D7CBC2D>I<EB07FC90383FFF809038F80FE03901E003F839078001FCD80F007F
+000E6D7E001E1580D81F80137F486C14C07FA27F5BA2121F6C5AC8138015FF1600A24A5A
+A24A5A5DEC07E04A5A023FC7FCEB1FFCECFF809038000FE0EC07F86E7E6E7E6E7E1680ED
+7FC0A216E0153FA216F0A2120C123F487E487EA316E0A249137F6CC713C01278EDFF807E
+6C4913006C495A3907C007FC3903F80FF0C6B55A013F1380D907F8C7FC243F7CBC2D>I<
+150E151E153EA2157EA215FE1401A21403EC077E1406140E141CA214381470A214E0EB01
+C0A2EB0380EB0700A2130E5BA25B5BA25B5B1201485A90C7FC5A120E120C121C5AA25A5A
+B8FCA3C8EAFE00AC4A7E49B6FCA3283E7EBD2D>I<00061403D80780131F01F813FE90B5
+FC5D5D5D15C092C7FC14FCEB3FE090C9FCACEB01FE90380FFF8090383E03E090387001F8
+496C7E49137E497F90C713800006141FC813C0A216E0150FA316F0A3120C127F7F12FFA4
+16E090C7121F12FC007015C012780038EC3F80123C6CEC7F00001F14FE6C6C485A6C6C48
+5A3903F80FE0C6B55A013F90C7FCEB07F8243F7CBC2D>I<EC1FE0ECFFF8903803F03E90
+380FC00F90391F000780133E017EEB1FC049133F4848137F12035B12074848EB3F80ED1F
+00001F91C7FC5BA2123FA3485AA214FE903887FF8039FF8F07E090389C01F09038B800FC
+01B0137E13F0497F16804914C0A2ED1FE0A34914F0A5127FA6123F6D14E0A2121FED3FC0
+A26C6C1480A20007EC7F006C6C137E6C6C5B6C6C485A90387E07F06DB45A010F1380D903
+FCC7FC243F7CBC2D>I<1238123C123F90B612FCA316F85A16F016E00078C712010070EC
+03C0ED078016005D48141E151C153C5DC8127015F04A5A5D14034A5A92C7FC5C141EA25C
+A2147C147814F8A213015C1303A31307A3130F5CA2131FA6133FAA6D5A0107C8FC26407B
+BD2D>I<EB03FC90381FFF8090387C07E09038F001F83901E0007C48487F48487F48C7FC
+ED0F80121E16C0003E1407A4123FA26DEB0F807F6C6C131F6D140001FC133E6C6C5B9038
+FF80786C6D5A6CEBF3E06CEBFF806C91C7FC133F6D13C06D7F013F13F801787F48486C7E
+3903E01FFF48486C1380260F800313C048487E489038007FE0003E143F007E141F007CEC
+0FF01507481403A31501A46C15E0007C1403A2007E15C06C14076CEC0F806DEB1F006C6C
+133ED807F05B3901FC03F86CB512E0011F1380D903FCC7FC243F7CBC2D>I<EB03FCEB1F
+FF90387E07C09038FC03F048486C7E48486C7E4848137C000F147E4848137F81003F1580
+5B007F15C0A2151F12FF16E0A516F0A5127F153FA36C7EA2001F147F120F6C6C13FF6D13
+DF000313013900F8039F90387E0F1FD91FFE13E0EB07F090C7FCA2ED3FC0A41680157FD8
+0F801400487E486C13FEA24A5A5D49485AEB8007391E000FE0001F495A260FC07FC7FC38
+03FFFE6C13F838003FC0243F7CBC2D>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FC
+B3121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A2779A619>I<121EEA7F80A2EAFFC0A4EA
+7F80A2EA1E00C7FCB3121E127FEAFF80A213C0A4127F121E1200A412011380A312031300
+5A1206120E120C121C5A1230A20A3979A619>I<EB1FF890B5FC3903E01FC0390F0007F0
+001EEB03F848EB01FC4814FE140000FE14FF7E7FA46CC7FC123EC7EA01FEA2EC03FCEC07
+F815F0EC0FC0EC1F80EC3F00143E5C147814F85C13015CA2495AA25CAB91C7FC90C8FCA8
+EB0780EB1FE0A2497EA46D5AA2EB078020407BBF2B>63 D<15074B7EA34B7EA34B7EA34B
+7EA34B7E15E7A2913801C7FC15C3A291380381FEA34AC67EA3020E6D7EA34A6D7EA34A6D
+7EA34A6D7EA34A6D7EA349486D7E91B6FCA249819138800001A249C87EA24982010E157F
+A2011E82011C153FA2013C820138151FA2017882170F13FC00034C7ED80FFF4B7EB500F0
+010FB512F8A33D417DC044>65 D<B712FCEEFF8017F00001903980000FF86C6CC7EA03FE
+707E701380EF7FC0EF3FE0A2EF1FF0A218F8A3170F171FA318F0A2EF3FE0177F18C0EFFF
+804C1300EE03FCEE0FF8EE7FE091B6C7FC17E091C7EA07FCEE01FE933800FF80EF7FC0EF
+3FE0EF1FF018F8170F18FC1707A218FEA718FC170FA2EF1FF818F0173FEF7FE0EFFFC004
+03138048486C90380FFE00B85A17E094C7FC373E7DBD40>I<DB3FF01306912603FFFE13
+0E020F9038FF801E913A3FF007E03E9139FF8000F8D903FEC7EA7C7ED907F8EC1EFE4948
+140FD93FE0140749481403495A91C812014848150012034848167E5B000F173EA2484816
+1EA2123F5B180E127FA349160012FFAC127F7F180EA2123FA27F001F171E181C6C7EA200
+07173C6D16386C6C1678000117706C6C16F06EEC01E06D6C15C06D6C1403D90FF0EC0780
+6D6CEC1F00D903FE143E902600FF8013F891393FF007F0020FB512C0020391C7FC913800
+3FF037427BBF42>I<B712FCEEFF8017E000019039C0001FF86C6C48EB03FEEE00FF717E
+717EEF0FE084717E717E170184717EA21980187F19C0A3F03FE0A519F0AB19E0A5F07FC0
+A21980A218FF19004D5AA24D5A6017074D5A4D5AEF7FC04DC7FCEE03FE48486CEB1FF8B8
+5A178004FCC8FC3C3E7DBD45>I<B912E0A300019038C000016C6C48EB001FEF0FF01703
+A217011700A31870A41838161CA41800A2163CA2167C16FC150391B5FCA3EC8003150016
+7C163CA2161CA21807A3180E93C7FCA4181E181CA2183CA2187CA218F817011703170717
+1F48486CEB01FFB912F0A3383E7DBD3E>I<B91280A300019038C000036C6C48EB007FEF
+1FC0170F1707A21703A31701A4EF00E0A21638A31800A31678A216F81501150791B5FCA3
+EC8007150115001678A21638A693C8FCAF3801FFE0B612F0A3333E7DBD3B>I<DB3FE013
+0C912603FFFE131C021F9038FF803C913A7FF00FC07C9139FF0001F0D903FC90380078FC
+4948143DD91FE0141F4948140F4948140701FF15034890C8FC491501485A000716005B00
+0F177C5B001F173CA2485AA2181C127FA25B95C7FC12FFAB041FB512F0127FA26D913900
+0FFE00EF03FC123FA27F121FA26C7EA212077F12036C7E7F6C7F6D6C14076D7E6D6C140F
+D907F8141ED903FEEC3C7C902600FF80EBF83C913A7FF007F01C021FB5EAC00C020391C8
+FC9138003FF03C427BBF47>I<B6D8C01FB512F8A3000101E0C7383FFC0026007F80EC0F
+F0B3A691B7FCA30280C7120FB3A92601FFE0EC3FFCB6D8C01FB512F8A33D3E7DBD44>I<
+B612F0A3C6EBF000EB3FC0B3B3B2EBFFF0B612F0A31C3E7EBD21>I<011FB512FCA3D900
+0713006E5A1401B3B3A6123FEA7F80EAFFC0A44A5A1380D87F005B007C130700385C003C
+495A6C495A6C495A2603E07EC7FC3800FFF8EB3FC026407CBD2F>I<B600C090387FFFFC
+A3000101E0C7000F138026007F80913807FE0018F818E0604D5A4DC7FC173E5F5F4C5A4C
+5A4C5A4C5A4CC8FC163E5E5E4B5A4B5AED07804B7E151F4B7E4B7E15FF913881EFF89138
+83C7FCEC878791388F03FE91389E01FF14BCDAF8007F4A6D7E5C4A6D7E4A6D7EA2707E70
+7EA2707E707EA2707F717E84173F717E717EA2717E848419802601FFE04A13C0B600C090
+B6FCA3403E7DBD47>I<B612F8A3000101E0C9FC38007F80B3B0EF0380A517071800A45F
+A35FA25F5F5F4C5A160748486C133FB8FCA3313E7DBD39>I<B500C093383FFFF0A30001
+6D93387FF800D8007F18E0D977F016EFA3D973F8ED01CFA2D971FCED038FA3D970FEED07
+0FA26E150E80A26E6C141CA36E6C1438A26E6C1470A36E6C14E0A26E6CEB01C0A36E6CEB
+0380A36E6CEB0700A2037F130EA36F6C5AA26F6C5AA36F6C5AA25FED07F0A2923803F9C0
+A36FB45AA26F90C7FCA213F8486C147ED807FFEF3FF8B500F8013C011FB512F0A34C3E7D
+BD53>I<B56C91B512F88080D8007F030713006EEC01FC6E6E5A1870EB77FCEB73FEA2EB
+71FF01707FA26E7E6E7EA26E7E6E7EA26E7E6E7EA26E7E6E7FA26F7E6F7EA26F7E6F7EA2
+6F7E6F7EA26F7E6F1380A2EE7FC0EE3FE0A2EE1FF0EE0FF8A2EE07FCEE03FEA2EE01FF70
+13F0A2177F173FA2171F170FA2170701F81503487ED807FF1501B500F81400A218703D3E
+7DBD44>I<ED7FE0913807FFFE91391FC03F8091397E0007E04948EB03F8D907F0EB00FE
+4948147F49486E7E49486E7E49C86C7E01FE6F7E00018349150300038348486F7EA24848
+6F7EA2001F188049167F003F18C0A3007F18E049163FA300FF18F0AC007F18E06D167FA4
+003F18C0A26C6CEEFF80A36C6C4B1300A26C6C4B5A00035F6D150700015F6C6C4B5A6D5E
+6D6C4A5A6D6C4A5A6D6C4AC7FC6D6C14FED901FCEB03F8D9007FEB0FE091391FC03F8091
+2607FFFEC8FC9138007FE03C427BBF47>I<B712F8EEFF8017E000019039C0003FF86C6C
+48EB07FCEE01FE707EEF7F80EF3FC018E0A2EF1FF0A218F8A818F0A2EF3FE0A218C0EF7F
+80EFFF004C5AEE07FCEE3FF091B612C04CC7FC0280C9FCB3A73801FFE0B612C0A3353E7D
+BD3E>I<B712C016FCEEFF800001D9C00013E06C6C48EB1FF0EE07FCEE01FE707E84717E
+A2717EA284A760177F606017FF95C7FCEE01FCEE07F8EE1FE0EEFF8091B500FCC8FC16F0
+91388001FCED003FEE1FC0707E707E83160383160183A383A484A4F0C004190EA28218E0
+057F131E2601FFE0161CB600C0EB3FF094381FF83805071370CA3801FFE09438003F803F
+407DBD43>82 D<D907FC130C90391FFF801C017FEBF03C3901FC03F83A03F0007E7CD807
+C0EB1FFC4848130F001F140748C71203003E1401007E1400A2007C157C12FCA2163CA36C
+151CA27EA26C6C14007F7FEA3FF8EBFF806C13F86CEBFF806C14F06C14FC6C14FF6C15C0
+013F14E0010714F0EB007F020713F89138007FFC150FED07FE15031501ED00FFA200E015
+7FA3163FA27EA3163E7E167E6C157C6C15FC6C15F86D13016DEB03F06DEB07E0D8F9FCEB
+0FC03AF07F803F8090391FFFFE00D8E00713F839C0007FC028427BBF33>I<003FB91280
+A3903AF0007FE001018090393FC0003F48C7ED1FC0007E1707127C00781703A300701701
+A548EF00E0A5C81600B3B14B7E4B7E0107B612FEA33B3D7DBC42>I<B600C090B512F8A3
+000101E0C70007130026007F80EC01FC715A1870B3B3A4013F16F06E5DA21701011F5E80
+010F15036E4A5A010793C7FC6D6C5C6D6C141E6D6C5C027F14F86E6C485A91390FF00FE0
+0203B51280020049C8FCED1FF03D407DBD44>I<B691380FFFFEA3000301E0020113E06C
+01809138007F806CEF3F00017F163E181C6E153C013F1638A26E1578011F1670A26D6C5D
+A26E140101075EA26E140301035EA26D6C4AC7FCA2806D150EA26F131E027F141CA26F13
+3C023F1438A26E6C5BA26F13F0020F5CA2EDF80102075CA26E6C485AA2EDFE07020191C8
+FCA26F5A6E130EA2ED7F9CA216DCED3FF8A36F5AA36F5AA26F5AA36F5A3F407EBD44>I<
+B500FE017FB5D88007B5FCA3000301C0010101E0C713F86C90C849EC3FE07148EC0F807E
+7215006E143F017F190E84A26D6C60A24D7E6D6C60A2EFE7F86D6C60A2933801C3FC6E18
+F001076104037F6E0281140101036104077F17006D6C4D5AA2040EEB7F806D6C4DC7FCA2
+4CEB3FC0DA7F80160EA24CEB1FE003C0161E023F171C047814F0DBE070010F133C021F17
+3804F014F84C1307DA0FF05EA2DBF1C0EB03FCDA07F95EA2DBFB80EB01FEDA03FF6F5AA2
+93C8FCA26E5FA24B157F020094C8FCA24B81037C153EA20378151E0338151C58407EBD5D
+>I<007FB5D8C003B512E0A3C649C7EBFC00D93FF8EC3FE06D48EC1F806D6C92C7FC171E
+6D6C141C6D6C143C5F6D6C14706D6D13F04C5ADA7FC05B023F13036F485ADA1FF090C8FC
+020F5BEDF81E913807FC1C163C6E6C5A913801FF7016F06E5B6F5AA26F7E6F7EA2828215
+3FED3BFEED71FF15F103E07F913801C07F0203804B6C7EEC07004A6D7E020E6D7E5C023C
+6D7E02386D7E14784A6D7E4A6D7F130149486E7E4A6E7E130749C86C7E496F7E497ED9FF
+C04A7E00076DEC7FFFB500FC0103B512FEA33F3E7EBD44>I<B66C0103B51280A3000101
+F0C8EBF8006C6C48ED3FC0725A013F041EC7FC6D7E606D6C15386D6C1578606D6C5D6E14
+016D5E6D6D1303606E6C49C8FC6E6C5B170E6E6C131E171C6E6C5B6E6C137817706E6C13
+F06F5B6E13016EEB83C05FED7FC7DB3FE7C9FC16EFED1FFE5E150F6F5AB3A4ED1FFC020F
+B512FCA3413E7FBD44>I<EAFFFCA4EAF000B3B3B3B3ABEAFFFCA40E5B77C319>91
+D<486C13C00003130101001380481303000EEB070048130E0018130C0038131C00301318
+0070133800601330A300E01370481360A400CFEB678039FFC07FE001E013F0A3007F133F
+A2003F131F01C013E0390F0007801C1C73BE2D>I<EAFFFCA4EA003CB3B3B3B3ABEAFFFC
+A40E5B7FC319>I<EA0180120313005A120E5A12181238123012701260A312E05AA412CF
+EAFFC013E0A3127FA2123F13C0EA0F000B1C7ABE19>96 D<EB0FF8EBFFFE3903F01F8039
+078007E0000F6D7E9038E001F8D81FF07F6E7EA3157F6C5AEA0380C8FCA4EC1FFF0103B5
+FC90381FF87FEB7F803801FC00EA07F8EA0FE0485A485AA248C7FCEE038012FEA315FFA3
+007F5BEC03BF3B3F80071F8700261FC00E13CF3A07F03C0FFE3A01FFF807FC3A003FC001
+F0292A7DA82D>I<EA01FC12FFA3120712031201B1EC03FC91381FFF8091387C07E09039
+FDE001F09039FFC000FC4A137E91C77E49158049141F17C0EE0FE0A217F0A2160717F8AA
+17F0A2160FA217E0161F17C06D1580EE3F006D5C6E13FE9039F3C001F89039F1E003F090
+39E0780FC09026C03FFFC7FCC7EA07F82D407EBE33>I<49B4FC010F13E090383F00F801
+7C131E4848131F4848137F0007ECFF80485A5B121FA24848EB7F00151C007F91C7FCA290
+C9FC5AAB6C7EA3003FEC01C07F001F140316806C6C13076C6C14000003140E6C6C131E6C
+6C137890383F01F090380FFFC0D901FEC7FC222A7DA828>I<ED01FC15FFA31507150315
+01B114FF010713E190381F80F990387E003D49131FD803F81307485A4913034848130112
+1F123F5B127FA290C7FCA25AAA7E7FA2123FA26C7E000F14037F000714076C6C497E6C6C
+497ED8007C017913F890383F01F190380FFFC1903A01FE01FC002D407DBE33>I<EB01FE
+90380FFFC090383F03F09038FC01F848486C7E4848137E48487F000F158049131F001F15
+C04848130FA2127F16E090C7FCA25AA290B6FCA290C9FCA67EA27F123F16E06C7E150100
+0F15C06C6C13036DEB07806C6C1400C66C131E017E5B90381F80F8903807FFE0010090C7
+FC232A7EA828>I<EC1FC0EC7FF8903801F83C903807E07E90380FC0FFEB1FC1EB3F8114
+01137FEC00FE01FE137C1500AEB6FCA3C648C7FCB3AE487E007F13FFA320407EBF1C>I<
+167C903903F801FF903A1FFF078F8090397E0FDE1F9038F803F83803F001A23B07E000FC
+0600000F6EC7FC49137E001F147FA8000F147E6D13FE00075C6C6C485AA23901F803E039
+03FE0FC026071FFFC8FCEB03F80006CAFC120EA3120FA27F7F6CB512E015FE6C6E7E6C15
+E06C810003813A0FC0001FFC48C7EA01FE003E140048157E825A82A46C5D007C153E007E
+157E6C5D6C6C495A6C6C495AD803F0EB0FC0D800FE017FC7FC90383FFFFC010313C0293D
+7EA82D>I<EA01FC12FFA3120712031201B1EC01FE913807FFC091381E07E091387803F0
+9138E001F8D9FDC07F148001FF6D7E91C7FCA25BA25BB3A6486C497EB5D8F87F13FCA32E
+3F7DBE33>I<EA01E0EA07F8A2487EA46C5AA2EA01E0C8FCACEA01FC127FA31207120312
+01B3AC487EB512F0A3143E7DBD1A>I<1478EB01FEA2EB03FFA4EB01FEA2EB00781400AC
+147FEB7FFFA313017F147FB3B3A5123E127F38FF807E14FEA214FCEB81F8EA7F01387C03
+F0381E07C0380FFF803801FC00185185BD1C>I<EA01FC12FFA3120712031201B292B512
+80A392383FFC0016E0168093C7FC153C5D5D4A5AEC07C04A5A4AC8FC143E147F4A7E13FD
+9038FFDFC0EC9FE0140F496C7E01FC7F496C7E1401816E7E81826F7E151F826F7EA28248
+6C14FEB539F07FFFE0A32B3F7EBE30>I<EA01FC12FFA3120712031201B3B3B1487EB512
+F8A3153F7DBE1A>I<2701F801FE14FF00FF902707FFC00313E0913B1E07E00F03F0913B
+7803F03C01F80007903BE001F87000FC2603F9C06D487F000101805C01FBD900FF147F91
+C75B13FF4992C7FCA2495CB3A6486C496CECFF80B5D8F87FD9FC3F13FEA347287DA74C>
+I<3901F801FE00FF903807FFC091381E07E091387803F000079038E001F82603F9C07F00
+01138001FB6D7E91C7FC13FF5BA25BB3A6486C497EB5D8F87F13FCA32E287DA733>I<14
+FF010713E090381F81F890387E007E01F8131F4848EB0F804848EB07C04848EB03E0000F
+15F04848EB01F8A2003F15FCA248C812FEA44815FFA96C15FEA36C6CEB01FCA3001F15F8
+6C6CEB03F0A26C6CEB07E06C6CEB0FC06C6CEB1F80D8007EEB7E0090383F81FC90380FFF
+F0010090C7FC282A7EA82D>I<3901FC03FC00FF90381FFF8091387C0FE09039FDE003F0
+3A03FFC001FC6C496C7E91C7127F49EC3F805BEE1FC017E0A2EE0FF0A3EE07F8AAEE0FF0
+A4EE1FE0A2EE3FC06D1580EE7F007F6E13FE9138C001F89039FDE007F09039FC780FC0DA
+3FFFC7FCEC07F891C9FCAD487EB512F8A32D3A7EA733>I<02FF131C0107EBC03C90381F
+80F090397F00387C01FC131CD803F8130E4848EB0FFC150748481303121F485A1501485A
+A448C7FCAA6C7EA36C7EA2001F14036C7E15076C6C130F6C7E6C6C133DD8007E13799038
+3F81F190380FFFC1903801FE0190C7FCAD4B7E92B512F8A32D3A7DA730>I<3901F807E0
+00FFEB1FF8EC787CECE1FE3807F9C100031381EA01FB1401EC00FC01FF1330491300A35B
+B3A5487EB512FEA31F287EA724>I<90383FC0603901FFF8E03807C03F381F000F003E13
+07003C1303127C0078130112F81400A27E7E7E6D1300EA7FF8EBFFC06C13F86C13FE6C7F
+6C1480000114C0D8003F13E0010313F0EB001FEC0FF800E01303A214017E1400A27E15F0
+7E14016C14E06CEB03C0903880078039F3E01F0038E0FFFC38C01FE01D2A7DA824>I<13
+1CA6133CA4137CA213FCA2120112031207001FB512C0B6FCA2D801FCC7FCB3A215E0A912
+009038FE01C0A2EB7F03013F138090381F8700EB07FEEB01F81B397EB723>I<D801FC14
+FE00FF147FA3000714030003140100011400B3A51501A31503120015076DEB06FF017E01
+0E13806D4913FC90381FC078903807FFE00100903880FE002E297DA733>I<B539E00FFF
+E0A32707FE000313006C48EB00FC5E00015D7F00005DA26D13016D5CA26D6C485AA2ECC0
+07011F91C7FCA290380FE00EA2ECF01E0107131CA26D6C5AA2ECFC7801011370A2ECFEF0
+01005BA2EC7FC0A36E5AA26EC8FCA3140E2B287EA630>I<B53BC3FFFE03FFF8A3290FFE
+003FE00013C06C486D48EB3F806C4817006D010F141E00016F131C15076D163C00004A6C
+1338A2017F5E4B7E151DD93F805DED3DFC1538D91FC04A5AED78FE9238707E03D90FE001
+7F5BEDE03F02F0140701070387C7FC9138F1C01F02F9148F010315CE9138FB800F02FF14
+DE6D15FCED00076D5DA24A1303027E5CA2027C1301023C5C023813003D287EA642>I<B5
+39F01FFFE0A30003D9C00F1300C690388007F8D97F0013E002805BD93FC05B011F49C7FC
+90380FE00EECF01E6D6C5A01035B6D6C5A6E5AEB00FF6E5A6E5A81141F814A7E81147BEC
+F1FC903801E1FEECC0FF01037F49486C7ED90F007F011E6D7E013E130F496D7E01FC8048
+6C80000F4A7EB539803FFFF8A32D277FA630>I<B539E00FFFE0A32707FE000313006C48
+EB01FC6F5A00015D7F00005DA2017F495AA2EC8003013F5CA26D6C48C7FCA26E5A010F13
+0EA26D6C5AA2ECF83C01031338A26D6C5AA2ECFEF001005BA2EC7FC0A36E5AA36EC8FCA2
+140EA2141E141C143C1438A2147800181370127EB45BA2495AA248485AD87E07C9FCEA78
+0EEA3C3CEA1FF8EA07E02B3A7EA630>I<001FB61280A2EBE0000180140049485A001E49
+5A121C4A5A003C495A141F00385C4A5A147F5D4AC7FCC6485AA2495A495A130F5C495A90
+393FC00380A2EB7F80EBFF005A5B484813071207491400485A48485BA248485B4848137F
+00FF495A90B6FCA221277EA628>I<B812F0A22C0280982D>I<BE12C0A25A0280985B>I
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fw cmbx12 20.736 19
+/Fw 19 120 df<BDFC1CFCF4FFC01DF81DFF1EC01EF88AC7003F91C96C14FF090315C0E1
+007F800A0F14F80A03800A00800B3F7F7780778077800B018077808C8A787F787FA27880
+8D8A8D8A8D8A8DA28D8AA28DA28BA28DA42280A38BA322C0B22280A367A32200A4699CB5
+FCA269A3545CA2696669666966695491C7FC6668545B9BB55A65535C535C535C0B3F5C9A
+B6C8FC5214FC0A0F5C0A3F5C0903B612C0097F5DBF48C9FC1EF81EE01E800BFCCAFC1DE0
+52CBFC99CCFC82767AF594>68 D<BF12FCA48AA4C7003F0280C8123F1B01F3003F1C0776
+7F1C008989898989A2891F8089A289A31E7FA21FC0A21E3FA3F20FF0A3F61FE0A49BC7FC
+A21A1FA31A3FA21A7FA21AFF1903190F197F94B7FCA8943880007F190F190319001A7FA2
+1A3FA21A1FA31A0FA997CBFCB3A9BBFCA86B757AF47A>70 D<96267FFFE01670063FB6ED
+01F80503B700F01403053F04FC14074CB96C130F040706E0131F043F72133F93BA00FC13
+7F0303DC00076D13FF030F03C09039003FFF814B02FCC8000713C3037F02E0030113F792
+B600806F6CB5FC02034ACA121F4A02F8834A02E0834A4A1701027F4A8391B548CC7E494A
+85495C4C854988494A85494A85495C8A4991CDFC90B54886A2484A1B7FA2481E3F5D481E
+1F5D5A1F0FA2485CA3481E075DA2795A489BC9FCA45DA2B6FCB27EA26F0403BA12C0A47E
+A3816C96C8000302F8C7FCA36C80A36C80A27E817E817E817F6D80827F6D806D806D8082
+6D6E606D806E80021F6E5F6E02F05F6E806E02FE5F0200DAFFC05E6F02F04BB6FC031F02
+FE030713CF6FDAFFE0021F138703039226FF8003B51201030093B6EAFC00043F4E133F04
+0706E0131F04014E1307DC003F4CC71201050304F8EC0070DD003F038092C8FCDE007F01
+F0CCFC827A75F798>I<001FC012F8A7481FFC03F0C76C91C7120F92C8EF007F02F81B1F
+02E01B0702801B0191C984491D7F491D3F491D1FA2491D0FA2491D07007F1FFEA2491D03
+A4491D01A700FF1FFF90CA85A6CB1A00B3B3B3AD4ABC12C0A8787479F387>84
+D<92383FFFF80207B612E0027F15FC49B87E010717E0011F83499026F0007F13FC4948C7
+000F7F90B502036D7E486E6D806F6D80727F486E6E7F8486727FA28684A26C5C72806C5C
+6D90C8FC6D5AEB0FF8EB03E090CAFCA70507B6FC041FB7FC0303B8FC157F0203B9FC021F
+ECFE0391B612800103ECF800010F14C04991C7FC017F13FC90B512F04814C0485C4891C8
+FC485B5A485B5C5A5CA2B5FC5CA360A36E5DA26C5F6E5D187E6C6D846E4A48806C6D4A48
+14FC6C6ED90FF0ECFFFC6C02E090263FE07F14FE00019139FC03FFC06C91B6487E013F4B
+487E010F4B1307010303F01301D9003F0280D9003F13FC020101F8CBFC57507ACE5E>97
+D<93387FFF80030FB512FC037FECFF804AB712E0020716F8021F16FE027FD9F8077F49B5
+D8C000804991C7003F13E04901FC020F7F49496E7F49498049496E7F49496E7F90B55A48
+727E92C914804884485B1BC048841BE0485BA27313F05AA25C5AA21BF885A2B5FCA391BA
+FCA41BF002F8CCFCA67EA3807EA47E806CF103F0F207F86C7F1A0F6C6E17F06C191F6F17
+E06C6E163F6D6DEE7FC06D6D16FF6D6D4B13806D6D4B13006D6D6CEC0FFE6D02E0EC3FFC
+6D02F8ECFFF86D9126FFC00F5B023F91B65A020F178002034CC7FC020016F8031F15E003
+0392C8FCDB000F13E04D507BCE58>101 D<F37F80922607FFFC913807FFE092B600E001
+1F13F8020703FC017F13FC021FDBFF01B512FE027F16C349B800F7EBBFFF49DA803F9038
+FFF83F010F9026FC000714C04901F00101EC007F49496D148049496E6D7E90B517E04B6E
+15FE48F1F01F4891C86C9038F80FFCF307F098C7FC48496F7FA34885AB6C61A36C6D4B5B
+A36C6E4A5B6C616F5C6D606D6D91B55A6D6D4991C8FC6D01FC01075B9226FF803F13F893
+B65A4917C0D93F1F93C9FC020715FCD97E0015E0030701FCCAFC01FE90CDFCA412017FA2
+80A280808014FE6C90B812C019FF1AF01AFC6DF0FF801BE06D851BFC6D856D856D1A806D
+1AC05B011F1AE0137F48BC12F0000701FCC9FC4801E0040314F84849EE007F4849171F91
+CB1207487313FC5B00FF855B86A56D60007F1BF86D60A26C6D4D13F06E5F6C6D4D13E06C
+6D4D13C06C01FC94B512806C01FF04031400C602C0030F13FC6D01F8037F5B011FD9FFE0
+011FB512E0010791B8128001014EC7FC6D6C17F8020F17C0DA007F03F8C8FC03014AC9FC
+58727BCE61>103 D<903801FFFCB6FCA8C67E131F7FB3AD95380FFFE095B512FE05036E
+7E050F15E0053F15F84D81932701FFF01F7F4CD900077FDC07FC6D80DC0FF06D80DC1FC0
+7F4C48824CC8FC047E6F7F5EEDFDF85E03FF707F5EA25EA25EA293C9FCA45DB3B3A6B8D8
+E003B81280A8617879F76C>I<EB01FCEB07FF011F13C0497F497F90B57EA24880A24880
+A76C5CA26C5CA26D5B6D5B6D5B010790C8FCEB01FC90CAFCB2903801FFFC007FB5FCA8C6
+7E131F7FB3B3B3A5B81280A8297979F835>I<EE01FCEE07FF041F13C04C13E04C13F093
+B512F8A24B14FCA24B14FEA76F14FCA26F14F8A27013F07013E07013C004071300EE01FC
+93C8FCB2EFFFFE92B6FCA8ED003F160F82B3B3B3B3A3EA01FCEA07FF487F487F487F486D
+15FC5EB57EA218F85E18F018E05E6C494913C018804A90B512006C4A5B6C49485B6CD9E0
+1F5B6C90B612E06C5EC693C7FC013F14F8010F14C09026007FFCC8FC379B8BF83B>I<90
+3801FFFCB6FCA8C67E131F7FB3AE0603B612FEA8DE001F01F8C7FC070713804F90C8FCF1
+3FFE4F5AF1FFF04E5B4E5B4E5B061F90C9FC4E5AF07FF84E5A4D5B05075B4D5B4D48CAFC
+4D5A4D5A4D5A04035B4C7F4C7F5E4C7F4C7F03FDB6FC92B7FC858585A204F98004E0804C
+804C7E4C6C7F4B6D7F4B824B7F7180718086837180727F8684727F728087847280728087
+84737F737F87854F14C0B8D88007B712F0A85C787AF766>I<902601FFF891260FFFE093
+383FFF80B692B500FE0303B512F805036E6C020F14FE050F03E0023F6E7E053F03F891B7
+12E04D6F4982932701FFF01F6D0107D9C07F7F4CD900076D90270FFC001F7FDC07FC6D91
+26801FF06D7FC66CDA0FF06D9126C03FC06D7F011FDA1FC06D4BC77E6D4A48DCE0FE834C
+C8ECE1FC047E6FD9F1F86E804CEFF3F0DBF9F8EFF7E04C6003FB7001FF6F804C6015FF4C
+95C9FCA24C5FA293C95CA44B60B3B3A6B8D8E003B8D8800FB712FEA8974E79CDA2>109
+D<902601FFF891380FFFE0B692B512FE05036E7E050F15E0053F15F84D81932701FFF01F
+7F4CD900077FDC07FC6D80C66CDA0FF06D80011FDA1FC07F6D4A48824CC8FC047E6F7F5E
+EDF9F85E03FB707F5E15FF5EA25EA293C9FCA45DB3B3A6B8D8E003B81280A8614E79CD6C
+>I<93381FFFE00303B6FC031F15E092B712FC020316FF020F17C0023FD9FC0014F091B5
+00C0010F13FC4991C700037F4901FC02007F010F496F13C049496F7F49496F7F4B814949
+6F7F90B5C96C7F4886A24849707F481B80A248497014C0A2481BE0A348497113F0A3481B
+F8A5B51AFCAE6C1BF8A46C1BF06E94B5FCA36C1BE0A26C6D4C14C0A26C1B806E5E6C1B00
+6C6E4B5BA26C6E4B5B6D6D4B5B6D6D4B5B6D6D4B5B6D6D92B55A6D01FF02035C6D02C001
+0F91C7FC010002FC90B512FC6E90B75A021F17E00207178002014CC8FCDA003F15F00303
+92C9FCDB001F13E056507BCE61>I<902601FFF8EB07FEB691383FFFC094B512F0040380
+4C14FE4C8093261FFC3F138093263FE07F13C0DC7F80B5FCC66C5D011FDAFE0114E06DEB
+F9FC16F815FB16F016E015FF16C07114C05E72138095381FFE0093C76C5AF001E095C8FC
+A25DA65DB3B3A2B812F8A8434E7ACD4F>114 D<912603FFFCEB0780027F9039FFE00FC0
+0103B6EAF83F010FEDFEFF013F92B5FC49EB000F2601FFF01300480180143F4890C8120F
+4848814848814981123F83485A187FA212FF6D163FA37F7F6DEE1F8002C092C7FC14F014
+FEECFFF06CECFF8016FEEEFFE06C16FC6C16FF18C06C836C17F86C836C836C83013F1780
+6D17C0010717E0010117F0EB003F020716F8EC001F030015FC1607EE007F051F13FE1707
+007E82B482836D167FA2183F7F181FA27F19FC7FA26D163F6D17F86D167F19F06D16FF6E
+4A13E002E04A13C06E4A138002FE023F1300913AFFC003FFFE01E790B65A01C316F00180
+16C026FE003F92C7FC48010714F80070D9007F90C8FC3F507ACE4C>I<15FFA75CA55CA4
+5CA25CA25CA25CA25C91B5FCA25B5B5B131F5B90B9FC120FBAFCA6D8000791C9FCB3B3A3
+F01FE0AE183F7014C07F187F7014806D16FF826D4B13006E6D485AEEFE0F6E90B55A020F
+5D6E5D020115C06E6C5C031F49C7FC030113F03B6E7CEC4B>I<DAFFFE933803FFF8B603
+03B6FCA8C66CEE0001011F717E6D84B3B3A862A497B5FCA261A2616D5F1ADF6F150F6DEF
+1F9F073F806D6EDA7F1F13FF6D6ED901FEEDFF8070EB07FC023F01FEEB3FF86E90B612F0
+6E16C0020316800200EDFE00031F14F80300028003C0C7FC614F79CD6C>I<B7D8FE01B7
+00F00103B612E0A8D8003F01FCC8003F01E0C80007EBE0006D0B0090C7FC6F6F6D5DA26D
+666F6F6D15036D66701A07737F6D667070150F6D4D60701A1F876D4D607071143F6E4C60
+701A7F886E4C607003BF6D14FF6E04FF95C8FC6670031F7F6E4B60704A6C6D130318036E
+640580496C6D13076E03076005C0180F4F6C7F6E030F6005E0496C6D131F6E031F6005F0
+183F4F6C14806F023F6005F8496DEBC07F6F027F6005FC18FF4F6D7F6F02FF95C9FC7190
+C76C13F16F90B55F1DF34E6E13FB6F624E6E13FFA26F624E806F62A24E806F624E807061
+A24E8170614E817096CAFCA295C97E70604D160F0407604D16077048705A834E7CCC8C>
+119 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fx cmr10 10 1
+/Fx 1 112 df<EB03FE90380FFF8090383E03E09038F800F84848137C48487F48487F48
+48EB0F80001F15C090C712074815E0A2007EEC03F0A400FE15F8A9007E15F0A2007F1407
+6C15E0A26C6CEB0FC0000F15806D131F6C6CEB3F006C6C137EC66C13F890387E03F09038
+1FFFC0D903FEC7FC25277EA52A>111 D E
+%EndDVIPSBitmapFont
+end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+%%BeginPaperSize: a4
+a4
+%%EndPaperSize
+
+%%EndSetup
+%%Page: 1 1
+1 0 bop 316 83 a Fx(o)150 1112 y Fw(The)64 b(DejaGn)-5
+b(u)65 b(T)-16 b(esting)65 b(F)-16 b(ramew)-5 b(ork)p
+150 1212 3600 34 v 2787 1308 a Fv(for)31 b(DejaGn)m(u)g(V)-8
+b(ersion)30 b(1.3)3395 1525 y(Jan)g(1996)150 5068 y Fu(Rob)45
+b(Sa)l(v)l(o)l(y)l(e)p 150 5141 3600 17 v eop
+%%Page: 2 2
+2 1 bop 3105 408 a Fv(Cygn)m(us)30 b(Supp)s(ort)150 4480
+y(Cop)m(yrigh)m(t)602 4477 y(c)577 4480 y Ft(\015)g Fv(92,)i(93,)f(94,)
+h(95,)f(1996)h(F)-8 b(ree)32 b(Soft)m(w)m(are)f(F)-8
+b(oundation,)30 b(Inc.)150 4615 y(P)m(ermission)g(is)i(gran)m(ted)h(to)
+f(mak)m(e)i(and)d(distribute)f(v)m(erbatim)i(copies)g(of)g(this)f(man)m
+(ual)h(pro)m(vided)f(the)150 4725 y(cop)m(yrigh)m(t)g(notice)f(and)g
+(this)f(p)s(ermission)f(notice)i(are)h(preserv)m(ed)f(on)h(all)e
+(copies.)150 4859 y(P)m(ermission)36 b(is)i(gran)m(ted)g(to)h(cop)m(y)g
+(and)f(distribute)e(mo)s(di\014ed)g(v)m(ersions)h(of)i(this)e(man)m
+(ual)g(under)g(the)150 4969 y(conditions)j(for)i(v)m(erbatim)g(cop)m
+(ying,)j(pro)m(vided)40 b(also)i(that)h(the)f(en)m(tire)g(resulting)e
+(deriv)m(ed)h(w)m(ork)h(is)150 5078 y(distributed)27
+b(under)i(the)i(terms)f(of)h(a)f(p)s(ermission)e(notice)i(iden)m(tical)
+f(to)j(this)d(one.)150 5213 y(P)m(ermission)i(is)i(gran)m(ted)g(to)h
+(cop)m(y)g(and)f(distribute)d(translations)i(of)i(this)e(man)m(ual)g
+(in)m(to)h(another)g(lan-)150 5322 y(guage,)f(under)d(the)h(ab)s(o)m(v)
+m(e)i(conditions)d(for)h(mo)s(di\014ed)e(v)m(ersions.)p
+eop
+%%Page: 1 3
+1 2 bop 150 -116 a Fv(Chapter)30 b(1:)41 b(What)31 b(is)e(DejaGn)m(u?)
+2349 b(1)150 100 y Fs(1)80 b(What)54 b(is)g(DejaGn)l(u?)275
+334 y Fv(DejaGn)m(u)35 b(is)e(a)i(framew)m(ork)g(for)f(testing)h(other)
+g(programs.)53 b(Its)34 b(purp)s(ose)f(is)g(to)j(pro)m(vide)d(a)i
+(single)150 443 y(fron)m(t)30 b(end)g(for)g(all)g(tests.)41
+b(Bey)m(ond)31 b(this,)f(DejaGn)m(u)h(o\013ers)f(sev)m(eral)h(adv)-5
+b(an)m(tages)32 b(for)f(testing:)199 578 y(1.)61 b(The)32
+b(\015exibilit)m(y)e(and)i(consistency)h(of)g(the)g(DejaGn)m(u)g
+(framew)m(ork)g(mak)m(e)h(it)e(easy)i(to)f(write)f(tests)330
+687 y(for)e(an)m(y)h(program.)199 822 y(2.)61 b(DejaGn)m(u)21
+b(pro)m(vides)f(a)h(la)m(y)m(er)g(of)g(abstraction)g(whic)m(h)e(allo)m
+(ws)h(y)m(ou)h(to)g(write)f(tests)i(that)f(are)g(p)s(ortable)330
+932 y(to)35 b(an)m(y)f(host)g(or)g(target)h(where)f(a)g(program)g(m)m
+(ust)g(b)s(e)f(tested.)52 b(F)-8 b(or)35 b(instance,)g(a)f(test)h(for)f
+(GDB)330 1041 y(can)26 b(run)e(\(from)i(an)m(y)g(Unix)f(based)g(host\))
+h(on)g(an)m(y)g(target)h(arc)m(hitecture)g(that)f(DejaGn)m(u)h(supp)s
+(orts.)330 1151 y(Curren)m(tly)d(DejaGn)m(u)j(runs)d(tests)j(on)f(sev)m
+(eral)g(single)f(b)s(oard)g(computers,)i(whose)f(op)s(erating)f(soft-)
+330 1260 y(w)m(are)31 b(ranges)f(from)g(just)g(a)h(b)s(o)s(ot)f
+(monitor)g(to)h(a)g(full-\015edged,)d(Unix-lik)m(e)h(realtime)h(OS.)199
+1395 y(3.)61 b(All)36 b(tests)j(ha)m(v)m(e)g(the)f(same)g(output)f
+(format.)63 b(This)36 b(mak)m(es)j(it)e(easy)i(to)f(in)m(tegrate)h
+(testing)f(in)m(to)330 1504 y(other)c(soft)m(w)m(are)i(dev)m(elopmen)m
+(t)e(pro)s(cesses.)51 b(DejaGn)m(u's)35 b(output)f(is)f(designed)g(to)h
+(b)s(e)g(parsed)f(b)m(y)330 1614 y(other)e(\014ltering)d(script,)i(and)
+g(it)f(is)h(also)g(h)m(uman)g(readable.)275 1773 y(DejaGn)m(u)h(is)e
+(written)h(in)f Fr(expect)p Fv(,)g(whic)m(h)g(in)g(turn)g(uses)h
+Fq(Tcl)p Fv(|T)-8 b(o)s(ol)29 b(command)h(language.)275
+1908 y(Running)21 b(tests)k(requires)d(t)m(w)m(o)k(things:)36
+b(the)24 b(testing)g(framew)m(ork,)i(and)d(the)h(test)h(suites)e
+(themselv)m(es.)150 2017 y(T)-8 b(ests)35 b(are)g(usually)d(written)i
+(in)f Fr(expect)g Fv(using)g(Tcl,)i(but)f(y)m(ou)h(can)g(also)g(use)f
+(a)h(Tcl)f(script)f(to)i(run)f(a)150 2127 y(test)f(suite)f(that)g(is)g
+(not)g(based)g(on)g Fr(expect)p Fv(.)44 b(\()p Fr(expect)31
+b Fv(script)g(\014lenames)g(con)m(v)m(en)m(tionally)i(use)f(`)p
+Fr(.exp)p Fv(')150 2237 y(as)h(a)g(su\016x;)g(for)g(example,)g(the)g
+(main)f(implemen)m(tation)f(of)i(the)g(DejaGn)m(u)h(test)f(driv)m(er)f
+(is)f(in)h(the)h(\014le)150 2346 y(`)p Fr(runtest.exp)p
+Fv('.\))p eop
+%%Page: 2 4
+2 3 bop 150 -116 a Fv(2)2409 b(DejaGn)m(u)32 b(T)-8 b(esting)30
+b(F)-8 b(ramew)m(ork)p eop
+%%Page: 3 5
+3 4 bop 150 -116 a Fv(Chapter)30 b(2:)41 b(What)31 b(is)e(new)h(in)f
+(this)h(release)g(?)1937 b(3)150 100 y Fs(2)80 b(What)54
+b(is)g(new)f(in)h(this)g(release)f(?)275 334 y Fv(This)39
+b(release)i(has)f(a)h(n)m(um)m(b)s(er)f(of)h(substan)m(tial)f(c)m
+(hanges)h(o)m(v)m(er)i(v)m(ersion)d(1.2.)73 b(The)40
+b(most)h(visible)150 443 y(c)m(hange)29 b(is)f(that)h(the)f(v)m(ersion)
+g(of)g(exp)s(ect)h(and)f(Tcl)f(included)f(in)h(the)h(release)h(are)f
+(up-to-date)i(with)d(the)150 553 y(curren)m(t)j(stable)g(net)h
+(releases.)41 b(Other)30 b(c)m(hanges)h(are:)199 687
+y(1.)61 b(The)35 b(con\014g)h(sub-system)f(in)f(DejaGn)m(u)j(has)e(b)s
+(een)g(completely)g(redesigned.)55 b(It)36 b(no)m(w)g(supp)s(orts)330
+797 y(testing)30 b(on)h(remote)g(hosts)f(as)h(w)m(ell)e(as)i(remote)g
+(targets.)199 932 y(2.)61 b(More)23 b(builtin)c(supp)s(ort)h(for)i
+(building)d(target)24 b(binaries)c(with)h(the)h(correct)i(link)m(er)c
+(\015ags.)39 b(Curren)m(tly)330 1041 y(this)29 b(only)h(w)m(orks)g
+(with)f(GCC,)h(preferably)f(with)g(a)i(target)h(supp)s(ort)d(b)m(y)h
+Fr(libgloss)p Fv(.)199 1176 y(3.)61 b(Lots)31 b(of)f(little)f(bug)h
+(\014xes)g(from)g(a)h(y)m(ear)g(of)g(hea)m(vy)g(use)f(here)g(at)h(Cygn)
+m(us)f(Supp)s(ort.)199 1310 y(4.)61 b(DejaGn)m(u)31 b(no)m(w)g(uses)f
+Fr(autoconf)e Fv(for)i(con\014guration.)199 1445 y(5.)61
+b(New)38 b(test)g(cases)h(for)e(DejaGn)m(u)h(ha)m(v)m(e)h(b)s(een)e
+(added)g(for)g(the)h(new)f(features,)j(plus)35 b(the)j
+Fr(")p Fv({to)s(ol)p Fr(")330 1554 y Fv(option)30 b(bug)g(in)f(the)h
+(1.2)i(testsuite)e(has)g(b)s(een)g(\014xed.)199 1689
+y(6.)61 b(The)30 b Fr(--tool)f Fv(option)g(is)h(no)m(w)g(optional.)199
+1823 y(7.)61 b Fr(runtest)26 b Fv(when)g(searc)m(hing)i(for)f(test)i
+(driv)m(ers)d(ignores)h(all)f(directories)h(named)g(SCCS,)f(R)m(CS,)i
+(and)330 1933 y(CVS.)199 2067 y(8.)61 b(There)30 b(is)f(no)m(w)h(a)h
+(generic)f(k)m(eyw)m(ord)h(based)e(test)j(harness)d(that)i(uses)e
+(commen)m(ts)i(in)e(source)i(co)s(de)330 2177 y(to)g(con)m(trol)g(ho)m
+(w)f(eac)m(h)i(test)f(case)h(gets)f(built)d(and)i(run.)199
+2311 y(9.)61 b(There)30 b(is)f(no)m(w)i(some)f(supp)s(ort)f(for)h
+(running)e(a)j(testsuite)f(with)f(m)m(ultiple)f(passes.)150
+2569 y Fu(2.1)68 b(Running)45 b(existing)h(tests)275
+2761 y Fv(T)-8 b(o)25 b(run)e(tests)j(from)e(an)h(existing)e
+(collection,)j(\014rst)e(use)h Fr(configure)d Fv(as)j(usual)e(to)j(set)
+f(up)f(the)h(source)150 2871 y(directory)30 b(con)m(taining)g(the)g
+(tests.)42 b(Then)29 b(try)h(running)390 3000 y Fr(make)47
+b(check)275 3134 y Fv(If)29 b(the)h Fr(check)e Fv(target)j(exists,)f
+(it)f(usually)e(sa)m(v)m(es)k(y)m(ou)f(some)g(trouble|for)f(instance,)h
+(it)f(can)h(set)g(up)150 3244 y(an)m(y)h(auxiliary)d(programs)i(or)g
+(other)h(\014les)e(needed)h(b)m(y)g(the)h(tests.)275
+3378 y(Once)e(y)m(ou)i(ha)m(v)m(e)g(run)e(`)p Fr(make)g(check)p
+Fv(')g(to)i(build)c(an)m(y)j(auxiliary)e(\014les,)h(y)m(ou)h(migh)m(t)g
+(w)m(an)m(t)h(to)f(call)g(the)150 3488 y(test)e(driv)m(er)d
+Fr(runtest)g Fv(directly)h(to)h(rep)s(eat)g(the)g(tests.)40
+b(Y)-8 b(ou)28 b(ma)m(y)f(also)g(ha)m(v)m(e)h(to)f(call)f
+Fr(runtest)f Fv(directly)150 3597 y(for)30 b(test)h(collections)f(with)
+f(no)i Fr(check)e Fv(target)j(in)d(the)h(`)p Fr(Makefile)p
+Fv('.)p eop
+%%Page: 4 6
+4 5 bop 150 -116 a Fv(4)2409 b(DejaGn)m(u)32 b(T)-8 b(esting)30
+b(F)-8 b(ramew)m(ork)275 83 y(T)m(ypically)g(,)39 b(y)m(ou)g(m)m(ust)f
+(use)h(t)m(w)m(o)h(command-line)d(options:)56 b(`)p Fr(--tool)p
+Fv(',)40 b(to)f(sp)s(ecify)e(whic)m(h)h(set)h(of)150
+193 y(tests)31 b(to)g(run)612 160 y Fp(1)648 193 y Fv(,)g(and)e(`)p
+Fr(--srcdir)p Fv(',)g(to)i(sp)s(ecify)e(where)h(to)h(\014nd)e(test)j
+(directories.)275 327 y(F)-8 b(or)27 b(example,)h(if)d(the)i(directory)
+g(`)p Fr(gdb/testsuite)p Fv(')c(con)m(tains)k(a)h(collection)e(of)h
+(DejaGn)m(u)h(tests)f(for)150 437 y Fo(gdb)p Fv(,)j(y)m(ou)h(can)g(run)
+e(them)h(lik)m(e)g(this:)390 565 y Fr(eg$)47 b(cd)g(gdb/testsuite)390
+669 y(eg$)g(runtest)f(--tool)g(gdb)150 773 y Fn(T)-7
+b(est)33 b(output)g(fol)5 b(lows,)34 b(ending)f(with:)390
+980 y Fr(===)47 b(gdb)g(Summary)f(===)390 1188 y(#)h(of)h(expected)d
+(passes)h(508)390 1292 y(#)h(of)h(expected)d(failures)h(103)390
+1396 y(/usr/latest/bin/gdb)d(version)i(4.14.4)h(-nx)275
+1530 y Fv(Y)-8 b(ou)20 b(can)h(use)f(the)h(option)e(`)p
+Fr(--srcdir)p Fv(')g(to)i(p)s(oin)m(t)e(to)i(some)g(other)g(directory)f
+(con)m(taining)g(a)g(collection)150 1640 y(of)31 b(tests:)390
+1768 y Fr(eg$)47 b(runtest)f(--tool)g(gdb)h(--srcdir)e
+(/devo/gdb/testsuite)275 1903 y Fv(These)d(examples)g(assume)h(a)g
+Fq(nativ)m(e)48 b Fv(con\014guration,)d(where)d(the)h(same)g(computer)g
+(runs)e(b)s(oth)150 2012 y Fr(runtest)31 b Fv(and)h(the)h(tests)h
+(themselv)m(es.)48 b(When)33 b(y)m(ou)g(ha)m(v)m(e)h(a)f
+Fq(cross)k Fv(con\014guration,)c(the)g(tests)h(run)d(on)150
+2122 y(a)j(di\013eren)m(t)f(computer,)h(con)m(trolled)f(b)m(y)g(the)h
+(host)f(running)e Fr(runtest)p Fv(.)47 b(In)33 b(this)f(situation,)h(y)
+m(ou)h(need)150 2232 y(the)d(option)e(`)p Fr(--name)p
+Fv(')h(to)h(sp)s(ecify)e(the)h(net)m(w)m(ork)h(address)f(for)g(the)h
+(other)f(computer:)390 2360 y Fr(eg$)47 b(runtest)f(--tool)g(gdb)h
+(--name)f(vx9.munist.com)275 2495 y Fv(If)24 b(y)m(ou)h(alw)m(a)m(ys)g
+(use)f(the)h(same)g(option)f(v)-5 b(alues,)25 b(y)m(ou)g(can)g(record)g
+(them)g(in)e(a)i(\014le)f(called)f(`)p Fr(site.exp)p
+Fv(',)150 2604 y(rather)33 b(than)g(t)m(yping)f(them)h(eac)m(h)h(time.)
+48 b(See)34 b(Chapter)e(4)h([Setting)g(defaults)f(for)h
+Fr(runtest)e Fv(options],)150 2714 y(page)g(15.)275 2848
+y(By)36 b(default,)g Fr(runtest)e Fv(prin)m(ts)g(only)h(the)h(names)f
+(of)h(the)g(tests)h(it)e(runs,)h(output)f(from)g(an)m(y)h(tests)150
+2958 y(that)41 b(ha)m(v)m(e)g(unexp)s(ected)e(results,)j(and)d(a)i
+(summary)e(sho)m(wing)g(ho)m(w)h(man)m(y)g(tests)h(passed)e(and)h(ho)m
+(w)150 3068 y(man)m(y)26 b(failed.)38 b(T)-8 b(o)26 b(displa)m(y)e
+(output)h(from)h(all)e(tests)j(\(whether)e(or)h(not)g(they)g(b)s(eha)m
+(v)m(e)g(as)h(exp)s(ected\),)g(use)150 3177 y(the)36
+b(`)p Fr(--all)p Fv(')f(option.)56 b(F)-8 b(or)37 b(more)f(v)m(erb)s
+(ose)g(output)f(ab)s(out)g(pro)s(cesses)h(b)s(eing)e(run,)i(comm)m
+(unication,)150 3287 y(and)f(so)h(on,)h(use)e(`)p Fr(--verbose)p
+Fv('.)55 b(T)-8 b(o)36 b(see)g(ev)m(en)g(more)g(output,)h(use)e(m)m
+(ultiple)f(`)p Fr(--verbose)p Fv(')f(options.)150 3396
+y(See)j(Chapter)f(3)i([Using)e Fr(runtest)p Fv(],)h(page)g(9,)i(for)e
+(a)g(more)g(detailed)f(explanation)g(of)h(eac)m(h)h Fr(runtest)150
+3506 y Fv(option.)275 3641 y(T)-8 b(est)28 b(output)f(go)s(es)h(in)m
+(to)g(t)m(w)m(o)h(\014les)d(in)h(y)m(our)g(curren)m(t)h(directory:)38
+b(summary)27 b(output)g(in)f(`)p Fq(to)s(ol)p Fr(.sum)p
+Fv(',)150 3750 y(and)31 b(detailed)g(output)h(in)f(`)p
+Fq(to)s(ol)p Fr(.log)p Fv('.)45 b(\()p Fq(to)s(ol)35
+b Fv(refers)d(to)h(the)f(collection)f(of)i(tests;)g(for)f(example,)g
+(after)150 3860 y(a)37 b(run)e(with)g(`)p Fr(--tool)29
+b(gdb)p Fv(',)38 b(lo)s(ok)e(for)h(output)f(\014les)f(`)p
+Fr(gdb.sum)p Fv(')g(and)h(`)p Fr(gdb.log)p Fv('.\))59
+b(See)36 b(Section)h(5.7)150 3969 y([The)30 b(\014les)f(DejaGn)m(u)j
+(writes],)e(page)h(35.)p 150 4070 1200 4 v 192 4136 a
+Fp(1)275 4169 y Fv(`)p Fr(--tool)p Fv(')h(selects)j(a)f(particular)f
+(suite)g(of)h(tests,)i Fn(not)43 b Fv(the)34 b(name)g(of)h(the)f
+(executable)g(program)g(to)275 4279 y(run.)55 b(See)36
+b(Chapter)f(4)h([Con\014guration)f(dep)s(enden)m(t)f(v)-5
+b(alues],)37 b(page)g(15,)h(for)d(information)f(on)i(the)275
+4388 y(v)-5 b(ariables)29 b(that)i(y)m(ou)f(can)h(use)f(to)h(sp)s
+(ecify)e(the)i(names)f(of)g(programs)g(to)i(run.)p eop
+%%Page: 5 7
+5 6 bop 150 -116 a Fv(Chapter)30 b(2:)41 b(What)31 b(is)e(new)h(in)f
+(this)h(release)g(?)1937 b(5)150 83 y Fu(2.2)68 b(What)45
+b(do)t(es)g(a)g(DejaGn)l(u)h(test)f(lo)t(ok)h(lik)l(e?)275
+276 y Fv(Eac)m(h)32 b(DejaGn)m(u)i(test)f(is)e(an)h Fr(expect)f
+Fv(script;)h(the)h(tests)g(v)-5 b(ary)32 b(widely)e(in)h(complexit)m(y)
+-8 b(,)33 b(dep)s(ending)150 385 y(on)d(the)h(nature)f(of)g(the)h(to)s
+(ol)f(and)g(the)h(feature)g(tested.)275 520 y(Here)38
+b(is)e(a)i(v)m(ery)g(simple)d Fo(gdb)i Fv(test|one)i(of)f(the)f
+(simplest)f(tests)i(shipp)s(ed)d(with)h(DejaGn)m(u)i(\(ex-)150
+629 y(tracted)31 b(from)f(`)p Fr(gdb.t00/echo.exp)p Fv('\):)1556
+596 y Fp(2)150 713 y Fm(\013)p 200 713 3554 4 v 3553
+w(\010)p 150 1833 4 1072 v 178 866 a Fr(#)48 b(send)e(a)i(string)e(to)h
+(the)g(GDB)g(stdin:)178 970 y(send)g("echo)f(Hello)h(world!\\n")178
+1177 y(#)h(inspect)d(the)i(GDB)g(stdout)f(for)h(the)g(correct)f(reply,)
+178 1281 y(#)i(and)f(determine)e(whether)h(the)h(test)f(passes)g(or)h
+(fails:)178 1385 y(expect)f({)274 1489 y(-re)h("Hello)f(world.*$prompt)
+e($")190 b({)47 b(pass)g("Echo)f(test")h(})274 1593 y(-re)g("$prompt)e
+($")811 b({)47 b(fail)g("Echo)f(test")h(})274 1696 y(timeout)1191
+b({)47 b(fail)g("\(timeout\))e(Echo)i(test")f(})274 1800
+y(})p 3803 1833 V 150 1885 a Fm(\012)p 200 1885 3554
+4 v 3553 w(\011)275 2029 y Fv(Though)33 b(brief,)g(this)g(example)h(is)
+f(a)h(complete)h(test.)53 b(It)34 b(illustrates)e(some)i(of)g(the)h
+(main)e(features)150 2139 y(of)e(DejaGn)m(u)g(test)g(scripts:)225
+2274 y Ft(\017)60 b Fv(The)31 b(test)h(case)h(do)s(es)e(not)h(start)g
+(the)g(tested)g(program)f(\()p Fo(gdb)h Fv(in)e(this)g(case\);)k(all)c
+(test)j(scripts)d(for)330 2383 y(in)m(teractiv)m(e)h(to)s(ols)f(can)h
+(assume)f(the)h(corresp)s(onding)d(to)s(ol)i(is)g(running.)225
+2518 y Ft(\017)60 b Fv(Commen)m(ts)31 b(start)f(with)g(`)p
+Fr(#)p Fv('.)225 2652 y Ft(\017)60 b Fv(The)20 b(main)f(commands)h(y)m
+(ou)h(use)f(to)h(con)m(trol)g(a)f(tested)i(program)e(are)h
+Fr(send)e Fv(\(to)i(giv)m(e)g(it)f(commands\))330 2762
+y(and)30 b Fr(expect)e Fv(\(to)k(analyze)f(its)e(resp)s(onses\).)225
+2896 y Ft(\017)60 b Fv(The)33 b Fr(expect)e Fv(command)i(uses)g(a)h
+(list)d(of)j(pairs;)f(a)h(pattern)f(\(regular)g(expression)f(if)g(`)p
+Fr(-re)p Fv(')h(sp)s(ec-)330 3006 y(i\014ed\),)i(follo)m(w)m(ed)g(b)m
+(y)g(an)f(action)i(to)f(run)f(if)g(the)h(pattern)g(matc)m(hes)h(output)
+e(from)h(the)g(program.)330 3115 y(Only)29 b(the)h(action)h(for)f(the)h
+Fn(\014rst)39 b Fv(matc)m(hing)31 b(pattern)f(will)e(execute.)225
+3250 y Ft(\017)60 b Fv(T)-8 b(est)31 b(cases)g(use)f(the)h(commands)f
+Fr(pass)f Fv(and)h Fr(fail)f Fv(to)i(record)g(the)f(test)h(outcome.)150
+3507 y Fu(2.3)68 b(Design)46 b(goals)275 3700 y Fv(DejaGn)m(u)d(grew)f
+(out)h(of)f(the)h(in)m(ternal)e(needs)h(of)g(Cygn)m(us)g(Supp)s(ort.)75
+b(Cygn)m(us)41 b(main)m(tains)h(and)150 3809 y(enhances)24
+b(a)g(v)-5 b(ariet)m(y)24 b(of)f(free)h(programs)f(in)g(man)m(y)h
+(di\013eren)m(t)f(en)m(vironmen)m(ts,)h(and)f(w)m(e)h(needed)g(a)g
+(testing)150 3919 y(to)s(ol)30 b(that:)225 4054 y Ft(\017)60
+b Fv(is)29 b(useful)g(to)i(dev)m(elop)s(ers)f(while)e(\014xing)h(bugs;)
+225 4188 y Ft(\017)60 b Fv(automates)32 b(running)c(man)m(y)i(tests)h
+(during)d(a)j(soft)m(w)m(are)h(release)f(pro)s(cess;)225
+4323 y Ft(\017)60 b Fv(is)29 b(p)s(ortable)h(among)h(a)f(v)-5
+b(ariet)m(y)31 b(of)g(host)f(computers;)225 4457 y Ft(\017)60
+b Fv(supp)s(orts)28 b(cross-dev)m(elopmen)m(t)k(testing;)225
+4591 y Ft(\017)60 b Fv(p)s(ermits)29 b(testing)h(in)m(teractiv)m(e)h
+(programs,)g(lik)m(e)e Fo(gdb)p Fv(;)i(and)225 4726 y
+Ft(\017)60 b Fv(p)s(ermits)29 b(testing)h(batc)m(h)h(orien)m(ted)f
+(programs,)h(lik)m(e)e Fo(gcc)p Fv(.)p 150 4822 1200
+4 v 192 4888 a Fp(2)275 4921 y Fv(More)42 b(recen)m(t)h
+Fo(gdb)f Fv(tests)h(use)e(the)h(`)p Fr(gdb_test)p Fv(')f(pro)s(cedure.)
+74 b(An)42 b(equiv)-5 b(alen)m(t)41 b(test)i(using)d(that)275
+5031 y(pro)s(cedure)29 b(is)g(`)i Fr(gdb_test)d("echo)h(Hello)g
+(world!")f("Hello)h(world!")f Fv(')p eop
+%%Page: 6 8
+6 7 bop 150 -116 a Fv(6)2409 b(DejaGn)m(u)32 b(T)-8 b(esting)30
+b(F)-8 b(ramew)m(ork)275 83 y(Some)28 b(of)g(the)h(requiremen)m(ts)e
+(pro)m(v)m(ed)i(c)m(hallenging.)39 b(F)-8 b(or)29 b(example,)f(in)m
+(teractiv)m(e)i(programs)d(do)i(not)150 193 y(lend)35
+b(themselv)m(es)h(v)m(ery)h(w)m(ell)e(to)i(automated)h(testing.)58
+b(But)37 b(all)e(the)h(requiremen)m(ts)g(are)h(imp)s(ortan)m(t:)150
+302 y(for)29 b(instance,)g(it)g(is)f(imp)s(erativ)m(e)g(to)h(mak)m(e)h
+(sure)f(that)g Fo(gdb)g Fv(w)m(orks)g(as)g(w)m(ell)f(when)g
+(cross-debugging)h(as)150 412 y(it)h(do)s(es)g(in)f(a)i(nativ)m(e)g
+(con\014guration.)275 546 y(Probably)d(the)i(greatest)i(c)m(hallenge)e
+(w)m(as)g(testing)g(in)f(a)h(cross-dev)m(elopmen)m(t)h(en)m(vironmen)m
+(t)f(\(whic)m(h)150 656 y(can)38 b(b)s(e)e(a)i(real)f(nigh)m(tmare\).)
+62 b(Most)38 b(cross-dev)m(elopmen)m(t)h(en)m(vironmen)m(ts)d(are)i
+(customized)f(b)m(y)h(eac)m(h)150 765 y(dev)m(elop)s(er.)60
+b(Ev)m(en)38 b(when)e(buying)f(pac)m(k)-5 b(aged)39 b(b)s(oards)d(from)
+g(v)m(endors)h(there)h(are)f(man)m(y)g(di\013erences.)150
+875 y(The)e(comm)m(unication)g(in)m(terfaces)g(v)-5 b(ary)36
+b(from)f(a)g(serial)f(line)g(to)i(ethernet.)56 b(DejaGn)m(u)36
+b(w)m(as)g(designed)150 985 y(with)e(a)j(mo)s(dular)c(comm)m(unication)
+i(setup,)i(so)f(that)h(eac)m(h)g(kind)c(of)j(comm)m(unication)g(can)g
+(b)s(e)f(added)150 1094 y(as)30 b(required,)e(and)h(supp)s(orted)e
+(thereafter.)42 b(Once)29 b(a)h(comm)m(unication)f(pro)s(cedure)f(is)h
+(co)s(ded,)g(an)m(y)h(test)150 1204 y(can)h(use)f(it.)41
+b(Curren)m(tly)29 b(DejaGn)m(u)i(can)g(use)f Fr(rsh)p
+Fv(,)g Fr(rlogin)p Fv(,)f Fr(telnet)p Fv(,)g Fr(tip)p
+Fv(,)h Fr(kermit)p Fv(,)f(and)h Fr(mondfe)f Fv(for)150
+1313 y(remote)i(comm)m(unications.)275 1448 y(Julia)20
+b(Menapace)j(\014rst)f(coined)f(the)i(term)f(\\Deja)i(Gn)m(u")e(to)h
+(describ)s(e)d(an)i(earlier)g(testing)g(framew)m(ork)150
+1557 y(at)40 b(Cygn)m(us)e(Supp)s(ort.)64 b(When)38 b(w)m(e)i(replaced)
+e(it)g(with)g(the)h(Exp)s(ect-based)g(framew)m(ork,)i(it)d(w)m(as)i
+(lik)m(e)150 1667 y(DejaGn)m(u)31 b(all)e(o)m(v)m(er)j(again)6
+b(.)22 b(.)g(.)150 1924 y Fu(2.4)68 b(A)44 b(POSIX)h(conforming)g(test)
+h(framew)l(ork)275 2117 y Fv(DejaGn)m(u)31 b(conforms)f(to)h(the)g
+Fo(posix)e Fv(standard)h(for)g(test)h(framew)m(orks.)275
+2252 y Fo(posix)j Fv(standard)h(1003.3)j(de\014nes)d(what)g(a)h
+(testing)g(framew)m(ork)g(needs)f(to)h(pro)m(vide,)h(in)d(order)h(to)
+150 2361 y(p)s(ermit)23 b(the)i(creation)g(of)g Fo(posix)f
+Fv(conformance)h(test)h(suites.)38 b(This)23 b(standard)h(is)f
+(primarily)f(orien)m(ted)i(to)150 2471 y(running)k Fo(posix)i
+Fv(conformance)h(tests,)h(but)d(its)h(requiremen)m(ts)g(also)h(supp)s
+(ort)d(testing)j(of)g(features)g(not)150 2580 y(related)22
+b(to)h Fo(posix)f Fv(conformance.)38 b Fo(posix)22 b
+Fv(1003.3)j(do)s(es)d(not)g(sp)s(ecify)f(a)i(particular)d(testing)j
+(framew)m(ork,)150 2690 y(but)30 b(at)h(this)e(time)h(there)h(is)e
+(only)h(one)g(other)h Fo(posix)f Fv(conforming)f(test)i(framew)m(ork:)
+41 b Fo(tet)p Fv(.)3320 2657 y Fp(3)275 2824 y Fv(The)26
+b Fo(posix)h Fv(do)s(cumen)m(tation)g(refers)f(to)i Fq(assertions)p
+Fv(.)40 b(An)26 b(assertion)h(is)f(a)i(description)d(of)j(b)s(eha)m
+(vior.)150 2934 y(F)-8 b(or)41 b(example,)j(if)39 b(a)i(standard)f(sa)m
+(ys)h(\\The)g(sun)e(shall)g(shine",)j(a)f(corresp)s(onding)e(assertion)
+h(migh)m(t)150 3044 y(b)s(e)c(\\The)h(sun)f(is)g(shining.")58
+b(A)37 b(test)g(based)g(on)g(this)f(assertion)g(w)m(ould)g(pass)g(or)h
+(fail)f(dep)s(ending)e(on)150 3153 y(whether)d(it)f(is)g(da)m(ytime)i
+(or)f(nigh)m(ttime.)42 b(It)32 b(is)e(imp)s(ortan)m(t)g(to)i(note)g
+(that)g(the)f(standard)f(b)s(eing)g(tested)150 3263 y(is)g(nev)m(er)h
+(1003.3;)i(the)e(standard)f(b)s(eing)g(tested)h(is)f(some)h(other)g
+(standard,)f(for)h(whic)m(h)e(the)i(assertions)150 3372
+y(w)m(ere)g(written.)275 3507 y(As)g(there)g(is)g(no)g(test)h(suite)e
+(to)i(test)h Fn(testing)g(fr)-5 b(ameworks)41 b Fv(for)31
+b Fo(posix)g Fv(1003.3)j(conformance,)e(v)m(eri-)150
+3616 y(fying)c(conformance)i(to)h(this)d(standard)h(is)f(done)h(b)m(y)h
+(rep)s(eatedly)e(reading)h(the)h(standard)e(and)h(exp)s(eri-)150
+3726 y(men)m(ting.)40 b(One)28 b(of)h(the)g(main)f(things)f(1003.3)32
+b(do)s(es)c(sp)s(ecify)g(is)f(the)i(set)h(of)f(allo)m(w)m(ed)f(output)h
+(messages,)150 3836 y(and)39 b(their)g(de\014nitions.)66
+b(F)-8 b(our)41 b(messages)f(are)g(supp)s(orted)e(for)i(a)g(required)e
+(feature)i(of)g Fo(posix)f Fv(con-)150 3945 y(forming)g(systems,)k(and)
+c(a)i(\014fth)e(for)h(a)h(conditional)d(feature.)71 b(DejaGn)m(u)41
+b(supp)s(orts)d(the)j(use)f(of)g(all)150 4055 y(\014v)m(e)h(output)f
+(messages;)46 b(in)40 b(this)f(sense)h(a)h(test)h(suite)d(that)i(uses)f
+(exactly)i(these)e(messages)i(can)f(b)s(e)150 4164 y(considered)29
+b Fo(posix)h Fv(conforming.)40 b(These)30 b(de\014nitions)e(sp)s(ecify)
+h(the)h(output)g(of)h(a)g(test)g(case:)150 4399 y Fr(PASS)288
+b Fv(A)30 b(test)i(has)e(succeeded.)41 b(That)30 b(is,)g(it)g
+(demonstrated)g(that)h(the)g(assertion)f(is)f(true.)150
+4583 y Fr(XFAIL)240 b Fo(posix)41 b Fv(1003.3)k(do)s(es)d(not)g(incorp)
+s(orate)g(the)g(notion)g(of)g(exp)s(ected)h(failures,)g(so)g
+Fr(PASS)p Fv(,)630 4692 y(instead)32 b(of)h Fr(XPASS)p
+Fv(,)g(m)m(ust)f(also)h(b)s(e)g(returned)e(for)i(test)h(cases)g(whic)m
+(h)d(w)m(ere)j(exp)s(ected)f(to)630 4802 y(fail)24 b(and)h(did)e(not.)
+40 b(This)23 b(means)i(that)h Fr(PASS)e Fv(is)h(in)f(some)i(sense)f
+(more)g(am)m(biguous)g(than)g(if)630 4912 y Fr(XPASS)j
+Fv(is)g(also)h(used.)40 b(F)-8 b(or)30 b(information)d(on)i
+Fr(XPASS)f Fv(and)g Fr(XFAIL)p Fv(,)h(see)g(Chapter)g(3)g([Using)630
+5021 y Fr(runtest)p Fv(],)g(page)i(9.)p 150 5122 1200
+4 v 192 5188 a Fp(3)275 5221 y Fo(tet)d Fv(w)m(as)h(created)h(b)m(y)f
+(Unisoft)f(for)h(a)g(consortium)f(comprised)g(of)h(X/Op)s(en,)g(Unix)e
+(In)m(ternational,)275 5331 y(and)i(the)i(Op)s(en)e(Soft)m(w)m(are)i(F)
+-8 b(oundation.)p eop
+%%Page: 7 9
+7 8 bop 150 -116 a Fv(Chapter)30 b(2:)41 b(What)31 b(is)e(new)h(in)f
+(this)h(release)g(?)1937 b(7)150 83 y Fr(FAIL)288 b Fv(A)27
+b(test)g Fn(has)35 b Fv(pro)s(duced)25 b(the)h(bug)g(it)g(w)m(as)h(in)m
+(tended)e(to)i(capture.)40 b(That)26 b(is,)h(it)f(has)g(demon-)630
+193 y(strated)32 b(that)g(the)g(assertion)g(is)f(false.)44
+b(The)31 b Fr(FAIL)g Fv(message)i(is)d(based)i(on)f(the)h(test)h(case)
+630 302 y(only)-8 b(.)40 b(Other)30 b(messages)i(are)e(used)g(to)h
+(indicate)e(a)i(failure)e(of)h(the)h(framew)m(ork.)630
+437 y(As)c(with)g Fr(PASS)p Fv(,)g Fo(posix)f Fv(tests)j(m)m(ust)e
+(return)f Fr(FAIL)h Fv(rather)g(than)g Fr(XFAIL)f Fv(ev)m(en)i(if)f(a)h
+(failure)630 546 y(w)m(as)j(exp)s(ected.)150 731 y Fr(UNRESOLVED)630
+840 y Fv(A)k(test)i(pro)s(duced)c(indeterminate)h(results.)54
+b(Usually)-8 b(,)36 b(this)e(means)h(the)h(test)g(executed)630
+950 y(in)g(an)h(unexp)s(ected)f(fashion;)k(this)c(outcome)j(requires)c
+(that)j(a)g(h)m(uman)e(b)s(eing)g(go)i(o)m(v)m(er)630
+1059 y(results,)c(to)h(determine)e(if)g(the)h(test)h(should)d(ha)m(v)m
+(e)k(passed)d(or)h(failed.)50 b(This)33 b(message)i(is)630
+1169 y(also)25 b(used)g(for)g(an)m(y)h(test)h(that)f(requires)e(h)m
+(uman)g(in)m(terv)m(en)m(tion)i(b)s(ecause)f(it)g(is)g(b)s(ey)m(ond)g
+(the)630 1279 y(abilities)h(of)i(the)h(testing)f(framew)m(ork.)40
+b(An)m(y)28 b(unresolv)m(ed)g(test)h(should)d(resolv)m(ed)i(to)h
+Fr(PASS)630 1388 y Fv(or)h Fr(FAIL)g Fv(b)s(efore)g(a)g(test)i(run)d
+(can)h(b)s(e)g(considered)f(\014nished.)630 1523 y(Note)h(that)f(for)f
+Fo(posix)p Fv(,)g(eac)m(h)i(assertion)e(m)m(ust)g(pro)s(duce)f(a)i
+(test)g(result)e(co)s(de.)41 b(If)27 b(the)i(test)630
+1632 y(isn't)36 b(actually)g(run,)h(it)f(m)m(ust)g(pro)s(duce)g
+Fr(UNRESOLVED)d Fv(rather)k(than)f(just)g(lea)m(ving)g(that)630
+1742 y(test)g(out)f(of)g(the)g(output.)54 b(This)33 b(means)i(that)g(y)
+m(ou)h(ha)m(v)m(e)g(to)g(b)s(e)e(careful)g(when)g(writing)630
+1851 y(tests,)g(to)f(not)g(carelessly)f(use)g(tcl)h(statemen)m(ts)h
+(lik)m(e)e Fr(return)p Fv(|if)e(y)m(ou)j(alter)f(the)h(\015o)m(w)g(of)
+630 1961 y(con)m(trol)25 b(of)g(the)g(tcl)g(co)s(de)g(y)m(ou)h(m)m(ust)
+e(insure)f(that)j(ev)m(ery)g(test)f(still)e(pro)s(duces)h(some)h
+(result)630 2071 y(co)s(de.)630 2205 y(Here)31 b(are)g(some)f(of)h(the)
+g(w)m(a)m(ys)g(a)g(test)g(ma)m(y)g(wind)d(up)h Fr(UNRESOLVED)p
+Fv(:)705 2340 y Ft(\017)60 b Fv(A)30 b(test's)i(execution)e(is)g(in)m
+(terrupted.)705 2474 y Ft(\017)60 b Fv(A)34 b(test)g(do)s(es)f(not)h
+(pro)s(duce)e(a)i(clear)f(result.)49 b(This)32 b(is)g(usually)f(b)s
+(ecause)j(there)g(w)m(as)810 2584 y(an)h Fr(ERROR)e Fv(from)i(DejaGn)m
+(u)h(while)d(pro)s(cessing)h(the)h(test,)i(or)e(b)s(ecause)g(there)g(w)
+m(ere)810 2693 y(three)41 b(or)f(more)h Fr(WARNING)e
+Fv(messages.)72 b(An)m(y)41 b Fr(WARNING)d Fv(or)j Fr(ERROR)e
+Fv(messages)j(can)810 2803 y(in)m(v)-5 b(alidate)32 b(the)h(output)f
+(of)h(the)h(test.)49 b(This)31 b(usually)g(requires)g(a)j(h)m(uman)e(b)
+s(eing)f(to)810 2912 y(examine)k(the)g(output)f(to)i(determine)e(what)g
+(really)g(happ)s(ened|and)f(to)i(impro)m(v)m(e)810 3022
+y(the)c(test)g(case.)705 3156 y Ft(\017)60 b Fv(A)30
+b(test)i(dep)s(ends)c(on)j(a)f(previous)f(test,)j(whic)m(h)d(fails.)705
+3291 y Ft(\017)60 b Fv(The)30 b(test)h(w)m(as)g(set)g(up)e(incorrectly)
+-8 b(.)150 3475 y Fr(UNTESTED)96 b Fv(A)31 b(test)h(w)m(as)g(not)f
+(run.)42 b(This)29 b(is)h(a)i(placeholder,)e(used)g(when)h(there)g(is)f
+(no)h(real)g(test)h(case)630 3585 y(y)m(et.)150 3744
+y(The)j(only)h(remaining)e(output)h(message)i(left)f(is)f(in)m(tended)g
+(to)i(test)g(features)f(that)g(are)h(sp)s(eci\014ed)d(b)m(y)150
+3854 y(the)d(applicable)d Fo(posix)h Fv(standard)h(as)h(conditional:)
+150 4038 y Fr(UNSUPPORTED)630 4148 y Fv(There)40 b(is)g(no)g(supp)s
+(ort)f(for)h(the)h(tested)g(case.)72 b(This)39 b(ma)m(y)i(mean)g(that)g
+(a)g(conditional)630 4257 y(feature)30 b(of)f(an)g(op)s(erating)g
+(system,)g(or)h(of)f(a)g(compiler,)g(is)f(not)h(implemen)m(ted.)39
+b(DejaGn)m(u)630 4367 y(also)23 b(uses)g(this)g(message)h(when)e(a)i
+(testing)g(en)m(vironmen)m(t)f(\(often)h(a)f(\\bare)h(b)s(oard")f
+(target\))630 4477 y(lac)m(ks)31 b(basic)f(supp)s(ort)e(for)i
+(compiling)f(or)h(running)e(the)i(test)i(case.)42 b(F)-8
+b(or)31 b(example,)f(a)h(test)630 4586 y(for)38 b(the)h(system)f
+(subroutine)e Fr(gethostname)f Fv(w)m(ould)i(nev)m(er)i(w)m(ork)f(on)g
+(a)h(target)h(b)s(oard)630 4696 y(running)28 b(only)h(a)i(b)s(o)s(ot)f
+(monitor.)275 4855 y(DejaGn)m(u)g(uses)f(the)h(same)h(output)e(pro)s
+(cedures)g(to)h(pro)s(duce)f(these)h(messages)h(for)e(all)g(test)i
+(suites,)150 4965 y(and)i(these)h(pro)s(cedures)e(are)h(already)g(kno)m
+(wn)g(to)h(conform)f(to)h Fo(posix)f Fv(1003.3.)52 b(F)-8
+b(or)34 b(a)g(DejaGn)m(u)g(test)150 5074 y(suite)28 b(to)i(conform)f
+(to)h Fo(posix)e Fv(1003.3,)k(y)m(ou)d(m)m(ust)g(a)m(v)m(oid)h(the)f
+Fr(setup_xfail)d Fv(pro)s(cedure)i(as)h(describ)s(ed)150
+5184 y(in)21 b(the)i Fr(PASS)e Fv(section)i(ab)s(o)m(v)m(e,)i(and)d(y)m
+(ou)h(m)m(ust)g(b)s(e)e(careful)h(to)i(return)d Fr(UNRESOLVED)f
+Fv(where)i(appropriate,)150 5293 y(as)31 b(describ)s(ed)d(in)h(the)i
+Fr(UNRESOLVED)c Fv(section)k(ab)s(o)m(v)m(e.)p eop
+%%Page: 8 10
+8 9 bop 150 -116 a Fv(8)2409 b(DejaGn)m(u)32 b(T)-8 b(esting)30
+b(F)-8 b(ramew)m(ork)150 83 y Fu(2.5)68 b(F)-11 b(uture)44
+b(directions)275 276 y Fv(In)28 b(the)h(near)g(future,)f(there)i(are)f
+(t)m(w)m(o)h(parallel)d(directions)h(for)h(DejaGn)m(u)h(dev)m(elopmen)m
+(t.)40 b(The)29 b(\014rst)150 385 y(is)g(to)j(add)d(supp)s(ort)g(for)h
+(more)h(hosts)f(and)g(targets.)275 520 y(The)d(second)g(w)m(ould)g(p)s
+(ermit)f(testing)h(programs)h(with)e(a)i(more)g(complex)f(in)m
+(terface,)i(whether)e(text)150 629 y(based)j(or)h(GUI)g(based.)42
+b(Tw)m(o)31 b(comp)s(onen)m(ts)g(already)f(exist:)42
+b(a)31 b(Tcl)f(based)g(X)h(windo)m(w)f(to)s(olkit,)g(and)h(a)150
+739 y(terminal)h(pac)m(k)-5 b(age)36 b(for)e Fr(expect)p
+Fv(.)49 b(Both)35 b(of)f(these)g(could)f(b)s(e)g(merged)h(in)m(to)g
+(DejaGn)m(u)h(in)d(a)j(w)m(a)m(y)f(that)150 848 y(p)s(ermits)29
+b(testing)h(programs)g(that)h(run)e(in)g(eac)m(h)j(en)m(vironmen)m(t.)
+275 983 y(Mean)m(while,)26 b(w)m(e)g(hop)s(e)f(DejaGn)m(u)i(enables)e
+(the)h(creation)g(of)g(test)h(suites)e(for)g(conformance)i(to)f
+Fo(ansi)150 1093 y Fv(C)33 b(and)g(C)p Fr(++)p Fv(,)h(to)g
+Fo(posix)p Fv(,)g(and)g(to)g(other)g(standards.)49 b(W)-8
+b(e)35 b(encourage)g(y)m(ou)f(to)h(mak)m(e)f(an)m(y)g(test)h(suites)150
+1202 y(y)m(ou)c(create)h(freely)d(a)m(v)-5 b(ailable,)30
+b(under)f(the)i(same)g(terms)f(as)g(DejaGn)m(u)i(itself.)150
+1460 y Fu(2.6)68 b(Tcl)45 b(and)f(Exp)t(ect)275 1652
+y Fv(Tcl)25 b(w)m(as)h(in)m(tro)s(duced)e(in)h(a)h(pap)s(er)f(b)m(y)h
+(John)f(K.)h(Ousterhout)f(at)i(the)f(1990)i(Win)m(ter)d(Usenix)h
+(confer-)150 1762 y(ence,)h Fq(Tcl:)38 b(An)25 b(Em)m(b)s(eddable)f
+(Command)g(Language)p Fv(.)40 b(That)26 b(pap)s(er)e(is)g(included)f
+(in)h(P)m(ostScript)h(form)150 1871 y(in)32 b(the)i(`)p
+Fr(doc)p Fv(')f(sub)s(directory)f(of)h(the)h(Tcl)f(distribution.)46
+b(The)34 b(v)m(ersion)f(of)g(Tcl)g(included)e(in)h(DejaGn)m(u)150
+1981 y(at)f(this)e(time)h(is)g(Tcl)f(7.4p3.)275 2115
+y(Don)h(Lib)s(es)f(in)m(tro)s(duced)f Fr(expect)h Fv(in)g(his)f(pap)s
+(er)h Fq(exp)s(ect:)42 b(Curing)28 b(Those)i(Uncon)m(trollable)f(Fits)h
+(of)150 2225 y(In)m(teraction)38 b Fv(at)h(the)f(1990)h(Summer)e
+(Usenix)f(conference.)64 b(The)37 b(pap)s(er)g(is)g(included)e(in)h(P)m
+(ostScript)150 2335 y(form)27 b(in)g(the)h Fr(expect)e
+Fv(distribution)f(\(as)j(are)h(sev)m(eral)f(other)g(pap)s(ers)f(ab)s
+(out)g Fr(expect)p Fv(\).)39 b(The)27 b(v)m(ersion)h(of)150
+2444 y(exp)s(ect)j(included)d(in)h(DejaGn)m(u)i(at)g(this)e(time)h(is)g
+(exp)s(ect)h(5.18.0.)p eop
+%%Page: 9 11
+9 10 bop 150 -116 a Fv(Chapter)30 b(3:)41 b(Using)29
+b Fr(runtest)2499 b Fv(9)150 100 y Fs(3)80 b(Using)54
+b Fl(runtest)275 334 y Fr(runtest)28 b Fv(is)i(the)h(executable)g(test)
+h(driv)m(er)d(for)i(DejaGn)m(u.)42 b(Y)-8 b(ou)31 b(can)g(sp)s(ecify)e
+(t)m(w)m(o)k(kinds)28 b(of)j(things)150 443 y(on)25 b(the)g
+Fr(runtest)e Fv(command)i(line:)37 b(command)24 b(line)g(options,)h
+(and)g(Tcl)f(v)-5 b(ariables)24 b(for)h(the)g(test)h(scripts.)150
+553 y(The)k(options)g(are)g(listed)f(alphab)s(etically)f(b)s(elo)m(w.)
+275 687 y Fr(runtest)g Fv(returns)h(an)i(exit)f(co)s(de)h(of)f
+Fr(1)h Fv(if)e(an)m(y)i(test)g(has)f(an)h(unexp)s(ected)f(result;)f
+(otherwise)h(\(if)g(all)150 797 y(tests)h(pass)f(or)g(fail)g(as)g(exp)s
+(ected\))h(it)f(returns)f Fr(0)h Fv(as)h(the)g(exit)f(co)s(de.)275
+932 y Fr(runtest)25 b Fv(\015ags)i(the)g(outcome)i(of)e(eac)m(h)h(test)
+g(as)g(one)f(of)g(these)h(cases.)41 b(\(See)27 b(Section)g(2.4)h([A)g
+(POSIX)150 1041 y(conforming)f(test)h(framew)m(ork],)h(page)f(6,)h(for)
+e(a)h(discussion)d(of)i(ho)m(w)h Fo(posix)e Fv(sp)s(eci\014es)h(the)g
+(meanings)g(of)150 1151 y(these)k(cases.\))150 1310 y
+Fr(PASS)288 b Fv(The)29 b(most)g(desirable)f(outcome:)41
+b(the)29 b(test)i(succeeded,)f(and)e(w)m(as)i(exp)s(ected)f(to)h
+(succeed.)150 1469 y Fr(XPASS)240 b Fv(A)26 b(pleasan)m(t)h(kind)d(of)j
+(failure:)37 b(a)26 b(test)h(w)m(as)g(exp)s(ected)g(to)g(fail,)f(but)f
+(succeeded.)40 b(This)24 b(ma)m(y)630 1579 y(indicate)h(progress;)i
+(insp)s(ect)e(the)h(test)h(case)g(to)f(determine)f(whether)g(y)m(ou)i
+(should)c(amend)630 1689 y(it)30 b(to)h(stop)f(exp)s(ecting)h(failure.)
+150 1848 y Fr(FAIL)288 b Fv(A)33 b(test)g(failed,)g(although)f(it)g(w)m
+(as)h(exp)s(ected)g(to)g(succeed.)49 b(This)31 b(ma)m(y)i(indicate)f
+(regress;)630 1958 y(insp)s(ect)d(the)i(test)g(case)g(and)f(the)h
+(failing)d(soft)m(w)m(are)k(to)f(lo)s(cate)g(the)g(bug.)150
+2117 y Fr(XFAIL)240 b Fv(A)38 b(test)g(failed,)h(but)e(it)g(w)m(as)h
+(exp)s(ected)g(to)h(fail.)61 b(This)36 b(result)h(indicates)g(no)g(c)m
+(hange)i(in)630 2227 y(a)33 b(kno)m(wn)g(bug.)47 b(If)33
+b(a)g(test)h(fails)d(b)s(ecause)i(the)g(op)s(erating)f(system)h(where)g
+(the)g(test)h(runs)630 2336 y(lac)m(ks)d(some)g(facilit)m(y)e(required)
+g(b)m(y)h(the)g(test,)i(the)e(outcome)i(is)e Fr(UNSUPPORTED)d
+Fv(instead.)150 2496 y Fr(UNRESOLVED)630 2605 y Fv(Output)39
+b(from)h(a)h(test)h(requires)d(man)m(ual)h(insp)s(ection;)j(the)e(test)
+h(suite)d(could)h(not)h(au-)630 2715 y(tomatically)e(determine)f(the)i
+(outcome.)68 b(F)-8 b(or)40 b(example,)i(y)m(our)d(tests)h(can)f(rep)s
+(ort)g(this)630 2824 y(outcome)32 b(is)d(when)g(a)i(test)g(do)s(es)g
+(not)f(complete)h(as)g(exp)s(ected.)150 2984 y Fr(UNTESTED)96
+b Fv(A)28 b(test)h(case)f(is)f(not)h(y)m(et)h(complete,)g(and)f(in)e
+(particular)g(cannot)j(y)m(et)f(pro)s(duce)f(a)h Fr(PASS)f
+Fv(or)630 3093 y Fr(FAIL)p Fv(.)39 b(Y)-8 b(ou)28 b(can)h(also)f(use)g
+(this)f(outcome)i(in)e(dumm)m(y)g(\\tests")j(that)e(note)h(explicitly)d
+(the)630 3203 y(absence)31 b(of)f(a)h(real)f(test)h(case)h(for)e(a)h
+(particular)d(prop)s(ert)m(y)-8 b(.)150 3362 y Fr(UNSUPPORTED)630
+3472 y Fv(A)32 b(test)h(dep)s(ends)d(on)i(a)h(conditionally)c(a)m(v)-5
+b(ailable)32 b(feature)g(that)h(do)s(es)f(not)g(exist)g(\(in)f(the)630
+3582 y(con\014gured)40 b(testing)h(en)m(vironmen)m(t\).)71
+b(F)-8 b(or)42 b(example,)h(y)m(ou)e(can)g(use)g(this)e(outcome)j(to)
+630 3691 y(rep)s(ort)f(on)h(a)h(test)g(case)g(that)g(do)s(es)e(not)i(w)
+m(ork)f(on)g(a)g(particular)f(target)i(b)s(ecause)g(its)630
+3801 y(op)s(erating)30 b(system)g(supp)s(ort)f(do)s(es)h(not)h(include)
+d(a)j(required)d(subroutine.)275 3960 y Fr(runtest)g
+Fv(ma)m(y)j(also)f(displa)m(y)f(the)h(follo)m(wing)f(messages:)150
+4120 y Fr(ERROR)240 b Fv(Indicates)43 b(a)g(ma)5 b(jor)43
+b(problem)f(\(detected)j(b)m(y)e(the)g(test)h(case)g(itself)7
+b(\))43 b(in)e(running)g(the)630 4229 y(test.)65 b(This)37
+b(is)g(usually)f(an)i(unreco)m(v)m(erable)h(error,)h(suc)m(h)e(as)h(a)f
+(missing)e(\014le)i(or)g(loss)g(of)630 4339 y(comm)m(unication)30
+b(to)i(the)f(target.)44 b(\()p Fo(posix)30 b Fv(test)i(suites)e(should)
+f(not)i(emit)g(this)f(message;)630 4448 y(use)g Fr(UNSUPPORTED)p
+Fv(,)e Fr(UNTESTED)p Fv(,)g(or)i Fr(UNRESOLVED)e Fv(instead,)i(as)g
+(appropriate.\))150 4608 y Fr(WARNING)144 b Fv(Indicates)30
+b(a)h(p)s(ossible)e(problem)g(in)g(running)f(the)j(test.)43
+b(Usually)29 b(w)m(arnings)g(corresp)s(ond)630 4717 y(to)24
+b(reco)m(v)m(erable)g(errors,)g(or)f(displa)m(y)e(an)h(imp)s(ortan)m(t)
+g(message)i(ab)s(out)f(the)g(follo)m(wing)e(tests.)150
+4877 y Fr(NOTE)288 b Fv(An)30 b(informational)e(message)k(ab)s(out)e
+(the)h(test)g(case.)275 5036 y(This)h(is)g(the)i(full)e(set)i(of)g
+(command)g(line)e(options)h(that)i Fr(runtest)d Fv(recognizes.)51
+b(Argumen)m(ts)34 b(ma)m(y)150 5146 y(b)s(e)c(abbreviated)f(to)j(the)e
+(shortest)h(unique)d(string.)p eop
+%%Page: 10 12
+10 11 bop 150 -116 a Fv(10)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)390 83 y Fr(runtest)46
+b(--tool)g Fq(to)s(ol)99 b Fr([)47 b Fq(testsuite)p Fr(.exp)g(...)g(])
+390 187 y([)g Fq(testsuite)p Fr(.exp="testfile1)d(...")j(])390
+291 y([)g Fq(tclv)-5 b(ar)7 b Fr(=)p Fq(v)-5 b(alue)5
+b Fr(...)46 b(])390 394 y([)h(--all)g(])95 b([)47 b(--baud)g
+Fq(baud-rate)52 b Fr(])96 b([)47 b(--connect)e Fq(t)m(yp)s(e)53
+b Fr(])390 498 y([)47 b(--debug)f(])95 b([)48 b(--help)e(])95
+b([)48 b(--host)e Fq(string)54 b Fr(])390 602 y([)47
+b(--mail)g(")p Fq(name)52 b Fr(...)o(")c(])95 b([)47
+b(--name)g Fq(string)54 b Fr(])390 706 y([)47 b(--name)g
+Fq(name)52 b Fr(])96 b([)47 b(--outdir)f Fq(path)h Fr(])390
+809 y([)g(--objdir)f Fq(path)i Fr(])95 b([)47 b(--reboot)f(])390
+913 y([)h(--srcdir)f Fq(path)i Fr(])95 b([)47 b(--strace)f
+Fq(n)h Fr(])390 1017 y([)g(--target)f Fq(string)55 b
+Fr(--build)45 b Fq(string)55 b Fr(])390 1121 y([)47 b(-v)h(|)f
+(--verbose)e(])96 b([)47 b(-V)g(|)h(--version)d(])95
+b([)48 b(--D)p Fq(n)e Fr(])150 1273 y(--tool)29 b Fq(to)s(ol)630
+1382 y(to)s(ol)39 b Fv(sp)s(eci\014es)c(what)h(set)g(of)g(tests)h(to)f
+(run,)g(and)g(what)f(initialization)e(mo)s(dule)h(to)j(use.)630
+1492 y Fq(to)s(ol)c Fv(is)c(used)g Fn(only)38 b Fv(for)30
+b(these)g(t)m(w)m(o)h(purp)s(oses:)39 b(it)29 b(is)f
+Fn(not)39 b Fv(used)29 b(to)i(name)e(the)h(executable)630
+1601 y(program)25 b(to)h(test.)40 b(Executable)25 b(to)s(ol)g(names)g
+(\(and)g(paths\))g(are)h(recorded)f(in)f(`)p Fr(site.exp)p
+Fv(')630 1711 y(\(see)g(Chapter)e(4)i([Con\014guration)d(dep)s(enden)m
+(t)h(v)-5 b(alues],)25 b(page)e(15\),)j(and)c(y)m(ou)i(can)f(o)m(v)m
+(erride)630 1820 y(them)30 b(b)m(y)h(sp)s(ecifying)d(Tcl)h(v)-5
+b(ariables)29 b(on)i(the)f(command)g(line.)630 1951 y(F)-8
+b(or)33 b(example,)g(including)c(`)p Fr(--tool)g(gcc)p
+Fv(')j(on)h(the)f Fr(runtest)f Fv(command)h(line)f(runs)g(tests)630
+2061 y(from)37 b(all)g(test)h(sub)s(directories)d(whose)j(names)f(matc)
+m(h)i(`)p Fr(gcc.*)p Fv(',)g(and)e(uses)g(one)h(of)g(the)630
+2170 y(initialization)27 b(mo)s(dules)h(named)i(`)p Fr
+(config/*-gcc.exp)p Fv('.)36 b(T)-8 b(o)31 b(sp)s(ecify)d(the)j(name)f
+(of)g(the)630 2280 y(compiler)19 b(\(p)s(erhaps)g(as)i(an)g(alternativ)
+m(e)g(path)f(to)h(what)g Fr(runtest)d Fv(w)m(ould)h(use)i(b)m(y)f
+(default\),)630 2390 y(use)30 b(`)p Fr(GCC=)p Fq(binname)5
+b Fv(')28 b(on)j(the)f Fr(runtest)e Fv(command)j(line.)150
+2541 y Fq(testsuite)p Fr(.exp)f(...)630 2651 y Fv(Sp)s(ecify)j(the)i
+(names)f(of)h(testsuites)f(to)i(run.)51 b(By)35 b(default,)g
+Fr(runtest)e Fv(runs)f(all)i(tests)h(for)630 2760 y(the)c(to)s(ol,)g
+(but)g(y)m(ou)g(can)g(restrict)g(it)f(to)i(particular)d(testsuites)i(b)
+m(y)g(giving)f(the)h(names)g(of)630 2870 y(the)g(`)p
+Fr(.exp)p Fv(')e Fr(expect)g Fv(scripts)g(that)i(con)m(trol)g(them.)630
+3001 y Fq(testsuite)p Fv(.exp)g(ma)m(y)g(not)f(include)f(path)h
+(information;)f(use)h(plain)e(\014lenames.)150 3152 y
+Fq(test\014le)p Fr(.exp="testfile1)e(...")630 3262 y
+Fv(Sp)s(ecify)38 b(a)j(subset)e(of)i(tests)g(in)d(a)j(suite)e(to)i
+(run.)69 b(F)-8 b(or)41 b(compiler)d(or)i(assem)m(bler)g(tests,)630
+3372 y(whic)m(h)31 b(often)i(use)f(a)g(single)f(`)p Fr(.exp)p
+Fv(')h(script)f(co)m(v)m(ering)i(man)m(y)g(di\013eren)m(t)f(source)g
+(\014les,)g(this)630 3481 y(option)h(allo)m(ws)h(y)m(ou)g(to)h(further)
+e(restrict)h(the)g(tests)h(b)m(y)f(listing)d(particular)i(source)h
+(\014les)630 3591 y(to)e(compile.)41 b(Some)31 b(to)s(ols)g(ev)m(en)g
+(supp)s(ort)e(wildcards)g(here.)42 b(The)30 b(wildcards)f(supp)s(orted)
+630 3700 y(dep)s(end)g(up)s(on)f(the)j(to)s(ol,)g(but)e(t)m(ypically)g
+(they)i(are)g Fr(?)p Fv(,)f Fr(*)p Fv(,)g(and)g Fr([chars])p
+Fv(.)150 3852 y Fq(tclv)-5 b(ar)7 b Fr(=)p Fq(v)-5 b(alue)630
+3962 y Fv(Y)d(ou)30 b(can)g(de\014ne)f(Tcl)g(v)-5 b(ariables)28
+b(for)h(use)h(b)m(y)f(y)m(our)h(test)g(scripts)f(in)f(the)i(same)g(st)m
+(yle)g(used)630 4071 y(with)43 b Fr(make)h Fv(for)h(en)m(vironmen)m(t)f
+(v)-5 b(ariables.)82 b(F)-8 b(or)46 b(example,)i(`)p
+Fr(runtest)29 b(GDB=gdb.old)p Fv(')630 4181 y(de\014nes)39
+b(a)h(v)-5 b(ariable)38 b(called)h(`)p Fr(GDB)p Fv(';)44
+b(when)39 b(y)m(our)h(scripts)e(refer)i(to)g(`)p Fr($GDB)p
+Fv(')f(in)g(this)f(run,)630 4290 y(they)31 b(use)f(the)g(v)-5
+b(alue)30 b(`)p Fr(gdb.old)p Fv('.)630 4421 y(The)f(default)g(Tcl)g(v)
+-5 b(ariables)28 b(used)h(for)h(most)g(to)s(ols)g(are)g(de\014ned)e(in)
+h(the)g(main)g(DejaGn)m(u)630 4531 y Fr(Makefile)p Fv(;)50
+b(their)44 b(v)-5 b(alues)44 b(are)i(captured)e(in)g(the)h(`)p
+Fr(site.exp)p Fv(')e(\014le.)83 b(See)45 b(Chapter)g(4)630
+4640 y([Con\014guration)29 b(dep)s(enden)m(t)h(v)-5 b(alues],)30
+b(page)h(15.)150 4792 y Fr(--all)240 b Fv(Displa)m(y)38
+b(all)f(test)j(output.)64 b(By)39 b(default,)h Fr(runtest)d
+Fv(sho)m(ws)h(only)g(the)g(output)g(of)h(tests)630 4902
+y(that)33 b(pro)s(duce)f(unexp)s(ected)g(results;)g(that)h(is,)g(tests)
+g(with)e(status)i(`)p Fr(FAIL)p Fv(')f(\(unexp)s(ected)630
+5011 y(failure\),)25 b(`)p Fr(XPASS)p Fv(')f(\(unexp)s(ected)h
+(success\),)i(or)e(`)p Fr(ERROR)p Fv(')f(\(a)i(sev)m(ere)g(error)f(in)f
+(the)h(test)h(case)630 5121 y(itself)7 b(\).)57 b(Sp)s(ecify)34
+b(`)p Fr(--all)p Fv(')h(to)i(see)f(output)g(for)g(tests)g(with)f
+(status)h(`)p Fr(PASS)p Fv(')g(\(success,)i(as)630 5230
+y(exp)s(ected\))c(`)p Fr(XFAIL)p Fv(')f(\(failure,)g(as)h(exp)s
+(ected\),)i(or)d(`)p Fr(WARNING)p Fv(')f(\(minor)h(error)g(in)f(the)i
+(test)630 5340 y(case)d(itself)7 b(\).)p eop
+%%Page: 11 13
+11 12 bop 150 -116 a Fv(Chapter)30 b(3:)41 b(Using)29
+b Fr(runtest)2453 b Fv(11)150 83 y Fr(--baud)29 b Fq(baud-rate)150
+193 y Fr(-b)h Fq(baud-rate)630 302 y Fv(Set)g(the)f(default)g(baud)f
+(rate)i(to)g(something)f(other)h(than)f(9600.)42 b(\(Some)30
+b(serial)e(in)m(terface)630 412 y(programs,)i(lik)m(e)g
+Fr(tip)p Fv(,)g(use)g(a)g(separate)i(initialization)27
+b(\014le)j(instead)f(of)i(this)e(v)-5 b(alue.\))150 571
+y Fr(--connect)28 b Fq(t)m(yp)s(e)630 681 y Fv(Connect)d(to)g(a)g
+(target)h(testing)f(en)m(vironmen)m(t)f(as)h(sp)s(eci\014ed)e(b)m(y)h
+Fq(t)m(yp)s(e)p Fv(,)j(if)c(the)i(target)h(is)e(not)630
+790 y(the)36 b(computer)g(running)e Fr(runtest)p Fv(.)56
+b(F)-8 b(or)37 b(example,)h(use)d(`)p Fr(--connect)p
+Fv(')g(to)h(c)m(hange)i(the)630 900 y(program)27 b(used)g(to)i(connect)
+f(to)g(a)g(\\bare)g(b)s(oard")f(b)s(o)s(ot)h(monitor.)39
+b(The)27 b(c)m(hoices)h(for)g Fq(t)m(yp)s(e)630 1010
+y Fv(in)k(the)i(DejaGn)m(u)g(1.0)h(distribution)30 b(are)k(`)p
+Fr(rlogin)p Fv(',)f(`)p Fr(telnet)p Fv(',)g(`)p Fr(rsh)p
+Fv(',)i(`)p Fr(tip)p Fv(',)f(`)p Fr(kermit)p Fv(',)630
+1119 y(and)c(`)p Fr(mondfe)p Fv('.)630 1254 y(The)j(default)f(for)h
+(this)f(option)h(dep)s(ends)e(on)i(the)g(con\014guration)g(\(see)h
+(Section)f(5.5)h([Re-)630 1363 y(mote)h(targets)g(supp)s(orted],)e
+(page)i(32\).)52 b(The)33 b(default)g(is)f(c)m(hosen)j(to)f(b)s(e)f
+(the)h(most)g(con-)630 1473 y(v)m(enien)m(t)e(comm)m(unication)f(metho)
+s(d)g(a)m(v)-5 b(ailable,)32 b(but)f(often)h(other)g(alternativ)m(es)g
+(w)m(ork)g(as)630 1582 y(w)m(ell;)c(y)m(ou)h(ma)m(y)g(\014nd)d(it)i
+(useful)f(to)i(try)f(alternativ)m(e)g(connect)i(metho)s(ds)d(if)g(y)m
+(ou)i(susp)s(ect)f(a)630 1692 y(comm)m(unication)i(problem)f(with)g(y)m
+(our)h(testing)h(target.)150 1851 y Fr(--debug)144 b
+Fv(T)-8 b(urns)23 b(on)i(the)f Fr(expect)f Fv(in)m(ternal)h(debugging)f
+(output.)39 b(Debugging)24 b(output)h(is)e(displa)m(y)m(ed)630
+1961 y(as)44 b(part)g(of)g(the)g Fr(runtest)e Fv(output,)47
+b(and)c(logged)i(to)f(a)h(\014le)e(called)g(`)p Fr(dbg.log)p
+Fv('.)79 b(The)630 2071 y(extra)25 b(debugging)d(output)i(do)s(es)f
+Fn(not)34 b Fv(app)s(ear)23 b(on)h(standard)f(output,)i(unless)d(the)i
+(v)m(erb)s(ose)630 2180 y(lev)m(el)33 b(is)g(greater)i(than)e(2)i
+(\(for)e(instance,)i(to)f(see)h(debug)d(output)i(immediately)-8
+b(,)33 b(sp)s(ecify)630 2290 y(`)p Fr(--debug)c(-v)g(-v)p
+Fv('\).)57 b(The)35 b(debugging)g(output)g(sho)m(ws)g(all)g(attempts)i
+(at)f(matc)m(hing)g(the)630 2399 y(test)e(output)f(of)g(the)h(to)s(ol)f
+(with)f(the)h(scripted)f(patterns)i(describing)c(exp)s(ected)k(output.)
+630 2509 y(The)c(output)g(generated)h(with)e(`)p Fr(--strace)p
+Fv(')g(also)h(go)s(es)h(in)m(to)g(`)p Fr(dbg.log)p Fv('.)150
+2668 y Fr(--help)150 2778 y(-he)336 b Fv(Prin)m(ts)25
+b(out)h(a)h(short)e(summary)g(of)h(the)h Fr(runtest)d
+Fv(options,)i(then)g(exits)g(\(ev)m(en)h(if)e(y)m(ou)h(also)630
+2888 y(sp)s(ecify)j(other)i(options\).)150 3047 y Fr(--host)e
+Fq(string)630 3156 y(string)47 b Fv(is)39 b(a)i(full)d(con\014guration)
+i(\\triple")f(name)h(as)h(used)e(b)m(y)i Fr(configure)p
+Fv(.)67 b(Use)41 b(this)630 3266 y(option)30 b(to)h(o)m(v)m(erride)g
+(the)f(default)g(string)f(recorded)i(b)m(y)f(y)m(our)h
+(con\014guration's)e(c)m(hoice)j(of)630 3376 y(host.)40
+b(This)27 b(c)m(hoice)j(do)s(es)f(not)g(c)m(hange)h(ho)m(w)f(an)m
+(ything)f(is)g(actually)g(con\014gured)g(unless)g({)630
+3485 y(build)21 b(is)h(also)i(sp)s(eci\014ed;)g(it)f(a\013ects)i
+Fn(only)33 b Fv(DejaGn)m(u)24 b(pro)s(cedures)f(that)h(compare)g(the)g
+(host)630 3595 y(string)39 b(with)f(particular)g(v)-5
+b(alues.)68 b(The)39 b(pro)s(cedures)f Fr(ishost)p Fv(,)j
+Fr(istarget)p Fv(,)f Fr(isnative)p Fv(,)630 3704 y(and)d
+Fr(setup_xfail)d Fv(are)k(a\013ected)i(b)m(y)d(`)p Fr(--host)p
+Fv('.)61 b(In)37 b(this)g(usage,)j Fr(host)c Fv(refers)h(to)i(the)630
+3814 y(mac)m(hine)f(that)h(the)f(tests)h(are)g(to)g(b)s(e)e(run)g(on,)j
+(whic)m(h)d(ma)m(y)i(not)g(b)s(e)e(the)i(same)f(as)h(the)630
+3924 y Fr(build)27 b Fv(mac)m(hine.)39 b(If)28 b Fr(--build)e
+Fv(is)i(also)g(sp)s(eci\014ed,)f(then)h Fr(--host)e Fv(refers)i(to)h
+(the)f(mac)m(hine)630 4033 y(that)j(the)g(tests)g(wil,)d(b)s(e)i(run)f
+(on,)i(not)f(the)h(mac)m(hine)f(DejaGn)m(u)h(is)e(run)g(on.)150
+4193 y Fr(--build)f Fq(string)630 4302 y(string)39 b
+Fv(is)32 b(a)h(full)e(con\014guration)h(\\triple")g(name)g(as)h(used)f
+(b)m(y)h Fr(configure)p Fv(.)45 b(This)31 b(is)h(the)630
+4412 y(t)m(yp)s(e)c(of)h(mac)m(hine)f(DejaGn)m(u)h(and)e(the)i(to)s
+(ols)f(to)g(b)s(e)g(tested)h(are)g(built)d(on.)39 b(F)-8
+b(or)29 b(a)g(normal)630 4521 y(cross)h(this)g(is)f(the)i(same)g(as)f
+(the)h(host,)f(but)g(for)g(a)h(canadian)f(cross,)h(they)f(are)h(sep)s
+(erate.)150 4681 y Fr(--name)e Fq(name)630 4790 y(name)44
+b Fv(is)37 b(a)i(name)g(for)f(the)h(particular)e(testing)h(target)j
+(mac)m(hine)d(\(for)h(cross)f(testing\).)630 4900 y(If)31
+b(the)i(testing)f(target)h(has)f(IP)g(net)m(w)m(ork)g(supp)s(ort)f
+(\(for)h(example,)g Fr(RPC)f Fv(or)h Fr(NFS)p Fv(\),)g(this)f(is)630
+5010 y(the)38 b(net)m(w)m(ork)g(name)g(for)f(the)h(target)h(itself.)61
+b(\()p Fq(name)43 b Fv(is)37 b Fn(not)i(the)h(c)-5 b(on\014gur)g(ation)
+41 b(string)630 5119 y Fv(y)m(ou)26 b(sp)s(ecify)f(as)h(a)h(target)h
+(with)c Fr(configure)p Fv(;)i(the)g(`)p Fr(--name)p Fv(')f(option)g
+(names)h(a)h(particular)630 5229 y(target,)38 b(rather)e(than)f
+(describing)e(a)j(class)f(of)g(targets.\))58 b(F)-8 b(or)36
+b(targets)h(that)f(connect)g(in)p eop
+%%Page: 12 14
+12 13 bop 150 -116 a Fv(12)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)630 83 y(other)25 b(w)m(a)m(ys,)i(the)
+e(meaning)g(of)g(the)g Fq(name)30 b Fv(string)24 b(dep)s(ends)f(on)i
+(the)g(connection)g(metho)s(d.)630 193 y(See)31 b(Section)f(5.5)h
+([Remote)h(targets)g(supp)s(orted],)d(page)i(32.)150
+352 y Fr(--name)e Fq(string)630 462 y Fv(Sp)s(ecify)24
+b(a)j(net)m(w)m(ork)g(name)f(of)g(testing)h(target)g(or)f(its)g(host.)
+39 b(The)26 b(particular)e(names)i(that)630 571 y(are)f(meaningful)e
+(with)g(`)p Fr(--name)p Fv(')h(will)e(dep)s(end)h(on)h(y)m(our)h(site)g
+(con\014guration,)g(and)f(on)h(the)630 681 y(connection)31
+b(proto)s(col:)42 b(for)31 b(example,)g Fr(tip)f Fv(connections)h
+(require)e(names)i(from)g(a)g(serial)630 790 y(line)24
+b(con\014guration)i(\014le)f(\(usually)f(called)h(`)p
+Fr(/etc/remote)p Fv('\),)g(while)g Fr(telnet)f Fv(connections)630
+900 y(use)30 b(IP)g(hostnames.)150 1059 y Fr(--objdir)e
+Fq(path)630 1169 y Fv(Use)45 b Fq(path)g Fv(as)g(the)g(top)g(directory)
+f(con)m(taining)g(an)m(y)h(auxiliary)e(compiled)g(test)i(co)s(de.)630
+1279 y(This)28 b(defaults)i(to)h(`)p Fr(.)p Fv('.)41
+b(Use)30 b(this)f(option)h(to)h(lo)s(cate)g(pre-compiled)e(test)i(co)s
+(de.)41 b(Y)-8 b(ou)31 b(can)630 1388 y(normally)e(prepare)g(an)m(y)i
+(auxiliary)d(\014les)h(needed)h(with)g Fr(make)p Fv(.)150
+1548 y Fr(--outdir)e Fq(path)630 1657 y Fv(W)-8 b(rite)28
+b(output)e(logs)h(in)f(directory)h Fq(path)p Fv(.)39
+b(The)27 b(default)f(is)h(`)p Fr(.)p Fv(',)h(the)f(directory)g(where)g
+(y)m(ou)630 1767 y(start)k Fr(runtest)p Fv(.)39 b(This)29
+b(option)h(a\013ects)i(only)e(the)h(summary)e(and)h(the)h(detailed)e
+(log)i(\014les)630 1876 y(`)p Fq(to)s(ol)p Fr(.sum)p
+Fv(')k(and)g(`)p Fq(to)s(ol)p Fr(.log)p Fv('.)57 b(The)35
+b(DejaGn)m(u)i(debug)e(log)h(`)p Fr(dbg.log)p Fv(')e(alw)m(a)m(ys)j
+(app)s(ears)630 1986 y(\(when)30 b(requested\))g(in)f(the)i(lo)s(cal)f
+(directory)-8 b(.)150 2145 y Fr(--reboot)96 b Fv(Reb)s(o)s(ot)27
+b(the)g(target)i(b)s(oard)d(when)g Fr(runtest)f Fv(initializes.)36
+b(Usually)-8 b(,)27 b(when)f(running)e(tests)630 2255
+y(on)33 b(a)h(separate)g(target)g(b)s(oard,)g(it)e(is)h(safer)g(to)h
+(reb)s(o)s(ot)f(the)g(target)i(to)f(b)s(e)e(certain)h(of)h(its)630
+2364 y(state.)42 b(Ho)m(w)m(ev)m(er,)33 b(when)c(dev)m(eloping)h(test)h
+(scripts,)e(reb)s(o)s(oting)h(tak)m(es)h(a)g(lot)g(of)f(time.)150
+2524 y Fr(--srcdir)e Fq(path)630 2633 y Fv(Use)40 b Fq(path)f
+Fv(as)h(the)g(top)g(directory)f(for)g(test)i(scripts)d(to)i(run.)67
+b Fr(runtest)38 b Fv(lo)s(oks)h(in)f(this)630 2743 y(directory)27
+b(for)h(an)m(y)g(sub)s(directory)d(whose)j(name)f(b)s(egins)f(with)h
+(the)h(to)s(olname)f(\(sp)s(eci\014ed)630 2853 y(with)32
+b(`)p Fr(--tool)p Fv('\).)49 b(F)-8 b(or)34 b(instance,)g(with)e(`)p
+Fr(--tool)d(gdb)p Fv(',)34 b Fr(runtest)d Fv(uses)i(tests)h(in)f(sub)s
+(di-)630 2962 y(rectories)i(`)p Fr(gdb.*)p Fv(')e(\(with)h(the)g(usual)
+f(shell-lik)m(e)g(\014lename)g(expansion\).)53 b(If)34
+b(y)m(ou)g(do)h(not)630 3072 y(use)j(`)p Fr(--srcdir)p
+Fv(',)g Fr(runtest)e Fv(lo)s(oks)h(for)h(test)h(directories)e(under)f
+(the)i(curren)m(t)g(w)m(orking)630 3181 y(directory)-8
+b(.)150 3341 y Fr(--strace)28 b Fq(n)630 3450 y Fv(T)-8
+b(urn)21 b(on)g(in)m(ternal)g(tracing)h(for)g Fr(expect)p
+Fv(,)g(to)h Fq(n)e Fv(lev)m(els)g(deep.)38 b(By)22 b(adjusting)f(the)h
+(lev)m(el,)i(y)m(ou)630 3560 y(can)g(con)m(trol)g(the)f(exten)m(t)i(to)
+f(whic)m(h)e(y)m(our)i(output)f(expands)f(m)m(ulti-lev)m(el)g(Tcl)h
+(statemen)m(ts.)630 3670 y(This)h(allo)m(ws)h(y)m(ou)h(to)g(ignore)g
+(some)g(lev)m(els)f(of)h Fr(case)e Fv(or)i Fr(if)f Fv(statemen)m(ts.)41
+b(Eac)m(h)26 b(pro)s(cedure)630 3779 y(call)k(or)g(con)m(trol)h
+(structure)f(coun)m(ts)h(as)f(one)h(\\lev)m(el".)630
+3914 y(The)49 b(output)h(is)f(recorded)g(in)g(the)h(same)g(\014le,)k(`)
+p Fr(dbg.log)p Fv(',)f(used)c(for)h(output)f(from)630
+4023 y(`)p Fr(--debug)p Fv('.)150 4183 y Fr(--target)28
+b Fq(string)630 4292 y Fv(Use)j(this)f(option)h(to)h(o)m(v)m(erride)f
+(the)g(default)f(setting)h(\(running)e(nativ)m(e)i(tests\).)44
+b Fq(string)38 b Fv(is)630 4402 y(a)29 b(full)e(con\014guration)h
+(\\triple")g(name)1955 4369 y Fp(1)2021 4402 y Fv(as)h(used)f(b)m(y)h
+Fr(configure)p Fv(.)38 b(This)27 b(option)h(c)m(hanges)630
+4511 y(the)43 b(con\014guration)f Fr(runtest)f Fv(uses)h(for)h(the)g
+(default)f(to)s(ol)g(names,)k(and)c(other)h(setup)630
+4621 y(information.)59 b(See)37 b(section)g(\\Using)g
+Fr(configure)p Fv(")e(in)g Fq(Cygn)m(us)h(con\014gure)5
+b Fv(,)39 b(for)e(details)630 4731 y(ab)s(out)30 b Fr(configure)e
+Fv(names.)p 150 4829 1200 4 v 192 4895 a Fp(1)275 4928
+y Fv(Con\014guration)h(triples)f(ha)m(v)m(e)k(the)e(form)g(`)p
+Fq(cpu)p Fr(-)p Fq(v)m(endor)p Fr(-)p Fq(os)t Fv('.)p
+eop
+%%Page: 13 15
+13 14 bop 150 -116 a Fv(Chapter)30 b(3:)41 b(Using)29
+b Fr(runtest)2453 b Fv(13)150 83 y Fr(--verbose)150 193
+y(-v)384 b Fv(T)-8 b(urns)32 b(on)h(more)h(output.)50
+b(Rep)s(eating)33 b(this)f(option)h(increases)g(the)h(amoun)m(t)g(of)f
+(output)630 302 y(displa)m(y)m(ed.)65 b(Lev)m(el)39 b(one)g(\(`)p
+Fr(-v)p Fv('\))h(is)e(simply)e(test)k(output.)66 b(Lev)m(el)40
+b(t)m(w)m(o)g(\(`)p Fr(-v)30 b(-v)p Fv('\))39 b(sho)m(ws)630
+412 y(messages)46 b(on)f(options,)k(con\014guration,)g(and)c(pro)s
+(cess)f(con)m(trol.)86 b(V)-8 b(erb)s(ose)46 b(messages)630
+521 y(app)s(ear)31 b(in)e(the)j(detailed)e(\(`)p Fr(*.log)p
+Fv('\))h(log)g(\014le,)g(but)f(not)i(in)e(the)h(summary)f(\(`)p
+Fr(*.sum)p Fv('\))h(log)630 631 y(\014le.)150 790 y Fr(--version)150
+900 y(-V)384 b Fv(Prin)m(ts)26 b(out)h(the)g(v)m(ersion)g(n)m(um)m(b)s
+(ers)f(of)h(DejaGn)m(u,)i Fr(expect)c Fv(and)h(Tcl,)i(and)e(exits)h
+(without)630 1010 y(running)h(an)m(y)i(tests.)150 1169
+y Fr(-D0)150 1279 y(-D1)336 b Fv(Start)26 b(the)g(in)m(ternal)e(Tcl)h
+(debugger.)39 b(The)25 b(Tcl)g(debugger)h(supp)s(orts)e(breakp)s(oin)m
+(ts,)h(single)630 1388 y(stepping,)42 b(and)e(other)g(common)h
+(debugging)e(activities.)70 b(\(See)41 b Fq(A)g(Debugger)g(for)f(Tcl)
+630 1498 y(Applications)32 b Fv(b)m(y)e(Don)h(Lib)s(es.)1722
+1465 y Fp(2)1758 1498 y Fv(\))630 1632 y(If)c(y)m(ou)h(sp)s(ecify)e(`)p
+Fr(-D1)p Fv(',)j(the)e Fr(expect)f Fv(shell)g(stops)i(at)g(a)g(breakp)s
+(oin)m(t)f(as)h(so)s(on)f(as)h(DejaGn)m(u)630 1742 y(in)m(v)m(ok)m(es)j
+(it.)630 1876 y(If)i(y)m(ou)h(sp)s(ecify)f(`)p Fr(-D0)p
+Fv(',)h(DejaGn)m(u)h(starts)f(as)g(usual,)f(but)g(y)m(ou)h(can)g(en)m
+(ter)g(the)g(debugger)630 1986 y(b)m(y)c(sending)f(an)h(in)m(terrupt)f
+(\(e.g.)42 b(b)m(y)31 b(t)m(yping)2219 1983 y Fk(h)p
+2244 1930 106 4 v 2244 1986 a Fj(C-c)p 2244 2001 V 2345
+1983 a Fk(i)2375 1986 y Fv(\).)p 150 5099 1200 4 v 192
+5165 a Fp(2)275 5198 y Fv(Distributed)d(in)h(P)m(ostScript)h(form)g
+(with)f Fr(expect)g Fv(as)h(the)h(\014le)275 5308 y(`)p
+Fr(expect/tcl-debug.ps)p Fv('.)p eop
+%%Page: 14 16
+14 15 bop 150 -116 a Fv(14)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)p eop
+%%Page: 15 17
+15 16 bop 150 -116 a Fv(Chapter)30 b(4:)41 b(Setting)30
+b Fr(runtest)e Fv(defaults)2055 b(15)150 100 y Fs(4)80
+b(Setting)53 b Fl(runtest)g Fs(defaults)275 334 y Fv(The)46
+b(site)g(con\014guration)h(\014le,)j(`)p Fr(site.exp)p
+Fv(',)f(captures)e(con\014guration-dep)s(enden)m(t)e(v)-5
+b(alues)47 b(and)150 443 y(propagates)36 b(them)f(to)h(the)g(DejaGn)m
+(u)g(test)g(en)m(vironmen)m(t)f(using)f(Tcl)g(v)-5 b(ariables.)54
+b(This)33 b(ties)i(the)h(De-)150 553 y(jaGn)m(u)30 b(test)i(scripts)d
+(in)m(to)h(the)h Fr(configure)d Fv(and)h Fr(make)h Fv(programs.)275
+687 y(DejaGn)m(u)h(supp)s(orts)d(more)j(than)f(one)h(`)p
+Fr(site.exp)p Fv(')d(\014le.)40 b(The)30 b(m)m(ultiple)e(instances)i
+(of)h(`)p Fr(site.exp)p Fv(')150 797 y(are)f(loaded)f(in)g(a)h(\014xed)
+f(order)g(built)f(in)m(to)h(DejaGn)m(u)i(\(the)f(more)g(lo)s(cal)f
+(last\).)41 b(The)29 b(\014rst)g(\014le)g(loaded)g(is)150
+907 y(the)i(optional)e Fr(~/.dejagnurc)p Fv(,)e(then)j(the)h(lo)s(cal)f
+(\014les,)f(and)h(\014nally)e(the)j(global)f(\014le.)199
+1041 y(1.)61 b(There)23 b(is)f(am)i(optional)e(\\master")j(`)p
+Fr(site.exp)p Fv(',)e(capturing)g(con\014guration)f(v)-5
+b(alues)23 b(that)h(apply)e(to)330 1151 y(DejaGn)m(u)32
+b(across)g(the)f(b)s(oard,)g(in)f(eac)m(h)i(con\014guration-sp)s
+(eci\014c)e(sub)s(directory)f(of)j(the)f(DejaGn)m(u)330
+1260 y(library)g(directory)-8 b(.)49 b Fr(runtest)31
+b Fv(loads)i(these)g(v)-5 b(alues)33 b(\014rst.)48 b(See)34
+b(App)s(endix)c(A)j([Con\014guring)f(and)330 1370 y(Installing)h
+(DejaGn)m(u],)38 b(page)f(49.)57 b(The)35 b(master)h(`)p
+Fr(site.exp)p Fv(')e(con)m(tains)i(the)f(default)g(v)-5
+b(alues)35 b(for)330 1479 y(all)f(targets)j(and)d(hosts)h(supp)s(orted)
+f(b)m(y)h(DejaGn)m(u.)56 b(This)33 b(master)j(\014le)e(is)g(iden)m
+(ti\014ed)g(b)m(y)h(setting)330 1589 y(the)27 b(en)m(vironmen)m(t)g(v)
+-5 b(ariable)26 b Fr(DEJAGNU)f Fv(to)j(the)g(name)f(of)g(the)h(\014le.)
+39 b(This)25 b(is)h(also)h(refered)g(to)h(as)g(the)330
+1699 y(\\global")j(con\014g)f(\014le.)199 1833 y(2.)61
+b(An)m(y)31 b(directory)f(con)m(taining)g(a)h(con\014gured)f(test)h
+(suite)f(also)g(has)h(a)g(`)p Fr(site.exp)p Fv(',)e(capturing)g(con-)
+330 1943 y(\014guration)g(v)-5 b(alues)29 b(sp)s(eci\014c)f(to)i(the)g
+(to)s(ol)g(under)e(test.)41 b(Since)29 b Fr(runtest)f
+Fv(loads)h(these)h(v)-5 b(alues)29 b(last,)330 2052 y(the)40
+b(individual)35 b(test)40 b(con\014guration)g(can)f(either)h(rely)e(on)
+i(and)f(use,)j(or)e(o)m(v)m(erride,)i(an)m(y)e(of)g(the)330
+2162 y(global)30 b(v)-5 b(alues)29 b(from)h(the)h(\\master")g(`)p
+Fr(site.exp)p Fv('.)330 2296 y(Y)-8 b(ou)24 b(can)g(usually)e(generate)
+j(or)f(up)s(date)f(the)h(testsuite)g(`)p Fr(site.exp)p
+Fv(')e(b)m(y)i(t)m(yping)f(`)p Fr(make)30 b(site.exp)p
+Fv(')330 2406 y(in)f(the)i(test)g(suite)f(directory)-8
+b(,)30 b(after)h(the)g(test)g(suite)f(is)f(con\014gured.)199
+2540 y(3.)61 b(Y)-8 b(ou)34 b(can)h(also)e(ha)m(v)m(e)j(a)e(\014le)f
+(in)g(y)m(our)g(home)h(directory)g(called)f Fr(.dejagnurc)p
+Fv(.)48 b(This)33 b(gets)h(loaded)330 2650 y(\014rst)j(b)s(efore)g(the)
+g(other)h(con\014g)f(\014les.)61 b(Usually)36 b(this)g(is)h(used)f(for)
+h(p)s(ersonal)f(stu\013,)j(lik)m(e)e(setting)330 2760
+y Fr(all_flag)28 b Fv(so)j(all)e(the)i(output)f(gets)h(prin)m(ted,)e
+(or)h(v)m(erb)s(osit)m(y)h(lev)m(els.)275 2919 y(Y)-8
+b(ou)29 b(can)g(further)f(o)m(v)m(erride)h(the)g(default)g(v)-5
+b(alues)28 b(in)g(a)h(user-editable)f(section)h(of)g(an)m(y)g(`)p
+Fr(site.exp)p Fv(',)150 3029 y(or)h(b)m(y)h(setting)f(v)-5
+b(ariables)29 b(on)h(the)h Fr(runtest)d Fv(command)i(line.)150
+3253 y Fi(4.0.1)63 b(Con\014g)41 b(V)-10 b(ariables)275
+3445 y Fv(DejaGn)m(u)35 b(uses)f(a)h(named)g(arra)m(y)g(in)e(Tcl)h(to)i
+(hold)d(all)h(the)h(info)e(for)i(eac)m(h)h(mac)m(hine.)53
+b(In)34 b(the)h(case)150 3555 y(of)30 b(a)g(canadian)f(cross,)h(this)e
+(means)i(host)f(information)f(as)i(w)m(ell)f(as)g(target)j
+(information.)38 b(The)29 b(named)150 3665 y(arra)m(y)38
+b(is)e(called)g Fr(target_info)p Fv(,)g(and)g(it)h(has)g(t)m(w)m(o)h
+(indices.)59 b(The)36 b(follo)m(wing)g(\014elds)f(are)j(part)f(of)g
+(the)150 3774 y(arra)m(y)-8 b(.)150 3934 y Fr(name)288
+b Fv(The)36 b(name)g(of)g(the)g(target.)59 b(\(mostly)36
+b(for)g(error)g(messages\))h(This)d(should)g(also)i(b)s(e)g(the)630
+4043 y(string)24 b(used)g(for)h(this)e(target's)k(arra)m(y)-8
+b(.)40 b(It)25 b(should)e(also)i(b)s(e)f(the)h(same)g(as)h(the)f(link)m
+(er)e(script)630 4153 y(so)38 b(w)m(e)g(can)g(\014nd)e(them)h
+(dynamically)-8 b(.)60 b(This)36 b(should)g(b)s(e)g(the)i(same)g(as)g
+(the)f(argumen)m(t)630 4262 y(used)30 b(for)g Fr(push_target{})p
+Fv(.)150 4422 y Fr(ldflags)144 b Fv(This)45 b(is)g(the)i(link)m(er)d
+(\015ags)j(required)e(to)i(pro)s(duce)e(a)i(fully)d(link)m(ed)h
+(executable.)89 b(F)-8 b(or)630 4531 y Fr(libgloss)28
+b Fv(supp)s(orted)h(targets)i(this)f(is)f(usually)f(just)i(the)h(name)f
+(of)h(the)f(link)m(er)f(script.)150 4691 y Fr(config)192
+b Fv(The)37 b(target)j(canonical)d(for)h(this)e(target.)65
+b(This)36 b(is)h(used)g(b)m(y)g(some)i(init)d(\014les)g(to)j(mak)m(e)
+630 4800 y(sure)30 b(the)g(target)i(is)e(supp)s(orted.)150
+4960 y Fr(cflags)192 b Fv(The)30 b(\015ags)g(required)f(to)i(pro)s
+(duce)e(an)i(ob)5 b(ject)31 b(\014le)e(from)h(a)h(source)g(\014le.)150
+5119 y Fr(connect)144 b Fv(This)29 b(is)h(the)h(connectmo)s(de)g(for)g
+(this)e(target.)44 b(This)29 b(is)g(for)i(b)s(oth)f(IP)g(and)h(serial)e
+(connec-)630 5229 y(tions.)40 b(T)m(ypically)29 b(this)g(is)g(either)h
+Fr(telnet)p Fv(,)f Fr(rlogin)p Fv(,)g(or)h Fr(rsh)p Fv(.)p
+eop
+%%Page: 16 18
+16 17 bop 150 -116 a Fv(16)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fr(target)192
+b Fv(This)26 b(is)i(the)g(hostname)h(of)f(the)h(target.)41
+b(This)27 b(is)g(for)h(TCP/IP)g(based)g(connections,)h(and)630
+193 y(is)g(also)i(used)e(for)h(v)m(ersion)g(of)h(tip)e(that)i(use)f
+(/etc/remote.)150 352 y Fr(serial)192 b Fv(This)29 b(is)g(the)i(serial)
+e(p)s(ort.)40 b(This)28 b(is)i(t)m(ypically)f(/dev/tt)m(y?)42
+b(or)31 b(com?:.)150 511 y Fr(netport)144 b Fv(This)29
+b(is)g(the)i(IP)f(p)s(ort.)40 b(This)29 b(is)g(commonly)h(used)g(for)g
+(telneting)g(to)h(target)h(b)s(oards)d(that)630 621 y(are)g(connected)g
+(to)g(a)f(terminal)f(serv)m(er.)40 b(In)28 b(that)h(case)g(the)f(IP)g
+(p)s(ort)g(sp)s(eci\014es)f(the)h(whic)m(h)630 731 y(serial)h(p)s(ort)h
+(to)h(use.)150 890 y Fr(baud)288 b Fv(This)29 b(is)g(the)i(baud)e(rate)
+i(for)f(a)h(serial)e(p)s(ort)h(connection.)150 1049 y
+Fr(x10)336 b Fv(This)29 b(is)h(the)h(parameters)h(for)f(an)f(x10)i(con)
+m(troller.)43 b(These)30 b(are)i(simple)d(devices)h(that)i(let)630
+1159 y(us)e(p)s(o)m(w)m(er)g(cycle)h(or)f(reset)h(a)g(target)h(b)s
+(oard)d(remotely)-8 b(.)150 1318 y Fr(fileid)192 b Fv(This)29
+b(is)g(the)i(\014leid)d(or)i(spa)m(wn)g(id)f(of)h(of)h(the)g
+(connection.)150 1478 y Fr(prompt)192 b Fv(a)31 b(glob)f(st)m(yle)g
+(pattern)h(to)g(recognize)g(the)g(prompt.)150 1637 y
+Fr(abbrev)192 b Fv(abbreviation)29 b(for)h(to)s(ol)h(init)d(\014les.)
+150 1797 y Fr(ioport)192 b Fv(This)30 b(is)h(the)h(p)s(ort)f(for)h(I/O)
+g(on)g(dual)e(p)s(ort)i(systems.)45 b(In)31 b(this)g(con\014guration,)h
+(the)g(main)630 1906 y(serial)f(p)s(ort)g Fr(0)h Fv(is)f(usually)f
+(used)h(for)h(stdin)e(and)i(stdout,)h(whic)m(h)d(the)j(second)f(serial)
+f(p)s(ort)630 2016 y(can)g(b)s(e)e(used)h(for)g(debugging.)275
+2175 y(The)d(\014rst)f(index)h(in)m(to)g(the)h(arra)m(y)g(is)f(the)g
+(same)h(v)-5 b(alue)27 b(as)h(used)f(in)f(the)i Fr(name)e
+Fv(\014eld.)39 b(This)26 b(is)g(usually)150 2285 y(a)33
+b(short)g(v)m(ersion)f(of)h(the)g(name)g(of)g(the)g(target)h(b)s(oard.)
+47 b(F)-8 b(or)33 b(an)g(example,)g(here's)g(the)g(settings)g(I)f(use)
+150 2394 y(for)f(m)m(y)h Fr(Motorola's)d(IDP)i Fv(b)s(oard)g(and)g(m)m
+(y)h Fr(Motorola)d Fv(6U)j(VME)g Fr(MVME135-1)d Fv(b)s(oard.)44
+b(\(b)s(oth)31 b(m68k)150 2504 y(targets\))150 2588 y
+Fm(\013)p 200 2588 3554 4 v 3553 w(\010)p 150 4758 4
+2123 v 178 2741 a Fr(#)48 b(IDP)f(board)178 2845 y(set)g
+(target_info\(idp,name\))328 b("idp")178 2948 y(set)47
+b(target_info\(idp,ldflags\))184 b("-Tidp.ld")178 3052
+y(set)47 b(target_info\(idp,config\))232 b(m68k-unknown-aout)178
+3156 y(set)47 b(target_info\(idp,cflags\))232 b("")178
+3260 y(set)47 b(target_info\(idp,connect\))184 b(telnet)178
+3363 y(set)47 b(target_info\(idp,target\))232 b("s7")178
+3467 y(set)47 b(target_info\(idp,serial\))232 b("tstty7")178
+3571 y(set)47 b(target_info\(idp,netport\))184 b("wharfrat:1007")178
+3675 y(set)47 b(target_info\(idp,baud\))328 b("9600")178
+3779 y(#)48 b(MVME)e(135)h(board)178 3882 y(set)g
+(target_info\(idp,name\))328 b("mvme")178 3986 y(set)47
+b(target_info\(idp,ldflags\))184 b("-Tmvme.ld")178 4090
+y(set)47 b(target_info\(idp,config\))232 b(m68k-unknown-aout)178
+4194 y(set)47 b(target_info\(idp,cflags\))232 b("")178
+4297 y(set)47 b(target_info\(idp,connect\))184 b(telnet)178
+4401 y(set)47 b(target_info\(idp,target\))232 b("s8")178
+4505 y(set)47 b(target_info\(idp,serial\))232 b("tstty8")178
+4609 y(set)47 b(target_info\(idp,netport\))184 b("wharfrat:1008")178
+4713 y(set)47 b(target_info\(idp,baud\))328 b("9600")p
+3803 4758 V 150 4810 a Fm(\012)p 200 4810 3554 4 v 3553
+w(\011)275 4954 y Fv(DejaGn)m(u)37 b(can)g(use)g(this)f(information)f
+(to)i(switc)m(h)g(b)s(et)m(w)m(een)g(m)m(ultiple)e(targets)j(in)d(one)i
+(test)h(run.)150 5064 y(This)29 b(is)g(done)h(through)g(the)g(use)g(of)
+h(the)g Fr(push_target)c Fv(pro)s(cedure,)i(whic)m(h)g(is)h(discussed)e
+(elsewhere.)275 5199 y(This)35 b(arra)m(y)j(can)f(also)h(hold)d
+(information)h(for)h(a)h(remote)g(host,)h(whic)m(h)d(is)g(used)h(when)f
+(testing)i(a)150 5308 y(candain)d(cross.)59 b(In)35 b(this)g(case,)k
+(the)e(only)e(thing)g(di\013eren)m(t)h(is)f(the)i(index)e(is)g(just)h
+Fr(host)p Fv(.)57 b(Here's)37 b(the)p eop
+%%Page: 17 19
+17 18 bop 150 -116 a Fv(Chapter)30 b(4:)41 b(Setting)30
+b Fr(runtest)e Fv(defaults)2055 b(17)150 83 y(settings)32
+b(I)f(use)h(to)g(run)e(tests)j(on)f(m)m(y)f(NT)h(mac)m(hine)f(while)f
+(running)f(DejaGn)m(u)k(on)e(a)h(Unix)f(mac)m(hine.)150
+193 y(\(in)e(this)h(case)h(a)g(Lin)m(ux)e(b)s(o)m(x\))150
+276 y Fm(\013)p 200 276 3554 4 v 3553 w(\010)p 150 793
+4 470 v 178 437 a Fr(set)47 b(target_info\(host,name\))280
+b("nt-host")178 541 y(set)47 b(target_info\(host,config\))184
+b("386-unknown-winnt")178 645 y(set)47 b(target_info\(host,connect\))
+136 b("telnet")178 748 y(set)47 b(target_info\(host,target\))184
+b("ripple")p 3803 793 V 150 845 a Fm(\012)p 200 845 3554
+4 v 3553 w(\011)275 990 y Fv(There)31 b(is)f(more)i(info)f(on)g(ho)m(w)
+h(to)g(use)g(these)g(v)-5 b(ariables)30 b(in)g(the)i(sections)g(on)f
+(the)h(con\014g)g(\014les.)44 b(See)150 1100 y(Chapter)30
+b(4)h([Con\014guration)e(Files],)h(page)h(18.)275 1234
+y(In)37 b(the)h(user)g(editable)f(second)h(section)h(of)f(`)p
+Fr(site.exp)p Fv(',)h(y)m(ou)f(can)h(not)f(only)g(o)m(v)m(erride)g(the)
+g(con-)150 1344 y(\014guration)32 b(v)-5 b(ariables)31
+b(captured)h(in)g(the)h(\014rst)e(section,)j(but)e(also)h(sp)s(ecify)e
+(default)h(v)-5 b(alues)32 b(for)g(all)g(the)150 1454
+y Fr(runtest)d Fv(command)h(line)f(options.)42 b(Sa)m(v)m(e)32
+b(for)e(`)p Fr(--debug)p Fv(',)g(`)p Fr(--help)p Fv(',)g(and)g(`)p
+Fr(--version)p Fv(',)f(eac)m(h)j(com-)150 1563 y(mand)j(line)f(option)i
+(has)g(an)g(asso)s(ciated)g(Tcl)f(v)-5 b(ariable.)57
+b(Use)36 b(the)g(Tcl)f Fr(set)g Fv(command)h(to)h(sp)s(ecify)e(a)150
+1673 y(new)j(default)h(v)-5 b(alue)38 b(\(as)h(for)g(the)g
+(con\014guration)g(v)-5 b(ariables\).)65 b(The)38 b(follo)m(wing)g
+(table)h(describ)s(es)e(the)150 1782 y(corresp)s(ondence)j(b)s(et)m(w)m
+(een)h(command)g(line)d(options)i(and)g(v)-5 b(ariables)39
+b(y)m(ou)i(can)g(set)g(in)e(`)p Fr(site.exp)p Fv('.)150
+1892 y(See)31 b(Chapter)e(3)i([Running)d(the)j(T)-8 b(ests],)31
+b(page)g(9,)g(for)g(explanations)e(of)h(the)h(command-line)e(options.)
+350 2033 y Fn(runtest)187 b(Tcl)379 2143 y(option)h(variable)395
+b(description)p 150 2178 3600 4 v 341 2288 a Fr(--all)233
+b(all)p 964 2288 29 4 v 33 w(flag)333 b Fv(displa)m(y)29
+b(all)g(test)i(results)e(if)h(set)293 2397 y Fr(--baud)233
+b(baud)510 b Fv(set)31 b(the)g(default)e(baud)g(rate)j(to)f(something)
+1516 2507 y(other)g(than)f(9600.)150 2611 y Fr(--connect)232
+b(connectmode)174 b Fv(`)p Fr(rlogin)p Fv(',)30 b(`)p
+Fr(telnet)p Fv(',)f(`)p Fr(rsh)p Fv(',)h(`)p Fr(kermit)p
+Fv(',)g(`)p Fr(tip)p Fv(',)1516 2721 y(or)h(`)p Fr(mondfe)p
+Fv(')293 2840 y Fr(--mail)233 b(mailing)p 1156 2840 V
+32 w(list)142 b Fv(address)30 b(list)f(for)h(mailing)e(test)j(output)
+293 2949 y Fr(--name)233 b(targetname)222 b Fv(net)m(w)m(ork)31
+b(name)g(of)f(testing)h(target)h(or)e(its)1516 3059 y(host)198
+3177 y Fr(--outdir)232 b(outdir)414 b Fv(directory)30
+b(for)g(`)p Fq(to)s(ol)p Fr(.sum)p Fv(')g(and)g(`)p Fq(to)s(ol)p
+Fr(.log)p Fv(')198 3287 y Fr(--objdir)232 b(objdir)414
+b Fv(directory)30 b(for)g(compiled)f(binaries)198 3397
+y Fr(--reboot)232 b(reboot)414 b Fv(reb)s(o)s(ot)30 b(the)h(target)h
+(if)d(set)i(to)g Fr("1")p Fv(;)f(do)g(not)1516 3506 y(reb)s(o)s(ot)g
+(if)g(set)h(to)g Fr("0")e Fv(\(the)i(default\))198 3625
+y Fr(--srcdir)232 b(srcdir)414 b Fv(directory)30 b(of)h(test)g(sub)s
+(directories)198 3734 y Fr(--strace)232 b(tracelevel)222
+b Fv(a)31 b(n)m(um)m(b)s(er:)44 b(Tcl)30 b(trace)i(depth)293
+3844 y Fr(--tool)233 b(tool)510 b Fv(name)31 b(of)f(to)s(ol)g(to)i
+(test;)f(iden)m(ti\014es)e(init,)g(test)1516 3954 y(sub)s(dir)150
+4058 y Fr(--verbose)232 b(verbose)366 b Fv(v)m(erb)s(osit)m(y)30
+b(lev)m(el.)46 b(As)30 b(option,)g(use)g(m)m(ultiple)1516
+4167 y(times;)g(as)h(v)-5 b(ariable,)29 b(set)i(a)g(n)m(um)m(b)s(er,)e
+(0)i(or)1516 4277 y(greater)198 4381 y Fr(--target)232
+b(target)p 1108 4381 V 32 w(triplet)46 b Fv(The)30 b(canonical)g
+(con\014guration)g(string)f(for)1516 4491 y(the)i(target.)293
+4595 y Fr(--host)233 b(host)p 1012 4595 V 33 w(triplet)141
+b Fv(The)30 b(canonical)g(con\014guration)g(string)f(for)1516
+4705 y(the)i(host.)245 4809 y Fr(--build)233 b(build)p
+1060 4809 V 33 w(triplet)93 b Fv(The)30 b(canonical)g(con\014guration)g
+(string)f(for)1516 4919 y(the)i(build)c(host.)p eop
+%%Page: 18 20
+18 19 bop 150 -116 a Fv(18)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fi(4.0.2)63
+b(Master)41 b(Con\014g)h(File)275 276 y Fv(The)28 b(master)i(con\014g)g
+(\014le)e(is)h(where)g(all)f(the)i(target)g(sp)s(eci\014c)f(con\014g)g
+(v)-5 b(ariables)28 b(get)j(set)f(for)f(a)h(whole)150
+385 y(site)39 b(get)h(set.)67 b(The)38 b(idea)g(is)g(that)i(for)f(a)g
+(cen)m(tralized)g(testing)g(lab)f(where)g(p)s(eople)g(ha)m(v)m(e)i(to)g
+(share)f(a)150 495 y(target)31 b(b)s(et)m(w)m(een)f(m)m(ultiple)d(dev)m
+(elop)s(ers.)39 b(There)29 b(are)h(settings)f(for)g(b)s(oth)g(remote)h
+(targets)g(and)f(remote)150 604 y(hosts.)51 b(Here's)35
+b(an)f(example)g(of)g(a)g(Master)h(Con\014g)e(File)g(\(also)i(called)e
+(the)h(Global)f(con\014g)h(\014le\))g(for)g(a)150 714
+y Fn(c)-5 b(anadian)32 b(cr)-5 b(oss)p Fv(.)42 b(A)28
+b(canadian)f(cross)h(is)f(when)g(y)m(ou)i(build)c(and)i(test)i(a)f
+(cross)g(compiler)f(on)h(a)g(mac)m(hine)150 824 y(other)j(than)f(the)g
+(one)h(it's)f(to)h(b)s(e)f(hosted)g(on.)275 958 y(Here)f(w)m(e)g(ha)m
+(v)m(e)h(the)f(con\014g)f(settings)h(for)f(our)h(California)d(o\016ce.)
+41 b(Note)30 b(that)f(all)f(con\014g)h(v)-5 b(alues)28
+b(are)150 1068 y(site)36 b(dep)s(endan)m(t.)58 b(Here)36
+b(w)m(e)h(ha)m(v)m(e)h(t)m(w)m(o)f(sets)g(of)f(v)-5 b(alues)36
+b(that)h(w)m(e)g(use)e(for)i(testing)f(m68k-aout)i(cross)150
+1177 y(compilers.)56 b(As)36 b(b)s(oth)f(of)h(these)h(target)g(b)s
+(oards)e(has)h(a)g(di\013eren)m(t)f(debugging)g(proto)s(col,)j(w)m(e)e
+(test)h(on)150 1287 y(b)s(oth)30 b(of)g(them)h(in)e(sequence.)150
+1366 y Fm(\013)p 200 1366 3554 4 v 3553 w(\010)p 150
+4664 4 3252 v 178 1519 a Fr(global)46 b(CFLAGS)178 1622
+y(global)g(CXXFLAGS)178 1830 y(case)h("$target_triplet")c(in)k({)369
+1934 y({)h("native")d(})j({)560 2038 y(set)f(target_abbrev)d(unix)369
+2141 y(})369 2245 y({)k("m68*-unknown-aout")42 b(})48
+b({)560 2349 y(set)f(target_abbrev)712 b("rom68k")560
+2453 y(#)47 b(IDP)g(target)953 b(#)48 b(IDP)f(board)f(with)h(rom68k)f
+(monitor)560 2556 y(set)h(target_info\(idp,name\))328
+b("idp")560 2660 y(set)47 b(target_info\(idp,ldflags\))184
+b("-Tidp.ld")560 2764 y(set)47 b(target_info\(idp,config\))232
+b(m68k-unknown-aout)560 2868 y(set)47 b(target_info\(idp,cflags\))232
+b("")560 2972 y(set)47 b(target_info\(idp,connect\))184
+b(telnet)560 3075 y(set)47 b(target_info\(idp,target\))232
+b("s7")560 3179 y(set)47 b(target_info\(idp,serial\))232
+b("tstty12")560 3283 y(set)47 b(target_info\(idp,netport\))184
+b("truckin:1007")560 3387 y(set)47 b(target_info\(idp,baud\))328
+b("9600")560 3490 y(#)47 b(MVME)g(target)905 b(#)48 b(Motorola)d(MVME)i
+(135)g(with)f(BUG)h(monitor)560 3594 y(set)g(target_info\(mvme,name\))
+280 b("mvme")560 3698 y(set)47 b(target_info\(mvme,ldflags)o(\))137
+b("-Tmvme.ld")560 3802 y(set)47 b(target_info\(mvme,config\))184
+b(m68k-unknown-aout)560 3906 y(set)47 b(target_info\(mvme,cflags\))184
+b("")560 4009 y(set)47 b(target_info\(mvme,connect)o(\))137
+b(telnet)560 4113 y(set)47 b(target_info\(mvme,target\))184
+b("s4")560 4217 y(set)47 b(target_info\(mvme,serial\))184
+b("tstty8")560 4321 y(set)47 b(target_info\(mvme,netport)o(\))137
+b("truckin:1004")560 4424 y(set)47 b(target_info\(mvme,baud\))280
+b("9600")417 4528 y(})178 4632 y(})p 3803 4664 V 150
+4716 a Fm(\012)p 200 4716 3554 4 v 3553 w(\011)275 4861
+y Fv(In)27 b(this)g(case,)j(w)m(e)f(ha)m(v)m(e)h(supp)s(ort)c(for)i
+(sev)m(eral)h(remote)g(hosts)g(for)f(our)g(m68k-aout)i(cross)e
+(compiler.)150 4971 y(T)m(ypically)h(the)j(remote)g(Unix)e(hosts)h(run)
+f(DejaGn)m(u)i(lo)s(cally)-8 b(,)31 b(but)f(w)m(e)i(also)f(use)g(them)g
+(for)g(debugging)150 5080 y(the)c(testsuites)f(when)g(w)m(e)h(\014nd)e
+(problems)g(in)g(running)f(on)j(remote)g(hosts.)40 b(Exp)s(ect)26
+b(w)m(on't)h(run)e(on)i(NT,)150 5190 y(so)j(DejaGn)m(u)h(is)e(run)f(on)
+i(the)g(lo)s(cal)f(build)d(mac)m(hine,)k(and)g(it'll)e(connect)i(to)h
+(the)f(NT)g(host)f(and)h(run)e(all)150 5300 y(the)j(tests)g(for)f(this)
+f(cross)i(compiler)e(on)h(that)h(host.)p eop
+%%Page: 19 21
+19 20 bop 150 -116 a Fv(Chapter)30 b(4:)41 b(Setting)30
+b Fr(runtest)e Fv(defaults)2055 b(19)390 52 y Fm(\013)p
+440 52 3314 4 v 3313 w(\010)p 390 3063 4 2964 v 418 228
+a Fr(case)47 b("$host_triplet")c(in)48 b({)609 332 y("native")e({)609
+436 y(})609 540 y("i?86-*-linux*")e({)906 b(#)48 b(Linux)e(host)800
+643 y(set)h(target_info\(host,name\))280 b("linux-host")800
+747 y(set)47 b(target_info\(host,config\))184 b($host_triplet)800
+851 y(set)47 b(target_info\(host,connect)o(\))137 b(rlogin)800
+955 y(set)47 b(target_info\(host,target\))184 b(chinadoll)609
+1059 y(})609 1162 y("i?86-*-winnt)1094 b(#)48 b(NT)f(host)800
+1266 y(set)g(target_info\(host,name\))280 b("nt-host")800
+1370 y(set)47 b(target_info\(host,config\))184 b(i386-unknown-winnt)800
+1474 y(set)47 b(target_info\(host,connect)o(\))137 b(telnet)800
+1577 y(set)47 b(target_info\(host,target\))184 b(ripple)609
+1681 y(})609 1785 y("hppa*-hp-hpux*")43 b({)859 b(#)48
+b(HP-UX)e(host)800 1889 y(set)h(target_info\(host,name\))280
+b("hpux-host")800 1993 y(set)47 b(target_info\(host,config\))184
+b($host_triplet)800 2096 y(set)47 b(target_info\(host,connect)o(\))137
+b(rlogin)800 2200 y(set)47 b(target_info\(host,target\))184
+b(slipknot)800 2304 y(})609 2408 y("sparc-sun-sunos*")43
+b({)763 b(#)48 b(SunOS)e(\(sun4\))800 2511 y(set)h
+(target_info\(host,name\))280 b("sunos-host")800 2615
+y(set)47 b(target_info\(host,config\))184 b($host_triplet)800
+2719 y(set)47 b(target_info\(host,connect)o(\))137 b(rlogin)800
+2823 y(set)47 b(target_info\(host,target\))184 b(darkstar)609
+2927 y(})418 3030 y(})p 3803 3063 V 390 3115 a Fm(\012)p
+440 3115 3314 4 v 3313 w(\011)150 3339 y Fi(4.0.3)63
+b(Lo)s(cal)40 b(Con\014g)i(File)275 3531 y Fv(It)33 b(is)g(usually)e
+(more)j(con)m(v)m(enien)m(t)h(to)f(k)m(eep)h(these)f(\\man)m(ual)f(o)m
+(v)m(errides")i(in)d(the)i(`)p Fr(site.exp)p Fv(')e(lo)s(cal)150
+3641 y(to)f(eac)m(h)h(test)f(directory)-8 b(,)30 b(rather)h(than)f(in)f
+(the)h(\\master")i(`)p Fr(site.exp)p Fv(')d(in)g(the)h(DejaGn)m(u)i
+(library)-8 b(.)275 3776 y(All)36 b(lo)s(cal)g(`)p Fr(site.exp)p
+Fv(')g(usually)f(\014les)i(ha)m(v)m(e)h(t)m(w)m(o)h(sections,)h
+(separated)e(b)m(y)f(commen)m(t)h(text.)63 b(The)150
+3885 y(\014rst)23 b(section)i(is)e(the)h(part)g(that)g(is)g(generated)h
+(b)m(y)f Fr(make)p Fv(.)37 b(It)24 b(is)f(essen)m(tially)g(a)i
+(collection)f(of)g(Tcl)f(v)-5 b(ariable)150 3995 y(de\014nitions)30
+b(based)j(on)g(`)p Fr(Makefile)p Fv(')e(en)m(vironmen)m(t)h(v)-5
+b(ariables.)47 b(Since)32 b(they)h(are)g(generated)h(b)m(y)f
+Fr(make)p Fv(,)150 4104 y(they)27 b(con)m(tain)h(the)f(v)-5
+b(alues)27 b(as)g(sp)s(eci\014ed)f(b)m(y)h Fr(configure)p
+Fv(.)37 b(\(Y)-8 b(ou)28 b(can)f(also)g(customize)h(these)g(v)-5
+b(alues)26 b(b)m(y)150 4214 y(using)d(the)h(`)p Fr(--site)p
+Fv(')e(option)i(to)h Fr(configure)p Fv(.\))36 b(In)23
+b(particular,)h(this)f(section)h(con)m(tains)g(the)h(`)p
+Fr(Makefile)p Fv(')150 4323 y(v)-5 b(ariables)34 b(for)h(host)h(and)f
+(target)i(con\014guration)e(data.)57 b(Do)36 b(not)g(edit)f(this)f
+(\014rst)h(section;)j(if)d(y)m(ou)h(do,)150 4433 y(y)m(our)30
+b(c)m(hanges)i(are)e(replaced)g(next)h(time)f(y)m(ou)h(run)e
+Fr(make)p Fv(.)275 4568 y(The)g(\014rst)h(section)h(starts)f(with:)150
+4629 y Fm(\013)p 200 4629 3554 4 v 3553 w(\010)p 150
+5014 4 338 v 178 4782 a Fr(##)47 b(these)g(variables)e(are)i
+(automatically)d(generated)h(by)j(make)e(##)178 4885
+y(#)i(Do)f(not)g(edit)f(here.)h(If)g(you)g(wish)f(to)i(override)d
+(these)i(values)178 4989 y(#)h(add)f(them)f(to)h(the)g(last)g(section)p
+3803 5014 V 150 5066 a Fm(\012)p 200 5066 3554 4 v 3553
+w(\011)275 5216 y Fv(In)23 b(the)h(second)g(section,)i(y)m(ou)e(can)g
+(o)m(v)m(erride)g(an)m(y)h(default)e(v)-5 b(alues)23
+b(\(lo)s(cally)g(to)i(DejaGn)m(u\))g(for)f(all)f(the)150
+5326 y(v)-5 b(ariables.)39 b(The)29 b(second)h(section)g(can)g(also)g
+(con)m(tain)g(y)m(our)g(preferred)e(defaults)h(for)h(all)e(the)i
+(command)p eop
+%%Page: 20 22
+20 21 bop 150 -116 a Fv(20)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y(line)30 b(options)h(to)h
+Fr(runtest)p Fv(.)43 b(This)30 b(allo)m(ws)h(y)m(ou)g(to)i(easily)e
+(customize)h Fr(runtest)d Fv(for)j(y)m(our)f(preferences)150
+193 y(in)41 b(eac)m(h)j(con\014gured)e(test-suite)h(tree,)j(so)d(that)g
+(y)m(ou)g(need)f(not)h(t)m(yp)s(e)g(options)e(rep)s(eatedly)h(on)h(the)
+150 302 y(command)31 b(line.)41 b(\(The)31 b(second)g(section)g(ma)m(y)
+g(also)g(b)s(e)g(empt)m(y)-8 b(,)32 b(if)e(y)m(ou)h(do)g(not)h(wish)d
+(to)i(o)m(v)m(erride)h(an)m(y)150 412 y(defaults.\))275
+546 y(The)d(\014rst)h(section)h(ends)e(with)g(this)g(line:)150
+607 y Fm(\013)p 200 607 3554 4 v 3553 w(\010)p 150 806
+4 151 v 178 760 a Fr(##)47 b(All)g(variables)f(above)g(are)h(generated)
+e(by)i(configure.)e(Do)i(Not)g(Edit)g(##)p 3803 806 V
+150 857 a Fm(\012)p 200 857 3554 4 v 3553 w(\011)275
+1002 y Fv(Y)-8 b(ou)31 b(can)f(mak)m(e)i(an)m(y)f(c)m(hanges)g(under)e
+(this)h(line.)40 b(If)30 b(y)m(ou)h(wish)d(to)k(rede\014ne)d(a)i(v)-5
+b(ariable)30 b(in)f(the)i(top)150 1112 y(section,)k(then)f(just)f(put)h
+(a)g(duplicate)f(v)-5 b(alue)33 b(in)g(this)g(second)h(section.)51
+b(Usually)33 b(the)h(v)-5 b(alues)33 b(de\014ned)150
+1221 y(in)c(this)h(con\014g)h(\014le)f(are)h(related)g(to)h(the)f
+(con\014guration)f(of)h(the)g(test)g(run.)41 b(This)29
+b(is)h(the)h(ideal)e(place)i(to)150 1331 y(set)g(the)g(v)-5
+b(ariables)29 b Fr(host_triplet)p Fv(,)e Fr(build_triplet)p
+Fv(,)g Fr(target_triplet)p Fv(.)38 b(All)29 b(other)h(v)-5
+b(ariables)30 b(are)150 1441 y(to)s(ol)i(dep)s(endan)m(t.)46
+b(ie)32 b(for)g(testing)h(a)g(compiler,)e(the)i(v)-5
+b(alue)32 b(for)g Fq(CC)40 b Fv(migh)m(t)32 b(b)s(e)g(set)g(to)i(a)e
+(freshly)f(built)150 1550 y(binary)-8 b(,)29 b(as)i(opp)s(osed)e(to)j
+(one)e(in)f(the)i(user's)f(path.)150 1774 y Fi(4.0.4)63
+b(P)m(ersonal)41 b(Con\014g)g(File)275 1967 y Fv(The)j(p)s(ersonal)g
+(con\014g)h(\014le)f(is)g(used)g(to)i(customize)g Fr(runtest's)c
+Fv(b)s(eha)m(viour)i(for)h(eac)m(h)h(p)s(erson.)150 2077
+y(It's)33 b(t)m(ypically)f(used)g(to)i(set)g(the)f(user)f(prefered)g
+(setting)h(for)g(v)m(erb)s(osit)m(y)-8 b(,)34 b(and)f(an)m(y)g(exp)s
+(erimen)m(tal)f(Tcl)150 2186 y(pro)s(cedures.)39 b(My)31
+b(p)s(ersonal)e(`)p Fr(~/.dejagnurc)p Fv(')e(\014le)j(lo)s(oks)g(lik)m
+(e:)150 2267 y Fm(\013)p 200 2267 V 3553 w(\010)p 150
+2661 4 346 v 178 2421 a Fr(set)47 b(all_flag)f(1)178
+2524 y(set)h(RLOGIN)f(/usr/ucb/rlogin)178 2628 y(set)h(RSH)g
+(/usr/ucb/rsh)p 3803 2661 V 150 2712 a Fm(\012)p 200
+2712 3554 4 v 3553 w(\011)275 2857 y Fv(Here)27 b(I)g(set)h
+Fr(all_flag)d Fv(so)j(I)f(see)h(all)e(the)h(test)i(cases)f(that)g(P)-8
+b(ASS)26 b(along)i(with)e(the)h(ones)h(that)g(F)-10 b(AIL.)150
+2967 y(I)36 b(also)g(set)h Fq(RLOGIN)46 b Fv(and)36 b
+Fr(RSH)f Fv(to)i(the)f(BSD)h(v)m(ersion.)58 b(I)36 b(ha)m(v)m(e)h
+Fr(kerberos)d Fv(installed,)i(and)g(when)f(I)150 3077
+y(rlogin)25 b(to)h(a)h(target)g(b)s(oard,)f(it)g(usually)e(isn't)h
+(supp)s(orted.)38 b(So)25 b(I)h(use)g(the)g(non)g(secure)g(v)m(ersions)
+f(of)h(these)150 3186 y(programs)k(rather)g(than)g(the)h(default)e
+(that's)j(in)d(m)m(y)h(path.)p eop
+%%Page: 21 23
+21 22 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(21)150 100 y Fs(5)80 b(The)54
+b(DejaGn)l(u)e(Implemen)l(tation)275 334 y Fv(DejaGn)m(u)30
+b(is)e(en)m(tirely)h(written)g(in)f Fr(expect)p Fv(,)g(whic)m(h)g(uses)
+h(Tcl)g(as)h(a)g(command)f(language.)41 b Fr(expect)150
+443 y Fv(serv)m(es)26 b(as)f(a)h(v)m(ery)g(programmable)e(shell;)h(y)m
+(ou)h(can)g(run)d(an)m(y)j(program,)g(as)g(with)e(the)h(usual)f(Unix)g
+(com-)150 553 y(mand)30 b(shells|but)e(once)k(the)f(program)f(is)g
+(started,)i(y)m(our)f Fr(expect)e Fv(script)h(has)g(fully)f
+(programmable)150 663 y(con)m(trol)24 b(of)f(its)g(input)e(and)i
+(output.)38 b(This)21 b(do)s(es)i(not)g(just)g(apply)f(to)i(the)f
+(programs)g(under)f(test;)27 b Fr(expect)150 772 y Fv(can)h(also)g(run)
+f(an)m(y)h(auxiliary)e(program,)j(suc)m(h)e(as)i Fr(diff)d
+Fv(or)i Fr(sh)p Fv(,)h(with)d(full)g(con)m(trol)j(o)m(v)m(er)g(its)e
+(input)g(and)150 882 y(output.)275 1016 y(DejaGn)m(u)40
+b(itself)f(is)g(merely)g(a)h(framew)m(ork)g(for)f(the)h(set)g(of)g
+(test)h(suites)e(distributed)e(separately)150 1126 y(for)i(eac)m(h)h
+Fo(gnu)f Fv(to)s(ol.)66 b(F)-8 b(uture)39 b(releases)g(of)g
+Fo(gnu)g Fv(to)s(ols)g(will)d(include)h(ev)m(en)i(more)g(tests,)k(dev)m
+(elop)s(ed)150 1235 y(throughout)30 b(the)h(free)f(soft)m(w)m(are)i
+(comm)m(unit)m(y)-8 b(.)275 1370 y Fr(runtest)29 b Fv(is)h(the)i(glue)f
+(to)h(tie)f(together)i(and)e(manage)h(the)g(test)g(scripts.)43
+b(The)31 b Fr(runtest)e Fv(program)150 1479 y(is)36 b(actually)g(a)h
+(simple)e(Bourne)h(shell)f(script)h(that)h(lo)s(cates)h(a)f(cop)m(y)g
+(of)g(the)g Fr(expect)e Fv(shell)g(and)h(then)150 1589
+y(starts)31 b(the)f(main)g(Tcl)f(co)s(de,)i Fr(runtest.exp)p
+Fv(.)38 b Fr(runtest.exp)27 b Fv(itself)i(has)h(these)h(essen)m(tial)f
+(functions:)199 1724 y(1.)61 b(P)m(arse)21 b(the)f(command)h(line)d
+(options,)k(load)e(the)g(library)e(\014les,)k(and)e(load)g(the)g
+(default)g(con\014guration)330 1833 y(\014les.)199 1968
+y(2.)61 b(Lo)s(cating)41 b(the)g(individual)c(test)42
+b(scripts.)71 b Fr(runtest.exp)38 b Fv(lo)s(cates)j(the)h(tests)f(b)m
+(y)g(exploiting)f(a)330 2077 y(straigh)m(tforw)m(ard)33
+b(naming)g(con)m(v)m(en)m(tion)h(based)g(on)f(the)h(string)e(y)m(ou)i
+(sp)s(ecify)e(with)g(the)i(`)p Fr(--tool)p Fv(')330 2187
+y(option.)199 2321 y(3.)61 b(Pro)m(viding)25 b(an)h(extended)h(test)g
+(en)m(vironmen)m(t,)g(b)m(y)g(de\014ning)d(additional)h(Tcl)g(pro)s
+(cedures)h(b)s(ey)m(ond)330 2431 y(those)31 b(already)f(in)f
+Fr(expect)p Fv(.)199 2565 y(4.)61 b(Lo)s(cating)24 b(target-dep)s
+(enden)m(t)h(functions,)f(to)h(standardize)e(the)i(test)g(en)m
+(vironmen)m(t)e(across)i(a)f(wide)330 2675 y(v)-5 b(ariet)m(y)31
+b(of)f(test)i(platforms.)150 2932 y Fu(5.1)68 b(Con)l(v)l(en)l(tions)47
+b(for)e(using)g(to)t(ol)g(names)275 3125 y Fv(DejaGn)m(u)26
+b(uses)f(`)p Fr($tool)p Fv(',)h(the)g(name)g(of)g(the)g(to)s(ol)f
+(under)g(test,)i(to)g(tie)e(together)j(the)e(testing)f(con\014g-)150
+3235 y(uration)31 b(in)f(a)i(straigh)m(tforw)m(ard)f(but)g(\015exible)f
+(w)m(a)m(y)-8 b(.)45 b(If)32 b(there)f(is)g(only)g(one)g(testsuite)h
+(for)g(a)g(particular)150 3344 y(application,)d(then)h(`)p
+Fr($tool)p Fv(')f(is)h(optional.)275 3479 y(`)p Fr($tool)p
+Fv(')38 b(is)g Fn(not)49 b Fv(used)38 b(to)i(in)m(v)m(ok)m(e)h(the)e
+(to)s(ol,)j(since)d(sites)f(that)i(run)e(m)m(ultiple)f
+(con\014gurations)i(of)150 3588 y(a)47 b(particular)e(to)s(ol)i(often)g
+(call)f(eac)m(h)i(con\014guration)e(b)m(y)h(a)g(di\013eren)m(t)g(name.)
+90 b Fr(runtest)44 b Fv(uses)j(the)150 3698 y(con\014guration-dep)s
+(enden)m(t)40 b(v)-5 b(ariables)40 b(captured)h(in)f(`)p
+Fr(site.exp)p Fv(')f(to)j(determine)e(ho)m(w)h(to)h(call)f(eac)m(h)150
+3807 y(to)s(ol.)275 3942 y Fr(runtest)30 b Fv(uses)h(to)s(ol)h(names)g
+(to)h(\014nd)e(directories)g(con)m(taining)h(tests.)46
+b Fr(runtest)30 b Fv(scans)i(the)h(source)150 4051 y(directory)22
+b(\(sp)s(eci\014ed)g(with)f Fr(--srcdir)p Fv(\))g(for)i(all)e
+(directories)h(whose)h(names)f(start)h(with)f(the)h(to)s(ol)g(name.)150
+4161 y(It)40 b(is)g(a)g(common)h(practice)f(to)h(put)f(a)g(p)s(erio)s
+(d)e(after)j(the)g(to)s(ol)f(part)g(of)g(the)h(name.)70
+b(F)-8 b(or)41 b(instance,)150 4271 y(directories)32
+b(that)i(start)f(with)f(`)p Fr(g++.)p Fv(')h(con)m(tain)g
+Fo(g)p Fr(++)g Fv(tests.)49 b(T)-8 b(o)34 b(add)e(a)i(new)e(test,)j
+(just)e(put)f(it)h(in)f(an)m(y)150 4380 y(directory)24
+b(\(create)j(an)e(en)m(tirely)f(new)g(directory)-8 b(,)27
+b(if)c(y)m(ou)j(wish\))d(whose)i(name)g(follo)m(ws)f(this)g(con)m(v)m
+(en)m(tion.)275 4515 y(A)h(test)g(is)f(an)m(y)h(\014le)f(in)g(an)h
+(appropriately)e(named)h(sub)s(directory)f(whose)i(name)g(ends)f(in)f
+(`)p Fr(.exp)p Fv(')h(\(the)150 4624 y(con)m(v)m(en)m(tional)32
+b(w)m(a)m(y)h(of)f(naming)e Fr(expect)g Fv(scripts\).)44
+b(These)31 b(simple)f(naming)g(con)m(v)m(en)m(tions)j(mak)m(e)g(it)e
+(as)150 4734 y(simple)25 b(as)j(p)s(ossible)c(to)k(install)e(new)g
+(tests:)40 b(all)26 b(y)m(ou)i(m)m(ust)f(do)g(is)f(put)h(the)g(test)i
+(in)d(the)h(righ)m(t)g(directory)-8 b(.)275 4868 y Fr(runtest)31
+b Fv(sorts)i(the)h(tests)g(in)e(eac)m(h)i(sub)s(directory)d(b)m(y)i
+(name)h(\(using)e(the)h(Tcl)g Fr(lsort)f Fv(command\))150
+4978 y(and)e(runs)f(them)h(in)f(the)h(resulting)f(order.)p
+eop
+%%Page: 22 24
+22 23 bop 150 -116 a Fv(22)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fu(5.2)68 b(Initialization)48
+b(mo)t(dule)275 276 y Fv(The)35 b(initialization)d(mo)s(dule)i(\(or)i
+(\\init)e(\014le"\))h(has)g(t)m(w)m(o)i(purp)s(oses:)49
+b(to)36 b(pro)m(vide)f(to)s(ol)h(and)e(target)150 385
+y(dep)s(enden)m(t)29 b(pro)s(cedures,)h(and)g(to)h(start)g(up)e(an)i
+(in)m(teractiv)m(e)g(to)s(ol)f(to)h(the)g(p)s(oin)m(t)e(where)h(it)g
+(is)g(ready)g(to)150 495 y(op)s(erate.)41 b(The)30 b(latter)g(includes)
+d(establishing)h(comm)m(unications)h(with)g(the)h(target.)42
+b(All)28 b(the)j(tests)f(for)150 604 y(in)m(teractiv)m(e)24
+b(programs)e(assume)h(that)g(the)g(to)s(ol)g(is)f(already)h(running)d
+(and)i(comm)m(unicating.)38 b(Initializa-)150 714 y(tion)30
+b(mo)s(dules)e(for)j(non-in)m(teractiv)m(e)g(programs)f(ma)m(y)h(only)e
+(need)h(to)h(supply)d(the)j(supp)s(ort)d(functions.)275
+848 y(Eac)m(h)33 b(test)g(suite)f(directory)g(m)m(ust)h(con)m(tain)g
+(\(in)e(its)h(`)p Fr(config)p Fv(')g(sub)s(directory\))f(a)i(separate)g
+(initial-)150 958 y(ization)27 b(mo)s(dule)f(for)h(eac)m(h)h(target.)41
+b(The)27 b(appropriate)g(init)e(\014le)i(is)f(can)i(b)s(e)e(named)h
+(sev)m(eral)h(w)m(a)m(ys.)40 b(The)150 1068 y(prefered)33
+b(name)h(is)f(the)i Fn(os)42 b Fv(part)34 b(of)g(the)g(canonical)g
+(con\014guration)f(name)h(with)f Fr(.exp)g Fv(as)h(the)h(su\016x.)150
+1177 y(An)e(example)f(w)m(ould)g(b)s(e)h(that)g(for)g(an)g
+Fr(m68k-coff)e Fv(system,)j(the)f Fr(target_os)e Fv(part)i(w)m(ould)e
+(b)s(e)i Fr(coff)p Fv(.)150 1287 y(The)27 b(next)h(w)m(a)m(y)h(is)d
+(for)i(system)g(where)f(there)h(are)g(short)f(\014lenames,)h(or)f(a)h
+(shortcut)g(is)f(desired)f(to)i(refer)150 1396 y(to)j(the)g(OS)f(name)g
+(for)g(that)h(target.)43 b(This)29 b(is)g(uses)h(the)h(v)-5
+b(alue)30 b(of)h Fr($target_abbrev)26 b Fv(rather)31
+b(than)f(the)150 1506 y Fr(target_os)p Fv(.)275 1641
+y(The)h(\014nal)h(\014le)f(lo)s(ok)m(ed)i(for)f(is)f(simply)f(`)p
+Fr(default.exp)p Fv('.)45 b(If)31 b(there)i(is)f(only)f(one)i(op)s
+(erating)f(system)150 1750 y(to)26 b(supp)s(ort,)f(then)f(this)g
+(\014le)h(can)g(b)s(e)g(used.)38 b(It's)25 b(main)f(purp)s(ose)g(is)g
+(to)i(o\013er)f(some)h(supp)s(ort)d(for)i(new)g(op-)150
+1860 y(erating)i(systems,)i(or)e(for)h(unsupp)s(orted)c(cross)k
+(targets.)41 b(The)27 b(last)g(\014le)g(lo)s(ok)m(ed)g(for)h(is)e(`)p
+Fr(unknown.exp)p Fv('.)150 1969 y(This)37 b(is)h(usually)f(limited)g
+(to)j(error)e(handling)f(for)h(unsupp)s(orted)f(targets.)68
+b(It's)39 b(whole)f(con)m(ten)m(ts)j(is)150 2079 y(t)m(ypically)-8
+b(.)150 2158 y Fm(\013)p 200 2158 3554 4 v 3553 w(\010)p
+150 2439 4 235 v 178 2311 a Fr(perror)46 b("Sorry,)g(there)g(is)i(no)f
+(support)f(for)h(this)f(target")178 2414 y(exit)h(1)p
+3803 2439 V 150 2491 a Fm(\012)p 200 2491 3554 4 v 3553
+w(\011)275 2636 y Fv(A)m(t)35 b(the)f(b)s(eginning)e(of)j(the)f(init)f
+(\014le,)h(y)m(ou)h(m)m(ust)f(\014rst)g(determine)f(the)i(prop)s(er)e
+(executable)i(name)150 2746 y(of)c(the)g(to)s(ol)g(to)h(execute,)h
+(since)d(the)h(actual)h(name)f(of)g(the)g(to)s(ol)g(to)h(b)s(e)e
+(tested)i(m)m(y)f(v)-5 b(ary)31 b(from)g(system)150 2855
+y(to)g(system.)41 b(Here's)31 b(an)f(example)g(for)g(the)h
+Fo(GNU)g Fv(C)f(compiler.)150 2934 y Fm(\013)p 200 2934
+V 3553 w(\010)p 150 4365 4 1384 v 178 3087 a Fr(global)46
+b(AR)178 3191 y(#)i(look)e(for)h(the)g(archiver)f(ar)178
+3295 y(if)h(![info)f(exists)h(AR])f({)369 3398 y(set)h(AR)g([findfile)e
+($base_dir/../../binutils/a)o(r)d($base_dir/../../binutils)o(/ar)f([tr)
+178 3502 y(ansform)46 b(ar]])369 3606 y(verbose)g("AR)h(defaulting)e
+(to)i($AR")g(2)178 3710 y(})178 3814 y(})178 4021 y(global)f(CFLAGS)178
+4125 y(if)h(![info)f(exists)h(CFLAGS])e(then)i({)369
+4229 y(set)g(CFLAGS)f("")178 4332 y(})p 3803 4365 V 150
+4417 a Fm(\012)p 200 4417 3554 4 v 3553 w(\011)275 4562
+y Fv(It)30 b(is)f(alw)m(a)m(ys)i(a)f(go)s(o)s(d)g(idea)g(to)h(\014rst)e
+(c)m(hec)m(k)j(the)e(v)-5 b(ariable,)29 b(and)h(only)f(set)i(it)e(if)g
+(it)h(has)g(not)g(y)m(et)i(b)s(een)150 4671 y(de\014ned.)39
+b(Often)31 b(the)f(prop)s(er)f(v)-5 b(alue)30 b(of)g
+Fr(AR)g Fv(is)g(set)g(on)h(the)f(command)g(line)f(that)i(in)m(v)m(ok)m
+(es)g(`)p Fr(runtest)p Fv('.)275 4806 y(The)c Fr(findfile)f
+Fv(pro)s(cedure)h(tak)m(es)i(as)f(it's)g(\014rst)f(argumen)m(t)i(a)f
+(\014le)f(name)h(to)h(lo)s(ok)f(for.)39 b(The)28 b(second)150
+4915 y(argumen)m(t)f(is)f(returned)g(if)g(the)h(\014le)f(is)f(found,)i
+(and)f(the)h(third)e(argumen)m(t)i(is)f(returned)g(if)g(the)h(\014le)f
+(is)g(not)150 5025 y(found.)39 b Fr(base_dir)29 b Fv(is)g(set)i(in)m
+(ternally)d(b)m(y)i(DejaGn)m(u)i(to)f(the)f(top)h(lev)m(el)f(directory)
+g(of)g(the)h(ob)5 b(ject)31 b(tree.)275 5160 y(The)42
+b Fr(transform)e Fv(pro)s(cedure)h(tak)m(es)j(as)f(its)f(argumen)m(t)h
+(the)g(nativ)m(e)g(name)g(of)f(a)h(to)s(ol)g(\(suc)m(h)g(as)150
+5269 y(`)p Fr(gcc)p Fv(')c(for)h(the)f(compiler\),)i(and)e(returns)g
+(the)h(name)f(as)h(con\014gured)f(for)g(that)i(to)s(ol)e(in)f(the)i
+(curren)m(t)p eop
+%%Page: 23 25
+23 24 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(23)150 83 y(installation.)38
+b(\(F)-8 b(or)31 b(example,)e(a)h(cross-compiling)d(v)m(ersion)i(of)g
+Fo(gnu)g Fv(CC)g(that)g(generates)i(MIPS)e(co)s(de)150
+193 y(ma)m(y)i(b)s(e)f(installed)e(with)h(a)i(name)f(lik)m(e)g
+Fr(mips-idt-ecoff-gcc)p Fv(.\))275 327 y(In)j(a)h(test)h(running)c
+(nativ)m(e,)36 b(writing)c(the)i(Tcl)f(co)s(de)h(for)g(initialization)d
+(is)i(usually)e(quite)j(simple.)150 437 y(F)-8 b(or)23
+b(cross)e(con\014gurations,)i(ho)m(w)m(ev)m(er,)i(more)d(elab)s(orate)g
+(instructions)e(are)i(usually)e(needed)h(to)i(describ)s(e)150
+546 y(ho)m(w)30 b(to)i(talk)e(to)h(a)g(remote)g(target.)275
+681 y(Eac)m(h)g(initialization)c(mo)s(dule)i(de\014nes)g(up)h(to)h
+(four)f(pro)s(cedures)f(with)g(standard)h(names)g(and)g(pur-)150
+790 y(p)s(oses.)58 b(The)36 b(names)g(of)h(these)g(pro)s(cedures)e(b)s
+(egin)f(with)h(`)p Fr($tool)p Fv(',)j(the)e(string)f(that)i(iden)m
+(ti\014es)e(tests)150 900 y(for)j(a)h(particular)e(to)s(ol:)57
+b Fr($tool_start)p Fv(,)38 b Fr($tool_load)p Fv(,)g Fr($tool_exit)p
+Fv(,)g(and)g Fr($tool_version)p Fv(.)61 b(F)-8 b(or)150
+1010 y(example,)28 b(the)f(start)h(pro)s(cedure)e(for)h
+Fo(gdb)g Fv(is)g(called)f Fr(gdb_start)p Fv(.)37 b(\(Since)27
+b(start)h(pro)s(cedures)e(are)i(used)150 1119 y(di\013eren)m(tly)f(for)
+g(batc)m(h)i(and)e(in)m(teractiv)m(e)i(to)s(ols,)f(ho)m(w)m(ev)m(er,)j
+Fr(runtest)25 b Fv(itself)i(nev)m(er)h(calls)g(the)g(start)g(pro-)150
+1229 y(cedure.)40 b(Init)30 b(\014les)f(for)h(in)m(teractiv)m(e)h(to)s
+(ols)g(are)f(exp)s(ected)h(to)g(end)f(b)m(y)g(running)e(the)i(start)h
+(pro)s(cedure.\))275 1363 y(The)37 b(initialization)d(mo)s(dule)i(is)g
+(also)i(a)g(go)s(o)s(d)f(place)g(to)i(call)d Fr(load_lib)g
+Fv(to)i(get)h(an)m(y)e(collections)150 1473 y(of)c(utilit)m(y)f(pro)s
+(cedures)f(mean)m(t)j(for)f(a)g(family)f(of)h(test)h(cases,)h(and)d(to)
+i(set)f(up)f(default)g(v)-5 b(alues)33 b(for)g(an)m(y)150
+1582 y(additional)28 b(Tcl)i(v)-5 b(ariables)29 b(needed)h(for)g(a)h
+(sp)s(eci\014c)e(set)i(of)f(tests.)275 1717 y(See)40
+b(Section)g(5.4)h([T)-8 b(arget)41 b(dep)s(enden)m(t)f(pro)s(cedures],)
+h(page)g(31,)j(for)c(full)d(descriptions)h(of)i(these)150
+1826 y(pro)s(cedures.)150 2084 y Fu(5.3)68 b(DejaGn)l(u)45
+b(pro)t(cedures)275 2276 y Fv(DejaGn)m(u)40 b(pro)m(vides)e(these)i
+(Tcl)e(pro)s(cedures)g(for)h(use)g(in)f(test)i(scripts.)66
+b(Y)-8 b(ou)40 b(can)f(also)h(use)f(an)m(y)150 2386 y(standard)29
+b Fr(expect)g Fv(or)h(Tcl)g(function.)39 b(These)30 b(pro)s(cedures)f
+(are)i(stored)f(in)f(libraries,)f(whic)m(h)h(DejaGn)m(u)150
+2496 y(loads)i(at)h(run)m(time.)42 b(Here's)32 b(explanation)e(of)i
+(the)f(library)e(pro)s(cedures)h(that)i(get)g(loaded)f(at)h(run)m
+(time.)150 2605 y(All)d(other)i(librarys)c(are)k(optional,)f(and)g
+(need)g(to)h(b)s(e)f(loaded)g(b)m(y)g(the)g(testsuite.)150
+2829 y Fi(5.3.1)63 b(Core)41 b(In)m(ternal)f(Pro)s(cedures)275
+3022 y Fv(See)30 b(Section)g(2.4)i([A)f(POSIX)e(conforming)g(test)j
+(framew)m(ork],)f(page)g(6,)g(for)f(more)h(detailed)e(expla-)150
+3132 y(nations)h(of)g(the)h(test)g(outcomes)h(\(`)p Fr(FAIL)p
+Fv(',)e(`)p Fr(PASS)p Fv(',)g(`)p Fr(UNTESTED)p Fv(',)f(`)p
+Fr(UNRESOLVED)p Fv(',)f(`)p Fr(UNSUPPORTED)p Fv('\).)150
+3316 y Fr(perror)h(")p Fq(string)37 b(n)m(um)m(b)s(er)7
+b Fr(")630 3425 y Fv(Declares)28 b(a)g(sev)m(ere)g(error)f(in)f(the)h
+(testing)h(framew)m(ork)f(itself.)39 b Fr(perror)25 b
+Fv(writes)h(in)g(the)i(log)630 3535 y(\014les)j(a)i(message)h(b)s
+(eginning)c(with)h(`)p Fr(ERROR)p Fv(',)h(app)s(ending)e(the)j(argumen)
+m(t)g Fq(string)p Fv(.)46 b(If)32 b(the)630 3645 y(optional)25
+b Fq(n)m(um)m(b)s(er)32 b Fv(is)25 b(supplied,)f(then)i(this)f(is)g
+(used)g(to)i(set)g(the)f(in)m(ternal)f(coun)m(t)i(of)f(errors)630
+3754 y(to)31 b(that)g(v)-5 b(alue.)630 3889 y(As)32 b(a)g(side)e
+(e\013ect,)k Fr(perror)c Fv(also)i(c)m(hanges)h(the)e(e\013ect)j(of)e
+(the)f(next)h Fr(pass)f Fv(or)h Fr(fail)e Fv(com-)630
+3998 y(mand:)50 b(the)36 b(test)h(outcome)f(b)s(ecomes)g(`)p
+Fr(UNRESOLVED)p Fv(',)f(since)g(an)h(automatic)g(`)p
+Fr(PASS)p Fv(')f(or)630 4108 y(`)p Fr(FAIL)p Fv(')d(cannot)h(b)s(e)f
+(trusted)g(after)h(a)g(sev)m(ere)g(error)f(in)g(the)g(test)i(framew)m
+(ork.)47 b(If)32 b(the)h(op-)630 4218 y(tional)d(n)m(umeric)g(v)-5
+b(alue)30 b(is)g(`)p Fr(0)p Fv(',)i(then)f(there)g(are)g(no)g(further)f
+(side)g(e\013ects)i(to)g(calling)d(this)630 4327 y(function,)37
+b(and)f(the)g(follo)m(wing)f(test)i(outcome)h(do)s(esn't)e(b)s(ecome)h
+(`)p Fr(UNRESOLVED)p Fv('.)57 b(This)630 4437 y(can)31
+b(b)s(e)e(used)h(for)g(errors)g(with)f(no)h(kno)m(wn)g(side)f
+(e\013ects.)150 4621 y Fr(warning)f(")p Fq(string)37
+b(n)m(um)m(b)s(er)7 b Fr(")630 4731 y Fv(Declares)27
+b(detection)g(of)f(a)h(minor)e(error)g(in)g(the)i(test)g(case)g
+(itself.)38 b Fr(warning)25 b Fv(writes)g(in)g(the)630
+4840 y(log)35 b(\014les)e(a)i(message)h(b)s(eginning)c(with)h(`)p
+Fr(WARNING)p Fv(',)i(app)s(ending)d(the)j(argumen)m(t)g
+Fq(string)p Fv(.)630 4950 y(Use)41 b Fr(warning)d Fv(rather)j(than)f
+Fr(error)f Fv(for)i(cases)g(\(suc)m(h)g(as)f(comm)m(unication)g
+(failure)f(to)630 5059 y(b)s(e)44 b(follo)m(w)m(ed)g(b)m(y)g(a)h
+(retry\))g(where)f(the)g(test)i(case)f(can)g(reco)m(v)m(er)h(from)e
+(the)h(error.)82 b(If)630 5169 y(the)34 b(optional)e
+Fq(n)m(um)m(b)s(er)39 b Fv(is)33 b(supplied,)e(then)i(this)f(is)h(used)
+g(to)h(set)g(the)f(in)m(ternal)g(coun)m(t)h(of)630 5279
+y(w)m(arnings)29 b(to)i(that)g(v)-5 b(alue.)p eop
+%%Page: 24 26
+24 25 bop 150 -116 a Fv(24)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)630 83 y(As)32 b(a)g(side)f(e\013ect,)
+k Fr(warning_threshold)27 b Fv(or)32 b(more)g(calls)f(to)i
+Fr(warning)d Fv(in)h(a)h(single)f(test)630 193 y(case)k(also)e(c)m
+(hanges)i(the)f(e\013ect)h(of)f(the)g(next)f Fr(pass)g
+Fv(or)g Fr(fail)g Fv(command:)47 b(the)34 b(test)g(out-)630
+302 y(come)39 b(b)s(ecomes)f(`)p Fr(UNRESOLVED)p Fv(')e(since)h(an)h
+(automatic)h(`)p Fr(PASS)p Fv(')e(or)h(`)p Fr(FAIL)p
+Fv(')f(ma)m(y)h(not)h(b)s(e)630 412 y(trust)m(w)m(orth)m(y)j(after)f
+(man)m(y)g(w)m(arnings.)71 b(If)41 b(the)g(optional)f(n)m(umeric)g(v)-5
+b(alue)40 b(is)g(`)p Fr(0)p Fv(',)k(then)630 521 y(there)32
+b(are)h(no)f(further)f(side)g(e\013ects)i(to)g(calling)e(this)g
+(function,)h(and)f(the)h(follo)m(wing)f(test)630 631
+y(outcome)40 b(do)s(esn't)f(b)s(ecome)h(`)p Fr(UNRESOLVED)p
+Fv('.)65 b(This)37 b(can)j(b)s(e)e(used)h(for)g(errors)f(with)g(no)630
+741 y(kno)m(wn)30 b(side)f(e\013ects.)150 923 y Fr(note)g(")p
+Fq(string)8 b Fr(")630 1032 y Fv(App)s(ends)32 b(an)i(informational)e
+(message)j(to)g(the)f(log)g(\014le.)51 b Fr(note)33 b
+Fv(writes)g(in)g(the)h(log)g(\014les)630 1142 y(a)40
+b(message)g(b)s(eginning)d(with)h(`)p Fr(NOTE)p Fv(',)j(app)s(ending)c
+(the)i(argumen)m(t)h Fq(string)p Fv(.)66 b(Use)40 b Fr(note)630
+1252 y Fv(sparingly)-8 b(.)40 b Fr(verbose)29 b Fv(should)f(b)s(e)j
+(used)e(for)i(most)g(suc)m(h)f(messages,)i(but)e(in)g(cases)h(where)630
+1361 y(a)g(message)g(is)f(needed)g(in)f(the)h(log)h(\014le)e
+(regardless)h(of)g(the)h(v)m(erb)s(osit)m(y)f(lev)m(el)g(use)g
+Fr(note)p Fv(.)150 1543 y Fr(pass)f(")p Fq(string)8 b
+Fr(")630 1653 y Fv(Declares)29 b(a)f(test)h(to)f(ha)m(v)m(e)h(passed.)
+40 b Fr(pass)26 b Fv(writes)h(in)g(the)h(log)g(\014les)e(a)j(message)g
+(b)s(eginning)630 1763 y(with)d(`)p Fr(PASS)p Fv(')g(\(or)h
+Fr(XPASS)p Fv(,)g(if)f(failure)f(w)m(as)i(exp)s(ected\),)i(app)s
+(ending)24 b(the)j(argumen)m(t)h Fq(string)p Fv(.)150
+1945 y Fr(fail)h(")p Fq(string)8 b Fr(")630 2055 y Fv(Declares)32
+b(a)f(test)h(to)g(ha)m(v)m(e)g(failed.)41 b Fr(fail)30
+b Fv(writes)g(in)g(the)h(log)g(\014les)f(a)i(message)g(b)s(eginning)630
+2164 y(with)26 b(`)p Fr(FAIL)p Fv(')g(\(or)h Fr(XFAIL)p
+Fv(,)g(if)f(failure)f(w)m(as)i(exp)s(ected\),)i(app)s(ending)24
+b(the)j(argumen)m(t)h Fq(string)p Fv(.)150 2346 y Fr(unresolved)g(")p
+Fq(string)8 b Fr(")630 2456 y Fv(Declares)35 b(a)f(test)h(to)g(ha)m(v)m
+(e)h(an)e(unresolv)m(ed)f(outcome.)53 b Fr(unresolved)31
+b Fv(writes)j(in)e(the)j(log)630 2566 y(\014le)j(a)i(message)h(b)s
+(eginning)36 b(with)i(`)p Fr(UNRESOLVED)p Fv(',)i(app)s(ending)c(the)k
+(argumen)m(t)g Fq(string)p Fv(.)630 2675 y(This)33 b(usually)g(means)i
+(the)g(test)h(did)d(not)j(execute)g(as)f(exp)s(ected,)i(and)e(a)g(h)m
+(uman)f(b)s(eing)630 2785 y(m)m(ust)28 b(go)g(o)m(v)m(er)h(results)e
+(to)i(determine)e(if)f(it)i(passed)f(or)h(failed)e(\(and)i(to)g(impro)m
+(v)m(e)g(the)g(test)630 2894 y(case\).)150 3077 y Fr(untested)g(")p
+Fq(string)8 b Fr(")630 3186 y Fv(Declares)25 b(a)g(test)g(w)m(as)f(not)
+h(run.)37 b Fr(untested)22 b Fv(writes)h(in)g(the)h(log)g(\014le)g(a)g
+(message)i(b)s(eginning)630 3296 y(with)31 b(`)p Fr(UNTESTED)p
+Fv(',)g(app)s(ending)f(the)i(argumen)m(t)h Fq(string)p
+Fv(.)45 b(F)-8 b(or)33 b(example,)g(y)m(ou)f(migh)m(t)g(use)630
+3405 y(this)c(in)g(a)h(dumm)m(y)f(test)i(whose)f(only)f(role)g(is)g(to)
+i(record)f(that)h(a)f(test)h(do)s(es)f(not)g(y)m(et)h(exist)630
+3515 y(for)g(some)h(feature.)150 3697 y Fr(unsupported)c(")p
+Fq(string)8 b Fr(")630 3807 y Fv(Declares)38 b(that)g(a)g(test)g(case)g
+(dep)s(ends)e(on)h(some)h(facilit)m(y)e(that)i(do)s(es)f(not)h(exist)f
+(in)f(the)630 3916 y(testing)h(en)m(vironmen)m(t.)58
+b Fr(unsupported)33 b Fv(writes)j(in)f(the)h(log)h(\014le)e(a)i
+(message)h(b)s(eginning)630 4026 y(with)29 b(`)p Fr(UNSUPPORTED)p
+Fv(',)f(app)s(ending)g(the)j(argumen)m(t)f Fq(string)p
+Fv(.)150 4208 y Fr(get_warning_threshold)630 4318 y Fv(Returns)f(the)i
+(curren)m(t)f(v)-5 b(alue)30 b(of)h Fr(warning_threshold)p
+Fv(.)36 b(The)29 b(default)h(v)-5 b(alue)30 b(is)f(3.)150
+4500 y Fr(set_warning_threshold)c Fq(threshold)630 4610
+y Fv(Sets)f(the)h(v)-5 b(alue)23 b(of)i Fr(warning_threshold)p
+Fv(.)34 b(A)24 b(v)-5 b(alue)24 b(of)g Fr(0)g Fv(disables)e(it:)38
+b(calls)23 b(to)i Fr(warning)630 4719 y Fv(will)j(not)i(turn)g(a)g(`)p
+Fr(PASS)p Fv(')g(or)g(`)p Fr(FAIL)p Fv(')g(in)m(to)h(an)f(`)p
+Fr(UNRESOLVED)p Fv('.)150 4902 y Fr(transform)e(")p Fq(to)s(olname)5
+b Fr(")630 5011 y Fv(Generates)39 b(a)f(string)f(for)h(the)g(name)g(of)
+g(a)h(to)s(ol)e(as)i(it)e(w)m(as)h(con\014gured)g(and)f(installed,)630
+5121 y(giv)m(en)27 b(its)g(nativ)m(e)h(name)g(\(as)g(the)g(argumen)m(t)
+f Fq(to)s(olname)5 b Fv(\).)41 b(This)25 b(mak)m(es)k(the)e(assumption)
+630 5230 y(that)49 b(all)e(to)s(ols)h(are)g(installed)e(using)h(the)h
+(same)h(naming)d(con)m(v)m(en)m(tions:)78 b(it)47 b(extrap-)630
+5340 y(olates)52 b(from)g(the)g(in)m(v)m(o)s(cation)f(name)h(for)g(`)p
+Fr(runtest)p Fv('.)103 b(F)-8 b(or)53 b(example,)k(if)51
+b(y)m(ou)h(call)p eop
+%%Page: 25 27
+25 26 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(25)630 83 y Fr(runtest)52 b
+Fv(as)i(`)p Fr(m68k-vxworks-runtest)p Fv(',)g(the)g(result)f(of)h(`)30
+b Fr(transform)e("gcc")h Fv(')54 b(is)630 193 y(`)p Fr
+(m68k-vxworks-gcc)p Fv('.)150 377 y Fr(ishost)29 b(")p
+Fq(host)r Fr(")630 487 y Fv(T)-8 b(ests)21 b(for)f(a)h(particular)d
+Fn(host)31 b Fv(en)m(vironmen)m(t.)37 b(If)20 b(the)g(curren)m(tly)g
+(con\014gured)f(host)i(matc)m(hes)630 596 y(the)34 b(argumen)m(t)g
+(string,)f(the)h(result)e(is)h Fr(1)p Fv(;)i(otherwise)d(the)i(result)f
+(is)f Fr(0)p Fv(.)50 b Fq(host)35 b Fv(m)m(ust)f(b)s(e)f(a)630
+706 y(full)22 b(three-part)j Fr(configure)d Fv(host)j(name;)h(in)e
+(particular,)g(y)m(ou)h(ma)m(y)g(not)f(use)h(the)f(shorter)630
+815 y(nic)m(knames)f(supp)s(orted)f(b)m(y)i Fr(configure)d
+Fv(\(but)i(y)m(ou)h(can)g(use)f(wildcard)f(c)m(haracters,)k(using)630
+925 y(shell)j(syn)m(tax,)i(to)g(sp)s(ecify)e(sets)i(of)f(names\).)150
+1109 y Fr(istarget)e(")p Fq(target)r Fr(")630 1219 y
+Fv(T)-8 b(ests)40 b(for)g(a)g(particular)e Fn(tar)-5
+b(get)50 b Fv(en)m(vironmen)m(t.)69 b(If)39 b(the)h(curren)m(tly)f
+(con\014gured)g(target)630 1328 y(matc)m(hes)c(the)g(argumen)m(t)f
+(string,)h(the)f(result)f(is)g Fr(1)p Fv(;)j(otherwise)e(the)g(result)f
+(is)h Fr(0)p Fv(.)51 b Fq(target)630 1438 y Fv(m)m(ust)35
+b(b)s(e)f(a)i(full)d(three-part)i Fr(configure)e Fv(target)j(name;)i
+(in)c(particular,)h(y)m(ou)g(ma)m(y)h(not)630 1548 y(use)31
+b(the)g(shorter)g(nic)m(knames)f(supp)s(orted)g(b)m(y)h
+Fr(configure)d Fv(\(but)j(y)m(ou)g(can)h(use)e(wildcard)630
+1657 y(c)m(haracters,)k(using)d(shell)f(syn)m(tax,)k(to)f(sp)s(ecify)d
+(sets)j(of)f(names\).)46 b(If)32 b(it)g(is)f(passed)h(a)g
+Fr(NULL)630 1767 y Fv(string,)e(then)g(it)g(returns)f(the)h(name)h(of)f
+(the)h(build)c(canonical)j(con\014guration.)150 1951
+y Fr(isbuild)e(")p Fq(host)r Fr(")630 2061 y Fv(T)-8
+b(ests)33 b(for)f(a)h(particular)e Fn(build)k(host)42
+b Fv(en)m(vironmen)m(t.)47 b(If)32 b(the)h(curren)m(tly)e(con\014gured)
+h(host)630 2170 y(matc)m(hes)40 b(the)f(argumen)m(t)g(string,)h(the)f
+(result)e(is)h Fr(1)p Fv(;)k(otherwise)d(the)f(result)g(is)g
+Fr(0)p Fv(.)65 b Fq(host)630 2280 y Fv(m)m(ust)40 b(b)s(e)g(a)h(full)e
+(three-part)i Fr(configure)d Fv(host)j(name;)46 b(in)39
+b(particular,)j(y)m(ou)e(ma)m(y)i(not)630 2389 y(use)31
+b(the)g(shorter)g(nic)m(knames)f(supp)s(orted)g(b)m(y)h
+Fr(configure)d Fv(\(but)j(y)m(ou)g(can)h(use)e(wildcard)630
+2499 y(c)m(haracters,)k(using)d(shell)f(syn)m(tax,)k(to)f(sp)s(ecify)d
+(sets)j(of)f(names\).)46 b(If)32 b(it)g(is)f(passed)h(a)g
+Fr(NULL)630 2609 y Fv(string,)e(then)g(it)g(returns)f(the)h(name)h(of)f
+(the)h(build)c(canonical)j(con\014guration.)630 2743
+y(item)k(is3w)m(a)m(y)h Fr(")p Fq(host)r Fr(")f Fv(T)-8
+b(ests)34 b(for)g(a)h(canadian)f(cross.)52 b(This)33
+b(is)g(when)g(the)i(tests)g(will)d(b)s(e)630 2853 y(run)24
+b(on)h(a)h(remotly)f(hosted)h(cross)f(compiler.)38 b(If)25
+b(it)g(is)g(a)g(canadian)g(cross,)i(then)e(the)h(result)630
+2962 y(is)j Fr(1)p Fv(;)i(otherwise)e(the)i(result)e(is)h
+Fr(0)p Fv(.)150 3147 y Fr(isnative)96 b Fv(T)-8 b(ests)28
+b(whether)e(the)h(curren)m(t)g(con\014guration)f(has)h(the)g(same)h
+(host)f(and)f(target.)42 b(When)26 b(it)630 3256 y(runs)32
+b(in)g(a)h Fn(native)41 b Fv(con\014guration)32 b(this)g(pro)s(cedure)g
+(returns)g(a)i Fr(1)p Fv(;)h(otherwise)d(it)h(returns)630
+3366 y(a)e Fr(0)p Fv(.)150 3550 y Fr(load_lib)d(")p Fq(library-\014le)5
+b Fr(")630 3660 y Fv(Loads)46 b(the)f(\014le)g Fq(library-\014le)j
+Fv(b)m(y)d(searc)m(hing)g(a)h(\014xed)f(path)g(built)f(in)m(to)h
+Fr(runtest)p Fv(.)84 b(If)630 3769 y(DejaGn)m(u)25 b(has)f(b)s(een)f
+(installed,)h(it)f(lo)s(oks)h(in)f(a)h(path)g(starting)g(with)f(the)h
+(installed)e(library)630 3879 y(directory)-8 b(.)39 b(If)26
+b(y)m(ou)g(are)h(running)c(DejaGn)m(u)k(directly)e(from)g(a)i(source)f
+(directory)-8 b(,)27 b(without)630 3988 y(\014rst)39
+b(running)f(`)p Fr(make)29 b(install)p Fv(',)41 b(this)e(path)h
+(defaults)g(to)g(the)h(curren)m(t)f(directory)-8 b(.)70
+b(In)630 4098 y(either)31 b(case,)i(it)e(then)h(lo)s(oks)f(in)f(the)i
+(curren)m(t)f(directory)g(for)g(a)h(directory)f(called)g
+Fr(lib)p Fv(.)43 b(If)630 4208 y(there)38 b(are)f(duplicate)g
+(de\014nitions,)g(the)g(last)g(one)h(loaded)f(tak)m(es)i(precedence)f
+(o)m(v)m(er)h(the)630 4317 y(earlier)29 b(ones.)150 4501
+y Fr(setup_xfail)e(")p Fq(con\014g)38 b Fv([)p Fq(bugid)t
+Fv(])p Fr(")630 4611 y Fv(Declares)c(that)h(the)e(test)i(is)d(exp)s
+(ected)j(to)f(fail)e(on)i(a)g(particular)e(set)i(of)f
+(con\014gurations.)630 4721 y(The)f Fq(con\014g)40 b
+Fv(argumen)m(t)32 b(m)m(ust)h(b)s(e)e(a)i(list)d(of)j(full)d
+(three-part)i Fr(configure)e Fv(target)k(name;)630 4830
+y(in)28 b(particular,)h(y)m(ou)h(ma)m(y)g(not)g(use)f(the)h(shorter)g
+(nic)m(knames)f(supp)s(orted)f(b)m(y)h Fr(configure)630
+4940 y Fv(\(but)22 b(y)m(ou)g(can)g(use)g(the)g(common)g(shell)f
+(wildcard)e(c)m(haracters)24 b(to)e(sp)s(ecify)f(sets)h(of)g(names\).)
+630 5049 y(The)33 b Fq(bugid)i Fv(argumen)m(t)f(is)f(optional,)h(and)f
+(used)g(only)f(in)g(the)i(logging)g(\014le)e(output;)j(use)630
+5159 y(it)29 b(as)g(a)h(link)d(to)j(a)f(bug-trac)m(king)h(system)f(suc)
+m(h)g(as)g Fo(gna)-6 b(ts)28 b Fv(\(see)i(section)g(\\Ov)m(erview")f
+(in)630 5269 y Fq(T)-8 b(rac)m(king)31 b(Bugs)f(With)g(GNA)-8
+b(TS)5 b Fv(\).)p eop
+%%Page: 26 28
+26 27 bop 150 -116 a Fv(26)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)630 83 y(Once)36 b(y)m(ou)g(use)f
+Fr(setup_xfail)p Fv(,)f(the)i Fr(fail)e Fv(and)h Fr(pass)g
+Fv(pro)s(cedures)f(pro)s(duce)h(the)h(mes-)630 193 y(sages)43
+b(`)p Fr(XFAIL)p Fv(')e(and)h(`)p Fr(XPASS)p Fv(')f(resp)s(ectiv)m(ely)
+-8 b(,)46 b(allo)m(wing)41 b(y)m(ou)h(to)h(distinguish)c(exp)s(ected)
+630 302 y(failures)28 b(\(and)j(unexp)s(ected)e(success!\))42
+b(from)30 b(other)g(test)h(outcomes.)630 437 y Fn(Warning:)43
+b Fv(y)m(ou)25 b(m)m(ust)f(clear)h(the)f(exp)s(ected)h(failure)e(after)
+i(using)e Fr(setup_xfail)e Fv(in)i(a)i(test)630 546 y(case.)41
+b(An)m(y)29 b(call)f(to)h Fr(pass)f Fv(or)h Fr(fail)e
+Fv(clears)i(the)g(exp)s(ected)g(failure)e(implicitly;)e(if)j(the)h
+(test)630 656 y(has)k(some)g(other)g(outcome,)i(e.g.)49
+b(an)32 b(error,)h(y)m(ou)h(can)f(call)f Fr(clear_xfail)d
+Fv(to)34 b(clear)f(the)630 765 y(exp)s(ected)g(failure)f(explicitly)-8
+b(.)46 b(Otherwise,)33 b(the)g(exp)s(ected-failure)f(declaration)h
+(applies)630 875 y(to)e(whatev)m(er)g(test)h(runs)c(next,)j(leading)e
+(to)i(surprising)c(results.)150 1059 y Fr(clear_xfail)g
+Fq(con\014g)630 1169 y Fv(Cancel)c(an)h(exp)s(ected)g(failure)d
+(\(previously)h(declared)h(with)f Fr(setup_xfail)p Fv(\))f(for)i(a)h
+(partic-)630 1279 y(ular)k(set)i(of)g(con\014gurations.)40
+b(The)29 b Fq(con\014g)37 b Fv(argumen)m(t)30 b(is)f(a)h(list)e(of)h
+(con\014guration)g(target)630 1388 y(names.)68 b(It)40
+b(is)e(only)h(necessary)h(to)g(call)f Fr(clear_xfail)d
+Fv(if)i(a)i(test)h(case)f(ends)f(without)630 1498 y(calling)29
+b(either)h Fr(pass)f Fv(or)h Fr(fail)p Fv(,)g(after)h(calling)e
+Fr(setup_xfail)p Fv(.)150 1682 y Fr(verbose)f Fv([)p
+Fr(-log)p Fv(])i([)p Fr(-n)p Fv(])g([)p Fr(--)p Fv(])h
+Fr(")p Fq(string)8 b Fr(")28 b Fq(n)m(um)m(b)s(er)630
+1792 y Fv(T)-8 b(est)42 b(cases)g(can)f(use)g(this)g(function)e(to)j
+(issue)e(helpful)f(messages)j(dep)s(ending)d(on)i(the)630
+1901 y(n)m(um)m(b)s(er)29 b(of)i(`)p Fr(--verbose)p Fv(')d(options)i
+(on)g(the)h Fr(runtest)d Fv(command)i(line.)40 b(It)30
+b(prin)m(ts)f Fq(string)630 2011 y Fv(if)40 b(the)i(v)-5
+b(alue)41 b(of)h(the)g(v)-5 b(ariable)40 b Fr(verbose)f
+Fv(is)i(higher)f(than)h(or)h(equal)f(to)h(the)g(optional)630
+2120 y Fq(n)m(um)m(b)s(er)p Fv(.)g(The)31 b(default)f(v)-5
+b(alue)31 b(for)g Fq(n)m(um)m(b)s(er)36 b Fv(is)31 b(1.)43
+b(Use)32 b(the)f(optional)g(`)p Fr(-log)p Fv(')f(argumen)m(t)630
+2230 y(to)k(cause)h Fq(string)40 b Fv(to)35 b(alw)m(a)m(ys)f(b)s(e)f
+(added)g(to)i(the)f(log)f(\014le,)h(ev)m(en)h(if)d(it)i(w)m(on't)g(b)s
+(e)f(prin)m(ted.)630 2340 y(Use)e(the)h(optional)e(`)p
+Fr(-n)p Fv(')h(argumen)m(t)g(to)h(prin)m(t)e Fq(string)37
+b Fv(without)30 b(a)i(trailing)d(newline.)41 b(Use)630
+2449 y(the)31 b(optional)e(`)p Fr(--)p Fv(')h(argumen)m(t)h(if)f
+Fq(string)37 b Fv(b)s(egins)28 b(with)i Fr(")p Fv(-)p
+Fr(")p Fv(.)150 2698 y Fi(5.3.2)63 b(Remote)39 b(Comm)m(unication)h
+(Pro)s(cedures)275 2891 y Fv(`)p Fr(lib/remote.exp)p
+Fv(')c(de\014nes)i(these)i(functions,)g(for)g(establishing)d(and)i
+(managing)g(comm)m(unica-)150 3000 y(tions:)275 3135
+y Fn(Pr)-5 b(o)g(c)g(e)g(dur)g(es)45 b(to)e(establish)h(a)f(c)-5
+b(onne)g(ction:)70 b Fv(Eac)m(h)42 b(of)g(these)f(pro)s(cedures)g
+(tries)g(to)h(establish)e(the)150 3244 y(connection)31
+b(up)f(to)h(three)g(times)g(b)s(efore)f(returning.)40
+b(W)-8 b(arnings)31 b(\(if)f(retries)g(will)e(con)m(tin)m(ue\))k(or)e
+(errors)150 3354 y(\(if)42 b(the)g(attempt)h(is)f(abandoned\))f(rep)s
+(ort)h(on)g(comm)m(unication)g(failures.)74 b(The)42
+b(result)f(for)h(an)m(y)h(of)150 3464 y(these)31 b(pro)s(cedures)e(is)h
+(either)g Fr(-1)p Fv(,)g(when)f(the)i(connection)g(cannot)g(b)s(e)f
+(established,)f(or)h(the)h(spa)m(wn)f(ID)150 3573 y(returned)f(b)m(y)h
+(the)h Fr(expect)e Fv(command)h Fr(spawn)p Fv(.)275 3708
+y(It)d(use)f(the)h(v)-5 b(alue)27 b(of)g(the)g Fr(connect)e
+Fv(\014eld)g(in)h(the)h Fr(target_info)d Fv(arra)m(y)j(\(w)m(as)h
+Fr(connectmode)c Fv(as)j(the)150 3817 y(t)m(yp)s(e)38
+b(of)g(connection)f(to)i(mak)m(e.)63 b(Curren)m(t)37
+b(supp)s(orted)f(connection)i(t)m(yp)s(es)f(are)h(tip,)h(k)m(ermit,)g
+(telnet,)150 3927 y(rsh,)e(rlogin,)f(and)f(netdata.)59
+b(If)36 b(the)g Fr(--reboot)e Fv(option)h(w)m(as)i(used)e(on)h(the)g
+(run)m(test)g(command)g(line,)150 4037 y(then)30 b(the)h(target)h(is)d
+(reb)s(o)s(oted)h(b)s(efore)g(the)h(connection)f(is)g(made.)150
+4221 y Fr(remote_open)d Fq(t)m(yp)s(e)630 4330 y Fn(R)-5
+b(emote)40 b(Conne)-5 b(ction)41 b(Pr)-5 b(o)g(c)g(e)g(dur)g(e.)64
+b Fv(This)36 b(is)h(passed)g Fn(host)47 b Fv(or)38 b
+Fn(tar)-5 b(get)p Fv(.)63 b(Host)39 b(or)e(target)630
+4440 y(refers)31 b(to)h(whether)f(it)g(is)f(a)i(connection)g(to)g(a)g
+(remote)g(target,)h(or)f(a)g(remote)g(host.)44 b(This)630
+4550 y(op)s(ens)34 b(the)g(connection)h(to)g(the)g(desired)e(target)j
+(or)e(host)h(using)e(the)i(default)e(v)-5 b(alues)34
+b(in)630 4659 y(the)25 b(con\014guration)f(system.)39
+b(It)25 b(returns)e(that)i Fr(spawn_id)e Fv(of)i(the)g(pro)s(cess)f
+(that)h(manages)630 4769 y(the)32 b(connection.)46 b(This)30
+b(v)-5 b(alue)31 b(can)i(b)s(e)e(used)g(in)g Fr(expect)f
+Fv(or)i Fr(exp_send)e Fv(statemen)m(ts,)k(or)630 4878
+y(passed)25 b(to)i(other)f(pro)s(cedures)e(that)i(need)g(the)g
+(connection)g(pro)s(cess's)f(id.)38 b(This)24 b(also)i(sets)630
+4988 y(the)31 b Fr(fileid)d Fv(\014eld)h(in)g(the)i Fr(target_info)c
+Fv(arra)m(y)-8 b(.)p eop
+%%Page: 27 29
+27 28 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(27)150 83 y Fr(remote_close)27
+b Fq(shellid)630 193 y Fn(shel)5 b(lid)42 b Fv(is)31
+b(v)-5 b(alue)31 b(returned)g(b)m(y)h(a)g(call)g(to)g
+Fr(remote_open)p Fv(.)42 b(This)31 b(closes)h(the)g(connection)630
+302 y(to)c(the)g(target)h(so)f(resources)f(can)h(b)s(e)f(used)g(b)m(y)g
+(others.)40 b(This)26 b(parameter)i(can)f(b)s(e)g(left)h(o\013)630
+412 y(if)h(the)i Fr(fileid)e Fv(\014eld)g(in)g(the)h
+Fr(target_info)d Fv(arra)m(y)k(is)f(set.)150 596 y Fr(telnet)f
+Fq(hostname)35 b(p)s(ort)150 706 y Fr(rlogin)29 b Fq(hostname)150
+815 y Fr(rsh)g Fq(hostname)630 925 y Fn(IP)d(network)g(pr)-5
+b(o)g(c)g(e)g(dur)g(es.)42 b Fq(hostname)28 b Fv(refers)23
+b(to)g(the)h(IP)e(address)h(or)g(name)g(\(for)g(example,)630
+1034 y(an)h(en)m(try)g(in)f(`)p Fr(/etc/hosts)p Fv('\))f(for)i(this)f
+(target.)40 b(The)23 b(pro)s(cedure)g(names)h(re\015ect)h(the)f(Unix)
+630 1144 y(utilit)m(y)29 b(used)h(to)i(establish)d(a)j(connection.)42
+b(The)31 b(optional)f Fq(p)s(ort)i Fv(is)e(used)g(to)i(sp)s(ecify)e
+(the)630 1254 y(IP)35 b(p)s(ort)f(n)m(um)m(b)s(er.)53
+b(The)35 b(v)-5 b(alue)34 b(of)h(the)g Fr(netport)e Fv(\014eld)h(in)f
+(the)j Fr(target_info)31 b Fv(arra)m(y)36 b(is)630 1363
+y(used.)64 b(\(w)m(as)40 b Fr($netport)p Fv(\))c(This)h(v)-5
+b(alue)38 b(has)g(t)m(w)m(o)i(parts,)h(the)d(hostname)h(and)f(the)h(p)s
+(ort)630 1473 y(n)m(um)m(b)s(er,)26 b(sep)s(erated)g(b)m(y)g(a)h
+Fn(:)p Fv(.)39 b(If)26 b Fr(host)f Fv(or)h Fr(target)f
+Fv(is)g(used)h(in)f(the)h Fr(hostname)e Fv(\014eld,)i(than)630
+1582 y(the)31 b(con\014g)f(arra)m(y)h(is)e(used)h(for)g(all)f
+(information.)150 1767 y Fr(tip)g Fq(p)s(ort)137 b Fn(Serial)29
+b(line)g(pr)-5 b(o)g(c)g(e)g(dur)g(e.)42 b Fv(Connect)26
+b(using)f(the)h(Unix)f(utilit)m(y)g Fr(tip)p Fv(.)38
+b Fq(p)s(ort)28 b Fv(m)m(ust)e(b)s(e)f(a)i(name)630 1876
+y(from)g(the)g Fr(tip)g Fv(con\014guration)g(\014le)f(`)p
+Fr(/etc/remote)p Fv('.)37 b(Often,)28 b(this)e(is)h(called)f(`)p
+Fr(hardwire)p Fv(',)630 1986 y(or)h(something)g(lik)m(e)g(`)p
+Fr(ttya)p Fv('.)39 b(This)26 b(\014le)g(holds)g(all)h(the)g
+(con\014guration)g(data)h(for)g(the)f(serial)630 2095
+y(p)s(ort.)61 b(The)37 b(v)-5 b(alue)37 b(of)h(the)f
+Fr(serial)f Fv(\014eld)g(in)g(the)i Fr(target_info)c
+Fv(arra)m(y)k(is)e(used.)61 b(\(w)m(as)630 2205 y Fr($serialport)p
+Fv(\))24 b(If)i Fr(host)f Fv(or)h Fr(target)f Fv(is)g(used)h(in)f(the)i
+Fr(port)e Fv(\014eld,)h(than)g(the)h(con\014g)f(arra)m(y)630
+2315 y(is)j(used)h(for)g(all)f(information.)150 2499
+y Fr(kermit)g Fq(p)s(ort)i(bps)630 2609 y Fn(Serial)39
+b(line)e(pr)-5 b(o)g(c)g(e)g(dur)g(e.)60 b Fv(Connect)36
+b(using)f(the)h(program)g Fr(kermit)p Fv(.)56 b Fq(p)s(ort)37
+b Fv(is)e(the)h(device)630 2718 y(name,)28 b(e.g.)40
+b(`)p Fr(/dev/ttyb)p Fv('.)e Fq(bps)29 b Fv(is)c(the)i(line)e(sp)s(eed)
+g(to)j(use)e(\(in)g(bits)f(p)s(er)g(second\))i(for)g(the)630
+2828 y(connection.)59 b(The)36 b(v)-5 b(alue)36 b(of)h(the)f
+Fr(serial)f Fv(\014eld)g(in)g(the)i Fr(target_info)c
+Fv(arra)m(y)k(is)e(used.)630 2937 y(\(w)m(as)29 b Fr($serialport)p
+Fv(\))d(If)i Fr(host)f Fv(or)h Fr(target)f Fv(is)h(used)f(in)g(the)i
+Fr(port)e Fv(\014eld,)h(than)g(the)h(con\014g)630 3047
+y(arra)m(y)i(is)e(used)h(for)g(all)f(information.)150
+3206 y Fn(Pr)-5 b(o)g(c)g(e)g(dur)g(es)35 b(to)e(manage)h(a)f(c)-5
+b(onne)g(ction:)150 3391 y Fr(tip_download)27 b Fq(spa)m(wnid)32
+b(\014le)630 3500 y Fv(Do)m(wnload)25 b(`)p Fq(\014le)5
+b Fv(')24 b(to)i(the)f(pro)s(cess)f Fq(spa)m(wnid)j Fv(\(the)e(v)-5
+b(alue)24 b(returned)g(when)g(the)h(connection)630 3610
+y(w)m(as)42 b(established\),)h(using)d(the)h Fr(~put)g
+Fv(command)g(under)f Fr(tip)p Fv(.)72 b(Most)43 b(often)f(used)e(for)
+630 3719 y(single)29 b(b)s(oard)h(computers)g(that)h(require)e(do)m
+(wnloading)g(programs)h(in)g Fo(asci)r(i)g Fv(S-records.)630
+3829 y(Returns)f Fr(1)h Fv(if)g(an)g(error)g(o)s(ccurs,)g
+Fr(0)g Fv(otherwise.)150 4013 y Fr(exit_remote_shell)c
+Fq(spa)m(wnid)630 4123 y Fv(Exits)34 b(a)g(remote)h(pro)s(cess)f
+(started)h(b)m(y)f(an)m(y)h(of)g(the)f(connection)h(pro)s(cedures.)51
+b Fq(spa)m(wnid)630 4232 y Fv(is)29 b(the)i(result)e(of)i(the)f
+(connection)h(pro)s(cedure)e(that)i(started)g(the)g(remote)g(pro)s
+(cess.)150 4417 y Fr(download)d Fq(\014le)35 b Fv([)30
+b Fq(spa)m(wnid)i Fv(])630 4526 y(After)c(y)m(ou)h(establish)d(a)j
+(connection)f(to)h(a)f(target,)j(y)m(ou)d(can)g(do)m(wnload)g(programs)
+f(using)630 4636 y(this)39 b(command.)68 b Fr(download)38
+b Fv(reads)i(in)e Fq(\014le)44 b Fv(\(ob)5 b(ject)41
+b(co)s(de)f(in)f(S-record)g(format\))i(and)630 4746 y(writes)29
+b(it)g(to)h(the)g(device)g(con)m(trolling)e(this)h Fq(spa)m(wnid)p
+Fv(.)38 b(\(F)-8 b(rom)31 b(the)f(p)s(oin)m(t)e(of)i(view)f(of)h(the)
+630 4855 y(target,)i(the)f(S-record)f(\014le)f(comes)i(in)f(via)g
+(standard)f(input.\))630 4990 y(If)38 b(y)m(ou)g(ha)m(v)m(e)i(more)e
+(than)g(one)g(target)i(activ)m(e,)i(y)m(ou)c(can)h(use)f(the)g
+(optional)f(argumen)m(t)630 5099 y Fq(spa)m(wnid)28 b
+Fv(to)g(sp)s(ecify)d(an)h(alternativ)m(e)h(target)h(\(the)f(default)f
+(is)g(the)g(most)h(recen)m(tly)g(estab-)630 5209 y(lished)h
+Fq(spa)m(wnid)p Fv(.\))p eop
+%%Page: 28 30
+28 29 bop 150 -116 a Fv(28)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fi(5.3.3)63
+b(Utilit)m(y)40 b(Pro)s(cedures)275 276 y Fv(`)p Fr(lib/utils.exp)p
+Fv(')27 b(de\014nes)i(these)i(utilit)m(y)e(pro)s(cedures:)150
+460 y Fr(getdirs)f Fq(dir)150 570 y Fr(getdirs)g Fq(dir)36
+b(pattern)630 679 y Fv(Returns)21 b(a)h(list)e(of)i(all)f(the)h
+(directories)e(in)h(the)h(single)e(directory)h Fq(dir)27
+b Fv(that)22 b(matc)m(h)h Fq(pattern)p Fv(.)630 789 y(If)31
+b(y)m(ou)g(do)g(not)g(sp)s(ecify)f Fq(pattern)p Fv(,)i
+Fr(getdirs)d Fv(assumes)h(`)p Fr(*)p Fv('.)43 b(Y)-8
+b(ou)32 b(ma)m(y)g(use)e(the)i(common)630 898 y(shell)f(wildcard)f(c)m
+(haracters)k(in)e Fq(pattern)p Fv(.)48 b(If)32 b(no)g(directories)g
+(matc)m(h)i(the)f(pattern,)g(then)630 1008 y(a)e Fr(NULL)e
+Fv(string)g(is)h(returned.)150 1192 y Fr(find)f Fq(dir)35
+b(pattern)630 1302 y Fv(Searc)m(h)42 b(for)f(\014les)f(whose)h(names)h
+(matc)m(h)g Fq(pattern)g Fv(\(using)e(shell)f(wildcard)g(c)m(haracters)
+630 1411 y(for)30 b(\014lename)g(expansion\).)41 b(Searc)m(h)31
+b(sub)s(directories)d(recursiv)m(ely)-8 b(,)31 b(starting)f(at)h
+Fq(dir)p Fv(.)40 b(The)630 1521 y(result)g(is)g(the)i(list)e(of)h
+(\014les)f(whose)h(names)g(matc)m(h;)48 b(if)40 b(no)h(\014les)f(matc)m
+(h,)45 b(the)d(result)e(is)630 1631 y(empt)m(y)-8 b(.)54
+b(Filenames)34 b(in)f(the)h(result)g(include)e(all)h(in)m(terv)m(ening)
+h(sub)s(directory)e(names.)53 b(If)630 1740 y(no)30 b(\014les)g(matc)m
+(h)h(the)f(pattern,)h(then)f(a)h Fr(NULL)e Fv(string)h(is)f(returned.)
+150 1924 y Fr(which)g Fq(binary)630 2034 y Fv(Searc)m(hes)43
+b(the)f(execution)g(path)g(for)g(an)g(executable)h(\014le)e
+Fq(binary)p Fv(,)j(lik)m(e)d(the)h(the)h(BSD)630 2144
+y Fr(which)38 b Fv(utilit)m(y)-8 b(.)66 b(This)37 b(pro)s(cedure)i
+(uses)f(the)i(shell)d(en)m(vironmen)m(t)i(v)-5 b(ariable)38
+b(`)p Fr(PATH)p Fv('.)67 b(It)630 2253 y(returns)32 b
+Fr(0)g Fv(if)g(the)h(binary)e(is)h(not)h(in)e(the)i(path,)h(or)f(if)f
+(there)h(is)e(no)i(`)p Fr(PATH)p Fv(')f(en)m(vironmen)m(t)630
+2363 y(v)-5 b(ariable.)40 b(If)29 b Fq(binary)37 b Fv(is)29
+b(in)g(the)i(path,)f(it)g(returns)f(the)i(full)d(path)i(to)h
+Fq(binary)p Fv(.)150 2547 y Fr(grep)e Fq(\014lename)35
+b(regexp)150 2707 y Fr(grep)29 b Fq(\014lename)35 b(regexp)e
+Fr(line)630 2816 y Fv(Searc)m(h)i(the)h(\014le)e(called)h
+Fq(\014lename)k Fv(\(a)d(fully)d(sp)s(eci\014ed)g(path\))j(for)f(lines)
+e(that)j(con)m(tain)g(a)630 2926 y(matc)m(h)i(for)g(regular)e
+(expression)g Fq(regexp)p Fv(.)63 b(The)36 b(result)h(is)f(a)i(list)e
+(of)i(all)e(the)i(lines)d(that)630 3035 y(matc)m(h.)54
+b(If)33 b(no)i(lines)d(matc)m(h,)37 b(the)d(result)f(is)h(an)g(empt)m
+(y)h(string.)51 b(Sp)s(ecify)33 b Fq(regexp)k Fv(using)630
+3145 y(the)31 b(standard)e(regular)h(expression)f(st)m(yle)h(used)g(b)m
+(y)g(the)h(Unix)e(utilit)m(y)g(program)h Fr(grep)p Fv(.)630
+3279 y(Use)f(the)f(optional)g(third)e(argumen)m(t)j(`)p
+Fr(line)p Fv(')f(to)h(start)g(lines)d(in)h(the)i(result)e(with)g(the)i
+(line)630 3389 y(n)m(um)m(b)s(er)35 b(in)g Fq(\014lename)p
+Fv(.)58 b(\(This)35 b(argumen)m(t)i(is)f(simply)e(an)i(option)g
+(\015ag;)k(t)m(yp)s(e)d(it)f(just)g(as)630 3499 y(sho)m(wn|`)p
+Fr(line)p Fv('.\))150 3683 y Fr(diff)29 b Fq(\014lename)35
+b(\014lename)630 3792 y Fv(Compares)f(the)g(t)m(w)m(o)h(\014les)e(and)g
+(returns)g(a)i(1)f(if)f(they)h(matc)m(h,)i(or)e(a)g(0)h(if)e(they)h
+(don't.)51 b(If)630 3902 y Fr(verbose)28 b Fv(is)i(set,)h(then)f(it'll)
+f(prin)m(t)g(the)h(di\013erences)g(to)h(the)g(screen.)150
+4086 y Fr(slay)e Fq(name)630 4196 y Fv(This)h(lo)s(ok)h(in)g(the)h(pro)
+s(cess)f(tab)s(el)g(for)g Fq(name)37 b Fv(and)31 b(send)g(it)h(a)g
+(unix)e Fr(SIGINT)p Fv(,)g(killing)f(the)630 4306 y(pro)s(cess.)150
+4490 y Fr(absolute)f Fq(path)630 4599 y Fv(This)h(pro)s(cedure)g(tak)m
+(es)j(the)e(relativ)m(e)h Fq(path)p Fv(,)f(and)g(con)m(v)m(erts)i(it)e
+(to)h(an)f(absolute)g(path.)150 4784 y Fr(psource)e Fq(\014lename)630
+4893 y Fv(This)23 b(sources)j(the)f(\014le)f Fq(\014lename)p
+Fv(,)i(and)f(traps)g(all)f(errors.)38 b(It)26 b(also)f(ignores)f(all)g
+(extraneous)630 5003 y(output.)40 b(If)30 b(there)h(w)m(as)g(an)f
+(error)g(it)g(returns)f(a)i(1,)g(otherwise)e(it)h(returns)f(a)i(0.)p
+eop
+%%Page: 29 31
+29 30 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(29)150 83 y Fr(prune)29 b Fq(list)i(pattern)
+630 193 y Fv(Remo)m(v)m(e)37 b(elemen)m(ts)f(of)f(the)g(Tcl)g(list)f
+Fq(list)p Fv(.)54 b(Elemen)m(ts)35 b(are)h(\014elds)d(delimited)g(b)m
+(y)i(spaces.)630 302 y(The)29 b(result)f(is)g(a)h(cop)m(y)h(of)g
+Fq(list)p Fv(,)e(without)g(an)m(y)h(elemen)m(ts)h(that)g(matc)m(h)g
+Fq(pattern)p Fv(.)40 b(Y)-8 b(ou)30 b(can)630 412 y(use)g(the)h(common)
+f(shell)f(wildcard)f(c)m(haracters)k(to)f(sp)s(ecify)e
+Fq(pattern)p Fv(.)150 595 y Fr(setenv)g Fq(v)-5 b(ar)36
+b(v)-5 b(al)630 705 y Fv(Sets)30 b(the)h(v)-5 b(ariable)29
+b Fq(v)-5 b(ar)37 b Fv(to)31 b(the)g(v)-5 b(alue)29 b
+Fq(v)-5 b(al)p Fv(.)150 888 y Fr(unsetenv)28 b Fq(v)-5
+b(ar)630 998 y Fv(Unsets)30 b(the)h(en)m(vironmen)m(t)f(v)-5
+b(ariable)29 b Fq(v)-5 b(ar)150 1181 y Fr(getenv)29 b
+Fq(v)-5 b(ar)630 1291 y Fv(returns)39 b(the)i(v)-5 b(alue)40
+b(of)h Fq(v)-5 b(ar)47 b Fv(in)39 b(the)i(en)m(vironmen)m(t)f(if)f(it)h
+(exists,)j(otherwise)d(it)g(returns)630 1400 y Fr(NULL)p
+Fv(.)150 1584 y Fr(runtest_file_p)26 b Fq(run)m(tests)34
+b(testcase)630 1693 y Fv(Searc)m(h)d Fq(run)m(tests)j
+Fv(for)c Fq(testcase)37 b Fv(and)30 b(return)g(1)g(if)g(found,)f(0)i
+(if)e(not.)41 b Fq(run)m(tests)34 b Fv(is)c(a)h(list)e(of)630
+1803 y(t)m(w)m(o)i(elemen)m(ts.)41 b(The)30 b(\014rst)f(is)g(the)h
+(pathname)g(of)g(the)g(testsuite)g(exp)s(ect)h(script)d(running.)630
+1912 y(The)g(second)h(is)f(a)i(cop)m(y)g(of)f(what)f(w)m(as)i(on)f(the)
+g(righ)m(t)f(side)g(of)h(the)h Fr(=)e Fv(if)g(`)p Fr(foo.exp="...)m(")p
+Fv(')630 2022 y(w)m(as)33 b(sp)s(eci\014ed,)f(or)h(an)f(empt)m(y)i
+(string)d(if)h(no)h(suc)m(h)f(argumen)m(t)h(is)f(presen)m(t.)48
+b(This)31 b(is)h(used)630 2131 y(b)m(y)e(to)s(ols)g(lik)m(e)g
+(compilers)f(where)h(eac)m(h)h(testcase)i(is)c(a)i(\014le.)150
+2315 y Fr(prune_system_crud)26 b Fq(system)k(text)630
+2424 y Fv(F)-8 b(or)30 b(system)f Fq(system)p Fv(,)h(delete)g(text)g
+(the)g(host)f(or)g(target)i(op)s(erating)e(system)g(migh)m(t)g(issue)
+630 2534 y(that)22 b(will)c(in)m(terfere)j(with)e(pattern)j(matc)m
+(hing)f(of)g(program)g(output)f(in)g Fq(text)p Fv(.)39
+b(An)20 b(example)630 2644 y(is)29 b(the)i(message)g(that)g(is)f(prin)m
+(ted)f(if)g(a)i(shared)e(library)f(is)i(out)g(of)h(date.)150
+2891 y Fi(5.3.4)63 b(Cross)41 b(target)g(pro)s(cedure)275
+3084 y Fv(`)p Fr(lib/target.exp)p Fv(')27 b(de\014nes)i(these)i(utilit)
+m(y)e(pro)s(cedures:)150 3267 y Fr(push_target)e Fn(name)630
+3377 y Fv(This)22 b(mak)m(es)j(the)f(target)h(named)e
+Fn(name)31 b Fv(b)s(e)24 b(the)g(curren)m(t)f(target)i(connection.)39
+b(The)23 b(v)-5 b(alue)630 3486 y(of)30 b Fn(name)38
+b Fv(is)29 b(an)h(index)f(in)m(to)h(the)g Fr(target_info)d
+Fv(arra)m(y)k(and)e(is)g(set)i(in)e(the)h(global)g(con\014g)630
+3596 y(\014le.)150 3779 y Fr(pop_target)630 3889 y Fv(This)f(unsets)g
+(the)i(curren)m(t)f(target)i(connection.)150 4072 y Fr(list_targets)630
+4182 y Fv(This)d(lists)f(all)i(the)g(supp)s(orted)f(targets)j(for)e
+(this)f(arc)m(hitecture.)150 4365 y Fr(push_host)f Fn(name)630
+4475 y Fv(This)g(mak)m(es)j(the)g(host)f(named)g Fn(name)37
+b Fv(b)s(e)30 b(the)g(curren)m(t)g(remote)h(host)g(connection.)40
+b(The)630 4584 y(v)-5 b(alue)31 b(of)i Fn(name)39 b Fv(is)31
+b(an)h(index)e(in)m(to)i(the)h Fr(target_info)28 b Fv(arra)m(y)33
+b(and)e(is)g(set)i(in)d(the)j(global)630 4694 y(con\014g)e(\014le.)150
+4877 y Fr(pop_host)96 b Fv(This)29 b(unsets)g(the)i(curren)m(t)f(host)h
+(connection.)630 5011 y(This)f(in)m(v)m(ok)m(es)i(the)f(compiler)f(as)i
+(set)g(b)m(y)f Fr(CC)g Fv(to)h(compile)e(the)i(\014le)e
+Fn(\014le)p Fv(.)44 b(The)31 b(default)g(op-)630 5121
+y(tions)24 b(for)h(man)m(y)g(cross)g(compilation)f(targets)i(are)f
+Fn(guesse)-5 b(d)35 b Fv(b)m(y)25 b(DejaGn)m(u,)i(and)d(these)i(op-)630
+5230 y(tions)g(can)h(b)s(e)f(added)h(to)g(b)m(y)g(passing)e(in)h(more)h
+(parameters)g(as)g(argumen)m(ts)g(to)h Fr(compile)p Fv(.)630
+5340 y(Optionally)-8 b(,)32 b(this)f(will)f(also)j(use)g(the)g(v)-5
+b(alue)32 b(of)h(the)g Fr(cflags)e Fv(\014eld)g(in)g(the)i(target)i
+(con\014g)p eop
+%%Page: 30 32
+30 31 bop 150 -116 a Fv(30)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)630 83 y(arra)m(y)g(.)43
+b(If)31 b(the)g(host)g(is)f(not)h(the)g(same)h(as)f(the)g(build)d(mac)m
+(hines,)j(then)g(then)f(compiler)g(is)630 193 y(run)f(on)h(the)h
+(remote)g(host)g(using)d Fr(execute_anywhere)p Fv(.)630
+324 y(This)k(pro)s(duces)g(an)i(arc)m(hiv)m(e)g(\014le.)50
+b(An)m(y)34 b(parameters)g(passed)f(to)h Fr(archive)e
+Fv(are)i(used)f(in)630 434 y(addition)39 b(to)j(the)g(default)e
+(\015ags.)74 b(Optionally)-8 b(,)42 b(this)e(will)f(also)i(use)g(the)h
+(v)-5 b(alue)40 b(of)i(the)630 544 y Fr(arflags)d Fv(\014eld)g(in)h
+(the)h(target)i(con\014g)e(arra)m(y)-8 b(.)73 b(If)41
+b(the)g(host)g(is)f(not)h(the)g(same)h(as)f(the)630 653
+y(build)31 b(mac)m(hines,)k(then)f(then)g(arc)m(hiv)m(er)h(is)e(run)g
+(on)h(the)h(remote)g(host)f(using)f Fr(execute_)630 763
+y(anywhere)p Fv(.)630 895 y(This)28 b(generates)j(an)f(index)e(for)h
+(the)h(arc)m(hiv)m(e)g(\014le)f(for)h(systems)f(that)i(aren't)f(POSIX)f
+(y)m(et.)630 1004 y(An)m(y)h(parameters)h(passed)f(to)h
+Fr(ranlib)e Fv(are)i(used)e(in)g(for)h(the)h(\015ags.)150
+1180 y Fr(execute_anywhere)26 b Fn(cmd)5 b(line)630 1290
+y Fv(This)36 b(executes)j(the)f Fn(cmd)5 b(line)45 b
+Fv(on)37 b(the)h(prop)s(er)f(host.)63 b(This)36 b(should)f(b)s(e)j
+(used)f(as)h(a)g(re-)630 1399 y(placemen)m(t)c(for)e(the)i(Tcl)e
+(command)h Fr(exec)f Fv(as)h(this)f(v)m(ersion)h(utilizes)e(the)i
+(target)i(con\014g)630 1509 y(info)25 b(to)h(execute)h(this)d(command)i
+(on)f(the)h(build)d(mac)m(hine)i(or)h(a)g(remote)g(host.)39
+b(All)25 b(con\014g)630 1619 y(information)k(for)i(the)g(remote)h(host)
+f(m)m(ust)g(b)s(e)f(setup)h(to)g(ha)m(v)m(e)h(this)e(command)h(w)m
+(ork.)42 b(If)630 1728 y(this)25 b(is)g(a)h(canadian)g(cross,)h
+(\(where)f(w)m(e)g(test)h(a)g(cross)f(compiler)e(that)j(runs)d(on)i(a)g
+(di\013eren)m(t)630 1838 y(host)k(then)f(where)h(DejaGn)m(u)g(is)f
+(running\))e(then)j(a)g(connection)g(is)f(made)h(to)g(the)g(remote)630
+1947 y(host)39 b(and)e(the)i(command)f(is)g(executed)h(there.)65
+b(It)39 b(returns)e(either)h Fn(REMOTERR)n(OR)630 2057
+y Fv(\(for)32 b(an)h(error\))f(or)g(the)h(output)e(pro)s(duced)g(when)g
+(the)i(command)f(w)m(as)g(executed.)48 b(This)630 2167
+y(is)29 b(used)h(for)g(running)e(the)i(to)s(ol)h(to)g(b)s(e)f(tested,)h
+(not)g(a)f(test)i(case.)150 2383 y Fi(5.3.5)63 b(Debugging)42
+b(Pro)s(cedures)275 2573 y Fv(`)p Fr(lib/debugger.exp)p
+Fv(')26 b(de\014nes)j(these)i(utilit)m(y)e(pro)s(cedures:)150
+2749 y Fr(dumpvars)f Fn(expr)630 2858 y Fv(This)33 b(tak)m(es)k(a)f
+(csh)f(st)m(yle)g(regular)g(expression)f(\(glob)h(rules\))f(and)h(prin)
+m(ts)f(the)h(v)-5 b(alues)35 b(of)630 2968 y(the)c(global)e(v)-5
+b(ariable)29 b(names)i(that)g(matc)m(h.)41 b(It)31 b(is)e(abbreviated)h
+(as)h Fr(dv)150 3144 y(dumplocals)d Fn(expr)630 3254
+y Fv(This)33 b(tak)m(es)k(a)f(csh)f(st)m(yle)g(regular)g(expression)f
+(\(glob)h(rules\))f(and)h(prin)m(ts)f(the)h(v)-5 b(alues)35
+b(of)630 3363 y(the)c(lo)s(cal)e(v)-5 b(ariable)29 b(names)i(that)g
+(matc)m(h.)41 b(It)31 b(is)e(abbreviated)h(as)g Fr(dl)p
+Fv(.)150 3539 y Fr(dumprocs)e Fn(expr)630 3649 y Fv(This)f(tak)m(es)j
+(a)g(csh)e(st)m(yle)h(regular)f(expression)g(\(glob)h(rules\))e(and)h
+(prin)m(ts)g(the)h(b)s(o)s(dy)e(of)i(all)630 3759 y(pro)s(cs)h(that)h
+(matc)m(h.)41 b(It)31 b(is)e(abbreviated)h(as)g Fr(dp)150
+3935 y(dumpwatch)e Fn(expr)630 4044 y Fv(This)i(tak)m(es)j(a)f(csh)g
+(st)m(yle)g(regular)f(expression)g(\(glob)g(rules\))g(and)g(prin)m(ts)g
+(all)f(the)i(w)m(atc)m(h-)630 4154 y(p)s(oin)m(ts.)40
+b(It)30 b(is)f(abbreviated)h(as)h Fr(dw)p Fv(.)150 4330
+y Fr(watchunset)d Fn(var)630 4440 y Fv(This)22 b(breaks)i(program)f
+(execution)i(when)d(the)j(v)-5 b(ariable)22 b Fn(var)35
+b Fv(is)22 b(unset.)39 b(It)24 b(is)f(abbreviated)630
+4549 y(as)31 b Fr(wu)p Fv(.)150 4725 y Fr(watchwrite)d
+Fn(var)630 4835 y Fv(This)g(breaks)h(program)h(execution)g(when)f(the)g
+(v)-5 b(ariable)29 b Fn(var)40 b Fv(is)29 b(written.)39
+b(It)30 b(is)f(abbrevi-)630 4945 y(ated)i(as)g Fr(ww)p
+Fv(.)150 5121 y Fr(watchread)d Fn(var)630 5230 y Fv(This)e(breaks)h
+(program)g(execution)h(when)e(the)i(v)-5 b(ariable)26
+b Fn(var)38 b Fv(is)27 b(read.)39 b(It)28 b(is)f(abbreviated)630
+5340 y(as)k Fr(wr)p Fv(.)p eop
+%%Page: 31 33
+31 32 bop 150 -116 a Fv(Chapter)30 b(5:)h(The)f(DejaGn)m(u)h(Implemen)m
+(tation)1857 b(31)150 83 y Fr(watchdel)28 b Fn(watch)630
+193 y Fv(This)h(deletes)h(a)h(the)f(w)m(atc)m(hp)s(oin)m(t)h(for)f
+Fn(watch)p Fv(.)42 b(It)31 b(is)e(abbreviated)h(as)g
+Fr(wd)p Fv(.)150 372 y Fr(print)f Fn(var)85 b Fv(This)29
+b(prin)m(ts)f(the)j(v)-5 b(alue)30 b(of)g(the)h(v)-5
+b(ariable)29 b Fn(var)p Fv(.)41 b(It)31 b(is)e(abbreviated)h(as)h
+Fr(p)p Fv(.)150 552 y Fr(quit)288 b Fv(This)29 b(mak)m(es)i(run)m(test)
+f(exit.)41 b(It)30 b(is)g(abbreviated)f(as)i Fr(q)p Fv(.)150
+732 y Fr(bt)384 b Fv(This)29 b(prin)m(ts)f(a)j(bac)m(ktrace)i(of)d(the)
+h(executed)g(Tcl)f(commands.)150 985 y Fu(5.4)68 b(T)-11
+b(arget)45 b(dep)t(enden)l(t)g(pro)t(cedures)275 1176
+y Fv(Eac)m(h)37 b(com)m(bination)e(of)i(target)h(and)e(to)s(ol)g
+(requires)f(some)i(target-dep)s(enden)m(t)g(pro)s(cedures.)57
+b(The)150 1286 y(names)24 b(of)f(these)h(pro)s(cedures)f(ha)m(v)m(e)h
+(a)g(common)g(form:)37 b(the)24 b(to)s(ol)f(name,)j(follo)m(w)m(ed)d(b)
+m(y)g(an)h(underbar)e(`)p Fr(_)p Fv(',)150 1396 y(and)k(\014nally)e(a)j
+(su\016x)e(describing)f(the)i(pro)s(cedure's)g(purp)s(ose.)37
+b(F)-8 b(or)27 b(example,)h(a)e(pro)s(cedure)f(to)i(extract)150
+1505 y(the)45 b(v)m(ersion)g(from)g Fo(gdb)g Fv(is)f(called)h(`)p
+Fr(gdb_version)p Fv('.)83 b(See)45 b(Section)g(5.2)h([Initialization)e
+(Mo)s(dule],)150 1615 y(page)39 b(22,)i(for)d(a)h(discussion)c(of)k(ho)
+m(w)f(DejaGn)m(u)h(arranges)f(to)h(\014nd)e(the)h(righ)m(t)g(pro)s
+(cedures)f(for)h(eac)m(h)150 1724 y(target.)275 1857
+y Fr(runtest)e Fv(itself)i(calls)f(only)h(t)m(w)m(o)i(of)f(these)g(pro)
+s(cedures,)g Fq(to)s(ol)t Fr(_exit)e Fv(and)h Fq(to)s(ol)t
+Fr(_version)p Fv(;)i(these)150 1967 y(pro)s(cedures)29
+b(use)h(no)g(argumen)m(ts.)275 2100 y(The)f(other)i(t)m(w)m(o)h(pro)s
+(cedures,)d Fq(to)s(ol)t Fr(_start)g Fv(and)h Fq(to)s(ol)t
+Fr(_load)p Fv(,)e(are)j(only)f(called)f(b)m(y)i(the)f(test)i(suites)150
+2209 y(themselv)m(es)38 b(\(or)f(b)m(y)h(testsuite-sp)s(eci\014c)f
+(initialization)d(co)s(de\);)42 b(they)37 b(ma)m(y)h(tak)m(e)h(argumen)
+m(ts)f(or)f(not,)150 2319 y(dep)s(ending)28 b(on)i(the)h(con)m(v)m(en)m
+(tions)g(used)f(within)e(eac)m(h)j(test)g(suite.)150
+2499 y Fq(to)s(ol)t Fr(_start)630 2609 y Fv(Starts)22
+b(a)g(particular)e(to)s(ol.)37 b(F)-8 b(or)23 b(an)e(in)m(teractiv)m(e)
+i(to)s(ol,)g Fq(to)s(ol)t Fr(_start)d Fv(starts)i(and)f(initializes)630
+2718 y(the)28 b(to)s(ol,)h(lea)m(ving)f(the)g(to)s(ol)g(up)f(and)h
+(running)d(for)j(the)g(test)h(cases;)h(an)e(example)g(is)f
+Fr(gdb_)630 2828 y(start)p Fv(,)41 b(the)f(start)h(function)d(for)i
+Fo(gdb)p Fv(.)69 b(F)-8 b(or)40 b(a)g(batc)m(h)h(orien)m(ted)f(to)s
+(ol,)i Fq(to)s(ol)t Fr(_start)c Fv(is)630 2937 y(optional;)26
+b(the)e(recommended)g(con)m(v)m(en)m(tion)h(is)e(to)i(let)f
+Fq(to)s(ol)t Fr(_start)f Fv(run)f(the)j(to)s(ol,)g(lea)m(ving)630
+3047 y(the)41 b(output)f(in)g(a)h(v)-5 b(ariable)40 b(called)g
+Fr(comp_output)p Fv(.)69 b(T)-8 b(est)41 b(scripts)f(can)h(then)g
+(analyze)630 3156 y(`)p Fr($comp_output)p Fv(')29 b(to)k(determine)e
+(the)h(test)g(results.)44 b(An)32 b(example)f(of)h(this)f(second)h
+(kind)630 3266 y(of)f(start)f(function)g(is)f Fr(gcc_start)p
+Fv(,)f(the)j(start)g(function)e(for)h Fo(gcc)p Fv(.)630
+3399 y Fr(runtest)18 b Fv(itself)h Fn(do)-5 b(es)25 b(not)f(c)-5
+b(al)5 b(l)30 b Fq(to)s(ol)t Fr(_start)p Fv(.)36 b(The)19
+b(initialization)e(mo)s(dule)i(`)p Fq(to)s(ol)t Fr(_init.exp)p
+Fv(')630 3509 y(m)m(ust)35 b(call)f Fq(to)s(ol)t Fr(_start)f
+Fv(for)i(in)m(teractiv)m(e)h(to)s(ols;)h(for)e(batc)m(h-orien)m(ted)h
+(to)s(ols,)g(eac)m(h)g(indi-)630 3618 y(vidual)i(test)k(script)d(calls)
+h Fq(to)s(ol)t Fr(_start)e Fv(\(or)j(mak)m(es)g(other)g(arrangemen)m
+(ts)g(to)h(run)d(the)630 3728 y(to)s(ol\).)150 3908 y
+Fq(to)s(ol)t Fr(_load)82 b Fv(Loads)25 b(something)f(in)m(to)h(a)g(to)s
+(ol.)39 b(F)-8 b(or)26 b(an)e(in)m(teractiv)m(e)i(to)s(ol,)g(this)e
+(conditions)f(the)i(to)s(ol)g(for)630 4017 y(a)35 b(particular)e(test)i
+(case;)j(for)d(example,)g Fr(gdb_load)e Fv(loads)h(a)h(new)f
+(executable)h(\014le)f(in)m(to)630 4127 y(the)24 b(debugger.)39
+b(F)-8 b(or)24 b(batc)m(h)h(orien)m(ted)f(to)s(ols,)h
+Fq(to)s(ol)t Fr(_load)d Fv(ma)m(y)j(do)f(nothing|though,)g(for)630
+4237 y(example,)h(the)f Fo(gcc)g Fv(supp)s(ort)e(uses)h
+Fr(gcc_load)f Fv(to)j(load)e(and)h(run)e(a)i(binary)e(on)i(the)g
+(target)630 4346 y(en)m(vironmen)m(t.)61 b(Con)m(v)m(en)m(tionally)-8
+b(,)39 b Fq(to)s(ol)t Fr(_load)d Fv(lea)m(v)m(es)j(the)e(output)g(of)h
+(an)m(y)f(program)g(it)630 4456 y(runs)f(in)h(a)h(v)-5
+b(ariable)36 b(called)h(`)p Fr(exec_output)p Fv('.)61
+b(W)-8 b(riting)37 b Fq(to)s(ol)t Fr(_load)e Fv(can)k(b)s(e)e(the)h
+(most)630 4565 y(complex)27 b(part)g(of)g(extending)g(DejaGn)m(u)h(to)f
+(a)h(new)f(to)s(ol)g(or)g(a)g(new)g(target,)j(if)c(it)g(requires)630
+4675 y(m)m(uc)m(h)k(comm)m(unication)g(co)s(ding)g(or)g(\014le)f(do)m
+(wnloading.)630 4808 y(T)-8 b(est)31 b(scripts)e(call)h
+Fq(to)s(ol)t Fr(_load)p Fv(.)150 4988 y Fq(to)s(ol)t
+Fr(_exit)82 b Fv(Cleans)33 b(up)g(\(if)h(necessary\))h(b)s(efore)f
+Fr(runtest)e Fv(exits.)52 b(F)-8 b(or)35 b(in)m(teractiv)m(e)g(to)s
+(ols,)g(this)e(usu-)630 5097 y(ally)38 b(ends)f(the)i(in)m(teractiv)m
+(e)h(session.)65 b(Y)-8 b(ou)39 b(can)g(also)g(use)f
+Fq(to)s(ol)t Fr(_exit)f Fv(to)i(remo)m(v)m(e)i(an)m(y)630
+5207 y(temp)s(orary)30 b(\014les)f(left)h(o)m(v)m(er)i(from)e(the)h
+(tests.)630 5340 y Fr(runtest)d Fv(calls)i Fq(to)s(ol)t
+Fr(_exit)p Fv(.)p eop
+%%Page: 32 34
+32 33 bop 150 -116 a Fv(32)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fq(to)s(ol)t
+Fr(_version)630 193 y Fv(Prin)m(ts)36 b(the)i(v)m(ersion)e(lab)s(el)g
+(and)h(n)m(um)m(b)s(er)f(for)h Fq(to)s(ol)p Fv(.)61 b(This)36
+b(is)g(called)g(b)m(y)i(the)f(DejaGn)m(u)630 302 y(pro)s(cedure)31
+b(that)i(prin)m(ts)e(the)i(\014nal)e(summary)h(rep)s(ort.)46
+b(The)32 b(output)g(should)f(consist)h(of)630 412 y(the)f(full)d(path)i
+(name)g(used)g(for)g(the)g(tested)i(to)s(ol,)e(and)g(its)g(v)m(ersion)g
+(n)m(um)m(b)s(er.)630 546 y Fr(runtest)e Fv(calls)i Fq(to)s(ol)t
+Fr(_version)p Fv(.)275 706 y(The)h(usual)g(con)m(v)m(en)m(tion)i(for)f
+(return)f(co)s(des)h(from)g(an)m(y)g(of)h(these)f(pro)s(cedures)f
+(\(although)h(it)g(is)f(not)150 815 y(required)25 b(b)m(y)i
+Fr(runtest)p Fv(\))f(is)g(to)h(return)f Fr(0)h Fv(if)f(the)h(pro)s
+(cedure)f(succeeded,)i Fr(1)f Fv(if)f(it)g(failed,)h(and)f
+Fr(-1)h Fv(if)f(there)150 925 y(w)m(as)31 b(a)g(comm)m(unication)e
+(error.)150 1182 y Fu(5.5)68 b(Remote)47 b(targets)f(supp)t(orted)275
+1375 y Fv(The)35 b(DejaGn)m(u)j(distribution)33 b(includes)h(supp)s
+(ort)g(for)i(the)h(follo)m(wing)e(remote)i(targets.)61
+b(Y)-8 b(ou)37 b(can)150 1484 y(set)f(the)f(target)h(name)f(and)g(the)g
+(connect)h(mo)s(de)f(in)e(the)j(`)p Fr(site.exp)p Fv(')d(\014le)h
+(\(using)g(the)h(Tcl)f(v)-5 b(ariables)150 1594 y(`)p
+Fr(targetname)p Fv(')37 b(and)h(`)p Fr(connectmode)p
+Fv(',)h(resp)s(ectiv)m(ely\),)i(or)e(on)g(the)g Fr(runtest)e
+Fv(command)i(line)e(\(using)150 1704 y(`)p Fr(--name)p
+Fv(')29 b(and)h(`)p Fr(--connect)p Fv('\).)150 1863 y
+Fo(amd)g Fh(29000,)j(with)d(UDI)g(proto)s(col)630 1973
+y Fv(Con\014gure)e(DejaGn)m(u)h(for)g(target)h(`)p Fr(a29k-amd-udi)p
+Fv('.)37 b(\(Cygn)m(us)29 b Fr(configure)d Fv(also)i(recog-)630
+2082 y(nizes)36 b(the)g(abbreviation)f(`)p Fr(udi29k)p
+Fv('.\))58 b(Then,)37 b(to)g(run)e(tests,)k(use)d(the)g
+Fr(runtest)e Fv(target)630 2192 y(name)29 b(to)g(sp)s(ecify)e(whether)h
+(y)m(ou)h(w)m(an)m(t)h(to)f(use)g(a)g(sim)m(ulator,)f(or)g(a)h
+(particular)e(hardw)m(are)630 2301 y(b)s(oard.)67 b(The)38
+b(particular)g(string)g(to)i(use)g(with)e(`)p Fr(--name)p
+Fv(')g(will)e(dep)s(end)i(on)h(y)m(our)h(UDI)630 2411
+y(setup)d(\014le,)j(`)p Fr(udi_soc)p Fv(')c(\(if)h(`)p
+Fr(udi_soc)p Fv(')f(is)h(not)i(in)d(y)m(our)i(w)m(orking)f(directory)-8
+b(,)40 b(the)e(en)m(vi-)630 2521 y(ronmen)m(t)31 b(v)-5
+b(ariable)29 b(`)p Fr(UDICONF)p Fv(')g(should)g(con)m(tain)h(a)h(path)g
+(to)g(this)e(\014le\).)41 b(F)-8 b(or)31 b(example,)g(if)630
+2630 y(y)m(our)f(UDI)h(setup)f(\014le)f(includes)f(these)j(lines:)150
+2734 y Fm(\013)p 200 2734 3554 4 v 3553 w(\010)p 150
+3043 4 262 v 178 2894 a Fr(iss)143 b(AF_UNIX)93 b(*)143
+b(isstip)46 b(-r)h(/home/gnu/29k/src/osboot/)o(sim/)o(osbo)o(ot)178
+2998 y(mon)143 b(AF_UNIX)93 b(*)143 b(montip)46 b(-t)h(serial)f(-baud)h
+(9600)f(-com)h(/dev/ttyb)p 3803 3043 V 150 3095 a Fm(\012)p
+200 3095 3554 4 v 3553 w(\011)630 3265 y Fv(Y)-8 b(ou)37
+b(can)f(use)g(`)p Fr(--name)28 b(iss)p Fv(')36 b(to)h(run)d(tests)j(on)
+f(the)g(sim)m(ulator,)h(and)e(`)p Fr(--name)29 b(mon)p
+Fv(')35 b(to)630 3375 y(run)e(tests)j(on)f(the)g(29K)g(hardw)m(are.)54
+b(See)35 b(the)g(man)m(ufacturer's)g(man)m(uals)f(for)h(more)g(in-)630
+3484 y(formation)30 b(on)g(UDI)h(and)f(`)p Fr(udi_soc)p
+Fv('.)630 3619 y(The)k(default)g(connect)i(proto)s(col)e(is)g(`)p
+Fr(mondfe)p Fv(')g(with)f(either)h(bac)m(k)i(end.)53
+b Fr(mondfe)33 b Fv(is)h(the)630 3728 y(only)21 b(shell)f(DejaGn)m(u)j
+(supp)s(orts)d(for)h(UDI)i(targets.)39 b Fr(mondfe)20
+b Fv(is)h(an)h Fo(amd)f Fv(sp)s(eci\014c)g(monitor)630
+3838 y(program)30 b(freely)g(a)m(v)-5 b(ailable)30 b(from)g
+Fo(amd)p Fv(.)630 3972 y Fn(Warning:)49 b Fv(This)30
+b(target)j(requires)d Fo(gdb)i Fv(v)m(ersion)f(4.7.2)i(\(or)f
+(greater\).)47 b(Earlier)30 b(v)m(ersions)630 4082 y(of)e
+Fo(gdb)g Fv(do)h(not)f(fully)e(supp)s(ort)h(the)h Fr(load)f
+Fv(command)i(on)f(this)f(target,)j(so)f(DejaGn)m(u)g(has)630
+4192 y(no)h(w)m(a)m(y)i(to)f(load)f(executable)h(\014les)e(from)h(the)g
+(debugger.)150 4351 y Fh(Motorola)j(680x0)f(b)s(oards,)d(a.out)j(or)e
+Fo(coff)f Fh(ob)5 b(ject)32 b(format)630 4461 y Fv(Con\014gure)d
+(DejaGn)m(u)j(for)e(an)m(y)g(remote)i(target)g(matc)m(hing)e(`)p
+Fr(m68k-*)p Fv('.)630 4595 y Fn(Warning:)70 b Fv(Most)43
+b(`)p Fr(m68k-*)p Fv(')d(con\014gurations)i(run)e(all)h(tests)i(only)f
+(for)f(nativ)m(e)i(testing)630 4705 y(\(when)c(the)g(target)i(is)e(the)
+g(same)h(as)g(the)f(host\).)68 b(When)39 b(y)m(ou)h(sp)s(ecify)e(most)i
+(of)f(these)630 4814 y(targets)i(for)e(a)h(cross)f(con\014guration,)i
+(y)m(ou)f(will)d(only)h(b)s(e)h(able)g(to)h(use)f(tests)h(that)g(run)
+630 4924 y(completely)25 b(within)e(the)j(host)g(\(for)g(example,)g
+(tests)h(of)f(the)g(binary)d(utilities)g(suc)m(h)j(as)g(the)630
+5033 y(arc)m(hiv)m(er;)31 b(or)f(compiler)f(tests)i(that)g(only)f
+(generate)i(co)s(de)e(rather)g(than)g(running)e(it\).)630
+5168 y(T)-8 b(o)27 b(run)e(a.out)j(or)f Fo(coff)e Fv(binaries)g(on)h(a)
+i(remote)f(M68K,)h(y)m(ou)f(m)m(ust)g(con\014gure)f(DejaGn)m(u)630
+5277 y(for)37 b(a)g(particular)e(target)k(b)s(oard.)59
+b(`)p Fr(m68k-abug)p Fv(')35 b(is)h(an)h(example.)60
+b(\(In)36 b(general)h(for)g(an)p eop
+%%Page: 33 35
+33 34 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(33)630 83 y(em)m(b)s(edded)35
+b(en)m(vironmen)m(t,)i(b)s(ecause)g(it)e(do)s(es)h(not)g(ha)m(v)m(e)i
+(absolute)e(addresses,)h(a.out)g(is)630 193 y(not)25
+b(a)g(go)s(o)s(d)g(c)m(hoice)h(for)f(output)f(format)h(in)f(an)m(y)h
+(case;)j(most)e(often)f(S-records)f(or)h(Hex-32)630 302
+y(are)31 b(used)e(instead.\))150 462 y Fh(Motorola)k(68K)e(MVME)g(135)g
+(b)s(oard)f(running)f(ABug)g(b)s(o)s(ot)h(monitor)630
+571 y Fv(Con\014gure)g(for)h(`)p Fr(m68k-abug-aout)p
+Fv(')c(or)k(`)p Fr(m68k-abug-coff)p Fv(')d(\(as)j(a)h(target\).)44
+b(This)29 b(b)s(o)s(ot)630 681 y(monitor)42 b(can)i(only)e(do)m(wnload)
+h(S-records;)49 b(therefore,)e(the)c(DejaGn)m(u)h(tests)g(for)f(this)
+630 790 y(en)m(vironmen)m(t)34 b(require)f(a)i(link)m(er)e(command)i
+(script)e(to)i(con)m(v)m(ert)h(either)e(output)h(format)630
+900 y(to)c(S-records,)f(setting)h(the)f(default)g(addresses)g(for)g
+Fr(.text)p Fv(,)f Fr(.bss)p Fv(,)g(and)h Fr(.data)p Fv(.)630
+1034 y(With)i(this)f(con\014guration,)i(the)f(default)g(for)g(`)p
+Fr(--connect)p Fv(')e(is)i(`)p Fr(tip)p Fv('.)46 b(`)p
+Fr(tip)p Fv(')32 b(is)f(the)i(only)630 1144 y(comm)m(unications)38
+b(proto)s(col)g(supp)s(orted)f(for)h(connecting)h(to)g(`)p
+Fr(m68k-abug-*)p Fv(')d(targets.)630 1254 y(`)p Fr(tip)p
+Fv(')28 b(uses)h(an)f Fo(asci)r(i)h Fv(do)m(wnloader)f(\(the)h
+Fr(~put)e Fv(command\))i(to)h(load)e(S-records)g(in)m(to)h(the)630
+1363 y(target)39 b(b)s(oard.)59 b(The)37 b(`)p Fr(--name)p
+Fv(')e(string)h(m)m(ust)h(b)s(e)f(a)i(mac)m(hine)e(name)i(that)f
+Fr(tip)f Fv(under-)630 1473 y(stands)g(\(for)h(example,)i(on)e(some)g
+Fr(tip)f Fv(implemen)m(tations)f(it)i(m)m(ust)f(b)s(e)h(an)f(en)m(try)h
+(from)630 1582 y(the)31 b(initialization)c(\014le)i(for)h
+Fr(tip)p Fv(;)g(this)f(\014le)h(is)f(sometimes)i(called)e(`)p
+Fr(/etc/remote)p Fv('\).)630 1717 y(See)d(y)m(our)g(system)g(do)s
+(cumen)m(tation)g(for)g(information)f(on)g(ho)m(w)h(to)h(create)h(new)d
+(en)m(tries)h(in)630 1826 y(`)p Fr(/etc/remote)p Fv('.)50
+b(\(Some)35 b Fo(unix)f Fv(systems)h(are)g(distributed)c(with)i(at)i
+(least)g(one)g(default)630 1936 y(en)m(try)29 b(with)f(a)h(name)g
+(resem)m(bling)e(`)p Fr(hardwire)p Fv(';)h(if)f(y)m(our)i(system)g(has)
+g(one,)g(y)m(ou)g(can)g(edit)630 2046 y(it,)44 b(or)d(mak)m(e)h(a)g(mo)
+s(di\014ed)d(cop)m(y)j(with)e(a)i(new)f(name.\))74 b(When)41
+b(y)m(ou)g(ha)m(v)m(e)i(a)f(w)m(orking)630 2155 y(`)p
+Fr(/etc/remote)p Fv(')30 b(en)m(try)j Fq(abugtarget)p
+Fv(,)h(y)m(ou)f(should)e(b)s(e)g(able)h(to)i(t)m(yp)s(e)e(`)p
+Fr(tip)e Fq(abugtarget)r Fv(',)630 2265 y(and)24 b(get)h(the)g(prompt)f
+(`)p Fr(135ABUG>)p Fv(')e(from)i(the)h(b)s(oard.)38 b(Use)25
+b(the)f(same)h Fq(abugtarget)j Fv(string)630 2374 y(with)h(`)p
+Fr(runtest)g(--name)p Fv('.)150 2534 y Fh(Motorola)k(IDP)d(b)s(oard)f
+(running)g(the)i(rom68k)g(b)s(o)s(ot)g(monitor)630 2643
+y Fv(This)36 b(is)g(the)i(same)g(in)e(functionalit)m(y)g(as)h(the)h
+(MVME)g(b)s(oard)e(running)f(the)j Fr(BUG)e Fv(b)s(o)s(ot)630
+2753 y(monitor.)k(Only)29 b(the)h(monitor)g(commands)g(and)g(the)g
+(addresses)g(are)h(di\013eren)m(t.)150 2912 y Fh(VxW)-8
+b(orks)31 b(\(Motorola)i(68K)e(or)g(In)m(tel)g(960\))630
+3022 y Fv(Con\014gure)k(DejaGn)m(u)h(for)g(either)f(`)p
+Fr(m68k-wrs-vxworks)p Fv(')d(\(abbreviated)k(`)p Fr(vxworks68)p
+Fv('\))630 3132 y(or)21 b(`)p Fr(i960-wrs-vxworks)p Fv(')c
+(\(abbreviated)k(`)p Fr(vxworks960)p Fv('\).)35 b(Since)20
+b(b)s(oth)g(targets)j(supp)s(ort)630 3241 y(IP)42 b(addressing,)i(sp)s
+(ecify)d(the)i(net)m(w)m(ork)h(address)d(\(for)i(example,)i(a)e(host)g
+(name)f(from)630 3351 y(`)p Fr(/etc/hosts)p Fv('\))28
+b(with)i(`)p Fr(--name)p Fv('.)630 3485 y(The)35 b(default)g(connect)h
+(proto)s(col)f(is)g(`)p Fr(rlogin)p Fv(',)h(but)e(y)m(ou)i(can)g(use)f
+(an)m(y)h(of)f(`)p Fr(--connect)630 3595 y(rlogin)p Fv(',)29
+b(`)p Fr(--connect)f(telnet)p Fv(',)h(or)i(`)p Fr(--connect)d(rsh)p
+Fv('.)630 3729 y(T)-8 b(est)42 b(scripts)f(need)g(no)g(sp)s(ecial)g(co)
+s(de)g(to)i(load)e(programs)g(in)m(to)h(these)g(targets;)49
+b(since)630 3839 y(VxW)-8 b(orks)42 b(supp)s(orts)d(NFS,)j(all)e(y)m
+(ou)h(m)m(ust)h(do)f(is)f(ensure)g(test)i(programs)f(are)h(on)f(an)630
+3949 y(exp)s(orted)30 b(\014lesystem.)630 4083 y(When)j(y)m(ou)g
+(compile)f(for)h(VxW)-8 b(orks,)35 b(use)d(the)i(link)m(er)d(`)p
+Fr(-r)p Fv(')i(option)g(to)g(mak)m(e)h(the)g(link)m(er)630
+4193 y(output)25 b(relo)s(catable|at)g(least)h(if)e(y)m(ou)h(w)m(an)m
+(t)h(to)g(use)f(library)d(routines.)38 b(Man)m(y)26 b(standard)630
+4302 y(C)34 b(routines)f(are)i(included)d(in)h(VxW)-8
+b(orks;)37 b(often)e(no)f(additional)f(libraries)e(are)k(needed.)630
+4412 y(See)c(y)m(our)f(VxW)-8 b(orks)31 b(system)g(do)s(cumen)m(tation)
+f(for)g(additional)e(details.)p eop
+%%Page: 34 36
+34 35 bop 150 -116 a Fv(34)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fu(5.6)68 b(The)45
+b(\014les)g(DejaGn)l(u)g(reads)275 276 y Fv(The)28 b
+Fr(runtest)g Fv(program)h(used)f(to)i(in)m(v)m(ok)m(e)h(DejaGn)m(u)f
+(is)e(a)i(short)f(shell)e(script)i(generated)h(b)m(y)f
+Fr(make)150 385 y Fv(during)h(the)i(con\014guration)f(pro)s(cess.)45
+b(Its)32 b(main)e(task)j(is)e(to)h(read)g(the)g(main)f(test)i(framew)m
+(ork)f(driv)m(er,)150 495 y(`)p Fr(runtest.exp)p Fv('.)275
+629 y(`)p Fr(runtest.exp)p Fv(',)c(in)h(turn,)g(reads)h
+Fr(expect)f Fv(co)s(de)i(from)e(certain)i(other)f(\014les,)g(in)f(this)
+g(order:)199 764 y(1.)61 b(Eac)m(h)31 b(of)f(the)g(`)p
+Fr(site.exp)p Fv(')f(lo)s(cal)g(de\014nition)f(\014les)h(a)m(v)-5
+b(ailable.)40 b(See)31 b(Chapter)e(4)i([Setting)f Fr(runtest)330
+873 y Fv(defaults],)g(page)h(15,)h(for)e(details.)199
+1008 y(2.)61 b(`)p Fr(lib/utils.exp)p Fv(',)23 b(a)i(collection)f(of)h
+(utilit)m(y)d(pro)s(cedures.)38 b(See)25 b(Section)f(5.3)i([DejaGn)m(u)
+f(Builtins],)330 1117 y(page)31 b(23,)h(for)e(descriptions)e(of)j
+(these)f(pro)s(cedures.)199 1252 y(3.)61 b(`)p Fr(lib/framework.exp)p
+Fv(',)37 b(a)j(\014le)e(of)h(subroutines)e(mean)m(t)j(for)f
+Fr(runtest)e Fv(itself)g(rather)i(than)g(for)330 1362
+y(general-purp)s(ose)29 b(use)h(in)f(b)s(oth)h Fr(runtest)e
+Fv(and)i(test)h(suites.)199 1496 y(4.)61 b(`)p Fr(debugger.exp)p
+Fv(',)45 b(Don)g(Lib)s(es')e(Tcl)g(Debugger.)84 b(\(See)45
+b Fq(A)f(Debugger)h(for)f(Tcl)g(Applications)330 1606
+y Fv(b)m(y)38 b(Don)h(Lib)s(es.)63 b(This)37 b(pap)s(er)g(is)g
+(distributed)f(with)h Fr(expect)g Fv(in)g(P)m(ostScript)h(form)g(as)g
+(the)h(\014le)330 1715 y(`)p Fr(expect/tcl-debug.ps)p
+Fv('.\))199 1850 y(5.)61 b(`)p Fr(lib/remote.exp)p Fv(',)20
+b(a)h(collection)f(of)h(subroutines)e(mean)m(t)i(for)g(connecting)g(to)
+g(remote)h(mac)m(hines.)199 1984 y(6.)61 b(`)p Fr(lib/target.exp)p
+Fv(',)41 b(a)g(collection)g(of)g(subroutines)e(used)h(for)h(the)g
+(con\014guration)f(systems)h(in)330 2094 y(DejaGn)m(u.)h(These)30
+b(pro)s(cedures)f(t)m(ypically)g(manipulate)g(or)h(utilize)f(the)h
+(con\014guration)g(system.)199 2228 y(7.)61 b(An)34 b(initialization)e
+(\014le)i Fq(to)s(ol)t Fr(_init.exp)p Fv(.)50 b(See)35
+b(Section)g(5.2)g([Initialization)e(mo)s(dule],)h(page)i(22,)330
+2338 y(for)30 b(more)h(discussion)c(of)k(init)e(\014les.)p
+eop
+%%Page: 35 37
+35 36 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(35)150 83 y Fu(5.7)68 b(The)45
+b(\014les)g(DejaGn)l(u)g(writes)275 276 y Fr(runtest)31
+b Fv(alw)m(a)m(ys)j(writes)e(t)m(w)m(o)j(kinds)c(of)i(output)g
+(\014les:)46 b(summary)32 b(logs)h(and)g(detailed)f(logs.)49
+b(The)150 385 y(con)m(ten)m(ts)32 b(of)f(b)s(oth)e(of)i(these)g(are)f
+(determined)f(b)m(y)i(y)m(our)f(tests.)275 520 y(F)-8
+b(or)37 b(troublesho)s(oting,)g(a)g(third)e(kind)g(of)i(output)g
+(\014le)f(is)g(useful:)52 b(use)36 b(`)p Fr(--debug)p
+Fv(')g(to)h(request)g(an)150 629 y(output)30 b(\014le)f(sho)m(wing)h
+(details)f(of)i(what)f Fr(expect)f Fv(is)g(doing)h(in)m(ternally)-8
+b(.)150 853 y Fi(5.7.1)63 b(Summary)39 b(log)275 1046
+y Fr(runtest)33 b Fv(alw)m(a)m(ys)j(pro)s(duces)e(a)i(summary)f(output)
+g(\014le)g(`)p Fq(to)s(ol)p Fr(.sum)p Fv('.)55 b(This)34
+b(summary)g(sho)m(ws)i(the)150 1156 y(names)f(of)g(all)f(test)i
+(\014les)e(run;)i(for)f(eac)m(h)h(test)g(\014le,)g(one)f(line)f(of)h
+(output)f(from)h(eac)m(h)h Fr(pass)e Fv(command)150 1265
+y(\(sho)m(wing)39 b(status)g(`)p Fr(PASS)p Fv(')g(or)g(`)p
+Fr(XPASS)p Fv('\))f(or)h Fr(fail)f Fv(command)h(\(status)h(`)p
+Fr(FAIL)p Fv(')f(or)g(`)p Fr(XFAIL)p Fv('\);)k(trailing)150
+1375 y(summary)26 b(statistics)g(that)h(coun)m(t)h(passing)d(and)h
+(failing)f(tests)i(\(exp)s(ected)h(and)e(unexp)s(ected\);)i(and)e(the)
+150 1484 y(full)e(pathname)i(and)f(v)m(ersion)h(n)m(um)m(b)s(er)f(of)h
+(the)g(to)s(ol)g(tested.)41 b(\(All)25 b(p)s(ossible)e(outcomes,)29
+b(and)c(all)g(errors,)150 1594 y(are)36 b(alw)m(a)m(ys)g(re\015ected)g
+(in)f(the)h(summary)e(output)h(\014le,)i(regardless)e(of)h(whether)f
+(or)g(not)h(y)m(ou)g(sp)s(ecify)150 1704 y(`)p Fr(--all)p
+Fv('.\))275 1838 y(If)k(an)m(y)g(of)h(y)m(our)f(tests)i(use)e(the)g
+(pro)s(cedures)g Fr(unresolved)p Fv(,)g Fr(unsupported)p
+Fv(,)g(or)h Fr(untested)p Fv(,)g(the)150 1948 y(summary)29
+b(output)h(also)h(tabulates)f(the)h(corresp)s(onding)d(outcomes.)275
+2082 y(F)-8 b(or)21 b(example,)h(after)f(`)p Fr(runtest)28
+b(--tool)h(binutils)p Fv(',)20 b(lo)s(ok)g(for)g(a)h(summary)e(log)h
+(in)f(`)p Fr(binutils.sum)p Fv('.)150 2192 y(Normally)-8
+b(,)39 b Fr(runtest)d Fv(writes)h(this)g(\014le)g(in)f(y)m(our)i
+(curren)m(t)g(w)m(orking)f(directory;)k(use)d(the)g(`)p
+Fr(--outdir)p Fv(')150 2301 y(option)30 b(to)h(select)g(a)g(di\013eren)
+m(t)f(directory)-8 b(.)150 2416 y(Here)31 b(is)e(a)i(short)f(sample)g
+(summary)f(log:)150 2495 y Fm(\013)p 200 2495 3554 4
+v 3553 w(\010)p 150 4457 4 1915 v 178 2648 a Fr(Test)47
+b(Run)g(By)g(rob)g(on)g(Mon)g(May)g(25)g(21:40:57)f(PDT)g(1992)942
+2752 y(===)h(gdb)g(tests)f(===)178 2856 y(Running)g(./gdb.t00/echo.exp)
+d(...)178 2959 y(PASS:)142 b(Echo)47 b(test)178 3063
+y(Running)f(./gdb.all/help.exp)d(...)178 3167 y(PASS:)142
+b(help)47 b(add-symbol-file)178 3271 y(PASS:)142 b(help)47
+b(aliases)178 3374 y(PASS:)142 b(help)47 b(breakpoint)e("bre")h
+(abbreviation)178 3478 y(FAIL:)142 b(help)47 b(run)g("r")f
+(abbreviation)178 3582 y(Running)g(./gdb.t10/crossload.exp)41
+b(...)178 3686 y(PASS:)142 b(m68k-elf)46 b(\(elf-big\))f(explicit)g
+(format;)h(loaded)178 3790 y(XFAIL:)94 b(mips-ecoff)45
+b(\(ecoff-bigmips\))f("ptype)i(v_signed_char")e(signed)178
+3893 y(C)k(types)942 3997 y(===)f(gdb)g(Summary)e(===)178
+4101 y(#)j(of)f(expected)e(passes)h(5)178 4205 y(#)i(of)f(expected)e
+(failures)h(1)178 4308 y(#)i(of)f(unexpected)e(failures)g(1)178
+4412 y(/usr/latest/bin/gdb)e(version)j(4.6.5)g(-q)p 3803
+4457 V 150 4509 a Fm(\012)p 200 4509 3554 4 v 3553 w(\011)p
+eop
+%%Page: 36 38
+36 37 bop 150 -116 a Fv(36)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fi(5.7.2)63
+b(Detailed)40 b(log)275 270 y Fr(runtest)28 b Fv(also)h(sa)m(v)m(es)j
+(a)e(detailed)f(log)h(\014le)g(`)p Fq(to)s(ol)p Fr(.log)p
+Fv(',)f(sho)m(wing)g(an)m(y)i(output)e(generated)i(b)m(y)f(tests)150
+380 y(as)g(w)m(ell)f(as)h(the)g(summary)f(output.)40
+b(F)-8 b(or)31 b(example,)f(after)h(`)p Fr(runtest)d(--tool)h(binutils)
+p Fv(',)f(lo)s(ok)i(for)g(a)150 489 y(detailed)f(log)i(in)e(`)p
+Fr(binutils.log)p Fv('.)37 b(Normally)-8 b(,)30 b Fr(runtest)f
+Fv(writes)g(this)g(\014le)g(in)g(y)m(our)i(curren)m(t)f(w)m(orking)150
+599 y(directory;)g(use)g(the)h(`)p Fr(--outdir)p Fv(')d(option)i(to)h
+(select)g(a)g(di\013eren)m(t)f(directory)-8 b(.)150 708
+y(Here)31 b(is)e(a)i(brief)e(example)h(sho)m(wing)f(a)i(detailed)f(log)
+g(for)g Fo(g)p Fr(++)g Fv(tests:)150 787 y Fm(\013)p
+200 787 3554 4 v 3553 w(\010)p 150 4306 4 3472 v 178
+940 a Fr(Test)47 b(Run)g(By)g(rob)g(on)g(Mon)g(May)g(25)g(21:40:43)f
+(PDT)g(1992)942 1148 y(===)h(g++)g(tests)f(===)178 1355
+y(---)h(Running)f(./g++.other/t01-1.exp)c(---)560 1459
+y(PASS:)142 b(operate)46 b(delete)178 1667 y(---)h(Running)f
+(./g++.other/t01-2.exp)c(---)560 1770 y(FAIL:)142 b(i960)46
+b(bug)h(EOF)178 1874 y(p0000646.C:)e(In)i(function)f(`int)94
+b(warn_return_1)44 b(\(\)':)178 1978 y(p0000646.C:109:)g(warning:)h
+(control)h(reaches)g(end)h(of)g(non-void)f(function)178
+2082 y(p0000646.C:)f(In)i(function)f(`int)94 b(warn_return_arg)44
+b(\(int\)':)178 2186 y(p0000646.C:117:)g(warning:)h(control)h(reaches)g
+(end)h(of)g(non-void)f(function)178 2289 y(p0000646.C:)f(In)i(function)
+f(`int)94 b(warn_return_sum)44 b(\(int,)i(int\)':)178
+2393 y(p0000646.C:125:)e(warning:)h(control)h(reaches)g(end)h(of)g
+(non-void)f(function)178 2497 y(p0000646.C:)f(In)i(function)f(`struct)f
+(foo)i(warn_return_foo)d(\(\)':)178 2601 y(p0000646.C:132:)g(warning:)h
+(control)h(reaches)g(end)h(of)g(non-void)f(function)178
+2808 y(---)h(Running)f(./g++.other/t01-4.exp)c(---)560
+2912 y(FAIL:)142 b(abort)178 3016 y(900403_04.C:8:)44
+b(zero)j(width)f(for)h(bit-field)e(`foo')178 3120 y(---)i(Running)f
+(./g++.other/t01-3.exp)c(---)560 3223 y(FAIL:)142 b(segment)46
+b(violation)178 3327 y(900519_12.C:9:)e(parse)i(error)h(before)f(`;')
+178 3431 y(900519_12.C:12:)e(Segmentation)g(violation)178
+3535 y(/usr/latest/bin/gcc:)e(Internal)k(compiler)g(error:)g(program)f
+(cc1plus)h(got)178 3638 y(fatal)h(signal)942 3846 y(===)g(g++)g
+(Summary)e(===)178 4054 y(#)j(of)f(expected)e(passes)h(1)178
+4157 y(#)i(of)f(expected)e(failures)h(3)178 4261 y(/usr/ps/bin/g++)e
+(version)i(cygnus-2.0.1)p 3803 4306 V 150 4358 a Fm(\012)p
+200 4358 3554 4 v 3553 w(\011)150 4566 y Fi(5.7.3)63
+b(Logging)42 b Fg(expect)g Fi(in)m(ternal)e(actions)275
+4753 y Fv(With)32 b(the)h(`)p Fr(--debug)p Fv(')e(option,)i(y)m(ou)h
+(can)f(request)g(a)g(log)g(\014le)f(sho)m(wing)g(the)h(output)f(from)h
+Fr(expect)150 4863 y Fv(itself,)k(running)d(in)h(debugging)g(mo)s(de.)
+59 b(This)34 b(\014le)i(\(`)p Fr(dbg.log)p Fv(',)h(in)e(the)i
+(directory)f(where)g(y)m(ou)g(start)150 4972 y Fr(runtest)p
+Fv(\))29 b(sho)m(ws)h(eac)m(h)h(pattern)g Fr(expect)e
+Fv(considers)g(in)g(analyzing)g(test)j(output.)275 5101
+y(This)26 b(\014le)h(re\015ects)h(eac)m(h)h Fr(send)e
+Fv(command,)h(sho)m(wing)f(the)h(string)f(sen)m(t)h(as)g(input)e(to)j
+(the)f(to)s(ol)f(under)150 5211 y(test;)32 b(and)d(eac)m(h)j
+Fr(expect)d Fv(command,)h(sho)m(wing)f(eac)m(h)j(pattern)e(it)g
+(compares)h(with)e(the)i(to)s(ol)f(output.)275 5340 y(The)f(log)i
+(messages)g(for)f Fr(expect)f Fv(b)s(egin)g(with)g(a)i(message)g(of)g
+(the)f(form)p eop
+%%Page: 37 39
+37 38 bop 150 -116 a Fv(Chapter)30 b(5:)41 b(The)30 b(DejaGn)m(u)h
+(Implemen)m(tation)1847 b(37)390 83 y Fr(expect:)46 b(does)g({)p
+Fq(to)s(ol)31 b(output)r Fr(})47 b(\(spawn_id)e Fq(n)p
+Fr(\))i(match)f(pattern)390 187 y({)p Fq(exp)s(ected)31
+b(pattern)p Fr(}?)150 321 y Fv(F)-8 b(or)30 b(ev)m(ery)h(unsuccessful)c
+(matc)m(h,)k Fr(expect)d Fv(issues)h(a)h(`)p Fr(no)p
+Fv(')f(after)h(this)f(message;)i(if)e(other)h(patterns)g(are)150
+431 y(sp)s(eci\014ed)f(for)i(the)g(same)h Fr(expect)d
+Fv(command,)i(they)h(are)f(re\015ected)h(also,)f(but)f(without)h(the)g
+(\014rst)f(part)150 540 y(of)h(the)f(message)i(\(`)p
+Fr(expect...)n(match)d(pattern)p Fv('\).)275 675 y(When)j
+Fr(expect)e Fv(\014nds)h(a)i(matc)m(h,)g(the)g(log)f(for)g(the)h
+(successful)e(matc)m(h)i(ends)f(with)f(`)p Fr(yes)p Fv(',)h(follo)m(w)m
+(ed)150 785 y(b)m(y)g(a)h(record)g(of)f(the)h Fr(expect)e
+Fv(v)-5 b(ariables)31 b(set)i(to)g(describ)s(e)e(a)i(successful)e(matc)
+m(h.)48 b(Here)33 b(is)f(an)g(excerpt)150 894 y(from)e(the)g(debugging)
+g(log)g(for)g(a)h Fo(gdb)f Fv(test:)150 973 y Fm(\013)p
+200 973 3554 4 v 3553 w(\010)p 150 3669 4 2649 v 178
+1134 a Fr(send:)47 b(sent)f({break)g(gdbme.c:34\\n})e(to)k(spawn)e(id)h
+(6)178 1237 y(expect:)f(does)h({})g(\(spawn_id)e(6\))i(match)g(pattern)
+e({Breakpoint.*at.*)f(file)226 1341 y(gdbme.c,)h(line)i
+(34.*\\\(gdb\\\))e($}?)i(no)178 1445 y({.*\\\(gdb\\\))e($}?)i(no)178
+1549 y(expect:)f(does)h({})g(\(spawn_id)e(0\))i(match)g(pattern)e
+({<return>}?)g(no)178 1652 y({\\\(y)i(or)g(n\\\))g(}?)g(no)178
+1756 y({buffer_full}?)d(no)178 1860 y({virtual}?)h(no)178
+1964 y({memory}?)g(no)178 2068 y({exhausted}?)g(no)178
+2171 y({Undefined}?)g(no)178 2275 y({command}?)g(no)178
+2379 y(break)i(gdbme.c:34)178 2483 y(Breakpoint)e(8)j(at)f(0x23d8:)f
+(file)g(gdbme.c,)g(line)g(34.)178 2586 y(\(gdb\))h(expect:)e(does)i
+({break)f(gdbme.c:34\\r\\nBreakpoint)41 b(8)48 b(at)f(0x23d8:)178
+2690 y(file)g(gdbme.c,)e(line)i(34.\\r\\n\(gdb\))d(})k(\(spawn_id)d
+(6\))i(match)g(pattern)178 2794 y({Breakpoint.*at.*)c(file)k(gdbme.c,)e
+(line)i(34.*\\\(gdb\\\))e($}?)i(yes)178 2898 y(expect:)f(set)h
+(expect_out\(0,start\))42 b({18})178 3002 y(expect:)k(set)h
+(expect_out\(0,end\))c({71})178 3105 y(expect:)j(set)h
+(expect_out\(0,string\))42 b({Breakpoint)j(8)i(at)h(0x23d8:)d(file)178
+3209 y(gdbme.c,)h(line)g(34.\\r\\n\(gdb\))f(})178 3313
+y(expect:)h(set)h(expect_out\(spawn_id\))42 b({6})178
+3417 y(expect:)k(set)h(expect_out\(buffer\))c({break)j
+(gdbme.c:34\\r\\nBreakpoint)41 b(8)178 3520 y(at)47 b(0x23d8:)f(file)h
+(gdbme.c,)e(line)i(34.\\r\\n\(gdb\))d(})560 3624 y(PASS:)142
+b(70)286 b(0)333 b(breakpoint)45 b(line)i(number)f(in)h(file)p
+3803 3669 V 150 3721 a Fm(\012)p 200 3721 3554 4 v 3553
+w(\011)150 3866 y Fv(This)26 b(example)i(exhibits)f(three)h(prop)s
+(erties)f(of)h Fr(expect)f Fv(and)g(DejaGn)m(u)i(that)g(migh)m(t)f(b)s
+(e)g(surprising)c(at)150 3976 y(\014rst)30 b(glance:)225
+4110 y Ft(\017)60 b Fv(Empt)m(y)25 b(output)f(for)h(the)g(\014rst)f
+(attempted)i(matc)m(h.)40 b(The)25 b(\014rst)f(set)h(of)g(attempted)h
+(matc)m(hes)h(sho)m(wn)330 4220 y(ran)34 b(against)g(the)h(output)f(`)p
+Fr({})p Fv('|that)h(is,)f(no)h(output.)52 b Fr(expect)33
+b Fv(b)s(egins)f(attempting)j(to)g(matc)m(h)330 4329
+y(the)i(patterns)f(supplied)e(immediately;)k(often,)g(the)f(\014rst)f
+(pass)g(is)g(against)h(incomplete)e(output)330 4439 y(\(or)c
+(completely)f(b)s(efore)g(all)f(output,)h(as)h(in)e(this)g(case\).)225
+4573 y Ft(\017)60 b Fv(In)m(tersp)s(ersed)39 b(to)s(ol)i(output.)71
+b(The)40 b(b)s(eginning)d(of)k(the)g(log)g(en)m(try)f(for)h(the)f
+(second)h(attempted)330 4683 y(matc)m(h)32 b(ma)m(y)g(b)s(e)e(hard)h
+(to)h(sp)s(ot:)42 b(this)30 b(is)g(b)s(ecause)h(the)h(prompt)e(`)p
+Fr(\(gdb\))f Fv(')j(app)s(ears)e(on)h(the)h(same)330
+4793 y(line,)d(just)h(b)s(efore)g(the)g(`)p Fr(expect:)p
+Fv(')f(that)i(marks)f(the)h(b)s(eginning)c(of)k(the)f(log)h(en)m(try)-8
+b(.)225 4927 y Ft(\017)60 b Fv(F)-8 b(ail-safe)32 b(patterns.)43
+b(Man)m(y)32 b(of)f(the)h(patterns)f(tested)h(are)f(fail-safe)g
+(patterns)g(pro)m(vided)f(b)m(y)h Fo(gdb)330 5037 y Fv(testing)43
+b(utilities,)h(to)f(reduce)g(p)s(ossible)e(indeterminacy)-8
+b(.)77 b(It)43 b(is)f(useful)f(to)j(an)m(ticipate)f(p)s(oten-)330
+5146 y(tial)g(v)-5 b(ariations)44 b(caused)g(b)m(y)g(extreme)h(system)f
+(conditions)f(\()p Fo(gdb)h Fv(migh)m(t)g(issue)e(the)j(message)p
+eop
+%%Page: 38 40
+38 39 bop 150 -116 a Fv(38)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)330 83 y(`)p Fr(virtual)29
+b(memory)f(exhausted)p Fv(')j(in)h(rare)g(circumstances\),)i(or)f(b)m
+(y)g(c)m(hanges)h(in)d(the)i(tested)h(pro-)330 193 y(gram)f(\(`)p
+Fr(Undefined)28 b(command)p Fv(')j(is)g(the)h(lik)m(eliest)f(outcome)j
+(if)d(the)h(name)h(of)f(a)h(tested)g(command)330 302
+y(c)m(hanges\).)330 437 y(The)f(pattern)g(`)p Fr({<return>})p
+Fv(')f(is)g(a)i(particularly)d(in)m(teresting)h(fail-safe)h(to)h
+(notice;)h(it)e(c)m(hec)m(ks)i(for)330 546 y(an)k(unexp)s(ected)952
+543 y Fk(h)p 976 490 151 4 v 976 546 a Fj(RET)p 976 562
+V 1123 543 a Fk(i)1191 546 y Fv(prompt.)64 b(This)37
+b(ma)m(y)i(happ)s(en,)g(for)f(example,)i(if)d(the)i(tested)g(to)s(ol)g
+(can)330 656 y(\014lter)29 b(output)h(through)g(a)h(pager.)330
+790 y(These)e(fail-safe)f(patterns)h(\(lik)m(e)g(the)g(debugging)f(log)
+h(itself)7 b(\))28 b(are)h(primarily)d(useful)h(while)g(dev)m(el-)330
+900 y(oping)32 b(test)h(scripts.)46 b(Use)33 b(the)g
+Fr(error)e Fv(pro)s(cedure)g(to)j(mak)m(e)f(the)g(actions)g(for)f
+(fail-safe)g(patterns)330 1010 y(pro)s(duce)i(messages)j(starting)e
+(with)g(`)p Fr(ERROR)p Fv(')f(on)i(the)f Fr(runtest)f
+Fv(standard)h(output,)i(and)d(in)h(the)330 1119 y(detailed)29
+b(log)i(\014le.)p eop
+%%Page: 39 41
+39 40 bop 150 -116 a Fv(Chapter)30 b(6:)41 b(Ho)m(w)31
+b(T)-8 b(o)31 b(W)-8 b(rite)31 b(a)f(T)-8 b(est)31 b(Case)1988
+b(39)150 100 y Fs(6)80 b(Ho)l(w)53 b(T)-13 b(o)53 b(W)-13
+b(rite)54 b(a)g(T)-13 b(est)53 b(Case)150 457 y Fu(6.1)68
+b(W)-11 b(riting)46 b(a)f(test)h(case)275 649 y Fv(The)30
+b(easiest)h(w)m(a)m(y)h(to)f(prepare)g(a)g(new)f(test)i(case)g(is)e(to)
+h(base)g(it)f(on)h(an)g(existing)f(one)h(for)f(a)i(similar)150
+759 y(situation.)63 b(There)38 b(are)g(t)m(w)m(o)i(ma)5
+b(jor)38 b(categories)i(of)e(tests:)57 b(batc)m(h)39
+b(or)f(in)m(teractiv)m(e.)65 b(Batc)m(h)40 b(orien)m(ted)150
+868 y(tests)31 b(are)g(usually)d(easier)i(to)h(write.)275
+1003 y(The)22 b Fo(gcc)h Fv(tests)h(are)f(a)h(go)s(o)s(d)f(example)g
+(of)g(batc)m(h)h(orien)m(ted)f(tests.)39 b(All)22 b Fo(gcc)h
+Fv(tests)h(consist)e(primarily)150 1112 y(of)35 b(a)h(call)f(to)h(a)g
+(single)e(common)h(pro)s(cedure,)h(since)f(all)f(the)h(tests)h(either)f
+(ha)m(v)m(e)i(no)e(output,)h(or)g(only)150 1222 y(ha)m(v)m(e)k(a)g(few)
+f(w)m(arning)f(messages)i(when)e(successfully)g(compiled.)65
+b(An)m(y)40 b(non-w)m(arning)d(output)i(is)g(a)150 1332
+y(test)31 b(failure.)39 b(All)29 b(the)h(C)g(co)s(de)h(needed)e(is)h(k)
+m(ept)h(in)e(the)h(test)h(directory)-8 b(.)41 b(The)30
+b(test)h(driv)m(er,)e(written)g(in)150 1441 y Fr(expect)p
+Fv(,)d(need)h(only)f(get)i(a)f(listing)e(of)i(all)e(the)i(C)g(\014les)f
+(in)f(the)i(directory)-8 b(,)28 b(and)e(compile)g(them)h(all)e(using)
+150 1551 y(a)j(generic)g(pro)s(cedure.)39 b(This)26 b(pro)s(cedure)h
+(and)h(a)g(few)g(others)g(supp)s(orting)d(for)j(these)g(tests)h(are)g
+(k)m(ept)f(in)150 1660 y(the)i(library)d(mo)s(dule)h(`)p
+Fr(lib/c-torture.exp)p Fv(')d(in)k(the)h Fo(gcc)f Fv(test)h(suite.)40
+b(Most)31 b(tests)f(of)g(this)e(kind)g(use)150 1770 y(v)m(ery)j(few)f
+Fr(expect)f Fv(features,)h(and)g(are)h(co)s(ded)f(almost)h(purely)d(in)
+h(Tcl.)150 1905 y(W)-8 b(riting)30 b(the)g(complete)h(suite)f(of)g(C)g
+(tests,)i(then,)e(consisted)g(of)g(these)h(steps:)199
+2039 y(1.)61 b(Cop)m(ying)26 b(all)f(the)i(C)f(co)s(de)g(in)m(to)h(the)
+g(test)g(directory)-8 b(.)39 b(These)26 b(tests)i(w)m(ere)f(based)f(on)
+g(the)h(C-torture)330 2149 y(test)e(created)g(b)m(y)f(T)-8
+b(orb)5 b(jorn)23 b(Granlund)f(\(on)i(b)s(ehalf)e(of)j(the)f(F)-8
+b(ree)25 b(Soft)m(w)m(are)g(F)-8 b(oundation\))24 b(for)g
+Fo(gcc)330 2258 y Fv(dev)m(elopmen)m(t.)199 2393 y(2.)61
+b(W)-8 b(riting)30 b(\(and)g(debugging\))f(the)i(generic)f
+Fr(expect)f Fv(pro)s(cedures)g(for)h(compilation.)199
+2527 y(3.)61 b(W)-8 b(riting)32 b(the)h(simple)e(test)i(driv)m(er:)45
+b(its)32 b(main)g(task)h(is)f(to)h(searc)m(h)h(the)f(directory)f
+(\(using)g(the)h(Tcl)330 2637 y(pro)s(cedure)f Fr(glob)f
+Fv(for)i(\014lename)f(expansion)g(with)f(wildcards\))g(and)h(call)g(a)h
+(Tcl)g(pro)s(cedure)e(with)330 2746 y(eac)m(h)h(\014lename.)39
+b(It)31 b(also)f(c)m(hec)m(ks)i(for)e(a)h(few)f(errors)g(from)g(the)g
+(testing)h(pro)s(cedure.)275 2906 y(T)-8 b(esting)37
+b(in)m(teractiv)m(e)h(programs)g(is)e(in)m(trinsically)e(more)k
+(complex.)62 b(T)-8 b(ests)38 b(for)f(most)h(in)m(teractiv)m(e)150
+3015 y(programs)30 b(require)f(some)i(trial)e(and)h(error)g(b)s(efore)g
+(they)g(are)h(complete.)275 3150 y(Ho)m(w)m(ev)m(er,)44
+b(some)d(in)m(teractiv)m(e)f(programs)g(can)g(b)s(e)g(tested)g(in)f(a)h
+(simple)e(fashion)h(reminiscen)m(t)g(of)150 3259 y(batc)m(h)c(tests.)54
+b(F)-8 b(or)36 b(example,)f(prior)e(to)i(the)g(creation)g(of)g(DejaGn)m
+(u,)h(the)f Fo(gdb)f Fv(distribution)d(already)150 3369
+y(included)j(a)k(wide-ranging)d(testing)j(pro)s(cedure.)59
+b(This)36 b(pro)s(cedure)g(w)m(as)h(v)m(ery)h(robust,)g(and)e(had)h
+(al-)150 3479 y(ready)29 b(undergone)f(m)m(uc)m(h)g(more)h(debugging)f
+(and)g(error)g(c)m(hec)m(king)i(than)e(man)m(y)h(recen)m(t)h(DejaGn)m
+(u)f(test)150 3588 y(cases.)64 b(Accordingly)-8 b(,)39
+b(the)e(b)s(est)h(approac)m(h)g(w)m(as)g(simply)d(to)j(encapsulate)g
+(the)g(existing)f Fo(gdb)g Fv(tests,)150 3698 y(for)32
+b(rep)s(orting)f(purp)s(oses.)45 b(Thereafter,)33 b(new)f
+Fo(gdb)g Fv(tests)h(built)d(up)i(a)g(family)f(of)i Fr(expect)d
+Fv(pro)s(cedures)150 3807 y(sp)s(ecialized)f(for)h Fo(gdb)g
+Fv(testing.)275 3942 y(`)p Fr(gdb.t10/crossload.exp)p
+Fv(')25 b(is)k(a)i(go)s(o)s(d)f(example)g(of)h(an)f(in)m(teractiv)m(e)h
+(test.)p eop
+%%Page: 40 42
+40 41 bop 150 -116 a Fv(40)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fu(6.2)68 b(Debugging)46
+b(a)f(test)h(case)150 276 y Fv(These)30 b(are)h(the)f(kinds)f(of)h
+(debugging)g(information)e(a)m(v)-5 b(ailable)30 b(from)g(DejaGn)m(u:)
+199 410 y(1.)61 b(Output)29 b(con)m(trolled)h(b)m(y)g(test)h(scripts)e
+(themselv)m(es,)h(explicitly)e(allo)m(w)m(ed)i(for)g(b)m(y)g(the)g
+(test)h(author.)330 520 y(This)21 b(kind)g(of)j(debugging)d(output)i
+(app)s(ears)f(in)g(the)h(detailed)f(output)h(recorded)g(in)e(the)j(`)p
+Fq(to)s(ol)p Fr(.log)p Fv(')330 629 y(\014le.)41 b(T)-8
+b(o)31 b(do)g(the)f(same)i(for)e(new)g(tests,)i(use)e(the)h
+Fr(verbose)e Fv(pro)s(cedure)h(\(whic)m(h)f(in)h(turn)f(uses)i(the)330
+739 y(v)-5 b(ariable)29 b(also)h(called)f Fr(verbose)p
+Fv(\))f(to)j(con)m(trol)g(ho)m(w)f(m)m(uc)m(h)g(output)f(to)i
+(generate.)42 b(This)29 b(will)e(mak)m(e)330 848 y(it)i(easier)h(for)g
+(other)g(p)s(eople)f(running)e(the)j(test)h(to)g(debug)e(it)g(if)g
+(necessary)-8 b(.)42 b(Whenev)m(er)30 b(p)s(ossible,)330
+958 y(if)h(`)p Fr($verbose)p Fv(')g(is)g Fr(0)p Fv(,)h(there)h(should)d
+(b)s(e)i(no)g(output)g(other)g(than)g(the)h(output)e(from)h
+Fr(pass)p Fv(,)g Fr(fail)p Fv(,)330 1068 y Fr(error)p
+Fv(,)h(and)f Fr(warning)p Fv(.)47 b(Then,)33 b(to)h(whatev)m(er)g
+(exten)m(t)g(is)e(appropriate)g(for)h(the)g(particular)f(test,)330
+1177 y(allo)m(w)h(successiv)m(ely)f(higher)g(v)-5 b(alues)33
+b(of)g(`)p Fr($verbose)p Fv(')e(to)j(generate)h(more)e(information.)48
+b(Be)34 b(kind)330 1287 y(to)d(other)g(programmers)f(who)f(use)h(y)m
+(our)h(tests:)41 b(pro)m(vide)30 b(for)g(a)h(lot)f(of)h(debugging)e
+(information.)199 1421 y(2.)61 b(Output)26 b(from)g(the)h(in)m(ternal)e
+(debugging)h(functions)f(of)i(Tcl)f(and)g Fr(expect)p
+Fv(.)38 b(There)26 b(is)g(a)h(command)330 1531 y(line)h(options)i(for)g
+(eac)m(h;)h(b)s(oth)e(forms)h(of)g(debugging)f(output)h(are)g(recorded)
+g(in)f(the)h(\014le)f Fr(dbg.log)330 1641 y Fv(in)g(the)i(curren)m(t)f
+(directory)-8 b(.)330 1775 y(Use)23 b(`)p Fr(--debug)p
+Fv(')d(for)i(information)f(from)h(the)g Fr(expect)e Fv(lev)m(el;)25
+b(it)d(generates)i(displa)m(ys)c(of)i(the)h Fr(expect)330
+1885 y Fv(attempts)i(to)g(matc)m(h)h(the)e(to)s(ol)g(output)g(with)f
+(the)i(patterns)f(sp)s(eci\014ed)f(\(see)i(Section)f(5.7.3)i([Debug)330
+1994 y(Log],)34 b(page)f(36\).)47 b(This)30 b(output)i(can)g(b)s(e)g(v)
+m(ery)h(helpful)c(while)h(dev)m(eloping)h(test)i(scripts,)f(since)f(it)
+330 2104 y(sho)m(ws)e(precisely)f(the)i(c)m(haracters)h(receiv)m(ed.)41
+b(Iterating)29 b(b)s(et)m(w)m(een)h(the)g(latest)g(attempt)g(at)h(a)e
+(new)330 2213 y(test)k(script)d(and)h(the)h(corresp)s(onding)e(`)p
+Fr(dbg.log)p Fv(')g(can)i(allo)m(w)f(y)m(ou)h(to)h(create)g(the)f
+(\014nal)e(patterns)330 2323 y(b)m(y)g(\\cut)h(and)f(paste".)42
+b(This)28 b(is)i(sometimes)g(the)h(b)s(est)f(w)m(a)m(y)h(to)g(write)f
+(a)g(test)i(case.)330 2457 y(Use)45 b(`)p Fr(--strace)p
+Fv(')d(to)j(see)g(more)f(detail)g(at)h(the)f(Tcl)g(lev)m(el;)51
+b(this)43 b(sho)m(ws)h(ho)m(w)h(Tcl)e(pro)s(cedure)330
+2567 y(de\014nitions)f(expand,)47 b(as)d(they)g(execute.)84
+b(The)43 b(asso)s(ciated)i(n)m(um)m(b)s(er)e(con)m(trols)h(the)g(depth)
+g(of)330 2677 y(de\014nitions)20 b(expanded;)25 b(see)e(the)g
+(discussion)d(of)j(`)p Fr(--strace)p Fv(')d(in)i(Chapter)g(3)h
+([Running)d(the)j(T)-8 b(ests],)330 2786 y(page)31 b(9.)199
+2921 y(3.)61 b(Finally)-8 b(,)24 b(if)e(the)i(v)-5 b(alue)23
+b(of)h(`)p Fr(verbose)p Fv(')e(is)h(3)h(or)f(greater,)k
+Fr(runtest)22 b Fv(turns)g(on)h(the)h Fr(expect)e Fv(command)330
+3030 y Fr(log_user)p Fv(.)38 b(This)26 b(command)h(prin)m(ts)f(all)h
+Fr(expect)f Fv(actions)i(to)g(the)g Fr(expect)e Fv(standard)h(output,)h
+(to)330 3140 y(the)j(detailed)e(log)h(\014le,)g(and)g(\(if)g(`)p
+Fr(--debug)p Fv(')f(is)g(on\))i(to)g(`)p Fr(dbg.log)p
+Fv('.)150 3397 y Fu(6.3)68 b(Adding)44 b(a)h(test)h(case)g(to)f(a)g
+(test)h(suite)275 3590 y Fv(There)32 b(are)h(t)m(w)m(o)h(sligh)m(tly)c
+(di\013eren)m(t)j(w)m(a)m(ys)g(to)g(add)f(a)h(test)h(case.)48
+b(One)32 b(is)g(to)h(add)f(the)h(test)h(case)f(to)150
+3699 y(an)27 b(existing)f(directory)-8 b(.)40 b(The)26
+b(other)i(is)e(to)i(create)g(a)g(new)e(directory)h(to)h(hold)e(y)m(our)
+h(test.)40 b(The)27 b(existing)150 3809 y(test)g(directories)e
+(represen)m(t)h(sev)m(eral)g(st)m(yles)g(of)g(testing,)i(all)d(of)h
+(whic)m(h)e(are)j(sligh)m(tly)d(di\013eren)m(t;)j(examine)150
+3919 y(the)k(directories)e(for)h(the)h(to)s(ol)f(of)h(in)m(terest)f(to)
+h(see)g(whic)m(h)e(\(if)h(an)m(y\))h(is)e(most)i(suitable.)275
+4053 y(Adding)f(a)i Fo(gcc)f Fv(test)i(can)e(b)s(e)h(v)m(ery)g(simple:)
+41 b(just)31 b(add)g(the)h(C)f(co)s(de)h(to)g(an)m(y)g(directory)g(b)s
+(eginning)150 4163 y(with)d(`)p Fr(gcc.)p Fv(')h(and)g(it)f(runs)g(on)i
+(the)f(next)h(`)p Fr(runtest)d(--tool)h(gcc)p Fv('.)275
+4297 y(T)-8 b(o)26 b(add)g(a)h(test)g(to)g Fo(gdb)p Fv(,)g(\014rst)f
+(add)g(an)m(y)g(source)h(co)s(de)f(y)m(ou)h(will)d(need)i(to)h(the)f
+(test)i(directory)-8 b(.)39 b(Then)150 4407 y(y)m(ou)29
+b(can)g(either)f(create)i(a)f(new)f Fr(expect)f Fv(\014le,)h(or)g(add)g
+(y)m(our)h(test)g(to)h(an)e(existing)g(one)g(\(an)m(y)i(\014le)d(with)h
+(a)150 4516 y(`)p Fr(.exp)p Fv(')g(su\016x\).)39 b(Creating)28
+b(a)g(new)g(`)p Fr(.exp)p Fv(')g(\014le)f(is)g(probably)g(a)i(b)s
+(etter)f(idea)g(if)f(the)h(test)h(is)f(signi\014can)m(tly)150
+4626 y(di\013eren)m(t)36 b(from)f(existing)g(tests.)59
+b(Adding)34 b(it)i(as)g(a)g(separate)h(\014le)f(also)g(mak)m(es)g
+(upgrading)f(easier.)57 b(If)150 4736 y(the)33 b(C)g(co)s(de)h(has)f
+(to)h(b)s(e)e(already)h(compiled)f(b)s(efore)h(the)g(test)i(will)30
+b(run,)j(then)g(y)m(ou'll)f(ha)m(v)m(e)j(to)f(add)e(it)150
+4845 y(to)f(the)g(`)p Fr(Makefile.in)p Fv(')c(\014le)j(for)g(that)h
+(test)g(directory)-8 b(,)31 b(then)f(run)f Fr(configure)f
+Fv(and)h Fr(make)p Fv(.)275 4980 y(Adding)f(a)j(test)g(b)m(y)g
+(creating)f(a)h(new)f(directory)g(is)f(v)m(ery)i(similar:)199
+5114 y(1.)61 b(Create)34 b(the)f(new)f(directory)-8 b(.)48
+b(All)31 b(sub)s(directory)g(names)i(b)s(egin)e(with)h(the)h(name)f(of)
+h(the)g(to)s(ol)g(to)330 5224 y(test;)f(e.g.)43 b Fo(g)p
+Fr(++)31 b Fv(tests)h(migh)m(t)e(b)s(e)g(in)g(a)h(directory)f(called)g
+(`)p Fr(g++.other)p Fv('.)41 b(There)30 b(can)h(b)s(e)f(m)m(ultiple)330
+5333 y(test)h(directories)f(that)h(start)g(with)e(the)h(same)h(to)s(ol)
+f(name)h(\(suc)m(h)f(as)h(`)p Fr(g++)p Fv('\).)p eop
+%%Page: 41 43
+41 42 bop 150 -116 a Fv(Chapter)30 b(6:)41 b(Ho)m(w)31
+b(T)-8 b(o)31 b(W)-8 b(rite)31 b(a)f(T)-8 b(est)31 b(Case)1988
+b(41)199 83 y(2.)61 b(Add)28 b(the)i(new)e(directory)h(name)g(to)h(the)
+g(`)p Fr(configdirs)p Fv(')c(de\014nition)h(in)h(the)i(`)p
+Fr(configure.in)p Fv(')c(\014le)330 193 y(for)g(the)g(test)h(suite)e
+(directory)-8 b(.)40 b(This)24 b(w)m(a)m(y)j(when)e Fr(make)g
+Fv(and)g Fr(configure)f Fv(next)i(run,)g(they)g(include)330
+302 y(the)31 b(new)e(directory)-8 b(.)199 437 y(3.)61
+b(Add)29 b(the)i(new)f(test)h(case)h(to)f(the)f(directory)-8
+b(,)31 b(as)f(ab)s(o)m(v)m(e.)199 571 y(4.)61 b(T)-8
+b(o)36 b(add)f(supp)s(ort)e(in)h(the)i(new)f(directory)g(for)g
+(con\014gure)g(and)g(mak)m(e,)i(y)m(ou)f(m)m(ust)f(also)h(create)h(a)
+330 681 y Fr(Makefile.in)h Fv(and)i(a)h Fr(configure.in)p
+Fv(.)69 b(See)41 b(section)g(\\What)g(Con\014gure)f(Do)s(es")i(in)e
+Fq(Cygn)m(us)330 790 y(Con\014gure)5 b Fv(.)150 1048
+y Fu(6.4)68 b(Hin)l(ts)46 b(on)f(writing)g(a)h(test)g(case)275
+1240 y Fv(There)27 b(ma)m(y)h(b)s(e)g(useful)e(existing)g(pro)s
+(cedures)h(already)g(written)g(for)h(y)m(our)g(test)g(in)f(the)h(`)p
+Fr(lib)p Fv(')g(direc-)150 1350 y(tory)j(of)f(the)h(DejaGn)m(u)g
+(distribution.)37 b(See)31 b(Section)f(5.3)h([DejaGn)m(u)h(Builtins],)c
+(page)j(23.)275 1484 y(It)26 b(is)g(safest)h(to)g(write)f(patterns)h
+(that)g(matc)m(h)g Fn(al)5 b(l)37 b Fv(the)27 b(output)f(generated)h(b)
+m(y)g(the)g(tested)g(program;)150 1594 y(this)22 b(is)g(called)h
+Fq(closure)p Fv(.)38 b(If)22 b(a)i(pattern)f(do)s(es)g(not)h(matc)m(h)g
+(the)f(en)m(tire)g(output,)i(an)m(y)e(output)g(that)h(remains)150
+1704 y(will)35 b(b)s(e)j(examined)f(b)m(y)g(the)i Fn(next)46
+b Fr(expect)37 b Fv(command.)63 b(In)37 b(this)g(situation,)i(the)f
+(precise)f(b)s(oundary)150 1813 y(that)32 b(determines)e(whic)m(h)g
+Fr(expect)f Fv(command)i(sees)g(what)g(is)g(v)m(ery)g(sensitiv)m(e)g
+(to)g(timing)f(b)s(et)m(w)m(een)i(the)150 1923 y Fr(expect)37
+b Fv(task)j(and)e(the)h(task)h(running)c(the)j(tested)h(to)s(ol.)66
+b(As)39 b(a)g(result,)h(the)g(test)f(ma)m(y)h(sometimes)150
+2032 y(app)s(ear)35 b(to)h(w)m(ork,)h(but)d(is)h(lik)m(ely)f(to)i(ha)m
+(v)m(e)g(unpredictable)d(results.)54 b(\(This)34 b(problem)g(is)g
+(particularly)150 2142 y(lik)m(ely)d(for)i(in)m(teractiv)m(e)h(to)s
+(ols,)f(but)g(can)g(also)f(a\013ect)j(batc)m(h)e(to)s(ols|esp)s
+(ecially)e(for)i(tests)h(that)f(tak)m(e)i(a)150 2252
+y(long)24 b(time)h(to)g(\014nish.\))37 b(The)24 b(b)s(est)g(w)m(a)m(y)i
+(to)f(ensure)f(closure)g(is)g(to)i(use)e(the)h(`)p Fr(-re)p
+Fv(')f(option)g(for)h(the)g Fr(expect)150 2361 y Fv(command)k(to)h
+(write)f(the)h(pattern)f(as)h(a)g(full)d(regular)i(expressions;)f(then)
+h(y)m(ou)h(can)g(matc)m(h)g(the)g(end)f(of)150 2471 y(output)i(using)f
+(a)i(`)p Fr($)p Fv('.)44 b(It)31 b(is)g(also)g(a)h(go)s(o)s(d)f(idea)g
+(to)h(write)f(patterns)g(that)h(matc)m(h)g(all)f(a)m(v)-5
+b(ailable)30 b(output)150 2580 y(b)m(y)36 b(using)f(`)p
+Fr(.*\\)p Fv(')h(after)h(the)f(text)i(of)e(in)m(terest;)k(this)35
+b(will)f(also)i(matc)m(h)h(an)m(y)g(in)m(terv)m(ening)f(blank)e(lines.)
+150 2690 y(Sometimes)e(an)h(alternativ)m(e)g(is)e(to)i(matc)m(h)h(end)e
+(of)g(line)f(using)g(`)p Fr(\\r)p Fv(')i(or)f(`)p Fr(\\n)p
+Fv(',)h(but)f(this)f(is)h(usually)e(to)s(o)150 2800 y(dep)s(enden)m(t)f
+(on)i(terminal)e(settings.)275 2934 y(Alw)m(a)m(ys)45
+b(escap)s(e)g(punctuation,)j(suc)m(h)d(as)g(`)p Fr(\()p
+Fv(')g(or)h(`)p Fr(")p Fv(',)j(in)43 b(y)m(our)j(patterns;)52
+b(for)45 b(example,)k(write)150 3044 y(`)p Fr(\\\()p
+Fv('.)41 b(If)30 b(y)m(ou)h(forget)g(to)h(escap)s(e)f(punctuation,)e(y)
+m(ou)i(will)d(usually)g(see)j(an)g(error)f(message)h(lik)m(e)f(`)p
+Fr(extra)150 3153 y(characters)e(after)h(close-quote)p
+Fv('.)275 3288 y(If)k(y)m(ou)h(ha)m(v)m(e)h(trouble)e(understanding)f
+(wh)m(y)h(a)i(pattern)f(do)s(es)f(not)h(matc)m(h)h(the)f(program)g
+(output,)150 3397 y(try)45 b(using)f(the)h(`)p Fr(--debug)p
+Fv(')f(option)h(to)h Fr(runtest)p Fv(,)h(and)d(examine)h(the)h(debug)e
+(log)h(carefully)-8 b(.)85 b(See)150 3507 y(Section)30
+b(5.7.3)i([Debug)f(Log],)h(page)f(36.)275 3641 y(Be)d(careful)f(not)h
+(to)h(neglect)f(output)g(generated)g(b)m(y)g(setup)f(rather)h(than)f(b)
+m(y)h(the)g(in)m(teresting)f(parts)150 3751 y(of)32 b(a)g(test)h(case.)
+46 b(F)-8 b(or)33 b(example,)f(while)e(testing)i Fo(gdb)p
+Fv(,)g(I)f(issue)g(a)h(send)f(`)p Fr(set)f(height)f(0\\n)p
+Fv(')i(command.)150 3861 y(The)h(purp)s(ose)f(is)h(simply)f(to)i(mak)m
+(e)h(sure)e Fo(gdb)h Fv(nev)m(er)g(calls)f(a)h(paging)f(program.)48
+b(The)33 b(`)p Fr(set)c(height)p Fv(')150 3970 y(command)39
+b(in)e Fo(gdb)i Fv(do)s(es)g(not)g(generate)h(an)m(y)g(output;)j(but)38
+b(running)e Fn(any)48 b Fv(command)38 b(mak)m(es)i Fo(gdb)150
+4080 y Fv(issue)28 b(a)h(new)g(`)p Fr(\(gdb\))g Fv(')g(prompt.)40
+b(If)28 b(there)i(w)m(ere)f(no)g Fr(expect)e Fv(command)i(to)h(matc)m
+(h)g(this)e(prompt,)h(the)150 4189 y(output)c(`)p Fr(\(gdb\))k
+Fv(')d(b)s(egins)e(the)i(text)h(seen)f(b)m(y)f(the)h(next)g
+Fr(expect)e Fv(command|whic)m(h)g(migh)m(t)h(mak)m(e)i
+Fn(that)150 4299 y Fv(pattern)j(fail)g(to)h(matc)m(h.)275
+4433 y(T)-8 b(o)39 b(preserv)m(e)g(basic)f(sanit)m(y)-8
+b(,)42 b(I)c(also)h(recommended)f(that)i(no)f(test)g(ev)m(er)h(pass)f
+(if)e(there)i(w)m(as)h(an)m(y)150 4543 y(kind)32 b(of)i(problem)f(in)g
+(the)h(test)h(case.)53 b(T)-8 b(o)34 b(tak)m(e)i(an)e(extreme)h(case,)h
+(tests)f(that)f(pass)g(ev)m(en)h(when)e(the)150 4653
+y(to)s(ol)i(will)d(not)j(spa)m(wn)f(are)h(misleading.)51
+b(Ideally)-8 b(,)35 b(a)g(test)g(in)f(this)f(sort)i(of)g(situation)f
+(should)e(not)j(fail)150 4762 y(either.)41 b(Instead,)31
+b(prin)m(t)e(an)i(error)f(message)i(b)m(y)e(calling)f(one)i(of)g(the)g
+(DejaGn)m(u)g(pro)s(cedures)f Fr(error)f Fv(or)150 4872
+y Fr(warning)p Fv(.)p eop
+%%Page: 42 44
+42 43 bop 150 -116 a Fv(42)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fu(6.5)68 b(Sp)t(ecial)45
+b(v)-7 b(ariables)46 b(used)f(b)l(y)g(test)h(cases)275
+276 y Fv(Y)-8 b(our)44 b(test)i(cases)f(can)g(use)f(these)h(v)-5
+b(ariables,)47 b(with)c(con)m(v)m(en)m(tional)j(meanings)d(\(as)i(w)m
+(ell)f(as)h(the)150 385 y(v)-5 b(ariables)29 b(sa)m(v)m(ed)i(in)f(`)p
+Fr(site.exp)p Fv(')e(see)j(Chapter)f(4)h([Setting)f Fr(runtest)e
+Fv(defaults],)i(page)h(15\):)390 514 y Fn(These)i(variables)g(ar)-5
+b(e)34 b(available)g(to)f(al)5 b(l)33 b(test)g(c)-5 b(ases.)150
+698 y Fr(prms_id)144 b Fv(The)34 b(trac)m(king)h(system)f(\(e.g.)55
+b Fo(gna)-6 b(ts)p Fv(\))34 b(n)m(um)m(b)s(er)f(iden)m(tifying)f(a)j
+(corresp)s(onding)d(bugre-)630 808 y(p)s(ort.)40 b(\(`)p
+Fr(0)p Fv(')31 b(if)e(y)m(ou)i(do)f(not)h(sp)s(ecify)e(it)h(in)f(the)h
+(test)i(script.\))150 992 y Fr(bug_id)192 b Fv(An)28
+b(optional)f(bug)g(id;)h(ma)m(y)h(re\015ect)f(a)h(bug)e(iden)m
+(ti\014cation)g(from)g(another)i(organization.)630 1102
+y(\(`)p Fr(0)p Fv(')i(if)e(y)m(ou)i(do)f(not)h(sp)s(ecify)e(it.\))150
+1286 y Fr(subdir)192 b Fv(The)30 b(sub)s(directory)e(for)i(the)h
+(curren)m(t)f(test)h(case.)390 1440 y Fn(These)i(variables)g(should)h
+(never)f(b)-5 b(e)32 b(change)-5 b(d.)43 b(They)33 b(app)-5
+b(e)g(ar)36 b(in)c(most)i(tests.)150 1624 y Fr(expect_out\(buffer\))630
+1733 y Fv(The)27 b(output)f(from)h(the)g(last)g(command.)40
+b(This)25 b(is)h(an)h(in)m(ternal)f(v)-5 b(ariable)26
+b(set)h(b)m(y)g Fr(expect)p Fv(.)150 1918 y Fr(exec_output)630
+2027 y Fv(This)j(is)h(the)h(output)f(from)h(a)g Fq(to)s(ol)t
+Fr(_load)e Fv(command.)45 b(This)30 b(only)g(applies)g(to)j(to)s(ols)f
+(lik)m(e)630 2137 y Fo(gcc)37 b Fv(and)f Fo(gas)h Fv(whic)m(h)f(pro)s
+(duce)g(an)h(ob)5 b(ject)38 b(\014le)f(that)g(m)m(ust)h(in)d(turn)i(b)s
+(e)f(executed)i(to)630 2247 y(complete)31 b(a)g(test.)150
+2431 y Fr(comp_output)630 2540 y Fv(This)k(is)g(the)h(output)g(from)g
+(a)h Fq(to)s(ol)t Fr(_start)d Fv(command.)58 b(This)35
+b(is)g(con)m(v)m(en)m(tionally)i(used)630 2650 y(for)d(batc)m(h)h
+(orien)m(ted)f(programs,)i(lik)m(e)d Fo(gcc)h Fv(and)g
+Fo(gas)p Fv(,)h(that)g(ma)m(y)g(pro)s(duce)f(in)m(teresting)630
+2760 y(output)c(\(w)m(arnings,)g(errors\))g(without)f(further)g(in)m
+(teraction.)p eop
+%%Page: 43 45
+43 44 bop 150 -116 a Fv(Chapter)30 b(7:)41 b(New)30 b(T)-8
+b(o)s(ols,)31 b(T)-8 b(argets,)31 b(or)g(Hosts)1888 b(43)150
+100 y Fs(7)80 b(New)54 b(T)-13 b(o)t(ols,)53 b(T)-13
+b(argets,)53 b(or)g(Hosts)275 334 y Fv(The)31 b(most)h(common)g(w)m(a)m
+(ys)h(to)g(extend)f(the)g(DejaGn)m(u)h(framew)m(ork)f(are:)44
+b(adding)31 b(a)h(suite)f(of)h(tests)150 443 y(for)24
+b(a)h(new)e(to)s(ol)h(to)h(b)s(e)f(tested;)j(adding)c(supp)s(ort)g(for)
+h(testing)g(on)g(a)h(new)e(target;)28 b(and)c(p)s(orting)f
+Fr(runtest)150 553 y Fv(to)31 b(a)g(new)f(host.)150 810
+y Fu(7.1)68 b(W)-11 b(riting)46 b(tests)f(for)h(a)f(new)g(to)t(ol)275
+1003 y Fv(In)38 b(general,)j(the)e(b)s(est)f(w)m(a)m(y)i(to)g(learn)e
+(ho)m(w)h(to)g(write)f(\(co)s(de)i(or)e(ev)m(en)i(prose\))f(is)f(to)h
+(read)g(some-)150 1112 y(thing)34 b(similar.)52 b(This)34
+b(principle)e(applies)h(to)j(test)g(cases)g(and)e(to)i(test)g(suites.)
+54 b(Unfortunately)-8 b(,)37 b(w)m(ell-)150 1222 y(established)42
+b(test)i(suites)f(ha)m(v)m(e)i(a)f(w)m(a)m(y)h(of)e(dev)m(eloping)g
+(their)g(o)m(wn)h(con)m(v)m(en)m(tions:)68 b(as)44 b(test)g(writers)150
+1332 y(b)s(ecome)29 b(more)g(exp)s(erienced)e(with)h(DejaGn)m(u)h(and)g
+(with)e(Tcl,)h(they)h(accum)m(ulate)h(more)f(utilities,)e(and)150
+1441 y(tak)m(e)32 b(adv)-5 b(an)m(tage)32 b(of)f(more)f(and)g(more)h
+(features)f(of)h Fr(expect)d Fv(and)i(Tcl)g(in)f(general.)275
+1576 y(Insp)s(ecting)37 b(suc)m(h)h(established)f(test)j(suites)d(ma)m
+(y)j(mak)m(e)f(the)g(prosp)s(ect)f(of)h(creating)g(an)g(en)m(tirely)150
+1685 y(new)31 b(test)h(suite)e(app)s(ear)h(o)m(v)m(erwhelming.)42
+b(Nev)m(ertheless,)32 b(it)f(is)f(quite)h(straigh)m(tforw)m(ard)g(to)h
+(get)g(a)f(new)150 1795 y(test)g(suite)f(going.)275 1929
+y(There)e(is)g(one)h(test)g(suite)f(that)i(is)d(guaran)m(teed)j(not)f
+(to)g(gro)m(w)h(more)f(elab)s(orate)g(o)m(v)m(er)h(time:)39
+b(b)s(oth)28 b(it)150 2039 y(and)34 b(the)g(to)s(ol)h(it)f(tests)h(w)m
+(ere)g(created)g(expressly)f(to)h(illustrate)d(what)j(it)f(tak)m(es)i
+(to)f(get)g(started)g(with)150 2149 y(DejaGn)m(u.)63
+b(The)37 b(`)p Fr(example/)p Fv(')f(directory)h(of)h(the)g(DejaGn)m(u)g
+(distribution)c(con)m(tains)k(b)s(oth)f(an)g(in)m(ter-)150
+2258 y(activ)m(e)d(to)s(ol)f(called)f Fr(calc)p Fv(,)h(and)f(a)h(test)h
+(suite)e(for)h(it.)47 b(Reading)33 b(this)f(test)h(suite,)g(and)g(exp)s
+(erimen)m(ting)150 2368 y(with)h(it,)j(is)d(a)i(go)s(o)s(d)f(w)m(a)m(y)
+i(to)f(supplemen)m(t)e(the)i(information)e(in)g(this)g(section.)56
+b(\(Thanks)35 b(to)h(Rob)s(ert)150 2477 y(Lupton)29 b(for)g(creating)h
+Fr(calc)e Fv(and)h(its)g(test)h(suite|and)e(also)i(the)g(\014rst)e(v)m
+(ersion)h(of)h(this)e(section)i(of)g(the)150 2587 y(man)m(ual!\))275
+2721 y(T)-8 b(o)31 b(help)f(orien)m(t)i(y)m(ou)f(further)g(in)f(this)g
+(task,)i(here)g(is)e(an)h(outline)f(of)i(the)f(steps)h(to)g(b)s(egin)e
+(building)150 2831 y(a)h(test)g(suite)f(for)g(a)h(program)f
+Fq(example)p Fv(.)199 2966 y(1.)61 b(Create)38 b(or)g(select)g(a)g
+(directory)g(to)g(con)m(tain)g(y)m(our)g(new)f(collection)g(of)h
+(tests.)63 b(Change)38 b(to)g(that)330 3075 y(directory)30
+b(\(sho)m(wn)g(here)g(as)h Fr(testsuite)p Fv(\):)570
+3204 y Fr(eg$)47 b(cd)g(testsuite/)199 3338 y Fv(2.)61
+b(Create)51 b(a)g(`)p Fr(configure.in)p Fv(')d(\014le)i(in)f(this)g
+(directory)-8 b(,)56 b(to)51 b(con)m(trol)g(con\014guration-dep)s
+(enden)m(t)330 3448 y(c)m(hoices)36 b(for)e(y)m(our)h(tests.)56
+b(So)35 b(far)g(as)g(DejaGn)m(u)h(is)e(concerned,)i(the)f(imp)s(ortan)m
+(t)g(thing)f(is)g(to)h(set)330 3557 y(a)g(v)-5 b(alue)33
+b(for)h(the)h(v)-5 b(ariable)33 b Fr(target_abbrev)p
+Fv(;)f(this)h(v)-5 b(alue)34 b(is)f(the)i(link)d(to)j(the)f(init)f
+(\014le)g(y)m(ou)i(will)330 3667 y(write)30 b(so)s(on.)40
+b(\(F)-8 b(or)32 b(simplicit)m(y)-8 b(,)28 b(w)m(e)j(assume)f(the)h(en)
+m(vironmen)m(t)f(is)g(Unix,)f(and)h(use)g(`)p Fr(unix)p
+Fv(')g(as)h(the)330 3777 y(v)-5 b(alue.\))330 3911 y(What)28
+b(else)g(is)f(needed)g(in)f(`)p Fr(configure.in)p Fv(')f(dep)s(ends)h
+(on)h(the)h(requiremen)m(ts)f(of)h(y)m(our)g(to)s(ol,)g(y)m(our)330
+4021 y(in)m(tended)j(test)i(en)m(vironmen)m(ts,)f(and)g(whic)m(h)e
+Fr(configure)g Fv(system)i(y)m(ou)h(use.)45 b(This)31
+b(example)g(is)h(a)330 4130 y(minimal)g Fr(configure.in)g
+Fv(for)i(use)h(with)e(Cygn)m(us)h(Con\014gure.)54 b(\(F)-8
+b(or)36 b(an)e(alternativ)m(e)i(based)e(on)330 4240 y(the)d(FSF)g
+Fr(autoconf)e Fv(system,)j(see)f(the)g Fr(calc)f Fv(example)h
+(distributed)d(with)i(DejaGn)m(u.\))44 b(Replace)330
+4350 y Fq(example)35 b Fv(with)29 b(the)i(name)f(of)h(y)m(our)f
+(program:)p eop
+%%Page: 44 46
+44 45 bop 150 -116 a Fv(44)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)330 52 y Fm(\013)p 380
+52 3374 4 v 3373 w(\010)p 330 1683 4 1584 v 358 205 a
+Fr(#)48 b(This)e(file)h(is)g(a)h(shell)e(script)g(fragment)358
+309 y(#)i(for)f(use)f(with)h(Cygnus)f(configure.)358
+516 y(srctrigger=")p Fq(example)p Fr(.0")358 620 y(srcname="The)f
+(DejaGnu)g Fq(example)53 b Fr(tests")358 828 y(#)48 b(per-host:)358
+1035 y(#)g(per-target:)358 1243 y(#)g(everything)d(defaults)g(to)i
+(unix)g(for)g(a)g(target)358 1347 y(target_abbrev=unix)358
+1554 y(#)h(post-target:)p 3803 1683 V 330 1735 a Fm(\012)p
+380 1735 3374 4 v 3373 w(\011)199 1880 y Fv(3.)61 b(Create)28
+b(`)p Fr(Makefile.in)p Fv(',)e(the)i(source)f(\014le)g(used)g(b)m(y)g
+Fr(configure)e Fv(to)j(build)d(y)m(our)i(`)p Fr(Makefile)p
+Fv('.)38 b(Its)330 1989 y(leading)29 b(section)i(should)d(as)j(usual)e
+(con)m(tain)h(the)h(v)-5 b(alues)30 b(that)g Fr(configure)e
+Fv(ma)m(y)j(o)m(v)m(erride:)330 2070 y Fm(\013)p 380
+2070 V 3373 w(\010)p 330 3721 4 1604 v 358 2224 a Fr(srcdir)46
+b(=)i(.)358 2327 y(prefix)e(=)i(/usr/local)358 2535 y(exec_prefix)d(=)i
+($\(prefix\))358 2639 y(bindir)f(=)i($\(exec_prefix\)/bin)358
+2742 y(libdir)e(=)i($\(exec_prefix\)/lib)358 2846 y(tooldir)e(=)h
+($\(libdir\)/$\(target_alias\))358 3054 y(datadir)f(=)h
+($\(exec_prefix\)/lib/dejagnu)358 3261 y(RUNTEST)f(=)h(runtest)358
+3365 y(RUNTESTFLAGS)e(=)358 3469 y(FLAGS_TO_PASS)f(=)358
+3676 y(####)j(host,)f(target,)g(site)h(specific)e(Makefile)h(frags)g
+(come)h(in)g(here.)p 3803 3721 V 330 3773 a Fm(\012)p
+380 3773 3374 4 v 3373 w(\011)330 3918 y Fv(This)26 b(should)g(b)s(e)h
+(follo)m(w)m(ed)h(b)m(y)f(the)i(standard)e(targets)i(at)f(y)m(our)g
+(site.)40 b(T)-8 b(o)28 b(b)s(egin)f(with,)g(they)h(need)330
+4028 y(not)j(do)f(an)m(ything|for)f(example,)i(these)g(de\014nitions)c
+(will)h(do:)p eop
+%%Page: 45 47
+45 46 bop 150 -116 a Fv(Chapter)30 b(7:)41 b(New)30 b(T)-8
+b(o)s(ols,)31 b(T)-8 b(argets,)31 b(or)g(Hosts)1888 b(45)330
+52 y Fm(\013)p 380 52 3374 4 v 3373 w(\010)p 330 1420
+4 1321 v 358 253 a Fr(all:)358 461 y(info:)358 668 y(install-info:)358
+876 y(install:)358 980 y(uninstall:)358 1187 y(clean:)740
+1291 y(-rm)47 b(-f)g(*~)g(core)g(*.info*)p 3803 1420
+V 330 1472 a Fm(\012)p 380 1472 3374 4 v 3373 w(\011)330
+1616 y Fv(It)30 b(is)f(also)h(a)g(go)s(o)s(d)g(idea)f(to)i(mak)m(e)g
+(sure)e(y)m(our)h(`)p Fr(Makefile)p Fv(')e(can)i(rebuild)d(itself)i(if)
+g(`)p Fr(Makefile.in)p Fv(')330 1726 y(c)m(hanges,)j(with)d(a)h(target)
+i(lik)m(e)e(this)f(\(whic)m(h)h(w)m(orks)g(for)g(either)g(Cygn)m(us)g
+(or)g(FSF)h(Con\014gure\):)330 1810 y Fm(\013)p 380 1810
+V 3373 w(\010)p 330 2223 4 366 v 358 1970 a Fr(Makefile)46
+b(:)h($\(srcdir\)/Makefile.in)42 b($\(host_makefile_frag\))g(\\)979
+2074 y($\(target_makefile_frag\))740 2178 y($\(SHELL\))k
+(./config.status)p 3803 2223 V 330 2275 a Fm(\012)p 380
+2275 3374 4 v 3373 w(\011)330 2420 y Fv(Y)-8 b(ou)34
+b(also)f(need)g(to)h(include)d(t)m(w)m(o)j(targets)h(imp)s(ortan)m(t)d
+(to)i(DejaGn)m(u:)47 b Fr(check)p Fv(,)33 b(to)h(run)e(the)h(tests,)330
+2530 y(and)d Fr(site.exp)p Fv(,)g(to)i(set)f(up)f(the)h(Tcl)g(copies)g
+(of)g(con\014guration-dep)s(enden)m(t)f(v)-5 b(alues.)42
+b(The)30 b Fr(check)330 2639 y Fv(target)i(m)m(ust)e(run)f(`)p
+Fr(runtest)g(--tool)f Fq(example)5 b Fv(':)330 2718 y
+Fm(\013)p 380 2718 V 3373 w(\010)p 330 3121 4 356 v 358
+2871 a Fr(check:)46 b(site.exp)g(all)740 2975 y($\(RUNTEST\))f
+($\(RUNTESTFLAGS\))f($\(FLAGS_TO_PASS\))f(\\)931 3078
+y(--tool)j Fq(example)53 b Fr(--srcdir)45 b($\(srcdir\))p
+3803 3121 V 330 3173 a Fm(\012)p 380 3173 3374 4 v 3373
+w(\011)330 3323 y Fv(The)35 b Fr(site.exp)f Fv(target)k(should)33
+b(usually)h(set)j(up)d(\(among)j(other)f(things!\))57
+b(a)36 b(Tcl)f(v)-5 b(ariable)35 b(for)330 3433 y(the)c(name)f(of)h(y)m
+(our)f(program:)p eop
+%%Page: 46 48
+46 47 bop 150 -116 a Fv(46)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)330 52 y Fm(\013)p 380
+52 3374 4 v 3373 w(\010)p 330 3475 4 3376 v 358 213 a
+Fr(site.exp:)45 b(./config.status)f(Makefile)740 316
+y(@echo)i("Making)g(a)i(new)f(config)f(file...")740 420
+y(-@rm)h(-f)g(./tmp?)740 524 y(@touch)f(site.exp)740
+731 y(-@mv)h(site.exp)e(site.bak)740 835 y(@echo)h("##)h(these)g
+(variables)e(are)i(automatically\\)406 939 y(generated)e(by)i(make)g
+(##")g(>)g(./tmp0)740 1043 y(@echo)f("#)i(Do)f(not)g(edit)f(here.)h(If)
+g(you)g(wish)f(to\\)406 1147 y(override)f(these)i(values")f(>>)h
+(./tmp0)740 1250 y(@echo)f("#)i(add)e(them)h(to)g(the)g(last)g
+(section")e(>>)j(./tmp0)740 1354 y(@echo)e("set)h(host_os)f
+(${host_os}")f(>>)i(./tmp0)740 1458 y(@echo)f("set)h(host_alias)e
+(${host_alias}")f(>>)j(./tmp0)740 1562 y(@echo)f("set)h(host_cpu)f
+(${host_cpu}")e(>>)j(./tmp0)740 1665 y(@echo)f("set)h(host_vendor)e
+(${host_vendor}")e(>>)48 b(./tmp0)740 1769 y(@echo)e("set)h(target_os)e
+(${target_os}")f(>>)k(./tmp0)740 1873 y(@echo)e("set)h(target_alias)d
+(${target_alias}")g(>>)j(./tmp0)740 1977 y(@echo)f("set)h(target_cpu)e
+(${target_cpu}")f(>>)j(./tmp0)740 2081 y(@echo)f("set)h(target_vendor)d
+(${target_vendor}")f(>>)k(./tmp0)740 2184 y(@echo)f("set)h
+(host_triplet)d(${host_canonical}")f(>>)k(./tmp0)740
+2288 y(@echo)f("set)h(target_triplet)d(${target_canonical}">>./)o(tmp0)
+740 2392 y(@echo)i("set)h(tool)g(binutils")e(>>)i(./tmp0)740
+2496 y(@echo)f("set)h(srcdir)f(${srcdir}")f(>>)i(./tmp0)740
+2599 y(@echo)f("set)h(objdir)f(`pwd`")g(>>)h(./tmp0)740
+2703 y(@echo)f("set)h Fq(examplename)53 b(example)5 b
+Fr(")47 b(>>)g(./tmp0)740 2807 y(@echo)f("##)h(All)g(variables)e(above)
+i(are)g(generated)e(by\\)406 2911 y(configure.)g(Do)i(Not)g(Edit)g(##")
+g(>>)g(./tmp0)1122 3015 y(@cat)f(./tmp0)h(>)g(site.exp)740
+3118 y(@sed)g(<)g(site.bak)f(\\)1074 3222 y(-e)h('1,/^##)f(All)h
+(variables)e(above)i(are.*##/)e(d')i(\\)1074 3326 y(>>)g(site.exp)740
+3430 y(-@rm)g(-f)g(./tmp?)p 3803 3475 V 330 3527 a Fm(\012)p
+380 3527 3374 4 v 3373 w(\011)199 3677 y Fv(4.)61 b(Create)31
+b(a)g(directory)f(\(in)f(`)p Fr(testsuite/)p Fv('\))g(called)g(`)p
+Fr(config/)p Fv(':)570 3805 y Fr(eg$)47 b(mkdir)f(config)199
+3940 y Fv(5.)61 b(Mak)m(e)31 b(an)e(init)e(\014le)i(in)e(this)h
+(directory;)i(its)e(name)i(m)m(ust)f(start)g(with)f(the)i
+Fr(target_abbrev)25 b Fv(v)-5 b(alue,)330 4049 y(so)33
+b(call)g(it)f(`)p Fr(config/unix.exp)p Fv('.)45 b(This)32
+b(is)g(the)h(\014le)f(that)i(con)m(tains)f(the)g(target-dep)s(enden)m
+(t)h(pro-)330 4159 y(cedures;)f(fortunately)-8 b(,)33
+b(most)g(of)f(them)h(do)f(not)g(ha)m(v)m(e)i(to)f(do)f(v)m(ery)h(m)m
+(uc)m(h)f(in)f(order)h(for)g Fr(runtest)330 4269 y Fv(to)f(run.)330
+4403 y(If)f Fq(example)35 b Fv(is)29 b(not)i(in)m(teractiv)m(e,)g(y)m
+(ou)g(can)f(get)i(a)m(w)m(a)m(y)g(with)d(this)g(minimal)f(`)p
+Fr(unix.exp)p Fv(')g(to)j(b)s(egin)330 4513 y(with:)330
+4574 y Fm(\013)p 380 4574 V 3373 w(\010)p 330 4883 4
+262 v 358 4734 a Fr(proc)47 b(foo_exit)e({})j({})358
+4838 y(proc)f(foo_version)e({})i({})p 3803 4883 V 330
+4935 a Fm(\012)p 380 4935 3374 4 v 3373 w(\011)330 5080
+y Fv(If)30 b Fq(example)36 b Fv(is)30 b(in)m(teractiv)m(e,)h(ho)m(w)m
+(ev)m(er,)i(y)m(ou)e(migh)m(t)f(as)h(w)m(ell)f(de\014ne)g(a)h(start)g
+(routine)f Fn(and)k(invoke)330 5190 y(it)39 b Fv(b)m(y)30
+b(using)f(an)h(init)f(\014le)h(lik)m(e)f(this:)p eop
+%%Page: 47 49
+47 48 bop 150 -116 a Fv(Chapter)30 b(7:)41 b(New)30 b(T)-8
+b(o)s(ols,)31 b(T)-8 b(argets,)31 b(or)g(Hosts)1888 b(47)330
+52 y Fm(\013)p 380 52 3374 4 v 3373 w(\010)p 330 1284
+4 1185 v 358 213 a Fr(proc)47 b(foo_exit)e({})j({})358
+316 y(proc)f(foo_version)e({})i({})358 524 y(proc)g(foo_start)e({})i({)
+454 628 y(global)f Fq(examplename)454 731 y Fr(spawn)g($)p
+Fq(examplename)454 835 y Fr(expect)g({)549 939 y(-re)h("")g({})454
+1043 y(})358 1147 y(})358 1250 y(foo_start)p 3803 1284
+V 330 1336 a Fm(\012)p 380 1336 3374 4 v 3373 w(\011)199
+1481 y Fv(6.)61 b(Create)31 b(a)g(directory)f(whose)g(name)g(b)s(egins)
+f(with)g(y)m(our)i(to)s(ol's)f(name,)h(to)g(con)m(tain)g(tests:)570
+1609 y Fr(eg$)47 b(mkdir)f Fq(example)p Fr(.0)199 1744
+y Fv(7.)61 b(Create)33 b(a)g(sample)f(test)h(\014le)f(in)f(`)p
+Fq(example)p Fr(.0)p Fv('.)47 b(Its)32 b(name)h(m)m(ust)f(end)g(with)f
+(`)p Fr(.exp)p Fv(';)j(y)m(ou)e(can)h(use)330 1853 y(`)p
+Fr(first-try.exp)p Fv(')27 b(T)-8 b(o)30 b(b)s(egin)e(with,)h(just)g
+(write)g(there)h(a)g(line)e(of)i(Tcl)f(co)s(de)h(to)h(issue)d(a)j
+(message:)330 1935 y Fm(\013)p 380 1935 V 3373 w(\010)p
+330 2140 4 159 v 358 2095 a Fr(send_user)45 b("Testing:)h(one,)g
+(two...\\n")p 3803 2140 V 330 2192 a Fm(\012)p 380 2192
+3374 4 v 3373 w(\011)199 2342 y Fv(8.)61 b(Bac)m(k)32
+b(in)d(the)i(`)p Fr(testsuite/)p Fv(')d(\(top)j(lev)m(el\))f(directory)
+-8 b(,)31 b(run)570 2471 y Fr(eg$)47 b(configure)330
+2606 y Fv(\(Y)-8 b(ou)36 b(ma)m(y)f(ha)m(v)m(e)i(to)e(sp)s(ecify)f
+(more)h(of)g(a)g(path,)i(if)c(a)j(suitable)d Fr(configure)g
+Fv(is)h(not)h(a)m(v)-5 b(ailable)34 b(in)330 2715 y(y)m(our)c
+(execution)h(path.\))199 2850 y(9.)61 b(Y)-8 b(ou)34
+b(are)g(no)m(w)g(ready)g(to)g(triumphan)m(tly)e(t)m(yp)s(e)i(`)p
+Fr(make)29 b(check)p Fv(')k(or)g(`)p Fr(runtest)c(--tool)g
+Fq(example)5 b Fv('.)330 2959 y(Y)-8 b(ou)31 b(should)d(see)j
+(something)f(lik)m(e)g(this:)330 3038 y Fm(\013)p 380
+3038 V 3373 w(\010)p 330 4046 4 961 v 358 3191 a Fr(Test)47
+b(Run)g(By)g(rhl)g(on)g(Fri)g(Jan)g(29)g(16:25:44)f(EST)g(1993)1122
+3399 y(===)h Fq(example)52 b Fr(tests)47 b(===)358 3606
+y(Running)f(./)p Fq(example)p Fr(.0/first-try.exp)d(...)358
+3710 y(Testing:)j(one,)g(two...)1122 3917 y(===)h Fq(example)52
+b Fr(Summary)46 b(===)p 3803 4046 V 330 4098 a Fm(\012)p
+380 4098 3374 4 v 3373 w(\011)330 4243 y Fv(There)35
+b(is)g(no)g(output)h(in)e(the)i(summary)-8 b(,)36 b(b)s(ecause)g(so)g
+(far)f(the)h(example)g(do)s(es)f(not)h(call)f(an)m(y)h(of)330
+4352 y(the)31 b(pro)s(cedures)e(that)i(establish)d(a)j(test)g(outcome.)
+154 4487 y(10.)61 b(Begin)39 b(writing)e(some)i(real)g(tests.)67
+b(F)-8 b(or)40 b(an)f(in)m(teractiv)m(e)h(to)s(ol,)h(y)m(ou)e(should)e
+(probably)g(write)i(a)330 4597 y(real)31 b(exit)f(routine)g(in)g
+(fairly)f(short)i(order;)f(in)g(an)m(y)h(case,)i(y)m(ou)e(should)e
+(also)i(write)f(a)h(real)f(v)m(ersion)330 4706 y(routine)f(so)s(on.)p
+eop
+%%Page: 48 50
+48 49 bop 150 -116 a Fv(48)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fu(7.2)68 b(Adding)44
+b(a)h(target)275 276 y Fv(DejaGn)m(u)j(has)f(some)h(additional)e
+(requiremen)m(ts)h(for)g(target)i(supp)s(ort,)i(b)s(ey)m(ond)c(the)h
+(general-)150 385 y(purp)s(ose)37 b(pro)m(visions)g(of)h(Cygn)m(us)g
+Fr(configure)p Fv(.)63 b Fr(runtest)37 b Fv(m)m(ust)h(activ)m(ely)h
+(comm)m(unicate)g(with)f(the)150 495 y(target,)31 b(rather)e(than)g
+(simply)e(generating)i(or)g(managing)g(co)s(de)g(for)g(the)h(target)g
+(arc)m(hitecture.)41 b(There-)150 604 y(fore,)30 b(eac)m(h)i(to)s(ol)d
+(requires)g(an)h(initialization)d(mo)s(dule)h(for)i(eac)m(h)h(target.)
+42 b(F)-8 b(or)31 b(new)e(targets,)j(y)m(ou)e(m)m(ust)150
+714 y(supply)21 b(a)j(few)g(Tcl)e(pro)s(cedures)h(to)h(adapt)g(DejaGn)m
+(u)g(to)h(the)f(target.)40 b(This)21 b(p)s(ermits)h(DejaGn)m(u)j
+(itself)d(to)150 824 y(remain)j(target)i(indep)s(enden)m(t.)37
+b(See)26 b(Section)f(5.2)i([Initialization)c(mo)s(dule],)j(page)g(22,)i
+(for)d(a)i(discussion)150 933 y(of)k(the)f(naming)f(con)m(v)m(en)m
+(tions)j(that)f(enable)f(DejaGn)m(u)h(to)g(lo)s(cate)g(and)f(use)g
+(init)f(\014les.)275 1068 y(Usually)24 b(the)i(b)s(est)f(w)m(a)m(y)i
+(to)g(write)e(a)h(new)g(initialization)c(mo)s(dule)j(is)g(to)h(edit)g
+(an)f(existing)g(initializa-)150 1177 y(tion)30 b(mo)s(dule;)g(some)h
+(trial)f(and)g(error)g(will)e(b)s(e)i(required.)41 b(If)30
+b(necessary)-8 b(,)32 b(y)m(ou)f(can)g(use)f(the)h(`)p
+Fr(--debug)p Fv(')150 1287 y(option)f(to)h(see)g(what)f(is)g(really)f
+(going)h(on.)275 1421 y(When)f(y)m(ou)h(co)s(de)g(an)f(initialization)e
+(mo)s(dule,)h(b)s(e)h(generous)h(in)e(prin)m(ting)f(information)h(con)m
+(trolled)150 1531 y(b)m(y)i(the)h Fr(verbose)d Fv(pro)s(cedure)h(\(see)
+j(Section)e(5.3)h([DejaGn)m(u)h(Builtins],)c(page)j(23\).)275
+1665 y(Most)40 b(of)f(the)h(w)m(ork)g(is)e(in)g(getting)i(the)g(comm)m
+(unications)f(righ)m(t.)67 b(Comm)m(unications)38 b(co)s(de)i(\(for)150
+1775 y(sev)m(eral)26 b(situations)e(in)m(v)m(olving)g(IP)h(net)m(w)m
+(orks)h(or)f(serial)f(lines\))g(is)h(a)m(v)-5 b(ailable)25
+b(in)f(a)h(DejaGn)m(u)i(library)c(\014le,)150 1885 y(`)p
+Fr(lib/remote.exp)p Fv('.)37 b(See)31 b(Section)f(5.3)i([DejaGn)m(u)f
+(Builtins],)d(page)j(23.)275 2019 y(If)e(y)m(ou)i(susp)s(ect)e(a)i
+(comm)m(unication)f(problem,)f(try)h(running)d(the)k(connection)f(in)m
+(teractiv)m(ely)g(from)150 2129 y Fr(expect)p Fv(.)37
+b(\(There)24 b(are)h(three)f(w)m(a)m(ys)h(of)g(running)c
+Fr(expect)i Fv(as)i(an)f(in)m(teractiv)m(e)h(in)m(terpreter.)38
+b(Y)-8 b(ou)25 b(can)f(run)150 2238 y Fr(expect)k Fv(with)g(no)h
+(argumen)m(ts,)h(and)f(con)m(trol)h(it)f(completely)g(in)m(teractiv)m
+(ely;)h(or)f(y)m(ou)h(can)f(use)g(`)p Fr(expect)150 2348
+y(-i)p Fv(')c(together)i(with)e(other)g(command-line)f(options)h(and)g
+(argumen)m(ts;)j(or)e(y)m(ou)f(can)h(run)e(the)i(command)150
+2457 y Fr(interpreter)f Fv(from)i(an)m(y)i Fr(expect)d
+Fv(pro)s(cedure.)39 b(Use)28 b Fr(return)e Fv(to)j(get)g(bac)m(k)g(to)f
+(the)h(calling)d(pro)s(cedure)150 2567 y(\(if)32 b(an)m(y\),)i(or)e
+Fr(return)d(-tcl)i Fv(to)i(mak)m(e)h(the)e(calling)f(pro)s(cedure)g
+(itself)h(return)f(to)i(its)f(caller;)h(use)f Fr(exit)150
+2677 y Fv(or)40 b(end-of-\014le)g(to)h(lea)m(v)m(e)g
+Fr(expect)e Fv(altogether.\))72 b(Run)39 b(the)h(program)h(whose)f
+(name)g(is)f(recorded)h(in)150 2786 y(`)p Fr($connectmode)p
+Fv(',)45 b(with)d(the)j(argumen)m(ts)f(in)e(`)p Fr($targetname)p
+Fv(',)j(to)g(establish)d(a)j(connection.)81 b(Y)-8 b(ou)150
+2896 y(should)28 b(at)j(least)g(b)s(e)f(able)g(to)h(get)g(a)g(prompt)f
+(from)g(an)m(y)g(target)i(that)f(is)f(ph)m(ysically)e(connected.)150
+3153 y Fu(7.3)68 b(P)l(orting)46 b(to)f(a)g(new)h(host)275
+3346 y Fv(The)c(task)i(of)f(p)s(orting)f(DejaGn)m(u)h(is)g(basically)e
+(that)j(of)f(p)s(orting)e(Tcl)i(and)f Fr(expect)p Fv(.)77
+b(Tcl)43 b(and)150 3455 y Fr(expect)p Fv(,)31 b(as)h(distributed)e
+(with)g(DejaGn)m(u,)k(b)s(oth)d(use)h Fr(autoconf)p Fv(;)f(they)h
+(should)f(p)s(ort)g(automatically)150 3565 y(to)g(most)g(Unix)e
+(systems.)275 3699 y(Once)k(Tcl)g(and)g Fr(expect)e Fv(are)j(p)s
+(orted,)g(DejaGn)m(u)h(should)c(run.)49 b(Most)34 b(system)g(dep)s
+(endencies)e(are)150 3809 y(tak)m(en)f(care)h(of)e(b)m(y)g(using)f
+Fr(expect)g Fv(as)i(the)f(main)f(command)i(shell.)p eop
+%%Page: 49 51
+49 50 bop 150 -116 a Fv(App)s(endix)28 b(A:)i(Installing)e(DejaGn)m(u)
+2215 b(49)150 100 y Fs(App)t(endix)53 b(A)81 b(Installing)55
+b(DejaGn)l(u)275 301 y Fv(Once)27 b(y)m(ou)h(ha)m(v)m(e)h(the)f(DejaGn)
+m(u)h(source)f(unpac)m(k)m(ed)g(and)f(a)m(v)-5 b(ailable,)28
+b(y)m(ou)g(m)m(ust)f(\014rst)g(con\014gure)h(the)150
+411 y(soft)m(w)m(are)35 b(to)g(sp)s(ecify)d(where)i(it)f(is)g(to)h(run)
+f(\(and)g(the)h(asso)s(ciated)g(defaults\);)h(then)f(y)m(ou)g(can)g
+(pro)s(ceed)150 520 y(to)d(installing)d(it.)150 758 y
+Fu(A.1)67 b(Con\014guring)45 b(the)h(DejaGn)l(u)f(test)h(driv)l(er)275
+944 y Fv(It)37 b(is)g(usually)e(b)s(est)i(to)h(con\014gure)g(in)e(a)i
+(directory)f(separate)h(from)f(the)h(source)g(tree,)i(sp)s(ecifying)150
+1054 y(where)29 b(to)i(\014nd)d(the)j(source)f(with)e(the)i(optional)f
+(`)p Fr(--srcdir)p Fv(')g(option)g(to)i Fr(configure)p
+Fv(.)38 b(DejaGn)m(u)30 b(uses)150 1164 y(the)39 b(GNU)h
+Fr(autoconf)c Fv(to)k(con\014gure)e(itself.)65 b(F)-8
+b(or)40 b(more)f(info)f(on)h(using)e(auto)s(conf,)k(read)e(the)g(GNU)
+150 1273 y(auto)s(conf)i(man)m(ual.)70 b(T)-8 b(o)41
+b(con\014gure,)i(execute)f(the)e(`)p Fr(configure)p Fv(')f(program,)k
+(no)d(other)h(options)f(are)150 1383 y(required.)f(F)-8
+b(or)31 b(an)f(example,)h(to)g(con\014gure)f(in)f(a)i(sep)s(erate)f
+(tree)h(for)g(ob)5 b(jects,)31 b(execute)h(the)e(con\014gure)150
+1492 y(script)f(from)h(the)h(source)f(tree)h(lik)m(e)f(this:)390
+1615 y Fr(../dejagnu-1.3/configure)275 1743 y Fv(DejaGn)m(u)f(do)s
+(esn't)g(care)g(at)g(con\014g)g(time)g(if)e(it's)i(for)f(testing)h(a)g
+(nativ)m(e)g(system)g(or)g(a)g(cross)g(system.)150 1852
+y(That)h(is)g(determined)f(at)i(run)m(time)e(b)m(y)h(using)f(the)i
+(con\014g)f(\014les.)275 1980 y(Y)-8 b(ou)49 b(ma)m(y)g(also)g(w)m(an)m
+(t)h(to)g(use)e(the)h Fr(configure)e Fv(option)h(`)p
+Fr(--prefix)p Fv(')f(to)j(sp)s(ecify)d(where)i(y)m(ou)150
+2090 y(w)m(an)m(t)f(DejaGn)m(u)f(and)f(its)g(supp)s(orting)e(co)s(de)j
+(installed.)88 b(By)47 b(default,)j(installation)44 b(is)i(in)g(sub)s
+(di-)150 2199 y(rectories)40 b(of)f(`)p Fr(/usr/local)p
+Fv(',)g(but)g(y)m(ou)g(can)h(select)g(an)m(y)f(alternate)h(directory)f
+Fq(altdir)44 b Fv(b)m(y)39 b(including)150 2309 y(`)p
+Fr(--prefix=)p Fq(altdir)7 b Fv(')23 b(on)k(the)g Fr(configure)d
+Fv(command)j(line.)37 b(\(This)26 b(v)-5 b(alue)26 b(is)g(captured)h
+(in)e(the)i(Mak)m(e\014le)150 2419 y(v)-5 b(ariables)29
+b Fr(prefix)g Fv(and)g Fr(exec_prefix)p Fv(.\))275 2547
+y(Sa)m(v)m(e)46 b(for)e(a)i(small)d(n)m(um)m(b)s(er)g(of)i(example)g
+(tests,)k(the)d(DejaGn)m(u)f(distribution)c(itself)j(do)s(es)h(not)150
+2656 y(include)38 b(an)m(y)j(test)g(suites;)j(these)d(are)f(a)m(v)-5
+b(ailable)40 b(separately)-8 b(.)71 b(T)-8 b(est)41 b(suites)e(for)h
+(the)g Fo(gnu)g Fv(compiler)150 2766 y(\(testing)e(b)s(oth)g(GCC)f(and)
+g(G)p Fr(++)p Fv(\))h(and)g(for)g(the)g Fo(gnu)f Fv(binary)g(utilities)
+e(are)j(distributed)d(in)i(parallel)150 2875 y(with)29
+b(the)h(DejaGn)m(u)h(distribution)26 b(\(but)k(pac)m(k)-5
+b(aged)31 b(as)g(separate)g(\014les\).)39 b(The)30 b(test)h(suite)e
+(for)h(the)g Fo(gnu)150 2985 y Fv(debugger)h(is)f(distributed)e(in)i
+(parallel)g(with)f(eac)m(h)k(release)e(of)h(GDB)g(itself,)e(starting)h
+(with)f(GDB)j(4.9.)150 3095 y(After)27 b(con\014guring)e(the)h(top-lev)
+m(el)h(DejaGn)m(u)g(directory)-8 b(,)27 b(unpac)m(k)f(and)g
+(con\014gure)g(the)h(test)g(directories)150 3204 y(for)40
+b(the)h(to)s(ols)f(y)m(ou)h(w)m(an)m(t)g(to)g(test;)47
+b(then,)c(in)c(eac)m(h)j(test)f(directory)-8 b(,)43 b(run)c
+Fr(make)h Fv(to)h(build)c(auxiliary)150 3314 y(programs)30
+b(required)f(b)m(y)h(some)h(of)f(the)h(tests.)150 3552
+y Fu(A.2)67 b(Installing)47 b(DejaGn)l(u)275 3738 y Fv(T)-8
+b(o)36 b(install)e(DejaGn)m(u)k(in)d(y)m(our)h(\014lesystem)f(\(either)
+i(in)e(`)p Fr(/usr/local)p Fv(',)g(or)i(as)f(sp)s(eci\014ed)f(b)m(y)h
+(y)m(our)150 3847 y(`)p Fr(--prefix)p Fv(')29 b(option)g(to)j
+Fr(configure)p Fv(\),)c(execute)390 3969 y Fr(eg$)47
+b(make)g(install)150 4098 y Fv(`)p Fr(make)29 b(install)p
+Fv(')g(do)s(es)h(these)h(things)e(for)h(DejaGn)m(u:)199
+4226 y(1.)61 b(Lo)s(ok)28 b(in)f(the)h(path)f(sp)s(eci\014ed)g(for)g
+(executables)i(\(`)p Fr($exec_prefix)p Fv('\))d(for)h(directories)g
+(called)g(`)p Fr(lib)p Fv(')330 4335 y(and)j(`)p Fr(bin)p
+Fv('.)40 b(If)30 b(these)h(directories)e(do)i(not)f(exist,)h(`)p
+Fr(make)e(install)p Fv(')g(creates)i(them.)199 4463 y(2.)61
+b(Create)31 b(another)g(directory)f(in)f(the)h(`)p Fr(lib)p
+Fv(')g(directory)-8 b(,)31 b(called)e(`)p Fr(dejagnu)p
+Fv('.)199 4591 y(3.)61 b(Cop)m(y)30 b(the)h Fr(runtest)d
+Fv(shell)h(script)g(in)m(to)i(`)p Fr($exec_prefix/bin)p
+Fv('.)199 4719 y(4.)61 b(Cop)m(y)20 b(all)f(the)i(library)d(\014les)h
+(\(used)h(to)h(supp)s(ort)d(the)j(framew)m(ork\))g(in)m(to)f(`)p
+Fr($exec_prefix/lib/dejagnu)o Fv('.)199 4847 y(5.)61
+b(Cop)m(y)40 b(`)p Fr(runtest.exp)p Fv(')e(in)m(to)i(`)p
+Fr($exec_prefix/lib/dejagnu)o Fv('.)65 b(This)38 b(is)h(the)h(main)f
+(Tcl)h(co)s(de)330 4957 y(implemen)m(ting)28 b(DejaGn)m(u.)275
+5103 y(Eac)m(h)33 b(test)h(suite)e(collection)h(comes)g(with)f(simple)f
+(installation)f(instructions)h(in)h(a)h(`)p Fr(README)p
+Fv(')f(\014le;)150 5213 y(in)43 b(general,)49 b(the)c(test)g(suites)f
+(are)h(designed)e(to)j(b)s(e)e(unpac)m(k)m(ed)g(in)g(the)g(source)h
+(directory)f(for)h(the)150 5322 y(corresp)s(onding)28
+b(to)s(ol,)j(and)f(extract)i(in)m(to)e(a)h(directory)f(called)f(`)p
+Fr(testsuite)p Fv('.)p eop
+%%Page: 50 52
+50 51 bop 150 -116 a Fv(50)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)p eop
+%%Page: 51 53
+51 52 bop 150 -116 a Fv(Index)3286 b(51)150 100 y Fs(Index)150
+1097 y Fu(-)150 1255 y Ff(--all)27 b Fe(\()p Ff(runtest)g
+Fe(option\))20 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)46 b Fe(10)150
+1366 y Ff(--baud)27 b Fe(\()p Ff(runtest)g Fe(option\))19
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)44 b Fe(11)150 1476 y Ff(--build)27
+b Fe(\()p Ff(runtest)g Fe(option\))17 b Fd(.)c(.)g(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(11)150 1587 y Ff(--connect)28 b Fe(\()p Ff(runtest)f
+Fe(option\))15 b Fd(.)d(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)40 b Fe(11)150 1698 y Ff(--debug)27
+b Fe(\()p Ff(runtest)g Fe(option\))17 b Fd(.)c(.)g(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(11)150 1809 y Ff(--help)27 b Fe(\()p Ff(runtest)g
+Fe(option\))19 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fe(11)150 1920
+y Ff(--host)27 b Fe(\()p Ff(runtest)g Fe(option\))19
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)44 b Fe(11)150 2031 y Ff(--name)27
+b Fe(\()p Ff(runtest)g Fe(option\))19 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44
+b Fe(11)150 2142 y Ff(--objdir)27 b Fe(\()p Ff(runtest)g
+Fe(option\))16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)g(.)42 b Fe(12)150 2252 y Ff(--outdir)27
+b Fe(\()p Ff(runtest)g Fe(option\))16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)42 b Fe(12)150
+2363 y Ff(--reboot)27 b Fe(\()p Ff(runtest)g Fe(option\))16
+b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)42 b Fe(12)150 2474 y Ff(--srcdir)27 b Fe(\()p
+Ff(runtest)g Fe(option\))16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)42 b Fe(12)150 2585
+y Ff(--strace)27 b Fe(\()p Ff(runtest)g Fe(option\))16
+b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)42 b Fe(12)150 2696 y Ff(--target)27 b Fe(\()p
+Ff(runtest)g Fe(option\))16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)42 b Fe(12)150 2807
+y Ff(--tool)27 b Fe(\()p Ff(runtest)g Fe(option\))19
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)44 b Fe(10)150 2918 y Ff(--tool)27
+b Fe(and)e(naming)g(con)n(v)n(en)n(tions)9 b Fd(.)j(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fe(21)150 3028
+y Ff(--verbose)28 b Fe(\()p Ff(runtest)f Fe(option\))15
+b Fd(.)d(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)40 b Fe(13)150 3139 y Ff(--version)28 b Fe(\()p Ff(runtest)f
+Fe(option\))15 b Fd(.)d(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)40 b Fe(13)150 3250 y Ff(-b)26 b Fe(\()p
+Ff(runtest)h Fe(option\))7 b Fd(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)32
+b Fe(11)150 3361 y Ff(-v)26 b Fe(\()p Ff(runtest)h Fe(option\))7
+b Fd(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)32 b Fe(13)150
+3472 y Ff(-V)26 b Fe(\()p Ff(runtest)h Fe(option\))7
+b Fd(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)32 b Fe(13)150
+3805 y Fu(.)150 3962 y Ff(.exp)14 b Fd(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40
+b Fe(1)150 4296 y Fu(A)150 4453 y Ff(absolute)27 b Fc(path)8
+b Fd(.)k(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)33
+b Fe(28)150 4564 y(adding)26 b(a)g(target)14 b Fd(.)f(.)f(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fe(48)150 4675 y(adding)26
+b(a)g(test)f(case)8 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)33
+b Fe(40)150 4786 y Ff(all_flag)7 b Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)32 b Fe(17)150
+4897 y(am)n(biguit)n(y)-6 b(,)24 b(required)i(for)g(POSIX)11
+b Fd(.)g(.)i(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+37 b Fe(7)150 5007 y(arc)n(hiv)n(e)26 b(ob)t(ject)g(\014les)15
+b Fd(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)41 b Fe(30)150
+5118 y(auxiliary)26 b(\014les,)h(building)16 b Fd(.)c(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)
+g(.)43 b Fe(3)150 5229 y(auxiliary)26 b(programs)11 b
+Fd(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)36 b Fe(49)150
+5340 y(auxiliary)26 b(test)g(programs)9 b Fd(.)j(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34
+b Fe(12)2025 424 y Fu(B)2025 557 y Ff(baud)13 b Fd(.)g(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38
+b Fe(17)2025 657 y(baud)25 b(rate,)h(sp)r(ecifying)12
+b Fd(.)i(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)38 b Fe(11)2025 756 y(bps,)25
+b(sp)r(ecifying)8 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)33 b Fe(11)2025 856 y Ff(bt)15 b Fd(.)e(.)f(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41
+b Fe(31)2025 956 y(bug)25 b(n)n(um)n(b)r(er)16 b Fd(.)11
+b(.)h(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)42
+b Fe(42)2025 1055 y(bug)25 b(n)n(um)n(b)r(er,)f(extra)15
+b Fd(.)e(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 b Fe(42)2025
+1155 y Ff(bug_id)10 b Fd(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fe(42)2025 1254
+y(build)25 b(con\014g)h(name,)f(c)n(hanging)c Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)46
+b Fe(11)2025 1354 y(build)25 b(host)h(con\014guration)g(test)14
+b Fd(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)40 b Fe(25)2025 1454 y Ff(build_triplet)18 b Fd(.)d(.)d(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)43 b Fe(17)2025 1553 y(built)25
+b(in)h(pro)r(cedures,)g(DejaGn)n(u)19 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 b Fe(23)2025
+1819 y Fu(C)2025 1952 y Fe(C)26 b(torture)f(test)d Fd(.)12
+b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)47
+b Fe(39)2025 2052 y(canadian)26 b(cross)h(con\014guration)f(test)12
+b Fd(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38
+b Fe(25)2025 2151 y(cancelling)27 b(exp)r(ected)e(failure)11
+b Fd(.)j(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)37 b Fe(26)2025 2251 y Ff(check)26 b Fe(mak)n(e\014le)f
+(target)e Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fe(3)2025
+2351 y Ff(clear_xfail)28 b Fc(con\014g)22 b Fd(.)12 b(.)h(.)f(.)g(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)41 b Fe(26)2025 2450 y(Closing)27 b(a)f(remote)f
+(connection)14 b Fd(.)g(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)40 b Fe(27)2025 2550 y(command)24
+b(line)i(option)g(v)l(ariables)13 b Fd(.)g(.)g(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)39 b Fe(17)2025 2650 y(command)24
+b(line)i(options)13 b Fd(.)g(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40
+b Fe(9)2025 2749 y(command)24 b(line)i(Tcl)g(v)l(ariable)g
+(de\014nition)18 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44
+b Fe(10)2025 2849 y(comm)n(unications)24 b(pro)r(cedures)9
+b Fd(.)k(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)35 b Fe(26)2025 2948 y Ff(comp_output)23 b Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)46
+b Fe(42)2025 3048 y(comparing)25 b(\014les)c Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46 b Fe(28)2025
+3148 y(compile)25 b(a)h(\014le)14 b Fd(.)f(.)g(.)f(.)g(.)h(.)f(.)g(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)40 b Fe(29)2025 3247 y(con\014guration)26
+b(dep)r(enden)n(t)e(defaults)14 b Fd(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)
+g(.)h(.)f(.)g(.)h(.)39 b Fe(15)2025 3347 y(con\014guring)26
+b(DejaGn)n(u)16 b Fd(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42 b
+Fe(49)2025 3447 y(connecting)26 b(to)g(target)e Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)50 b Fe(11)2025 3546 y Ff(connectmode)23
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)46
+b Fe(17)2025 3646 y(con)n(v)n(erting)25 b(relativ)n(e)i(paths)e(to)h
+(absolute)d Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48
+b Fe(28)2025 3746 y(Core)26 b(In)n(ternal)g(Pro)r(cedures)14
+b Fd(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)39 b Fe(23)2025 3845 y(cross)27 b(con\014guration)14
+b Fd(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40 b Fe(4)2025
+3945 y(curren)n(t)25 b(test)h(sub)r(directory)18 b Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)44 b Fe(42)2025 4211 y Fu(D)2025 4344 y Ff(dbg.log)27
+b Fe(\014le)19 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)45 b Fe(11)2025 4443 y(debug)25 b(log)c Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45
+b Fe(36)2025 4543 y(debug)25 b(log)i(for)f(test)g(cases)8
+b Fd(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)g(.)h(.)f(.)g(.)h(.)33 b Fe(11)2025 4642 y Ff(debugger.exp)22
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45
+b Fe(30)2025 4742 y(debugging)26 b(a)g(test)f(case)f
+Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fe(40)2025 4842 y(default)26
+b(options,)g(con)n(trolling)c Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)46 b Fe(17)2025
+4941 y(defaults,)27 b(option)11 b Fd(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)37 b Fe(17)2025 5041 y(defaults,)27 b(setting)f(in)f
+(init)h(\014le)9 b Fd(.)k(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)35 b Fe(23)2025 5141 y(DejaGn)n(u)25
+b(con\014guration)18 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 b
+Fe(49)2025 5240 y(DejaGn)n(u)25 b(test)h(driv)n(er)11
+b Fd(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)38 b Fe(9)2025
+5340 y(DejaGn)n(u,)26 b(the)f(name)18 b Fd(.)12 b(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)44 b Fe(6)p eop
+%%Page: 52 54
+52 53 bop 150 -116 a Fv(52)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 152 y Fe(Delete)26
+b(a)g(w)n(atc)n(hp)r(oin)n(t.)16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42
+b Fe(31)150 253 y(design)26 b(goals)18 b Fd(.)c(.)f(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fe(5)150 354
+y(detailed)26 b(log)f Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)49 b Fe(36)150 455 y Ff(diff)27 b Fc(\014lename)i
+(\014lename)18 b Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fe(28)150
+555 y(directories)27 b(matc)n(hing)e(a)h(pattern)18 b
+Fd(.)11 b(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(28)150 656 y(directory)26 b(names)f(and)g Ff(--tool)17
+b Fd(.)d(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)43 b Fe(21)150 757 y(do)n(wnload)26 b(a)g(\014le)20
+b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45
+b Fe(27)150 858 y Ff(download)27 b Fc(\014le)j Fe([)c
+Fc(spa)n(wnid)j Fe(])18 b Fd(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 b Fe(27)150
+959 y(do)n(wnload,)27 b Ff(tip)13 b Fd(.)g(.)f(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)39 b Fe(27)150 1059 y Ff(dumplocals)28
+b Fd(expr)15 b(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)32
+b Fe(30)150 1160 y Ff(dumprocs)27 b Fd(expr)18 b(.)c(.)e(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fe(30)150 1261 y
+Ff(dumpvars)27 b Fd(expr)18 b(.)c(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)35 b Fe(30)150 1362 y Ff(dumpwatch)28 b Fd(expr)16
+b(.)d(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34
+b Fe(30)150 1635 y Fu(E)150 1770 y Ff(echo.exp)8 b Fd(.)14
+b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)34 b Fe(5)150 1870 y Ff(ERROR)24 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)49 b Fe(9,)26
+b(23)150 1971 y(example)9 b Fd(.)i(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fe(5)150
+2072 y Ff(exec_output)23 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)46 b Fe(42)150 2173 y Ff(exec_prefix)p
+Fe(,)28 b(con\014gure)e(options.)9 b Fd(.)k(.)g(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fe(49)150 2274 y Ff(execute_anywhere)29
+b Fd(cmd)t(line)17 b(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)37 b Fe(30)150 2374 y(executing)26
+b(commands)e(remotely)18 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)44 b Fe(30)150 2475 y(existing)26
+b(tests,)h(running)10 b Fd(.)h(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36
+b Fe(3)150 2576 y(exit)25 b(co)r(de)i(from)e Ff(runtest)8
+b Fd(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)35 b Fe(9)150 2677 y(exit)25
+b(pro)r(cedure,)h(tested)g(to)r(ols)14 b Fd(.)g(.)e(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)40 b Fe(31)150
+2778 y Ff(exit_remote_shell)29 b Fc(spa)n(wnid)10 b Fd(.)j(.)g(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)33
+b Fe(27)150 2878 y Ff(exp)26 b Fe(\014lename)f(su\016x)15
+b Fd(.)d(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)41 b Fe(21)150
+2979 y Ff(expect)27 b Fe(in)n(ternal)f(tracing)10 b Fd(.)j(.)f(.)h(.)f
+(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)35 b Fe(12)150 3080 y Ff(expect)27 b Fe(script)f(names)c
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fe(1)150
+3181 y Ff(expect)27 b Fe(scripting)f(language)21 b Fd(.)12
+b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)45 b Fe(8)150 3281 y Ff(expect_out\(buffer\))10
+b Fd(.)17 b(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36 b Fe(42)150
+3382 y(exp)r(ected)25 b(failure)20 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)44 b Fe(9,)26 b(25)150 3483 y(exp)r(ected)f(failure,)i
+(cancelling)21 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fe(26)150 3756 y Fu(F)150
+3891 y Ff(FAIL)7 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b Fe(7,)26
+b(9)150 3992 y Ff(fail)h(")p Fc(string)6 b Ff(")g Fd(.)14
+b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)32
+b Fe(24)150 4093 y(failing)c(test,)e(exp)r(ected)15 b
+Fd(.)d(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41 b Fe(9)150 4193
+y(failing)28 b(test,)e(unexp)r(ected)9 b Fd(.)i(.)h(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35
+b Fe(9)150 4294 y(failure,)27 b(exp)r(ected)14 b Fd(.)e(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)40 b Fe(25)150 4395 y(failure,)27
+b(POSIX)e(de\014nition)17 b Fd(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43
+b Fe(7)150 4496 y(\014lename)25 b(for)h(test)g(\014les)14
+b Fd(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)40 b Fe(21)150 4596 y(\014les)26
+b(matc)n(hing)f(a)h(pattern)18 b Fd(.)12 b(.)g(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(28)150 4697 y Ff(find)27 b Fc(dir)k(pattern)13 b
+Fd(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)39 b Fe(28)150
+4798 y Ff(findfile)7 b Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)32 b Fe(22)150 4899 y(\014nding)25
+b(\014le)h(di\013erences)17 b Fd(.)c(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(28)150 5000 y(future)25 b(directions)15 b Fd(.)f(.)e(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)g(.)h(.)41 b Fe(8)2025 501 y Fu(G)2025
+648 y Ff(gdb.t00/echo.exp)14 b Fd(.)i(.)c(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)41 b Fe(5)2025 755 y Ff(get_warning_threshold)29
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)g(.)h(.)f(.)50 b Fe(24)2025 862 y Ff(getdirs)27
+b Fc(dir)d Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)44 b Fe(28)2025 968 y Ff(getdirs)27 b Fc(dir)k(pattern)9
+b Fd(.)j(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)35 b Fe(28)2025 1075
+y Ff(getenv)27 b Fc(v)l(ar)19 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 b Fe(29)2025 1181
+y(getting)26 b(en)n(vironmen)n(t)e(v)l(ariables)11 b
+Fd(.)i(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)37
+b Fe(29)2025 1288 y(GNA)-6 b(TS)25 b(bug)g(n)n(um)n(b)r(er)15
+b Fd(.)c(.)h(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 b Fe(42)2025 1395
+y(Granlund,)25 b(T)-6 b(orb)t(jorn)12 b Fd(.)i(.)e(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)38 b Fe(39)2025 1501 y Ff(grep)26 b Fc(\014lename)j(regexp)10
+b Fd(.)i(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)33 b Fe(28)2025 1608
+y Ff(grep)26 b Fc(\014lename)j(regexp)f Ff(line)7 b Fd(.)13
+b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)33 b Fe(28)2025 1915 y Fu(H)2025 2063 y Fe(help)25
+b(with)h Ff(runtest)21 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45
+b Fe(11)2025 2170 y(hin)n(ts)25 b(on)h(test)f(case)i(writing)12
+b Fd(.)h(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+g(.)h(.)f(.)g(.)38 b Fe(41)2025 2276 y(host)26 b(con\014g)f(name,)h(c)n
+(hanging)17 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)42 b Fe(11)2025 2383 y(host)26
+b(con\014guration)g(test)c Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47
+b Fe(25)2025 2490 y(host,)26 b(explained)19 b Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fe(49)2025
+2596 y Ff(host_triplet)22 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)45 b Fe(17)2025 2904 y Fu(I)2025 3052
+y Ff(ignoretests)23 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)h(.)46 b Fe(17)2025 3158 y(init)26 b(\014le)f(name)14
+b Fd(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40
+b Fe(22)2025 3265 y(init)26 b(\014le,)g(purp)r(ose)16
+b Fd(.)c(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)42 b
+Fe(22)2025 3372 y(initialization)7 b Fd(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)33 b Fe(22)2025 3478
+y(input)25 b(\014les)15 b Fd(.)d(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)41 b Fe(34)2025 3585 y(installed)26
+b(to)r(ol)h(name)c Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)50
+b Fe(24)2025 3691 y(installing)27 b(DejaGn)n(u)11 b Fd(.)i(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)37 b Fe(49)2025 3798 y(in)n(ternal)26
+b(details)c Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47
+b Fe(21)2025 3904 y(in)n(v)n(oking)23 b Fd(.)13 b(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)50
+b Fe(9)2025 4011 y(IP)25 b(net)n(w)n(ork)h(pro)r(cedures)20
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)46 b Fe(27)2025 4118 y Ff(isbuild)27
+b(")p Fc(host)r Ff(")12 b Fd(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)38 b Fe(25)2025 4224 y Ff(ishost)27 b(")p Fc(host)r
+Ff(")13 b Fd(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)39
+b Fe(25)2025 4331 y Ff(isnative)7 b Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fe(25)2025
+4437 y Ff(istarget)27 b(")p Fc(target)r Ff(")17 b Fd(.)c(.)g(.)f(.)g(.)
+h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)43 b Fe(25)2025 4745 y Fu(K)2025 4893
+y Ff(kermit)27 b Fc(p)r(ort)g(bps)18 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)42 b Fe(27)2025 5000 y Ff(kermit)p
+Fe(,)27 b(remote)e(testing)h(via)9 b Fd(.)k(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fe(11)p
+eop
+%%Page: 53 55
+53 54 bop 150 -116 a Fv(Index)3286 b(53)150 695 y Fu(L)150
+850 y Fe(last)26 b(command)e(output)c Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)46
+b Fe(42)150 960 y Ff(lib/debugger.exp)13 b Fd(.)j(.)d(.)f(.)g(.)h(.)f
+(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)39 b Fe(30)150 1070 y Ff(lib/remote.exp)16
+b Fd(.)g(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42 b
+Fe(26)150 1180 y Ff(lib/target.exp)16 b Fd(.)g(.)c(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)42 b Fe(29)150 1289 y Ff(lib/utils.exp)18
+b Fd(.)d(.)d(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(28)150 1399 y(Lib)r(es,)27 b(Don)18 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fe(8)150
+1509 y(list,)27 b(pruning)13 b Fd(.)f(.)g(.)g(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)38 b Fe(29)150 1619 y Ff(list_targets)22
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)45
+b Fe(29)150 1729 y(lists)27 b(supp)r(orted)e(targets)6
+b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)32 b Fe(29)150 1839 y(load)26
+b(library)g(\014le)15 b Fd(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)41 b Fe(25)150 1948 y(load)26 b(pro)r(cedure,)g(tested)g(to)r(ols)7
+b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)32 b Fe(31)150 2058 y Ff(load_lib)27 b(")p
+Fc(library-\014le)t Ff(")15 b Fd(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40
+b Fe(25)150 2168 y(lo)r(cal)27 b(`)p Ff(site.exp)p Fe(')e
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47
+b Fe(19)150 2278 y(log)27 b(\014les,)f(where)g(to)g(write)7
+b Fd(.)13 b(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)g(.)h(.)f(.)g(.)h(.)32 b Fe(12)150 2388 y(Lupton,)25
+b(Rob)r(ert)10 b Fd(.)i(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36
+b Fe(43)150 2715 y Fu(M)150 2870 y Ff(make)27 b Fe(builds)e(part)h(of)g
+(tests)9 b Fd(.)k(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)35 b Fe(49)150 2980 y
+Ff(make)27 b(check)12 b Fd(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)38 b Fe(3)150 3090 y(master)25
+b(`)p Ff(site.exp)p Fe(')g Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48
+b Fe(18)150 3199 y(Menapace,)27 b(Julia)20 b Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fe(6)150
+3309 y Ff(mondfe)10 b Fd(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fe(32)150 3419
+y Ff(mondfe)p Fe(,)27 b(remote)f(testing)g(via)9 b Fd(.)j(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)34
+b Fe(11)150 3746 y Fu(N)150 3901 y Fe(name)25 b(\\DejaGn)n(u")c
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46
+b Fe(6)150 4011 y(name)25 b(for)h(remote)g(test)f(mac)n(hine)7
+b Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)32 b Fe(12)150 4121 y(name)25 b(transformations)15
+b Fd(.)e(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)41 b Fe(24)150 4231 y(name,)25
+b(initialization)j(mo)r(dule)13 b Fd(.)e(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fe(22)150
+4341 y(naming)25 b(con)n(v)n(en)n(tions)14 b Fd(.)e(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)40 b Fe(21)150 4450 y(naming)25 b(tests)h(to)g(run)14
+b Fd(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)40 b Fe(10)150 4560
+y(nativ)n(e)25 b(con\014guration)11 b Fd(.)j(.)e(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)37 b Fe(4)150 4670 y(nativ)n(e)25 b(con\014guration)i(test)8
+b Fd(.)k(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)33 b Fe(25)150 4780 y(net)n(w)n(ork)25
+b(\(IP\))h(pro)r(cedures)8 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34
+b Fe(27)150 4890 y Ff(NOTE)6 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)32 b Fe(9,)26
+b(24)150 5000 y Ff(note)h(")p Fc(string)6 b Ff(")g Fd(.)14
+b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)32
+b Fe(24)2025 84 y Fu(O)2025 217 y Ff(objdir)10 b Fd(.)j(.)f(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35
+b Fe(17)2025 316 y(ob)t(ject)26 b(directory)e Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)50 b Fe(12)2025
+416 y(Op)r(ening)25 b(a)h(remote)f(connection)15 b Fd(.)e(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40
+b Fe(26)2025 516 y(op)r(erating)26 b(principles)13 b
+Fd(.)g(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)39 b Fe(21)2025 615
+y(option)26 b(defaults)c Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)47 b Fe(17)2025 715 y(option)26 b(list,)g Ff(runtest)15
+b Fd(.)f(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 b Fe(9)2025
+814 y(options)7 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)33 b Fe(9)2025 914
+y(options)26 b(for)g Ff(runtest)p Fe(,)i(common)15 b
+Fd(.)c(.)h(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)41 b Fe(4)2025 1014 y(options,)26 b(Tcl)h(v)l(ariables)f(for)h
+(defaults)18 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+44 b Fe(17)2025 1113 y(order)26 b(of)g(tests)15 b Fd(.)e(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)41 b Fe(21)2025
+1213 y(Ousterhout,)25 b(John)h(K.)16 b Fd(.)c(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)42 b Fe(8)2025 1313 y Ff(outdir)10 b Fd(.)j(.)f(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35
+b Fe(17)2025 1412 y(output)24 b(directory)14 b Fd(.)f(.)g(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)40 b Fe(12)2025 1512 y(output)24
+b(\014les)10 b Fd(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)36 b Fe(35)2025 1612 y(output,)25 b(additional)e
+Fd(.)12 b(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fe(13)2025
+1711 y(o)n(v)n(erriding)26 b(`)p Ff(site.exp)p Fe(')f
+Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)49 b Fe(15)2025 1811 y(o)n(v)n(erview)20
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)46 b Fe(1)2025 2077 y Fu(P)2025 2210 y Ff(PASS)7
+b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)33 b Fe(6,)27 b(9)2025 2309 y Ff(pass)f(")p
+Fc(string)6 b Ff(")g Fd(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)32 b Fe(24)2025 2409 y(path)25 b(lo)r(okup)15
+b Fd(.)e(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41
+b Fe(28)2025 2509 y(pattern)25 b(matc)n(h,)g(directory)d
+Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)48 b Fe(28)2025 2608 y(pattern)25
+b(matc)n(h,)g(\014lenames)18 b Fd(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b
+Fe(28)2025 2708 y Ff(perror)27 b(")p Fc(string)33 b(n)n(um)n(b)r(er)5
+b Ff(")h Fd(.)11 b(.)h(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)32 b Fe(23)2025 2807 y(p)r(ersonal)26
+b(con\014g)g(`)p Ff(site.exp)p Fe(')12 b Fd(.)j(.)e(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)38
+b Fe(20)2025 2907 y Ff(pop_host)7 b Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fe(29)2025
+3007 y Ff(pop_target)24 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)48 b Fe(29)2025 3106 y(p)r(orting)26
+b(to)g(a)g(new)g(host)18 b Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)43
+b Fe(48)2025 3206 y(POSIX)24 b(conformance)e Fd(.)13
+b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48 b Fe(6)2025 3306 y
+Ff(prefix)p Fe(,)27 b(con\014gure)f(options)9 b Fd(.)j(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34
+b Fe(49)2025 3405 y(Prin)n(t)25 b(a)h(bac)n(ktrace)17
+b Fd(.)c(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)43 b Fe(31)2025
+3505 y(Prin)n(t)25 b(global)j(v)l(ariable)e(v)l(alues)14
+b Fd(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)40 b Fe(30)2025 3605 y(Prin)n(t)25 b(lo)r(cal)j(v)l(ariable)e
+(v)l(alue)15 b Fd(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)41 b Fe(30)2025 3704 y(Prin)n(t)25
+b(pro)r(cedure)h(b)r(o)r(dies)15 b Fd(.)e(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)40
+b Fe(30)2025 3804 y Ff(print)26 b Fd(var)d(.)12 b(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)39 b Fe(31)2025
+3904 y(Prin)n(t)25 b(w)n(atc)n(hp)r(oin)n(ts)8 b Fd(.)14
+b(.)e(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)34 b Fe(30)2025
+4003 y(Prin)n(ting)26 b(v)l(ariable)g(v)l(alues)21 b
+Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)47 b Fe(31)2025 4103 y(PRMS)25
+b(bug)h(n)n(um)n(b)r(er)17 b Fd(.)c(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)46
+b Fe(42)2025 4202 y Ff(prms_id)8 b Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b Fe(42)2025
+4302 y(problem,)25 b(detected)g(b)n(y)g(test)h(case)17
+b Fd(.)c(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+44 b Fe(9)2025 4402 y Ff(prune)26 b Fc(list)i(pattern)9
+b Fd(.)k(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35 b Fe(29)2025
+4501 y Ff(prune_system_crud)29 b Fc(system)c(text)d Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47
+b Fe(29)2025 4601 y(pruning)25 b(system)g(output,)g(examining)g
+(program)g(output)2193 4701 y Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)40
+b Fe(29)2025 4800 y Ff(psource)27 b Fc(\014lename)22
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 b Fe(28)2025
+4900 y Ff(push_host)27 b Fd(name)14 b(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)34 b Fe(29)2025 5000 y Ff(push_target)28
+b Fd(name)i(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)49 b Fe(29)p
+eop
+%%Page: 54 56
+54 55 bop 150 -116 a Fv(54)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 657 y Fu(Q)150 810
+y Ff(quit)13 b Fd(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fe(31)150 919
+y(Quiting)26 b(DejaGn)n(u)19 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)45 b Fe(31)150 1243 y Fu(R)150 1396 y Fe(ranlib)26
+b(a)g(\014le)8 b Fd(.)k(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)33 b Fe(30)150 1506 y Ff(reboot)10 b Fd(.)j(.)g(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35
+b Fe(17)150 1615 y(reb)r(o)r(oting)27 b(remote)e(targets)c
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)45 b Fe(12)150 1724 y(regular)27 b(expression,)f
+(\014le)g(con)n(ten)n(ts)18 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)44 b Fe(28)150 1833 y(remote)25
+b(connection)h(pro)r(cedures)8 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)33 b Fe(26)150 1942
+y(remote)25 b(connection,)i(ending)12 b Fd(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)38
+b Fe(27)150 2052 y(remote)25 b(test)h(mac)n(hine)f(name)11
+b Fd(.)h(.)g(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)37 b Fe(12)150 2161 y(remote)25 b(testb)r(ed,)h(connecting)
+g(to)8 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)34 b Fe(11)150 2270 y(remote)25 b(testing)13
+b Fd(.)g(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)39
+b Fe(32)150 2379 y(remote)25 b(testing)h(via)g Ff(kermit)21
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)45 b Fe(11)150 2488 y(remote)25 b(testing)h(via)g
+Ff(mondfe)21 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)g(.)h(.)f(.)45 b Fe(11)150 2597 y(remote)25
+b(testing)h(via)g Ff(rlogin)21 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)45 b Fe(11)150
+2707 y(remote)25 b(testing)h(via)g Ff(rsh)f Fd(.)12 b(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+49 b Fe(11)150 2816 y(remote)25 b(testing)h(via)g Ff(telnet)21
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)45 b Fe(11)150 2925 y(remote)25 b(testing)h(via)g
+Ff(tip)f Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)49 b Fe(11)150 3034
+y Ff(remote.exp)24 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)47 b Fe(26)150 3143 y Ff(remote_close)28
+b Fc(shellid)10 b Fd(.)j(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b
+Fe(27)150 3253 y Ff(remote_open)c Fc(t)n(yp)r(e)e Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)48 b Fe(26)150 3362
+y Ff(rlogin)27 b Fc(hostname)20 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)42 b Fe(27)150 3471 y Ff(rlogin)p Fe(,)27 b(remote)f(testing)g
+(via)9 b Fd(.)j(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)34 b Fe(11)150 3580 y Ff(rsh)26 b
+Fc(hostname)e Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+46 b Fe(27)150 3689 y Ff(rsh)p Fe(,)27 b(remote)e(testing)h(via)13
+b Fd(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)39 b Fe(11)150 3799 y(running)16
+b Fd(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)42 b Fe(9)150 3908 y(running)25 b(tests)17
+b Fd(.)c(.)f(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(3)150 4017 y Ff(runtest)27 b Fe(description)12 b
+Fd(.)h(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)38 b Fe(9)150
+4126 y Ff(runtest)27 b Fe(exit)f(co)r(de)8 b Fd(.)13
+b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34 b Fe(9)150
+4235 y Ff(runtest)27 b Fe(option)f(defaults)17 b Fd(.)c(.)f(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42
+b Fe(17)150 4344 y Ff(runtest)27 b Fe(option)f(list)7
+b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)33 b Fe(9)150
+4454 y Ff(runtest)p Fe(,)28 b(listing)e(options)21 b
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)45 b Fe(11)150 4563 y Ff(runtest)p
+Fe(,)28 b(most)d(common)f(options)16 b Fd(.)d(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)42 b Fe(4)150 4672
+y Ff(runtest)p Fe(,)28 b(v)l(ariable)e(defns)g(on)f(cmdline)12
+b Fd(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)37
+b Fe(10)150 4781 y Ff(runtest.exp)23 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46 b Fe(21)150 4890 y
+Ff(runtest_file_p)29 b Fc(run)n(tests)f(testcase)17 b
+Fd(.)d(.)e(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)39
+b Fe(29)150 5000 y Ff(runtests)7 b Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)32 b Fe(17)2025
+681 y Fu(S)2025 835 y Fe(searc)n(hing)26 b(\014le)g(con)n(ten)n(ts)13
+b Fd(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)39 b Fe(28)2025 945 y(selecting)27
+b(a)f(range)g(of)g(tests)15 b Fd(.)e(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)41 b Fe(10,)27 b(29)2025
+1054 y(selecting)g(tests)f(for)g(a)g(to)r(ol)16 b Fd(.)e(.)e(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42
+b Fe(10)2025 1164 y(serial)27 b(do)n(wnload,)g Ff(tip)22
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47 b Fe(27)2025 1274
+y(serial)27 b(line)f(connection,)g Ff(kermit)15 b Fd(.)f(.)f(.)f(.)g(.)
+h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 b
+Fe(27)2025 1383 y(serial)27 b(line)f(connection,)g Ff(tip)21
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)45 b Fe(27)2025 1493 y(set)26 b(curren)n(t)f(host)9
+b Fd(.)j(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)34
+b Fe(29)2025 1602 y(set)26 b(curren)n(t)f(target)15 b
+Fd(.)e(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)41 b Fe(29)2025
+1712 y Ff(set_warning_threshold)30 b Fc(threshold)20
+b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43
+b Fe(24)2025 1822 y Ff(setenv)27 b Fc(v)l(ar)j(v)l(al)10
+b Fd(.)i(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32
+b Fe(29)2025 1931 y(setting)26 b(defaults)g(for)h(DejaGn)n(u)f(v)l
+(ariables)17 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42
+b Fe(15)2025 2041 y(setting)26 b(en)n(vironmen)n(t)e(v)l(ariables)15
+b Fd(.)e(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+41 b Fe(29)2025 2150 y(setting)26 b(up)f(targets)12 b
+Fd(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)38 b Fe(22)2025
+2260 y Ff(setup_xfail)28 b(")p Fc(con\014g)k Fe([)p Fc(bugid)s
+Fe(])p Ff(")10 b Fd(.)j(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)36 b Fe(25)2025 2369 y Ff(site.exp)7 b
+Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)32 b Fe(15)2025 2479 y(`)p Ff(site.exp)p Fe(')c(for)e(all)h(of)
+f(DejaGn)n(u)13 b Fd(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)38 b Fe(18)2025 2589 y(`)p Ff(site.exp)p
+Fe(')28 b(for)e(eac)n(h)g(p)r(erson)8 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)34
+b Fe(20)2025 2698 y(`)p Ff(site.exp)p Fe(')28 b(for)e(eac)n(h)g(to)r
+(ol)17 b Fd(.)c(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fe(19)2025 2808 y(`)p
+Ff(site.exp)p Fe(',)28 b(m)n(ultiple)23 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)50 b Fe(15)2025 2917 y Ff(slay)26 b Fc(name)21 b
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+43 b Fe(28)2025 3027 y(sla)n(ying)26 b(pro)r(cesses)9
+b Fd(.)14 b(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)35
+b Fe(28)2025 3137 y(source)26 b(directory)d Fd(.)12 b(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)48 b Fe(12)2025 3246 y(sourcing)26
+b(Tcl)h(\014les)7 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+32 b Fe(28)2025 3356 y(sp)r(ecial)27 b(v)l(ariables)20
+b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45
+b Fe(42)2025 3465 y(sp)r(ecifying)26 b(target)h(name)18
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)44 b Fe(11)2025 3575 y(sp)r(ecifying)26
+b(the)g(build)f(con\014g)h(name)19 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)46 b Fe(11)2025 3685 y(sp)r(ecifying)26
+b(the)g(host)g(con\014g)f(name)17 b Fd(.)12 b(.)g(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42 b Fe(11)2025 3794 y(sp)r(ecifying)26
+b(the)g(target)g(con\014guration)d Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)48 b Fe(12)2025 3904 y Ff(srcdir)10 b
+Fd(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)35 b Fe(17)2025 4013 y(standard)25 b(conformance:)35
+b(POSIX)25 b(1003.3)17 b Fd(.)e(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44
+b Fe(6)2025 4123 y(start)26 b(pro)r(cedure,)g(tested)f(to)r(ols)16
+b Fd(.)e(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)42 b Fe(31)2025 4232 y(starting)26 b(in)n(teractiv)n(e)g(to)r(ols)f
+Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)49 b Fe(22)2025 4342 y(starting)26
+b(the)f(tcl)h(debugger)20 b Fd(.)13 b(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45 b Fe(13)2025
+4452 y Ff(subdir)10 b Fd(.)j(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35 b Fe(42)2025 4561
+y(success,)27 b(POSIX)d(de\014nition)f Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)49
+b Fe(6)2025 4671 y(successful)27 b(test)19 b Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)45
+b Fe(9)2025 4780 y(successful)27 b(test,)f(unexp)r(ected)c
+Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)50 b Fe(9)2025 4890 y(su\016x,)25 b Ff(expect)i
+Fe(scripts)12 b Fd(.)i(.)e(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)39
+b Fe(1)2025 5000 y(summary)23 b(log)e Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fe(35)p eop
+%%Page: 55 57
+55 56 bop 150 -116 a Fv(Index)3286 b(55)150 84 y Fu(T)150
+217 y Fe(target)26 b(con\014guration)h(test)10 b Fd(.)i(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)35
+b Fe(25)150 316 y(target)26 b(con\014guration,)h(sp)r(ecifying)d
+Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)49
+b Fe(12)150 416 y(target)26 b(dep)r(enden)n(t)f(pro)r(cedures)11
+b Fd(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)
+g(.)37 b Fe(31)150 516 y(target)26 b(mac)n(hine)f(name)10
+b Fd(.)i(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)36 b Fe(11)150 615 y(target,)27
+b(explained)8 b Fd(.)k(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)33
+b Fe(49)150 715 y Ff(target.exp)24 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47 b Fe(29)150 815 y
+Ff(target_triplet)16 b Fd(.)g(.)c(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+42 b Fe(17)150 914 y Ff(targetname)24 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47 b Fe(17)150 1014
+y(targets)12 b Fd(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)37 b Fe(32)150 1113 y(tcl)13
+b Fd(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)39 b Fe(8)150 1213
+y(tcl)26 b(debugger)11 b Fd(.)h(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+g(.)h(.)f(.)g(.)37 b Fe(13)150 1313 y(Tcl)27 b(v)l(ariables)f(for)g
+(option)g(defaults)8 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)33 b Fe(17)150 1412 y(Tcl)27 b(v)l(ariables,)f
+(de\014ning)f(for)i Ff(runtest)22 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)46 b Fe(10)150 1512 y Fc(tclv)l(ar)5
+b Ff(=)p Fc(v)l(alue)16 b Fd(.)d(.)g(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)38 b Fe(10)150 1612 y Ff(telnet)27
+b Fc(hostname)i(p)r(ort)24 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47
+b Fe(27)150 1711 y Ff(telnet)p Fe(,)27 b(remote)f(testing)g(via)9
+b Fd(.)j(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)h(.)34 b Fe(11)150 1811 y(terminating)25 b(remote)h(connection)
+10 b Fd(.)j(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)
+36 b Fe(27)150 1911 y(test)26 b(case)g(cannot)g(run)7
+b Fd(.)k(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)33 b Fe(9)150
+2010 y(test)26 b(case)g(messages)d Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)48 b Fe(9)150 2110 y(test)26 b(case)g(w)n(arnings)f
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)49 b Fe(9)150
+2210 y(test)26 b(case,)h(debugging)8 b Fd(.)k(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)33 b Fe(40)150 2309 y(test)26 b(case,)h(declaring)f(am)n(biguit)n
+(y)10 b Fd(.)i(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)36 b Fe(24)150 2409 y(test)26 b(case,)h(declaring)f(failure)17
+b Fd(.)d(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)43 b Fe(24)150 2508 y(test)26 b(case,)h(declaring)f(no)g
+(supp)r(ort)13 b Fd(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)38 b Fe(24)150 2608 y(test)26 b(case,)h(declaring)f(no)g
+(test)8 b Fd(.)k(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)33 b Fe(24)150 2708 y(test)26 b(case,)h(declaring)f
+(success)f Fd(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)49 b Fe(24)150 2807 y(test)26 b(case,)h(ERR)n(OR)d
+(in)12 b Fd(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)38 b Fe(23)150
+2907 y(test)26 b(case,)h(exp)r(ecting)e(failure)9 b Fd(.)14
+b(.)e(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)34 b Fe(25)150 3007 y(test)26 b(case,)h(informational)g
+(messages)8 b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)34 b Fe(24)150 3106 y(test)26 b(case,)h(W)-9 b(ARNING)24
+b(in)12 b Fd(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)h(.)f(.)g(.)h(.)f(.)38 b Fe(23)150 3206 y(test)26
+b(case,)h(W)-9 b(ARNING)24 b(threshold)16 b Fd(.)c(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)41 b Fe(24)150 3306
+y(test)26 b(case,)h(writing)c Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)48 b Fe(39)150 3405 y(test)26 b(cases,)h(debug)e(log)c
+Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)45 b Fe(11)150 3505
+y(test)26 b(directories,)h(naming)22 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48
+b Fe(21)150 3605 y(test)26 b(\014lename)c Fd(.)12 b(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)48 b Fe(21)150 3704 y(test)26
+b(output,)f(displa)n(ying)h(all)c Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)46 b Fe(10)150
+3804 y(test)26 b(programs,)g(auxiliary)16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)42
+b Fe(12)150 3903 y(test)26 b(suite)g(distributions)21
+b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)47 b Fe(49)150 4003 y(test,)26
+b(failing)12 b Fd(.)i(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)38 b Fe(9)150 4103 y(test,)26 b(successful)8
+b Fd(.)14 b(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)34
+b Fe(9)150 4202 y(test,)26 b(unresolv)n(ed)f(outcome)c
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)47 b Fe(9)150 4302 y(test,)26
+b(unsupp)r(orted)14 b Fd(.)d(.)i(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40
+b Fe(9)150 4402 y(tests,)26 b(running)6 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)32 b Fe(3)150 4501
+y(tests,)26 b(running)f(order)14 b Fd(.)f(.)f(.)h(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+39 b Fe(21)150 4601 y(tests,)26 b(running)f(sp)r(eci\014cally)e
+Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)48 b Fe(10,)26 b(29)150 4701 y(TET)10 b Fd(.)k(.)e(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)37
+b Fe(6)150 4800 y Ff(tip)26 b Fc(p)r(ort)c Fd(.)12 b(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45
+b Fe(27)150 4900 y Ff(tip)p Fe(,)27 b(remote)e(testing)h(via)13
+b Fd(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)39 b Fe(11)150 5000 y Ff(tip_download)28
+b Fc(spa)n(wnid)h(\014le)f Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)49 b Fe(27)2025 368
+y Ff(tool)13 b Fd(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)38 b Fe(17)2025 472
+y(to)r(ol)26 b(command)e(language)d Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)45
+b Fe(8)2025 576 y(to)r(ol)26 b(initialization)d Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)46 b Fe(22)2025
+681 y(to)r(ol)26 b(name,)g(as)g(installed)c Fd(.)12 b(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+46 b Fe(24)2025 785 y(to)r(ol)26 b(names)g(and)f(naming)g(con)n(v)n(en)
+n(tions)17 b Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)42
+b Fe(21)2025 889 y Fc(to)r(ol)s Ff(_exit)17 b Fd(.)d(.)f(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 b Fe(31)2025
+994 y Fc(to)r(ol)s Ff(_load)17 b Fd(.)d(.)f(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)43 b Fe(31)2025 1098
+y Fc(to)r(ol)s Ff(_start)16 b Fd(.)e(.)f(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)41 b Fe(31)2025 1202 y Fc(to)r(ol)s
+Ff(_version)13 b Fd(.)i(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)39 b Fe(32)2025 1307 y Ff(tracelevel)24 b Fd(.)12
+b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)48
+b Fe(17)2025 1411 y(tracing)26 b(Tcl)h(commands)22 b
+Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)50 b Fe(12)2025 1516 y Ff(transform)25
+b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+49 b Fe(22)2025 1620 y Ff(transform)27 b(")p Fc(to)r(olname)t
+Ff(")14 b Fd(.)g(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)40 b Fe(24)2025 1724
+y(transform)26 b(to)r(ol)g(name)19 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+45 b Fe(24)2025 1829 y(turning)25 b(on)h(output)d Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)50 b Fe(13)2025 2123
+y Fu(U)2025 2266 y Fe(unexp)r(ected)24 b(success)7 b
+Fd(.)14 b(.)e(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)34 b Fe(9)2025
+2370 y Ff(UNRESOLVED)17 b Fd(.)d(.)e(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)42 b Fe(7,)27 b(9)2025 2475 y Ff(unresolved)h(")p
+Fc(string)6 b Ff(")16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41
+b Fe(24)2025 2579 y(unset)25 b(curren)n(t)g(host)c Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)46 b Fe(29)2025 2684
+y(unset)25 b(curren)n(t)g(target)9 b Fd(.)k(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+34 b Fe(29)2025 2788 y Ff(unsetenv)27 b Fc(v)l(ar)17
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)37
+b Fe(29)2025 2892 y(unsetting)25 b(en)n(vironmen)n(t)f(v)l(ariables)9
+b Fd(.)k(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)35
+b Fe(29)2025 2997 y Ff(UNSUPPORTED)15 b Fd(.)g(.)d(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)41 b Fe(7,)27 b(9)2025 3101 y
+Ff(unsupported)h(")p Fc(string)6 b Ff(")14 b Fd(.)g(.)e(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+40 b Fe(24)2025 3205 y(unsupp)r(orted)24 b(test)6 b Fd(.)13
+b(.)g(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)33 b Fe(9)2025
+3310 y Ff(UNTESTED)21 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)g(.)h(.)f(.)g(.)h(.)45 b Fe(7,)27 b(9)2025 3414 y
+Ff(untested)g(")p Fc(string)6 b Ff(")20 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)44 b Fe(24)2025 3519 y(un)n(tested)25 b(prop)r(erties)f
+Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)50 b Fe(9)2025
+3623 y(utilities,)27 b(loading)g(from)e(init)h(\014le)15
+b Fd(.)d(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+40 b Fe(23)2025 3727 y Ff(utils.exp)25 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)49 b Fe(28)2025
+4022 y Fu(V)2025 4165 y Fe(v)l(ariables)26 b(for)h(all)f(tests)15
+b Fd(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)41 b Fe(42)2025 4269
+y(v)l(ariables)26 b(for)h(option)f(defaults)c Fd(.)12
+b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)47
+b Fe(17)2025 4373 y(v)l(ariables)26 b(of)h(DejaGn)n(u,)f(defaults)21
+b Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+46 b Fe(15)2025 4478 y Ff(verbose)8 b Fd(.)14 b(.)e(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)
+h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)34 b
+Fe(17)2025 4582 y Ff(verbose)27 b Fe([)p Ff(-log)p Fe(])g([)p
+Ff(-n)p Fe(])g([)p Ff(--)p Fe(])g Ff(")p Fc(string)6
+b Ff(")27 b Fc(n)n(um)n(b)r(er)21 b Fd(.)12 b(.)h(.)f(.)g(.)g(.)44
+b Fe(26)2025 4686 y Ff(verbose)27 b Fe(builtin)e(function)6
+b Fd(.)13 b(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)g(.)h(.)32 b Fe(26)2025 4791 y(v)n(ersion)26
+b(n)n(um)n(b)r(ers)18 b Fd(.)10 b(.)j(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)44 b Fe(13)2025 4895 y(v)n(ersion)26 b(pro)r(cedure,)g(tested)f(to)
+r(ols)14 b Fd(.)g(.)e(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)40 b Fe(32)2025 5000 y(VxW)-6 b(orks,)25 b(link)g(with)h(`)p
+Ff(-r)p Fe(')16 b Fd(.)d(.)f(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)41 b Fe(33)p eop
+%%Page: 56 58
+56 57 bop 150 -116 a Fv(56)2364 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 147 y Fu(W)150 282
+y Ff(WARNING)22 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)46 b Fe(9,)26 b(23)150 383 y Ff(warning)h(")p
+Fc(string)33 b(n)n(um)n(b)r(er)5 b Ff(")22 b Fd(.)12
+b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)48 b Fe(23)150 483 y(W)-6 b(atc)n(h)25 b(when)h(a)g(v)l(ariable)
+g(is)g(read)19 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)g(.)h(.)44 b Fe(30)150 584 y(W)-6 b(atc)n(h)25
+b(when)h(a)g(v)l(ariable)g(is)g(unset)19 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45 b Fe(30)150 685
+y(W)-6 b(atc)n(h)25 b(when)h(a)g(v)l(ariable)g(is)g(written)f
+Fd(.)12 b(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)50
+b Fe(30)150 785 y Ff(watchdel)27 b Fd(watch)j(.)13 b(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)48 b Fe(31)150 886 y Ff(watchread)28
+b Fd(var)16 b(.)d(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)33
+b Fe(30)150 987 y Ff(watchunset)28 b Fd(var)14 b(.)f(.)g(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)32 b Fe(30)150 1087 y Ff(watchwrite)c
+Fd(var)14 b(.)f(.)g(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)32
+b Fe(30)2025 90 y(What)25 b(is)h(New)17 b Fd(.)c(.)g(.)f(.)g(.)h(.)f(.)
+g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)44 b Fe(3)2025 189
+y Ff(which)26 b Fc(binary)21 b Fd(.)12 b(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)40 b Fe(28)2025 289 y(writing)26
+b(a)g(test)g(case)21 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)45
+b Fe(39)2025 556 y Fu(X)2025 688 y Ff(XFAIL)25 b Fd(.)12
+b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)
+g(.)50 b Fe(6,)27 b(9)2025 788 y(XF)-9 b(AIL,)25 b(a)n(v)n(oiding)h
+(for)h(POSIX)19 b Fd(.)13 b(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)47 b Fe(6)2025 888 y Ff(XFAIL)p
+Fe(,)27 b(pro)r(ducing)20 b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h
+(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)
+g(.)46 b Fe(25)2025 988 y Ff(XPASS)12 b Fd(.)h(.)g(.)f(.)g(.)h(.)f(.)g
+(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)
+f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)38
+b Fe(9)2025 1087 y Ff(XPASS)p Fe(,)27 b(pro)r(ducing)20
+b Fd(.)12 b(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)h(.)f
+(.)g(.)h(.)f(.)g(.)h(.)f(.)g(.)g(.)h(.)f(.)g(.)46 b Fe(25)p
+eop
+%%Page: -1 59
+-1 58 bop 3725 -116 a Fv(i)150 100 y Fs(T)-13 b(able)54
+b(of)g(Con)l(ten)l(ts)150 442 y Fu(1)135 b(What)45 b(is)g(DejaGn)l(u?)
+24 b Fb(.)19 b(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h
+(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)69 b Fu(1)150
+711 y(2)135 b(What)45 b(is)g(new)g(in)g(this)g(release)i(?)29
+b Fb(.)19 b(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)73
+b Fu(3)449 848 y Fv(2.1)92 b(Running)28 b(existing)h(tests)20
+b Fn(.)c(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g
+(.)49 b Fv(3)449 958 y(2.2)92 b(What)31 b(do)s(es)f(a)h(DejaGn)m(u)g
+(test)g(lo)s(ok)f(lik)m(e?)f Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)59 b Fv(5)449
+1068 y(2.3)92 b(Design)30 b(goals)23 b Fn(.)16 b(.)f(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)53 b Fv(5)449 1177 y(2.4)92 b(A)30 b(POSIX)g(conforming)f(test)
+j(framew)m(ork)25 b Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Fv(6)449
+1287 y(2.5)92 b(F)-8 b(uture)30 b(directions)17 b Fn(.)d(.)h(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+47 b Fv(8)449 1396 y(2.6)92 b(Tcl)30 b(and)f(Exp)s(ect)e
+Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)56 b Fv(8)150 1639 y Fu(3)135
+b(Using)45 b Fa(runtest)11 b Fb(.)16 b(.)k(.)f(.)h(.)f(.)h(.)f(.)g(.)h
+(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)
+h(.)f(.)g(.)56 b Fu(9)150 1909 y(4)135 b(Setting)46 b
+Fa(runtest)41 b Fu(defaults)26 b Fb(.)21 b(.)e(.)h(.)f(.)g(.)h(.)f(.)h
+(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)71 b Fu(15)748
+2046 y Fv(4.0.1)93 b(Con\014g)29 b(V)-8 b(ariables)17
+b Fn(.)d(.)h(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)46
+b Fv(15)748 2155 y(4.0.2)93 b(Master)31 b(Con\014g)f(File)13
+b Fn(.)h(.)i(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)43 b
+Fv(18)748 2265 y(4.0.3)93 b(Lo)s(cal)30 b(Con\014g)g(File)22
+b Fn(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51
+b Fv(19)748 2374 y(4.0.4)93 b(P)m(ersonal)30 b(Con\014g)g(File)24
+b Fn(.)15 b(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55 b Fv(20)150
+2617 y Fu(5)135 b(The)44 b(DejaGn)l(u)h(Implemen)l(tation)28
+b Fb(.)22 b(.)e(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)73
+b Fu(21)449 2754 y Fv(5.1)92 b(Con)m(v)m(en)m(tions)31
+b(for)f(using)f(to)s(ol)h(names)16 b Fn(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)45
+b Fv(21)449 2863 y(5.2)92 b(Initialization)28 b(mo)s(dule)d
+Fn(.)16 b(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+h(.)56 b Fv(22)449 2973 y(5.3)92 b(DejaGn)m(u)31 b(pro)s(cedures)14
+b Fn(.)g(.)h(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)44 b Fv(23)748 3083 y(5.3.1)93 b(Core)30 b(In)m(ternal)g(Pro)s
+(cedures)15 b Fn(.)e(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)44 b Fv(23)748 3192
+y(5.3.2)93 b(Remote)31 b(Comm)m(unication)e(Pro)s(cedures)14
+b Fn(.)g(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)43
+b Fv(26)748 3302 y(5.3.3)93 b(Utilit)m(y)29 b(Pro)s(cedures)21
+b Fn(.)14 b(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)50
+b Fv(28)748 3411 y(5.3.4)93 b(Cross)29 b(target)j(pro)s(cedure)17
+b Fn(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47 b Fv(29)748 3521 y(5.3.5)93
+b(Debugging)30 b(Pro)s(cedures)25 b Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+55 b Fv(30)449 3631 y(5.4)92 b(T)-8 b(arget)32 b(dep)s(enden)m(t)d(pro)
+s(cedures)13 b Fn(.)h(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)42
+b Fv(31)449 3740 y(5.5)92 b(Remote)32 b(targets)f(supp)s(orted)10
+b Fn(.)j(.)i(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)39
+b Fv(32)449 3850 y(5.6)92 b(The)30 b(\014les)f(DejaGn)m(u)i(reads)26
+b Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)55
+b Fv(34)449 3959 y(5.7)92 b(The)30 b(\014les)f(DejaGn)m(u)i(writes)11
+b Fn(.)j(.)h(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)40
+b Fv(35)748 4069 y(5.7.1)93 b(Summary)28 b(log)14 b Fn(.)i(.)f(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)43 b
+Fv(35)748 4178 y(5.7.2)93 b(Detailed)30 b(log)17 b Fn(.)e(.)g(.)h(.)f
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)47
+b Fv(36)748 4288 y(5.7.3)93 b(Logging)30 b Fr(expect)f
+Fv(in)m(ternal)g(actions)f Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)57 b Fv(36)150 4531 y Fu(6)135
+b(Ho)l(w)45 b(T)-11 b(o)45 b(W)-11 b(rite)45 b(a)h(T)-11
+b(est)44 b(Case)39 b Fb(.)19 b(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h
+(.)f(.)h(.)f(.)h(.)82 b Fu(39)449 4667 y Fv(6.1)92 b(W)-8
+b(riting)30 b(a)g(test)i(case)25 b Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)53 b Fv(39)449
+4777 y(6.2)92 b(Debugging)30 b(a)h(test)g(case)f Fn(.)15
+b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)58
+b Fv(40)449 4887 y(6.3)92 b(Adding)29 b(a)h(test)i(case)f(to)g(a)g
+(test)g(suite)19 b Fn(.)c(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)48 b Fv(40)449
+4996 y(6.4)92 b(Hin)m(ts)30 b(on)g(writing)f(a)h(test)i(case)22
+b Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)51
+b Fv(41)449 5106 y(6.5)92 b(Sp)s(ecial)29 b(v)-5 b(ariables)29
+b(used)g(b)m(y)h(test)i(cases)23 b Fn(.)15 b(.)g(.)g(.)h(.)f(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)52
+b Fv(42)p eop
+%%Page: -2 60
+-2 59 bop 150 -116 a Fv(ii)2402 b(DejaGn)m(u)32 b(T)-8
+b(esting)30 b(F)-8 b(ramew)m(ork)150 83 y Fu(7)135 b(New)45
+b(T)-11 b(o)t(ols,)45 b(T)-11 b(argets,)46 b(or)f(Hosts)23
+b Fb(.)e(.)e(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)68
+b Fu(43)449 220 y Fv(7.1)92 b(W)-8 b(riting)30 b(tests)h(for)f(a)h(new)
+e(to)s(ol)19 b Fn(.)d(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)48
+b Fv(43)449 330 y(7.2)92 b(Adding)29 b(a)h(target)17
+b Fn(.)g(.)e(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)46 b Fv(48)449 439 y(7.3)92 b(P)m(orting)30
+b(to)h(a)g(new)f(host)f Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g
+(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)58 b Fv(48)150 682 y Fu(App)t(endix)44
+b(A)134 b(Installing)46 b(DejaGn)l(u)29 b Fb(.)20 b(.)f(.)h(.)f(.)g(.)h
+(.)f(.)h(.)f(.)h(.)f(.)g(.)74 b Fu(49)449 819 y Fv(A.1)92
+b(Con\014guring)28 b(the)i(DejaGn)m(u)i(test)f(driv)m(er)9
+b Fn(.)k(.)j(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)38 b Fv(49)449 928 y(A.2)92 b(Installing)28
+b(DejaGn)m(u)10 b Fn(.)15 b(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)h
+(.)f(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)g(.)
+g(.)g(.)g(.)g(.)g(.)g(.)g(.)39 b Fv(49)150 1171 y Fu(Index)e
+Fb(.)19 b(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h
+(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)h(.)f(.)h(.)f(.)g(.)h(.)f(.)h(.)f(.)
+h(.)f(.)g(.)h(.)f(.)82 b Fu(51)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
diff --git a/contrib/bluegnu2.0.3/doc/dejagnu.texi b/contrib/bluegnu2.0.3/doc/dejagnu.texi
new file mode 100644
index 0000000..0d787fa
--- /dev/null
+++ b/contrib/bluegnu2.0.3/doc/dejagnu.texi
@@ -0,0 +1,3503 @@
+o\input texinfo @c -*- Texinfo -*-
+@finalout
+@setfilename dejagnu.info
+@c
+@c This file documents the GNU Testing Framework ``DejaGnu''
+@c
+@c Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+@c
+@c This text may be freely distributed under the terms of the GNU
+@c General Public License.
+@c
+
+@c FIXME---MAIN TODO LIST!
+@c
+@c * Revisit organization.
+@c
+@c * discuss Tcl/expect basics---enough to get started (see seminar notes).
+@c Maybe this would permit abbreviating appendices.
+
+@ifinfo
+@format
+START-INFO-DIR-ENTRY
+* DejaGnu: (dejagnu). The GNU testing framework.
+END-INFO-DIR-ENTRY
+@end format
+@end ifinfo
+
+@syncodeindex ky cp
+@syncodeindex fn cp
+
+@setchapternewpage odd
+@settitle DejaGnu Testing Framework
+@titlepage
+@title The DejaGnu Testing Framework
+@subtitle for DejaGnu Version 1.3
+@sp 1
+@subtitle Jan 1996
+@author Rob Savoye
+@page
+
+@tex
+{\parskip=0pt \hfill Cygnus Support}
+@end tex
+
+@vskip 0pt plus 1filll
+Copyright @copyright{} 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+@noindent
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided also that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions.
+@end titlepage
+
+@ifinfo
+Copyright @copyright{} 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+@ignore
+Permission is granted to process this file through TeX and print the
+results, provided the printed document carries a copying permission
+notice identical to this one except for the removal of this paragraph
+(this paragraph not being relevant to the printed manual).
+@end ignore
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided also that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions.
+
+@node Top
+@top DejaGnu
+
+DejaGnu is a framework for running test suites on software tools.
+
+This file describes version 1.3 of DejaGnu.
+
+@menu
+* Overview:: What is DejaGnu?
+* What is New:: What is new in this release.
+* Invoking runtest:: Using `runtest', the main test driver
+* Customizing:: Setting `runtest' defaults
+* Internals:: The DejaGnu implementation
+* Tests:: How to write a test case
+* Extending:: New tools, new targets, and new hosts
+* Installation:: Configuring and Installing DejaGnu
+* Index:: Index
+@end menu
+@end ifinfo
+
+@iftex
+@raggedbottom
+@end iftex
+
+@node Overview
+@chapter What is DejaGnu?
+@cindex overview
+
+DejaGnu is a framework for testing other programs. Its purpose is to
+provide a single front end for all tests. Beyond this, DejaGnu offers
+several advantages for testing:
+
+@enumerate
+@item
+The flexibility and consistency of the DejaGnu framework make it easy
+to write tests for any program.
+
+@item
+DejaGnu provides a layer of abstraction which allows you to write tests
+that are portable to any host or target where a program must be tested.
+For instance, a test for GDB can run (from any Unix based host) on any
+target architecture that DejaGnu supports. Currently DejaGnu runs tests
+on several single board computers, whose operating software ranges from
+just a boot monitor to a full-fledged, Unix-like realtime OS.
+
+@item
+All tests have the same output format. This makes it easy to integrate
+testing into other software development processes. DejaGnu's output is
+designed to be parsed by other filtering script, and it is also human
+readable.
+@end enumerate
+
+DejaGnu is written in @code{expect}, which in turn uses @dfn{Tcl}---Tool
+command language.
+
+@cindex @code{expect} script names
+@kindex .exp
+@cindex suffix, @code{expect} scripts
+Running tests requires two things: the testing framework, and the test
+suites themselves. Tests are usually written in @code{expect} using
+Tcl, but you can also use a Tcl script to run a test suite that is not
+based on @code{expect}. (@code{expect} script filenames conventionally
+use @samp{.exp} as a suffix; for example, the main implementation of the
+DejaGnu test driver is in the file @file{runtest.exp}.)
+
+
+@menu
+* Running Tests:: A first look at running DejaGnu tests
+* Sample Test:: What does a DejaGnu test case look like?
+* Design Goals:: Goals behind DejaGnu
+* Posix:: DejaGnu conforms to POSIX 1003.3
+* Future Directions:: Where is DejaGnu going?
+* Tcl and Expect:: Reading more about Tcl and Expect
+@end menu
+
+@node What is New
+@chapter What is new in this release ?
+@cindex What is New
+
+This release has a number of substantial changes over version 1.2. The
+most visible change is that the version of expect and Tcl included in
+the release are up-to-date with the current stable net releases. Other
+changes are:
+
+@enumerate
+@item
+@c FIXME: add a link to the config section
+The config sub-system in DejaGnu has been completely redesigned. It now
+supports testing on remote hosts as well as remote targets.
+
+@item
+More builtin support for building target binaries with the correct
+linker flags. Currently this only works with GCC, preferably with a
+target support by @code{libgloss}.
+
+@item
+Lots of little bug fixes from a year of heavy use here at Cygnus
+Support.
+
+@item
+DejaGnu now uses @code{autoconf} for configuration.
+
+@item
+New test cases for DejaGnu have been added for the new features, plus
+the "--tool" option bug in the 1.2 testsuite has been fixed.
+
+@item
+The @code{--tool} option is now optional.
+
+@item
+@code{runtest} when searching for test drivers ignores all directories
+named SCCS, RCS, and CVS.
+
+@item
+There is now a generic keyword based test harness that uses comments in
+source code to control how each test case gets built and run.
+
+@item
+There is now some support for running a testsuite with multiple passes.
+
+@end enumerate
+
+@node Running Tests
+@section Running existing tests
+@cindex existing tests, running
+@cindex running tests
+@cindex tests, running
+
+@kindex make check
+To run tests from an existing collection, first use @code{configure} as
+usual to set up the source directory containing the tests. Then try
+running
+
+@example
+make check
+@end example
+
+@cindex @code{check} makefile target
+If the @code{check} target exists, it usually saves you some
+trouble---for instance, it can set up any auxiliary programs or other
+files needed by the tests.
+
+@cindex auxiliary files, building
+Once you have run @samp{make check} to build any auxiliary files, you
+might want to call the test driver @code{runtest} directly to repeat the
+tests. You may also have to call @code{runtest} directly for test
+collections with no @code{check} target in the @file{Makefile}.
+
+@c force page break to avoid losing footnote to another page
+@page
+@cindex @code{runtest}, most common options
+@cindex options for @code{runtest}, common
+Typically, you must use two command-line options: @samp{--tool}, to
+specify which set of tests to run@footnote{@samp{--tool} selects a
+particular suite of tests, @emph{not} the name of the executable program
+to run. @xref{Config Values,,Configuration dependent values}, for
+information on the variables that you can use to specify the names of
+programs to run.}, and @samp{--srcdir}, to specify where to find test
+directories.
+
+For example, if the directory @file{gdb/testsuite} contains a collection
+of DejaGnu tests for @sc{gdb}, you can run them like this:
+
+@example
+eg$ cd gdb/testsuite
+eg$ runtest --tool gdb
+@exdent @emph{Test output follows, ending with:}
+
+ === gdb Summary ===
+
+# of expected passes 508
+# of expected failures 103
+/usr/latest/bin/gdb version 4.14.4 -nx
+@end example
+
+You can use the option @samp{--srcdir} to point to some other directory
+containing a collection of tests:
+
+@smallexample
+eg$ runtest --tool gdb --srcdir /devo/gdb/testsuite
+@end smallexample
+
+@cindex native configuration
+@cindex cross configuration
+These examples assume a @dfn{native} configuration, where the same
+computer runs both @code{runtest} and the tests themselves. When you
+have a @dfn{cross} configuration, the tests run on a different computer,
+controlled by the host running @code{runtest}. In this situation, you
+need the option @samp{--name} to specify the network address for the
+other computer:
+
+@smallexample
+eg$ runtest --tool gdb --name vx9.munist.com
+@end smallexample
+
+If you always use the same option values, you can record them in a file
+called @file{site.exp}, rather than typing them each time. @xref{Config
+Values,,Setting defaults for @code{runtest} options}.
+
+By default, @code{runtest} prints only the names of the tests it runs,
+output from any tests that have unexpected results, and a summary
+showing how many tests passed and how many failed. To display output
+from all tests (whether or not they behave as expected), use the
+@samp{--all} option. For more verbose output about processes being run,
+communication, and so on, use @samp{--verbose}. To see even more output,
+use multiple @samp{--verbose} options. @xref{Invoking runtest,,Using
+@code{runtest}}, for a more detailed explanation of each @code{runtest}
+option.
+
+Test output goes into two files in your current directory: summary
+output in @file{@var{tool}.sum}, and detailed output in
+@file{@var{tool}.log}. (@var{tool} refers to the collection of tests;
+for example, after a run with @samp{--tool gdb}, look for output files
+@file{gdb.sum} and @file{gdb.log}.) @xref{Output Files,,The files
+DejaGnu writes}.
+
+@node Sample Test
+@section What does a DejaGnu test look like?
+
+@cindex example
+Each DejaGnu test is an @code{expect} script; the tests vary widely in
+complexity, depending on the nature of the tool and the feature tested.
+
+@kindex gdb.t00/echo.exp
+@kindex echo.exp
+Here is a very simple @sc{gdb} test---one of the simplest tests shipped
+with DejaGnu (extracted from @file{gdb.t00/echo.exp}):@footnote{More
+recent @sc{gdb} tests use the @samp{gdb_test} procedure.
+An equivalent test using that procedure is @samp{ gdb_test "echo Hello
+world!" "Hello world!" }}
+@c FIXME! include xref in footnote, when gdb_test documented in some manual.
+@c @xref{}.
+@c Extra spaces in @samp above avoid running end ' against " inside.
+
+@cartouche
+@smallexample
+# send a string to the GDB stdin:
+send "echo Hello world!\n"
+
+# inspect the GDB stdout for the correct reply,
+# and determine whether the test passes or fails:
+expect @{
+ -re "Hello world.*$prompt $" @{ pass "Echo test" @}
+ -re "$prompt $" @{ fail "Echo test" @}
+ timeout @{ fail "(timeout) Echo test" @}
+ @}
+@end smallexample
+@end cartouche
+
+Though brief, this example is a complete test. It illustrates some of
+the main features of DejaGnu test scripts:
+
+@itemize @bullet
+@item
+The test case does not start the tested program (@sc{gdb} in this case);
+all test scripts for interactive tools can assume the corresponding tool
+is running.
+
+@item
+Comments start with @samp{#}.
+
+@item
+The main commands you use to control a tested program are @code{send}
+(to give it commands) and @code{expect} (to analyze its responses).
+
+@item
+The @code{expect} command uses a list of pairs; a pattern (regular
+expression if @samp{-re} specified), followed by an action to run if the
+pattern matches output from the program. Only the action for the
+@emph{first} matching pattern will execute.
+
+@item
+Test cases use the commands @code{pass} and @code{fail} to record the
+test outcome.
+@end itemize
+
+@node Design Goals
+@section Design goals
+@cindex design goals
+
+DejaGnu grew out of the internal needs of Cygnus Support. Cygnus
+maintains and enhances a variety of free programs in many different
+environments, and we needed a testing tool that:
+
+@itemize @bullet
+@item
+is useful to developers while fixing bugs;
+
+@item
+automates running many tests during a software release process;
+
+@item
+is portable among a variety of host computers;
+
+@item
+supports cross-development testing;
+
+@item
+permits testing interactive programs, like @sc{gdb}; and
+
+@item
+permits testing batch oriented programs, like @sc{gcc}.
+@end itemize
+
+Some of the requirements proved challenging. For example, interactive
+programs do not lend themselves very well to automated testing. But all
+the requirements are important: for instance, it is imperative to make
+sure that @sc{gdb} works as well when cross-debugging as it does in a
+native configuration.
+
+Probably the greatest challenge was testing in a cross-development
+environment (which can be a real nightmare). Most cross-development
+environments are customized by each developer. Even when buying
+packaged boards from vendors there are many differences. The
+communication interfaces vary from a serial line to ethernet. DejaGnu
+was designed with a modular communication setup, so that each kind of
+communication can be added as required, and supported thereafter. Once
+a communication procedure is coded, any test can use it. Currently
+DejaGnu can use @code{rsh}, @code{rlogin}, @code{telnet}, @code{tip},
+@code{kermit}, and @code{mondfe} for remote communications.
+
+@cindex name ``DejaGnu''
+@cindex DejaGnu, the name
+@cindex Menapace, Julia
+Julia Menapace first coined the term ``Deja Gnu'' to describe an earlier
+testing framework at Cygnus Support. When we replaced it with the
+Expect-based framework, it was like DejaGnu all over again@dots{}
+
+@node Posix
+@section A POSIX conforming test framework
+
+@cindex POSIX conformance
+@cindex standard conformance: POSIX 1003.3
+DejaGnu conforms to the @sc{posix} standard for test frameworks.
+
+@cindex TET
+@sc{posix} standard 1003.3 defines what a testing framework needs to
+provide, in order to permit the creation of @sc{posix} conformance
+test suites. This standard is primarily oriented to running @sc{posix}
+conformance tests, but its requirements also support testing of features
+not related to @sc{posix} conformance. @sc{posix} 1003.3 does not
+specify a particular testing framework, but at this time there is only
+one other @sc{posix} conforming test framework:
+@sc{tet}.@footnote{@sc{tet} was created by Unisoft for a consortium
+comprised of X/Open, Unix International, and the Open Software
+Foundation.}
+
+The @sc{posix} documentation refers to @dfn{assertions}. An assertion
+is a description of behavior. For example, if a standard says ``The sun
+shall shine'', a corresponding assertion might be ``The sun is
+shining.'' A test based on this assertion would pass or fail depending
+on whether it is daytime or nighttime. It is important to note that the
+standard being tested is never 1003.3; the standard being tested is some
+other standard, for which the assertions were written.
+
+As there is no test suite to test @emph{testing frameworks} for
+@sc{posix} 1003.3 conformance, verifying conformance to this standard is
+done by repeatedly reading the standard and experimenting. One of the
+main things 1003.3 does specify is the set of allowed output messages,
+and their definitions. Four messages are supported for a required
+feature of @sc{posix} conforming systems, and a fifth for a conditional
+feature. DejaGnu supports the use of all five output messages; in this
+sense a test suite that uses exactly these messages can be considered
+@sc{posix} conforming. These definitions specify the output of a test
+case:
+
+@ftable @code
+@cindex success, POSIX definition
+@item PASS
+A test has succeeded. That is, it demonstrated that the assertion is true.
+
+@cindex XFAIL, avoiding for POSIX
+@item XFAIL
+@sc{posix} 1003.3 does not incorporate the notion of expected failures,
+so @code{PASS}, instead of @code{XPASS}, must also be returned for test
+cases which were expected to fail and did not. This means that
+@code{PASS} is in some sense more ambiguous than if @code{XPASS} is also
+used. For information on @code{XPASS} and @code{XFAIL}, see
+@ref{Invoking runtest,,Using @code{runtest}}.
+
+@item FAIL
+@cindex failure, POSIX definition
+A test @emph{has} produced the bug it was intended to capture. That is,
+it has demonstrated that the assertion is false. The @code{FAIL}
+message is based on the test case only. Other messages are used to
+indicate a failure of the framework.
+
+As with @code{PASS}, @sc{posix} tests must return @code{FAIL} rather
+than @code{XFAIL} even if a failure was expected.
+
+@item UNRESOLVED
+@cindex ambiguity, required for POSIX
+A test produced indeterminate results. Usually, this means the test
+executed in an unexpected fashion; this outcome requires that a human
+being go over results, to determine if the test should have passed or
+failed. This message is also used for any test that requires human
+intervention because it is beyond the abilities of the testing
+framework. Any unresolved test should resolved to @code{PASS} or
+@code{FAIL} before a test run can be considered finished.
+
+Note that for @sc{posix}, each assertion must produce a test result
+code. If the test isn't actually run, it must produce @code{UNRESOLVED}
+rather than just leaving that test out of the output. This means that
+you have to be careful when writing tests, to not carelessly use tcl
+statements like @code{return}---if you alter the flow of control of the
+tcl code you must insure that every test still produces some result code.
+
+Here are some of the ways a test may wind up @code{UNRESOLVED}:
+
+@itemize @bullet
+@item
+A test's execution is interrupted.
+
+@item
+A test does not produce a clear result. This is usually because there
+was an @code{ERROR} from DejaGnu while processing the test, or because there
+were three or more @code{WARNING} messages. Any @code{WARNING} or
+@code{ERROR} messages can invalidate the output of the test. This
+usually requires a human being to examine the output to
+determine what really happened---and to improve the test case.
+
+@item
+A test depends on a previous test, which fails.
+
+@item
+The test was set up incorrectly.
+@end itemize
+
+@item UNTESTED
+A test was not run. This is a placeholder, used when there is no
+real test case yet.
+@end ftable
+
+@noindent
+The only remaining output message left is intended to test features that
+are specified by the applicable @sc{posix} standard as conditional:
+
+@ftable @code
+@item UNSUPPORTED
+There is no support for the tested case. This may mean that a
+conditional feature of an operating system, or of a compiler, is not
+implemented. DejaGnu also uses this message when a testing environment
+(often a ``bare board'' target) lacks basic support for compiling or
+running the test case. For example, a test for the system subroutine
+@code{gethostname} would never work on a target board running only a
+boot monitor.
+@end ftable
+
+DejaGnu uses the same output procedures to produce these messages for
+all test suites, and these procedures are already known to conform to
+@sc{posix} 1003.3. For a DejaGnu test suite to conform to @sc{posix}
+1003.3, you must avoid the @code{setup_xfail} procedure as described in
+the @code{PASS} section above, and you must be careful to return
+@code{UNRESOLVED} where appropriate, as described in the
+@code{UNRESOLVED} section above.
+
+@node Future Directions
+@section Future directions
+@cindex future directions
+
+In the near future, there are two parallel directions for DejaGnu
+development. The first is to add support for more hosts and targets.
+
+The second would permit testing programs with a more complex interface,
+whether text based or GUI based. Two components already exist: a Tcl
+based X window toolkit, and a terminal package for @code{expect}. Both
+of these could be merged into DejaGnu in a way that permits testing
+programs that run in each environment.
+
+Meanwhile, we hope DejaGnu enables the creation of test suites for
+conformance to @sc{ansi} C and C++, to @sc{posix}, and to other
+standards. We encourage you to make any test suites you create freely
+available, under the same terms as DejaGnu itself.
+
+@node Tcl and Expect
+@section Tcl and Expect
+@cindex tool command language
+@cindex tcl
+@cindex Ousterhout, John K.
+Tcl was introduced in a paper by John K. Ousterhout at the 1990 Winter
+Usenix conference, @cite{Tcl: An Embeddable Command Language}. That
+paper is included in PostScript form in the @file{doc} subdirectory of
+the Tcl distribution. The version of Tcl included in DejaGnu at this time is
+Tcl 7.4p3.
+
+@cindex @code{expect} scripting language
+@cindex Libes, Don
+Don Libes introduced @code{expect} in his paper @cite{expect: Curing
+Those Uncontrollable Fits of Interaction} at the 1990 Summer Usenix
+conference. The paper is included in PostScript form in the
+@code{expect} distribution (as are several other papers about
+@code{expect}). The version of expect included in DejaGnu at this time
+is expect 5.18.0.
+
+@node Invoking runtest
+@chapter Using @code{runtest}
+@cindex invoking
+@cindex running
+@cindex command line options
+@cindex options
+
+@cindex @code{runtest} description
+@cindex DejaGnu test driver
+@code{runtest} is the executable test driver for DejaGnu. You can
+specify two kinds of things on the @code{runtest} command line: command
+line options, and Tcl variables for the test scripts. The options are
+listed alphabetically below.
+
+@cindex exit code from @code{runtest}
+@cindex @code{runtest} exit code
+@code{runtest} returns an exit code of @code{1} if any test
+has an unexpected result; otherwise (if all tests pass or fail as
+expected) it returns @code{0} as the exit code.
+
+@code{runtest} flags the outcome of each test as one of these cases.
+(@xref{Posix,,A POSIX conforming test framework}, for a discussion of
+how @sc{posix} specifies the meanings of these cases.)
+
+@table @code
+@item PASS
+@kindex PASS
+@cindex successful test
+@cindex test, successful
+The most desirable outcome: the test succeeded, and was expected to
+succeed.
+
+@item XPASS
+@kindex XPASS
+@cindex successful test, unexpected
+@cindex unexpected success
+A pleasant kind of failure: a test was expected to fail, but succeeded.
+This may indicate progress; inspect the test case to determine whether
+you should amend it to stop expecting failure.
+
+@item FAIL
+@kindex FAIL
+@cindex failing test, unexpected
+@cindex test, failing
+A test failed, although it was expected to succeed. This may indicate
+regress; inspect the test case and the failing software to locate the bug.
+
+@item XFAIL
+@kindex XFAIL
+@cindex expected failure
+@cindex failing test, expected
+A test failed, but it was expected to fail. This result indicates no
+change in a known bug. If a test fails because the operating system
+where the test runs lacks some facility required by the test, the
+outcome is @code{UNSUPPORTED} instead.
+
+@item UNRESOLVED
+@kindex UNRESOLVED
+@cindex test, unresolved outcome
+Output from a test requires manual inspection; the test suite could not
+automatically determine the outcome. For example, your tests can report
+this outcome is when a test does not complete as expected.
+
+@item UNTESTED
+@kindex UNTESTED
+@cindex untested properties
+A test case is not yet complete, and in particular cannot yet produce a
+@code{PASS} or @code{FAIL}. You can also use this outcome in dummy
+``tests'' that note explicitly the absence of a real test case
+for a particular property.
+
+@item UNSUPPORTED
+@kindex UNSUPPORTED
+@cindex unsupported test
+@cindex test, unsupported
+A test depends on a conditionally available feature that does not exist
+(in the configured testing environment). For example, you can use this
+outcome to report on a test case that does not work on a particular
+target because its operating system support does not include a required
+subroutine.
+@end table
+
+@code{runtest} may also display the following messages:
+
+@table @code
+@item ERROR
+@kindex ERROR
+@cindex problem, detected by test case
+@cindex test case cannot run
+Indicates a major problem (detected by the test case itself) in running
+the test. This is usually an unrecoverable error, such as a missing file
+or loss of communication to the target. (@sc{posix} test suites should
+not emit this message; use @code{UNSUPPORTED}, @code{UNTESTED}, or
+@code{UNRESOLVED} instead, as appropriate.)
+
+@item WARNING
+@kindex WARNING
+@cindex test case warnings
+Indicates a possible problem in running the test. Usually warnings
+correspond to recoverable errors, or display an important message about
+the following tests.
+
+@item NOTE
+@kindex NOTE
+@cindex test case messages
+An informational message about the test case.
+@end table
+
+This is the full set of command line options that @code{runtest}
+recognizes. Arguments may be abbreviated to the shortest unique string.
+
+@cindex @code{runtest} option list
+@cindex option list, @code{runtest}
+@smallexample
+runtest --tool @var{tool} [ @var{testsuite}.exp @dots{} ]
+[ @var{testsuite}.exp="testfile1 @dots{}" ]
+[ @var{tclvar}=@var{value}@dots{} ]
+[ --all ] [ --baud @var{baud-rate} ] [ --connect @var{type} ]
+[ --debug ] [ --help ] [ --host @var{string} ]
+[ --mail "@var{name} @dots{}" ] [ --name @var{string} ]
+[ --name @var{name} ] [ --outdir @var{path} ]
+[ --objdir @var{path} ] [ --reboot ]
+[ --srcdir @var{path} ] [ --strace @var{n} ]
+[ --target @var{string} --build @var{string} ]
+[ -v | --verbose ] [ -V | --version ] [ --D@var{n} ]
+@end smallexample
+
+@table @code
+@item --tool @var{tool}
+@cindex selecting tests for a tool
+@cindex @code{--tool} (@code{runtest} option)
+@var{tool} specifies what set of tests to run, and what initialization
+module to use. @var{tool} is used @emph{only} for these two purposes:
+it is @emph{not} used to name the executable program to test.
+Executable tool names (and paths) are recorded in @file{site.exp}
+(@pxref{Config Values,,Configuration dependent values}), and you can
+override them by specifying Tcl variables on the command line.
+
+For example, including @samp{--tool gcc} on the @code{runtest} command
+line runs tests from all test subdirectories whose names match
+@file{gcc.*}, and uses one of the initialization modules named
+@file{config/*-gcc.exp}. To specify the name of the compiler (perhaps
+as an alternative path to what @code{runtest} would use by default), use
+@samp{GCC=@var{binname}} on the @code{runtest} command line.
+
+@item @var{testsuite}.exp @dots{}
+@cindex selecting a range of tests
+@cindex tests, running specifically
+@cindex naming tests to run
+Specify the names of testsuites to run.
+By default, @code{runtest} runs all tests for the tool, but you can
+restrict it to particular testsuites by giving the names of the @samp{.exp}
+@code{expect} scripts that control them.
+
+@var{testsuite}.exp may not include path information; use plain filenames.
+
+@item @var{testfile}.exp="testfile1 @dots{}"
+@cindex selecting a range of tests
+@cindex tests, running specifically
+@cindex naming tests to run
+Specify a subset of tests in a suite to run.
+For compiler or assembler tests, which often use a single @samp{.exp}
+script covering many different source files, this option allows you to
+further restrict the tests by listing particular source files to compile.
+Some tools even support wildcards here. The wildcards supported depend
+upon the tool, but typically they are @code{?}, @code{*}, and @code{[chars]}.
+
+@item @var{tclvar}=@var{value}
+@kindex @var{tclvar}=@var{value}
+@cindex Tcl variables, defining for @code{runtest}
+@cindex command line Tcl variable definition
+@cindex @code{runtest}, variable defns on cmdline
+You can define Tcl variables for use by your test scripts in the same
+style used with @code{make} for environment variables. For example,
+@samp{runtest GDB=gdb.old} defines a variable called @samp{GDB}; when
+your scripts refer to @samp{$GDB} in this run, they use the value
+@samp{gdb.old}.
+
+The default Tcl variables used for most tools are defined in the main
+DejaGnu @code{Makefile}; their values are captured in the
+@file{site.exp} file. @xref{Config Values,,Configuration dependent
+values}.
+
+@item --all
+@cindex @code{--all} (@code{runtest} option)
+@cindex test output, displaying all
+Display all test output. By default, @code{runtest} shows only the
+output of tests that produce unexpected results; that is, tests with
+status @samp{FAIL} (unexpected failure), @samp{XPASS} (unexpected
+success), or @samp{ERROR} (a severe error in the test case itself).
+Specify @samp{--all} to see output for tests with status @samp{PASS}
+(success, as expected) @samp{XFAIL} (failure, as expected), or
+@samp{WARNING} (minor error in the test case itself).
+
+@item --baud @var{baud-rate}
+@itemx -b @var{baud-rate}
+@cindex baud rate, specifying
+@cindex bps, specifying
+@cindex @code{--baud} (@code{runtest} option)
+@cindex @code{-b} (@code{runtest} option)
+Set the default baud rate to something other than 9600. (Some serial
+interface programs, like @code{tip}, use a separate initialization file
+instead of this value.)
+
+@item --connect @var{type}
+@cindex connecting to target
+@cindex @code{--connect} (@code{runtest} option)
+@cindex remote testbed, connecting to
+@cindex @code{rlogin}, remote testing via
+@cindex @code{telnet}, remote testing via
+@cindex @code{rsh}, remote testing via
+@cindex @code{tip}, remote testing via
+@cindex @code{kermit}, remote testing via
+@cindex @code{mondfe}, remote testing via
+@cindex remote testing via @code{rlogin}
+@cindex remote testing via @code{telnet}
+@cindex remote testing via @code{rsh}
+@cindex remote testing via @code{tip}
+@cindex remote testing via @code{kermit}
+@cindex remote testing via @code{mondfe}
+Connect to a target testing environment as specified by @var{type}, if
+the target is not the computer running @code{runtest}. For example, use
+@samp{--connect} to change the program used to connect to a ``bare
+board'' boot monitor. The choices for @var{type} in the DejaGnu 1.0
+distribution are @samp{rlogin}, @samp{telnet}, @samp{rsh}, @samp{tip},
+@samp{kermit}, and @samp{mondfe}.
+
+@noindent
+The default for this option depends on the configuration (@pxref{Cross
+Targets,,Remote targets supported}). The default is chosen to be the
+most convenient communication method available, but often other
+alternatives work as well; you may find it useful to try alternative
+connect methods if you suspect a communication problem with your testing
+target.
+
+@item --debug
+@cindex @code{--debug} (@code{runtest} option)
+@cindex debug log for test cases
+@cindex test cases, debug log
+@cindex @code{dbg.log} file
+Turns on the @code{expect} internal debugging output. Debugging output
+is displayed as part of the @code{runtest} output, and logged to a file
+called @file{dbg.log}. The extra debugging output does @emph{not}
+appear on standard output, unless the verbose level is greater than 2
+(for instance, to see debug output immediately, specify @samp{--debug -v
+-v}). The debugging output shows all attempts at matching the test
+output of the tool with the scripted patterns describing expected
+output. The output generated with @samp{--strace} also goes into
+@file{dbg.log}.
+
+@item --help
+@itemx -he
+@cindex @code{--help} (@code{runtest} option)
+@cindex help with @code{runtest}
+@cindex @code{runtest}, listing options
+Prints out a short summary of the @code{runtest} options, then exits
+(even if you also specify other options).
+
+@item --host @var{string}
+@cindex @code{--host} (@code{runtest} option)
+@cindex specifying the host config name
+@cindex host config name, changing
+@var{string} is a full configuration ``triple'' name as used by
+@code{configure}. Use this option to override the default string
+recorded by your configuration's choice of host. This choice does not
+change how anything is actually configured unless --build is also
+specified; it affects @emph{only} DejaGnu procedures that compare the
+host string with particular values. The procedures @code{ishost},
+@code{istarget}, @code{isnative}, and @code{setup_xfail} are affected by
+@samp{--host}. In this usage, @code{host} refers to the machine that the
+tests are to be run on, which may not be the same as the @code{build}
+machine. If @code{--build} is also specified, then @code{--host} refers
+to the machine that the tests wil, be run on, not the machine DejaGnu is
+run on.
+
+@item --build @var{string}
+@cindex @code{--build} (@code{runtest} option)
+@cindex specifying the build config name
+@cindex build config name, changing
+@var{string} is a full configuration ``triple'' name as used by
+@code{configure}. This is the type of machine DejaGnu and the tools to
+be tested are built on. For a normal cross this is the same as the host,
+but for a canadian cross, they are seperate.
+
+@item --name @var{name}
+@cindex specifying target name
+@cindex target machine name
+@cindex @code{--name} (@code{runtest} option)
+@var{name} is a name for the particular testing target machine (for
+cross testing). If the testing target has IP network support (for
+example, @code{RPC} or @code{NFS}), this is the network name for the
+target itself. (@var{name} is @emph{not the configuration string} you
+specify as a target with @code{configure}; the @samp{--name} option
+names a particular target, rather than describing a class of targets.)
+For targets that connect in other ways, the meaning of the @var{name}
+string depends on the connection method. @xref{Cross Targets,,Remote
+targets supported}.
+
+@item --name @var{string}
+@cindex remote test machine name
+@cindex name for remote test machine
+Specify a network name of testing target or its host. The particular
+names that are meaningful with @samp{--name} will depend on your site
+configuration, and on the connection protocol: for example, @code{tip}
+connections require names from a serial line configuration file (usually
+called @file{/etc/remote}), while @code{telnet} connections use IP
+hostnames.
+
+@item --objdir @var{path}
+@cindex @code{--objdir} (@code{runtest} option)
+@cindex object directory
+@cindex test programs, auxiliary
+@cindex auxiliary test programs
+Use @var{path} as the top directory containing any auxiliary compiled
+test code. This defaults to @file{.}. Use this option to locate
+pre-compiled test code. You can normally prepare any auxiliary files
+needed with @code{make}.
+
+@item --outdir @var{path}
+@cindex output directory
+@cindex @code{--outdir} (@code{runtest} option)
+@cindex log files, where to write
+Write output logs in directory @var{path}. The default is @samp{.}, the
+directory where you start @code{runtest}. This option affects only the
+summary and the detailed log files @file{@var{tool}.sum} and
+@file{@var{tool}.log}. The DejaGnu debug log @file{dbg.log} always
+appears (when requested) in the local directory.
+
+@item --reboot
+@cindex rebooting remote targets
+@cindex @code{--reboot} (@code{runtest} option)
+Reboot the target board when @code{runtest} initializes.
+Usually, when running tests on a separate target board, it is safer to
+reboot the target to be certain of its state. However, when developing
+test scripts, rebooting takes a lot of time.
+
+@item --srcdir @var{path}
+@cindex source directory
+@cindex @code{--srcdir} (@code{runtest} option)
+Use @var{path} as the top directory for test scripts to run.
+@code{runtest} looks in this directory for any subdirectory whose name
+begins with the toolname (specified with @samp{--tool}). For instance,
+with @samp{--tool gdb}, @code{runtest} uses tests in subdirectories
+@file{gdb.*} (with the usual shell-like filename expansion). If you do
+not use @samp{--srcdir}, @code{runtest} looks for test directories under
+the current working directory.
+
+@item --strace @var{n}
+@cindex @code{--strace} (@code{runtest} option)
+@cindex tracing Tcl commands
+@cindex @code{expect} internal tracing
+Turn on internal tracing for @code{expect}, to @var{n} levels deep. By
+adjusting the level, you can control the extent to which your output
+expands multi-level Tcl statements. This allows you to ignore some
+levels of @code{case} or @code{if} statements. Each procedure call or
+control structure counts as one ``level''.
+
+The output is recorded in the same file, @file{dbg.log}, used for output
+from @samp{--debug}.
+
+@item --target @var{string}
+@cindex @code{--target} (@code{runtest} option)
+@cindex specifying the target configuration
+@cindex target configuration, specifying
+Use this option to override the default setting (running native tests).
+@var{string} is a full configuration ``triple''
+name@footnote{Configuration triples have the form
+@samp{@var{cpu}-@var{vendor}-@var{os}}.} as used by @code{configure}.
+This option changes the configuration @code{runtest} uses for the
+default tool names, and other setup information. @xref{Using
+configure,,Using @code{configure}, configure.info, Cygnus configure},
+for details about @code{configure} names.
+
+@item --verbose
+@itemx -v
+@cindex @code{--verbose} (@code{runtest} option)
+@cindex @code{-v} (@code{runtest} option)
+@cindex turning on output
+@cindex output, additional
+Turns on more output. Repeating this option increases the amount of
+output displayed. Level one (@samp{-v}) is simply test output. Level
+two (@samp{-v -v}) shows messages on options, configuration, and process
+control. Verbose messages appear in the detailed (@file{*.log}) log
+file, but not in the summary (@file{*.sum}) log file.
+
+@item --version
+@itemx -V
+@cindex @code{-V} (@code{runtest} option)
+@cindex @code{--version} (@code{runtest} option)
+@cindex version numbers
+Prints out the version numbers of DejaGnu, @code{expect} and Tcl, and
+exits without running any tests.
+
+@item -D0
+@itemx -D1
+@cindex starting the tcl debugger
+@cindex tcl debugger
+@c FIXME!!! we should say a *lot* more about this debugger
+Start the internal Tcl debugger. The Tcl debugger supports breakpoints,
+single stepping, and other common debugging activities. (See @cite{A
+Debugger for Tcl Applications} by Don Libes. @footnote{Distributed in
+PostScript form with @code{expect} as the file@*
+@file{expect/tcl-debug.ps}.})
+
+If you specify @samp{-D1}, the @code{expect} shell stops at a breakpoint
+as soon as DejaGnu invokes it.
+
+If you specify @samp{-D0}, DejaGnu starts as usual, but you can enter
+the debugger by sending an interrupt (e.g. by typing @key{C-c}).
+@end table
+
+@node Customizing
+@chapter Setting @code{runtest} defaults
+
+@kindex site.exp
+@cindex variables of DejaGnu, defaults
+The site configuration file, @file{site.exp}, captures
+configuration-dependent values and propagates them to the DejaGnu test
+environment using Tcl variables. This ties the DejaGnu test scripts
+into the @code{configure} and @code{make} programs.
+
+@cindex @file{site.exp}, multiple
+@cindex overriding @file{site.exp}
+DejaGnu supports more than one @file{site.exp} file. The multiple
+instances of @file{site.exp} are loaded in a fixed order built into
+DejaGnu (the more local last). The first file loaded is the optional
+@code{~/.dejagnurc}, then the local files, and finally the global file.
+
+@enumerate
+@item
+There is am optional ``master'' @file{site.exp}, capturing configuration values
+that apply to DejaGnu across the board, in each configuration-specific
+subdirectory of the DejaGnu library directory. @code{runtest} loads
+these values first. @xref{Installation,,Configuring and Installing
+DejaGnu}. The master @file{site.exp} contains the default values for
+all targets and hosts supported by DejaGnu. This master file is
+identified by setting the environment variable @code{DEJAGNU} to the
+name of the file. This is also refered to as the ``global'' config file.
+
+@item
+Any directory containing a configured test suite also has a
+@file{site.exp}, capturing configuration values specific to the tool
+under test. Since @code{runtest} loads these values last, the
+individual test configuration can either rely on and use, or override,
+any of the global values from the ``master'' @file{site.exp}.
+
+You can usually generate or update the testsuite @file{site.exp} by
+typing @samp{make site.exp} in the test suite directory, after the test
+suite is configured.
+
+@item
+You can also have a file in your home directory called
+@code{.dejagnurc}. This gets loaded first before the other config
+files. Usually this is used for personal stuff, like setting
+@code{all_flag} so all the output gets printed, or verbosity levels.
+@end enumerate
+
+You can further override the default values in a user-editable section
+of any @file{site.exp}, or by setting variables on the @code{runtest}
+command line.
+
+@menu
+* Config Values:: Variables used in the configuration file.
+* Master Config File:: The master configuration file.
+* Local Config File:: The local configuration file.
+* Personal Config File:: The personal configuration file.
+@end menu
+
+@node Config Values, Master Config File, , Customizing
+@subsection Config Variables
+@cindex configuration dependent defaults
+@cindex setting defaults for DejaGnu variables
+
+@c NOTE: default values are given via @code{"fubar"} rather than the
+@c more conventional @samp{fubar} to permit a consistent and clear
+@c notation for the empty string (@code{""}), which will work exactly as
+@c typed.
+
+DejaGnu uses a named array in Tcl to hold all the info for each
+machine. In the case of a canadian cross, this means host information as
+well as target information. The named array is called
+@code{target_info}, and it has two indices. The following fields are
+part of the array.
+
+@table @code
+@item name
+The name of the target. (mostly for error messages) This
+should also be the string used for this target's array.
+It should also be the same as the linker script so we
+can find them dynamically. This should be the same as the argument used
+for @code{push_target@{@}}.
+
+@item ldflags
+This is the linker flags required to produce a fully linked
+executable. For @code{libgloss} supported targets this is usually just
+the name of the linker script.
+
+@item config
+The target canonical for this target. This is used by some init files to
+make sure the target is supported.
+
+@item cflags
+The flags required to produce an object file from a source file.
+
+@item connect
+This is the connectmode for this target. This is for both IP and
+serial connections. Typically this is either @code{telnet},
+@code{rlogin}, or @code{rsh}.
+
+@item target
+This is the hostname of the target. This is for TCP/IP based connections,
+and is also used for version of tip that use /etc/remote.
+
+@item serial
+This is the serial port. This is typically /dev/tty? or com?:.
+
+@item netport
+This is the IP port. This is commonly used for telneting to target
+boards that are connected to a terminal server. In that case the IP port
+specifies the which serial port to use.
+
+@item baud
+This is the baud rate for a serial port connection.
+
+@item x10
+This is the parameters for an x10 controller. These are simple devices
+that let us power cycle or reset a target board remotely.
+
+@item fileid
+This is the fileid or spawn id of of the connection.
+
+@item prompt
+a glob style pattern to recognize the prompt.
+
+@item abbrev
+abbreviation for tool init files.
+
+@item ioport
+This is the port for I/O on dual port systems. In this configuration,
+the main serial port @code{0} is usually used for stdin and stdout,
+which the second serial port can be used for debugging.
+@end table
+
+The first index into the array is the same value as used in the
+@code{name} field. This is usually a short version of the name of the
+target board. For an example, here's the settings I use for my
+@code{Motorola's} @code{IDP} board and my @code{Motorola} 6U VME
+@code{MVME135-1} board. (both m68k targets)
+
+@cartouche
+@smallexample
+# IDP board
+set target_info(idp,name) "idp"
+set target_info(idp,ldflags) "-Tidp.ld"
+set target_info(idp,config) m68k-unknown-aout
+set target_info(idp,cflags) ""
+set target_info(idp,connect) telnet
+set target_info(idp,target) "s7"
+set target_info(idp,serial) "tstty7"
+set target_info(idp,netport) "wharfrat:1007"
+set target_info(idp,baud) "9600"
+# MVME 135 board
+set target_info(idp,name) "mvme"
+set target_info(idp,ldflags) "-Tmvme.ld"
+set target_info(idp,config) m68k-unknown-aout
+set target_info(idp,cflags) ""
+set target_info(idp,connect) telnet
+set target_info(idp,target) "s8"
+set target_info(idp,serial) "tstty8"
+set target_info(idp,netport) "wharfrat:1008"
+set target_info(idp,baud) "9600"
+@end smallexample
+@end cartouche
+
+DejaGnu can use this information to switch between multiple targets in
+one test run. This is done through the use of the @code{push_target}
+procedure, which is discussed elsewhere.
+@c FIXME: write that section and put an xref here
+
+This array can also hold information for a remote host, which is used
+when testing a candain cross. In this case, the only thing different is
+the index is just @code{host}. Here's the settings I use to run tests
+on my NT machine while running DejaGnu on a Unix machine. (in this case
+a Linux box)
+
+@cartouche
+@smallexample
+set target_info(host,name) "nt-host"
+set target_info(host,config) "386-unknown-winnt"
+set target_info(host,connect) "telnet"
+set target_info(host,target) "ripple"
+@end smallexample
+@end cartouche
+
+There is more info on how to use these variables in the sections on the
+config files. @xref{Master Config File,,Configuration Files}.
+
+@cindex option defaults
+@cindex @code{runtest} option defaults
+@cindex variables for option defaults
+@cindex defaults, option
+In the user editable second section of @file{site.exp}, you can not only
+override the configuration variables captured in the first section, but
+also specify default values for all the @code{runtest} command line
+options. Save for @samp{--debug}, @samp{--help}, and @samp{--version},
+each command line option has an associated Tcl variable. Use the Tcl
+@code{set} command to specify a new default value (as for the
+configuration variables). The following table describes the
+correspondence between command line options and variables you can set in
+@file{site.exp}. @xref{Invoking runtest,,Running the Tests}, for
+explanations of the command-line options.
+
+@kindex all_flag
+@kindex baud
+@kindex reboot
+@kindex outdir
+@kindex objdir
+@kindex runtests
+@kindex ignoretests
+@kindex srcdir
+@kindex tracelevel
+@kindex targetname
+@kindex connectmode
+@kindex tool
+@kindex target_triplet
+@kindex host_triplet
+@kindex build_triplet
+@kindex verbose
+
+@cindex command line option variables
+@cindex Tcl variables for option defaults
+@cindex default options, controlling
+@cindex options, Tcl variables for defaults
+
+@ifinfo
+@display
+runtest Tcl
+option variable description
+__________ ________ ___________________________________________
+
+--all all_flag display all test results if set
+
+--baud baud set the default baud rate to something other
+ than 9600.
+--connect connectmode @samp{rlogin}, @samp{telnet}, @samp{rsh},
+ @samp{kermit}, @samp{tip}, or @samp{mondfe}
+
+--outdir outdir directory for @file{@var{tool}.sum} and @file{@var{tool}.log}
+
+--objdir objdir directory for pre-compiled binaries
+
+--reboot reboot reboot the target if set to @code{"1"};
+ do not reboot if set to @code{"0"} (the default)
+
+--srcdir srcdir directory of test subdirectories
+
+--strace tracelevel a number: Tcl trace depth
+
+--tool tool name of tool to test; identifies init, test subdir
+
+--verbose verbose verbosity level. As option, use multiple times;
+ as variable, set a number, 0 or greater
+--target target_triplet The canonical configuration string for the target.
+--host host_triplet The canonical configuration string for the host.
+--build build_triplet The canonical configuration string for the
+ build host.
+
+@end display
+@end ifinfo
+
+@tex
+\vbox{\halign{\hfil \tt #\quad &\quad\tt #\hfil &\hbox{\vtop{{\raggedright\parindent=0pt\parskip=5pt\hsize=2.75in\rm#\strut\par}}}\hfill\cr
+\cr
+{\it runtest}&{\it Tcl}\cr
+{\it option}&{\it variable}&{\it description}\cr
+\noalign{\hrule width\hsize}\cr
+--all &all\_flag &display all test results if set\cr
+--baud &baud &set the default baud rate to something other
+ than 9600.\cr
+--connect &connectmode &@samp{rlogin}, @samp{telnet}, @samp{rsh},
+ @samp{kermit}, @samp{tip}, or @samp{mondfe}\cr
+--mail &mailing\_list&address list for mailing test output\cr
+--name &targetname &network name of testing target or its host\cr
+--outdir &outdir &directory for @file{@var{tool}.sum} and @file{@var{tool}.log}\cr
+--objdir &objdir &directory for compiled binaries\cr
+--reboot &reboot &reboot the target if set to @code{"1"};
+do not reboot if set to @code{"0"} (the default)\cr
+--srcdir &srcdir &directory of test subdirectories\cr
+--strace &tracelevel &a number: Tcl trace depth\cr
+--tool &tool &name of tool to test; identifies init, test subdir\cr
+--verbose &verbose &verbosity level. As option, use multiple times;
+ as variable, set a number, 0 or greater\cr
+--target &target\_triplet
+ &The canonical configuration string for the target.\cr
+--host &host\_triplet &The canonical configuration string for the host.\cr
+--build &build\_triplet &The canonical configuration string for the
+ build host.\cr
+}}
+@end tex
+
+@node Master Config File, Local Config File, Config Values, Customizing
+@subsection Master Config File
+@cindex master @file{site.exp}
+@cindex @file{site.exp} for all of DejaGnu
+The master config file is where all the target specific config variables
+get set for a whole site get set. The idea is that for a centralized
+testing lab where people have to share a target between multiple
+developers. There are settings for both remote targets and remote hosts.
+Here's an example of a Master Config File (also called the Global config
+file) for a @emph{canadian cross}. A canadian cross is when you build
+and test a cross compiler on a machine other than the one it's to be
+hosted on.
+
+Here we have the config settings for our California office. Note that
+all config values are site dependant. Here we have two sets of values
+that we use for testing m68k-aout cross compilers. As both of these
+target boards has a different debugging protocol, we test on both of
+them in sequence.
+
+@cartouche
+@smallexample
+global CFLAGS
+global CXXFLAGS
+
+case "$target_triplet" in @{
+ @{ "native" @} @{
+ set target_abbrev unix
+ @}
+ @{ "m68*-unknown-aout" @} @{
+ set target_abbrev "rom68k"
+ # IDP target # IDP board with rom68k monitor
+ set target_info(idp,name) "idp"
+ set target_info(idp,ldflags) "-Tidp.ld"
+ set target_info(idp,config) m68k-unknown-aout
+ set target_info(idp,cflags) ""
+ set target_info(idp,connect) telnet
+ set target_info(idp,target) "s7"
+ set target_info(idp,serial) "tstty12"
+ set target_info(idp,netport) "truckin:1007"
+ set target_info(idp,baud) "9600"
+ # MVME target # Motorola MVME 135 with BUG monitor
+ set target_info(mvme,name) "mvme"
+ set target_info(mvme,ldflags) "-Tmvme.ld"
+ set target_info(mvme,config) m68k-unknown-aout
+ set target_info(mvme,cflags) ""
+ set target_info(mvme,connect) telnet
+ set target_info(mvme,target) "s4"
+ set target_info(mvme,serial) "tstty8"
+ set target_info(mvme,netport) "truckin:1004"
+ set target_info(mvme,baud) "9600"
+ @}
+@}
+@end smallexample
+@end cartouche
+
+ In this case, we have support for several remote hosts for
+our m68k-aout cross compiler. Typically the remote Unix hosts run
+DejaGnu locally, but we also use them for debugging the testsuites when
+we find problems in running on remote hosts. Expect won't run on NT, so
+DejaGnu is run on the local build machine, and it'll connect to the NT
+host and run all the tests for this cross compiler on that host.
+
+@smallexample
+@cartouche
+case "$host_triplet" in @{
+ "native" @{
+ @}
+ "i?86-*-linux*" @{ # Linux host
+ set target_info(host,name) "linux-host"
+ set target_info(host,config) $host_triplet
+ set target_info(host,connect) rlogin
+ set target_info(host,target) chinadoll
+ @}
+ "i?86-*-winnt # NT host
+ set target_info(host,name) "nt-host"
+ set target_info(host,config) i386-unknown-winnt
+ set target_info(host,connect) telnet
+ set target_info(host,target) ripple
+ @}
+ "hppa*-hp-hpux*" @{ # HP-UX host
+ set target_info(host,name) "hpux-host"
+ set target_info(host,config) $host_triplet
+ set target_info(host,connect) rlogin
+ set target_info(host,target) slipknot
+ @}
+ "sparc-sun-sunos*" @{ # SunOS (sun4)
+ set target_info(host,name) "sunos-host"
+ set target_info(host,config) $host_triplet
+ set target_info(host,connect) rlogin
+ set target_info(host,target) darkstar
+ @}
+@}
+@end cartouche
+@end smallexample
+
+@node Local Config File, Personal Config File, Master Config File, Customizing
+@subsection Local Config File
+@cindex local @file{site.exp}
+@cindex @file{site.exp} for each tool
+It is usually more convenient to keep these ``manual overrides'' in the
+@file{site.exp} local to each test directory, rather than in the
+``master'' @file{site.exp} in the DejaGnu library.
+
+All local @file{site.exp} usually files have two sections, separated by
+comment text. The first section is the part that is generated by
+@code{make}. It is essentially a collection of Tcl variable definitions
+based on @file{Makefile} environment variables. Since they are generated
+by @code{make}, they contain the values as specified by
+@code{configure}. (You can also customize these values by using the
+@samp{--site} option to @code{configure}.) In particular, this section
+contains the @file{Makefile} variables for host and target configuration
+data. Do not edit this first section; if you do, your changes are replaced
+next time you run @code{make}.
+
+The first section starts with:
+
+@cartouche
+@smallexample
+## these variables are automatically generated by make ##
+# Do not edit here. If you wish to override these values
+# add them to the last section
+@end smallexample
+@end cartouche
+
+In the second section, you can override any default values (locally to
+DejaGnu) for all the variables. The
+second section can also contain your preferred defaults for all the
+command line options to @code{runtest}. This allows you to easily
+customize @code{runtest} for your preferences in each configured
+test-suite tree, so that you need not type options repeatedly on the
+command line. (The second section may also be empty, if you do not wish
+to override any defaults.)
+
+The first section ends with this line:
+
+@cartouche
+@smallexample
+## All variables above are generated by configure. Do Not Edit ##
+@end smallexample
+@end cartouche
+
+You can make any changes under this line. If you wish to redefine a
+variable in the top section, then just put a duplicate value in this
+second section. Usually the values defined in this config file are
+related to the configuration of the test run. This is the ideal place to
+set the variables @code{host_triplet}, @code{build_triplet},
+@code{target_triplet}. All other variables are tool dependant. ie for
+testing a compiler, the value for @var{CC} might be set to a freshly
+built binary, as opposed to one in the user's path.
+
+@node Personal Config File, , Local Config File, Customizing
+@subsection Personal Config File
+@cindex personal config @file{site.exp}
+@cindex @file{site.exp} for each person
+The personal config file is used to customize @code{runtest's} behaviour
+for each person. It's typically used to set the user prefered setting
+for verbosity, and any experimental Tcl procedures. My personal
+@file{~/.dejagnurc} file looks like:
+
+@cartouche
+@smallexample
+set all_flag 1
+set RLOGIN /usr/ucb/rlogin
+set RSH /usr/ucb/rsh
+@end smallexample
+@end cartouche
+
+Here I set @code{all_flag} so I see all the test cases that PASS along
+with the ones that FAIL. I also set @var{RLOGIN} and @code{RSH} to the
+BSD version. I have @code{kerberos} installed, and when I rlogin to a
+target board, it usually isn't supported. So I use the non secure
+versions of these programs rather than the default that's in my path.
+
+@node Internals
+@chapter The DejaGnu Implementation
+@cindex operating principles
+@cindex internal details
+
+DejaGnu is entirely written in @code{expect}, which uses Tcl as a
+command language. @code{expect} serves as a very programmable shell;
+you can run any program, as with the usual Unix command shells---but
+once the program is started, your @code{expect} script has fully
+programmable control of its input and output. This does not just apply
+to the programs under test; @code{expect} can also run any auxiliary
+program, such as @code{diff} or @code{sh}, with full control over its
+input and output.
+
+DejaGnu itself is merely a framework for the set of test suites
+distributed separately for each @sc{gnu} tool. Future releases of
+@sc{gnu} tools will include even more tests, developed throughout the
+free software community.
+
+@kindex runtest.exp
+@code{runtest} is the glue to tie together and manage the test scripts.
+The @code{runtest} program is actually a simple Bourne shell script that
+locates a copy of the @code{expect} shell and then starts the main Tcl
+code, @code{runtest.exp}. @code{runtest.exp} itself has these essential
+functions:
+
+@enumerate
+@item
+Parse the command line options, load the library files, and load the
+default configuration files.
+
+@item
+Locating the individual test scripts. @code{runtest.exp} locates the tests
+by exploiting a straightforward naming convention based on the string
+you specify with the @samp{--tool} option.
+
+@item
+Providing an extended test environment, by defining additional Tcl
+procedures beyond those already in @code{expect}.
+
+@item
+Locating target-dependent functions, to standardize the test environment
+across a wide variety of test platforms.
+@end enumerate
+
+@menu
+* Names:: Conventions for using tool names
+* Init Module:: Initialization module
+* DejaGnu Builtins:: DejaGnu provides these Tcl procedures
+* Target Dependent:: Procedures supplied by the init module
+* Cross Targets:: Remote targets supported
+* Input Files:: The files DejaGnu depends on
+* Output Files:: The files DejaGnu produces
+@end menu
+
+@node Names
+@section Conventions for using tool names
+
+@cindex @code{--tool} and naming conventions
+@cindex tool names and naming conventions
+@cindex naming conventions
+DejaGnu uses @samp{$tool}, the name of the tool under test, to tie
+together the testing configuration in a straightforward but flexible
+way. If there is only one testsuite for a particular application, then
+@samp{$tool} is optional.
+
+@samp{$tool} is @emph{not} used to invoke the tool, since sites that run
+multiple configurations of a particular tool often call each
+configuration by a different name. @code{runtest} uses the
+configuration-dependent variables captured in @file{site.exp} to
+determine how to call each tool.
+
+@cindex directory names and @code{--tool}
+@cindex test directories, naming
+@code{runtest} uses tool names to find directories containing tests.
+@code{runtest} scans the source directory (specified with
+@code{--srcdir}) for all directories whose names start with the tool
+name. It is a common practice to put a period after the tool part of the
+name. For instance, directories that start with
+@samp{g++.} contain @sc{g++} tests. To add a new test, just put it in
+any directory (create an entirely new directory, if you wish) whose name
+follows this convention.
+
+@cindex @code{exp} filename suffix
+@cindex test filename
+@cindex filename for test files
+A test is any file in an appropriately named subdirectory whose name
+ends in @samp{.exp} (the conventional way of naming @code{expect}
+scripts). These simple naming conventions make it as simple as possible
+to install new tests: all you must do is put the test in the right
+directory.
+
+@cindex order of tests
+@cindex tests, running order
+@code{runtest} sorts the tests in each subdirectory by name (using the
+Tcl @code{lsort} command) and runs them in the resulting order.
+
+@node Init Module
+@section Initialization module
+@cindex tool initialization
+@cindex setting up targets
+
+@c FIXME! should this node be merged with "Target dependent"?
+
+@cindex init file, purpose
+@cindex starting interactive tools
+@cindex initialization
+The initialization module (or ``init file'') has two purposes: to
+provide tool and target dependent procedures, and to start up an
+interactive tool to the point where it is ready to operate. The latter
+includes establishing communications with the target. All the tests for
+interactive programs assume that the tool is already running and
+communicating. Initialization modules for non-interactive programs may
+only need to supply the support functions.
+
+@cindex init file name
+@cindex name, initialization module
+Each test suite directory must contain (in its @file{config}
+subdirectory) a separate initialization module for each target. The
+appropriate init file is can be named several ways. The prefered name is
+the @emph{os} part of the canonical configuration name with @code{.exp}
+as the suffix. An example would be that for an @code{m68k-coff} system,
+the @code{target_os} part would be @code{coff}. The next way is for
+system where there are short filenames, or a shortcut is desired to
+refer to the OS name for that target. This is uses the value of
+@code{$target_abbrev} rather than the @code{target_os}.
+
+The final file looked for is simply @file{default.exp}. If there is only
+one operating system to support, then this file can be used. It's main
+purpose is to offer some support for new operating systems, or for
+unsupported cross targets. The last file looked for is
+@file{unknown.exp}. This is usually limited to error handling for
+unsupported targets. It's whole contents is typically.
+
+@cartouche
+@smallexample
+perror "Sorry, there is no support for this target"
+exit 1
+@end smallexample
+@end cartouche
+
+At the beginning of the init file, you must first determine the proper
+executable name of the tool to execute, since the actual name of the
+tool to be tested my vary from system to system. Here's an example
+for the @sc{GNU} C compiler.
+
+@cartouche
+@smallexample
+global AR
+# look for the archiver ar
+if ![info exists AR] @{
+ set AR [findfile $base_dir/../../binutils/ar $base_dir/../../binutils/ar [tr
+ansform ar]]
+ verbose "AR defaulting to $AR" 2
+@}
+@}
+
+global CFLAGS
+if ![info exists CFLAGS] then @{
+ set CFLAGS ""
+@}
+@end smallexample
+@end cartouche
+
+It is always a good idea to first check the variable, and only set it if
+it has not yet been defined. Often the proper value of @code{AR} is set
+on the command line that invokes @file{runtest}.
+
+@kindex findfile
+The @code{findfile} procedure takes as it's first argument a file name
+to look for. The second argument is returned if the file is found, and
+the third argument is returned if the file is not found. @code{base_dir}
+is set internally by DejaGnu to the top level directory of the object
+tree.
+
+@kindex transform
+The @code{transform} procedure takes as its argument the native name of
+a tool (such as @samp{gcc} for the compiler), and returns the name as
+configured for that tool in the current installation. (For example, a
+cross-compiling version of @sc{gnu} CC that generates MIPS code may be
+installed with a name like @code{mips-idt-ecoff-gcc}.)
+
+In a test running native, writing the Tcl code for initialization is
+usually quite simple. For cross configurations, however, more elaborate
+instructions are usually needed to describe how to talk to a remote
+target.
+
+Each initialization module defines up to four procedures with standard
+names and purposes. The names of these procedures begin with
+@samp{$tool}, the string that identifies tests for a particular tool:
+@code{$tool_start}, @code{$tool_load}, @code{$tool_exit}, and
+@code{$tool_version}. For example, the start procedure for @sc{gdb} is
+called @code{gdb_start}. (Since start procedures are used differently
+for batch and interactive tools, however, @code{runtest} itself never
+calls the start procedure. Init files for interactive tools are
+expected to end by running the start procedure.)
+
+@cindex utilities, loading from init file
+@cindex defaults, setting in init file
+The initialization module is also a good place to call @code{load_lib}
+to get any collections of utility procedures meant for a family of test
+cases, and to set up default values for any additional Tcl variables
+needed for a specific set of tests.
+
+@xref{Target Dependent,,Target dependent procedures}, for full
+descriptions of these procedures.
+
+@node DejaGnu Builtins
+@section DejaGnu procedures
+@cindex built in procedures, DejaGnu
+
+DejaGnu provides these Tcl procedures for use in test scripts.
+You can also use any standard @code{expect} or Tcl function. These
+procedures are stored in libraries, which DejaGnu loads at
+runtime. Here's explanation of the library procedures that get loaded at
+runtime. All other librarys are optional, and need to be loaded by the
+testsuite.
+
+@menu
+* framework.exp:: Core Internal Procedures.
+* remote.exp:: Procedures for remote communication.
+* utils.exp:: Utility procedures.
+* target.exp:: Cross target procedures.
+* debugger.exp:: Procedures for debugging your Tcl code.
+@end menu
+
+@node framework.exp, remote.exp, ,DejaGnu Builtins
+@subsection Core Internal Procedures
+@cindex Core Internal Procedures
+
+@xref{Posix,,A POSIX conforming test framework}, for more detailed
+explanations of the test outcomes (@samp{FAIL}, @samp{PASS},
+@samp{UNTESTED}, @samp{UNRESOLVED}, @samp{UNSUPPORTED}).
+
+@ftable @code
+@item perror "@var{string} @var{number}"
+@cindex test case, ERROR in
+@kindex ERROR
+Declares a severe error in the testing framework itself.
+@code{perror} writes in the log files a message beginning with
+@samp{ERROR}, appending the argument @var{string}. If the optional
+@var{number} is supplied, then this is used to set the internal count of
+errors to that value.
+
+As a side effect, @code{perror} also changes the effect of the next
+@code{pass} or @code{fail} command: the test outcome becomes
+@samp{UNRESOLVED}, since an automatic @samp{PASS} or @samp{FAIL} cannot
+be trusted after a severe error in the test framework. If the optional
+numeric value is @samp{0}, then there are no further side effects to
+calling this function, and the following test outcome doesn't become
+@samp{UNRESOLVED}. This can be used for errors with no known side
+effects.
+
+@item warning "@var{string} @var{number}"
+@cindex test case, WARNING in
+@kindex WARNING
+Declares detection of a minor error in the test case itself.
+@code{warning} writes in the log files a message beginning with
+@samp{WARNING}, appending the argument @var{string}. Use @code{warning}
+rather than @code{error} for cases (such as communication failure
+to be followed by a retry) where the test case can recover from the
+error. If the optional @var{number} is supplied, then this is used to
+set the internal count of warnings to that value.
+
+As a side effect, @code{warning_threshold} or more calls to
+@code{warning} in a single test case also changes the effect of the next
+@code{pass} or @code{fail} command: the test outcome becomes
+@samp{UNRESOLVED} since an automatic @samp{PASS} or @samp{FAIL} may not
+be trustworthy after many warnings. If the optional numeric value is
+@samp{0}, then there are no further side effects to calling this
+function, and the following test outcome doesn't become
+@samp{UNRESOLVED}. This can be used for errors with no known side
+effects.
+
+@item note "@var{string}"
+@cindex test case, informational messages
+@kindex NOTE
+Appends an informational message to the log file.
+@code{note} writes in the log files a message beginning with
+@samp{NOTE}, appending the argument @var{string}. Use @code{note}
+sparingly. @code{verbose} should be used for most such messages,
+but in cases where a message is needed in the log file regardless of
+the verbosity level use @code{note}.
+
+@item pass "@var{string}"
+@cindex test case, declaring success
+Declares a test to have passed. @code{pass} writes in the
+log files a message beginning with @samp{PASS} (or @code{XPASS}, if
+failure was expected), appending the argument @var{string}.
+
+@item fail "@var{string}"
+@cindex test case, declaring failure
+Declares a test to have failed. @code{fail} writes in the
+log files a message beginning with @samp{FAIL} (or @code{XFAIL}, if
+failure was expected), appending the argument @var{string}.
+
+@item unresolved "@var{string}"
+@cindex test case, declaring ambiguity
+Declares a test to have an unresolved outcome. @code{unresolved} writes
+in the log file a message beginning with @samp{UNRESOLVED}, appending
+the argument @var{string}. This usually means the test did not execute
+as expected, and a human being must go over results to determine if it
+passed or failed (and to improve the test case).
+
+@item untested "@var{string}"
+@cindex test case, declaring no test
+Declares a test was not run. @code{untested} writes in the log file a
+message beginning with @samp{UNTESTED}, appending the argument
+@var{string}. For example, you might use this in a dummy test whose
+only role is to record that a test does not yet exist for some feature.
+
+@item unsupported "@var{string}"
+@cindex test case, declaring no support
+Declares that a test case depends on some facility that does not exist
+in the testing environment. @code{unsupported} writes in the log file a
+message beginning with @samp{UNSUPPORTED}, appending the argument
+@var{string}.
+
+@item get_warning_threshold
+@cindex test case, WARNING threshold
+Returns the current value of @code{warning_threshold}.
+The default value is 3.
+
+@item set_warning_threshold @var{threshold}
+@cindex test case, WARNING threshold
+Sets the value of @code{warning_threshold}.
+A value of @code{0} disables it: calls to @code{warning} will not turn
+a @samp{PASS} or @samp{FAIL} into an @samp{UNRESOLVED}.
+
+@item transform "@var{toolname}"
+@cindex transform tool name
+@cindex installed tool name
+@cindex tool name, as installed
+@cindex name transformations
+Generates a string for the name of a tool as it was configured and
+installed, given its native name (as the argument @var{toolname}).
+This makes the assumption that all tools are installed using the same
+naming conventions: it extrapolates from the invocation name for
+@file{runtest}. For example, if you call @code{runtest} as
+@file{m68k-vxworks-runtest}, the result of @w{@samp{ transform "gcc" }}
+is @samp{m68k-vxworks-gcc}.
+
+@item ishost "@var{host}"
+@cindex host configuration test
+Tests for a particular @emph{host} environment. If the currently
+configured host matches the argument string, the result is @code{1};
+otherwise the result is @code{0}. @var{host} must be a full three-part
+@code{configure} host name; in particular, you may not use the shorter
+nicknames supported by @code{configure} (but you can use wildcard
+characters, using shell syntax, to specify sets of names).
+
+@item istarget "@var{target}"
+@cindex target configuration test
+Tests for a particular @emph{target} environment. If the currently
+configured target matches the argument string, the result is @code{1};
+otherwise the result is @code{0}. @var{target} must be a full
+three-part @code{configure} target name; in particular, you may not use
+the shorter nicknames supported by @code{configure} (but you can use
+wildcard characters, using shell syntax, to specify sets of names). If it is
+passed a @code{NULL} string, then it returns the name of the build
+canonical configuration.
+
+@item isbuild "@var{host}"
+@cindex build host configuration test
+Tests for a particular @emph{build host} environment. If the currently
+configured host matches the argument string, the result is @code{1};
+otherwise the result is @code{0}. @var{host} must be a full three-part
+@code{configure} host name; in particular, you may not use the shorter
+nicknames supported by @code{configure} (but you can use wildcard
+characters, using shell syntax, to specify sets of names). If it is
+passed a @code{NULL} string, then it returns the name of the build
+canonical configuration.
+
+item is3way "@var{host}"
+@cindex canadian cross configuration test
+Tests for a canadian cross. This is when the tests will be run on a
+remotly hosted cross compiler. If it is a canadian cross, then the
+result is @code{1}; otherwise the result is @code{0}.
+
+@item isnative
+@cindex native configuration test
+Tests whether the current configuration has the same host and target.
+When it runs in a @emph{native} configuration this procedure returns a
+@code{1}; otherwise it returns a @code{0}.
+
+@item load_lib "@var{library-file}"
+@cindex load library file
+Loads the file @var{library-file} by searching a fixed path built into
+@code{runtest}. If DejaGnu has been installed, it looks in a path
+starting with the installed library directory. If you are running
+DejaGnu directly from a source directory, without first running
+@samp{make install}, this path defaults to the current directory. In
+either case, it then looks in the current directory for a directory
+called @code{lib}. If there are duplicate definitions, the last one
+loaded takes precedence over the earlier ones.
+
+@item setup_xfail "@var{config} @r{[}@var{bugid}@r{]}"
+@c two spaces above to make it absolutely clear there's whitespace---a
+@c crude sort of italic correction!
+@cindex test case, expecting failure
+@cindex failure, expected
+@cindex expected failure
+Declares that the test is expected to fail on a particular set of
+configurations. The @var{config} argument must be a list of full
+three-part @code{configure} target name; in particular, you may not use
+the shorter nicknames supported by @code{configure} (but you can use the
+common shell wildcard characters to specify sets of names). The
+@var{bugid} argument is optional, and used only in the logging file
+output; use it as a link to a bug-tracking system such as @sc{gnats}
+(@pxref{Overview,, Overview, gnats.info, Tracking Bugs With GNATS}).
+
+@cindex @code{XFAIL}, producing
+@cindex @code{XPASS}, producing
+Once you use @code{setup_xfail}, the @code{fail} and @code{pass}
+procedures produce the messages @samp{XFAIL} and @samp{XPASS}
+respectively, allowing you to distinguish expected failures (and
+unexpected success!) from other test outcomes.
+
+@emph{Warning:} you must clear the expected failure after using
+@code{setup_xfail} in a test case. Any call to @code{pass} or
+@code{fail} clears the expected failure implicitly; if the test has some
+other outcome, e.g. an error, you can call @code{clear_xfail} to clear
+the expected failure explicitly. Otherwise, the expected-failure
+declaration applies to whatever test runs next, leading to surprising
+results.
+
+@item clear_xfail @var{config}
+@cindex cancelling expected failure
+@cindex expected failure, cancelling
+Cancel an expected failure (previously declared with @code{setup_xfail})
+for a particular set of configurations. The @var{config} argument is a
+list of configuration target names. It is only necessary to call
+@code{clear_xfail} if a test case ends without calling either
+@code{pass} or @code{fail}, after calling @code{setup_xfail}.
+
+@item verbose @r{[}-log@r{]} @r{[}-n@r{]} @r{[}--@r{]} "@var{string}" @var{number}
+@cindex @code{verbose} builtin function
+Test cases can use this function to issue helpful messages depending on
+the number of @samp{--verbose} options on the @code{runtest} command
+line. It prints @var{string} if the value of the variable
+@code{verbose} is higher than or equal to the optional @var{number}. The
+default value for @var{number} is 1. Use the optional @samp{-log} argument
+to cause @var{string} to always be added to the log file, even if it won't
+be printed. Use the optional @samp{-n} argument to print @var{string}
+without a trailing newline. Use the optional @samp{--} argument if
+@var{string} begins with "-".
+
+@end ftable
+
+@noindent
+@node remote.exp, utils.exp, framework.exp, DejaGnu Builtins
+@subsection Remote Communication Procedures
+
+@kindex remote.exp
+@kindex lib/remote.exp
+@cindex remote connection procedures
+@cindex communications procedures
+@file{lib/remote.exp} defines these functions, for establishing and
+managing communications:
+
+@emph{Procedures to establish a connection:} Each of these procedures
+tries to establish the connection up to three times before returning.
+Warnings (if retries will continue) or errors (if the attempt is
+abandoned) report on communication failures. The result for any of
+these procedures is either @code{-1}, when the connection cannot be
+established, or the spawn ID returned by the @code{expect} command
+@code{spawn}.
+
+It use the value of the @code{connect} field in the @code{target_info}
+array (was @code{connectmode} as the type of connection to make. Current
+supported connection types are tip, kermit, telnet, rsh, rlogin, and
+netdata. If the @code{--reboot} option was used on the runtest command
+line, then the target is rebooted before the connection is made.
+
+@ftable @code
+
+@item remote_open @var{type}
+@cindex Opening a remote connection
+@emph{Remote Connection Procedure.} This is passed @emph{host} or
+@emph{target}. Host or target refers to whether it is a connection to a
+remote target, or a remote host. This opens the connection to the
+desired target or host using the default values in the configuration
+system. It returns that @code{spawn_id} of the process that manages the
+connection. This value can be used in @code{expect} or @code{exp_send}
+statements, or passed to other procedures that need the connection
+process's id. This also sets the @code{fileid} field in the
+@code{target_info} array.
+
+
+@item remote_close @var{shellid}
+@cindex Closing a remote connection
+@emph{shellid} is value returned by a call to @code{remote_open}. This
+closes the connection to the target so resources can be used by
+others. This parameter can be left off if the @code{fileid} field in the
+@code{target_info} array is set.
+
+@item telnet @var{hostname} @var{port}
+@itemx rlogin @var{hostname}
+@itemx rsh @var{hostname}
+@cindex IP network procedures
+@cindex network (IP) procedures
+@emph{IP network procedures.} @var{hostname} refers to the IP address or
+name (for example, an entry in @file{/etc/hosts}) for this target. The
+procedure names reflect the Unix utility used to establish a
+connection. The optional @var{port} is used to specify the IP port
+number. The value of the @code{netport} field in the @code{target_info}
+array is used. (was @code{$netport}) This value has two parts, the
+hostname and the port number, seperated by a @emph{:}. If @code{host} or
+@code{target} is used in the @code{hostname} field, than the config
+array is used for all information.
+
+@item tip @var{port}
+@cindex serial line connection, @code{tip}
+@emph{Serial line procedure.} Connect using the Unix utility @code{tip}.
+@var{port} must be a name from the @code{tip} configuration file
+@file{/etc/remote}. Often, this is called @samp{hardwire}, or something
+like @samp{ttya}. This file holds all the configuration data for
+the serial port. The value of the @code{serial} field in the
+@code{target_info} array is used. (was @code{$serialport}) If
+@code{host} or @code{target} is used in the @code{port} field, than
+the config array is used for all information.
+
+@item kermit @var{port} @var{bps}
+@cindex serial line connection, @code{kermit}
+@emph{Serial line procedure.} Connect using the program @code{kermit}.
+@var{port} is the device name, e.g. @file{/dev/ttyb}. @var{bps} is
+the line speed to use (in bits per second) for the connection. The value
+of the @code{serial} field in the @code{target_info} array is used. (was
+@code{$serialport}) If @code{host} or @code{target} is used in the
+@code{port} field, than the config array is used for all information.
+
+@end ftable
+
+@noindent
+@emph{Procedures to manage a connection:}
+
+@ftable @code
+@item tip_download @var{spawnid} @var{file}
+@cindex download, @code{tip}
+@cindex serial download, @code{tip}
+Download @file{@var{file}} to the process @var{spawnid} (the value
+returned when the connection was established), using the @code{~put}
+command under @code{tip}. Most often used for single board computers
+that require downloading programs in @sc{ascii} S-records. Returns
+@code{1} if an error occurs, @code{0} otherwise.
+
+@item exit_remote_shell @var{spawnid}
+@cindex terminating remote connection
+@cindex remote connection, ending
+Exits a remote process started by any of the connection procedures.
+@var{spawnid} is the result of the connection procedure that started the
+remote process.
+
+@item download @var{file} @r{[} @var{spawnid} @r{]}
+@cindex download a file
+After you establish a connection to a target, you can download programs
+using this command. @code{download} reads in @var{file} (object code in
+S-record format) and writes it to the device controlling this
+@var{spawnid}. (From the point of view of the target, the S-record file
+comes in via standard input.)
+
+If you have more than one target active, you can use the optional argument
+@var{spawnid} to specify an alternative target (the default is the most
+recently established @var{spawnid}.)
+@end ftable
+
+@noindent
+@node utils.exp, target.exp, remote.exp, DejaGnu Builtins
+@subsection Utility Procedures
+
+@kindex utils.exp
+@kindex lib/utils.exp
+@file{lib/utils.exp} defines these utility procedures:
+
+@ftable @code
+@item getdirs @var{dir}
+@itemx getdirs @var{dir} @var{pattern}
+@cindex directories matching a pattern
+@cindex pattern match, directory
+Returns a list of all the directories in the single directory @var{dir}
+that match @var{pattern}. If you do not specify @var{pattern},
+@code{getdirs} assumes @samp{*}. You may use the common shell wildcard
+characters in @var{pattern}. If no directories match the pattern, then a
+@code{NULL} string is returned.
+
+@item find @var{dir} @var{pattern}
+@cindex files matching a pattern
+@cindex pattern match, filenames
+Search for files whose names match @var{pattern} (using shell wildcard
+characters for filename expansion). Search subdirectories recursively,
+starting at @var{dir}. The result is the list of files whose names
+match; if no files match, the result is empty. Filenames in the result
+include all intervening subdirectory names. If no files match the
+pattern, then a @code{NULL} string is returned.
+
+@item which @var{binary}
+@cindex path lookup
+Searches the execution path for an executable file @var{binary}, like
+the the BSD @code{which} utility. This procedure uses the shell
+environment variable @samp{PATH}. It returns @code{0} if the binary is
+not in the path, or if there is no @samp{PATH} environment variable. If
+@var{binary} is in the path, it returns the full path to @var{binary}.
+
+@item grep @var{filename} @var{regexp}
+@item grep @var{filename} @var{regexp} line
+@cindex regular expression, file contents
+@cindex searching file contents
+Search the file called @var{filename} (a fully specified path) for lines
+that contain a match for regular expression @var{regexp}. The result is
+a list of all the lines that match. If no lines match, the result is an
+empty string. Specify @var{regexp} using the standard regular
+expression style used by the Unix utility program @code{grep}.
+
+Use the optional third argument @samp{line} to start lines in the result
+with the line number in @var{filename}. (This argument is simply an
+option flag; type it just as shown---@samp{line}.)
+
+@item diff @var{filename} @var{filename}
+@cindex finding file differences
+@cindex comparing files
+Compares the two files and returns a 1 if they match, or a 0 if they
+don't. If @code{verbose} is set, then it'll print the differences to the
+screen.
+
+@item slay @var{name}
+@cindex slaying processes
+This look in the process tabel for @var{name} and send it a unix
+@code{SIGINT}, killing the process.
+
+@item absolute @var{path}
+@cindex converting relative paths to absolute
+This procedure takes the relative @var{path}, and converts it to an
+absolute path.
+
+@item psource @var{filename}
+@cindex sourcing Tcl files
+This sources the file @var{filename}, and traps all errors. It also
+ignores all extraneous output. If there was an error it returns a 1,
+otherwise it returns a 0.
+
+@item prune @var{list} @var{pattern}
+@cindex list, pruning
+Remove elements of the Tcl list @var{list}. Elements are fields
+delimited by spaces. The result is a copy of @var{list}, without any
+elements that match @var{pattern}. You can use the common shell
+wildcard characters to specify @var{pattern}.
+
+@item setenv @var{var} @var{val}
+@cindex setting environment variables
+Sets the variable @var{var} to the value @var{val}.
+
+@item unsetenv @var{var}
+@cindex unsetting environment variables
+Unsets the environment variable @var{var}
+
+@item getenv @var{var}
+@cindex getting environment variables
+returns the value of @var{var} in the environment if it exists,
+otherwise it returns @code{NULL}.
+
+@item runtest_file_p @var{runtests} @var{testcase}
+@cindex selecting a range of tests
+@cindex tests, running specifically
+Search @var{runtests} for @var{testcase} and return 1 if found, 0 if not.
+@var{runtests} is a list of two elements. The first is the pathname of
+the testsuite expect script running. The second is a copy of what was
+on the right side of the @code{=} if @samp{foo.exp="@dots{}"} was specified,
+or an empty string if no such argument is present.
+This is used by tools like compilers where each testcase is a file.
+
+@item prune_system_crud @var{system} @var{text}
+@cindex pruning system output, examining program output
+For system @var{system}, delete text the host or target operating system might
+issue that will interfere with pattern matching of program output in
+@var{text}. An example is the message that is printed if a shared library
+is out of date.
+
+@end ftable
+
+@noindent
+@node target.exp, debugger.exp, utils.exp, DejaGnu Builtins
+@subsection Cross target procedure
+
+@kindex target.exp
+@kindex lib/target.exp
+@file{lib/target.exp} defines these utility procedures:
+
+@ftable @code
+
+@item push_target @emph{name}
+@cindex set current target
+This makes the target named @emph{name} be the current target
+connection. The value of @emph{name} is an index into the
+@code{target_info} array and is set in the global config file.
+
+@item pop_target
+@cindex unset current target
+This unsets the current target connection.
+
+@item list_targets
+@cindex lists supported targets
+This lists all the supported targets for this architecture.
+
+@item push_host @emph{name}
+@cindex set current host
+This makes the host named @emph{name} be the current remote host
+connection. The value of @emph{name} is an index into the
+@code{target_info} array and is set in the global config file.
+
+@item pop_host
+@cindex unset current host
+This unsets the current host connection.
+
+@c @item compile @emph{file}
+@cindex compile a file
+This invokes the compiler as set by @code{CC} to compile the file
+@emph{file}. The default options for many cross compilation targets are
+@emph{guessed} by DejaGnu, and these options can be added to by passing
+in more parameters as arguments to @code{compile}. Optionally, this will
+also use the value of the @code{cflags} field in the target config
+array. If the host is not the same as the build machines, then then
+compiler is run on the remote host using @code{execute_anywhere}.
+
+@c @item archive @emph{file}
+@cindex archive object files
+This produces an archive file. Any parameters passed to @code{archive}
+are used in addition to the default flags. Optionally, this will
+also use the value of the @code{arflags} field in the target config
+array. If the host is not the same as the build machines, then then
+archiver is run on the remote host using @code{execute_anywhere}.
+
+@c @item ranlib @emph{file}
+@cindex ranlib a file
+This generates an index for the archive file for systems that aren't
+POSIX yet. Any parameters passed to @code{ranlib} are used in for the
+flags.
+
+@item execute_anywhere @emph{cmdline}
+@cindex executing commands remotely
+This executes the @emph{cmdline} on the proper host. This should be used
+as a replacement for the Tcl command @code{exec} as this version
+utilizes the target config info to execute this command on the build
+machine or a remote host. All config information for the remote host
+must be setup to have this command work. If this is a canadian cross,
+(where we test a cross compiler that runs on a different host then where
+DejaGnu is running) then a connection is made to the remote host and
+the command is executed there. It returns either @emph{REMOTERROR} (for
+an error) or the output produced when the command was executed. This is
+used for running the tool to be tested, not a test case.
+
+@end ftable
+
+@node debugger.exp, , target.exp, DejaGnu Builtins
+@subsection Debugging Procedures
+
+@kindex debugger.exp
+@kindex lib/debugger.exp
+@file{lib/debugger.exp} defines these utility procedures:
+
+@ftable @code
+
+@item dumpvars @emph{expr}
+@cindex Print global variable values
+This takes a csh style regular expression (glob rules) and prints the
+values of the global variable names that match. It is abbreviated as
+@code{dv}
+
+@item dumplocals @emph{expr}
+@cindex Print local variable value
+This takes a csh style regular expression (glob rules) and prints the
+values of the local variable names that match. It is abbreviated as
+@code{dl}.
+
+@item dumprocs @emph{expr}
+@cindex Print procedure bodies
+This takes a csh style regular expression (glob rules) and prints the
+body of all procs that match. It is abbreviated as @code{dp}
+
+@item dumpwatch @emph{expr}
+@cindex Print watchpoints
+This takes a csh style regular expression (glob rules) and prints all
+the watchpoints. It is abbreviated as @code{dw}.
+
+@c FIXME: finish these when the code is fixed.
+@c @item watcharray @emph{element} @emph{type}
+@c @cindex Set a watchpoint on an array
+@c This sets an watchpoint of the @emph{element-type} on the
+@c @item watchvar v null type
+@c @cindex Set a watchpoint on a variable
+
+@item watchunset @emph{var}
+@cindex Watch when a variable is unset
+This breaks program execution when the variable @emph{var} is unset. It
+is abbreviated as @code{wu}.
+
+@item watchwrite @emph{var}
+@cindex Watch when a variable is written
+This breaks program execution when the variable @emph{var} is
+written. It is abbreviated as @code{ww}.
+
+@item watchread @emph{var}
+@cindex Watch when a variable is read
+This breaks program execution when the variable @emph{var} is read. It
+is abbreviated as @code{wr}.
+
+@item watchdel @emph{watch}
+@cindex Delete a watchpoint.
+This deletes a the watchpoint for @emph{watch}. It is abbreviated as
+@code{wd}.
+
+@item print @emph{var}
+@cindex Printing variable values
+This prints the value of the variable @emph{var}. It is abbreviated as
+@code{p}.
+
+@item quit
+@cindex Quiting DejaGnu
+This makes runtest exit. It is abbreviated as @code{q}.
+
+@item bt
+@cindex Print a backtrace
+This prints a backtrace of the executed Tcl commands.
+
+@end ftable
+
+@node Target Dependent
+@section Target dependent procedures
+@cindex target dependent procedures
+
+@c FIXME? These may be renamed to just "start", "load", "exit", and
+@c "version" eventually.
+
+Each combination of target and tool requires some target-dependent
+procedures. The names of these procedures have a common form: the tool
+name, followed by an underbar @samp{_}, and finally a suffix describing
+the procedure's purpose. For example, a procedure to extract the
+version from @sc{gdb} is called @samp{gdb_version}. @xref{Init Module,,
+Initialization Module}, for a discussion of how DejaGnu arranges to find
+the right procedures for each target.
+
+@code{runtest} itself calls only two of these procedures,
+@code{@var{tool}_exit} and @code{@var{tool}_version}; these procedures use
+no arguments.
+
+The other two procedures, @code{@var{tool}_start} and
+@code{@var{tool}_load}, are only called by the test suites themselves
+(or by testsuite-specific initialization code); they may take arguments
+or not, depending on the conventions used within each test suite.
+
+@ftable @code
+@item @var{tool}_start
+@cindex start procedure, tested tools
+Starts a particular tool. For an interactive tool,
+@code{@var{tool}_start} starts and initializes the tool, leaving the
+tool up and running for the test cases; an example is @code{gdb_start},
+the start function for @sc{gdb}. For a batch oriented tool,
+@code{@var{tool}_start} is optional; the recommended convention is to
+let @code{@var{tool}_start} run the tool, leaving the output in a
+variable called @code{comp_output}. Test scripts can then analyze
+@samp{$comp_output} to determine the test results. An example of this
+second kind of start function is @code{gcc_start}, the start function
+for @sc{gcc}.
+
+@code{runtest} itself @emph{does not call} @code{@var{tool}_start}. The
+initialization module @file{@var{tool}_init.exp} must call
+@code{@var{tool}_start} for interactive tools; for batch-oriented tools,
+each individual test script calls @code{@var{tool}_start} (or makes
+other arrangements to run the tool).
+
+@item @var{tool}_load
+@cindex load procedure, tested tools
+Loads something into a tool. For an interactive tool, this conditions
+the tool for a particular test case; for example, @code{gdb_load} loads
+a new executable file into the debugger. For batch oriented tools,
+@code{@var{tool}_load} may do nothing---though, for example, the
+@sc{gcc} support uses @code{gcc_load} to load and run a binary on the
+target environment. Conventionally, @code{@var{tool}_load} leaves the
+output of any program it runs in a variable called @samp{exec_output}.
+Writing @code{@var{tool}_load} can be the most complex part of extending
+DejaGnu to a new tool or a new target, if it requires much communication
+coding or file downloading.
+
+Test scripts call @code{@var{tool}_load}.
+
+@item @var{tool}_exit
+@cindex exit procedure, tested tools
+Cleans up (if necessary) before @code{runtest} exits. For interactive
+tools, this usually ends the interactive session. You can also use
+@code{@var{tool}_exit} to remove any temporary files left over from the
+tests.
+
+@code{runtest} calls @code{@var{tool}_exit}.
+
+@item @var{tool}_version
+@cindex version procedure, tested tools
+Prints the version label and number for @var{tool}. This is called by
+the DejaGnu procedure that prints the final summary report. The output
+should consist of the full path name used for the tested tool, and its
+version number.
+
+@code{runtest} calls @code{@var{tool}_version}.
+@end ftable
+
+The usual convention for return codes from any of these procedures
+(although it is not required by @code{runtest}) is to return @code{0} if
+the procedure succeeded, @code{1} if it failed, and @code{-1} if there
+was a communication error.
+
+@node Cross Targets
+@section Remote targets supported
+
+@cindex targets
+@cindex remote testing
+The DejaGnu distribution includes support for the following remote
+targets. You can set the target name and the connect mode in the
+@file{site.exp} file (using the Tcl variables @samp{targetname} and
+@samp{connectmode}, respectively), or on the @code{runtest} command line
+(using @samp{--name} and @samp{--connect}).
+
+@table @strong
+@item @sc{amd} 29000, with UDI protocol
+Configure DejaGnu for target @samp{a29k-amd-udi}. (Cygnus
+@code{configure} also recognizes the abbreviation @samp{udi29k}.) Then,
+to run tests, use the @code{runtest} target name to specify whether you
+want to use a simulator, or a particular hardware board. The particular
+string to use with @samp{--name} will depend on your UDI setup file,
+@file{udi_soc} (if @file{udi_soc} is not in your working directory, the
+environment variable @samp{UDICONF} should contain a path to this file).
+For example, if your UDI setup file includes these lines:
+@end table
+@c table "ends" *only* to allow wider example below
+
+@cartouche
+@smallexample
+iss AF_UNIX * isstip -r /home/gnu/29k/src/osboot/sim/osboot
+mon AF_UNIX * montip -t serial -baud 9600 -com /dev/ttyb
+@end smallexample
+@end cartouche
+
+@table @strong
+@item @w{ }
+@c fake out table/item into continuing w/same margin as before
+You can use @samp{--name iss} to run tests on the simulator, and
+@samp{--name mon} to run tests on the 29K hardware. See the
+manufacturer's manuals for more information on UDI and @file{udi_soc}.
+@c FIXME! Is there a better ref than "the manufacturer's manuals"?
+
+@kindex mondfe
+The default connect protocol is @samp{mondfe} with either back end.
+@code{mondfe} is the only shell DejaGnu supports for UDI targets.
+@code{mondfe} is an @sc{amd} specific monitor program freely available
+from @sc{amd}.
+
+@emph{Warning:} This target requires @sc{gdb} version 4.7.2 (or
+greater). Earlier versions of @sc{gdb} do not fully support the
+@code{load} command on this target, so DejaGnu has no way to load
+executable files from the debugger.
+
+@item Motorola 680x0 boards, a.out or @sc{coff} object format
+Configure DejaGnu for any remote target matching @samp{m68k-*}.
+
+@emph{Warning:} Most @samp{m68k-*} configurations run all tests only for
+native testing (when the target is the same as the host). When you
+specify most of these targets for a cross configuration, you will only be
+able to use tests that run completely within the host (for example,
+tests of the binary utilities such as the archiver; or compiler tests
+that only generate code rather than running it).
+
+To run a.out or @sc{coff} binaries on a remote M68K, you must configure
+DejaGnu for a particular target board. @samp{m68k-abug} is an example.
+(In general for an embedded environment, because it does not have absolute
+addresses, a.out is not a good choice for output format in any case; most
+often S-records or Hex-32 are used instead.)
+
+@item Motorola 68K MVME 135 board running ABug boot monitor
+Configure for @samp{m68k-abug-aout} or @samp{m68k-abug-coff} (as a
+target). This boot monitor can only download S-records; therefore, the
+DejaGnu tests for this environment require a linker command script to
+convert either output format to S-records, setting the default addresses
+for @code{.text}, @code{.bss}, and @code{.data}.
+
+With this configuration, the default for @samp{--connect} is @samp{tip}.
+@samp{tip} is the only communications protocol supported for connecting
+to @samp{m68k-abug-*} targets. @samp{tip} uses an @sc{ascii} downloader
+(the @code{~put} command) to load S-records into the target board. The
+@samp{--name} string must be a machine name that @code{tip}
+understands (for example, on some @code{tip} implementations it must be
+an entry from the initialization file for @code{tip}; this file is
+sometimes called @file{/etc/remote}).
+
+See your system documentation for information on how to create new
+entries in @file{/etc/remote}. (Some @sc{unix} systems are distributed
+with at least one default entry with a name resembling @samp{hardwire};
+if your system has one, you can edit it, or make a modified copy with a
+new name.) When you have a working @file{/etc/remote} entry
+@var{abugtarget}, you should be able to type @samp{tip
+@var{abugtarget}}, and get the prompt @samp{135ABUG>} from the board.
+Use the same @var{abugtarget} string with @samp{runtest --name}.
+
+@item Motorola IDP board running the rom68k boot monitor
+@c FIXME 1: this doesn't really say anything! OK, so functionality is
+@c the same. Is object code the same (srecords)? Do we configure with
+@c the same triplets? What is the default for --connect? Is
+@c any comms method other than tip supported? What prompt to expect
+@c when tip connected?
+@c FIXME 2: should @code{BUG} below be @code{ABUG}?
+This is the same in functionality as the MVME board running the
+@code{BUG} boot monitor. Only the monitor commands and the addresses are
+different.
+
+@item VxWorks (Motorola 68K or Intel 960)
+Configure DejaGnu for either @samp{m68k-wrs-vxworks} (abbreviated
+@samp{vxworks68}) or @samp{i960-wrs-vxworks} (abbreviated
+@samp{vxworks960}). Since both targets support IP addressing, specify
+the network address (for example, a host name from @file{/etc/hosts})
+with @samp{--name}.
+
+The default connect protocol is @samp{rlogin}, but you can use any of
+@samp{--connect rlogin}, @samp{--connect telnet}, or @samp{--connect
+rsh}.
+
+Test scripts need no special code to load programs into these targets;
+since VxWorks supports NFS, all you must do is ensure test programs are
+on an exported filesystem.
+
+@cindex VxWorks, link with @samp{-r}
+When you compile for VxWorks, use the linker @samp{-r} option to make
+the linker output relocatable---at least if you want to use library
+routines. Many standard C routines are included in VxWorks; often no
+additional libraries are needed. See your VxWorks system documentation
+for additional details.
+@end table
+
+@node Input Files
+@section The files DejaGnu reads
+@cindex input files
+
+The @code{runtest} program used to invoke DejaGnu is a short shell
+script generated by @code{make} during the configuration process. Its
+main task is to read the main test framework driver, @file{runtest.exp}.
+
+@file{runtest.exp}, in turn, reads @code{expect} code from certain other
+files, in this order:
+
+@enumerate
+@item
+Each of the @file{site.exp} local definition files available.
+@xref{Customizing,,Setting @code{runtest} defaults}, for details.
+
+@item
+@file{lib/utils.exp}, a collection of utility procedures. @xref{DejaGnu
+Builtins,,DejaGnu Builtins}, for descriptions of these procedures.
+
+@item
+@file{lib/framework.exp}, a file of subroutines meant for @code{runtest}
+itself rather than for general-purpose use in both @code{runtest} and
+test suites.
+
+@item
+@file{debugger.exp}, Don Libes' Tcl Debugger. (See @cite{A Debugger for
+Tcl Applications} by Don Libes. This paper is distributed with
+@code{expect} in PostScript form as the file
+@file{expect/tcl-debug.ps}.)
+
+@item
+@file{lib/remote.exp}, a collection of subroutines meant for connecting
+to remote machines.
+
+@item
+@file{lib/target.exp}, a collection of subroutines used for the
+configuration systems in DejaGnu. These procedures typically manipulate
+or utilize the configuration system.
+
+@item
+@c FIXME! A comment in runtest.exp claims a system default is used if
+@c no tool-specific init file is not available; I couldn't see where
+@c the program flow actually does this, though---pesch 30jul1993.
+An initialization file @code{@var{tool}_init.exp}. @xref{Init
+Module,,Initialization module}, for more discussion of init files.
+@end enumerate
+
+@c This hard page break is mainly intended for smallbook formatting;
+@c some examples in this section come out better if this starts at a
+@c page boundary.
+@page
+@node Output Files
+@section The files DejaGnu writes
+@cindex output files
+
+@code{runtest} always writes two kinds of output files: summary logs and
+detailed logs. The contents of both of these are determined by your
+tests.
+
+For troubleshooting, a third kind of output file is useful: use
+@samp{--debug} to request an output file showing details of what
+@code{expect} is doing internally.
+
+@menu
+* Summary:: Files that summarize tests
+* Detail:: Files that contain complete test results
+* Debug:: Logging expect internal actions
+@end menu
+
+@node Summary
+@subsection Summary log
+@cindex summary log
+
+@code{runtest} always produces a summary output file
+@file{@var{tool}.sum}. This summary shows the names of all test files
+run; for each test file, one line of output from each @code{pass}
+command (showing status @samp{PASS} or @samp{XPASS}) or @code{fail}
+command (status @samp{FAIL} or @samp{XFAIL}); trailing summary
+statistics that count passing and failing tests (expected and
+unexpected); and the full pathname and version number of the tool
+tested. (All possible outcomes, and all errors, are always reflected in
+the summary output file, regardless of whether or not you specify
+@samp{--all}.)
+
+If any of your tests use the procedures @code{unresolved},
+@code{unsupported}, or @code{untested}, the summary output also
+tabulates the corresponding outcomes.
+
+For example, after @samp{runtest --tool binutils}, look for a summary
+log in @file{binutils.sum}. Normally, @code{runtest} writes this file
+in your current working directory; use the @samp{--outdir} option to
+select a different directory.
+
+@need 3500
+@noindent
+Here is a short sample summary log:
+
+@cartouche
+@smallexample
+Test Run By rob on Mon May 25 21:40:57 PDT 1992
+ === gdb tests ===
+Running ./gdb.t00/echo.exp ...
+PASS: Echo test
+Running ./gdb.all/help.exp ...
+PASS: help add-symbol-file
+PASS: help aliases
+PASS: help breakpoint "bre" abbreviation
+FAIL: help run "r" abbreviation
+Running ./gdb.t10/crossload.exp ...
+PASS: m68k-elf (elf-big) explicit format; loaded
+XFAIL: mips-ecoff (ecoff-bigmips) "ptype v_signed_char" signed
+C types
+ === gdb Summary ===
+# of expected passes 5
+# of expected failures 1
+# of unexpected failures 1
+/usr/latest/bin/gdb version 4.6.5 -q
+@end smallexample
+@end cartouche
+
+@node Detail
+@subsection Detailed log
+@cindex detailed log
+
+@code{runtest} also saves a detailed log file @file{@var{tool}.log},
+showing any output generated by tests as well as the summary output.
+For example, after @samp{runtest --tool binutils}, look for a detailed
+log in @file{binutils.log}. Normally, @code{runtest} writes this file
+in your current working directory; use the @samp{--outdir} option to
+select a different directory.
+
+@need 4000
+@noindent
+Here is a brief example showing a detailed log for @sc{g++} tests:
+
+@cartouche
+@smallexample
+Test Run By rob on Mon May 25 21:40:43 PDT 1992
+
+ === g++ tests ===
+
+--- Running ./g++.other/t01-1.exp ---
+ PASS: operate delete
+
+--- Running ./g++.other/t01-2.exp ---
+ FAIL: i960 bug EOF
+p0000646.C: In function `int warn_return_1 ()':
+p0000646.C:109: warning: control reaches end of non-void function
+p0000646.C: In function `int warn_return_arg (int)':
+p0000646.C:117: warning: control reaches end of non-void function
+p0000646.C: In function `int warn_return_sum (int, int)':
+p0000646.C:125: warning: control reaches end of non-void function
+p0000646.C: In function `struct foo warn_return_foo ()':
+p0000646.C:132: warning: control reaches end of non-void function
+
+--- Running ./g++.other/t01-4.exp ---
+ FAIL: abort
+900403_04.C:8: zero width for bit-field `foo'
+--- Running ./g++.other/t01-3.exp ---
+ FAIL: segment violation
+900519_12.C:9: parse error before `;'
+900519_12.C:12: Segmentation violation
+/usr/latest/bin/gcc: Internal compiler error: program cc1plus got
+fatal signal
+
+ === g++ Summary ===
+
+# of expected passes 1
+# of expected failures 3
+/usr/ps/bin/g++ version cygnus-2.0.1
+@end smallexample
+@end cartouche
+
+@node Debug
+@subsection Logging @code{expect} internal actions
+@cindex debug log
+
+With the @samp{--debug} option, you can request a log file showing the
+output from @code{expect} itself, running in debugging mode. This file
+(@file{dbg.log}, in the directory where you start @code{runtest}) shows
+each pattern @code{expect} considers in analyzing test output.
+
+This file reflects each @code{send} command, showing the string sent as
+input to the tool under test; and each @code{expect} command, showing
+each pattern it compares with the tool output.
+
+The log messages for @code{expect} begin with a message of the form
+
+@smallexample
+expect: does @{@var{tool output}@} (spawn_id @var{n}) match pattern
+@{@var{expected pattern}@}?
+@end smallexample
+
+@noindent
+For every unsuccessful match, @code{expect} issues a @samp{no} after
+this message; if other patterns are specified for the same
+@code{expect} command, they are reflected also, but without the first
+part of the message (@samp{expect@dots{}match pattern}).
+
+When @code{expect} finds a match, the log for the successful match ends
+with @samp{yes}, followed by a record of the @code{expect} variables set
+to describe a successful match. Here is an excerpt from the debugging
+log for a @sc{gdb} test:
+
+@c FIXME! Why is the second spawn_id shown 0 rather than 6?
+@cartouche
+@smallexample
+send: sent @{break gdbme.c:34\n@} to spawn id 6
+expect: does @{@} (spawn_id 6) match pattern @{Breakpoint.*at.* file
+ gdbme.c, line 34.*\(gdb\) $@}? no
+@{.*\(gdb\) $@}? no
+expect: does @{@} (spawn_id 0) match pattern @{<return>@}? no
+@{\(y or n\) @}? no
+@{buffer_full@}? no
+@{virtual@}? no
+@{memory@}? no
+@{exhausted@}? no
+@{Undefined@}? no
+@{command@}? no
+break gdbme.c:34
+Breakpoint 8 at 0x23d8: file gdbme.c, line 34.
+(gdb) expect: does @{break gdbme.c:34\r\nBreakpoint 8 at 0x23d8:
+file gdbme.c, line 34.\r\n(gdb) @} (spawn_id 6) match pattern
+@{Breakpoint.*at.* file gdbme.c, line 34.*\(gdb\) $@}? yes
+expect: set expect_out(0,start) @{18@}
+expect: set expect_out(0,end) @{71@}
+expect: set expect_out(0,string) @{Breakpoint 8 at 0x23d8: file
+gdbme.c, line 34.\r\n(gdb) @}
+expect: set expect_out(spawn_id) @{6@}
+expect: set expect_out(buffer) @{break gdbme.c:34\r\nBreakpoint 8
+at 0x23d8: file gdbme.c, line 34.\r\n(gdb) @}
+ PASS: 70 0 breakpoint line number in file
+@end smallexample
+@end cartouche
+
+@noindent
+This example exhibits three properties of @code{expect} and DejaGnu that
+might be surprising at first glance:
+
+@itemize @bullet
+@item
+Empty output for the first attempted match. The first set of attempted
+matches shown ran against the output @samp{@{@}}---that is, no output.
+@code{expect} begins attempting to match the patterns supplied
+immediately; often, the first pass is against incomplete output (or
+completely before all output, as in this case).
+
+@item
+Interspersed tool output. The beginning of the log entry for the second
+attempted match may be hard to spot: this is because the prompt
+@samp{(gdb) } appears on the same line, just before the @samp{expect:}
+that marks the beginning of the log entry.
+
+@item
+Fail-safe patterns. Many of the patterns tested are fail-safe patterns
+provided by @sc{gdb} testing utilities, to reduce possible
+indeterminacy. It is useful to anticipate potential variations
+caused by extreme system conditions (@sc{gdb} might issue the message
+@samp{virtual memory exhausted} in rare circumstances), or by changes in
+the tested program (@samp{Undefined command} is the likeliest outcome if
+the name of a tested command changes).
+
+The pattern @samp{@{<return>@}} is a particularly interesting fail-safe
+to notice; it checks for an unexpected @key{RET} prompt. This may
+happen, for example, if the tested tool can filter output through a
+pager.
+
+These fail-safe patterns (like the debugging log itself) are primarily
+useful while developing test scripts. Use the @code{error} procedure to
+make the actions for fail-safe patterns produce messages starting with
+@samp{ERROR} on the @code{runtest} standard output, and in the detailed
+log file.
+@end itemize
+
+@node Tests
+@chapter How To Write a Test Case
+@cindex writing a test case
+@cindex test case, writing
+
+@menu
+* Writing:: Writing a test case
+* Debugging:: Debugging a test case
+* Adding:: Adding a test case to a test suite
+* Hints:: Hints on writing a test case
+* Variables:: Special variables used by test cases
+@end menu
+
+@node Writing
+@section Writing a test case
+
+The easiest way to prepare a new test case is to base it on an existing
+one for a similar situation. There are two major categories of tests:
+batch or interactive. Batch oriented tests are usually easier to write.
+
+The @sc{gcc} tests are a good example of batch oriented tests. All
+@sc{gcc} tests consist primarily of a call to a single common procedure,
+since all the tests either have no output, or only have a few warning
+messages when successfully compiled. Any non-warning output is a test
+failure. All the C code needed is kept in the test directory. The test
+driver, written in @code{expect}, need only get a listing of all the C
+files in the directory, and compile them all using a generic procedure.
+This procedure and a few others supporting for these tests are kept in
+the library module @file{lib/c-torture.exp} in the @sc{gcc} test suite.
+Most tests of this kind use very few @code{expect} features, and are
+coded almost purely in Tcl.
+
+@noindent
+Writing the complete suite of C tests, then, consisted of these steps:
+
+@enumerate
+@item
+@cindex Granlund, Torbjorn
+@cindex C torture test
+Copying all the C code into the test directory. These tests were based on
+the C-torture test created by Torbjorn Granlund (on behalf of the Free
+Software Foundation) for @sc{gcc} development.
+
+@item
+Writing (and debugging) the generic @code{expect} procedures for
+compilation.
+
+@item
+Writing the simple test driver: its main task is to search the directory
+(using the Tcl procedure @code{glob} for filename expansion with
+wildcards) and call a Tcl procedure with each filename. It also checks
+for a few errors from the testing procedure.
+@end enumerate
+
+Testing interactive programs is intrinsically more complex. Tests for most
+interactive programs require some trial and error before they are complete.
+
+However, some interactive programs can be tested in a simple fashion
+reminiscent of batch tests. For example, prior to the creation of
+DejaGnu, the @sc{gdb} distribution already included a wide-ranging
+testing procedure. This procedure was very robust, and had already
+undergone much more debugging and error checking than many recent
+DejaGnu test cases. Accordingly, the best approach was simply to
+encapsulate the existing @sc{gdb} tests, for reporting purposes.
+Thereafter, new @sc{gdb} tests built up a family of @code{expect}
+procedures specialized for @sc{gdb} testing.
+
+@file{gdb.t10/crossload.exp} is a good example of an interactive test.
+@c FIXME! Check what *kind* of example it is---work-intensive, or generic...
+
+@node Debugging
+@section Debugging a test case
+@cindex debugging a test case
+@cindex test case, debugging
+
+@noindent
+These are the kinds of debugging information available from DejaGnu:
+
+@enumerate
+@item
+Output controlled by test scripts themselves, explicitly allowed for by
+the test author. This kind of debugging output appears in the detailed
+output recorded in the @file{@var{tool}.log} file. To do the same for
+new tests, use the @code{verbose} procedure (which in turn uses the
+variable also called @code{verbose}) to control how much output to
+generate. This will make it easier for other people running the test to
+debug it if necessary. Whenever possible, if @samp{$verbose} is
+@code{0}, there should be no output other than the output from
+@code{pass}, @code{fail}, @code{error}, and @code{warning}. Then, to
+whatever extent is appropriate for the particular test, allow
+successively higher values of @samp{$verbose} to generate more
+information. Be kind to other programmers who use your tests: provide
+for a lot of debugging information.
+
+@item
+Output from the internal debugging functions of Tcl and @code{expect}.
+There is a command line options for each; both forms of debugging output
+are recorded in the file @code{dbg.log} in the current directory.
+
+Use @samp{--debug} for information from the @code{expect} level; it
+generates displays of the @code{expect} attempts to match the tool
+output with the patterns specified (@pxref{Debug,,Debug Log}). This
+output can be very helpful while developing test scripts, since it shows
+precisely the characters received. Iterating between the latest attempt
+at a new test script and the corresponding @file{dbg.log} can allow you
+to create the final patterns by ``cut and paste''. This is sometimes
+the best way to write a test case.
+
+Use @samp{--strace} to see more detail at the Tcl level; this shows how Tcl
+procedure definitions expand, as they execute. The associated number
+controls the depth of definitions expanded; see the discussion of
+@samp{--strace} in @ref{Invoking runtest,,Running the Tests}.
+
+@item
+Finally, if the value of @samp{verbose} is 3 or greater, @code{runtest}
+turns on the @code{expect} command @code{log_user}. This command prints
+all @code{expect} actions to the @code{expect} standard output, to the
+detailed log file, and (if @samp{--debug} is on) to @file{dbg.log}.
+@end enumerate
+
+@node Adding
+@section Adding a test case to a test suite
+@cindex adding a test case
+
+There are two slightly different ways to add a test case. One is to add
+the test case to an existing directory. The other is to create a new
+directory to hold your test. The existing test directories represent
+several styles of testing, all of which are slightly different; examine
+the directories for the tool of interest to see which (if any) is most
+suitable.
+
+Adding a @sc{gcc} test can be very simple: just add the C code to any
+directory beginning with @samp{gcc.} and it runs on the next
+@samp{runtest --tool gcc}.
+
+To add a test to @sc{gdb}, first add any source code you will need to
+the test directory. Then you can either create a new @code{expect} file,
+or add your test to an existing one (any file with a @samp{.exp}
+suffix). Creating a new @samp{.exp} file is probably a better idea if
+the test is significantly different from existing tests. Adding it as a
+separate file also makes upgrading easier. If the C code has to be
+already compiled before the test will run, then you'll have to add it to
+the @file{Makefile.in} file for that test directory, then run
+@code{configure} and @code{make}.
+
+Adding a test by creating a new directory is very similar:
+
+@enumerate
+@item
+Create the new directory. All subdirectory names begin with the name of
+the tool to test; e.g. @sc{g++} tests might be in a directory called
+@file{g++.other}. There can be multiple test directories that start with
+the same tool name (such as @samp{g++}).
+
+@item
+Add the new directory name to the @samp{configdirs} definition in the
+@file{configure.in} file for the test suite directory. This way when
+@code{make} and @code{configure} next run, they include the new directory.
+
+@item
+Add the new test case to the directory, as above.
+
+@item
+To add support in the new directory for configure and make, you must
+also create a @code{Makefile.in} and a @code{configure.in}. @xref{What
+Configure Does,,What Configure Does, configure.info, Cygnus Configure}.
+@end enumerate
+
+@c FIXME! Expand this sentence to at least a section, maybe a chapter...
+@c The @file{admin} directory contains templates for a few common forms
+@c of test.
+
+@node Hints
+@section Hints on writing a test case
+@cindex hints on test case writing
+
+There may be useful existing procedures already written for your test in
+the @file{lib} directory of the DejaGnu distribution. @xref{DejaGnu
+Builtins,,DejaGnu Builtins}.
+
+It is safest to write patterns that match @emph{all} the output
+generated by the tested program; this is called @dfn{closure}. If a
+pattern does not match the entire output, any output that remains will
+be examined by the @emph{next} @code{expect} command. In this
+situation, the precise boundary that determines which @code{expect}
+command sees what is very sensitive to timing between the @code{expect}
+task and the task running the tested tool. As a result, the test may
+sometimes appear to work, but is likely to have unpredictable results.
+(This problem is particularly likely for interactive tools, but can also
+affect batch tools---especially for tests that take a long time to finish.)
+The best way to ensure closure is to use the @samp{-re} option for the
+@code{expect} command to write the pattern as a full regular
+expressions; then you can match the end of output using a @samp{$}. It
+is also a good idea to write patterns that match all available output by
+using @samp{.*\} after the text of interest; this will also match any
+intervening blank lines. Sometimes an alternative is to match end of
+line using @samp{\r} or @samp{\n}, but this is usually too dependent on
+terminal settings.
+@c FIXME!! explain what "end of output" means for interactive task.
+@c (Timeout or EOF, right?)
+
+Always escape punctuation, such as @samp{(} or @samp{"}, in your
+patterns; for example, write @samp{\(}. If you forget to escape
+punctuation, you will usually see an error message like @samp{extra
+characters after close-quote}.
+
+If you have trouble understanding why a pattern does not match the
+program output, try using the @samp{--debug} option to @code{runtest},
+and examine the debug log carefully. @xref{Debug,,Debug Log}.
+
+Be careful not to neglect output generated by setup rather than by the
+interesting parts of a test case. For example, while testing @sc{gdb},
+I issue a send @samp{set height 0\n} command. The purpose is simply to
+make sure @sc{gdb} never calls a paging program. The @samp{set height}
+command in @sc{gdb} does not generate any output; but running @emph{any}
+command makes @sc{gdb} issue a new @samp{(gdb) } prompt. If there were
+no @code{expect} command to match this prompt, the output @samp{(gdb) }
+begins the text seen by the next @code{expect} command---which might
+make @emph{that} pattern fail to match.
+
+To preserve basic sanity, I also recommended that no test ever pass if
+there was any kind of problem in the test case. To take an extreme
+case, tests that pass even when the tool will not spawn are misleading.
+Ideally, a test in this sort of situation should not fail either.
+Instead, print an error message by calling one of the DejaGnu procedures
+@code{error} or @code{warning}.
+
+@node Variables
+@section Special variables used by test cases
+@cindex special variables
+
+@cindex variables for all tests
+Your test cases can use these variables, with conventional meanings (as
+well as the variables saved in @file{site.exp}
+@pxref{Customizing,,Setting @code{runtest} defaults}):
+
+@quotation
+@emph{These variables are available to all test cases.}
+@end quotation
+
+@ftable @code
+@item prms_id
+@cindex PRMS bug number
+@cindex GNATS bug number
+@cindex bug number
+The tracking system (e.g. @sc{gnats}) number identifying a corresponding
+bugreport. (@samp{0} if you do not specify it in the test script.)
+
+@item bug_id
+@cindex bug number, extra
+An optional bug id; may reflect a bug identification from another
+organization. (@samp{0} if you do not specify it.)
+
+@item subdir
+@cindex current test subdirectory
+The subdirectory for the current test case.
+@end ftable
+
+@quotation
+@emph{These variables should never be changed. They appear in most
+tests.}
+@end quotation
+
+@ftable @code
+@item expect_out(buffer)
+@cindex last command output
+The output from the last command. This is an internal variable set by
+@code{expect}.
+
+@item exec_output
+This is the output from a @code{@var{tool}_load} command. This only
+applies to tools like @sc{gcc} and @sc{gas} which produce an object
+file that must in turn be executed to complete a test.
+
+@item comp_output
+This is the output from a @code{@var{tool}_start} command. This is
+conventionally used for batch oriented programs, like @sc{gcc} and
+@sc{gas}, that may produce interesting output (warnings, errors) without
+further interaction.
+@end ftable
+
+@node Extending
+@chapter New Tools, Targets, or Hosts
+
+The most common ways to extend the DejaGnu framework are: adding a suite
+of tests for a new tool to be tested; adding support for testing on a
+new target; and porting @code{runtest} to a new host.
+
+@menu
+* Adding Tools:: How to add tests for a new tool
+* Adding Targets:: How to add a new target
+* Porting:: Porting DejaGnu to a new host
+@end menu
+
+@node Adding Tools
+@section Writing tests for a new tool
+
+In general, the best way to learn how to write (code or even prose) is
+to read something similar. This principle applies to test cases and to
+test suites. Unfortunately, well-established test suites have a way of
+developing their own conventions: as test writers become more
+experienced with DejaGnu and with Tcl, they accumulate more utilities,
+and take advantage of more and more features of @code{expect} and Tcl in
+general.
+
+Inspecting such established test suites may make the prospect of
+creating an entirely new test suite appear overwhelming. Nevertheless,
+it is quite straightforward to get a new test suite going.
+
+@cindex Lupton, Robert
+There is one test suite that is guaranteed not to grow more elaborate
+over time: both it and the tool it tests were created expressly to
+illustrate what it takes to get started with DejaGnu. The
+@file{example/} directory of the DejaGnu distribution contains both an
+interactive tool called @code{calc}, and a test suite for it. Reading
+this test suite, and experimenting with it, is a good way to supplement
+the information in this section. (Thanks to Robert Lupton for creating
+@code{calc} and its test suite---and also the first version of this
+section of the manual!)
+
+To help orient you further in this task, here is an outline of the steps
+to begin building a test suite for a program @var{example}.
+
+@enumerate
+@item
+Create or select a directory to contain your new collection of tests.
+Change to that directory (shown here as @code{testsuite}):
+
+@example
+eg$ cd testsuite/
+@end example
+
+@item
+Create a @file{configure.in} file in this directory, to control
+configuration-dependent choices for your tests. So far as DejaGnu is
+concerned, the important thing is to set a value for the variable
+@code{target_abbrev}; this value is the link to the init file you will
+write soon. (For simplicity, we assume the environment is Unix, and use
+@samp{unix} as the value.)
+
+What else is needed in @file{configure.in} depends on the requirements
+of your tool, your intended test environments, and which
+@code{configure} system you use. This example is a minimal
+@code{configure.in} for use with Cygnus Configure. (For an alternative
+based on the FSF @code{autoconf} system, see the @code{calc} example
+distributed with DejaGnu.) Replace @var{example} with the name of your
+program:
+
+@cartouche
+@smallexample
+# This file is a shell script fragment
+# for use with Cygnus configure.
+
+srctrigger="@var{example}.0"
+srcname="The DejaGnu @var{example} tests"
+
+# per-host:
+
+# per-target:
+
+# everything defaults to unix for a target
+target_abbrev=unix
+
+# post-target:
+
+@end smallexample
+@end cartouche
+
+@item
+Create @file{Makefile.in}, the source file used by @code{configure} to
+build your @file{Makefile}. Its leading section should as usual contain
+the values that @code{configure} may override:
+
+@cartouche
+@smallexample
+srcdir = .
+prefix = /usr/local
+
+exec_prefix = $(prefix)
+bindir = $(exec_prefix)/bin
+libdir = $(exec_prefix)/lib
+tooldir = $(libdir)/$(target_alias)
+
+datadir = $(exec_prefix)/lib/dejagnu
+
+RUNTEST = runtest
+RUNTESTFLAGS =
+FLAGS_TO_PASS =
+
+#### host, target, site specific Makefile frags come in here.
+@end smallexample
+@end cartouche
+
+This should be followed by the standard targets at your site. To begin
+with, they need not do anything---for example, these definitions will
+do:
+
+@cartouche
+@smallexample
+
+all:
+
+info:
+
+install-info:
+
+install:
+uninstall:
+
+clean:
+ -rm -f *~ core *.info*
+
+@end smallexample
+@end cartouche
+
+It is also a good idea to make sure your @file{Makefile} can rebuild
+itself if @file{Makefile.in} changes, with a target like this (which
+works for either Cygnus or FSF Configure):
+
+@cartouche
+@smallexample
+Makefile : $(srcdir)/Makefile.in $(host_makefile_frag) \
+ $(target_makefile_frag)
+ $(SHELL) ./config.status
+@end smallexample
+@end cartouche
+
+You also need to include two targets important to DejaGnu: @code{check},
+to run the tests, and @code{site.exp}, to set up the Tcl copies of
+configuration-dependent values. The @code{check} target must run
+@samp{runtest --tool @var{example}}:
+
+@cartouche
+@smallexample
+check: site.exp all
+ $(RUNTEST) $(RUNTESTFLAGS) $(FLAGS_TO_PASS) \
+ --tool @var{example} --srcdir $(srcdir)
+@end smallexample
+@end cartouche
+
+The @code{site.exp} target should usually set up (among other things!) a
+Tcl variable for the name of your program:
+
+@cartouche
+@smallexample
+site.exp: ./config.status Makefile
+ @@echo "Making a new config file..."
+ -@@rm -f ./tmp?
+ @@touch site.exp
+
+ -@@mv site.exp site.bak
+ @@echo "## these variables are automatically\
+ generated by make ##" > ./tmp0
+ @@echo "# Do not edit here. If you wish to\
+ override these values" >> ./tmp0
+ @@echo "# add them to the last section" >> ./tmp0
+ @@echo "set host_os $@{host_os@}" >> ./tmp0
+ @@echo "set host_alias $@{host_alias@}" >> ./tmp0
+ @@echo "set host_cpu $@{host_cpu@}" >> ./tmp0
+ @@echo "set host_vendor $@{host_vendor@}" >> ./tmp0
+ @@echo "set target_os $@{target_os@}" >> ./tmp0
+ @@echo "set target_alias $@{target_alias@}" >> ./tmp0
+ @@echo "set target_cpu $@{target_cpu@}" >> ./tmp0
+ @@echo "set target_vendor $@{target_vendor@}" >> ./tmp0
+ @@echo "set host_triplet $@{host_canonical@}" >> ./tmp0
+ @@echo "set target_triplet $@{target_canonical@}">>./tmp0
+ @@echo "set tool binutils" >> ./tmp0
+ @@echo "set srcdir $@{srcdir@}" >> ./tmp0
+ @@echo "set objdir `pwd`" >> ./tmp0
+ @@echo "set @var{examplename} @var{example}" >> ./tmp0
+ @@echo "## All variables above are generated by\
+ configure. Do Not Edit ##" >> ./tmp0
+ @@cat ./tmp0 > site.exp
+ @@sed < site.bak \
+ -e '1,/^## All variables above are.*##/ d' \
+ >> site.exp
+ -@@rm -f ./tmp?
+@end smallexample
+@end cartouche
+
+@item
+Create a directory (in @file{testsuite/}) called @file{config/}:
+
+@example
+eg$ mkdir config
+@end example
+
+@item
+Make an init file in this directory; its name must start with the
+@code{target_abbrev} value, so call it @file{config/unix.exp}.
+This is the file that contains the target-dependent procedures;
+fortunately, most of them do not have to do very much in order for
+@code{runtest} to run.
+
+If @var{example} is not interactive, you can get away with this minimal
+@file{unix.exp} to begin with:
+
+@cartouche
+@smallexample
+proc foo_exit @{@} @{@}
+proc foo_version @{@} @{@}
+@end smallexample
+@end cartouche
+
+If @var{example} is interactive, however, you might as well define a
+start routine @emph{and invoke it} by using an init file like this:
+
+@cartouche
+@smallexample
+proc foo_exit @{@} @{@}
+proc foo_version @{@} @{@}
+
+proc foo_start @{@} @{
+ global @var{examplename}
+ spawn $@var{examplename}
+ expect @{
+ -re "" @{@}
+ @}
+@}
+foo_start
+@end smallexample
+@end cartouche
+
+@item
+Create a directory whose name begins with your tool's name, to contain
+tests:
+
+@example
+eg$ mkdir @var{example}.0
+@end example
+
+@item
+Create a sample test file in @file{@var{example}.0}. Its name must end
+with @samp{.exp}; you can use @samp{first-try.exp} To begin with, just
+write there a line of Tcl code to issue a message:
+
+@cartouche
+@smallexample
+send_user "Testing: one, two...\n"
+@end smallexample
+@end cartouche
+
+@item
+Back in the @file{testsuite/} (top level) directory, run
+
+@example
+eg$ configure
+@end example
+
+(You may have to specify more of a path, if a suitable @code{configure}
+is not available in your execution path.)
+
+@item
+You are now ready to triumphantly type @samp{make check} or
+@samp{runtest --tool @var{example}}. You should see something like this:
+
+@cartouche
+@smallexample
+Test Run By rhl on Fri Jan 29 16:25:44 EST 1993
+
+ === @var{example} tests ===
+
+Running ./@var{example}.0/first-try.exp ...
+Testing: one, two...
+
+ === @var{example} Summary ===
+
+@end smallexample
+@end cartouche
+
+There is no output in the summary, because so far the example does not
+call any of the procedures that establish a test outcome.
+
+@item
+Begin writing some real tests. For an interactive tool, you should
+probably write a real exit routine in fairly short order; in any case,
+you should also write a real version routine soon.
+@end enumerate
+
+@node Adding Targets
+@section Adding a target
+@cindex adding a target
+
+DejaGnu has some additional requirements for target support, beyond the
+general-purpose provisions of Cygnus @code{configure}. @code{runtest}
+must actively communicate with the target, rather than simply generating
+or managing code for the target architecture. Therefore, each tool
+requires an initialization module for each target. For new targets, you
+must supply a few Tcl procedures to adapt DejaGnu to the target. This
+permits DejaGnu itself to remain target independent. @xref{Init
+Module,,Initialization module}, for a discussion of the naming
+conventions that enable DejaGnu to locate and use init files.
+
+Usually the best way to write a new initialization module is to edit an
+existing initialization module; some trial and error will be required.
+If necessary, you can use the @samp{--debug} option to see what
+is really going on.
+
+When you code an initialization module, be generous in printing
+information controlled by the @code{verbose} procedure (@pxref{DejaGnu
+Builtins, DejaGnu procedures}).
+
+Most of the work is in getting the communications right. Communications
+code (for several situations involving IP networks or serial lines) is
+available in a DejaGnu library file, @file{lib/remote.exp}.
+@xref{DejaGnu Builtins,,DejaGnu Builtins}.
+
+@c FIXME! Say something about Tcl debugger here.
+If you suspect a communication problem, try running the connection
+interactively from @code{expect}. (There are three ways of running
+@code{expect} as an interactive interpreter. You can run @code{expect}
+with no arguments, and control it completely interactively; or you can
+use @samp{expect -i} together with other command-line options and
+arguments; or you can run the command @code{interpreter} from any
+@code{expect} procedure. Use @code{return} to get back to the calling
+procedure (if any), or @code{return -tcl} to make the calling procedure
+itself return to its caller; use @code{exit} or end-of-file to leave
+@code{expect} altogether.) Run the program whose name is recorded in
+@samp{$connectmode}, with the arguments in @samp{$targetname}, to
+establish a connection. You should at least be able to get a prompt
+from any target that is physically connected.
+
+@node Porting
+@section Porting to a new host
+@cindex porting to a new host
+
+The task of porting DejaGnu is basically that of porting Tcl and
+@code{expect}. Tcl and @code{expect}, as distributed with DejaGnu, both
+use @code{autoconf}; they should port automatically to most Unix
+systems.
+
+Once Tcl and @code{expect} are ported, DejaGnu should run. Most system
+dependencies are taken care of by using @code{expect} as the main
+command shell.
+
+@node Installation
+@appendix Installing DejaGnu
+
+@cindex host, explained
+@cindex target, explained
+@cindex DejaGnu configuration
+@cindex configuring DejaGnu
+Once you have the DejaGnu source unpacked and available, you must first
+configure the software to specify where it is to run (and the associated
+defaults); then you can proceed to installing it.
+
+@menu
+* Configuring DejaGnu::
+* Installing DejaGnu::
+@end menu
+
+@node Configuring DejaGnu
+@section Configuring the DejaGnu test driver
+
+It is usually best to configure in a directory separate
+from the source tree, specifying where to find the source with the
+optional @samp{--srcdir} option to @code{configure}. DejaGnu uses the
+GNU @code{autoconf} to configure itself. For more info on using
+autoconf, read the GNU autoconf manual. To configure, execute the
+@file{configure} program, no other options are required. For an example,
+to configure in a seperate tree for objects, execute the configure
+script from the source tree like this:
+
+@smallexample
+../dejagnu-1.3/configure
+@end smallexample
+
+DejaGnu doesn't care at config time if it's for testing a native system
+or a cross system. That is determined at runtime by using the config
+files.
+
+@cindex @code{prefix}, configure options
+@cindex @code{exec_prefix}, configure options.
+You may also want to use the @code{configure} option @samp{--prefix} to
+specify where you want DejaGnu and its supporting code installed. By
+default, installation is in subdirectories of @file{/usr/local}, but you
+can select any alternate directory @var{altdir} by including
+@samp{--prefix=@var{altdir}} on the @code{configure} command line.
+(This value is captured in the Makefile variables @code{prefix}
+and @code{exec_prefix}.)
+
+@cindex auxiliary programs
+@cindex test suite distributions
+@cindex @code{make} builds part of tests
+Save for a small number of example tests, the DejaGnu distribution
+itself does not include any test suites; these are available separately.
+Test suites for the @sc{gnu} compiler (testing both GCC and G++) and for
+the @sc{gnu} binary utilities are distributed in parallel with the
+DejaGnu distribution (but packaged as separate files). The test suite
+for the @sc{gnu} debugger is distributed in parallel with each release
+of GDB itself, starting with GDB 4.9. After configuring the top-level
+DejaGnu directory, unpack and configure the test directories for the
+tools you want to test; then, in each test directory, run @code{make} to
+build auxiliary programs required by some of the tests.
+
+@node Installing DejaGnu
+@section Installing DejaGnu
+
+@cindex installing DejaGnu
+To install DejaGnu in your filesystem (either in @file{/usr/local}, or
+as specified by your @samp{--prefix} option to @code{configure}), execute
+
+@example
+eg$ make install
+@end example
+
+@noindent
+@samp{make install} does these things for DejaGnu:
+
+@enumerate
+@item
+Look in the path specified for executables (@file{$exec_prefix}) for
+directories called @file{lib} and @file{bin}. If these directories do
+not exist, @samp{make install} creates them.
+
+@item
+Create another directory in the @file{lib} directory, called
+@file{dejagnu}.
+
+@item
+Copy the @code{runtest} shell script into @file{$exec_prefix/bin}.
+
+@item
+Copy all the library files (used to support the framework) into
+@file{$exec_prefix/lib/dejagnu}.
+
+@item
+Copy @file{runtest.exp} into @file{$exec_prefix/lib/dejagnu}. This is
+the main Tcl code implementing DejaGnu.
+
+@end enumerate
+
+Each test suite collection comes with simple installation instructions
+in a @file{README} file; in general, the test suites are designed to be
+unpacked in the source directory for the corresponding tool, and extract
+into a directory called @file{testsuite}.
+
+@node Index
+@unnumbered Index
+
+@printindex cp
+
+@contents
+
+@bye
diff --git a/contrib/bluegnu2.0.3/doc/notice.html b/contrib/bluegnu2.0.3/doc/notice.html
new file mode 100644
index 0000000..4c59360
--- /dev/null
+++ b/contrib/bluegnu2.0.3/doc/notice.html
@@ -0,0 +1,395 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 3.2 Final//EN">
+<!--Converted with LaTeX2HTML 98.1p1 release (March 2nd, 1998)
+originally by Nikos Drakos (nikos@cbl.leeds.ac.uk), CBLU, University of Leeds
+* revised and updated by: Marcus Hennecke, Ross Moore, Herb Swan
+* with significant contributions from:
+ Jens Lippmann, Marek Rouchal, Martin Wilck and others -->
+<HTML>
+<HEAD>
+<TITLE>Release NoticeBlueGnu Testing Framework
+Version 2.0.3</TITLE>
+<META NAME="description" CONTENT="Release NoticeBlueGnu Testing Framework
+Version 2.0.3">
+<META NAME="keywords" CONTENT="READMEdvi">
+<META NAME="resource-type" CONTENT="document">
+<META NAME="distribution" CONTENT="global">
+<META HTTP-EQUIV="Content-Type" CONTENT="text/html; charset=iso-8859-1">
+<LINK REL="STYLESHEET" HREF="READMEdvi.css">
+</HEAD>
+<BODY >
+
+<IMG WIDTH="37" HEIGHT="24" ALIGN="BOTTOM" BORDER="0" ALT="next"
+ SRC="/tools/latex2html-98.1p1/icons.gif/next_motif_gr.gif">
+<IMG WIDTH="26" HEIGHT="24" ALIGN="BOTTOM" BORDER="0" ALT="up"
+ SRC="/tools/latex2html-98.1p1/icons.gif/up_motif_gr.gif">
+<IMG WIDTH="63" HEIGHT="24" ALIGN="BOTTOM" BORDER="0" ALT="previous"
+ SRC="/tools/latex2html-98.1p1/icons.gif/previous_motif_gr.gif"> <BR>
+<BR> <P>
+
+<!--End of Navigation Panel-->
+
+<P>
+
+<P>
+<H1 ALIGN="CENTER">Release Notice
+<BR>
+BlueGnu Testing Framework
+<BR>
+Version 2.0.3</H1>
+<P ALIGN="CENTER"><STRONG>Jan-Willem Neurdenburg
+<BR>
+jotOmega dsc
+<BR>
+56 Brigham Hill Road
+<BR>
+Grafton&nbsp;MA&nbsp;&nbsp;01519-1135
+<BR>
+neurdenburgj@acm.org
+<BR>
+Tel: (508) 839-0276
+<BR>
+Fax: (508) 839-7267</STRONG></P>
+<P ALIGN="LEFT"></P>
+
+<P>
+
+<H1><A NAME="SECTION00010000000000000000">
+Introduction</A>
+</H1>
+BlueGnu is a framework for testing other programs. It has been created
+to be compatible with DejaGnu. Its purpose is to provide a single
+front end for all tests. Beyond this, BlueGnu offers several
+advantages for testing:
+
+<P>
+<UL>
+<P>
+<LI>The flexibility and consistency of the BlueGnu framework makes it
+easy to write tests for any program, with the exception of GUI
+applications.
+
+<P>
+<LI>BlueGnu provides a layer of abstraction, which makes all tests
+(if correctly written) portable to any host or target where a program
+must be tested.
+
+<P>
+<LI>BlueGnu is written in [incr Tcl], which in turn is based on Tcl
+(Tool Command Language). The framework comprises two parts:
+<DL COMPACT>
+<DT>1.
+<DD>the testing framework,
+<DT>2.
+<DD>the test-suites or test-sets themselves.
+</DL>
+<P>
+<LI>BlueGnu will work with any Tcl based interpreter as long as
+[incr Tcl] has been included. You can include 'expect', 'Tk', and/or
+other extensions.
+
+<P>
+<LI>Includes DejaGnu release 1.6
+
+<P>
+</UL>
+<P>
+
+<H1><A NAME="SECTION00020000000000000000">
+Requirements</A>
+</H1>
+The following modules should have been installed, before you can
+install and/or use BlueGnu:
+
+<P>
+<UL>
+<LI>Tcl release 8.0 or higher,
+<LI>incr Tcl release 3.0 or higher.
+</UL>
+<P>
+Any other extensions that is compatible with Tcl release 8.0 can be used
+as well.
+
+<P>
+
+<H1><A NAME="SECTION00030000000000000000">
+Structure and Contents of the Release</A>
+</H1>
+
+<P>
+The root directory of the release contains the README files with
+installation instructions and the files needed to build and install
+this product. It also contains the executable scripts of the
+BlueGnu testing framework.
+
+<P>
+The top-level directories are listed below:
+
+<P>
+<DL>
+<DT><STRONG>lib:</STRONG>
+<DD>the packages and procedures that make the BlueGnu and
+DejaGnu testing framework. This also includes the default target
+definition files.
+<P>
+<DT><STRONG>testsets:</STRONG>
+<DD>the BlueGnu test-suites and test examples. It contains
+the following subdirectories.
+
+<P>
+<DL>
+<DT><STRONG>BlueGnu:</STRONG>
+<DD>test scripts to test the testing framework itself.
+<P>
+<DT><STRONG>examples:</STRONG>
+<DD>test suite and test script examples.
+
+<P>
+<DT><STRONG>config, lib, tools:</STRONG>
+<DD>currently empty, but can be used for
+test-set dependent configuration files, library files, and tools.
+</DL>
+<P>
+<DT><STRONG>config:</STRONG>
+<DD>currently empty.
+
+<P>
+<DT><STRONG>doc:</STRONG>
+<DD>the DejaGnu texinfo source and the documentation in
+'info', 'dvi', 'ps', and 'pdf' representation, respectively
+dejagnu.info*, dejagnu.dvi, dejagnu.ps, and dejagnu.pdf. A DejaGnu man
+page is also available.
+
+<P>
+It also contains
+the T<SMALL>E</SMALL>X version (README.tex) of this document as well as the 'dvi', 'ps'
+'html', and 'pdf' representation, respectively notice.dvi, notice.ps,
+notice.html, and notice.pdf.
+
+<P>
+<DT><STRONG>testsuite:</STRONG>
+<DD>contains a mixture of DejaGnu and BlueGnu test
+scripts.
+
+<P>
+<DT><STRONG>contrib:</STRONG>
+<DD>contains examples how DejaGnu is used at Cygnus.
+
+<P>
+<DT><STRONG>example:</STRONG>
+<DD>contains a full DejaGnu test framework example for testing the program 'calc' which is also included.
+
+<P>
+</DL>
+<P>
+
+<H1><A NAME="SECTION00040000000000000000">
+Installation and use under Unix</A>
+</H1>
+
+<P>
+Before you can install and use BlueGnu you need to have installed the
+following three packages:
+<UL>
+<LI>Tcl version 8.0.3
+<LI>Tk version 8.0.3
+<LI>incr Tcl version 3.0.1
+</UL>The source for these packages should all be located in one directory.
+The subdirectory in the directory should be:
+<UL>
+<LI>tcl8.0.3
+<LI>tk8.0.3
+<LI>itcl3.0.1
+</UL>
+<P>
+The following examples use the command `./configure
+-prefix=/tools/...`. This will install all packages in a directory
+``/tools''. When you omit the ``-prefix''-switch then the
+installation default will be the directory ``/usr/local''.
+
+<P>
+
+<H2><A NAME="SECTION00041000000000000000">
+Installation of needed Packages</A>
+</H2>
+
+<P>
+When you have not installed Tcl and the other needed extensions, then
+you need to retrieve the sources from ``www.tcltk.com/itcl''. You need
+to `gunzip` the files and do a `tar xf` of all these packages in one
+directory, let's call this directory ``TclTk''.
+
+<P>
+From the directory ``TclTk'', you should do the following to install
+the packages:
+
+<P>
+<PRE>
+% cd tcl8.0.3/unix
+% ./configure --prefix=/tools/tcl8.0.3 --enable-gcc --enable-shared
+% make
+% mkdir /tools/tcl8.0.3
+% make install
+% cd ../../tk8.0.3/unix
+% ./configure --prefix=/tools/tk8.0.3 --enable-gcc --enable-shared
+% make
+% mkdir /tools/tk8.0.3
+% make install
+% cd ../../itcl3.0.1
+% ./configure --prefix=/tools/itcl3.0.1 --enable-gcc --enable-shared
+% make
+% mkdir /tools/itcl3.0.1
+% make install
+</PRE>
+<P>
+
+<H2><A NAME="SECTION00042000000000000000">
+Installing BlueGnu</A>
+</H2>
+You can now `gunzip` and `tar xf` the BlueGnu version 2.0.3 in the
+directory ``TckTk''. This will create the directory
+``bluegnu2.0.3''. Now do the following:
+
+<P>
+<PRE>
+% cd bluegnu2.0.3
+% ./configure --prefix=/tools/bluegnu2.0.3
+% make
+% mkdir /tools/bluegnu2.0.3
+% make install
+</PRE>
+<P>
+This will install BlueGnu in the directories:
+<UL>
+<LI>/tools/bluegnu2.0.3/bin
+<LI>/tools/bluegnu2.0.3/lib/bluegnu
+<LI>/tools/bluegnu2.0.3/info
+<LI>/tools/bluegnu2.0.3/man
+</UL>
+<P>
+
+<H2><A NAME="SECTION00043000000000000000">
+Using BlueGnu</A>
+</H2>
+When you have installed [incr Tcl] and BlueGnu and you have the
+respective ``bin'' directories in your PATH variable, then you can
+start running some tests. You can go into the BlueGnu source directory
+``bluegnu2.0.3/testsets/examples'' and run the following:
+
+<P>
+<PRE>
+% bluegnu versionTcl.itcl
+% bluegnu ts_001
+% bluegnu ts_002
+% bluegnu ts_003
+</PRE>
+<P>
+The above test result should all be PASS. The following test will give
+a result UNKNOWN, because no pass/fail instruction have been given.
+
+<P>
+<PRE>
+% bluegnu tc001
+</PRE>
+<P>
+The last test you can run will fail in its simple form:
+
+<P>
+<PRE>
+% bluegnu tc002
+</PRE>
+<P>
+But will pass if you execute the test as follows:
+
+<P>
+<PRE>
+% bluegnu tc002[English]
+</PRE>
+<P>
+This is because the test scripts need a test case identifier to find
+the correct benchmark code.
+
+<P>
+
+<H1><A NAME="SECTION00050000000000000000">
+Changes</A>
+</H1>
+
+<H2><A NAME="SECTION00051000000000000000">
+Version 2.0.3</A>
+</H2>
+This being the first public release it is not to useful to list all
+the changes. BlueGnu has been modeled after DejaGnu and is a complete
+new implementation which has been tested thoroughly. When
+documentation is being written more changes will be made. An example
+of some of these changes as a result of this documentation effort can
+be found in the test-suites ts<code>_</code>001, ts<code>_</code>002, and
+ts<code>_</code>003. The first two are not as easy to write as the
+third. The test suite ts<code>_</code>001 is a script implementation of the
+command line:
+<PRE>
+% cd bluegnu2.0.3/testsets
+% bluegnu examples/tc002[English=B] \
+&gt; "examples/tc002[Dutch=B]={MSG=Hallo Wereld}"
+</PRE>This may be useful for simple tests but when you want to write more
+complex test-suite scripts you would like some more flexibility, so two
+procedures were introduced, which are shown in test-suite ts<code>_</code>002. This
+makes writing rather complex so the procedures have become part of
+the procedures 'appendQueue', 'prependQueue', and 'runtest'. The
+resulting script is shown in test-suit ts<code>_</code>003.
+
+<P>
+Changes like this will be made in the future!
+
+<P>
+
+<H1><A NAME="SECTION00060000000000000000">
+Future Enhancements</A>
+</H1>
+The following enhancements are being planned:
+<UL>
+<LI>Target code will be made into a class with methods 'start',
+'load', 'exit', and 'version'. Instead of the current
+'&lt;target&gt;<code>_</code>start', '&lt;target&gt;<code>_</code>load', '&lt;target&gt;<code>_</code>exit', and
+'&lt;target&gt;<code>_</code>version', which have been taken from DejaGnu.
+
+<P>
+<LI>Procedures will be created that make it easy to test WEB
+application from the framework.
+
+<P>
+<LI>Other enhancements will be made depending on the use of the
+framework in testing different applications.
+</UL>
+<H1><A NAME="SECTION00070000000000000000">
+ About this document ... </A>
+</H1>
+ <STRONG>Release Notice
+<BR>
+BlueGnu Testing Framework
+<BR>
+Version 2.0.3</STRONG><P>
+This document was generated using the
+<A HREF="http://www-dsed.llnl.gov/files/programs/unix/latex2html/manual/"><STRONG>LaTeX</STRONG>2<tt>HTML</tt></A> translator Version 98.1p1 release (March 2nd, 1998)
+<P>
+Copyright &#169; 1993, 1994, 1995, 1996, 1997,
+<A HREF="http://cbl.leeds.ac.uk/nikos/personal.html">Nikos Drakos</A>,
+Computer Based Learning Unit, University of Leeds.
+<P>
+The command line arguments were: <BR>
+ <STRONG>latex2html</STRONG> <tt>-t BlueGnu Release Notice -split 0 READMEdvi.tex</tt>.
+<P>
+The translation was initiated by Jan-Willem Neurdenburg on 1999-09-19<HR>
+<IMG WIDTH="37" HEIGHT="24" ALIGN="BOTTOM" BORDER="0" ALT="next"
+ SRC="/tools/latex2html-98.1p1/icons.gif/next_motif_gr.gif">
+<IMG WIDTH="26" HEIGHT="24" ALIGN="BOTTOM" BORDER="0" ALT="up"
+ SRC="/tools/latex2html-98.1p1/icons.gif/up_motif_gr.gif">
+<IMG WIDTH="63" HEIGHT="24" ALIGN="BOTTOM" BORDER="0" ALT="previous"
+ SRC="/tools/latex2html-98.1p1/icons.gif/previous_motif_gr.gif"> <BR>
+
+<!--End of Navigation Panel-->
+<ADDRESS>
+<I>Jan-Willem Neurdenburg <BR>
+1999-09-19</I>
+</ADDRESS>
+</BODY>
+</HTML>
diff --git a/contrib/bluegnu2.0.3/doc/notice.pdf b/contrib/bluegnu2.0.3/doc/notice.pdf
new file mode 100644
index 0000000..52645f4
--- /dev/null
+++ b/contrib/bluegnu2.0.3/doc/notice.pdf
@@ -0,0 +1,1165 @@
+%PDF-1.2
+8 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.19
+/Ascent 694.44
+/Descent -194.51
+/Flags 4
+/FontBBox [-232 -250 945 963]
+/FontName /CMR17
+/ItalicAngle 0
+/XHeight 430
+/StemV 80
+/FontFile 7 0 R
+>>
+endobj
+9 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F1
+/FontDescriptor 8 0 R
+/BaseFont /BHYBSB+CMR17
+/FirstChar 0
+/LastChar 127
+/Widths [575.97 772.08 719.84 641.07 615.35 693.31 667.59 719.84 667.59 719.84 667.59
+525.41 499.29 499.29 748.93 748.93 249.64 275.77 458.62 458.62 458.62 458.62 458.62
+693.31 406.37 458.62 667.59 719.84 458.62 837.18 941.67 719.84 249.64 249.64 458.62
+772.08 458.62 772.08 719.84 249.64 354.13 354.13 458.62 719.84 249.64 301.89 249.64
+458.62 458.62 458.62 458.62 458.62 458.62 458.62 458.62 458.62 458.62 458.62 249.64
+249.64 249.64 719.84 432.5 432.5 719.84 693.31 654.33 667.59 706.58 628.21 602.09
+726.27 693.31 327.61 471.48 719.44 575.97 850.05 693.31 719.84 628.21 719.84 680.45
+510.86 667.59 693.31 693.31 954.53 693.31 693.31 563.11 249.64 458.62 249.64 458.62
+249.64 249.64 458.62 510.86 406.37 510.86 406.37 275.77 458.62 510.86 249.64 275.77
+484.74 249.64 772.08 510.86 458.62 510.86 484.74 354.13 359.36 354.13 510.86 484.74
+667.59 484.74 484.74 406.37 458.62 917.24 458.62 458.62 458.62]
+>>
+endobj
+11 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-246 -251 988 968]
+/FontName /CMR12
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 10 0 R
+>>
+endobj
+12 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F2
+/FontDescriptor 11 0 R
+/BaseFont /JUQUTE+CMR12
+/FirstChar 0
+/LastChar 127
+/Widths [611.8 815.96 761.57 679.62 652.77 734.02 707.17 761.57 707.17 761.57 707.17
+571.17 543.98 543.98 815.96 815.96 271.99 299.19 489.58 489.58 489.58 489.58 489.58
+734.02 435.18 489.58 707.17 761.57 489.58 883.79 992.58 761.57 271.99 271.99 489.58
+815.96 489.58 815.96 761.57 271.99 380.78 380.78 489.58 761.57 271.99 326.39 271.99
+489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 271.99
+271.99 271.99 761.57 462.38 462.38 761.57 734.02 693.4 707.17 747.79 666.2 639 768.28
+734.02 353.24 503.01 761.22 611.8 897.21 734.02 761.57 666.2 761.57 720.6 543.98
+707.17 734.02 734.02 1006.01 734.02 734.02 598.37 271.99 489.58 271.99 489.58 271.99
+271.99 489.58 543.98 435.18 543.98 435.18 299.19 489.58 543.98 271.99 299.19 516.78
+271.99 815.96 543.98 489.58 543.98 516.78 380.78 386.22 380.78 543.98 516.78 707.17
+516.78 516.78 435.18 489.58 979.16 489.58 489.58 489.58]
+>>
+endobj
+14 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 686.11
+/Ascent 694.44
+/Descent -194.44
+/Flags 4
+/FontBBox [-296 -251 1139 946]
+/FontName /CMBX12
+/ItalicAngle 0
+/XHeight 444
+/StemV 80
+/FontFile 13 0 R
+>>
+endobj
+15 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F3
+/FontDescriptor 14 0 R
+/BaseFont /PRPCHF+CMBX12
+/FirstChar 0
+/LastChar 127
+/Widths [675.93 937.5 875 787.04 750 879.63 812.5 875 812.5 875 812.5 656.25 625
+625 937.5 937.5 312.5 343.75 562.5 562.5 562.5 562.5 562.5 849.54 500 574.07 812.5
+875 562.5 1018.52 1143.52 875 312.5 342.59 581.02 937.5 562.5 937.5 875 312.5 437.5
+437.5 562.5 875 312.5 375 312.5 562.5 562.5 562.5 562.5 562.5 562.5 562.5 562.5 562.5
+562.5 562.5 312.5 312.5 342.59 875 531.25 531.25 875 849.54 799.77 812.5 862.27 738.43
+707.18 884.26 879.63 418.98 581.02 880.79 675.93 1067.13 879.63 844.91 768.52 844.91
+839.12 625 782.41 864.58 849.54 1162.04 849.54 849.54 687.5 312.5 581.02 312.5 562.5
+312.5 312.5 546.88 625 500 625 513.31 343.75 562.5 625 312.5 343.75 593.75 312.5
+937.5 625 562.5 625 593.75 459.49 443.75 437.5 625 593.75 812.5 593.75 593.75 500
+562.5 1125 562.5 562.5 562.5]
+>>
+endobj
+17 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -960
+/Flags 68
+/FontBBox [-29 -960 1116 775]
+/FontName /CMSY10
+/ItalicAngle -14
+/XHeight 431
+/StemV 80
+/FontFile 16 0 R
+>>
+endobj
+18 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F4
+/FontDescriptor 17 0 R
+/BaseFont /MYFBJI+CMSY10
+/FirstChar 0
+/LastChar 127
+/Widths [777.78 277.78 777.78 500 777.78 500 777.78 777.78 777.78 777.78 777.78 777.78
+777.78 1000 500 500 777.78 777.78 777.78 777.78 777.78 777.78 777.78 777.78 777.78
+777.78 777.78 777.78 1000 1000 777.78 777.78 1000 1000 500 500 1000 1000 1000 777.78
+1000 1000 611.11 611.11 1000 1000 1000 777.78 275 1000 666.67 666.67 888.89 888.89
+0 0 555.56 555.56 666.67 500 722.22 722.22 777.78 777.78 611.11 798.47 656.81 526.53
+771.39 527.78 718.75 594.87 844.52 544.52 677.78 761.95 689.72 1200.9 820.49 796.11
+695.56 816.67 847.5 605.56 544.64 625.83 612.78 987.78 713.3 668.34 724.73 666.67
+666.67 666.67 666.67 666.67 611.11 611.11 444.45 444.45 444.45 444.45 500 500 388.89
+388.89 277.78 500 500 611.11 500 277.78 833.34 750 833.34 416.67 666.67 666.67 777.78
+777.78 444.45 444.45 444.45 611.11 777.78 777.78 777.78 777.78]
+>>
+endobj
+20 0 obj
+<<
+/Length 2396
+>>
+stream
+0 w 0 g 0 G BT/F1 20.66 Tf 172.82 -114.07 TD[(Release)-301(Notice)]TJ -58.8 -24.91 TD[(BlueGn)26(u)-301(T)77(esting)-301(F)78(ramew)26(ork)]TJ 66.1 -24.91 TD[(V)78(ersion)-301(2.0.3)]TJ/F2 14.35 Tf -24.54 -35.49 TD[(Jan-Willem)-326(Neurden)26(burg)]TJ 35.56 -17.93 TD[(jotOmega)-326(dsc)]TJ -25.71 -17.93 TD[(56)-326(Brigham)-326(Hill)-327(Road)]TJ -9.02 -17.94 TD[(Grafton)-326(MA)-653(01519-1135)]TJ 6.28 -17.93 TD[(neurden)27(burg)-26(j@acm.org)]TJ 10.54 -17.93 TD[(T)81(el:)-434(\(508\))-326(839-0276)]TJ -1.66 -17.93 TD[(F)81(ax:)-434(\(508\))-326(839-7267)]TJ 1.47 -28.05 TD[(Septem)27(b)-26(er)-327(19,)-326(1999)]TJ/F3 17.22 Tf -134.19 -52.4 TD[(1)-1124(In)30(tro)-30(duction)]TJ/F2 11.96 Tf 0 -26.28 TD[(BlueGn)27(u)-356(is)-356(a)-356(framew)26(ork)-355(for)-356(testing)-357(other)-356(programs.)-525(It)-356(has)-356(b)-27(een)-357(created)-356(to)]TJ 0 -14.45 TD[(b)-27(e)-300(compatible)-301(with)-301(DejaGn)26(u.)-425(Its)-301(purp)-27(ose)-301(is)-301(to)-301(pro)27(vide)-300(a)-301(single)-301(fron)26(t)-299(end)-301(for)]TJ 0 -14.44 TD[(all)-326(tests.)-435(Bey)26(ond)-325(this,)-327(BlueGn)27(u)-326(o\013ers)-326(sev)26(eral)-325(adv)53(an)27(tages)-325(for)-327(testing:)]TJ/F4 11.96 Tf 17.44 -26.97 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(The)-245(\015exibilit)26(y)-245(and)-246(consistency)-245(of)-246(the)-246(BlueGn)26(u)-245(framew)27(ork)-245(mak)26(es)-245(it)-246(easy)]TJ 0 -14.45 TD[(to)-283(write)-284(tests)-284(for)-284(an)27(y)-283(program,)-293(with)-283(the)-284(exception)-284(of)-284(GUI)-283(applications.)]TJ/F4 11.96 Tf -11.83 -24.3 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(BlueGn)27(u)-333(pro)26(vides)-333(a)-334(la)26(y)27(er)-333(of)-334(abstraction,)-336(whic)26(h)-333(mak)26(es)-333(all)-334(tests)-334(\(if)-334(cor-)]TJ 0 -14.45 TD[(rectly)-389(written\))-389(p)-28(ortable)-389(to)-390(an)27(y)-389(host)-389(or)-390(target)-389(where)-390(a)-389(program)-389(m)26(ust)]TJ 0 -14.44 TD[(b)-27(e)-326(tested.)]TJ/F4 11.96 Tf -11.83 -24.3 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(BlueGn)27(u)-376(is)-377(written)-377(in)-377([incr)-376(Tcl],)-390(whic)26(h)-375(in)-377(turn)-377(is)-377(based)-377(on)-376(Tcl)-377(\(T)80(o)-26(ol)]TJ 0 -14.45 TD[(Command)-326(Language\).)-435(The)-326(framew)26(ork)-326(comprises)-326(t)26(w)27(o)-325(parts:)]TJ 10.79 -24.3 TD[(1.)-489(the)-326(testing)-327(framew)26(ork,)]TJ 151.29 -29.89 TD[(1)]TJ ET 0 g 0 G
+endstream
+endobj
+22 0 obj
+<<
+/F1 9 0 R
+/F2 12 0 R
+/F3 15 0 R
+/F4 18 0 R
+>>
+endobj
+6 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 22 0 R
+>>
+endobj
+25 0 obj
+<<
+/Length 3301
+>>
+stream
+0 w 0 g 0 G BT/F2 11.96 Tf 78.91 -65.75 TD[(2.)-489(the)-326(test-suites)-327(or)-326(test-sets)-327(themselv)27(es.)]TJ/F4 11.96 Tf -22.62 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(BlueGn)27(u)-313(will)-314(w)26(ork)-313(with)-314(an)26(y)-313(Tcl)-314(based)-314(in)26(terpreter)-313(as)-314(long)-314(as)-314([incr)-315(Tcl])]TJ 0 -14.45 TD[(has)-301(b)-27(een)-301(included.)-427(Y)81(ou)-300(can)-302(include)-301('exp)-27(ect',)-306('Tk',)-306(and/or)-302(other)-301(exten-)]TJ 0 -14.44 TD[(sions.)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(Includes)-326(DejaGn)26(u)-325(release)-326(1.6)]TJ/F3 17.22 Tf -29.27 -39.94 TD[(2)-1124(Requiremen)30(ts)]TJ/F2 11.96 Tf 0 -26.28 TD[(The)-467(follo)26(wing)-466(mo)-27(dules)-467(should)-468(ha)26(v)28(e)-467(b)-27(een)-467(installed,)-503(b)-27(efore)-467(y)26(ou)-466(can)-468(install)]TJ 0 -14.45 TD[(and/or)-326(use)-326(BlueGn)26(u:)]TJ/F4 11.96 Tf 17.44 -27.39 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(Tcl)-326(release)-326(8.0)-327(or)-326(higher,)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(incr)-326(Tcl)-326(release)-327(3.0)-326(or)-326(higher.)]TJ -11.71 -27.4 TD[(An)27(y)-310(other)-310(extensions)-310(that)-311(is)-310(compatible)-310(with)-311(Tcl)-310(release)-310(8.0)-311(can)-310(b)-27(e)-311(used)]TJ -17.56 -14.45 TD[(as)-326(w)26(ell.)]TJ/F3 17.22 Tf 0 -39.93 TD[(3)-1124(Structure)-375(and)-375(Con)30(ten)31(ts)-374(of)-375(the)-375(Release)]TJ/F2 11.96 Tf 0 -26.28 TD[(The)-235(ro)-27(ot)-235(directory)-236(of)-235(the)-235(release)-235(con)26(tains)-235(the)-235(README)-235(\014les)-235(with)-236(installation)]TJ 0 -14.45 TD[(instructions)-407(and)-407(the)-408(\014les)-407(needed)-408(to)-407(build)-408(and)-407(install)-407(this)-408(pro)-27(duct.)-678(It)-408(also)]TJ 0 -14.45 TD[(con)27(tains)-326(the)-326(executable)-326(scripts)-327(of)-326(the)-327(BlueGn)27(u)-326(testing)-326(framew)26(ork.)]TJ 17.56 -14.44 TD[(The)-326(top-lev)26(el)-325(directories)-326(are)-327(listed)-326(b)-27(elo)26(w:)]TJ/F3 11.96 Tf -17.56 -27.4 TD[(lib:)]TJ/F2 11.96 Tf 24.54 0 TD[(the)-275(pac)26(k)54(ages)-274(and)-276(pro)-27(cedures)-276(that)-276(mak)26(e)-274(the)-276(BlueGn)26(u)-275(and)-275(DejaGn)26(u)-275(test-)]TJ 4.73 -14.44 TD[(ing)-326(framew)26(ork.)-434(This)-326(also)-327(includes)-326(the)-326(default)-327(target)-326(de\014nition)-327(\014les.)]TJ/F3 11.96 Tf -29.27 -24.41 TD[(testsets:)]TJ/F2 11.96 Tf 53.47 0 TD[(the)-298(BlueGn)26(u)-298(test-suites)-299(and)-298(test)-299(examples.)-426(It)-299(con)26(tains)-298(the)-298(follo)26(w-)]TJ -24.2 -14.45 TD[(ing)-326(sub)-27(directories.)]TJ/F3 11.96 Tf 0 -27.4 TD[(BlueGn)31(u:)]TJ/F2 11.96 Tf 61.64 0 TD[(test)-326(scripts)-326(to)-327(test)-326(the)-326(testing)-327(framew)26(ork)-325(itself.)]TJ/F3 11.96 Tf -61.64 -19.42 TD[(examples:)]TJ/F2 11.96 Tf 63.22 0 TD[(test)-326(suite)-326(and)-327(test)-326(script)-326(examples.)]TJ/F3 11.96 Tf -63.22 -19.43 TD[(con\014g,)-375(lib,)-375(to)-31(ols:)]TJ/F2 11.96 Tf 103.44 0 TD[(curren)27(tly)-402(empt)26(y)82(,)-421(but)-403(can)-403(b)-27(e)-403(used)-403(for)-403(test-set)-403(de-)]TJ -77.69 -14.45 TD[(p)-27(enden)26(t)-325(con\014guration)-326(\014les,)-327(library)-326(\014les,)-326(and)-327(to)-27(ols.)]TJ 136.33 -41.41 TD[(2)]TJ ET 0 g 0 G
+endstream
+endobj
+26 0 obj
+<<
+/F2 12 0 R
+/F4 18 0 R
+/F3 15 0 R
+>>
+endobj
+24 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 26 0 R
+>>
+endobj
+29 0 obj
+<<
+/Length 3404
+>>
+stream
+0 w 0 g 0 G BT/F3 11.96 Tf 38.85 -65.75 TD[(con\014g:)]TJ/F2 11.96 Tf 43.96 0 TD[(curren)27(tly)-326(empt)27(y)81(.)]TJ/F3 11.96 Tf -43.96 -24.41 TD[(do)-31(c:)]TJ/F2 11.96 Tf 30.14 0 TD[(the)-275(DejaGn)26(u)-275(texinfo)-275(source)-276(and)-275(the)-276(do)-27(cumen)26(tation)-275(in)-275('info',)-286('dvi',)-286('ps',)]TJ -0.87 -14.45 TD[(and)-426('p)-28(df)-69(')-427(represen)26(tation,)-451(resp)-27(ectiv)26(ely)-426(dejagn)26(u.info*,)-451(dejagn)26(u.dvi,)-451(de-)]TJ 0 -14.44 TD[(jagn)27(u.ps,)-326(and)-326(dejagn)26(u.p)-26(df.)-435(A)-327(DejaGn)27(u)-326(man)-326(page)-327(is)-326(also)-326(a)26(v)54(ailable.)]TJ 0 -19.43 TD[(It)-375(also)-375(con)26(tains)-374(the)-376(T)]TJ 111.07 -2.57 TD[(E)]TJ 6.5 2.57 TD[(X)-375(v)26(ersion)-374(\(README.tex\))-375(of)-376(this)-375(do)-27(cumen)26(t)-374(as)]TJ -117.57 -14.45 TD[(w)27(ell)-340(as)-340(the)-341('dvi',)-343('ps')-341('h)26(tml',)-343(and)-340('p)-27(df)-70(')-340(represen)26(tation,)-343(resp)-27(ectiv)26(ely)-339(no-)]TJ 0 -14.44 TD[(tice.dvi,)-326(notice.ps,)-326(notice.h)26(tml,)-325(and)-327(notice.p)-27(df.)]TJ/F3 11.96 Tf -29.27 -24.41 TD[(testsuite:)]TJ/F2 11.96 Tf 59.38 0 TD[(con)27(tains)-326(a)-326(mixture)-326(of)-327(DejaGn)26(u)-325(and)-326(BlueGn)26(u)-326(test)-326(scripts.)]TJ/F3 11.96 Tf -59.38 -24.41 TD[(con)31(trib:)]TJ/F2 11.96 Tf 51.33 0 TD[(con)27(tains)-326(examples)-326(ho)26(w)-325(DejaGn)26(u)-325(is)-327(used)-326(at)-327(Cygn)27(us.)]TJ/F3 11.96 Tf -51.33 -24.41 TD[(example:)]TJ/F2 11.96 Tf 57.92 0 TD[(con)27(tains)-384(a)-386(full)-385(DejaGn)26(u)-384(test)-385(framew)26(ork)-384(example)-385(for)-385(testing)-386(the)]TJ -28.65 -14.44 TD[(program)-326('calc')-326(whic)26(h)-325(is)-327(also)-326(included.)]TJ/F3 17.22 Tf -29.27 -39.94 TD[(4)-1124(Installation)-375(and)-375(use)-375(under)-375(Unix)]TJ/F2 11.96 Tf 0 -26.28 TD[(Before)-370(y)26(ou)-369(can)-371(install)-370(and)-371(use)-370(BlueGn)26(u)-369(y)26(ou)-370(need)-370(to)-371(ha)27(v)27(e)-370(installed)-370(the)-371(fol-)]TJ 0 -14.45 TD[(lo)27(wing)-326(three)-326(pac)26(k)55(ages:)]TJ/F4 11.96 Tf 17.44 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(Tcl)-326(v)26(ersion)-325(8.0.3)]TJ/F4 11.96 Tf -11.83 -24.4 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(Tk)-326(v)26(ersion)-325(8.0.3)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(incr)-326(Tcl)-326(v)26(ersion)-325(3.0.1)]TJ -29.27 -24.41 TD[(The)-410(source)-410(for)-410(these)-410(pac)26(k)55(ages)-410(should)-410(all)-410(b)-27(e)-410(lo)-27(cated)-410(in)-411(one)-410(directory)81(.)-686(The)]TJ 0 -14.45 TD[(sub)-27(directory)-326(in)-326(the)-327(directory)-326(should)-327(b)-27(e:)]TJ/F4 11.96 Tf 17.44 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(tcl8.0.3)]TJ/F4 11.96 Tf -11.83 -24.4 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(tk8.0.3)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(itcl3.0.1)]TJ -11.71 -24.41 TD[(The)-261(follo)26(wing)-260(examples)-262(use)-261(the)-262(command)-261(`./con\014gure)-262({pre\014x=/to)-27(ols/...`.)]TJ -17.56 -14.45 TD[(This)-332(will)-332(install)-332(all)-332(pac)27(k)54(ages)-331(in)-332(a)-332(directory)-332(\\/to)-27(ols".)-453(When)-332(y)27(ou)-331(omit)-333(the)-332(\\{)]TJ 0 -14.44 TD[(pre\014x"-switc)27(h)-254(then)-255(the)-255(installation)-254(default)-255(will)-255(b)-27(e)-255(the)-255(directory)-255(\\/usr/lo)-27(cal".)]TJ 191.35 -55.83 TD[(3)]TJ ET 0 g 0 G
+endstream
+endobj
+30 0 obj
+<<
+/F3 15 0 R
+/F2 12 0 R
+/F4 18 0 R
+>>
+endobj
+28 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 30 0 R
+>>
+endobj
+34 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 611.11
+/Ascent 611.11
+/Descent -222.22
+/Flags 5
+/FontBBox [-1 -234 716 801]
+/FontName /CMTT12
+/ItalicAngle 0
+/XHeight 431
+/StemV 80
+/FontFile 33 0 R
+>>
+endobj
+35 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F5
+/FontDescriptor 34 0 R
+/BaseFont /ATVUDO+CMTT12
+/FirstChar 0
+/LastChar 127
+/Widths [514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58
+514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58 514.58]
+>>
+endobj
+36 0 obj
+<<
+/Length 2558
+>>
+stream
+0 w 0 g 0 G BT/F3 14.35 Tf 38.85 -65.75 TD[(4.1)-1124(Installation)-375(of)-375(needed)-375(P)30(ac)31(k)63(ages)]TJ/F2 11.96 Tf 0 -22.17 TD[(When)-324(y)26(ou)-324(ha)26(v)27(e)-323(not)-325(installed)-325(Tcl)-325(and)-325(the)-324(other)-325(needed)-325(extensions,)-325(then)-325(y)26(ou)]TJ 0 -14.45 TD[(need)-252(to)-252(retriev)26(e)-251(the)-252(sources)-252(from)-252(\\www.tcltk.com/itcl".)-411(Y)81(ou)-251(need)-252(to)-252(`gunzip`)]TJ 0 -14.44 TD[(the)-310(\014les)-311(and)-311(do)-310(a)-311(`tar)-311(xf`)-311(of)-310(all)-311(these)-311(pac)26(k)55(ages)-310(in)-311(one)-310(directory)80(,)-313(let's)-310(call)-311(this)]TJ 0 -14.45 TD[(directory)-326(\\TclTk".)]TJ 17.56 -14.44 TD[(F)81(rom)-393(the)-394(directory)-394(\\TclTk",)-411(y)26(ou)-393(should)-394(do)-394(the)-395(follo)27(wing)-393(to)-395(install)-394(the)]TJ -17.56 -14.45 TD[(pac)27(k)54(ages:)]TJ/F5 11.96 Tf 0 -27.4 TD[(%)-514(cd)-515(tcl8.0.3/unix)]TJ 0 -14.44 TD[(%)-514(./configure)-515(--prefix=/tools/tcl8.0.3)-514(--enable-gcc)-515(--enable-shared)]TJ 0 -14.45 TD[(%)-514(make)]TJ 0 -14.44 TD[(%)-514(mkdir)-515(/tools/tcl8.0.3)]TJ 0 -14.45 TD[(%)-514(make)-515(install)]TJ 0 -14.45 TD[(%)-514(cd)-515(../../tk8.0.3/unix)]TJ 0 -14.44 TD[(%)-514(./configure)-515(--prefix=/tools/tk8.0.3)-514(--enable-gcc)-515(--enable-shared)]TJ 0 -14.45 TD[(%)-514(make)]TJ 0 -14.44 TD[(%)-514(mkdir)-515(/tools/tk8.0.3)]TJ 0 -14.45 TD[(%)-514(make)-515(install)]TJ 0 -14.44 TD[(%)-514(cd)-515(../../itcl3.0.1)]TJ 0 -14.45 TD[(%)-514(./configure)-515(--prefix=/tools/itcl3.0.1)-514(--enable-gcc)-515(--enable-shared)]TJ 0 -14.45 TD[(%)-514(make)]TJ 0 -14.44 TD[(%)-514(mkdir)-515(/tools/itcl3.0.1)]TJ 0 -14.45 TD[(%)-514(make)-515(install)]TJ/F3 14.35 Tf 0 -34.66 TD[(4.2)-1124(Installing)-375(BlueGn)30(u)]TJ/F2 11.96 Tf 0 -22.17 TD[(Y)81(ou)-411(can)-412(no)26(w)-411(`gunzip`)-412(and)-412(`tar)-412(xf`)-413(the)-412(BlueGn)27(u)-412(v)27(ersion)-412(2.0.3)-412(in)-412(the)-412(direc-)]TJ 0 -14.44 TD[(tory)-401(\\Tc)26(kTk".)-660(This)-401(will)-402(create)-402(the)-401(directory)-402(\\bluegn)26(u2.0.3".)-659(No)26(w)-401(do)-401(the)]TJ 0 -14.45 TD[(follo)27(wing:)]TJ/F5 11.96 Tf 0 -27.4 TD[(%)-514(cd)-515(bluegnu2.0.3)]TJ 0 -14.44 TD[(%)-514(./configure)-515(--prefix=/tools/bluegnu2.0.3)]TJ 0 -14.45 TD[(%)-514(make)]TJ 0 -14.44 TD[(%)-514(mkdir)-515(/tools/bluegnu2.0.3)]TJ 0 -14.45 TD[(%)-514(make)-515(install)]TJ/F2 11.96 Tf 17.56 -27.4 TD[(This)-326(will)-326(install)-327(BlueGn)27(u)-326(in)-326(the)-327(directories:)]TJ 173.79 -42.05 TD[(4)]TJ ET 0 g 0 G
+endstream
+endobj
+37 0 obj
+<<
+/F3 15 0 R
+/F2 12 0 R
+/F5 35 0 R
+>>
+endobj
+32 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 37 0 R
+>>
+endobj
+40 0 obj
+<<
+/Length 2393
+>>
+stream
+0 w 0 g 0 G BT/F4 11.96 Tf 56.29 -65.75 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(/to)-27(ols/bluegn)26(u2.0.3/bin)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(/to)-27(ols/bluegn)26(u2.0.3/lib/bluegn)28(u)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(/to)-27(ols/bluegn)26(u2.0.3/info)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(/to)-27(ols/bluegn)26(u2.0.3/man)]TJ/F3 14.35 Tf -29.27 -34.66 TD[(4.3)-1124(Using)-375(BlueGn)30(u)]TJ/F2 11.96 Tf 0 -22.17 TD[(When)-384(y)26(ou)-384(ha)26(v)27(e)-383(installed)-385([incr)-385(Tcl])-385(and)-385(BlueGn)27(u)-384(and)-385(y)26(ou)-384(ha)27(v)27(e)-384(the)-385(resp)-27(ec-)]TJ 0 -14.44 TD[(tiv)27(e)-231(\\bin")-231(directories)-232(in)-231(y)26(our)-231(P)81(A)82(TH)-231(v)53(ariable,)-249(then)-232(y)27(ou)-231(can)-231(start)-232(running)-231(some)]TJ 0 -14.45 TD[(tests.)-398(Y)80(ou)-216(can)-218(go)-218(in)27(to)-217(the)-218(BlueGn)27(u)-217(source)-218(directory)-217(\\bluegn)26(u2.0.3/testsets/examples")]TJ 0 -14.44 TD[(and)-326(run)-326(the)-327(follo)27(wing:)]TJ/F5 11.96 Tf 0 -27.4 TD[(%)-514(bluegnu)-515(versionTcl.itcl)]TJ 0 -14.45 TD[(%)-514(bluegnu)-515(ts_001)]TJ 0 -14.44 TD[(%)-514(bluegnu)-515(ts_002)]TJ 0 -14.45 TD[(%)-514(bluegnu)-515(ts_003)]TJ/F2 11.96 Tf 17.56 -27.4 TD[(The)-356(ab)-28(o)27(v)27(e)-356(test)-357(result)-357(should)-357(all)-357(b)-27(e)-357(P)80(ASS.)-356(The)-357(follo)26(wing)-356(test)-357(will)-357(giv)27(e)-356(a)]TJ -17.56 -14.44 TD[(result)-326(UNKNO)26(WN,)-325(b)-27(ecause)-327(no)-326(pass/fail)-326(instruction)-327(ha)26(v)28(e)-326(b)-27(een)-326(giv)26(en.)]TJ/F5 11.96 Tf 0 -27.4 TD[(%)-514(bluegnu)-515(tc001)]TJ/F2 11.96 Tf 17.56 -27.4 TD[(The)-326(last)-326(test)-327(y)27(ou)-326(can)-326(run)-327(will)-326(fail)-326(in)-327(its)-326(simple)-327(form:)]TJ/F5 11.96 Tf -17.56 -27.39 TD[(%)-514(bluegnu)-515(tc002)]TJ/F2 11.96 Tf 17.56 -27.4 TD[(But)-326(will)-326(pass)-327(if)-326(y)26(ou)-325(execute)-327(the)-326(test)-326(as)-327(follo)26(ws:)]TJ/F5 11.96 Tf -17.56 -27.4 TD[(%)-514(bluegnu)-515(tc002[English])]TJ/F2 11.96 Tf 17.56 -27.4 TD[(This)-463(is)-463(b)-27(ecause)-463(the)-463(test)-463(scripts)-463(need)-463(a)-463(test)-463(case)-463(iden)26(ti\014er)-462(to)-463(\014nd)-463(the)]TJ -17.56 -14.44 TD[(correct)-326(b)-27(enc)26(hmark)-325(co)-27(de.)]TJ 191.35 -99.59 TD[(5)]TJ ET 0 g 0 G
+endstream
+endobj
+41 0 obj
+<<
+/F4 18 0 R
+/F2 12 0 R
+/F3 15 0 R
+/F5 35 0 R
+>>
+endobj
+39 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 41 0 R
+>>
+endobj
+45 0 obj
+<<
+/Type /FontDescriptor
+/CapHeight 683.33
+/Ascent 694.44
+/Descent -194.44
+/Flags 68
+/FontBBox [-30 -250 1026 750]
+/FontName /CMMI12
+/ItalicAngle -14
+/XHeight 431
+/StemV 80
+/FontFile 44 0 R
+>>
+endobj
+46 0 obj
+<<
+/Type /Font
+/Subtype /Type1
+/Name /F6
+/FontDescriptor 45 0 R
+/BaseFont /AEVAHO+CMMI12
+/FirstChar 0
+/LastChar 127
+/Widths [606.65 815.96 748.3 679.62 728.67 811.28 765.79 571.17 652.77 598.03 757.63
+622.79 552.77 507.89 433.67 395.37 427.66 483.1 456.3 346.06 563.65 571.17 589.12
+483.79 427.66 555.44 505.03 556.53 425.23 527.77 579.51 613.42 636.57 609.72 458.21
+577.08 808.91 505.03 354.16 641.43 979.16 979.16 979.16 979.16 271.99 271.99 489.58
+489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 489.58 271.99
+271.99 761.57 489.58 761.57 489.58 516.89 734.02 743.86 700.54 812.98 724.82 633.85
+772.35 811.28 431.86 541.2 833.04 666.2 947.27 784.08 748.3 631.13 775.5 745.29 602.19
+573.89 665.01 570.83 924.41 812.64 568.11 670.19 380.78 380.78 380.78 979.16 979.16
+410.88 514 416.31 421.41 508.79 453.82 482.64 468.86 563.65 334.03 405.09 509.25
+291.66 856.47 584.48 470.71 491.43 434.14 441.26 461.22 353.58 557.29 473.37 699.93
+556.42 477.43 454.86 312.5 377.89 623.37 489.58 271.99]
+>>
+endobj
+47 0 obj
+<<
+/Length 4786
+>>
+stream
+0 w 0 g 0 G BT/F3 17.22 Tf 38.85 -65.75 TD[(5)-1124(Changes)]TJ/F3 14.35 Tf 0 -29.78 TD[(5.1)-1124(V)92(ersion)-374(2.0.3)]TJ/F2 11.96 Tf 0 -22.16 TD[(This)-370(b)-28(eing)-370(the)-371(\014rst)-371(public)-371(release)-371(it)-370(is)-371(not)-371(to)-371(useful)-371(to)-371(list)-370(all)-371(the)-371(c)26(hanges.)]TJ 0 -14.45 TD[(BlueGn)27(u)-462(has)-462(b)-27(een)-463(mo)-27(deled)-462(after)-463(DejaGn)26(u)-461(and)-463(is)-462(a)-462(complete)-463(new)-462(imple-)]TJ 0 -14.44 TD[(men)27(tation)-323(whic)26(h)-323(has)-325(b)-27(een)-324(tested)-324(thoroughly)80(.)-433(When)-324(do)-27(cumen)26(tation)-323(is)-324(b)-28(eing)]TJ 0 -14.45 TD[(written)-301(more)-302(c)26(hanges)-301(will)-302(b)-27(e)-302(made.)-427(An)-302(example)-302(of)-302(some)-302(of)-302(these)-302(c)26(hanges)-301(as)]TJ 0 -14.45 TD[(a)-350(result)-351(of)-351(this)-351(do)-27(cumen)26(tation)-350(e\013ort)-351(can)-350(b)-28(e)-350(found)-351(in)-351(the)-351(test-suites)-351(ts)]TJ/F5 11.96 Tf 361.58 0 TD[(_)]TJ/F2 11.96 Tf 6.16 0 TD[(001,)]TJ -367.74 -14.44 TD[(ts)]TJ/F5 11.96 Tf 9.17 0 TD[(_)]TJ/F2 11.96 Tf 6.16 0 TD[(002,)-331(and)-330(ts)]TJ/F5 11.96 Tf 56.75 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(003.)-447(The)-330(\014rst)-331(t)26(w)28(o)-330(are)-330(not)-331(as)-330(easy)-331(to)-330(write)-330(as)-331(the)-330(third.)-448(The)]TJ -78.23 -14.45 TD[(test)-326(suite)-326(ts)]TJ/F5 11.96 Tf 60.03 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(001)-326(is)-326(a)-327(script)-326(implemen)26(tation)-325(of)-327(the)-326(command)-326(line:)]TJ/F5 11.96 Tf -66.18 -24.41 TD[(%)-514(cd)-515(bluegnu2.0.3/testsets)]TJ 0 -14.44 TD[(%)-514(bluegnu)-515(examples/tc002[English=B])-514(\\)]TJ 0 -14.45 TD[(>)-514("examples/tc002[Dutch=B]={MSG=Hallo)-515(Wereld}")]TJ/F2 11.96 Tf 0 -24.41 TD[(This)-351(ma)26(y)-350(b)-27(e)-352(useful)-351(for)-352(simple)-351(tests)-352(but)-351(when)-352(y)27(ou)-351(w)26(an)27(t)-350(to)-351(write)-352(more)-351(com-)]TJ 0 -14.44 TD[(plex)-277(test-suite)-277(scripts)-277(y)26(ou)-276(w)26(ould)-277(lik)27(e)-277(some)-277(more)-277(\015exibilit)26(y)82(,)-287(so)-277(t)26(w)28(o)-277(pro)-27(cedures)]TJ 0 -14.45 TD[(w)27(ere)-374(in)26(tro)-26(duced,)-387(whic)26(h)-373(are)-375(sho)26(wn)-374(in)-375(test-suite)-374(ts)]TJ/F5 11.96 Tf 255.16 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(002.)-580(This)-375(mak)27(es)-374(writing)]TJ -261.31 -14.44 TD[(rather)-386(complex)-386(so)-387(the)-386(pro)-28(cedures)-386(ha)26(v)27(e)-385(b)-27(ecome)-387(part)-386(of)-387(the)-386(pro)-28(cedures)-386('ap-)]TJ 0 -14.45 TD[(p)-27(endQueue',)-304('prep)-27(endQueue',)-304(and)-299('run)26(test'.)-425(The)-298(resulting)-299(script)-299(is)-298(sho)26(wn)-298(in)]TJ 0 -14.44 TD[(test-suit)-326(ts)]TJ/F5 11.96 Tf 54.83 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(003.)]TJ -43.42 -14.45 TD[(Changes)-326(lik)26(e)-325(this)-326(will)-327(b)-27(e)-326(made)-327(in)-326(the)-327(future!)]TJ/F3 17.22 Tf -17.56 -39.93 TD[(6)-1124(F)92(uture)-374(Enhancemen)31(ts)]TJ/F2 11.96 Tf 0 -26.29 TD[(The)-326(follo)26(wing)-325(enhancemen)26(ts)-325(are)-327(b)-27(eing)-326(planned:)]TJ/F4 11.96 Tf 17.44 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(T)81(arget)-246(co)-27(de)-247(will)-247(b)-27(e)-247(made)-247(in)26(to)-246(a)-247(class)-246(with)-247(metho)-28(ds)-246('start',)-263('load',)-263('exit',)]TJ 0 -14.44 TD[(and)-217('v)26(ersion'.)-398(Instead)-217(of)-218(the)-218(curren)27(t)-217(')]TJ/F6 11.96 Tf 185.36 0 TD[(<)]TJ/F2 11.96 Tf 9.11 0 TD[(target)]TJ/F6 11.96 Tf 30.56 0 TD[(>)]TJ/F5 11.96 Tf 9.11 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(start',)-239(')]TJ/F6 11.96 Tf 36.74 0 TD[(<)]TJ/F2 11.96 Tf 9.11 0 TD[(target)]TJ/F6 11.96 Tf 30.56 0 TD[(>)]TJ/F5 11.96 Tf 9.11 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(load',)]TJ -331.96 -14.45 TD[(')]TJ/F6 11.96 Tf 3.25 0 TD[(<)]TJ/F2 11.96 Tf 9.11 0 TD[(target)]TJ/F6 11.96 Tf 30.56 0 TD[(>)]TJ/F5 11.96 Tf 9.11 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(exit',)-334(and)-334(')]TJ/F6 11.96 Tf 55.78 0 TD[(<)]TJ/F2 11.96 Tf 9.11 0 TD[(target)]TJ/F6 11.96 Tf 30.56 0 TD[(>)]TJ/F5 11.96 Tf 9.11 0 TD[(_)]TJ/F2 11.96 Tf 6.15 0 TD[(v)27(ersion',)-334(whic)26(h)-332(ha)26(v)27(e)-332(b)-27(een)-333(tak)26(en)-332(from)]TJ -168.89 -14.44 TD[(DejaGn)27(u.)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(Pro)-27(cedures)-331(will)-331(b)-27(e)-331(created)-331(that)-331(mak)27(e)-330(it)-331(easy)-331(to)-331(test)-331(WEB)-331(application)]TJ 0 -14.45 TD[(from)-326(the)-326(framew)26(ork.)]TJ/F4 11.96 Tf -11.83 -24.41 TD[(\017)]TJ/F2 11.96 Tf 11.83 0 TD[(Other)-340(enhancemen)27(ts)-339(will)-340(b)-28(e)-340(made)-340(dep)-27(ending)-340(on)-340(the)-340(use)-340(of)-340(the)-340(frame-)]TJ 0 -14.44 TD[(w)27(ork)-326(in)-326(testing)-326(di\013eren)26(t)-326(applications.)]TJ 162.08 -49.72 TD[(6)]TJ ET 0 g 0 G
+endstream
+endobj
+48 0 obj
+<<
+/F3 15 0 R
+/F2 12 0 R
+/F5 35 0 R
+/F4 18 0 R
+/F6 46 0 R
+>>
+endobj
+43 0 obj
+<<
+/ProcSet [/PDF /Text /ImageC]
+/Font 48 0 R
+>>
+endobj
+7 0 obj
+<<
+/Length1 1137
+/Length2 5239
+/Length3 533
+/Length 6909
+>>
+stream
+%!PS-AdobeFont-1.1: CMR17 1.0
+%%CreationDate: 1991 Aug 20 16:38:24
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR17) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /BHYBSB+CMR17 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 46 /period put
+dup 48 /zero put
+dup 50 /two put
+dup 51 /three put
+dup 66 /B put
+dup 70 /F put
+dup 71 /G put
+dup 78 /N put
+dup 82 /R put
+dup 84 /T put
+dup 86 /V put
+dup 97 /a put
+dup 99 /c put
+dup 101 /e put
+dup 103 /g put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 119 /w put
+readonly def
+/FontBBox{-33 -250 945 749}readonly def
+/UniqueID 5000795 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+sýe[z.W/3x¬“=×P‚òñhp+á›Æ ïkÕð­¡€ÒÀK}¹¶Û®þ è ¨ ߥ6m“ >hÊSärõ%…?LxO,,: š4Ùß
+" ôFùtð,bNì“BÊÄ$>Ú‚†\UÞ|fõôÜGÇUK0¨>2ÕH‹ë¢þ4ÉtNÎÕQ\6òz¡â
+±J›Èôç(ùد-¬•­‘ù/8RfKý)ˆzÄæ;féIÆ‚`þ¶c©˜µYVìZƒ£5Ü¿^¬xöÓ´enÜ»Ú[¨q¯óHwSþ`EU-?©G¸Ó~<ÅÐäl)‹2\M8´ÇF2릭ƒÏ%IÕd®º ë°+îÑž/ç|=ÛOìr£Ì.à…=”±…ëlÿ£c³šnCw)8VÜnŒÓ]*D$h0VŠ±ä=€UÉ?ø¦œ´vZ½M\·ã^'éĘ|`Ì`z²j™iÅ™–lu1¤ˆ8®±…[Õ>pgKþÎM’—Ú–›¨-=@ܼŸ¸…Y‚%&†Éâì¾ ¯H
+&’7+ !îSaÆšx“
+ücpä`F2ÀBX.&!˾ÞæÐÃÛÛ÷$ɤ¹n‹‹ø?ɪõ¾í®ºýËSí—G`3&Þv\ß““®9OнQwÌ縠¨ì,k=Ý<µNl÷I™ÏÎûÑî •4fVÖ¹9J«Ö=ñ©ÌöÚá
+p ŸÙ/½Z 
+^¡´xÓ²–^(í¿ì´Ò \“œW˜¨ºÓM“§e7·1Ô½ W}`¦r.Ì Ñ“ˆÓΩXŠÒ‡P>¨&ÿÕ8ЬÀJõ@&ræ3hÌ7àÌ„‘çkD–«YkŠá¸òuÛÖl&Í+¨å•Ù«]Öñ6$e_æâ@ c³CÖPŽ‰¤*-ìÄB÷eÇ%ÈoŸžyj!ŒPŒ—pšêHªÉ«e,–~R ­› Ûæ0IÓ,Š/¡×¤TæÄõ4‚ù¥É¸J©,
+=ãõK¥ãÞ-çy\ï+éÅ ÓråOy¯†¯”§§u=Ÿt+ŸéCô¡cÙIÇ$ùèÈ–Éåmâ¨ñ iþ‰&¹Øœ”ålœ…‡!Û‘ <OC@šþQm´±ë@p[±L.}€ãà÷ÌFGBFllˆ‘_ùx\nB^üÐÇÃqróL¥× dÌ·(H¦êoW›yU¤5j˜Y~ ‹%Š‘ׄqÓ?¢yŽQËHi ‹­s^3þ6ïÞ
+„k;Kâö×óöD=ñ~š5û‡š]T‰¥·×–x¸Ud¯"°ÉhÛé\F¶MÐlj\”¹–‚G´ºG&“!Jßœ)ËP4›d\gtYe»šN±z³1Œ 0{½ô86‰‚åîvÌhI–¼ƒû DÒ^„·-d"ÃÒå×z Š3z\jíƒÔZˆv7Æhi?ÞǦÌúZ”ê"ÚÝÒìš´Ÿ›
+B'ŽÄ\H(ÆYèV6’þ4 ³?PÔ£½¬cLkݾÅÒòœÙ:ûÐw°ÀñÁÝùêøD„3""„ÙL`BˆXÎ~â1×…ƒ3ËÙüÍ×s*Ò̘!»O¦¡åTkŒ}C&Zˆ¨‹ƒšÏ%Q‹W¥ß
+Ríá-J©ÍwÃyð'ÌI“wÊ·?Ê8ò’ÚûîTÖ{…ºÜÜÒi‘=¥ |Ã;„÷$’œªœÂMw«(IK,+°8ámöóÆ÷ìn[’昆M½#'Èú{îžê´ ÑîŽ"ìiN\,÷œ|Þzç7¦ì›íò@½Ÿ@êK8å“tLS£-ÞGHÀÛ€k™ò¼î×^Óå—îàaI3¬ Þ«êLÞ»{ÂN]T6u®NßJ=6(Oò®*Öô»¯~èD$×£Hê-uNU
+1á:µÐ» ¾ù´’!ŠÞÖ Âðh
+]YÛZÉBT‰è$‹Pª‹b¹ïµ~ëvÇÎ×âN7°­xjÂÆåã„3Ù;VGµ˜:6×<9CœÏ²·ÿI*C}T–_ð!ÊñöÖƒŠ^’]áYsƒ"tyi]Ó¡ÙG ëºU5SxºêkúX³â"‚H+áÙM YšÀæ>¦ ¤V^Öµ¿½Gs
++ñ£*YC=fUýe°`Ëi–ôÅ mäÖeBá³Ü_1í¢ÿ6úͦØÕÖê Ë`´ )f•ïš*˜ÓŽë?oRýƒ&Ü~ó&‡?V ËÌ3¸ˆ”ß¡­rÑ”‡Ê™ª~^þ¯âú¼oÓœTÌšZžgºtVœ•T‡Ta¬—9±ZºÅ<Äc,ó/BS•€çy—ú±ìÊ©óQÍ ¸ïMj¾kÂ
+#U07=·ì¯iyòúªA›¤~Vß´|åw-x÷™¶ul÷/!¢-ĽEŽS‹ëÚg8Å¥Ëù>;H"Þn×V°€D‡a“«ˆCr†ŽT‰¿
+›*œ ‰÷2bµÐÄ»HƒyßÅÛålZl#——Æ5¡^ª¾~žVµ«!
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+10 0 obj
+<<
+/Length1 2044
+/Length2 13621
+/Length3 533
+/Length 16198
+>>
+stream
+%!PS-AdobeFont-1.1: CMR12 1.0
+%%CreationDate: 1991 Aug 20 16:38:05
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMR12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /JUQUTE+CMR12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 11 /ff put
+dup 12 /fi put
+dup 13 /fl put
+dup 33 /exclam put
+dup 34 /quotedblright put
+dup 39 /quoteright put
+dup 40 /parenleft put
+dup 41 /parenright put
+dup 42 /asterisk put
+dup 44 /comma put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 55 /seven put
+dup 56 /eight put
+dup 57 /nine put
+dup 58 /colon put
+dup 61 /equal put
+dup 64 /at put
+dup 65 /A put
+dup 66 /B put
+dup 67 /C put
+dup 68 /D put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 72 /H put
+dup 73 /I put
+dup 74 /J put
+dup 75 /K put
+dup 76 /L put
+dup 77 /M put
+dup 78 /N put
+dup 79 /O put
+dup 80 /P put
+dup 81 /Q put
+dup 82 /R put
+dup 83 /S put
+dup 84 /T put
+dup 85 /U put
+dup 87 /W put
+dup 88 /X put
+dup 89 /Y put
+dup 91 /bracketleft put
+dup 92 /quotedblleft put
+dup 93 /bracketright put
+dup 96 /quoteleft put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 106 /j put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 119 /w put
+dup 120 /x put
+dup 121 /y put
+dup 122 /z put
+dup 123 /endash put
+readonly def
+/FontBBox{-34 -251 988 750}readonly def
+/UniqueID 5000794 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+:–|¬p§£[ˆµC#´\zC)‡“Œkí­;r­c‘‹nZ E~ N¼ JR@ý|Mã^¥Ho¤=—‡ 8UÚ̱í 2X(±;|vzXÈyðTn¥@D@úe&—WƒÂשW+Ž]QvºÅ˜¸– ô®¿7c‰Á­þjü S³¬ÙÑhì:'ÔñÙ°…Ü-÷4l‡=#
+’´*E»]£C´íØ9Ý`hZYª¤ŸÆ\Øâ­*œ\«•4•*Ÿ@ÕóŽ’$C¥Ý–ög @‹ÑØž5ô«˜âöŒ3fïÁKZþÙÈEØÔøà~¨…¡q«Mn!pî¬ ž·ïFë—8M¡úó;·¼€.®¨‡YtQˆòf³ ~yc?í”àU£!cçL½–Ü]°fò¥1=m FVË@FàðX:ð
+QŠð´ŸI¿ Ý£/‰nKãúà/™Ö@VJ XÒéŠ|
+ oÇ–TÑ-Ïç‚!‘jw1s5¬Ú ’á--­ÊßèZ|Àøã0 ³ˆoÕâ~;„dƒ',•€užÐ`Akß
+¹+¯€µÀwóåù4ímF‚(ä95¿DæÂÂÏyu’¹ s‹ÉÅ%¶½ Zã5µUôÀýD xÆ[ßú¡ÎDd·ý_
+ËÖdªaûûFƒP’ÖqFr8<r7Ä÷>Ñ÷á,_oæNÑàaÊHce(_±ÃKLð%¥3®öæV/ì«< ,ï7yàáNF}ïæŠIFD´Ûßúx͉NŠñÐ5yÃÒšáLbj¿Á}#Có%°3®c
+µØQžüåVäÆÂeÉ@Qb‰skß¼êöýM¾rûKq¥"YÎES ÍëÃdßì:Tÿtïµ·öòe[~‘ O&¬vþFý¯_I¬êìÈŸ6#¢ë¥+@?ØÂ6k5LybU¶]?ê†=øñÃTÈÓõña÷!k©£t`Í”Öð÷ý¶lÓFe}`ó»g=­§d2h"àü
+nrärIÎú. O9˜3™ Hã8¡z¦.Æßý<n=üSvà‹XärÚíSZŽWrk§;g¿xF¯ú)ƒÝû8–à ¿
+ÏÜò¿°Z)»ãÊ!”ÜýÖÏiIçd¶28`F`E£;…½éÒèæÚ¸:Mè¿JÓ×ÐYÈ ï怖û»Ì *ÇÏë|µúºT³‡á”åeÚ¡Àèd:êËéÜBT 4}Rv'¨£âI¹@йNWoŒr ý%ë ®*vˆ7"Qýe´Y„ýîT˹ma›8¹ m¥‚Ìž;WÛû"va ‘Üp^à2Þˆ.‘/æ±Þï$Ͷ×pµúR>–Ñ­áÜ¥> ¥  sêTûµ~1;¦2qqVh FÕÑHÇŒŠÊ¦pÒ\°çFïëšÅ(^­\ äkEZñhÔš„×dY€üšÂB©”{ ˆäòd­¥/ž&•Ž•ÈvÛ *üÔÊ_¥UÕm™+;-ivÀYÄÆèLüY»p
+nev“òXn¥n2ªR’åÙXS_âXA«pSˆTZAmJ•R/꿺q
+RÊ ³Ï0›¤Ú¿ú¦¿Y7uGÈ%"7tåQ †d ÑKBݘ—ææP‚ä(5£¿õDò¥Ù½ %G
+^Ÿ’D k‡à¼¤Àµv*
+ä¢Ûhˆ8Ö QGÞ«_ãµÅR$ü˜!a–±Ì&¹u„ßÓÇìÜ›Ö}­‰°Š~C‡,Öüm–zÍEiˆU!xG¾n¦Iy÷¾Ø†Í¢k’#L®wA‰™!Ê
+ …›ÃäöÀ÷¢Af©dºüE¥¬eS¢äŸs†”
+1¢&”[¦¬)Újµîµ’™”
+#RpBÁò?]X$99Cs›+n¯ižî‹¹Á?ó‘#GáÓ*¹³>ð¼ä l`‡ö˜YAÁµ2BtÓl,´@ÛJþW
+÷4LÁ±öˆMï0[½8žÊXìÔñ‘Wý
+ÐæÔ–ÆÊ”xþp¤ŒÌPg˜»I8ÎÄýì#ºÀ)ú`ìÞp‡¢dƒ©”Ì×°j–c–_6¿Ä5%æÜ AÝ=`ä@%®®C0B~èF®wŠ,¼ˆ >9€5¾îªó~_äP<O¢š÷l]ãð
+ÆïÈïYÎ¥º†–ï¥rÒ)RšGÀ1>B¥°ë saN´£Šh˜;+Ž…%81¯ÓуóËà
+®ûÌ iÃhä›n?H¿Ì=újã>ïÚo™$–·ÓÐ)äºÉÄ è¼
+˜UèZ»â~®$ M"—g¦ìè3ß“¾  ;\ﳎ•ù’ò øqÉkà ÈV€1gÄHCGÁjBàæ6©¨¡Q^ge‡°Kê$”_)Ó.ªŒoœÈN¹½ ^%–eõ½èÅãçzüLâ*Ôop­´sZddTº(©üiNÉúO_ u–/ù†EId‰”íLMg õ„Ù $/‡Åé$xa£€ÉkUY•t„b·>Ã)÷•˜ÈìªÛV†Â_R¢,‹øÝâ\)»H­¥PÔ_²I½œ¯‡”š3“MX!0Uáê÷X‹„Æ&Ä÷èŒ*V@dŽPöèÒ¿Ò¥hù_¢ŒÊؤ”L¤¯6 Ò±qïîARm¾¦‘S>dzA²Kh=¹†C:U 9#*}gÐËTBÆÒÆ ú $dg©Ó‰Ä/=´O©þù»¥y»Æ1 E¥”-1» ƒ™Ip…g¶>˜×@V6½­NÒý@‰Ì$ÜšóÑp™¿”­ýÎÂ`íÚnÖ)WôF’!yÙ[ÈÜHÁÐS¬©‰GÒê ² wŠ”AþXúèÍË”>ôz8à
+ˆ<Äg¸¡7|éd*‰r®÷ÌDƒ@ üŒýKœÍ‰Lt÷¡v4¨a`Çü•åõ)>o'‹ïônU+F| Ž*¦ÅÂ/ÏGÛ¢¹uhðèøhuCD
+Ä·¾}êzvÑÍ홯'À‡t-»—(=ü‹lìÒ!¹â&¿DiÖ{ Ÿï–ÂüTOeš])=‘ÃD¹ó#ÑÇî-Õi'?sþK–™ÜŸÅmû›Ü 9ñT9½ïVÔzàw¦‚‚B‡§ÿ›cwvå‚6¸üÀ²Xiè·12˜²!ø›˜aTçm­9I‡Ï½‹–þ }…¼³ Ã!¤„-A“2éB¨ª
+"æ˜ >r¸½âð‰SÏt3Á1¥âóÖª-&aåéÅ^z´­ÐÕä$‡yb¯Ì&Í6;šr%FóØ2ªr㔹Nt9á-Ĥifý¥h63/fÜŠ!}ïŠi!µ^ÜûhÊ…Úú¨Æíáz?TyêÀãá‰] ð®ð¾Ì¸¢óÜSà,: ˜æ®ûIP¢,¾Sj¦*Ã&<bså™âÕ:©°X­LR¹¥XH«¦ÐIVìÄäË×]ŸŠ©ëHÓÌÆO«ÿ7µ»•Y!-1úéÐv1Ü$Ôbl±t%Iÿ¹Ã<$0ÊBŠiÙ±\OVþܹ:ÑÊŽ’ºEôÛk93w*Gk2+&DŠ6Ì,Ñû•ïÝnŸĨŽƒ`â“yf;k‡|ÿIIqm#˜¿ç–ÓöJ–qn™¯Mæö.„8Šó u†dN(7Q«ŒvÔÞžjô1û§ `µÿfò‚…B§HP•fņ„¥;éí óc.’…•,Ñfí Y+G“‰l¦¼øš˜„ «X&—¢íèUmA~[)gúÁgicÆ\¦ßB6½½Ì¥·YÄï|ä£O)òÜ„3‘ìaj'º4ì¿žïRÈ á
+–ût™%lÉyP=–-‰Ž-à­|Í/XÔsÄ€© ’-Cþfë“,þTÑ’™]øó
+]O®h¨³°–Ô(u­ô9¤cZ³Ÿ^i|ôm#M¨‰² °Ì>†cC›Xɱ
+M3vË&µ?HCª8çégõ~úô8²NÖ±ñD3íRÕc‘~Ы‚û«*çd’áí­ƒö&¹™mCÅüÇ?â´´•Ê]E4hŸo1¤¾ )-âní¹:Fߎ95ÀIåŒ##Ã3¡D7Á¨‘¯4Íꀶ p~›9â”b÷¥éa8%ƒë3„Ú¡)æ&F6 ṳ̀ðκ\Ù½H}Åi¶1ß{õ³Ñb%mÈkÃÖ„ä yš8s7IsøÏ÷}]ìó®¨4-ÞªKý¼š¾z.}Ð;\ÛWdØë «ó‰I×ù£‡‡s…˜9kƒo*Ø"z–+l8œ§CšBÈÚÖ•š5I?däú⛚fôÃã³ÇA¦–;¥hÜWŽÒ–ãdp’Øø3ë#¬´÷uþé1Ú}ä`ú¬.Sç¢Ü|à5ï£Ѓ.üÓÒÑÑoCœþ½{U͹٠(rŒ“`FóF¡ü¾[ÁcN«×e8²/ðTþ£‡cý°=ЫcÖöÍþ4pé]lP|ĘåJN÷Úi’š2Ð D¯¸0¤ªwÝÒ°‚…B_Í9¢æN®Ï3/×Õ|€ÎqLÈ7‡
+QÜrú꧱H4-_VË*º¯œ@T³+Äåsf “ žë8•BªˆîÕÝŒÛÀ(¯âÚc`ÃùQÕ#ùT-™ûÍm¯l[TbÓSÎ\ -㹂ÀZ·Ýéjl)Vò¼i î¿é“`4Î_;òQß,°º†Öþ¬÷5Ž®1ÇDÑ"wéDÏÂi¥€1z,Ë嬼`RCˆm5~\j3:ôªí –-Xýˆ.…å¥0Ç[±ÍëãGb®tŸsVuåóZ^*jZ@±¯Ai&Vì“øay\QãÄñ{êÅ=«AîóO¿¿~]Z*
+,µ¨÷Ķž‚7°ß”I—ùAø¨—Þ {HÆ,ÑEwQ‚¥¡Äx$sŒÞ&ß$¹>
+±VÛ¤-ý‡‚- ÿ‘‰Ï.¼f˜"xÿ´­Ø,
+äá­Y”‘Kî–4ž @‰FéòLÄ¥ïl’ô™…š”›FNç î°tcÔ- A JðzŒá‰R™k˜Ÿ×ÞǺ©åµHÈ°aïÏ‘”ÐèpŸÄŠ;vÀà
+’s=ÍiÞÚ¥ü¦¿nÀã@¶¾-£µÛö>söòÖ.Y…˜K„×ú,⮕´íàZV.)íFøT69ØðQl>Xõþd”Ò€{lûම`;ìrÁNÄS••âe xÿ–§/ö@V®€<º[’" ¢ r­f%+%óÝ–õüÜ[Ó7Žâàñè©c•[èéKE*S¸Õð ñ¦±$Ðç¦Ýñb”·ÉNJ×ÂItüt–-$¿O“7\lþÆEüí"
+Q"á#{ 9ín'Œ;ï µOZTæ« t#;‡¯aì)gµÏ䣅ÔÌïUMáÇæ2×hãQ™Z)­ñË!ˆ~Ôx0;os›JëÁ8ÅcÛJ®X½l0©Üü\w44Ÿ”F’X7³ F‘á°Y$ô‹;5 ûgÔܳ<,® ê#°ŒšQ[©<ʺâQÉÞOŠHOû¤¤àð]Þ¿@ëߘv>ÊËñnñ‹C7 õÜ‚ }^˜QM'F¹±5OÀŒ¡M»ƒ÷4I8lã15L4YÕi L«ÆòÿØȱãYÊâì–í‰w›fG|ó…—Qìì1–‘˜ÅtƒŒü… òVW~ò§É9Þ½ä-}ÿ+{5|¼ åÅ£Áÿ‘¸¶¡ Ïxkų¢Ç7<])S;Vk‚Æ_Ósv¾‘“S© ºôÞ
+¸:ç²Zš3&'ó¦©4~­ ô„£MÙp—>å­xç»X´¶Ö¸!dŒA+þ´–^3êýàÚlÍÉfDôшÖò0ýM
+ñá/‘ž“ù ·W`^& 0›ýÐoOª•· b@"“Æê ‰¥>èY)sýND_ªHËãˆâs”ñe/‡!ioƒY½¼Z…Ü^«KP@܇µÍAþK´¢®©aìÝ‚^ *½ñcà —8(±’ÇR-®±H‰÷jLÊâ»RÕ„Eìâ”oÈ‹&¥‹<ï~Ü©Ò‡¸<;0G‡l‚œÓ¿ÒÇJÍ…Õ`¶y:
+˜ÂÈ þ;31>Œq
+bb *}Âe—0.ú—Å}Žü}çsî#Œ$éàÒ×òE`Æ2²çßâÖ˦êžÿ\#°,S@µ;¾îïÞ÷h§ÓþÕBF5íK}´ðÁ¿8xhŒ Ûˆ,­Õ)QówÎ)N­ÞúÒãnG?Ià4‘cçg6\®— ½J†=ˆõ.)7™öPÓ3«=E¶ÒdãüjFá•(>Pó½ë L%t ÂÏE“¥qfýáohZlé—ûŸWÀIÜ°:J¥Õ¨vmAo–—€Þ4”q1²›hìÉ·¨ÒÞcâ.Xjº@[9ŽOÛ¾vËÔÈ‘i©íXSDojÿÞý‰’H3²Þ|U ÄÝÎ[È^’PŽSÂÕÏT<žcü}=éþ§WÙË*•¢™Så²7¥›1'á'3BAŒ½p½øßqTJA÷¯BrD}
+tÞþ3wæ±gN ‡7Q—x9#R,ÖF‰cÍŒ·ŒÁ_Ðuf
+SzÙÉY¿P9°Zˆ+þÁ[¦åNÇ,׸ˆ€F¬
+ª u¦ðÃïÐ×Rÿ‹a¶FÀr°*U¾ ‡ÕWõµ5e`®ÄGi¾Êáƒcu&rµñ’õÑ[Á¨rO]rBèÙR4ÍCÿ;òT*ÚH1¨x¤ÐQ÷6¦‹Sç-éWíõ;fÖ”œì¶½z?žá2ÀˆŒ
+F_FsÍÁZ‹(GŽŸŒ¶½ Î FâÄ$4·^Ì2J®|J
+²ÔÝŸD÷Õ%¢ª²£à©GØNk¦!+!i²8¢Ä¨Àî®2˜R‹,Ã}ÕO"ØM°=JËÞb 9iq}
+g¸
+ã“ÒèÑ⛃L¥¶Î,ë=´€CúV:Ã’CH?CÊ ,~ ›âÃLiWt¤[´ýŒ‡Ã1“¨5>I¬úýyéYy*$‚ÄO º+"bþß9ª=‘
+éìYnXö+ XÓLø\ûw‹#J4›è‰š€Cmv7<Ee¬|õ ¦ÓQâêÙ“Ÿ¤¿¶ùÞüî(¦ùLݱp‚GÍŒ`ÿfÍW»W@¹ØÆOÞoÇ‹Ô"«3¾Y»ÅƬrOèíÂnêÊmUE œÚMxMº`mj:Æ
+€ ›9¡0;E¦Ô]¦‚­ÌE€µÏ‚™NõÃÔõ
+“-öš}Ioì[¬Rá@:ÈE‹$eO8 ®ã@~ÇiïG®Nv»¯.C ˜/6é"lmÀª)Ÿô[„{ tç84¸níß}°tq
+ÍcŸk(cZ×Y„ÍȺ¯ÆØFéèªÖƒN½/Þ\/êíÖ}™(Ì0 -×Yc ÎàÖ bbÌpwwZSñP@#3¥KY‘¨=û­‘Uíí*þؘ¤sJPÎ÷Û9rjԛѶ›É÷ÝJHàŒõ5;9÷²]å½+~Q’µWoèíð
+‰ªò„R‡ßË+(§å:´ÃäôCOob¿çø¡c° e•T@ë<d.Ë•U®¤öרی®WÆGe(DC=ë®Û^G‹*ld65møòÂÿØ”ðÜÅA»î¹Ð×FÚðµÔ+šKÔF'gSDÝ9øDrU©òÚ¦æ+ìå@
+ÂLç³HÞ—c|NŒ=€Š ²¦ÄäðF•tÔ+G~דáADâ¤
+'ÀA9èÜt/b¹Ø^ŠŠ&òÎå쬴ÂñYŽXç­hPÓ=IØ]×ïòÎâ”5.¾%·$!s0gn$mšò…謾Êê–w «Üý«[˜¾:#£y¥ufÏ@ØÇ¿S¹~ëiuÌ£÷©®¢ÜÑ•‡.\*L|˜fû©¦.©m[Ôù.x¸×†j@ö¤ˆ¸üe› œÝqÕª2‘ØWµƒ ¾F, ŸÝï~!4˜³¡ ”ØÏe£ºA:éÍ \ÁÿË™ßÏ­Š‰ Åó¼YOÁð3sìË”7Æî¿qÊz<’x,£…õ4cWÖ}œÎVqô
+>«·ð³¨jÑ£ïyå’®’.‘Ìòß
+ýÀµÿq›œ€A;Ù´¶XS|óˆÃ ø ÎÚWÌ
+­Š”ïŸ!t#ç¾ÎÙaÖÞù’"®i’é 3S„Îù¥Åô¸Þ÷T(
+ZBx!ƒ‹ƒÅz îòSo(dþŽ568ñ
+Ð\aõèùÕ‰q«4€òW¯àF'
+F·0jPæ¥uT¿N ¶¡úŸ^ 3/fOÄEìë4Q.ëÍÿ-P¬G7ÃF}ÛŸ+Æàã¸é©9|B©€uÒ@—•v”†áòŠ-£ÅXŠK`øÃ/‡„µ¬3Eʪ°ü¨'›± Òõõ‘èËY1Û.ñi½zøž@¥ì™ì—5Ìá.™{Òºlß¹)9;VÔ£½Ê±Íe¦AÞHMŠæ¡A ¹fÌ# |ùß{#öœŽ&ŒBvþÛ —ý÷R0zxšM¾ \´ƒ¾ÜŒs5~øÐ3«‚ŽÍÏN°½À=ªTX¸/¤¾X˜úæ̬®Ø½mšÝïCö3Óók/¿Së«Ó=B‰ïä|Ä› TÊš˜ôpúˆÒÞà{±™˜ +§] 3ó,ûÙ,þ ©éCbé‰Ë¡w­á»°|ëÑUݨûVY©½ãQŽê²û¾I”^£äÿ¶°
+ÇZš8ˆ2¹1 ¹ÞQ‡XÂ0‰³-çSÿx™ÏCðO/s>Q¡XÓ¸\^%QÄ©›é>ûέ£Ü){¶6T’^ýÿ¨UÿËÅ÷Áh‚´»¤òaqEƾ.4a`øο°>$úv¼@<Åý’·r&ž¼
+ª–9ˆœÞÌWåj‘ŸöCŸŽv,²1ê]m(eç÷Û/È8ô£x½ÜºTí[tmÀË#º@ˇ}"éðê§yuÑ⯛ÚudqgmÌÄxšÞ$‚—¨‘°aoÛ’œè5ln
+¤¡œ¨ÏbØ"ƪ¸F÷Eã#öUÑO3´Qg¤±û@kÖ
+¢7aÝÿÚæEó¨iá’mÇ};¸?öj]ÆöKªeÇh†áßÎÿ¢;!~>c²h8ßèl);¿¹$6Õ/Û𦫱bÌÑìb(Æø_Îî™9Æ
+>þ¸ËÝn²°ZÊ÷‡èfÁ‹ã,Ï}su¨Ž¢©*"xJ‡¡Üx‚Æ
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+13 0 obj
+<<
+/Length1 1401
+/Length2 7398
+/Length3 533
+/Length 9332
+>>
+stream
+%!PS-AdobeFont-1.1: CMBX12 1.0
+%%CreationDate: 1991 Aug 20 16:34:54
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMBX12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Bold) readonly def
+/ItalicAngle 0 def
+/isFixedPitch false def
+end readonly def
+/FontName /PRPCHF+CMBX12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 12 /fi put
+dup 44 /comma put
+dup 46 /period put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 52 /four put
+dup 53 /five put
+dup 54 /six put
+dup 58 /colon put
+dup 66 /B put
+dup 67 /C put
+dup 69 /E put
+dup 70 /F put
+dup 71 /G put
+dup 73 /I put
+dup 80 /P put
+dup 82 /R put
+dup 83 /S put
+dup 85 /U put
+dup 86 /V put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 113 /q put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 120 /x put
+readonly def
+/FontBBox{-53 -251 1139 750}readonly def
+/UniqueID 5000769 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+hÌV°]ß¿ l0t¾ë9ܼ¢r¦æ)ûzê,[§ºå {L¥•ßx 5)—ì>ådß"Ÿ»Tsõè̱ÌSé§â™¨ê¢›iѶ"±ðÏüX)Hu–ÙPËQ pÜŸt;ëïDö®’úÎÅvX™œ‹ð`a`9bÀi^¸} Ú«eeW Šf é®ïŠå_q¸¼v9My)gäØ;nŒ=™‡ÕåLS¿+»2…[”ds´H3½x‡=øäÇæhÿÿ%ª»¤tK$ÖË‚${0RÌ]fóñ¼ø¥j?´FêX{ؾ0%vRÎà5bŠíßØ(;ZÒ‹€­$ؘ—
+È¡ã>T<äãÄžæ!ÅÎ>Šé0øcfɈ``hÙé#–ëõ³Û Eü= ÔpÇ¡M’»þ'½t³c¨Ž3¨é¨ZÃ!ç=Å+3;‘ pÅHs¤"-fà&¾m,ˆ•ŠpÁnå ð «—g^Ži"níP]6Â!¾ dtBDKð2_‰›¡^›Eù ÷=ÃIomàÝD¡yI¥(fÇ7t”¾ÿDA¼¤ü+ûryú)8ú›âÞv/ Ôp<NàCq.ûŸ‡E(· ›äð„Þ’-lf×öÿ–¤’3²9mœ¸[/õe‰:Ó¡ÛˆäiüìÕ[?­ý>P‘H9ÞåÕÒ¶?ƒè§•83ïâI*01O2⽚u*½¨vîø†ñ9îÎ)ã &¥§rqÈ”P¶ËC ç–øÐUÔ
+‰+Ìyá÷ͤ‡ÒÏ]…k¾>¨Üûã TÞQc@–%ÎPð£eœ ’LC*öªÊ‡¢æQ_ÓìÊNJ<F@–ĈÓuÀ%¡ŠýŠ8û%6g~±e0t(Å#Ø·¦ã™²ÒÊþ8&5qUûáVÒº—Ö>ÂÿÊPcÅJª³´Ï;ÿƒtñ̵€‘xWœI£ Ÿ9Q ]|ÅÛÙ¢Z\-Íë: ‹ª·¿Î_]áhÖaî)Êít`UTÉéLL.oü”­)0VV¼RS?Þ~S´šp¤- á6’6@? ñ‚à1CÃ"ÔmÿÈÐU¯j€Yºû‡¶œƒSÂÓÃþ¿<af”«—b¶¸`„ÿüב®°ÑŒ£hšìÂp®cÍGõ¹n)ª‚úpob¼Î©Íñ0~w­Eü ºzô|Ö1~hR?Ãi/hÌ$í}2SŸe6m²íÞÕß?ÕˆV©ð li½ ¢ÀÉÞf}Ñã/
+Y_¸ œ·ÕTóUK~iÀD†I=?xŸÒÏŒÍï®èënD§ôœy3àN»BXŸm>æËI!}2ؽ[*ßEd4ºT¯‘ËýÞN¹6S‡D'+ξP…ðõI(FÊa§×ŒÓd¢‡ÑEÀ£Œ§§ X 6ɹ&³¹”xuÔó±›GKlB´Z8m0åYN~/“ÈÎקœÞü´8œ0ûâ¡‚È%5ÐAšPí
+ ŸMôwçŽ=ÅuqFÒK!þxÖ<'(­üãŒÈì5ûc6ë$65ýeµ®£séJÐ.Á¼Â¹-5¢þEÝ~2
+RÜûkJ›ßð¼o»U™0Ðî I!•uõJlf ‚‘bp¸%÷'þ˜­x]‡SÎ  YõÂ1Ð_Ûß46´GËâ@«O$·¡±¥k^0%/ð3ËDÅz(½âÇ(‰ƒ­
+“&^JB³oX¬d´#‡MýɈ‹(&ªôã´|ÏÐÛ9ÇÂBè{ÑùÞt7é1wˆåaõ‚éÀ&—8¥ ¤ŸÊ7¡Z Ŭ~ ‚“Úßs`ç”%á®6UìÛBmÂpD«p:èb×<Þ¯Eµ}5µÒç|ñzbæðwG´e1Þn‹Ñ)Æ´)þ‰1m$!O ä–-û®.)Úvâ*:@¢©Äëþ&ýÅ ’ž?‹êátîPè‰.Â>Íwüí÷ÒG‹Ö
+Yß‘¥P:ÒÂ
+÷ aW¤}?Ž†$0ÇòKº™ž,$úÐÎj°¤ø(hpŽL6°*Šë¦áýͤψ.ù‹|¨$}µÞoƒˆS¨üÖ×ïÕã¯M ׬cF5.îm`z¿œ­n¤u߆KŠ?ToXú”¡˜/Òïî 6?›Yh„f.e
+ 7¹¶T†5­nþ±}®Œ÷¶¸}’ôìj€Ÿ¾“3×±³obHv\ê:
+Ùý1ÉÌ׫\ÇžUÀÆ;Þ)õU¹CAUÍšRå¿P©i”Ë
+=DÜô•HøíŒøÎÔÙäN½OR ÉÃzÀ c쇯Ó7¥2ŠŽ£g8³¯ã¹^rÛ\®UŸ‘­ø^ dØîEÆZeÇB‚‘mÆ5²Ž©µ(Ä:¸•öNÈéçbyÌŠóÆß v;d÷7#nÍ*¡£Nÿé2§Ö
+MÌðþA~&'uµ'¯;,ß
+Ÿõú¸ÀÈÎT¬7z¨ÓÔ’‡v¢“‘4ròiŽ±‹¨DËDù•”v7*9õÑÔW”?·¬Ú–³ãA…‡¢m"î7öc\~hâ¡<ˆáÚR{Û6¸»x ‡ìÓ
+Ë×òhLùù­Ø–½ŸêQž[ÌÉÛK±sÕS›©2¼Æ›‡¬Ìé¥Zij1Ç‘ÒA’ª#<Ÿœ¾]¾K„&i_‰XÐvŽ‡d‹88LÙj-„¶m /ÇÔŸš(27­ŒÀ·ü6X a'¼²jo½ôÏÄYhJëÇâ—HM»a»5Á
+ Å·ÛØá¼Óþ‰7kÍŒ“´ãvË^éÉw1eðÍ’B(íO½KQ±A8ðéØ,»žZa:úg<º ûŸkœR@®Š¶ƒú>‰5¯¨™»vT|‹¦õü‘¡0€R°èa¼¯…:ñ/ì”P<Iö¡}~“oW>Æ‘êr4„Hξ›Î“ô‰bÞŒˆOmœ%¤n| â 0«›dhäÛ~)£Ò¡*}›ýw0‘wÀ­÷yqYÍÐÎÝ5ž‚ÂYââK:±möïieθûSâA-¤ÿp
+öÙS·ÔÞ²åMï µ!vu%Oÿ;›Í
+âYK"ðb¯}n­L3:ÏI9‹©þ(çäˆ ×]z -½Æ†ÿ¶-™<ïmìVFkÚ³£…9Ëÿ’"øfžk¥Ÿt
+H ÖªÍ{= y=ÓP›MÒÂf¥†`±@°šìÔâCd·ñt“v‚4fêæBv³@š«¶ö$pËßO"—_8OõܦßÖ)3¯oö:F“—LT.sàíÔÈ]9Êvgö—ê‘ñ†0_!
+{>–t#QlÉ°Äæ»/â,†fóGd¶¨ÎŽ¤iòA¼>Ο_ñäÛSáÄ!¥Éûѽ†Tò””åÙ@‹EŒ+Ï©‹süÄŠóY^]Ü·Ù‰ì &¾ñ*$ zlEü!É‹âäñÇ;ÞKM@]Ur-„·vaz0!Ï+a]´§ž 'Z÷gU‰6‰_4ülÝr“ü·>o|ôÛöÔ#lL±psÞoP™3æ3rÞ"ÅókÕB*þCè­Ø* ¥›J×å¸7¸J Ó*S)ýGBa›ýÌöòŽF¤3ÎGL-‹
+*É¥s
+—F4~:²2hÙó°/ø¤õåÄ8[ic€'[ÀŸê5×NIÍhEô,Ô¥,™>k](&N„2㞢5¹
+»pŠ”¨"ñF2÷g/¯z¶qÓ+§>ëJQÕ´¢òôÖœwž2Ù-/ÖÇ-r™ÍS´Ø|È7Þ“‡
+á´X}¦éÊ,“t bWy`
+oH ßç™{“6_Žˆû¬”»Z`±={›㤽²ñŒÒëj%õx:†½! H3Í ŽA#¡oMÃ)#‘Ÿ3u*UùÅ'«Š} غ–ð%ãZ„#·€ñ|ÊÐÎm"=zñ®g’ÿ„ZÙâl3€ÍÀ—žÓòdw8+j•^|”MŽÖȤL§¦F ]÷ÞeZ|¯
+IöJMƒäWÃãξXøпrÒñKÕçÅ´·‹¼ 3†Æ«–è¯!àž.x±›Õ£r€Ò tPò\èçÑúrˆrž°û³Â2gJ’íø©3¥ °SƒIɾ’¹ÖcΠ>Sj¾5YðA>ÄPs?,P? sy;›¹æ2€57ÁÞ Ïµ öƒ-{ÈZD0Yªßï]Ü[s\pžx'˜"n½lðcœ¿
+ªDݘ#l¾@Ʋ„'/Sp:WÐ]ÁiôB»ÎA,ùŒg`€-Â9 ݈–\_\ß7Ź B‰©$?Ûõ•É›:ÇÛ ·´º¥oÔ-ôº<ÖÉaa=ÅX»y íÙò-å $IhÖMô iEÁT€á… /õ±’¤
+ظ£‹_(¡s‡ª™ÝaZ©1àX*ñçf뉗°x ) ?ç%åÆÉy]ýM¨Oño¬ìQCE¶*ƒâqÄp I’ÍÂ麃¶Dó-°üÄ,+¢¯Ú~8aÜ{œ_nui+üga¤qAŒ~
+ÖI­¨RŠ‚™ù¸ohŠ«ÆËëò<˜¼.-¨%ëMR'@Ü‚óBd³3#ÊûË•—’P+Ä¿*Êû9£l]%‘†ȌL‹ª7Ѓ~?}´,•ª?…ØúðA«'Í@Ê|ãÊóÙœ\Ô«qs)W¬:šˆ°X3†½â$sJÂX- ÝŽçHV´Á;¬Š®OrtW˜ªù€ww©Ôc©÷±ö?^Š$\e1k ²0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+16 0 obj
+<<
+/Length1 775
+/Length2 594
+/Length3 533
+/Length 1902
+>>
+stream
+%!PS-AdobeFont-1.1: CMSY10 1.0
+%%CreationDate: 1991 Aug 15 07:20:57
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMSY10) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.035 def
+/isFixedPitch false def
+end readonly def
+/FontName /MYFBJI+CMSY10 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 15 /bullet put
+readonly def
+/FontBBox{-29 -960 1116 775}readonly def
+/UniqueID 5000820 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÈÎÙ°š'Z²1NÏ‚“R‚oN—]ÎÎÇ+,󡈙ÌÞÙ5Ð; lƸ<ßO#¹¦ ´™v¬32cÉÜïͽL„í
+>ºW¹Šb3ÙéðÃðÌk,j›¢:ó‰æßÿNþÃÞÖ'lkäp<å7%–ô탴›¸só¦9Î
+†¶Ø1Œ¦â,Šñ;T×WoäÊZzù
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+33 0 obj
+<<
+/Length1 1546
+/Length2 7957
+/Length3 533
+/Length 10036
+>>
+stream
+%!PS-AdobeFont-1.1: CMTT12 1.0
+%%CreationDate: 1991 Aug 20 16:45:46
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.0) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMTT12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle 0 def
+/isFixedPitch true def
+end readonly def
+/FontName /ATVUDO+CMTT12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 34 /quotedbl put
+dup 37 /percent put
+dup 45 /hyphen put
+dup 46 /period put
+dup 47 /slash put
+dup 48 /zero put
+dup 49 /one put
+dup 50 /two put
+dup 51 /three put
+dup 56 /eight put
+dup 61 /equal put
+dup 62 /greater put
+dup 66 /B put
+dup 68 /D put
+dup 69 /E put
+dup 71 /G put
+dup 72 /H put
+dup 77 /M put
+dup 83 /S put
+dup 84 /T put
+dup 87 /W put
+dup 91 /bracketleft put
+dup 92 /backslash put
+dup 93 /bracketright put
+dup 95 /underscore put
+dup 97 /a put
+dup 98 /b put
+dup 99 /c put
+dup 100 /d put
+dup 101 /e put
+dup 102 /f put
+dup 103 /g put
+dup 104 /h put
+dup 105 /i put
+dup 107 /k put
+dup 108 /l put
+dup 109 /m put
+dup 110 /n put
+dup 111 /o put
+dup 112 /p put
+dup 114 /r put
+dup 115 /s put
+dup 116 /t put
+dup 117 /u put
+dup 118 /v put
+dup 120 /x put
+dup 123 /braceleft put
+dup 125 /braceright put
+readonly def
+/FontBBox{-1 -234 524 695}readonly def
+/UniqueID 5000833 def
+currentdict end
+currentfile eexec
+›œi_,+õ`ôÀÕ"WºÍÖP
+½¥í˜5ö ÏÈð l.×j‡…kPôØ úëPŒ—ø(?ˆ±~M;Àö^Ãyy¬Ü*f˼[âõ:­ç-ѵZ/¿îeŒ¹_[³+ 5{^Ýòd tp¾ñÅ!¶ûÕÇ~¾Ùd¬Z+¾ÉسäŠå»
+²ìN/OçPÏšiPdXè‰baÀ±Â“¤*¨}äéøjLœöŸºq‘ø®Q
+L¥‹o=à'öro2t=Îs•ÂÆóÂÞíÜúŽí}¥mÖ¼Þ3Ÿ÷¦”vIä2^Éa²ß­Ò­Fñ‡ûÖ>ìbÂo´jfj ˆc‚Üë©÷ÎÝdÝÈ¢ñ_ã@v dÄoëÑôÜ7®Þ è¯ËŽJÚ - TºÊ[ç(«‹ó/× )ªò}eŠhôT¤¿8oc"MÇð¨bOk†1šN/Ñxõ–ó² °2ê(ÁW¦ŠiúÒ¼ˆˆXÒ(l Nða¼ 1Eò£~¾À?QÞ|Ú4Í—~°—X³¤–ôšt'žóÆ2-ÅIEùPbÅózQÏ~¯Eò³cK-}ì;)ó[fÍ0 à–öƪ+ðLJ“aÁŸ<g¢“oü ñäi€²›õ@GÅñúHæv§O¤43„ø¤›(¹Fá« ’Þ[¿Bd@­#Pl¸2ÞÆMa†œ³Mé$ÒÂn@K}½›å[œ Zã \Òx­»Iß„í-sŽ]œ;šÁž,å6l–dO[=>êXœ®ÛXoÙ¸ôß2ì‘›t4Õ»å~‰.°8V}õ¸¯ Ú^’Ejó``’æ×ýÕ¡4<=ŒØSÄ…Ã7ÄH®¦O1ø‡'V–£'.
+à«°Û…Z<“Ûbgß3¾4£E¨4ÀõpïÄæ­›ý5?$ø–æ
+=Áʹ:T»wЇ·|…ñ¥yBi;9lÒWRxý1Ú¦@g‘5\x8šëóúN)vn9oŠC´¸OQT~=Üc&>¢­†×r*¾ ¦H¿æl&ăV¬"P0÷s±¡ vÝ4ü6ÖKë3Sþl—P¿‘ç*×JîA`ꦺ]ÊJo? Iâÿ Í{ÒŽ‹•$qÑEVÍ.ŽVQ ¿2€¾£È5ïŠP“ºó.߯É,]A½z- õ Uu3ó¦Ó£O"Fz§¤ZÏœïy—wÏïv îVeˆbOjŽç6#lDCj°w¿Y¿Ê6åP†G˜ GUSÂØ?ôÇW7m°ZÓ€0öû†›
+
+ŠÝaôŸÕÓ©)¥³«o¡®wE÷ÿ/w_W|¼À˜±Û¿ èÇzúM9«ËMA”ü-@CûØÞâ!.MoÁcw{½qÚÌ£™M±J¡HÀÙ ±3pŽ7·¡
+%WHEÑÙe˱×­¾
+= zðs[¤Òä½89WLyK”ªö+Ï4¿IÕNCš+2·‹÷†å.lû©µ3xù-|ÁKg:þŽßÙÖ $XÁ-…ãŒHžñì×íìËôéZdëš—T¨xdÌ›Ø{ϱ…"¸öý¸ýŽDàõ3·”sŸñfoT©Eý--yÞ›ùj$ùá Û÷“]üö¸,s8O%™f š'\3ç׿Ž>}q?Rã.£ÿH¿—´ž+¬€GwL"Êuþz/ŒR
+
+Ù Šè?©Í7ÿ}5m„fa]ð&%ÅôÜ;ÐÜA
+}ˆ¬Ë­(ì¬õ[ÄÞÖ <à­YU}Û©Fk^H|b§žÃÒ5Z«lO` ÖÆ¢í{<0}W:J㦧/u²ù¼çR'^tÂ^<Âæáhðy¼§„Q¶P¼j Lte^a4 âûö`:,‚ì¨gÏÆ%^ç×Û½_Umþò˜Ãù°^2}ŽÜ¥'ýR¯ý_p:Å7›Ò\ ‹‡!íG>É!ª• ÖI‘Î=Éÿ ª®Pže#ÞièÝû¿c@J½oB•þÄÓY¦Ü¬4À¹ÓŸ‚¶'³}až…l`Ú¸šri¶¥«4³ç3¼ Y@=Û¿†êv°ÓÉxÖZ/[èHèRœ¿U’׌l¡±ól¹®Ò‚Þ¬FÏÌÂÉd%HÛûoîµ~?\` mqåµ)qZ&²Òï¢4-|bÍÖÓ ¾Ç2
+c(?eªÌÇZ$¦k¡®¦GuOéªrsÂN]s‘Ó{«ˆdûŽÄa¯æøßg¢4•È/MK•3FqONÂÙyÝÆWÜôÉ™ Ž‚æßç
+õݱ¦¼†ÿÀ×íÝÏ…Í?–_§˜éévç…†|%}ÚÞù  g>Þ¤¯Iˆí¯ÍC¨¾æ\prq œÎuN¾”WéŽ4~9aÈ’²+³êZœÊÕÕ¡"ó–r$ˆ
+/
+ÇÉýaM[Âë?0½AáщÛmd_ÇÅâ ë `0ñE¯î±“ºõ7•ªÉŠ`ÅŒ?³ A‰TïÕ*4:áâÃèùCú¿dʽöL𘞗䗩²©™Ú6—/åÂûéÍ8䃶KÓ‰6¶cN•`
+/jø ±µé.™‹»ÙôR‘ƒ¿ñ~g“-Xº&:¶<ì„ThF©.§rèƒA;úâ‡ÐÜòÕ圿{ÅÑ‚=f,á±q·#ñ=6†Í ÿÆyÄÏ·YœÚÃC{¤´j¬Ñþ@fºÌU­ $"ø%#þ+p5¦W¼èÜ•°ô½×nMÕæÛxOÓk^cjy·kZXiöí¾€¿-)_™
+u ÒÜqh‡²OˆÌc Ã~þ¦ +f£²³wYÁüØ:ëði‰Y+20•`œðP‰2cí``³´EBL”ýð=[.>ΖùçµNÐô&åfQŸ*~[
+…óãµ^òh-‡ñÙcÎySh–¿q˜Ç^¬n‘Ç;‡Lú”7"Á5©²iZ1Õ¶-c½1DNMë Ãæ6=¬ 0#³Â:G‡)
+™…
+)†Là>ƒO¼x«^ A¹ßZ®x„ÅÜ‘yξÕJäí„]XKma_JXº«0k#µï=ZkG“+p´ÿªß¼ýŒlìRò
+ڥر–eª~º„ÂY‘NªXÏôÅ‚r£h‹X ˆøˆ(›^Ê
+TU˜:5s vÓ×ëd½Æ*(êõ‹F¥kÞ‚]tµ®«­«¢œf³#A•ó/X0:6L-ùëÁäé“)šž$l®02ö«˜§Š î<Áåu,tÈmJ–•$•x§xjÀ?f‹U7¹e‹mèߧ;³¤>•—ÍÛ¢F¾¶þ ¢àÁ á×åî IÖïøÌì,ÀnéwNä ²IÛKÝ·¯©±ÑŠ½k}݈•ž \K`hzñdHЕzÞh{ç”TÑO—Ø.ƒ$ÄçÏ[„PËÍecl³&!øÿ2ÞÒþðrmêòsö‘Âfh5äbÓu^º§´8ç6 —÷öt§²€ ÖÔÔÑùÞùÇ+”SÎe¾Q§Á˜g½æ=®ºt0 ‰¨~ÅÙ~Ùït©_ó¬VúPŸombÁö7Žì eµ.ª0½Èf¢_<“*¨*yìêÄZ¸®û¢edPâ­4¸tÉÅn9]Xꊯëü"ªØf?î/mFíkÜ}RÎ_ºœ}®Jž©ƒüÑ×a1|¿ëGzÃN)ž¦˜ÁÁ)ÀŽ]Ç»(„;VÎ_ý° ú=â`{oâ*:.ËšïR¼¸M`@xeËÎYð­çÙõܽc+QRzX"îƧ>J²æ ¦í´‘*Û&PöõÎ2å52P¦îI¬ý,è;½M0Ã3?ü÷q΢¦G¢`â˾X5.B­ ôƒUÓN¥ÇHvMœ^³¤ŸÜ7é)Æ÷N-¬©\Ai¸ýrù!1Ñ^š5œY5Æ-i‡ŸÄÈ“ŸÚ½ “f‘ä(KúóöT§ßîõR«—Íñ¾ÈCãU—í·¯ê‘FÞÇJƒ!16ÈQHÒ¼´ÏÚkríúQÓUzP¬¾µû±_XíԾȚÖi¤Y5Vh·â{#O"UHUù¬ j}§?ÍeH«s…0€£
+C’ÄAòËúMþÉ7£ædhB ÷LˆzÝvõj ËR~î×]ìø#–ù¬ É#Ò’ÌæiÞž^Æ_ùxB¡—ø˜Y¯Kje$ŽŒÏëƒÐ…ÑM+—îËï‚ãRÿn Q­ú”Ú¶‡å¸Ý`v0=¯¨ª‚«©XW¹U&ñrðpÛ8v s Ã7Ññ™Ñ+ÊÄéz]Þóêçð˜~(In4±Œi˜2¸Ò¹Á9=½ìY#‰6ÝuÐɵýqæÓ]Ä»S…w
+¥[z®6¼ y¹eXŸÌ“_5%ÿ‰yz\zEíµècÓÏ(ï Kò2ëY˜iâÓÌ`ÕF¸nÒ‹3ÀÛÆ'ý’¹LZÄÆCç§Vp8±/z>„jzD˜Sæ †¨)ÆCÅ:J-Ú½×h‚÷Ã($âIb
+mú.—L#9Â6*Q’™60ë#é-ÍQnP臖«ÛzÔ 0¬âÊu~J/ïi^Nz*]."‹)Ÿ&¾Yr/MÊížé“³ÎX‡¼l´ìô¢[Büe–ýµ™Þ„s’›µ½~M_¼¶M¨Tk\X‚öh;„wúÀÖS{¦ïžìÙýùöѪž•%¨ò*’wHê7D˜à5ò©.ËŒÀ†(õˆYy ¦`ɱ•.ØïÏM¾EÂå±Áìm[^S
+°YTðéÇýÂiûb6Q·+Œà”qQ P{‡sלj-•T¯KZgU€NŽ[r`/¤-þ®1ý¤K7¬àÛÖ®SYËö¡Õ9qûë¢Ñ+1h@<ºÛtSÈ;ûW‘ßB!E a‚ܸr–˜{{.°øY
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+44 0 obj
+<<
+/Length1 796
+/Length2 2243
+/Length3 533
+/Length 3572
+>>
+stream
+%!PS-AdobeFont-1.1: CMMI12 1.100
+%%CreationDate: 1996 Jul 27 08:57:55
+
+% Copyright (C) 1997 American Mathematical Society. All Rights Reserved.
+
+11 dict begin
+/FontInfo 7 dict dup begin
+/version (1.100) readonly def
+/Notice (Copyright (C) 1997 American Mathematical Society. All Rights Reserved) readonly def
+/FullName (CMMI12) readonly def
+/FamilyName (Computer Modern) readonly def
+/Weight (Medium) readonly def
+/ItalicAngle -14.04 def
+/isFixedPitch false def
+end readonly def
+/FontName /AEVAHO+CMMI12 def
+/PaintType 0 def
+/FontType 1 def
+/FontMatrix [0.001 0 0 0.001 0 0] readonly def
+/Encoding 256 array
+0 1 255 {1 index exch /.notdef put} for
+dup 60 /less put
+dup 62 /greater put
+readonly def
+/FontBBox{-30 -250 1026 750}readonly def
+/UniqueID 5087386 def
+currentdict end
+currentfile eexec
+€4y‚«9BÙ0ài§ H1r^ƒ vû¡.Hn˜œ˜tµ'ð’W"xp'ôDpÔ„&,6 ßÝß6WS:W»÷0H¿»ü·:e„TAýÈ7­ÙJÈûÒ.>ÈñÔ´»{8"Ìa˜ïçh½ŸÎ³Dnä¨Ü'ÖÍ$…8Nõõ“ÿÚCòÒ °Š¢z²[wM± ¬ýÍ3æŒFSj´'½×ÚSK x­=x“r!‹0u’\á/ü…0üÕãŽ:jm²Üû®;FSçà'01NµJ)m+ïŠyA’%Ú×´æÖùψ¶›¢“¿•€~{Ë ·N‘ú í"ŽB ªä§ªÊ`±b™¬J½#ïñv_=‘ù/:ûýí7/ÏnKÚ/³Éþz‡¼¾oÓlÕµ‚?Ût"6¦<3F¡ >k6,ô/ÃÈ
+¿
+G³DÃmä/Ä ÿD«mRIéõR¨p{·f$&D@ÈC½^_ ”LëfnæCYÖcãU²ñp“©d(l¦ $v~ºOä‡8Uº¾/¹`öƒ
+Á}K¤¯pƒò114Yû»û—ÔƒM•uJ³ò-d•Ò@‡ÔHao¡Î'¼PÓFT2‡ã† ™´3bA»™ ¢6Àâ`ý'[¥^ÑœƒášÝú¡ó/kr„ˆEÌîq£1Û¸Iu÷©„¾×Æì*å³5§cÐÆ'?†¤f2ý‘A¢yOÈ`ß:.µ›‰wLvp"Ûµwã ¡(½w¤:ø†ÐÂVµ©hïwj¬ ¥8~ë#4Áô, ¡\ ~¦2N‡ôd ˆ
+Ýï7aâ–ÜÚ ~†FtcËK)ÍÉZÚ Gm^ùï{Å:¥:μ^
+ êÝdƒN€Ö$]eÇW4žÂä$¬s…¶Y0-µ€-÷ÌŒÙöëkè™MO»ë²ÍKöUYŠõÍSˆ €-„24ZWí,.•I.<O
+náÅÙ΄sKW.t¤c6±
+í.ÂÅŒrþŠ“ÞØ–•ÁUs»•äy{è”]]ðmáÞËJ©1h(1)?¶ù÷éÕ@Åçò]F;{!> d(¢Æ/R4M}‹²0G}…ãšLcÒÒ äã¼xH/§<vw—û“¹…7dh ˜MÎÿ%± ¥³U¿ôrpØhÌ5x·‰{ˆØQßuÒfÅ.ÆÛEI÷ç·æœ“øßARщ9ÕÏ2–.úxyI¾ÐƒRZæ.!Íñ/Ù2ùn]_ÉmQ‘-v9t7{ix^„¿–
+÷ˆ¸^‰D5z‘¼Ó‚M©õ7ŠÚ¾œónϸa•ç=)Ãÿ_Ž(æOR2Hë¦Ïb¢x« ÷æ6'T›Ôšø.ߟ2îC2 $ã“e‹B8¯dä!‰¡Á.BE:bpæ× „Í"‰3_.žÐF6‹éQ±)J /kø…E6¡×F$tØâîÇ ~¥ÆÍÇ!⨸Õ(¾ÈX,5Ò¦æÓ ”4k^ÂG|- [—`<Œ4#tM^ Pêu U”»$¹ãL¢®‚ÓÛÝÄZwÎþ“ĪfB©Çn4õvïqý`ô>Nt•+ÅvåXn¹‰.m?FÚ5ø„´œ=iÐÃdœ˜ä·È0 ¥ªFoy#oÙLè–Çv”ÐJ(4…ÂœgJ‚FØ{¶ ¸#ºûw,¨ð;8:9‡gÉyx­ì•‹úÚ–V‰7±¬Ž6[uÉ3ÛüKòÿúðÛ©‰¹Ï
+w(Lÿž†…ÇYØ&Ž'‘2îLu $Û,8ÔfìK¬¸$ŸÙǶíSØ[™à¢n.l(oB*µôÉjËËؤÁ~D”•Æ ß™²‡ÑÇüï®dóÉ‹q_®ÚLq°÷°ƒiˆ2LÆà&*BÜÕžª,:KK½¹Ì±ç…›Çà­\-é[r Ï$$ƒ>„·p—öïúûÛ"‹ƒ^®SØ# 1øsèÖË7Éh¼µþëíõ×™êÙFÔäGœ½Yã 4¡‰ï©”‰ž­£ëµF×9¿]OøÀóGa£Ñ‹¨·wæ…VÖ2Fë¼)zÒ‡9ÖI|ß•Î0² ŸâÀ§`¿$†pL¥11#.Mv3fGý°®ÓਞBž'À©-0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+0000000000000000000000000000000000000000000000000000000000000000
+cleartomark
+
+endstream
+endobj
+1 0 obj
+<<
+/Creator ( TeX output 1999.09.19:2116)
+/Producer (dvipdfm \(null\), Copyright \251 1998, by Mark A. Wicks)
+/CreationDate (D:19990919212041+00'00')
+>>
+endobj
+5 0 obj
+<<
+/Type /Page
+/Resources 6 0 R
+/Contents [19 0 R 4 0 R 20 0 R 21 0 R]
+/Parent 3 0 R
+>>
+endobj
+23 0 obj
+<<
+/Type /Page
+/Resources 24 0 R
+/Contents [19 0 R 4 0 R 25 0 R 21 0 R]
+/Parent 49 0 R
+>>
+endobj
+27 0 obj
+<<
+/Type /Page
+/Resources 28 0 R
+/Contents [19 0 R 4 0 R 29 0 R 21 0 R]
+/Parent 49 0 R
+>>
+endobj
+49 0 obj
+<<
+/Type /Pages
+/Count 2
+/Kids [23 0 R 27 0 R]
+/Parent 3 0 R
+>>
+endobj
+31 0 obj
+<<
+/Type /Page
+/Resources 32 0 R
+/Contents [19 0 R 4 0 R 36 0 R 21 0 R]
+/Parent 3 0 R
+>>
+endobj
+38 0 obj
+<<
+/Type /Page
+/Resources 39 0 R
+/Contents [19 0 R 4 0 R 40 0 R 21 0 R]
+/Parent 50 0 R
+>>
+endobj
+42 0 obj
+<<
+/Type /Page
+/Resources 43 0 R
+/Contents [19 0 R 4 0 R 47 0 R 21 0 R]
+/Parent 50 0 R
+>>
+endobj
+50 0 obj
+<<
+/Type /Pages
+/Count 2
+/Kids [38 0 R 42 0 R]
+/Parent 3 0 R
+>>
+endobj
+3 0 obj
+<<
+/Type /Pages
+/Count 6
+/Kids [5 0 R 49 0 R 31 0 R 50 0 R]
+/MediaBox [0 0 612 792]
+>>
+endobj
+19 0 obj
+<<
+/Length 1
+>>
+stream
+
+endstream
+endobj
+21 0 obj
+<<
+/Length 1
+>>
+stream
+
+endstream
+endobj
+4 0 obj
+<<
+/Length 18
+>>
+stream
+1 0 0 1 72 720 cm
+endstream
+endobj
+51 0 obj
+<<
+>>
+endobj
+52 0 obj
+null
+endobj
+53 0 obj
+<<
+>>
+endobj
+2 0 obj
+<<
+/Type /Catalog
+/Pages 3 0 R
+/Outlines 51 0 R
+/Threads 52 0 R
+/Names 53 0 R
+>>
+endobj
+xref
+0 54
+0000000000 65535 f
+0000075678 00000 n
+0000076972 00000 n
+0000076638 00000 n
+0000076840 00000 n
+0000075846 00000 n
+0000007289 00000 n
+0000027172 00000 n
+0000000009 00000 n
+0000000212 00000 n
+0000034173 00000 n
+0000001248 00000 n
+0000001453 00000 n
+0000050466 00000 n
+0000002485 00000 n
+0000002692 00000 n
+0000059891 00000 n
+0000003611 00000 n
+0000003817 00000 n
+0000076740 00000 n
+0000004776 00000 n
+0000076790 00000 n
+0000007224 00000 n
+0000075949 00000 n
+0000010761 00000 n
+0000007353 00000 n
+0000010706 00000 n
+0000076055 00000 n
+0000014337 00000 n
+0000010826 00000 n
+0000014282 00000 n
+0000076241 00000 n
+0000018312 00000 n
+0000061884 00000 n
+0000014402 00000 n
+0000014606 00000 n
+0000015647 00000 n
+0000018257 00000 n
+0000076346 00000 n
+0000020888 00000 n
+0000018377 00000 n
+0000020822 00000 n
+0000076452 00000 n
+0000027107 00000 n
+0000072014 00000 n
+0000020953 00000 n
+0000021162 00000 n
+0000022192 00000 n
+0000027030 00000 n
+0000076161 00000 n
+0000076558 00000 n
+0000076907 00000 n
+0000076929 00000 n
+0000076950 00000 n
+trailer
+<<
+/Size 54
+/Root 2 0 R
+/Info 1 0 R
+>>
+startxref
+77068
+%%EOF
diff --git a/contrib/bluegnu2.0.3/doc/notice.ps b/contrib/bluegnu2.0.3/doc/notice.ps
new file mode 100644
index 0000000..9836799
--- /dev/null
+++ b/contrib/bluegnu2.0.3/doc/notice.ps
@@ -0,0 +1,1394 @@
+%!PS-Adobe-2.0
+%%Creator: dvips(k) 5.85 Copyright 1999 Radical Eye Software
+%%Title: READMEdvi.dvi
+%%Pages: 6
+%%PageOrder: Ascend
+%%BoundingBox: 0 0 596 842
+%%DocumentPaperSizes: a4
+%%EndComments
+%DVIPSWebPage: (www.radicaleye.com)
+%DVIPSCommandLine: dvips READMEdvi.dvi -o notice.ps
+%DVIPSParameters: dpi=600, compressed
+%DVIPSSource: TeX output 1999.09.19:2116
+%%BeginProcSet: texc.pro
+%!
+/TeXDict 300 dict def TeXDict begin/N{def}def/B{bind def}N/S{exch}N/X{S
+N}B/A{dup}B/TR{translate}N/isls false N/vsize 11 72 mul N/hsize 8.5 72
+mul N/landplus90{false}def/@rigin{isls{[0 landplus90{1 -1}{-1 1}ifelse 0
+0 0]concat}if 72 Resolution div 72 VResolution div neg scale isls{
+landplus90{VResolution 72 div vsize mul 0 exch}{Resolution -72 div hsize
+mul 0}ifelse TR}if Resolution VResolution vsize -72 div 1 add mul TR[
+matrix currentmatrix{A A round sub abs 0.00001 lt{round}if}forall round
+exch round exch]setmatrix}N/@landscape{/isls true N}B/@manualfeed{
+statusdict/manualfeed true put}B/@copies{/#copies X}B/FMat[1 0 0 -1 0 0]
+N/FBB[0 0 0 0]N/nn 0 N/IEn 0 N/ctr 0 N/df-tail{/nn 8 dict N nn begin
+/FontType 3 N/FontMatrix fntrx N/FontBBox FBB N string/base X array
+/BitMaps X/BuildChar{CharBuilder}N/Encoding IEn N end A{/foo setfont}2
+array copy cvx N load 0 nn put/ctr 0 N[}B/sf 0 N/df{/sf 1 N/fntrx FMat N
+df-tail}B/dfs{div/sf X/fntrx[sf 0 0 sf neg 0 0]N df-tail}B/E{pop nn A
+definefont setfont}B/Cw{Cd A length 5 sub get}B/Ch{Cd A length 4 sub get
+}B/Cx{128 Cd A length 3 sub get sub}B/Cy{Cd A length 2 sub get 127 sub}
+B/Cdx{Cd A length 1 sub get}B/Ci{Cd A type/stringtype ne{ctr get/ctr ctr
+1 add N}if}B/id 0 N/rw 0 N/rc 0 N/gp 0 N/cp 0 N/G 0 N/CharBuilder{save 3
+1 roll S A/base get 2 index get S/BitMaps get S get/Cd X pop/ctr 0 N Cdx
+0 Cx Cy Ch sub Cx Cw add Cy setcachedevice Cw Ch true[1 0 0 -1 -.1 Cx
+sub Cy .1 sub]/id Ci N/rw Cw 7 add 8 idiv string N/rc 0 N/gp 0 N/cp 0 N{
+rc 0 ne{rc 1 sub/rc X rw}{G}ifelse}imagemask restore}B/G{{id gp get/gp
+gp 1 add N A 18 mod S 18 idiv pl S get exec}loop}B/adv{cp add/cp X}B
+/chg{rw cp id gp 4 index getinterval putinterval A gp add/gp X adv}B/nd{
+/cp 0 N rw exit}B/lsh{rw cp 2 copy get A 0 eq{pop 1}{A 255 eq{pop 254}{
+A A add 255 and S 1 and or}ifelse}ifelse put 1 adv}B/rsh{rw cp 2 copy
+get A 0 eq{pop 128}{A 255 eq{pop 127}{A 2 idiv S 128 and or}ifelse}
+ifelse put 1 adv}B/clr{rw cp 2 index string putinterval adv}B/set{rw cp
+fillstr 0 4 index getinterval putinterval adv}B/fillstr 18 string 0 1 17
+{2 copy 255 put pop}for N/pl[{adv 1 chg}{adv 1 chg nd}{1 add chg}{1 add
+chg nd}{adv lsh}{adv lsh nd}{adv rsh}{adv rsh nd}{1 add adv}{/rc X nd}{
+1 add set}{1 add clr}{adv 2 chg}{adv 2 chg nd}{pop nd}]A{bind pop}
+forall N/D{/cc X A type/stringtype ne{]}if nn/base get cc ctr put nn
+/BitMaps get S ctr S sf 1 ne{A A length 1 sub A 2 index S get sf div put
+}if put/ctr ctr 1 add N}B/I{cc 1 add D}B/bop{userdict/bop-hook known{
+bop-hook}if/SI save N @rigin 0 0 moveto/V matrix currentmatrix A 1 get A
+mul exch 0 get A mul add .99 lt{/QV}{/RV}ifelse load def pop pop}N/eop{
+SI restore userdict/eop-hook known{eop-hook}if showpage}N/@start{
+userdict/start-hook known{start-hook}if pop/VResolution X/Resolution X
+1000 div/DVImag X/IEn 256 array N 2 string 0 1 255{IEn S A 360 add 36 4
+index cvrs cvn put}for pop 65781.76 div/vsize X 65781.76 div/hsize X}N
+/p{show}N/RMat[1 0 0 -1 0 0]N/BDot 260 string N/Rx 0 N/Ry 0 N/V{}B/RV/v{
+/Ry X/Rx X V}B statusdict begin/product where{pop false[(Display)(NeXT)
+(LaserWriter 16/600)]{A length product length le{A length product exch 0
+exch getinterval eq{pop true exit}if}{pop}ifelse}forall}{false}ifelse
+end{{gsave TR -.1 .1 TR 1 1 scale Rx Ry false RMat{BDot}imagemask
+grestore}}{{gsave TR -.1 .1 TR Rx Ry scale 1 1 false RMat{BDot}
+imagemask grestore}}ifelse B/QV{gsave newpath transform round exch round
+exch itransform moveto Rx 0 rlineto 0 Ry neg rlineto Rx neg 0 rlineto
+fill grestore}B/a{moveto}B/delta 0 N/tail{A/delta X 0 rmoveto}B/M{S p
+delta add tail}B/b{S p tail}B/c{-4 M}B/d{-3 M}B/e{-2 M}B/f{-1 M}B/g{0 M}
+B/h{1 M}B/i{2 M}B/j{3 M}B/k{4 M}B/w{0 rmoveto}B/l{p -4 w}B/m{p -3 w}B/n{
+p -2 w}B/o{p -1 w}B/q{p 1 w}B/r{p 2 w}B/s{p 3 w}B/t{p 4 w}B/x{0 S
+rmoveto}B/y{3 2 roll p a}B/bos{/SS save N}B/eos{SS restore}B end
+
+%%EndProcSet
+TeXDict begin 39158280 55380996 1000 600 600 (READMEdvi.dvi)
+@start
+%DVIPSBitmapFont: Fa cmmi12 12 2
+/Fa 2 63 df<F001C0F007E0181FF07FC0943801FF00EF07FCEF1FF0EF7FC04C48C7FCEE
+0FFCEE3FF0EEFFC0030390C8FCED0FF8ED3FE0EDFF80DA03FEC9FCEC1FF8EC7FE0903801
+FF80D907FECAFCEB1FF0EB7FC04848CBFCEA07FCEA1FF0EA7FC048CCFCA2EA7FC0EA1FF0
+EA07FCEA01FF38007FC0EB1FF0EB07FE903801FF809038007FE0EC1FF8EC03FE913800FF
+80ED3FE0ED0FF8ED03FF030013C0EE3FF0EE0FFCEE01FF9338007FC0EF1FF0EF07FCEF01
+FF9438007FC0F01FE01807F001C03B3878B44C>60 D<127012FCB4FCEA7FC0EA1FF0EA07
+FCEA01FF38007FC0EB1FF0EB07FE903801FF809038007FE0EC1FF8EC03FE913800FF80ED
+3FE0ED0FF8ED03FF030013C0EE3FF0EE0FFCEE01FF9338007FC0EF1FF0EF07FCEF01FF94
+38007FC0F01FE0A2F07FC0943801FF00EF07FCEF1FF0EF7FC04C48C7FCEE0FFCEE3FF0EE
+FFC0030390C8FCED0FF8ED3FE0EDFF80DA03FEC9FCEC1FF8EC7FE0903801FF80D907FECA
+FCEB1FF0EB7FC04848CBFCEA07FCEA1FF0EA7FC048CCFC12FC12703B3878B44C>62
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fb cmtt12 12 48
+/Fb 48 126 df<00085B003EEB07C0007FEB0FE0A24814F0A26C14E0B3A2007E1307003E
+14C0A20008EB01001C1E75BD33>34 D<D803E0143CD80FF8147C486C14FEA2486C1301A2
+D87F7F495AEA7E3F5E00FEEB8007EAFC1F5E150FA24B5AA25ED8FE3F133F007E13004B5A
+EA7F7FD83FFE91C7FC5D6C5A5D380FF801EA03E0C7485AA25D1407A24A5AA25D141FA24A
+5AA25D147FA292C8FC5CA2495AA25C1303A2495A167C4A48B4FC010F491380A24A4813C0
+131F92380FEFE0D93FC013C7031F13F002801383137FA2EBFF00A25B1201A24914C70003
+020F13E016EF4848903807FFC0A2496D1380A26C486D13000001EC007C2C4D7DC433>37
+D<007FB612FEA2B8FCA36C15FEA228077BA133>45 D<121FEA3F80EA7FC0EAFFE0A5EA7F
+C0EA3F80EA1F000B0B6C8A33>I<167816F8ED01FCA21503A2ED07F8A2ED0FF0A2ED1FE0
+A216C0153FA2ED7F80A2EDFF00A24A5AA25D1403A24A5AA24A5AA24A5AA25D143FA24A5A
+A24AC7FCA2495AA25C1303A2495AA2495AA25C131FA2495AA2495AA249C8FCA25B1201A2
+485AA2485AA2485AA25B121FA2485AA2485AA248C9FCA25AA2127CA2264D7AC433>I<14
+FF010313C0010F13F0497F497F497F9038FF81FF3A01FE007F804848EB3FC049131F4848
+EB0FE0A24848EB07F0A24848EB03F8A24848EB01FCA348C812FEA4007E157E00FE157FAE
+6C15FF6C15FEA46D1301003F15FCA26D1303001F15F8A26C6CEB07F0A26C6CEB0FE06D13
+1F6C6CEB3FC0A26CB4EBFF806C018113006DB45A6D5B6D5B6D5B010313C0010090C7FC28
+3F7BBD33>I<EB01E0497EA21307A2130FA2131F133F137F13FF1203123F5AEAFFF713E7
+1387EA7E071200B3B3A2003FB512FE48801680A216006C5C213E76BD33>I<EB03FF011F
+13E0017F13FC48B57E48ECFF804815C0260FFE0313E03A1FF0007FF049EB1FF84848130F
+49EB03FC127F90C7EA01FE4814005A6C15FF167FA3127E123CC9FCA216FF16FEA2150116
+FC150316F81507ED0FF0ED1FE0153F16C0ED7F80EDFF004A5AEC07FC4A5A4A5A4A5A4A5A
+4A5A4990C7FC495AEB07F8EB1FF0495A495A495A4890C8FC4848143E4848147FEA0FF048
+5A48B7FCB8FCA37E6C15FE283E7BBD33>I<903801FFC0010F13F8013F13FE90B67E4881
+4881489038807FF03A0FFC000FF801F06D7E484813036F7EA21500A26C5A6C5AC9FC1501
+5EA215034B5A150F4B5A4B5A913803FFC00103B55A4991C7FC5D8116C06D8090C76C7EED
+0FF8ED03FC6F7E6F7E821780163FA2EE1FC0A3123C127EB4FCA2163F1780167F6C16006D
+5C6D495A6C6C1303D81FF8EB0FFC3A0FFF807FF86C90B55A6C5D6C15806C6C91C7FC010F
+13FC010113C02A3F7CBD33>I<ECFFC0010713F8011F13FE017F6D7E90B67E4881489038
+807FF03A07FE001FF8D80FF8EB07FC49130348486D7E491300003F814980A66C6C14FEA2
+6C6C495A6D13036C6C495AD803FEEB1FF03A01FF807FE06C90B55A013F91C7FC010F13FC
+A2013F13FF90B612C0489038807FE03A07FC000FF848486D7ED81FE0EB01FE4913004848
+147F007F168090C8123FA200FEED1FC0A76C153F6C16806D147F003F16006D5C6C6C495A
+01F813076C6C495A3A07FF807FF86C90B55A6C5D6C6C14806D91C7FC010713F8010013C0
+2A3F7CBD33>56 D<007FB71280A2B812C0A36C16806C1600CBFCA9003FB7FC481680B812
+C0A36C1680A22A177CA933>61 D<1278127EB4FC13C07FEA7FF813FEEA1FFF6C13C00003
+7F6C13F86C6C7EEB1FFF6D7F010313E06D7F9038007FFC6E7E91380FFF806E13C0020113
+F06E13F8ED3FFE151FED07FF815DED1FFE153FEDFFF84A13F0020713C04A138091383FFE
+004A5A903801FFF0495B010F13804990C7FCEB7FFC48485A4813E0000F5B4890C8FCEA7F
+FE13F8EAFFE05B90C9FC127E127828337BB733>I<007FB512F8B7FC16C082826C813A03
+F8000FFCED03FE15016F7E82A2EE3F80A7EE7F00A25E4B5AA2ED07FCED1FF890B65A5E16
+80828216F89039F8000FFCED01FE6F7EEE7F80163F17C0161FA2EE0FE0A7161F17C0A216
+3FEE7F8016FF4B1300150F007FB65AB75A5E16E05E6C4AC7FC2B3D7DBC33>66
+D<003FB512F04814FCB7FC826C816C813A03F8007FF0ED1FF8ED07FC15036F7E8281EE7F
+80A2163F17C0161FA217E0160FA4EE07F0AD160F17E0A4161F17C0163FA21780167FEEFF
+00A24B5A15034B5AED1FF8ED7FF0003FB6FC4815C0B75A93C7FC6C14FC6C14F02C3D7EBC
+33>68 D<003FB712E04816F0B8FCA27E7ED801FCC71207A8EE03E093C7FCA6151F4B7EA4
+90B6FCA69038FC003FA46FC7FC92C8FCA817F8EE01FCA9003FB7FC5AB8FCA27E6C16F82E
+3D7EBC33>I<91387F803C903901FFF03E0107EBFC7E011F13FE49EBFFFE5B9038FFE07F
+48EB803FEC000FEA03FC00071407491303485A491301121F5B123F491300A2127F90C8FC
+167C93C7FCA25A5AA992387FFFC092B512E0A37E6C6E13C0923800FE00A36D1301123FA2
+7F121F6D1303120F7F6C6C1307A26C6C130F6C6C131F9038FF803F6CEBE0FF6DB5FC7F6D
+13FE010713F80101EBF07C9026007F80C7FC2B3F7CBD33>71 D<3B7FFFC00FFFF8B56C48
+13FCA46C496C13F8D803F8C7EA7F00B3A290B7FCA601F8C77EB3A53B7FFFC00FFFF8B56C
+4813FCA46C496C13F82E3D7EBC33>I<D83FF8EC1FFC486CEC3FFE486CEC7FFFA2007F16
+FE6C6CECFFFC000716E001EF14F7EC8001A39039E7C003E7A3ECE007A201E314C7A2ECF0
+0FA201E11487ECF81FA201E01407A2ECFC3FA2EC7C3E157E147EEC3E7CA3EC1E78EC1FF8
+A2EC0FF0A3EC07E0EC03C091C7FCAED83FFCEC3FFC486CEC7FFEB591B5FCA26C48EC7FFE
+6C48EC3FFC303D7FBC33>77 D<D907FE137890393FFFC07C90B5EAF0FC4814FC000714FF
+5AEBFC03391FF0007F4848133F0180131F007F140F90C712074814035AA21501A46CEC00
+F86C15007F7F6C7E7FEA1FFE380FFFE06C13FF6C14F06C14FC6C6C13FF011F1480010314
+C0D9003F13E0020313F09138003FF8ED0FFC1507ED03FE1501150016FFA2007C157F12FE
+A56C15FF16FE7FED01FC6D130301F0EB07F801FC130F9039FF807FF091B512E016C000FC
+1580013FEBFE00D8F80F5BD8780013E0283F7BBD33>83 D<003FB712F84816FCB8FCA43A
+FE000FE001A8007CED00F8C71500B3B3A40107B512C049804980A26D5C6D5C2E3D7EBC33
+>I<D83FFCEC3FFC486CEC7FFEB591B5FCA26C48EC7FFE6C48EC3FFCD80FC0EC03F0A76D
+1407000716E0A86C6CEC0FC0A2EC07E0EC0FF0EC1FF8A3000116809039F83FFC1FEC3E7C
+A4EC7E7EA200001600A2EC7C3E01FC5CECFC3FA3ECF81F017C143EA590397DF00FBEA301
+3D14BC90393FE007FCA5ECC003011F5C6D486C5A303E7FBC33>87
+D<007FB512C0B612E0A415C048C8FCB3B3B3ABB612C015E0A46C14C01B4D6CC433>91
+D<127CA212FEA27EA26C7EA26C7EA26C7EA2120F7FA26C7EA26C7EA26C7EA212007FA26D
+7EA26D7EA26D7EA2130F80A26D7EA26D7EA2130180A26D7EA26E7EA26E7EA2141F81A26E
+7EA26E7EA26E7EA2140181A26E7EA2ED7F80A2ED3FC0A2151F16E0A2ED0FF0A2ED07F8A2
+ED03FCA21501A2ED00F81678264D7AC433>I<007FB512C0B612E0A47EC7120FB3B3B3AB
+007FB5FCB6FCA46C14C01B4D7DC433>I<007FB612FEA2B8FCA36C15FEA228077B7D33>
+95 D<EB1FFC90B57E000314E048804814FC48809038F007FFEBE0016E7F153F6C48806C
+48131FC87F150FA5EC0FFF49B5FC131F137F48B6FC0007140F4813C0381FFC00EA3FF0EA
+7FC05B48C7FC5AA56C141F7E6D137FD83FE0497ED9F807EBFFF06CB712F87E6C14F36C14
+C1C69138003FF0D91FF090C7FC2D2E7BAC33>97 D<EA3FFC487E12FFA2127F123F1200AB
+EC01FE91380FFFC04A13F0027F7F91B512FE90B7FCECFE07DAF800138002E0EB7FC04AEB
+3FE04A131FEE0FF091C7FC16074915F81603A217FC1601A9160317F8A26D140717F06E13
+0F17E06E131FEE3FC06E137F9139F801FF80DAFE07130091B55A495C6E5BD97E3F13E0D9
+3C0F138090260003FEC7FC2E3E7FBC33>I<ECFFF0010713FE011FEBFF804914C04914E0
+48B612F048EBC01F9038FE000F485A485A4848EB07E049EB03C0484890C7FC5BA2127F90
+C9FCA25A5AA97E7EA27F003FEC01F06DEB03F86C7E6D13076C6C14F06C6C130F01FFEB1F
+E06CEBE07F6C90B512C06C1580013F14006D13FC01075B010013C0252E79AC33>I<ED7F
+F84B7E5CA280157F1501ABEB01FF010713C1011F13F1017F13F990B6FC5A4813813907FE
+003FD80FF8131F49130F48481307491303123F491301127F90C7FCA25A5AA97E7E15037F
+123F6D1307A26C6C130F6D131F6C6C133F6C6C137F2603FF81B512F091B612F8C602FD13
+FC6D13F96D01E113F8010F018013F0D901FEC8FC2E3E7DBC33>I<ECFF80010713F0011F
+13FC497F90B6FC48158048018013C03A07FE003FE001F8EB0FF048481307484814F84913
+03003F15FC491301127F90C7FC16FE15005A5AB7FCA516FC48C9FC7E7EA36C7E167C6C6C
+14FE7F6C7E6D13016C6CEB03FC6CB4130F6C9038C03FF86C90B512F06D14E06D14C0010F
+1400010313FC9038007FE0272E7BAC33>I<ED3FE0913801FFFC020713FE141F4A13FF5C
+ECFFC015004948137E4A133C010314005CA8003FB612F84815FCB7FCA36C15F8260003F8
+C7FCB3AD003FB612804815C0A46C1580283E7DBD33>I<D901FEEB1FE0903A0FFFC0FFF0
+013F01F313F84990B512FC90B7FC5A48010313E12607FC00EB80F849017F136048489038
+3FC00049131FA2001F8149130FA66D131F000F5DA26D133F6C6C495A6D13FF2603FF0390
+C7FCECFFFE485C5D5DD80FCF13C0D981FEC8FC0180C9FCA27FA26C7E7F90B512FC6CECFF
+C06C15F0000715FC4815FF4816809038E0000748489038007FC090C8EA1FE048150F007E
+150700FE16F0481503A56C1507007E16E0007F150F6C6CEC1FC001E0147FD81FF8903801
+FF80270FFF801F13006C90B55A6C5DC615F0013F14C0010F91C7FC010013F02E447DAB33
+>I<EA3FFC487E12FFA2127F123F1200AB4AB4FC020713C0021F13F0027F7F91B5FC90B6
+7EED07FEECF801ECF0004A7F4A7F5CA291C7FCA35BB3A43B3FFFF80FFFFC486D4813FEB5
+6C4813FFA26C496C13FE6C496C13FC303D7FBC33>I<14E0EB03F8A2497EA36D5AA2EB00
+E091C8FCAA383FFFF8487FA47EEA0001B3AD007FB612C0B712E016F0A216E06C15C0243E
+78BD33>I<EA7FF8487EA4127F1200AC4AB512C04A14E04A14F0A26E14E06E14C0913900
+0FF0004B5A4B5A4B5A4BC7FC4A5A4A5A4A5A4A5A4A5A4A5A4A5A4A7E01FD7F90B5FC81EC
+F3F8ECE3FC14C1EC80FEEC007F5B496D7E6F7E82150F6F7E6F7E8215016F7E3B7FFFF80F
+FFF0B56C4813F817FCA217F86C496C13F02E3D7EBC33>107 D<383FFFFC487FB5FCA27E
+7EC7FCB3B3AD003FB612F84815FCB712FEA26C15FC6C15F8273D7ABC33>I<02FC137E3B
+7FC3FF01FF80D8FFEF01877F90B500CF7F15DF92B57E6C010F13872607FE07130301FC01
+FE7F9039F803FC01A201F013F8A401E013F0B3A53C7FFE0FFF07FF80B548018F13C0A46C
+486C01071380322C80AB33>I<4AB4FC263FFC0713C0267FFE1F13F000FF017F7F91B5FC
+6CB67E6CEC07FEC6EBF801ECF0004A7F4A7F5CA291C7FCA35BB3A43B3FFFF80FFFFC486D
+4813FEB56C4813FFA26C496C13FE6C496C13FC302C7FAB33>I<EB01FE90380FFFC0013F
+13F0497F90B57E488048EB03FF2607FC0013804848EB7FC049133F4848EB1FE049130F48
+48EB07F0A2007F15F890C71203A300FEEC01FCAA6C14036C15F8A26D1307003F15F06D13
+0FA26C6CEB1FE06D133F6C6CEB7FC06C6CEBFF802603FF0313006CEBFFFE6C5C6D5B6D5B
+010F13C0D901FEC7FC262E7AAC33>I<EC01FE3A3FFC0FFFC0486C4813F000FF017F7F91
+B512FE6CB7FC6CEBFE07C6D9F800138002E0EB7FC04AEB3FE04A131FEE0FF091C7FC1607
+4915F81603A217FC1601A9160317F8A26D140717F06E130F17E06E131FEE3FC06E137F91
+39F801FF80DAFE07130091B55A495C6E5B6E13E0020F1380DA03FEC7FC91C9FCAF383FFF
+F8487FB57EA26C5B6C5B2E427FAB33>I<ED03FE3B7FFF801FFF80B5D8C07F13E002C1B5
+FC02C314F014C76C9038CFFE0F39001FDFF09139FFC007E092388003C092C8FC5C5C5CA2
+5CA25CA35CB2007FB512FEB7FCA46C5C2C2C7DAB33>114 D<90381FFE0F90B5EA8F8000
+0314FF120F5A5AEBF007387F800190C7FC00FE147F5A153FA37E007FEC1F0001C090C7FC
+EA3FF8EBFFC06C13FF6C14E0000314F8C680011F13FF01001480020713C0EC007FED1FE0
+007C140F00FEEC07F01503A27EA27F15076D14E06D130F6DEB3FC09038FE01FF90B61280
+160000FD5C00FC14F8D8F83F13E0D8780790C7FC242E79AC33>I<EB03C0497E130FAA00
+3FB612FC4881B7FCA36C5D26000FE0C8FCB3A3161FEE3F80A5167F6E140001075C6E5A91
+38FE07FE6DB55A6D5C6D5C6E5B021F1380DA07FCC7FC29387EB633>I<D83FFCEB1FFE48
+6C497E00FF5CA2007F80003F800000EC007FB3A75EA25DA26D5B90387F800FDAE03F13FC
+6DB612FE17FF6D806D01FE13FE01039038F83FFC010001C0C7FC302C7FAA33>I<3B3FFF
+C00FFFF0486D4813F8B56C4813FCA26C496C13F86C496C13F0D801F8C7EA7E006D14FE00
+005DA26D1301017E5CA2017F13036D5CA2EC8007011F5CA2ECC00F010F5CA36D6C485AA3
+ECF03F010391C7FCA26E5A0101137EA2ECFCFE01005BA214FF6E5AA36E5AA26E5A6E5A2E
+2B7EAA33>I<3B3FFFC07FFF80486DB512C0B500F114E0A26C01E014C06C496C13803B00
+FE000FE000017F495AEB3F804B5A6D6C48C7FC90380FE07E903807F0FEECF1FC903803FB
+F8EB01FF6D5B5D6E5A143F6E5A143F814A7E14FF903801FBF0ECF9F8903803F1FCEB07E0
+157E90380FC07F011F6D7E90383F801F02007F496D7E01FE6D7E484813033B7FFFC03FFF
+E0B56C4813F0A46C496C13E02C2B7DAA33>120 D<ED07FEED7FFF4AB5FC14075C4A13FE
+91383FFE0015E0EC7F8092C7FCB3A45C495A1303EB1FFCEA3FFFB55A14E05C8014F8003F
+7FEA001FEB03FE13016D7E80B3A481EC3FE015FE91381FFFFE6E13FF8014016E7EED07FE
+284D7BC433>123 D<EA7FF0B5FC14C014F0806C7F38003FFE1303EB00FF80B3A4816E7E
+81EC1FFCEDFFFC6E13FF1403805C140F4A13FCEDFC00EC3FE05D4A5A92C7FCB3A45CEB03
+FE133F387FFFFCB55A5C14C091C8FCEA7FF0284D7BC433>125 D
+E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fc cmbx12 14.4 28
+/Fc 28 118 df<EA07F0487E487E487E487EB51280A76C13006C5A6C5A6C5A6C5A111176
+9025>46 D<913803FFC0023F13FC91B6FC010315C0010F018113F0903A1FFC003FF84948
+6D7E49486D7E49486D7E48496D138048496D13C0A24817E04890C813F0A34817F8A24817
+FC49157FA3007F17FEA600FF17FFB3A5007F17FEA6003F17FCA26D15FFA26C17F8A36C17
+F0A26C6D4913E0A26C6D4913C06C17806E5B6C6D4913006D6C495AD91FFCEB3FF8903A0F
+FF81FFF06D90B55A01011580D9003F01FCC7FC020313C0384F7BCD43>48
+D<157815FC14031407141F14FF130F0007B5FCB6FCA2147F13F0EAF800C7FCB3B3B3A600
+7FB712FEA52F4E76CD43>I<EC3FFE0103B512E0010F14FC013F14FF90B712C048D9C07F
+7F2703FE000F13F8D807F801037FD80FE06D7F48486D7F48488001F01680486C6E13C07F
+486C6E13E07FA27013F0A56C5AA26C5AEA0FF0EA03C0C914E05EA218C05E1880A24C1300
+5F4C5A4B5B5F4B5B5F4B5B4B90C7FC4B5A5E4B5AED7FE04B5A4A5B4A48C8FC4A5A5D4A48
+EB01F04A5AEC3F804AC7FC02FEEC03E0495A495A495A495AD91F80140749C8FC013E150F
+017FB7FC90B812C05A5A5A5A5A5A5AB9FC1880A4344E79CD43>I<91380FFFC091B512FC
+0107ECFF80011F15E090263FF8077F9026FF800113FC4848C76C7ED803F86E7E491680D8
+07FC8048B416C080486D15E0A4805CA36C17C06C5B6C90C75AD801FC1680C9FC4C13005F
+A24C5A4B5B4B5B4B13C04B5BDBFFFEC7FC91B512F816E016FCEEFF80DA000713E0030113
+F89238007FFE707E7013807013C018E07013F0A218F8A27013FCA218FEA2EA03E0EA0FF8
+487E487E487EB57EA318FCA25E18F891C7FC6C17F0495C6C4816E001F04A13C06C484A13
+80D80FF84A13006CB44A5A6CD9F0075BC690B612F06D5D011F1580010302FCC7FCD9001F
+1380374F7ACD43>I<177C17FEA2160116031607160FA2161F163F167FA216FF5D5DA25D
+5DED1FBFED3F3F153E157C15FCEC01F815F0EC03E01407EC0FC01580EC1F005C147E147C
+5C1301495A495A5C495A131F49C7FC133E5B13FC485A5B485A1207485A485A90C8FC123E
+127E5ABA12C0A5C96C48C7FCAF020FB712C0A53A4F7CCE43>I<D80380150ED807E0157E
+01FEEC03FED9FFF0137F91B65A5F5F5F5F5F94C7FC5E5E16F016C093C8FC15F801E190C9
+FC01E0CAFCABEC0FFF027F13F001E3B512FE01E76E7E9026FFF8077FDAC0017F49C713F8
+496E7E49143F4981496E7E6C481680C9FC18C08218E0A418F0A3EA0FE0487E487E487E48
+7EA418E0A35B6C484A13C05B491680003EC85A003F17006C6C4A5A6D5D6C6C4A5AD807F8
+495BD803FE01075B2701FFC03F5B6C90B65A013F4AC7FC6D14F8010314C09026007FF8C8
+FC344F79CD43>I<BA12C019FEF1FFC01AF01AFCD8000701F0C7000313FFDE007F7F737F
+070F7F737F878587858785A287A84F5BA263616361634F5B4F5B077F90C7FC4E485A0607
+13F892B812E097C8FC861AF003F0C7000313FE9539003FFF80070F13E0737F07017F8773
+7F747E1C807413C0A27413E0A31CF0A386A362A31CE0A2621CC0A250138097B5FC1C004F
+5B19074F5B073F13F04EB55ABC128098C7FC1AF81AC007F8C8FC54527CD160>66
+D<932601FFFCEC01C0047FD9FFC013030307B600F81307033F03FE131F92B8EA803F0203
+DAE003EBC07F020F01FCC7383FF0FF023F01E0EC0FF94A01800203B5FC494848C9FC4901
+F8824949824949824949824949824990CA7E494883A2484983485B1B7F485B481A3FA248
+49181FA3485B1B0FA25AA298C8FC5CA2B5FCAE6C057FB712E0A280A36C94C7003FEBC000
+A36C7FA36C7FA27E6C7FA26C7F6C7FA26D7E6D7F6D7F6D6D5E6D7F6D01FC93B5FC6D13FF
+6D6C6D5C6E01F0EC07FB020F01FEEC1FF10203903AFFF001FFE0020091B6EAC07F033FEE
+001F030703FC1307DB007F02E01301040149CAFC5B5479D26A>71
+D<B812C0A5D8000701F8C7FCB3B3B3B2B812C0A52A527CD132>73
+D<BAFC19F819FF1AE086D8000701F0C7001F13FC060113FF726C13807313C0070F13E01B
+F0857313F81BFCA27313FEA41BFFA81BFEA31BFC61A21BF84F13F04F13E0614F13C04F13
+004E485A061F5B92B812F01AC04FC7FC19E003F8CBFCB3AEB812C0A550527CD15C>80
+D<B800C00103B612FCA5D8000701F8CAEBF000F31F80B3B3B11B3FA26D97C7FC81637F1B
+7E6D6D17FE505A6E7E505A6E6D15076E4D5A6E6D4B5A6E6D4B5A6E01F84B5A6E6DDA03FF
+C8FC6E6CB46CEB0FFE6F9039F001FFF8030F90B65A030316C0DB007F92C9FC040F14F8DC
+007F13805E537CD167>85 D<B700FE031FB512FEA5D8001F01F0CA383FFE00F307F06D62
+6F170F6D62811B1F6D6D601B3F6D97C7FC6F5F6D197E821BFE6E6D5E1A016E6D5E1A036E
+60701507A26E6D5E1A0F6E6D5E1A1F6E6070153FA26E6D93C8FC626E6E147E1AFE6F5E71
+1301A26F6D5C19036F6D5C19076F5E71130FA26F6D5C191F6F6D5C193F6F93C9FC715BA2
+6FEC807E19FE706D5A18C1705C18E3705C18F318F770EBFFE0A2705CA2705CA37091CAFC
+A2705BA2715AA3715AA2715AA2715A715A5F537DD166>I<EC7FFF0107B512F0013F14FE
+90B77E48D9E00F7F2703FE000113F0486C6D7F6EEB3FFC48826E131F83707FA36C496D7F
+A26C90C7FC6C5AC9FCA6037FB5FC020FB6FC91B7FC01071487013FEBF0074913803901FF
+FC004813F0485B485B485B4890C7FC5A5BA2485AA45EA26D5C007F151D163D6C6C02797F
+6C6D01F113F86C9026C003E1EBFFE06C9026F81FC014F06C90B5487EC6ED001F011F01FC
+010713E0010101E090C8FC3C387CB641>97 D<913801FFF8021FEBFF8091B612F0010315
+FC010F9038C00FFE903A1FFE0001FFD97FFC491380D9FFF05B4817C048495B5C5A485BA2
+486F138091C7FC486F1300705A4892C8FC5BA312FFAD127F7FA27EA2EF03E06C7F17076C
+6D15C07E6E140F6CEE1F806C6DEC3F006C6D147ED97FFE5C6D6CEB03F8010F9038E01FF0
+010390B55A01001580023F49C7FC020113E033387CB63C>99 D<4DB47E0407B5FCA5EE00
+1F1707B3A4913801FFE0021F13FC91B6FC010315C7010F9038E03FE74990380007F7D97F
+FC0101B5FC49487F4849143F484980485B83485B5A91C8FC5AA3485AA412FFAC127FA36C
+7EA37EA26C7F5F6C6D5C7E6C6D5C6C6D49B5FC6D6C4914E0D93FFED90FEFEBFF80903A0F
+FFC07FCF6D90B5128F0101ECFE0FD9003F13F8020301C049C7FC41547CD24B>I<913803
+FFC0023F13FC49B6FC010715C04901817F903A3FFC007FF849486D7E49486D7E4849130F
+48496D7E48178048497F18C0488191C7FC4817E0A248815B18F0A212FFA490B8FCA318E0
+49CAFCA6127FA27F7EA218E06CEE01F06E14037E6C6DEC07E0A26C6DEC0FC06C6D141F6C
+6DEC3F806D6CECFF00D91FFEEB03FE903A0FFFC03FF8010390B55A010015C0021F49C7FC
+020113F034387CB63D>I<ED3FFC0203B5FC020F14C0023F14E09139FFF81FF0499038C0
+3FF849EB807F49903800FFFC495A495AA2495AA2EE7FF8495AEE3FF0EE0FC093C7FCAEB7
+12E0A526007FF8C8FCB3B3A7007FB512FEA52E547CD329>I<DA3FFF14FF0103B5D8F007
+13C0010FDAFC1F13E0013FECFF7F90267FFC0F9038FF9FF09026FFE001EBF83F48496C13
+E0484990387FF01F4890C7D83FF813E0489338FC0FC0F0078048486E6CC7FCA2003F82A9
+001F5EA26C6C4A5AA26C5E6C6D495A6C6D495A6C6D485BDAFC0F5B4890B6C8FCD803EF14
+FC01C314F02607C03F90C9FC91CBFCA2120FA37FA213F813FE90B7FC6C16F817FF18C06C
+836C836C836D828448B9FC12074848C700031480D81FF8EC003F4848150748486F13C083
+485A83A56D5D007F18806D5D003F18006C6C4B5AD80FFEED1FFC6C6C6CEC7FF86C01E049
+485A6C01FE011F5B6C6CB71280010F03FCC7FC010115E0D9000F01FCC8FC3C4F7CB543>
+I<137F497E000313E0487FA2487FA76C5BA26C5BC613806DC7FC90C8FCADEB3FF0B5FCA5
+12017EB3B3A6B612E0A51B547BD325>105 D<EB3FF0B5FCA51203C6FCB3A54CB512F8A5
+9339003FFE00EF1FF0EF3FC04D5A4DC7FCEE03FEEE07F84C5A4C5AEE7FC04CC8FC4B5A4B
+5AED0FF8ED1FE04B7E4B7EECF1FF02F37F02F77F91B6FC83159F030F7F02FE80DAF8077F
+4A7E6F7F6F7F83707E82707F84707F707F82707F84707F177F717E4D13C0B6D8F003B6FC
+A540537CD247>107 D<EB3FF0B5FCA512017EB3B3B3B1B612F0A51C537BD225>I<D93FF0
+EB1FFCB591B512C0030314F0030F8092391FE07FFC92393F001FFE0003027C80C602F07F
+DAF1E081ECF3C0DAF7807F8502FFC7FC5CA25CA45CB3ACB6D8F807B612C0A542367BB54B
+>110 D<913801FFE0021F13FE91B612C0010315F0010F9038807FFC903A1FFC000FFED9
+7FF86D6C7E49486D7F48496D7F48496D7F4A147F48834890C86C7EA24883A248486F7EA3
+007F1880A400FF18C0AC007F1880A3003F18006D5DA26C5FA26C5F6E147F6C5F6C6D4A5A
+6C6D495B6C6D495B6D6C495BD93FFE011F90C7FC903A0FFF807FFC6D90B55A010015C002
+3F91C8FC020113E03A387CB643>I<90397FE003FEB590380FFF80033F13E04B13F09238
+FE1FF89139E1F83FFC0003D9E3E013FEC6ECC07FECE78014EF150014EE02FEEB3FFC5CEE
+1FF8EE0FF04A90C7FCA55CB3AAB612FCA52F367CB537>114 D<903903FFF00F013FEBFE
+1F90B7FC120348EB003FD80FF81307D81FE0130148487F4980127F90C87EA24881A27FA2
+7F01F091C7FC13FCEBFFC06C13FF15F86C14FF16C06C15F06C816C816C81C681013F1580
+010F15C01300020714E0EC003F030713F015010078EC007F00F8153F161F7E160FA27E17
+E07E6D141F17C07F6DEC3F8001F8EC7F0001FEEB01FE9039FFC00FFC6DB55AD8FC1F14E0
+D8F807148048C601F8C7FC2C387CB635>I<143EA6147EA414FEA21301A313031307A213
+0F131F133F13FF5A000F90B6FCB8FCA426003FFEC8FCB3A9EE07C0AB011FEC0F8080A26D
+EC1F0015806DEBC03E6DEBF0FC6DEBFFF86D6C5B021F5B020313802A4D7ECB34>I<D93F
+F8913801FFC0B50207B5FCA50003ED001FC61607B3AE5FA35FA2017F5D173B177B6D6C14
+F3DC01E313F06D6CD907C3EBFFC0903A0FFFC03F836D90B51203010114FE6D6C13F80207
+01E091C7FC42377BB54B>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fd cmbx12 12 22
+/Fd 22 121 df<ED0FFF4AB512C0020F14F0027F80903A01FFF803FC499038C000FE010F
+EB00034948497E49485B5C495A4C138001FF6E13005CA3705AEE01F893C8FCA74BB51280
+B9FCA5C69038E00003B3B0007FD9FFC1B6FCA538467EC53E>12 D<EA07C0EA1FF0EA3FF8
+EA7FFC12FF13FEA213FFA47E7E7EEA07CFEA000FA2131F131EA2133EA2133C137C13F8A2
+EA01F0120313E0EA07C0EA1F801300121E120C1022788E1F>44 D<EA07C0EA1FF0EA3FF8
+EA7FFCEAFFFEA7EA7FFCEA3FF8EA1FF0EA07C0C7FCAEEA07C0EA1FF0EA3FF8EA7FFCEAFF
+FEA7EA7FFCEA3FF8EA1FF0EA07C00F2C78AB1F>58 D<B9FC18F018FE727E19E026003FFC
+C700077F05017F716C7E727E727EA2721380A37213C0A74E1380A24E1300A24E5A4E5A4E
+5A4D5B05075B94B5128091B700FCC7FC18F018FF19E002FCC7000113F8716C7EF01FFE72
+7E7213801AC07213E0A27213F0A31AF8A71AF0A2601AE0604E13C0604E138095B5120005
+075BBA12F86119C04EC7FC18E045447CC350>66 D<DCFFF01470031F01FF14F04AB6EAE0
+010207EDF803023FEDFE0791B539E001FF0F4949C7EA3F9F010701F0EC0FFF4901C08049
+90C87E4948814948814948167F4849163F4849161F5A4A160F485B19074890CAFC19035A
+5BA2007F1801A34994C8FC12FFAD057FB612F0127F7FA3003FDC0001EBF000A27F7EA26C
+7FA26C7F807E6C7F6C7F6D7E6D6C5D6D6C7E6D6D5C6D01F05C010101FE143F6D903AFFF0
+01FF9F023F90B6120F0207EDFC030201EDF000DA001F02C01330030001FCC9FC4C467AC4
+58>71 D<903801FFE0011F13FE017F6D7E48B612E03A03FE007FF84848EB1FFC6D6D7E48
+6C6D7EA26F7FA36F7F6C5A6C5AEA00F090C7FCA40203B5FC91B6FC1307013F13F19038FF
+FC01000313E0000F1380381FFE00485A5B127F5B12FF5BA35DA26D5B6C6C5B4B13F0D83F
+FE013EEBFFC03A1FFF80FC7F0007EBFFF86CECE01FC66CEB8007D90FFCC9FC322F7DAD36
+>97 D<EB7FC0B5FCA512037EB1ED0FF892B57E02C314E002CF14F89139DFC03FFC9139FF
+000FFE02FCEB03FF4A6D13804A15C04A6D13E05CEF7FF0A218F8173FA318FCAC18F8A217
+7F18F0A3EFFFE06E15C06E5B6E491380027C491300496C495A903AFC1FC07FFC496CB512
+F0D9F00314C049C691C7FCC8EA1FF036467DC43E>I<EC3FFC49B512C0010F14F0013F14
+FC90397FF003FE9039FFC001FF0003495A48494813805B120F485AA2485A6F1300007F6E
+5AED00784991C7FCA212FFAC6C7EA3123F6DEC03C0A26C6C1407000F16806D140F6C6DEB
+1F006C6D133E6C01F05B3A007FFC03F86DB55A010F14C0010391C7FC9038003FF82A2F7C
+AD32>I<EE03FEED07FFA5ED001F160FB1EC3FE0903803FFFC010FEBFF8F013F14CF9039
+FFF807FF48EBC00148903880007F4890C7123F4848141F49140F121F485AA3127F5BA212
+FFAC127FA37F123FA26C6C141FA26C6C143F0007157F6C6C91B5FC6CD9C00314FC6C9038
+F01FEF6DB5128F011FEBFE0F010713F89026007FC0EBF80036467CC43E>I<EC3FF80103
+B57E010F14E0013F8090397FF83FF89039FFC007FC48496C7E48496C7E48486D1380485A
+001FED7FC05B003FED3FE0A2127F5B17F0161F12FFA290B7FCA401F0C9FCA5127FA27FA2
+123F17F06C7E16016C6C15E06C6C14036C6DEB07C06C6DEB0F806C01F0EB3F0090397FFE
+01FE011FB55A010714F0010114C09026001FFEC7FC2C2F7DAD33>I<DAFFE0137E010F90
+39FE03FF80013FEBFF8F90B812C048D9C07F133F489038001FF84848EB0FFC4848903907
+FE1F80001F9238FF0F00496D90C7FCA2003F82A8001F93C7FCA26D5B000F5D6C6C495A6C
+6C495A6C9038C07FF04890B55A1680D8078F49C8FC018013E0000F90CAFCA47F7F7F90B6
+12C016FC6CEDFF8017E06C826C16FC7E000382000F82D81FF0C77ED83FC0140748480201
+13808248C9FC177FA46D15FF007F17006D5C6C6C4A5A6C6C4A5AD80FFEEC3FF83B07FFC0
+01FFF0000190B612C06C6C92C7FC010F14F8D9007F90C8FC32427DAC38>103
+D<137C48B4FC4813804813C0A24813E0A56C13C0A26C13806C1300EA007C90C7FCAAEB7F
+C0EA7FFFA512037EB3AFB6FCA518467CC520>105 D<EB7FC0B5FCA512037EB3B3B3A3B6
+1280A519457CC420>108 D<90277F8007FEEC0FFCB590263FFFC090387FFF8092B5D8F0
+01B512E002816E4880913D87F01FFC0FE03FF8913D8FC00FFE1F801FFC0003D99F009026
+FF3E007F6C019E6D013C130F02BC5D02F86D496D7EA24A5D4A5DA34A5DB3A7B60081B600
+03B512FEA5572D7CAC5E>I<90397F8007FEB590383FFF8092B512E0028114F8913987F0
+3FFC91388F801F000390399F000FFE6C139E14BC02F86D7E5CA25CA35CB3A7B60083B512
+FEA5372D7CAC3E>I<EC1FFC49B512C0010714F0011F14FC90397FF80FFF9026FFC0017F
+48496C7F4848C7EA3FE000078248486E7E49140F001F82A2003F82491407007F82A400FF
+1780AA007F1700A46C6C4A5AA2001F5E6D141F000F5E6C6C4A5AA26C6C6CEBFFE06C6D48
+5B27007FF80F90C7FC6DB55A010F14F8010114C09026001FFCC8FC312F7DAD38>I<9039
+7FC00FF8B590B57E02C314E002CF14F89139DFC03FFC9139FF001FFE000301FCEB07FF6C
+496D13804A15C04A6D13E05C7013F0A2EF7FF8A4EF3FFCACEF7FF8A318F017FFA24C13E0
+6E15C06E5B6E4913806E4913006E495A9139DFC07FFC02CFB512F002C314C002C091C7FC
+ED1FF092C9FCADB67EA536407DAC3E>I<90387F807FB53881FFE0028313F0028F13F8ED
+8FFC91389F1FFE000313BE6C13BC14F8A214F0ED0FFC9138E007F8ED01E092C7FCA35CB3
+A5B612E0A5272D7DAC2E>114 D<90391FFC038090B51287000314FF120F381FF003383F
+C00049133F48C7121F127E00FE140FA215077EA27F01E090C7FC13FE387FFFF014FF6C14
+C015F06C14FC6C800003806C15806C7E010F14C0EB003F020313E0140000F0143FA26C14
+1F150FA27EA26C15C06C141FA26DEB3F8001E0EB7F009038F803FE90B55A00FC5CD8F03F
+13E026E007FEC7FC232F7CAD2C>I<EB01E0A51303A41307A2130FA2131FA2133F137F13
+FF1203000F90B51280B7FCA4C601E0C7FCB3A3ED01E0A9150302F013C0137F150790393F
+F80F8090391FFC1F006DB5FC6D13FC01015B9038003FE023407EBE2C>I<D97FC049B4FC
+B50103B5FCA50003EC000F6C81B3A85EA25EA25E7E6E491380017FD901F713FE9138F807
+E76DB512C7010F1407010313FE9026007FF0EBFC00372E7CAC3E>I<B500FE90383FFFF0
+A5C601F0903803E0006D6C495A013F4A5A6D6C49C7FC6E5B6D6C137E6DEB807C6D6D5A6D
+EBC1F0EDE3E06DEBF7C06EB45A806E90C8FC5D6E7E6E7F6E7FA24A7F4A7F8291381F3FFC
+EC3E1F027C7F4A6C7E49486C7F01036D7F49487E02C08049486C7F49C76C7E013E6E7E01
+7E141FB500E090B512FCA5362C7EAB3B>120 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fe cmsy10 12 1
+/Fe 1 16 df<49B4FC010F13E0013F13F8497F48B6FC4815804815C04815E04815F0A248
+15F84815FCA3B712FEAA6C15FCA36C15F86C15F0A26C15E06C15C06C15806C15006C6C13
+FC6D5B010F13E0010190C7FC27267BAB32>15 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Ff cmr12 12 76
+/Ff 76 124 df<9239FFC001FC020F9038F80FFF913B3F803E3F03C0913BFC00077E07E0
+D903F890390FFC0FF0494890383FF81F4948EB7FF0495A494814E049C7FCF00FE0499139
+3FC0038049021F90C7FCAFB912F0A3C648C7D81FC0C7FCB3B2486CEC3FF0007FD9FC0FB5
+12E0A33C467EC539>11 D<4AB4FC020F13E091387F80F8903901FC001C49487FD907E013
+0F4948137F011FECFF80495A49C7FCA25B49EC7F00163E93C7FCACEE3F80B8FCA3C648C7
+FC167F163FB3B0486CEC7FC0007FD9FC1FB5FCA330467EC536>I<913801FFC0020FEBFB
+8091387F803F903801FC00494813FFEB07E0EB1FC0A2495A49C7FC167F49143F5BAFB8FC
+A3C648C7123FB3B2486CEC7FC0007FD9FC1FB5FCA330467EC536>I<121EEA7F80EAFFC0
+A9EA7F80ACEA3F00AB121EAC120CA5C7FCAA121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A
+4778C61B>33 D<001EEB03C0397F800FF000FF131F01C013F8A201E013FCA3007F130F39
+1E6003CC0000EB000CA401E0131C491318A3000114384913300003147090C712604814E0
+000614C0000E130148EB038048EB070048130E0060130C1E1D7DC431>I<121EEA7F8012
+FF13C0A213E0A3127FEA1E601200A413E013C0A312011380120313005A1206120E5A5A5A
+12600B1D78C41B>39 D<140C141C1438147014E0EB01C01303EB0780EB0F00A2131E5BA2
+5B13F85B12015B1203A2485AA3485AA348C7FCA35AA2123EA2127EA4127CA312FCB3A212
+7CA3127EA4123EA2123FA27EA36C7EA36C7EA36C7EA212017F12007F13787FA27F7FA2EB
+0780EB03C01301EB00E014701438141C140C166476CA26>I<12C07E12707E7E7E120F6C
+7E6C7EA26C7E6C7EA21378137C133C133E131E131FA2EB0F80A3EB07C0A3EB03E0A314F0
+A21301A214F8A41300A314FCB3A214F8A31301A414F0A21303A214E0A3EB07C0A3EB0F80
+A3EB1F00A2131E133E133C137C13785BA2485A485AA2485A48C7FC120E5A5A5A5A5A1664
+7BCA26>I<14F0A2805CA70078EC01E000FCEC03F0B4140FD87F80EB1FE0D83FC0EB3FC0
+3A0FF060FF003903F861FC3900FC63F090383F6FC0D90FFFC7FCEB03FCEB00F0EB03FCEB
+0FFF90383F6FC09038FC63F03903F861FC390FF060FF3A3FC0F03FC0D87F80EB1FE0D8FF
+00EB0FF000FC14030078EC01E0C790C7FCA7805CA2242B7ACA31>I<121EEA7F8012FF13
+C0A213E0A3127FEA1E601200A413E013C0A312011380120313005A1206120E5A5A5A1260
+0B1D78891B>44 D<B612C0A61A067F9721>I<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00
+0A0A78891B>I<1618163C167CA2167816F8A216F01501A216E01503A216C01507A21680
+150FA2ED1F00A2151E153EA2153C157CA2157815F8A25D1401A24A5AA25D1407A25D140F
+A292C7FC5CA2141E143EA2143C147CA25CA25C1301A25C1303A25C1307A25C130FA291C8
+FC5BA2133EA2133C137CA2137813F8A25B1201A25B1203A2485AA25B120FA290C9FC5AA2
+121E123EA2123C127CA2127812F8A25A126026647BCA31>I<14FF010713E090381F81F8
+90383E007C01FC133F4848EB1F8049130F4848EB07C04848EB03E0A2000F15F049130100
+1F15F8A2003F15FCA390C8FC4815FEA54815FFB3A46C15FEA56D1301003F15FCA3001F15
+F8A26C6CEB03F0A36C6CEB07E0000315C06D130F6C6CEB1F806C6CEB3F00013E137C9038
+1F81F8903807FFE0010090C7FC28447CC131>I<143014F013011303131F13FFB5FC13E7
+13071200B3B3B0497E497E007FB6FCA3204278C131>I<EB03FE90381FFFC0017F13F039
+01F80FFC3903C001FE48486C7E000EC7EA7F8048EC3FC0ED1FE04815F00030140F007015
+F800601407126CB415FC7F7F1503A46C4813076CC7FCC8FC16F8A2150F16F0151F16E0A2
+ED3FC0ED7F8016005D5D4A5A4A5A4A5A5D4A5A4A5A4AC7FC147C5C5C495A495A495A49C7
+120C131E5B013814185B5B485A4848143848C81230000E1570001FB612F0A25A5AB712E0
+A326427BC131>I<49B4FC010F13E0013F13FC9038FE01FE3A01F0007F80D803C0EB3FC0
+48C7EA1FE0120EED0FF0EA0FE0486C14F8A215077F5BA26C48130FEA03C0C813F0A3ED1F
+E0A2ED3FC01680ED7F0015FE4A5AEC03F0EC1FC0D90FFFC7FC15F090380001FCEC007FED
+3F80ED1FC0ED0FE016F0ED07F816FC150316FEA2150116FFA3121EEA7F80487EA416FE49
+1303A2007EC713FC00701407003015F80038140F6C15F06CEC1FE06C6CEB3FC0D803E0EB
+7F803A01FE01FE0039007FFFF8010F13E0010190C7FC28447CC131>I<ED0380A2150715
+0FA2151F153FA2157F15FFA25CEC03BF153F14071406140C141C141814301470146014C0
+13011480EB03005B13065B131C13185B1370136013E0485A5B120390C7FC1206120E120C
+5A123812305A12E0B812C0A3C8383F8000ADEDFFE0027FEBFFC0A32A437DC231>I<0006
+15C0D807C0130701FCEB7F8090B612005D5D5D15E0158026063FFCC7FC90C9FCAE14FF01
+0713C090381F01F090383800FC01F0137ED807C07F49EB1F8016C090C7120F000615E0C8
+EA07F0A316F81503A216FCA5123E127F487EA416F890C712075A006015F0A20070140F00
+3015E00038EC1FC07E001EEC3F806CEC7F006C6C13FE6C6C485A3901F807F039007FFFE0
+011F90C7FCEB07F826447BC131>I<EC07FCEC3FFF91B512C0903903FC03E0903907E000
+F0D91FC0133849C71258017EEB01FC01FE1303491307485A485AA24848EB03F8000FEC01
+F092C7FC485AA3485AA3127FA29038007F80903801FFF090380780FC39FF0E003E49EB1F
+8049EB0FC049EB07E0136001E0EB03F04914F8150116FC5BED00FEA390C812FFA47EA57F
+123FA216FE121F15016D14FC120FED03F86C7EED07F06C6C14E06C6CEB0FC06C6CEB1F80
+017EEB3F0090383F80FE90380FFFF8010313E00100138028447CC131>I<14FF010713E0
+011F13F890387F00FE01FC133FD801F0EB1F804848EB0FC049EB07E00007EC03F0484813
+01A290C713F8481400A47FA26D130116F07F6C6CEB03E013FC6C6CEB07C09039FF800F80
+6C9038C01F006CEBF03EECF87839007FFEF090383FFFC07F01077F6D13F8497F90381E7F
+FFD97C1F1380496C13C02601E00313E048486C13F000079038007FF84848EB3FFC48C712
+0F003EEC07FE150148140016FF167F48153FA2161FA56C151E007C153EA2007E153C003E
+157C6C15F86DEB01F06C6CEB03E06C6CEB07C0D803F8EB1F80C6B4EBFF0090383FFFFC01
+0F13F00101138028447CC131>56 D<121EEA7F80A2EAFFC0A4EA7F80A2EA1E00C7FCB3A5
+121EEA7F80A2EAFFC0A4EA7F80A2EA1E000A2B78AA1B>58 D<007FBAFCBB1280A26C1900
+CEFCB0007FBAFCBB1280A26C190041187BA44C>61 D<16C04B7EA34B7EA34B7EA34B7EA3
+ED19FEA3ED30FFA203707FED607FA203E07FEDC03FA2020180ED801FA2DA03007F160FA2
+0206801607A24A6D7EA34A6D7EA34A6D7EA20270810260147FA202E08191B7FCA2498202
+80C7121FA249C87F170FA20106821707A2496F7EA3496F7EA3496F7EA201788313F8486C
+83D80FFF03037FB500E0027FEBFFC0A342477DC649>65 D<B8FC17E017FC00019039C000
+03FF6C6C4801007FEF3FC0717E717E717E84170384170184A760A21703601707604D5A4D
+5AEF7FC04DC7FCEE03FEEE3FF091B65A17FC0280C7B47EEF1FC0EF0FF0717E717E717E71
+7E1980187F19C0A2183F19E0A8F07FC0A2198018FF4D1300A24D5AEF0FFC4D5AEF7FE048
+486C903803FFC0B9C7FC17FC17C03B447CC345>I<DB0FFE146092B500C013E0020314F0
+913A0FFC01FC0191393FC0003E02FFC7EA0F83D903FCEC03C74948EC01E74948EC00FF49
+48157F4948153F4948151F49C9120F485A491607120348481603A248481601A248481600
+A2123FA2491760127FA31900485AAE6C7EA21960A2123F7FA2001F18E07F000F18C0A26C
+6C160119806C6C160312016DEE07006C6C16066D6C150E6D6C5D6D6C5D6D6C15786D6C5D
+6D6C4A5AD900FFEC0780DA3FC0011FC7FCDA0FFC13FC0203B512F0020014C0DB0FFEC8FC
+3B487BC546>I<B8FC17F017FC00019039C00007FF6C499038007FC0017FED1FE0EF07F0
+EF03FC717E717E84727E727E727EA2727E85180385A2180185A38584A31A80AD1A00A360
+61A361180361180761180F614E5A183F614EC7FC18FEEF03FC4D5AEF1FE001FFED7FC048
+6DD907FFC8FCB812FC17F094C9FC41447CC34B>I<B912F8A3000101C0C7127F6C6C48EC
+07FC17011700187C183C181CA284A31806A4180704067FA395C7FCA4160EA2161E163E16
+FE91B5FCA3EC8000163E161E160EA21606A319C0A3F0018093C7FCA41803A21900A260A2
+60A2181EA2183E187EEF01FE170748486C147FB95AA33A447CC342>I<B912F0A3000101
+C0C7127F6C6C48EC0FF817031701170018781838A2181CA3180CA4180E1806160CA21800
+A5161CA2163C167CED01FC91B5FCA3EC8001ED007C163C161CA2160CA793C8FCB0804848
+7EB612F8A337447CC340>I<DB0FFE146092B500C013E0020314F0913A0FFC01FC019139
+3FC0003E02FFC7EA0F83D903FCEC03C74948EC01E74948EC00FF4948157F4948153F4948
+151F49C9120F485A491607120348481603A248481601A248481600A2123FA2491760127F
+A396C7FC485AAD4CB612C06C7EA293C7387FF000725A003F171F7FA2121F7F120FA26C7E
+A26C7E6C7EA26C7E6D7E6D6C153F6D7E6D6C157F6D6C15E7D903FEEC01C7D900FFEC0383
+DA3FE0EB0F01DA0FFCEBFE000203B500F81360020002E090C7FCDB0FFEC9FC42487BC54D
+>I<B6D8C003B6FCA3000101E0C70007138026007F80913801FE00B3A991B7FCA30280C7
+1201B3AC2601FFE0913807FF80B6D8C003B6FCA340447CC349>I<B612F0A3C6EBF0006D
+5A6D5AB3B3B3A4497E497EB612F0A31C447DC323>I<B600C049B512C0A3000101E0C838
+7FFC006C49ED3FE06D481680063EC7FC183C183860604D5A4D5A4DC8FC171E17385F5F4C
+5A4C5A4CC9FC160E5E5E5E5E4B5A4B7E4B7E150F4B7E4B7E1577EDE3FE913881C1FFEC83
+81DA87007F028E6D7E149C02B86D7E02F06D7E14C04A6D7E707EA2707E707EA2707F717E
+A2717E717EA2717E717EA2717E717EA2717F8585496C82486D4A13FCB600C0011FEBFFE0
+A343447CC34C>75 D<B612F8A3000101E0C9FC6C6C5A5CB3B31830A418701860A518E0A3
+EF01C0A217031707A2170F173F177FEE01FF48486C011F1380B9FCA334447CC33D>I<B5
+6C933807FFFC6E5EA20001F1FE0026006FE0EE1BF8A3D967F01633A2D963F81663A3D961
+FC16C3A3D960FEED0183A2027FED0303A36E6C1406A36E6C140CA26E6C1418A36E6C1430
+A36E6C1460A26E6C14C0A36E6CEB0180A3037FEB0300A292383F8006A36F6C5AA36F6C5A
+A26F6C5AA36F6C5AA36F6C5AA26FB45AA370C7FC13F0A2486C143ED80FFFEF0FFEB500F0
+011C0107B512FCA34E447BC359>I<B56C020FB5FC8080C6040013F06D6CED1F80D96FF8
+ED0F00A2D967FC1506EB63FEA2EB61FF01607FA26E7E6E7EA26E7E6E7EA26E7E6E7EA26E
+7E6E7FA26F7E6F7EA26F7E6F7EA26F7E6F7EA26F7E6F1380A2EE7FC0EE3FE0A2EE1FF0EE
+0FF8A2EE07FCEE03FEA2EE01FF701386A2EF7FC6EF3FE6A2EF1FF6EF0FFEA217071703A2
+17011700A201F0167E183E487ED80FFF161EB500F0150EA2180640447CC349>I<ED1FFC
+4AB512C0913907F007F091391F8000FC027EC7123FD901F8EC0FC049486E7E49486E7E49
+486E7E49486E7E49C9127E017E8201FE834848707E4848707EA24848707EA2000F844916
+03001F84A24848707EA3007F84A24982A300FF1980AD6C6C4C1300A4003F606D1603A200
+1F60A26C6C4C5AA26C6C4C5AA20003606D161F6C6C4C5A000060017F4CC7FC6E5D013F5E
+6D6C4A5AD907E0EC03F06D6C4A5AD901FCEC1FC0D9007E4AC8FCDA1F8013FC913907F007
+F00201B512C09126001FFCC9FC41487BC54C>I<B712FCEEFFC017F800019039C0000FFC
+6C6C48EB01FF9338007F80EF1FE0170FEF07F018F8EF03FCA218FE1701A218FFA718FEA2
+170318FCA2EF07F818F0EF0FE0EF1FC0EF7F80933801FE00EE0FFC91B612F017800280C9
+FCB3AA3801FFE0B612C0A338447CC342>I<ED1FFC4AB512C0913907F007F091391F8000
+FC027EC7123F4948EC1FC0D903F0EC07E049486E7E49486E7E49486E7E49C9127E49167F
+01FE707E4848707E00038449160F000784491607000F84A24848707EA2003F84491601A2
+007F84A34982A200FF1980AD007F19006D5EA3003F60A26D1603001F60A2000F606D1607
+0007606DD903F0130F0003DA0FFC5C6DD91C0E131F00014A6C5C6C6C903A3003803F8001
+7FD9700149C7FC92386000C0D93F8015FED91FC0ECE1FCD907E0EC63F0D903F0EC77E090
+2601FC70EB7FC09026007E3091C8FCDA1FB813FC912707FC07F814C00201B57E9139001F
+FC3C92C7FC053E1301171E051F13031A80F08007F0C00F94380FF03F95B51200A2836171
+5BA2715B9438007FE0F01F8042597BC54C>I<B712E016FF17C000019039C0003FF86C6C
+48EB03FCEE00FF717E717E717E717E717EA284170384A760A21707604D5AA24D5A4D5A4D
+C8FCEE01FEEE07F8EE3FE091B6C9FC16FC913980007F80EE0FE0707EEE03FC707E160083
+717EA2717EA784A71A6084171FA21AE0716C13C02601FFE002071301B600C01680943801
+FC03943900FE0700CBEA3FFEF007F843467CC348>I<49B41303010FEBE007013F13F890
+39FE00FE0FD801F8131FD807E0EB079F49EB03DF48486DB4FC48C8FC4881003E81127E82
+127C00FC81A282A37E82A27EA26C6C91C7FC7F7FEA3FF813FE381FFFE06C13FE6CEBFFE0
+6C14FC6C14FF6C15C0013F14F0010F80010180D9001F7F14019138001FFF03031380816F
+13C0167F163F161F17E000C0150FA31607A37EA36C16C0160F7E17806C151F6C16006C5D
+6D147ED8FBC05CD8F9F0495AD8F07C495A90393FC00FE0D8E00FB51280010149C7FC39C0
+003FF02B487BC536>I<003FB912F8A3903BF0001FF8001F01806D481303003EC7150048
+187C0078183CA20070181CA30060180CA5481806A5C81600B3B3A54B7EED7FFE49B77EA3
+3F447DC346>I<B600C0010FB5FCA3000101E0C813F026007F80ED1F80F00F00A21806B3
+B3A7180E6D6C150CA2181C131F6E1518010F163818306D6C1570606D6C14016D6C5D6D6C
+EC0780027F4AC7FC6E6C131EDA1FE0137C913907FC03F00201B55A6E6C1380DB07FCC8FC
+40467CC349>I<B60107B500F890380FFFFEA3000301E0D9001F90C813F06C0180DA0FFC
+ED3FC091C86C48ED1F006C871C0E6D6C6E7E1C0CA26D6C6F5DA36EDA06FF1538011F1A30
+A26E020E6D1470010FDB0C7F1560A26E021C7F0107DB183F5DA2856D6CDA301F4A5AA36D
+6C4A6C6C49C7FCA36D6C4A6C6C1306A3DB80016E130E027FDA8003140CA2DBC00380023F
+DA00015CA203E081021F01066D5CA36E6C486E6C5AA36E6C486E6C5AA36F48EC1FE10203
+60A2DBFE7015F302010160020F90C8FCA2DBFFE015FB6E49EC07FEA36F486E5AA36FC86C
+5AA3031E6F5AA4030C16605F467EC364>87 D<003FB500E0011FB5FCA3C691C7000713E0
+D93FFC020190C7FC6D4815FC010F6F5A6D6C15E0A26D6C4A5A6D6C5D4DC8FC6D6D5B6E6C
+13065F6E6C131C6E6C13185F6E6C13706E6C13605F913803FE01DA01FF5B4CC9FC6E1387
+ED7FC616CCED3FFC6F5A5E6F7E6F7EA26F7E82A203067F150E92380C7FC04B6C7E153892
+38301FF04B6C7E15E04B6C7E4A486C7E14034B6C7E02066D7F140E020C6E7E4A6E7E1438
+02306E7E4A6E7E14E04A6E7E49486E7E130349C86C7E496F7F5B496C8201FF83000701E0
+020313F8B500F8021FEBFFF0A344447EC349>I<B66C91380FFFFCA3000101F8C8000313
+C026007FE0923800FE0061013F17F06D6C5E80010F5F6D6C4B5A18036D6C93C7FC6E1506
+6D160E6D6D140C181C6E6C14186E6C5C18706E6C146018E06E6C5C6E6C495A17036E6C91
+C8FC5F6E6C13066E6D5A171C92387FC0185FED3FE06F6C5A17E06F6C5AEEF980ED07FF6F
+90C9FCA26F5AB3A6923807FF800203B6FCA346447FC349>I<EAFFFCA4EAF000B3B3B3B3
+B3A2EAFFFCA40E6476CA1B>91 D<01C01318000114384848137048C712E0000EEB01C000
+0C1480001C13030018140000385B003013060070130E0060130CA300E0131C481318A400
+CFEB19E039FFC01FF801E013FCA3007F130FA2003F130701C013F8390F0001E01E1D71C4
+31>I<EAFFFCA4EA003CB3B3B3B3B3A2EAFFFCA40E647ECA1B>I<13C01201EA0380EA0700
+120E120C121C12181238123012701260A312E05AA412CFEAFFC013E0A3127FA2123F13C0
+EA0F000B1D79C41B>96 D<EB07FC90383FFF809038F80FE03903C003F048C66C7E000E6D
+7ED80FC0137E486C137F6D6D7EA36F7EA26C5AEA0380C8FCA4EC0FFF49B5FC90380FFE1F
+EB3FC0EBFF00EA03FC485A485A485A485A127F5B176048C7FCA3153FA36D137F007F14EF
+6D9038C7E0C0003F13013A1FE00783F13B07F81E03FF802701FFFC0113003A001FE0007C
+2B2E7CAC31>I<EA01FC12FFA3120712031201B3EC03FC91380FFF8091383C07E0913870
+01F89039FDE0007E02807F01FFEC1F8091C713C049EC0FE049140717F0A2EE03F8A217FC
+A2160117FEAB17FC1603A217F8A2EE07F0A26DEC0FE017C06D141F01FBEC3F80D9F380EB
+7E00D9E1C05B9039E0F001F89039C03C07E09039801FFF80C7D803FCC7FC2F467DC436>
+I<EC7F80903803FFF090380FC07C90383F000F01FCEB03804848EB01C00003140F4848EB
+1FE049133F120F485AA2485AED1FC0007FEC070092C7FCA290C9FC5AAB7E7FA2123F1630
+7F001F15706C6C146016E06C6C14C06C6C13010001EC03806C6CEB0700013F131E90381F
+C078903807FFF001001380242E7DAC2B>I<167FED3FFFA315018182B3EC7F80903803FF
+F090380FC07C90383F000E017E1307496D5AD803F87F48487F5B000F81485AA2485AA212
+7FA290C8FC5AAB7E7FA2123FA26C7EA2000F5D7F6C6C5B00035C6C6C9038077F806C6C01
+0E13C0013F011C13FE90380FC0F8903803FFE09026007F0013002F467DC436>I<EB01FE
+903807FFC090381F03F090387E00FC49137E48487F485A4848EB1F80000F15C049130F12
+1F484814E01507A2007F15F090C7FCA25AA390B6FCA290C9FCA67EA27FA2123F16306C7E
+1670000F15606D14E06C6C14C0000314016C6CEB03806C6CEB0700013E131E90381F80F8
+903803FFE0010090C7FC242E7DAC2B>I<EC0FE0EC7FF8903801F81E903803F03F90390F
+E07F8090381FC0FF5C133F495AA2ED7F0001FE131C92C7FCAFB67EA3C648C8FCB3B2486C
+7E007F13FFA321467EC51E>I<EE0F80D901FCEB7FE0903A0FFF81F0F090393F07E38190
+39FC01FF033A01F800FE014848017E13E00007027FC7FC497F000F8149131F001F81A900
+0F5D6D133F000792C7FC6D5B0003147E6C6C5B6D485A3903BF07E090380FFF80260701FC
+C8FC90CAFCA25AA37F6C7E7F90B512F86C14FF16E06C15F86C6C8048B67E3A07C0000FFF
+48481300003FC8EA3F80003E151F48ED0FC0A2481507A56C150F007C1680007E151F003E
+16006C153E6C6C5CD807E0495AD801F8EB07E0D8007FEB3F8090261FFFFEC7FC010113E0
+2C427DAC31>I<EA01FC12FFA3120712031201B3EC01FE913807FFC091381E07F0913838
+01F802707FECE000D9FDC07F5C01FF147F91C7FCA25BA35BB3A8486CECFF80B5D8F83F13
+FEA32F457DC436>I<EA01E0EA07F8A2487EA46C5AA2EA01E0C8FCADEA01FC12FFA31207
+12031201B3B0487EB512F8A315437DC21C>I<143C14FFA2491380A46D1300A2143C91C7
+FCADEC7F80EB3FFFA31300147F143FB3B3AA123E127F39FF807F00A2147EA25C6C485A38
+3C01F06C485A3807FF80D801FEC7FC195785C21E>I<EA01FC12FFA3120712031201B3A2
+92381FFFE0A36F1300ED07F816E05E5E030EC7FC5D5D5D5D4A5A4A5A4AC8FC5CEC3F804A
+7E14FF9038FDCFE09038FF8FF01407496C7E01FC7F14016E7E81816F7E82151F6F7E8215
+07826F7E8282486C491380B5D8F81F13F8A32D457DC433>I<EA01FC12FFA31207120312
+01B3B3B3A5487EB512F8A315457DC41C>I<D801FC01FFEC1FE000FF010701E0EBFFFC91
+3B0F03F801E07F913C3C01FC07803F800007903C7000FE0E001FC0000349D97E1C130F26
+01FDC0D97F38804A143001FFDA3FF06D7E91C75BA2495DA3495DB3A8486C4A6C497EB5D8
+F81FB50003B512E0A34B2C7DAB52>I<3901FC01FE00FF903807FFC091381E07F0913838
+01F8000701707F0003EBE0002601FDC07F5C01FF147F91C7FCA25BA35BB3A8486CECFF80
+B5D8F83F13FEA32F2C7DAB36>I<EC7F80903803FFF090380FC0FC90383E001F496D7E49
+6D7E48486D7E48486D7E48486D7E000F81A24848147E003F157FA290C87E481680A44816
+C0AA6C1680A26D147F003F1600A2001F157E6D14FE000F5D6D130100075D6C6C495A6C6C
+495A6C6C495A013E49C7FC90381FC0FE903807FFF89038007F802A2E7DAC31>I<3901FC
+03FC00FF90380FFF8091383C07E091387001F83A07FDE000FE00010180137F01FFEC3F80
+91C7EA1FC04915E049140F17F0160717F8160317FCA3EE01FEABEE03FCA3EE07F8A217F0
+160F6D15E0EE1FC06D143F17806EEB7E00D9FDC05B9039FCF003F891383C0FE091381FFF
+80DA03FCC7FC91C9FCAE487EB512F8A32F3F7DAB36>I<3903F803F000FFEB1FFCEC3C3E
+EC707F0007EBE0FF3803F9C000015B13FBEC007E153C01FF13005BA45BB3A748B4FCB512
+FEA3202C7DAB26>114 D<90383FE0183901FFFC383907E01F78390F0003F8001E130148
+1300007C1478127800F81438A21518A27EA27E6C6C13006C7E13FC383FFFE06C13FC6C13
+FF6C14C06C14E0C614F0011F13F81300EC0FFC140300C0EB01FE1400157E7E153EA27EA3
+6C143C6C147C15786C14F86CEB01F039F38003E039F1F00F8039E07FFE0038C00FF01F2E
+7DAC26>I<1306A5130EA4131EA3133E137EA213FE12011207001FB512F0B6FCA2C648C7
+FCB3A4150CAA017E131C017F1318A26D133890381F8030ECC070903807E0E0903801FFC0
+9038007F001E3E7EBC26>I<D801FC147F00FFEC3FFFA300071401000380000181B3A85E
+A35DA212006D5B017E9038077F80017F010E13C06D011C13FE90380FC078903803FFF090
+26007F8013002F2D7DAB36>I<B539F001FFFCA3000790C7EA7FE06C48EC1F8000011600
+160E1200160C017F5CA280013F5CA26E1370011F146080010F5CA2ECF00101075CA26D6C
+48C7FCA26E5A01011306A26D6C5AA214FF6E5AA215B8EC3FB015F06E5AA36E5AA26E5AA3
+6EC8FC2E2C7EAA33>I<B500E0B539E03FFF80A30007903C000FFE000FFC00D803FCD903
+F8EB03F8F001E0120103015D6D80000060A26D6E13036DD9037E91C7FCA20280017F5B01
+3FD9063F1306A2D91FC06E5AED0C1FA2D90FE06E5AED180FA2D907F06E5AED3007A2D903
+F86E5AED6003A2902601FCE06D5AEDC00117FCD900FFECFD80ED800017FF027F92C8FC92
+C77EA26E147E023E143EA2021E143C021C141CA2412C7EAA46>I<B539F007FFFCA30003
+D9C00113C0C6496C1300017F14FC013F5C6E13E06D7E010F495A6D6C485A02F890C7FC90
+3803FC060101130E6E5A903800FF186E5AEC3FF05D141F140F6E7E81140FEC0DFCEC19FE
+EC38FF4A7E9138603F8002C07F0101131F49486C7E02007F01066D7E010E1303496D7E01
+3C80017C80D801FC1580D80FFE4913C0B5D8800F13FFA3302B7FAA33>I<B539F001FFFC
+A3000790C7EA7FE06C48EC1F8000011600160E0000150C6D141C6D1418A26E1338013F14
+30A26D6C5BA26E13E0010F5CA26D6C485AA2ECF803010391C7FCA2903801FC06A2ECFE0E
+0100130CA2EC7F18A215B8EC3FB0A2EC1FE0A36E5AA26E5AA36EC8FCA21406A35CA25CA2
+123C007E5BB4FC5CA25CEAFE01387C0380D87007C9FCEA3C1EEA0FFCEA03F02E3F7EAA33
+>I<003FB612E0A29038C0003F90C713C0003CEC7F800038ECFF00A20030495A0070495A
+A24A5A0060495AA24A5A4A5AA2C7485A4AC7FC5B5C495A13075C495A131F4A1360495A49
+5AA249C712C0485AA2485A485A1501485A48481303A24848EB07804848131F00FF14FF90
+B6FCA2232B7DAA2B>I<B9FCA23002809B31>I E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fg cmbx12 17.28 31
+/Fg 31 121 df<16F04B7E1507151F153FEC01FF1407147F010FB5FCB7FCA41487EBF007
+C7FCB3B3B3B3007FB91280A6395E74DD51>49 D<913801FFF8021FEBFFC091B612F80103
+15FF010F16C0013F8290267FFC0114F89027FFE0003F7F4890C7000F7F48486E7FD807F8
+6E148048486E14C048486E14E048486F13F001FC17F8486C816D17FC6E80B56C16FE8380
+A219FFA283A36C5BA26C5B6C90C8FCD807FC5DEA01F0CA14FEA34D13FCA219F85F19F04D
+13E0A294B512C019804C14004C5B604C5B4C5B604C13804C90C7FC4C5A4C5A4B13F05F4B
+13804B90C8FC4B5AED1FF84B5A4B5A4B48143F4A5B4A48C8FC4A5A4A48157E4A5A4A5AEC
+7F8092C9FC02FE16FE495A495A4948ED01FCD90FC0150749B8FC5B5B90B9FC5A4818F85A
+5A5A5A5ABAFCA219F0A4405E78DD51>I<92B5FC020F14F8023F14FF49B712C04916F001
+0FD9C01F13FC90271FFC00077FD93FE001017F49486D8049C86C7F484883486C6F7F14C0
+486D826E806E82487FA4805CA36C5E4A5E6C5B6C5B6C495E011FC85A90C95CA294B55A61
+4C91C7FC604C5B4C5B4C5B4C5B047F138092260FFFFEC8FC020FB512F817E094C9FC17F8
+17FF91C7003F13E0040713F8040113FE707F717F7113E085717FA2717F85A285831A80A3
+1AC0EA03FCEA0FFF487F487F487FA2B57EA31A80A34D14005C7E4A5E5F6C495E49C8485B
+D81FF85F000F5ED807FE92B55A6C6C6C4914806C01F0010791C7FC6C9026FF803F5B6D90
+B65A011F16F0010716C001014BC8FCD9001F14F0020149C9FC426079DD51>I<F01F804E
+7E187F18FFA25F5F5F5FA25F5F5FA294B5FC5E5E5EA25E5EEE3FBFEE7F3FA216FEED01FC
+ED03F8ED07F0A2ED0FE0ED1FC0ED3F8016005D15FE4A5A4A5AA24A5A4A5A4A5A4A5AA24A
+C7FC14FE495A5C1303495A495A495A5C133F49C8FC13FE485AA2485A485A485A5B121F48
+5A48C9FC12FEBCFCA6CA6CEBC000B1037FB8FCA6485E7CDD51>I<01C0EE01C0D801F816
+0F01FF167F02F0EC07FFDAFF8090B5FC92B7128019006060606060606095C7FC17FC5F17
+E0178004FCC8FC16E09026FC3FFCC9FC91CBFCADED3FFE0203B512F0020F14FE023F6E7E
+91B712E001FDD9E00F7F9027FFFE00037F02F801007F02E06EB4FC02806E138091C8FC49
+6F13C04917E07113F0EA00F090C914F8A219FC83A219FEA419FFA3EA03F0EA0FFC487E48
+7E487FA2B57EA319FEA35C4D13FC6C90C8FC5B4917F8EA3FF001804B13F06D17E0001F5E
+6C6C17C06D4B1380D807FC92B512006C6C4A5B6C6C6C01075B6C01E0011F5BD97FFE90B5
+5A6DB712C0010F93C7FC6D15FC010115F0D9003F1480020301F0C8FC406078DD51>I<EE
+1FFF0303B512E0031F14F892B612FE0203814AD9FC037F021F9039C0007FC04A90C7EA1F
+E0DAFFFC6E7E494914074949EC7FF8494914FF49495B4949497F4990C7FC495D5C13FF48
+5BA25A4A6E5B5A715B48496E5B725A4894C8FCA35AA35C48913801FFE0030F13FE033F6D
+7E4B14E092B612F89126E1FE037FB53AE3F0007FFEDAE7E06D7EDAEFC06D7F4B6D7F02FF
+C76C7F4A82717F4A82A24A828385A24A1780A54A17C0A37EA77EA47E6E1780A27EA21A00
+7E4D5B7E6E5E7E6E5E6C4C5B6D7E013F4B5B6D6C4A5B6D01C0495B6D6D90B5C7FC6DD9FC
+0713FC6D90B65A6D5E023F15C0020F92C8FC020114F8DA001F1380426079DD51>I<4DB5
+ED03C0057F02F014070407B600FE140F047FDBFFC0131F4BB800F0133F030F05FC137F03
+3F9127F8007FFE13FF92B6C73807FF814A02F0020113C3020702C09138007FE74A91C900
+1FB5FC023F01FC16074A01F08291B54882490280824991CB7E4949844949844949844986
+5D49498490B5FC484A84A2484A84A24891CD127FA25A4A1A3F5AA348491A1FA44899C7FC
+A25CA3B5FCB07EA380A27EA2F50FC0A26C7FA37E6E1A1F6C1D80A26C801D3F6C6E1A00A2
+6C6E616D1BFE6D7F6F4E5A7F6D6D4E5A6D6D4E5A6D6D4E5A6D6E171F6D02E04D5A6E6DEF
+FF806E01FC4C90C7FC020F01FFEE07FE6E02C0ED1FF8020102F8ED7FF06E02FF913803FF
+E0033F02F8013F1380030F91B648C8FC030117F86F6C16E004071680DC007F02F8C9FC05
+0191CAFC626677E375>67 D<BD12FCA488A2D8000102C0C71201F1000F1A01F2007F1B3F
+1B0F1B07757EA28787A288A3F43F80A31C1FA3197EA3F40FC0A499C7FC19FEA31801A218
+031807181F18FF93B6FCA6EEC000181F180718031801A21800A21D7E197EA21DFCA696C8
+12011DF8A31C03A3F407F0A31C0FA21C1F1C3F1DE01C7F1CFF63631B0F093F13C098B5FC
+1A0797B6FCBEFCA31D80A35F617AE06A>69 D<BD12E0A41CF0A2D8000102C0C71207F100
+3F1A0F1A031A001B7F1B3FF31FF81B0FA21B07A21B03A21B011CFCA31B00A419FCA21C7E
+A41C00A21801A31803A21807180F183FEF01FF93B6FCA6EEC001EF003F180F18071803A2
+1801A31800A896C9FCB3A5B912F8A657617AE065>I<B912E0A6C702E0C7FCB3B3B3B3AE
+B912E0A633627CE13C>73 D<BA12F8F1FFE01AFEF2FFC01BF01BFED800010280C76C7F07
+0714C0070014F0747F081F7F747F747F7480A2748089A37480A389A865A3505CA265A250
+5C9AC9FC505B505B505B087F5B4FB55A0707148096B548CAFC93B812F81BC050CBFC621A
+FF932680000314C0DE007F7F071F13F8737F737F737F73808885888688A2747FA688A688
+A676140FF71F80A374801F3F86771400745E746E5BB96E6E5B746E485A75EBFE07091F90
+B55A090715E009015DCF003F91C7FC0A0013FC71647AE178>82 D<DBFFFCEC01E0020FD9
+FFE01303027F02FC130749B7130F0107EEC01F011F16F049D9C007EBF83F4948C7383FFE
+7FD9FFF8020FB5FC4801E014014849804849153F91C97E484882001F834982003F83845B
+007F187FA2193FA200FF181FA27F190FA27FA26D17078080806C01F893C7FC80ECFF8015
+F86CECFFC016FC6CEDFFE017FE6CEEFFE018F86C17FE6C717E6C846C846D17F86D836D83
+6D8313036D18806D6C17C0020F17E01401DA000F16F01500040715F8EE007F1703050014
+FC183F84060713FE84A2007C8300FC83A2197FA3193F7EA31AFC7EA27F1AF86D177F7F1A
+F06D17FF6D18E06D5E01FF18C06E4B138002E04B130002F84B5A02FFED3FFC01CF01E0EC
+FFF8018301FF010F5B010191B65A6D6C5E48011F93C7FC48010315FC48D9003F14E04802
+0149C8FC476677E35A>I<B96C023FB612FEA6D8000102C0CA0007EBF000E2007FC7FCB3
+B3B3AA656D63A2821C01806570170380525A6E7F6E4F5A70171F6E626E6D4D5A6E6D177F
+525A6E6E030390C8FC033F01E04B5A6F6DED1FFC6F01FCED7FF80303D9FF80903803FFE0
+6F02F8017F5B6F6C90B7C9FC041F5E040716F8040016C0050F4ACAFCDD003F13C06F647A
+E17C>85 D<913803FFFE027FEBFFF00103B612FE010F6F7E4916E090273FFE001F7FD97F
+E001077FD9FFF801017F486D6D7F717E486D6E7F85717FA2717FA36C496E7FA26C5B6D5A
+EB1FC090C9FCA74BB6FC157F0207B7FC147F49B61207010F14C0013FEBFE004913F048B5
+12C04891C7FC485B4813F85A5C485B5A5CA2B55AA45FA25F806C5E806C047D7F6EEB01F9
+6C6DD903F1EBFF806C01FED90FE114FF6C9027FFC07FC01580000191B5487E6C6C4B7E01
+1F02FC130F010302F001011400D9001F90CBFC49437CC14E>97 D<92380FFFF04AB67E02
+0F15F0023F15FC91B77E01039039FE001FFF4901F8010113804901E0010713C049018049
+13E0017F90C7FC49484A13F0A2485B485B5A5C5A7113E0485B7113C048701380943800FE
+0095C7FC485BA4B5FCAE7EA280A27EA2806C18FCA26C6D150119F87E6C6D15036EED07F0
+6C18E06C6D150F6D6DEC1FC06D01E0EC7F806D6DECFF00010701FCEB03FE6D9039FFC03F
+FC010091B512F0023F5D020F1580020102FCC7FCDA000F13C03E437BC148>99
+D<F17FF8050FB5FCA6EF000F8484B3A892380FFF804AB512F8020F14FE023FECFF8391B7
+12E301039138807FF3499039F8000FFB011F01E00103B5FC494913004990C87E49488148
+498148834A815A485BA2485BA25AA3485BA4B5FCAE7EA46C7FA37EA26C7FA26C5F806C5F
+6C6D5D6C6D5D017F93B5FC6D6C6C0103806D6D49806D01F0D91FF7EBFFFE6D9039FE01FF
+E7010190B612876D6CECFE07021F14F8020314E09127003FFE00ECC0004F657BE35A>I<
+92380FFFC04AB512FC020FECFF80023F15E091B712F80103D9FE037F499039F0007FFF01
+1F01C0011F7F49496D7F4990C76C7F49486E7F48498048844A804884485B727E5A5C4871
+7EA35A5C721380A2B5FCA391B9FCA41A0002C0CBFCA67EA380A27EA27E6E160FF11F806C
+183F6C7FF17F006C7F6C6D16FE6C17016D6C4B5A6D6D4A5A6D01E04A5A6D6DEC3FE00103
+01FC49B45A6D9026FFC01F90C7FC6D6C90B55A021F15F8020715E0020092C8FC030713F0
+41437CC14A>I<EE3FFC0307B51280033F14C04AB612F0020715F84A9038F03FFC4AEB80
+7F913A7FFE00FFFE4A5A4B4813FF4913F05B4913E0A24913C0A27013FE4949EB7FFCEF3F
+F8EF1FF0EF07C094C7FCB0B812C0A6D8001F01C0C8FCB3B3B0007FB612FCA638657CE431
+>I<F107F8DB7FFEEC3FFE020FB5D8F001B5FC027FDAFE03148049B7128F49DCDFFD13C0
+010FD9F00FEBFFC149D9800114014990C7EBFC0349486E6C7E4948EC3FFF48496E018113
+800780130048F0C03E97C7FC48496E7FA34884A96C60A36C6D4A5BA26C60A26C6D4A90C8
+FC6D6C4A5A6D6C4A5A6D6D485BDBF00F5B4990B612C060D97C7F4AC9FCD9FC0F14F09126
+007FFECAFC92CCFC1201A47FA27F8014F091B77E18FE6CEFFFC019F06D17FC19FF6D846D
+846D846D84013F8490BAFC0003854801E0C712014890C9000F7F484816014848EE007F48
+48717E8512FF5B85A56D5F007F616D173F003F616D177F6C6C4D5A6C01C003035B6C6D4B
+5B6C01F8031F5BC601FF92B5C7FC6D01F8011F5B011F90B712F8010717E0010094C8FC02
+0F15F0DA003F01FCC9FC4A607CC151>I<903807FF80B6FCA6C6FC7F7FB3A8EF1FFF94B5
+12F0040714FC041F14FF4C8193267FE07F7F922781FE001F7FDB83F86D7FDB87F07FDB8F
+C0814C7F039FC78015BE03BC8003FC825DA25DA25DA45DB3B2B7D8F007B71280A651647B
+E35A>I<EB0FE0EB3FF8497E48B5FCA24880A24880A76C5CA26C91C7FCA238007FFC6D5A
+EB0FE090C9FCAF903807FF80007FB5FCA6C6FC7F7FB3B3AEB712C0A622657BE42C>I<90
+3807FF80B6FCA6C6FC7F7FB3B3B3B3ADB712E0A623647BE32C>108
+D<902607FF80D91FFFEEFFF8B691B500F00207EBFF80040702FC023F14E0041F02FF91B6
+12F84C6F488193267FE07F6D4801037F922781FE001F9027E00FF0007FC6DA83F86D9026
+F01FC06D7F6DD987F06D4A487F6DD98FC0DBF87EC7804C6D027C80039FC76E488203BEEE
+FDF003BC6E4A8003FC04FF834B5FA24B5FA24B94C8FCA44B5EB3B2B7D8F007B7D8803FB6
+12FCA67E417BC087>I<902607FF80EB1FFFB691B512F0040714FC041F14FF4C8193267F
+E07F7F922781FE001F7FC6DA83F86D7F6DD987F07F6DD98FC0814C7F039FC78015BE03BC
+8003FC825DA25DA25DA45DB3B2B7D8F007B71280A651417BC05A>I<923807FFE092B6FC
+020715E0021F15F8027F15FE494848C66C6C7E010701F0010F13E04901C001037F49496D
+7F4990C87F49486F7E49486F7E48496F13804819C04A814819E048496F13F0A24819F8A3
+48496F13FCA34819FEA4B518FFAD6C19FEA46C6D4B13FCA36C19F8A26C6D4B13F0A26C19
+E06C6D4B13C0A26C6D4B13806C6D4B13006D6C4B5A6D6D495B6D6D495B010701F0010F13
+E06D01FE017F5B010090B7C7FC023F15FC020715E0020092C8FC030713E048437CC151>
+I<DB0FFFEC01F04AB500E01303020F02F81307023F14FE91B7130F01030280EB801F4990
+3AFC001FC03F011F01F0EB0FE04949903803F07F490180903801F8FF90B56E7E4891C8B5
+FC48498184485B484981A248835C5A845C5AA4B55AAE7E80A37EA2807EA26C6D5D606C7F
+606C6D5D7E6C6D92B5FC6D6D5B6D6D13076D6DEB0FEF6D01F8EB3FCF6D9039FE01FF8F01
+0190B6120F6D6C14FC021F14F0020314C09139003FFE0092C8FCB3A3053FB612FCA64E5D
+7BC055>113 D<D90FFFEB0FFCB690383FFF8093B512E04B14F04B14F8923907FC7FFC92
+390FE0FFFEC6EC1F806DD93F0113FF6D133E157E157C15F8A215F07013FEA24BEB7FFCEF
+3FF8EF0FE04B90C7FCA55DB3B0B712F8A638417BC042>I<913A3FFF8007800107B5EAF8
+1F011FECFE7F017F91B5FC48B8FC48EBE0014890C7121FD80FFC1407D81FF0801600485A
+007F167F49153FA212FF171FA27F7F7F6D92C7FC13FF14E014FF6C14F8EDFFC06C15FC16
+FF6C16C06C16F06C826C826C826C82013F1680010F16C01303D9007F15E0020315F0EC00
+1F1500041F13F81607007C150100FC81177F6C163FA2171F7EA26D16F0A27F173F6D16E0
+6D157F6D16C001FEEDFF806D0203130002C0EB0FFE02FCEB7FFC01DFB65A010F5DD8FE03
+15C026F8007F49C7FC48010F13E035437BC140>I<EC07E0A6140FA5141FA3143FA2147F
+A214FF5BA25B5B5B5B137F48B5FC000F91B512FEB8FCA5D8001F01E0C8FCB3AFEF0FC0AC
+171F6D6D1480A2173F6D16006F5B6D6D137E6D6D5B6DEBFF836EEBFFF86E5C020F14C002
+035C9126003FFCC7FC325C7DDA3F>I<902607FFC0ED3FFEB60207B5FCA6C6EE00076D82
+6D82B3B3A260A360A2607F60183E6D6D147E4E7F6D6D4948806D6DD907F0ECFF806D01FF
+EB3FE06D91B55A6E1500021F5C020314F8DA003F018002F0C7FC51427BC05A>I<007FB6
+00C0017FB512F8A6D8001F01F8C70007EBF0006D040190C7FC6D6D5D6D6D4A5A6D6D4A5A
+70495A6D4C5A6E7F6E6D495A6E6D495A7049C8FC6E4A5A6E6D485A6E6D485A6E13FFEF8F
+F06EEC9FE06FEBFFC06F5C6F91C9FC5F6F5B816F7F6F7F8481707F8493B57E4B805D4B80
+DB0FF37FDB1FE17F04C080153F4B486C7F4B486C7F4A486D7F4A486D7F4A5A4B6D7F020F
+6E7F4A486D7F4A486D804A5A4AC86C7F49486F7F4A6F7F0107707FEB3FFFB600F049B7FC
+A650407EBF55>120 D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fh cmr12 14.4 49
+/Fh 49 121 df<15E01401EC03C0EC0780EC0F00141E5C147C5C495A13035C495A130F5C
+131F91C7FC133E137EA25BA2485AA25B1203A2485AA3120F5BA2121FA25BA2123FA290C8
+FCA35AA5127EA312FEB3A3127EA3127FA57EA37FA2121FA27FA2120FA27F1207A36C7EA2
+12017FA26C7EA2137EA2133E7F80130F8013076D7E8013016D7E147C143C8080EC0780EC
+03C0EC01E014001B7974D92E>40 D<12E07E12787E7E7E6C7E7F6C7E6C7E7F1200137C13
+7E133E133F7F6D7E80A26D7EA26D7EA2130180A26D7EA380147EA2147FA280A21580A214
+1FA315C0A5140FA315E0B3A315C0A3141FA51580A3143FA21500A25CA2147EA214FE5CA3
+495AA25C1303A2495AA2495AA25C49C7FC5B133E137E137C5B12015B485A485A5B48C8FC
+121E5A5A5A5A1B797AD92E>I<120FEA3FC0EA7FE012FF13F0A213F8A3127F123FEA0F38
+1200A513781370A313F013E0A2120113C0120313801207EA0F00121EA25A5A12300D2376
+8B21>44 D<B612FEA71F077F9C27>I<120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F
+000C0C768B21>I<EC1FF891B5FC010314C090390FF81FF090391FC003F849486C7E017E
+C7127E49800001168049141F4848EC0FC0000716E0491407000F16F0A34848EC03F8A200
+3F16FCA44848EC01FEA700FF16FFB3A5007F16FEA56D1403A2003F16FCA4001F16F8A26D
+1407000F16F0A26C6CEC0FE0A26C6CEC1FC0A26C6CEC3F806C6CEC7F00017F14FE6D6C48
+5A6D6C485A90390FF81FF00103B512C0010091C7FCEC1FF830517BCE3B>48
+D<14075C5C147F5C1307133F000FB5FCB6FC13F913C1EAF0011200B3B3B3A7497F010F13
+E0B712FEA4274F75CE3B>I<EC7FE0903803FFFE010F6D7E013F14E0D9FF0013F8D801F8
+EB1FFCD803E06D7E4848EB03FF48486D138090C813C0001E16E0001C157F003CED3FF012
+380078ED1FF81270A2B4ED0FFC13C07FA66C5A6C5A000EC8FCC9EA1FF8A317F0163FA2EE
+7FE017C016FF17804B1300A24B5A4B5A5E4B5A4B5A4B5A5E4BC7FC15FE4A5A4A5A4A5A4A
+5A5D4A5A4AC8FC147E5C4948141CEB03E0495A4948143891C8FC131E5B5B491578485A48
+481570484815F048B7FCA25A5A5AB812E0A42E4F7ACE3B>I<EC3FF849B57E010F14E090
+391FC01FF890397E0003FC01F86DB4FCD801E06D13804848EC7FC0484815E048C8123F01
+C015F013F0486CEC1FF87FA56C5AA2EA03E0C9EA3FF0A317E0167F17C016FF17804B1300
+5E4B5A4B5A4B5AED3FC0DA07FFC7FC903803FFFC5DEDFF8090C7EA1FE0ED07F8ED01FE6F
+7EEE7F8017C0EE3FE0EE1FF017F8A2EE0FFC17FEA2160717FFA3120FEA3FC0487E487EA4
+17FE160F5B6C4815FC90C8FC0078ED1FF87E003EED3FF06CED7FE06C7E6C6CECFFC0D803
+F0491380D801FC903807FE003A00FFC01FFC013FB512F0010F14C0010391C7FC9038003F
+F830517BCE3B>I<000316C001C0140301F8141F903AFFC003FF8091B612005E5E5E16E0
+16804BC7FC019F13F8018113800180C9FCB0EC0FF0ECFFFE01836D7E903987F01FE09039
+9F0007F801BE6D7E01F86D7E496D7E49EC7F805BEE3FC04915E0C9121F17F0A317F8160F
+A317FCA5120EEA3F80487E12FF7FA217F85B161F5B48C813F012700078ED3FE0A26C16C0
+167F6CEDFF80001F16006C6C495A6C6C13036C6CEB07F8D801F8EB1FF06CB4EB7FE06DB5
+1280011F49C7FC010713F8010013C02E517ACE3B>53 D<ED3FE0913803FFFC020F13FF91
+393FE01F8091397F0007C0D901FCEB01E04948EB00F0495A494813034948EB0FF8494813
+1F49C7FC13FEA2485A120349EC0FF00007ED03C093C7FC485AA2121F5BA2123FA3127F5B
+EC0FFF023F13C091B512F03AFFC1F003FC9039C3C000FED9C780137F91C7EA3F8001CE15
+C001DCEC1FE0160F01F815F0EE07F85B17FCA24915FE1603A34915FFA4127FA66C7EA317
+FE121FA216076C6C15FCA2000716F86D140F000316F06DEC1FE012016C6CEC3FC06DEC7F
+806D6CEBFF006D6C485A90390FF80FFC6DB512F0010114C06D6C90C7FCEC0FF830517BCE
+3B>I<121EA2121F13F090B812C0A4481780A218005FA2003CC9123C00385E0078167017
+F000704B5A5F16034C5A94C7FC485D161E5EC9123816785E5E15014B5A5E15074BC8FCA2
+151E153E153C157C157815F8A24A5AA21403A25D1407A2140FA25D141FA3143FA3147F5D
+A414FFA65BAC6D90C9FC143C32537AD03B>I<EC1FF891B5FC010314E090390FF00FF890
+391F8001FC017EC77E49EC3F80D801F0141F0003ED0FC04915E048481407EE03F0120F49
+15F81601121FA37FA36D14036D15F07F6C6CEC07E07F6D6CEB0FC06C6D131F02F0EB3F80
+6C6D14006C01FE137E6E485A6CECC3F06DEBE7E0011FEBFF806D49C7FC01037F6D806D6C
+13E091B57E010314FCD90FC77FD93F817FD97E0014C049133F48486D13E04848010713F0
+48486D13F848481300001FED7FFC49141F48C8EA0FFE1607007E1503EE01FF8212FE4816
+7FA2173FA56C163E127E177E007F167C6C16FC6D15F86C6C14016C6CEC03F06DEC07E06C
+6CEC0FC06C6CEC3F80C6B4ECFF0090397FE007FC011FB55A010714E0010191C7FC903800
+1FF830517BCE3B>I<EC1FF891B5FC010314C090390FF00FE090391FC003F890397F8001
+FC01FEC77E0001157F4848EC3F805B0007ED1FC0484815E0001F150F4915F0123F160700
+7F16F85BA217FC12FFA2160317FEA617FFA35E127FA37F003F5DA2121F6D5C000F151B00
+07153B7F6C6C1473000115E36C6C1301017FEB03C3903A3FC00F83FE010FB51203010313
+FC010013F091C7FC160717FCA317F8A2160F17F0A2161FD803C015E0EA0FF0486CEC3FC0
+1780167F170016FE150149495AD80FC0495A90C7485A6C6C495A01E0495A2703FC01FFC7
+FC6CB55A6C6C13F8011F13E0010390C8FC30517BCE3B>I<120FEA3FC0EA7FE0EAFFF0A6
+EA7FE0EA3FC0EA0F00C7FCB3A9120FEA3FC0EA7FE0EAFFF0A6EA7FE0EA3FC0EA0F000C33
+76B221>I<EE7FF80307B57E033F14F09239FF8007FCDA03F8C7127FDA0FC0EC0FC0023F
+C8EA03F0027CED00F84A167CD903E0161F4948707E4948707E49CA6C7E013E717E013C17
+0049187849DA1FE0804848DAFFFC80030713FF484890270FF01F807F484890273FC007C0
+EB078092397F0001F048C700FE6D6CEB03C04A481478000E01036F1301001E49486E14E0
+001C4A91380FF800003C010F7013F00038494802071470A20078494802031478A200701A
+384A5AA200F01A3C481A1C4AC8FCAB6E7E7E1270A26E7E12781B3800386D6C1407A2003C
+6D6C140F001C1307001E6E021F1470000E6D6C143F000F0101157B6E6CDAF9FE13E06C6C
+017FD901F1130192273FC007C0EB03C06C6C903C0FF01F807F07806C6C6DB539003FFF00
+030001FCEB0FFE6C6CDA1FE0EB03F8017891CBFC7F133E7F6D7E6D7E6D6CEF01FCD900F8
+1707027CEF3FF0023F933801FF80DA0FC092381FFE00DA03F8913801FFF0912600FF8090
+B5C7FC033FB612F8030792C8FCDB007F13804E557AD35B>64 D<EE03804C7EA34C7EA34C
+7EA34C7EA34C7EA24C7E16E7A203017F16C3A20303801681A2DB07017F82A2030E80177F
+A24B80173FA24B6D7EA20378800370130FA203F0804B1307A20201814B7FA24A488183A2
+4AC78083A2020E82187FA24A6F7E021FB7FC4A82A30278C8EA1FFC0270150FA202F0824A
+1507A249488284A249488384A249CA7FA24984010E177FA2011E84193F133E017F844848
+6C4C7E000F01E04B487EB500FE037FEBFFFEA44F557CD458>I<B812FEEFFFC018F818FE
+26007FF8C73807FF806D4802017F011F6F6C7E727E727E727E727EA2727EA2721380A21A
+C0A384A360A21A80A2601A00A24E5A180F614E5A4E5AF0FFE04D1380050790C7FCEF7FFC
+91B712E08418FE02F0C73801FF809438007FE0F01FF8727EF003FE857213807213C0F17F
+E0A2F13FF0A21AF8191FA21AFCA81AF8193FA21AF0197FF1FFE0A24E13C04E1380604E13
+00F03FFC013FEEFFF8496C02075BBA12C096C7FC18FC18C046527AD153>I<BA12FCA426
+007FFCC712016D489138001FFE011F160318011800197E193EA2191EA285A385A6F10380
+A2171CA296C7FCA5173CA3177C17FC1601160F91B6FCA49138F8000F16011600177C173C
+A3171CA794C9FCB3497E49B4FCB712E0A441527BD14C>70 D<DC1FFC14060303B56C130E
+031F02F0131E037F14FC912801FFF801FE133E0207903980001F80DA1FFCC73807C07EDA
+3FF0913803E0FEDAFFE0EC00F049018015794990C9123D4948161F4948160F4948160749
+5A494816034A160113FF484916004890CBFC1A7E485AA24848183EA2121F49181EA2123F
+5B1A0E127FA397C7FC5B12FFAE127F6D4BB612FEA4003F93C7003F13806D94380FFE0019
+07121FA27F120FA26C7EA26C7EA26C7F6C7F137F806D7E6D6C160F6D7E6D7E6D6C161F6D
+01C0153D6D6D157DDA3FF815F8DA1FFE913803F07E912607FFC090380FE03E020101FC90
+387F801E6E6CB538FE000E031F02F81306030302E090C7FC9226001FFEC9FC4F567AD35C
+>I<B70107B612F8A4C66C48C80003EBF0006D486F5B6D486F5BB3AD91B9FCA402F8C9FC
+B3B1496C4B7F496C4B7FB70107B612F8A44D527BD158>I<49B612FEA490C7003F138092
+380FFE001507B3B3B3A21206EA3FC0487E487EA44B5AA25B007F5D0180131F0078C75B6C
+143F003E4A5A6C5D6C6C495A2707E003FEC7FC3901FC07FC6CB512F0013F13C0D907FCC8
+FC2F547BD13C>74 D<B500FC95B512FCA36E5FD8007FF2F800D93DFF943803BFF0011D62
+A2011C6DEE073FA36E6C160EA36E6C161CA26E6C1638A36E6C1670A36E6C16E0A36E6CED
+01C0A26E6CED0380A36E6DEC0700A36F6C140EA36F6C5CA26F6C5CA36F6C5CA36F6C5CA2
+6F6C495AA36F6C495AA36F6D48C7FCA393387FC00EA2706C5AA3706C5AA3706C5AA3706C
+5AA270B45AA3705BA3013E6E90C8FC137F496C4E7E000701F0027E4B7EB66C4BB612FC17
+3CA35E527AD16B>77 D<B500FC030FB512F8A28080D8003FDC007F13006D6DED0FF8735A
+011D6D6F5A011C6D6F5AA26E7E81143F6E7E81140F6E7E82806E7F82806F7E82153F6F7E
+A26F7E6F7EA26F7F83816F7F83167F707E83161F707E838270138018C0827013E0A2EF7F
+F0EF3FF8A2EF1FFC18FE170FEF07FF1981837113C119E183F07FF119F9183FF01FFD19FF
+8484A28484A284A2197F193F133E017F171F496C160F000713F0B66C15071903A219014D
+527BD158>I<EE7FF80307B57E033F14F09239FFC00FFC913A03FE0001FFDA0FF8903800
+7FC0DA3FE0EC1FF0DA7F80EC07F84AC86C7E49486F7E49486F7E4948707E4948707E4948
+707E4948707E017F844948707E91CA120348854848717EA24848711380A2000F1AC04918
+7F001F1AE0A34848F03FF0A3007F1AF8A249181FA300FF1AFCAE6C6CF03FF8A5003F1AF0
+6D187FA2001F1AE0A26D18FF000F1AC0A26C6C4D1380A200031A006D5F6C616C6D4C5A6E
+160F017F606D6C4C5A6D6C4C5AA26D6C4C5A6D6C4C5A6D6C4B90C7FCD900FFED03FCDA7F
+C0EC0FF86E6C4A5ADA0FF8EC7FC0DA03FE4948C8FC913A00FFC00FFC033FB512F0030714
+809226007FF8C9FC4E567AD35B>I<B812C017FEEFFFC018F026007FFCC713FC6D48EC0F
+FF011F03017F9438007FE0727E727E727E180785727EA28684A286A762A26097C7FCA24E
+5A614E5A4E5A4E5AF0FFC04D90C8FCEF0FFEEFFFF891B712C04DC9FC839126F8000113C0
+9338003FF0EF0FFC717EEF01FF85717F727EA2727EA2727EA985A81B0785180FA21B0F06
+07140E496C82496C6F141EB76EEB801C72EBC03C96387FE0F896381FFFF0CC000713E096
+38007F8050547BD156>82 D<DA3FF0130349B55B010714C0011FECF00F903A7FE00FF81F
+49C712FED801FCEC3F3F4848EC1FBF48486EB4FC48481403485A4980003F8190C97E5A83
+127E8312FEA283A37E837FA27F007F93C7FC7F7FEA3FFC7F6C6C7E14F86CEBFF806C14F8
+EDFF806C15F06C15FE6C6C806D15C0010F81010315F8D9007F80140F020080030F7F0300
+1480161F040713C0160182EF7FE0A2173FEF1FF0A200E0160FA31707A37EA318E07E170F
+7E18C06C161F6C17806D153F6D16006D157E6D15FED8FCFC4A5A017F4A5A26F83FC0EB0F
+F0D90FFEEB7FC0D8F003B65A48C64AC7FC023F13F848010113C034567AD341>I<003FBB
+12C0A449C79038F0000701F06E48130001C0183F48C8EE0FE0007E1907007C1903A20078
+1901A400701900A500F01AF0481A70A6C91700B3B3AC4C7E030313FC027FB712E0A44C51
+7CD055>I<B600F8010FB66C010FB512E0A4000149C8001F01E0C8EBFE0026007FF80307
+0180ED3FF04A94C9EA0FE0013F7060785A6E83011F7095C7FCA26E83010F70170EA2866D
+6C4B5FA36D6C922603BFF05DA36F9126071FF815786D1C70A26F020F6D15F06DDC0E0F5E
+A26F021E6D1401027FDB1C075EA26F023C7F023FDB38034B5AA2876E6C4A6C4BC8FCA36E
+6C4A6C6D130EA36F49486D6C131E02071A1CA26F01036F133C6E4B013F1438A2DC80076F
+13786E92C7001F1470A27048816E020E020F5CA2876F6C480207495AA36F6C486E6C485A
+A370486E1387031F96C9FCA2DCFCF016CF030F496E13CEA204FF17FE6F496F5AA36F496F
+5AA36F90C96C5AA36F48705AA34C1607047C5FA30438705A73547ED178>87
+D<ECFFC0010F13F8013F13FE9039FF00FF80D801F0EB3FE0D803C0EB0FF0486C6D7E01F8
+6D7E000F816D13016F7EA3707E6C5AEA01E0C9FCA6ED3FFF020FB5FC9138FFFC7F010713
+00EB1FF0EB7FC04848C7FCEA03FC485A485A485A123F5B485A187012FF90C8FCA216FFA3
+5D6D14BF007F14036DEB073F6C6C90390F1FC0E06C6C131E6C6C90393C0FE1C02707FE01
+F013FF0001B5486C13806C6C90398003FE00D907FCC712F834367BB43B>97
+D<EB7F80B5FCA41203C6FC137FB3A6ED07FC92387FFF800281B512E0913987F00FF89139
+8F8001FC029EC7B4FC02BC6E7E02F86E7E4A6E7E4A6E7E4A1407844A6E7EA2841701A284
+A283A21980AB19005FA360A24D5AA24D5A804D5A6E5D6E4A5AD97E784A5A6E4AC7FCD97C
+1EEB01FE6E495A903A7807E01FF00201B512C0902670007F90C8FC90C7EA0FF839547DD2
+41>I<EC0FFE91387FFFE049B512F8903907F801FE90391FE0001FD93F80EB078049C7EA
+0FC001FE143F484815E00003157F485A485AA2485AEE3FC0003FED0F004991C7FCA2127F
+A35B12FFAB127F7FA3123F6D1570121F6D15F0000F16E06D140112076C6CEC03C06D1580
+6C6C14076C6DEB0F00D93FC0131E6D6C137C903907FC03F06DB55AD9007F1380DA0FF8C7
+FC2C367CB434>I<17FF4BB5FCA4ED0007160182B3A6EC0FF8EC7FFF49B512E0903907FC
+03F090391FE0007C49487F49C7120F01FE80484880485A000781484880A2485AA2485AA2
+127FA35B12FFAB127FA27FA2123FA27F121FA26C6C5C00075D7F6C6C5C6C6C5C6C6C021E
+7F6D6C017C13E0D91FC049EBFF8090390FF807E00103B512800100495ADA1FF091C7FC39
+547CD241>I<EC0FF891B5FC010314C090390FF80FF090391FC003FC90397F8001FE49C7
+7E4848EC7F804848143F49EC1FC0485A000FED0FE05B001F16F01607485AA2007F16F8A2
+5B160312FF90B7FCA30180C9FCA8127F7FA2123FA26D1538121F17786C6C1570000716F0
+6D15E06C6C14016C6CEC03C06C6C15806D6C130F6D6CEB1F00D90FF0133C903907FE01F8
+0101B512E06D6C1380DA07FCC7FC2D367DB434>I<157F913803FFE0020F13F091383FC0
+F891387F01FC903901FE03FE903803FC0714F81307EB0FF0A290391FE003FCED01F892C7
+FC495AB3B612FEA426003FC0C7FCB3B3A580EBFFF0007FEBFFF8A427547DD324>I<EF1F
+C0DA3FE0EBFFE0902701FFFC0313F001079039FF07E1F8903A1FE03FCF01903A3F800FFC
+03903A7F0007F80101FE010314F04848903901FC004000036F1300491300000781A24980
+000F82A8000793C7FC6D5CA200035D6D130100015D6C6C495A017F495A6E485A9039FFE0
+3FC0D801C7B5C8FC01C113FC3903803FE091CAFCA57FA27F7F7F6CB612E016FF6C16C017
+F0013F15FC8390B8FCD803F8C7001F1380D80FE0020113C04848EC007F4848ED1FE090C9
+120F127EEF07F012FE481603A56C1607007E17E0007F160F6C6CED1FC06C6CED3F806C6C
+ED7F006C6C15FED803FCEC03FCC6B4EC0FF0D93FF0EBFFC0010FB6C7FC010114F8D9001F
+1380354E7DB43B>I<EB7F80B5FCA41203C6FC137FB3A6ED07FC92383FFF8092B512E091
+3981F00FF8913983C007FC9139870003FE028E1301029C6D7E14B814B002F06E7E5CA25C
+A35CB3AD2601FFE0903801FFE0B600C0B612C0A43A537CD241>I<1378EA01FE487E487F
+A66C90C7FC6C5AEA007890C8FCB0EB7F80B5FCA41203C6FC137FB3B3A43801FFE0B61280
+A419507CCF21>I<EC0780EC1FE0EC3FF0EC7FF8A6EC3FF0EC1FE0EC078091C7FCB0EC0F
+F8EB1FFFA4EB003F140FA21407B3B3B2120C003F14F0387F800FEAFFC015E0141F15C0EC
+3F80EA7F809038007F006C13FC6CB45A000713E0C690C7FC1D6885CF24>I<EB7F80B5FC
+A41203C6FC137FB3B3B3B13801FFE0B612C0A41A537CD221>108
+D<01FFD907FEEC03FFB590261FFFC0010F13E0037F01F0013F13F8912701F80FFC9038FC
+07FE913D03C003FE01E001FF000390260700019038038000C6010E6D6C48C76C7E6D48DA
+7F8E6E7E4A159CA24ADA3FF86E7E02605D14E04A5DA34A5DB3AD2601FFE0DAFFF0EC7FF8
+B6D8C07F9026FFE03FB512F0A45C347CB363>I<01FFEB07FCB590383FFF8092B512E091
+3901F00FF8913903C007FC000349C66C7EC6010E13016D486D7E5C143002706E7E146014
+E05CA35CB3AD2601FFE0903801FFE0B600C0B612C0A43A347CB341>I<EC0FFC91387FFF
+8049B512E0903907F807F890391FE001FE90393F80007F017EC7EA1F80496E7E48486E7E
+00038248486E7EA248486E7EA248486E7EA2003F82A24848ED7F80A400FF17C0AB007F17
+80A26D15FFA2003F1700A2001F5E6D1401000F5E6D140300075E6C6C4A5A6C6C4A5AA2D8
+007FEC3F806D6C49C7FC90391FE001FE903907F807F86DB55AD9007F1380DA0FFCC8FC32
+367CB43B>I<90397F8007FCB590387FFF800281B512E0913987F00FF891398F8003FC00
+0190399E0001FF6C01BC6D7FD97FF86E7E4A6E7E4A6E7E4A140F844A6E7EA2717EA3717E
+A4711380AB4D1300A44D5AA24D5AA2606E140F4D5A6E5D6E4A5A6E4A5A02BC4AC7FC029E
+495A028FEB07FC913987E01FF00281B512C0DA807F90C8FCED0FF892CAFCB13801FFE0B6
+12C0A4394B7DB341>I<01FFEB1F80B5EB7FF0913801FFF8913803E1FC91380783FE0003
+EB0F07C6131EEB7F1C1438143091387003FC91386000F0160014E05CA45CB3AA8048487E
+B612F0A427347DB32E>114 D<D907FE13C090387FFF8148B512E33907F803FF390FC000
+7F4848133F48C7121F003E140F007E1407127C00FC1403A315017EA27E7F6C6C90C7FC13
+F013FF6C13F86CEBFF806C14E06C14F86C14FEC680013F1480010714C0D9003F13E01403
+9138007FF0151F00E0140FED07F8A26C1403A215017EA36C15F0A26C14036C15E015076D
+EB0FC06DEB1F80D8FDF0EB3F0039F8FC01FE39F07FFFF8D8E01F13E0D8C00390C7FC2536
+7CB42E>I<EB01C0A71303A41307A3130FA2131FA2133F137F13FF5A5A001F90B512E0B7
+FCA326003FC0C7FCB3A71638AC6E1378011F1470A26D6C13F016E0903807F801903903FC
+03C0903901FE07806DB51200EC3FFCEC07F0254B7EC92E>I<D97F80EC7F80B591B5FCA4
+00031503C61500017F157FB3AC17FFA35EA3013F5C6EEB077FA2011F020E7F6D6C011C13
+F06E0178EBFFC0903903FC01F06DB512E06D6C1380912607FC00EB80003A357CB341>I<
+007FB5D8800FB51280A4C69026FC0003EBF000D93FF86D1380011F4BC7FC010F15F80107
+5D6D6C5C6E495A6D6C5C6D14076E6C48C8FCEDC01E6E6C5A021F133891380FF0786F5A91
+3807FDE002035BEC01FF5E80157F6F7E824B7E15FFEDE7F802017F913803C3FEEC07814A
+C67E020E80021E6D7E4A133F4A6D7E4A80707E4948130749486D7E010781010F6E7E013F
+8201FF8200076D010713F0B500F8011FEBFFE0A43B337FB23E>120
+D E
+%EndDVIPSBitmapFont
+%DVIPSBitmapFont: Fi cmr17 20.74 26
+/Fi 26 120 df<EA0780EA1FE0EA3FF0EA7FF8EAFFFCA6EA7FF8EA3FF0EA1FE0EA07800E
+0E728D2B>46 D<ED0FFC92B512C0020314F091390FF807FC91393FC000FF4AC7EA3F80D9
+01FEEC1FE0D903F8EC07F049486E7E49486E7E49486E7E013F824A8149C96C7EA201FE70
+7E000184A24848707EA34848707EA2000F84A34848707EA4003F84A54848701380A900FF
+19C0B3AC007F1980A56D5EA3003F1900A5001F60A26D1607A2000F60A36C6C4C5AA30003
+606D161F000160A26C6C4C5AA26D6C4B5A013F94C7FC6E5D6D6C4A5A6D6C4A5A6D6C4A5A
+6D6C4A5A6D6C4A5A6D6C4A5ADA3FC001FFC8FC91390FF807FC0203B512F0020014C0DB0F
+FCC9FC42757AF14F>48 D<ED7FF00207B57E023F14F091B612FC4915FF902707FE007F13
+C0D90FE0010F7FD91F80010113F849C87F017CED3FFE496F7E48486F138048486F13C048
+48817113E0484817F090CAFC48EF7FF8121E003EEF3FFC123CA2007CEF1FFE1278A2EA7F
+C0D8FFF0EE0FFF7F7F7FA76C5A6C5A6C5AD807C0EE1FFECBFCA3F03FFCA3F07FF8A219F0
+18FF19E05F19C04D1380A24D130060170F4D5A604D5A4D5A604D5A4C90C7FC4C5A4C5A5F
+4C5A4C5A4C5A4C5A94C8FC16FE4B5A4B5A4B5A4B5A4B5A4B5A4BC9FC157E5D4A5A4A5A4A
+5A4A5A4A4815074AC9FC143E4A160E5C495A495A495A495A49CA121E011E171C5B5B4917
+3C485A4848177C4848EE01FC48B912F8A25A5A5ABAFCA219F0A3407279F14F>50
+D<ED1FFE4AB512E0020F14FC023F14FF9126FFE00713C0D903FEC713F0D907F0EC3FF8D9
+1FC06E7E49C8EA07FE017E6F7E017883496F7F48486F7F120349834848167F01F88313FE
+6D6C153F486D82A4805CA37E6C5B6C48C95BD80078167F90CAFCA261A218FF61A24D5B61
+5F96C7FC4D5A60170F4D5AEF3FE04D5A4D5A4C48C8FCEE07FCEE1FF092381FFFC091260F
+FFFEC9FCA2EEFFE091C7EA07FCEE00FFEF3FC0EF1FF0717EEF07FE717E717F717F85727E
+727EA285727EA2727EA31A80A2841AC0A3EA07E0EA1FF8487E487EB5FCA51A80605BA26C
+48180013F001C05E007CCA5B7E4E5A7E6D4C5A6C6C5F000717FF01F04B5B6C6C4B5B6C6C
+5F6CB4030F90C7FC6D6C4A5AD93FF04A5AD90FFCECFFF8902707FFE00713E0010190B612
+806D6C92C8FC020F14F8020314E09126001FFEC9FC42757AF14F>I<BA12FCF1FFE01AFC
+F2FF801BE0D8003F01E0C8000F13F801074903007F4BEE3FFF6D060F7F747F08017F747F
+757E757E757E8887751380A21DC0871DE087A31DF0A387A363A31DE0A2631DC0A2631D80
+511300A2515A515A515A515A505B505B505B081F90C7FCF23FFCF2FFF0070713C0077F90
+C8FC92B812F8621AFF0380C8000313E09638003FF8F20FFE973803FF807413E0746C7E75
+7E757E757E757E7513801DC07513E0A27513F0F47FF8A21DFC1C3FA21DFE1C1FA21DFFAA
+1DFEA21C3FA21DFC1C7FA2F4FFF8A25113F0631DE05113C051138063511300F3FFFE505B
+08075B49061F13E06F047F5B013F6D0307B5C7FCBC5A1BF01BC050C8FC1AC0607678F571
+>66 D<BD12F8A5D8003F01F0C98001074916074B16006D193F1B1F1B071B031B011B0088
+1C7EA21C3EA21C1EA31C0EA21C0FA388A6F40380A3191CA299C7FCA7193CA4197CA219FC
+18011803180F18FF92B7FCA503C0C7FC180F180318011800197CA2193CA4191CA996CAFC
+B3AB497F81013F13FEB812E0A5597678F568>70 D<DE7FFCED01C0050FB512C094B600F8
+1403040315FE041F6F6C1307047FD9F00013E04B4848C7D80FF0130F030701F0EC03FC4B
+0180DA00FE131FDB3FFEC9123FDB7FF893381F803F4A4848EE07E04A01C0933803F07F4A
+4916014A90CBEAF8FFDA1FFC187C4A48183F4A48844A5A498649498449498492CCFC4948
+85131F4A85495A017F1B7F5C01FF1B3F5C5A4A1A1F5AA248491A0FA25A91CE1207A25A5B
+A2003F1C03A25BA2127F9AC8FCA45B12FFB26C7EA3083FB712F8A3123F7F97C7ECF8000A
+0F13E0001F755B887F7EA2807EA26C7FA26C7FA27E806D7EA26D7E131F806D7E7F816D7F
+6D6D606D7F6E7E6E6C606E6C606E7E6E01C0173E6E6DEF7E7F6E6DEFFC3F9126007FFCEE
+01F86FB4933807F01F030F01C092380FE00F6F01F8ED7F80030101FF913901FF00076F6C
+01F8D93FFC1303041F90B600F01301040304C01300040093CAFC050F14F09426007FFECB
+FC6D7C78F87D>I<B600E04CB612FCA28181A2D8000F6DDC000714000103070013F86FF0
+3FE0DABFFF725A149F028F6D715AA202876D71C7FC82148302817F82148082157F6F7E82
+8183816F7F83816F7F838183167F707E83828482707F84828482707F84177F717E848385
+83717F85838583717F85187F85183F727E8684727F86848684727F86197F86193F737E1B
+80857313C0A27313E01BF0857313F81BFC1A7F1BFE1A3FF21FFF1C87861CC7867413E71C
+F7867413FFA287A28787A287A28787497E87497E87496C85EB7FFC0003B56C84B600FE84
+A288A288667678F577>78 D<B912FCF0FFF019FEF1FFC01AF8D8003F01F0C7000713FE01
+07499139003FFF804B03077F6D050113F0736C7E747EF20FFF747F747F86747F88757EA2
+757EA2757EA288A28789A99AC8FCA263A264A2515A641B7F64515A64505B5090C9FC505A
+505AF23FF8F27FE0963801FF80DF0FFECAFCF17FF895380FFFE092B8CBFC19F019FC03C0
+C7380FFF80060113E09538003FF8F11FFEF107FF737F7313E0737F747E1A3F87747E1A0F
+878688A3747FAB88AC1F101F38747FA47416787614701B7F496D1BF0756C14E0013F01FC
+051F1401B8707E0907EC03C0756CEB0780759038800F009839007FE03ECF381FFFFC0A07
+5B9938007FC06D7978F575>82 D<001FBE12F8A502F8C7000F01F0C7121F4801806E4902
+0113FC01FCC86C49EC003F491B1F01E01B07491B03491B0190C91800A2003E1D7CA2003C
+1D3CA3481D1EA500701D0EA8481D07A6CA1900B3B3B3B14D7F4D7F057F13FE031FB812F8
+A568757BF473>84 D<B700F00503B612C0A5C602FCCC003FEBFC00011F01E0070F13E06D
+497313807748C7FC6D64775A7F6F627F666F19036D64811D07027F6381023F50C8FCA26F
+61021F1A1E811D3E6E1A3C826E62A27018F86E62821C016E62826E4F5AA2701707037F61
+821C0F033F96C9FC82031F181EA270173E6F183C831C7C6F1878836F60A27115016F6083
+1B036F6083047F4C5AA271150F043F94CAFC8363041F161E83705EA272147C701678841B
+F8705E84704B5AA2721303705E841A07057F5D84053F4ACBFCA2725B051F141E841A3E71
+143C1980715CA2F1C0F8715C19E019E1715C19F171EBF3C0A219FF725BA37290CCFCA272
+5AA3725AA3725AA2725AA3725A72797EF577>86 D<913803FF80021F13F891B512FE903A
+03FC01FF80903A07E0003FE0D91F80EB0FF8013EC76C7E496E7E01F06E7E48486E7F717E
+4848153F4982D807A06F7E13FC487E6D6F7E80A2717EA46C90C8FC6C5A6C5ACAFCA6EE07
+FF0303B5FC157F913903FFFE07021F138091387FF800903801FFC0010790C7FCEB1FFCEB
+3FF0EBFFE0485B485B4890C8FC5B485A485AA2485A1A0E485AA312FF5B170FA4171FA26D
+153F007F163B177B6DDBF1FE131C003F16E16C6C14016C6C912603C0FF13386C6CEC0F80
+6C6C6C903A1F007F80706C6D017CECE1E028007FF803F8EB3FFF011FB500E06D13800103
+91C7000713009026003FF8EC01FC474D79CB4F>97 D<ED07FE92387FFFE00203B512FC91
+390FFC01FF913A3FE0001FC0DA7F80EB03E0D901FEC812F84948157C4948814948814948
+81013FEE0780494815034948ED0BC048177F91C9EAFFE048485D00075EA2485AA2485AA2
+7113C0003F70138049EE7F0095C7FC127FA35BA212FFAE127F7FA4123F7FA2121F6D1738
+120F19786C6C1770A26C6C17F019E06C6D15016C18C06D6C15036D6CED07806EED0F006D
+6C151E6D6C153ED903FE5D6D6C15F06D01C0EB03E0DA3FF0EB0FC0DA0FFE01FFC7FC0203
+B512FCDA007F13E0030790C8FC3D4D7BCB46>99 D<ED1FFC4AB512C0020714F091391FF0
+0FFC91397F8001FFD901FEC7EA7FC049486E7E49486E7E49486E7E49486E7E49486E7E49
+48140101FF824890C91380A24848EE7FC0A2485A000FEF3FE05BA2001F18F0181F485AA3
+007F18F8A349160FA212FF90B9FCA301E0CBFCAB127F7FA3123FA36C7EA219386C7E1978
+000718707F000318F06C6C17E018016C6DED03C06D6C1680013F16076D6CED0F006D6C15
+1E6D6C5D6D6C5D6DB44A5A6D6C6C495ADA3FE0EB1F80DA0FFE01FEC7FC0203B512F8DA00
+7F13E0DB07FEC8FC3D4D7BCB46>101 D<F103F8F13FFEDB1FF891B5FC92B5903903FC07
+8002079139E007E01F913D1FF00FF81F803FC0913B3FC003FC3E0002FFC7B45A49486E5A
+49486E5A49486E48EB1F8049486E6CEB060097C7FC49486E7E013F82A249486E7EA201FF
+82A24A80A24884AA6C95C8FCA26E5CA2017F5EA26D6C4A5AA2011F5E6D6C4A5AA26D6C4A
+5A6D6C4A5A496C4A5A6E4AC9FC903A0F3FC003FC903A1E1FF00FF80207B512E0D91C0091
+CAFC013CEB1FF892CCFCA25BA3137CA4137EA27F8080EB1FF091B612FE6DEDFFF818FF6D
+17E06D17F8010017FE010383010F84D93FE0C7000114E001FFC9120FD801FC04017F4848
+9338003FF84848171F4848717E48481707003F727E49170148CBFC737EA200FE85A76C61
+6C616D1701003F616D17036C6C4D5A6C6C4D5A6C6C4D5A6C6C4D5A6C6C4D5A26007F80DB
+01FEC7FCD93FE0ED07FCD90FF8ED1FF0D903FFEDFFC0010001F8011F90C8FC021FB612F8
+02011580DA000F01F0C9FC4A707DCC4F>103 D<131EEB7F80497E487F487FA66C5B6C5B
+6D5A011EC7FC90C8FCB3A7EB01F0EA07FFB5FCA51201EA007F133FA2131FB3B3B3A3497E
+EBFFFEB612FCA51E727AF12A>105 D<EB01F0EA07FFB5FCA51201EA007F133FA2131FB3
+B10507B512FEA5050114C07149C7FC19F019C0614EC8FC60EF01F04D5A604D5A4DC9FC17
+3E5F5F4C5A4C5A4C5A4C5A4CCAFC163C5E16FC15014B7E4B7E5D033F7F037C7F5D9139F1
+F07FE09139F3E03FF0ECF7C09139FF801FF8ED000F02FC804A6D7E4A13034A80707F8284
+717E173F84717E170F84717EA2717E717FA2717F727EA2727E85181F858585496C83D9FF
+FC037F13F0B600FC0103B612C0A54A787AF753>107 D<EB01F0EA07FFB5FCA51201EA00
+7F133FA2131FB3B3B3B3B3AC497EEBFFFEB612FEA51F787AF72A>I<D901F0902601FFC0
+ED0FFED807FF021F01FC92B512E0B5027F01FF020314F8922601FC0101C090390FE00FFE
+922803E0003FE090391F0001FFDB0F80D91FF8017C6D13C04BC7000F4A147FC6023C9127
+07FC01E06E7E013F496E6C48486E7E011F0170DA01FF496E7E03F0160790260FF1E04CC8
+FCDAF3C06E019E6F7E4B169C02F717BC92C913B802FFDC7FF86F7E4A5FA34A5FA44A5FB3
+B3A8496C4C6C4B7ED97FFF030301F8031F13C0B7D88007B600FC013FB612E0A57B4B7ACA
+86>I<D901F0903803FF80D807FF021F13F8B5027F13FE923A01FC03FF80923A03E0007F
+E0DB0F80EB1FF0031EC76C7EC65C013F496E7E011F496E7E5DEB0FF1DAF3C06E7E5D14F7
+92C9FC02FF835CA35CA45CB3B3A8496C4B7FD97FFF030713F0B7D8800FB612F8A54D4B7A
+CA58>I<ED07FE92387FFFE00203B512FC91390FFC03FF913A3FC0003FC04AC7EA0FE0D9
+01FEEC07F8D903F8EC01FC49486E7E4948157F49486F7E49486F7E017F8349C96C7E4916
+070001844848707EA2000784491601000F84A24848701380A2003F19C0A349177F007F19
+E0A412FF1AF0AD007F19E0A26D17FFA2003F19C0A46C6C4C1380A2000F1900A26C6C4C5A
+A26C6C4C5A0001606D160F6C606D6C4B5A6D6C4B5AA26D6C4B5AD907F003FEC7FCD903FC
+EC03FC6D6C4A5A6D6C6CEB1FF0DA3FE0EB7FC091270FFC03FFC8FC0203B512FCDA007F13
+E0DB07FEC9FC444D7BCB4F>I<D903E0EB1FE0D80FFFECFFFCB501037F923907E01F8092
+391F807FC092383E00FF4B4813E000011478D8007F13F090383FE1E015C0EB1FE39126E7
+800013C0EF7F8092C7EA3F0002EF91C7FC14EE14FE5CA45CA55CB3B3A480133F90B5FCB7
+12C0A5334B7ACA3D>114 D<DA1FFFEB038049B512E0010FECF807903A3FE001FE0F01FE
+C7EA1F9FD801F8EC07DFD807E0EC03FF484880498048C9127F48163F003E161F127E170F
+127C12FC1707A46C1603A27E7F6C7E7F6D92C7FCEA3FFC13FF6C13E06C13FF6C14F06CEC
+FF806C15F86C15FE013F6E7E010F15E0010381010081020F14FEDA007F7F1503DB003F13
+80040713C0040113E000E081177FEF3FF06C161F170FEF07F8A217037E1701A27EA37E18
+F07E17036D16E0A26D15076DED0FC06D168000FE161F017CED3F00486C157E6DEC01F826
+F80FC0EB07F026F003F8EB7FC00100B6C7FC48013F13FC02071380354D7CCB3E>I<1407
+A85CA65CA35CA35CA25CA25BA25B5B5B5B5B5B48B712FE120FB8FCA3D8000190C9FCB3B3
+A2EF01C0B0EF03806D7FA3027FEC0700815F6E6C130E021F141E6F131C6E6C5B6E6C13F8
+913901FF01F09139007FFFC0031F5BDB03FCC7FC326B7EE93D>I<02F8EE0F80D803FFEE
+3FFFB5030FB5FCA5C6EE000F013F1603011F82A2010F82B3B3A660A460A3601307606E15
+0E0103161E606E4B7F010116706D6C03F07F6FD903E013F86E6C4948EBFFF8DA1FE0EB1F
+00DA0FFE13FE0203B512F8DA007F13E0030790C7EBC0004D4C7ACA58>I<B600F0017FB5
+00F849B512FCA5000149C849C8003F13E026007FF8DB3FF8030F13004A031F705A013F4D
+ED03F8180F011F755A735E6D6C1507667315036D6C63A24E7E6D6C50C7FC85606D6C031C
+160E866FEC387F6D63866FEC703F027F62866FDAE01F1578023F1A70866F902601C00F15
+F0021F62866F90260380071401020F62866F90260700031403020762866F010E01011407
+020397C8FC866F496D5C6E190E053C1580DC8038027F131E6E191C057815C0DCC070023F
+133C037F183805F015E07048021F1378033F187004E116F092261FF1C0020F5BA204F316
+F892260FFB80913807F9C0A204FF16FD6F90C86CB45AA36F486F90C9FCA36F486F5AA36F
+48167CA24C163C047016386E4B7EC973>119 D E
+%EndDVIPSBitmapFont
+end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 600dpi
+TeXDict begin
+%%BeginPaperSize: a4
+a4
+%%EndPaperSize
+
+%%EndSetup
+%%Page: 1 1
+1 0 bop 1440 951 a Fi(Release)53 b(Notice)950 1158 y(BlueGn)l(u)f(T)-13
+b(esting)52 b(F)-13 b(ramew)l(ork)1501 1366 y(V)g(ersion)53
+b(2.0.3)1297 1661 y Fh(Jan-Willem)36 b(Neurden)m(burg)1593
+1811 y(jotOmega)f(dsc)1379 1960 y(56)j(Brigham)d(Hill)j(Road)1303
+2110 y(Grafton)f(MA)78 b(01519-1135)1356 2259 y(neurden)m(burg)s
+(j@acm.org)1444 2409 y(T)-10 b(el:)50 b(\(508\))37 b(839-0276)1430
+2558 y(F)-10 b(ax:)51 b(\(508\))37 b(839-7267)1442 2792
+y(Septem)m(b)s(er)g(19,)g(1999)324 3228 y Fg(1)161 b(In)l(tro)t
+(duction)324 3448 y Ff(BlueGn)m(u)35 b(is)g(a)h(framew)m(ork)f(for)g
+(testing)g(other)h(programs.)52 b(It)35 b(has)h(b)s(een)h(created)f(to)
+324 3568 y(b)s(e)30 b(compatible)e(with)i(DejaGn)m(u.)42
+b(Its)31 b(purp)s(ose)f(is)g(to)g(pro)m(vide)g(a)g(single)f(fron)m(t)g
+(end)i(for)324 3688 y(all)f(tests.)45 b(Bey)m(ond)34
+b(this,)e(BlueGn)m(u)h(o\013ers)g(sev)m(eral)g(adv)-5
+b(an)m(tages)33 b(for)f(testing:)469 3913 y Fe(\017)49
+b Ff(The)25 b(\015exibilit)m(y)e(and)i(consistency)h(of)e(the)h(BlueGn)
+m(u)f(framew)m(ork)h(mak)m(es)g(it)f(easy)568 4033 y(to)k(write)g
+(tests)h(for)f(an)m(y)h(program,)f(with)g(the)h(exception)g(of)e(GUI)i
+(applications.)469 4236 y Fe(\017)49 b Ff(BlueGn)m(u)33
+b(pro)m(vides)h(a)f(la)m(y)m(er)h(of)e(abstraction,)h(whic)m(h)h(mak)m
+(es)g(all)d(tests)k(\(if)d(cor-)568 4356 y(rectly)39
+b(written\))f(p)s(ortable)g(to)h(an)m(y)g(host)g(or)g(target)f(where)i
+(a)f(program)e(m)m(ust)568 4477 y(b)s(e)32 b(tested.)469
+4679 y Fe(\017)49 b Ff(BlueGn)m(u)37 b(is)g(written)h(in)f([incr)g
+(Tcl],)i(whic)m(h)f(in)f(turn)g(is)h(based)g(on)g(Tcl)f(\(T)-8
+b(o)s(ol)568 4800 y(Command)31 b(Language\).)43 b(The)34
+b(framew)m(ork)e(comprises)h(t)m(w)m(o)g(parts:)658 5002
+y(1.)48 b(the)33 b(testing)g(framew)m(ork,)1918 5251
+y(1)p eop
+%%Page: 2 2
+2 1 bop 658 548 a Ff(2.)48 b(the)33 b(test-suites)h(or)e(test-sets)i
+(themselv)m(es.)469 751 y Fe(\017)49 b Ff(BlueGn)m(u)31
+b(will)e(w)m(ork)j(with)f(an)m(y)h(Tcl)f(based)i(in)m(terpreter)e(as)h
+(long)e(as)i([incr)f(Tcl])568 872 y(has)f(b)s(een)h(included.)42
+b(Y)-8 b(ou)30 b(can)h(include)e('exp)s(ect',)j('Tk',)g(and/or)e(other)
+g(exten-)568 992 y(sions.)469 1196 y Fe(\017)49 b Ff(Includes)33
+b(DejaGn)m(u)f(release)h(1.6)324 1528 y Fg(2)161 b(Requiremen)l(ts)324
+1747 y Ff(The)47 b(follo)m(wing)d(mo)s(dules)i(should)g(ha)m(v)m(e)i(b)
+s(een)g(installed,)g(b)s(efore)f(y)m(ou)g(can)g(install)324
+1868 y(and/or)32 b(use)h(BlueGn)m(u:)469 2096 y Fe(\017)49
+b Ff(Tcl)32 b(release)h(8.0)f(or)g(higher,)469 2299 y
+Fe(\017)49 b Ff(incr)32 b(Tcl)g(release)h(3.0)f(or)g(higher.)470
+2528 y(An)m(y)g(other)f(extensions)i(that)d(is)h(compatible)e(with)h
+(Tcl)h(release)g(8.0)g(can)g(b)s(e)g(used)324 2648 y(as)i(w)m(ell.)324
+2981 y Fg(3)161 b(Structure)51 b(and)j(Con)l(ten)l(ts)c(of)k(the)f
+(Release)324 3200 y Ff(The)24 b(ro)s(ot)f(directory)g(of)g(the)h
+(release)g(con)m(tains)g(the)g(README)g(\014les)f(with)g(installation)
+324 3320 y(instructions)40 b(and)h(the)g(\014les)g(needed)h(to)e(build)
+g(and)g(install)f(this)h(pro)s(duct.)68 b(It)41 b(also)324
+3441 y(con)m(tains)32 b(the)h(executable)h(scripts)f(of)f(the)h(BlueGn)
+m(u)g(testing)f(framew)m(ork.)470 3561 y(The)i(top-lev)m(el)d
+(directories)h(are)h(listed)f(b)s(elo)m(w:)324 3789 y
+Fd(lib:)47 b Ff(the)28 b(pac)m(k)-5 b(ages)29 b(and)e(pro)s(cedures)i
+(that)f(mak)m(e)f(the)h(BlueGn)m(u)g(and)f(DejaGn)m(u)g(test-)568
+3910 y(ing)k(framew)m(ork.)44 b(This)33 b(also)e(includes)i(the)g
+(default)f(target)g(de\014nition)f(\014les.)324 4113
+y Fd(testsets:)48 b Ff(the)31 b(BlueGn)m(u)e(test-suites)i(and)f(test)g
+(examples.)43 b(It)30 b(con)m(tains)g(the)g(follo)m(w-)568
+4234 y(ing)h(sub)s(directories.)568 4462 y Fd(BlueGn)m(u:)48
+b Ff(test)34 b(scripts)f(to)f(test)h(the)g(testing)f(framew)m(ork)h
+(itself.)568 4624 y Fd(examples:)48 b Ff(test)34 b(suite)e(and)h(test)g
+(script)g(examples.)568 4786 y Fd(con\014g,)38 b(lib,)e(to)s(ols:)48
+b Ff(curren)m(tly)41 b(empt)m(y)-8 b(,)42 b(but)f(can)f(b)s(e)g(used)i
+(for)d(test-set)j(de-)782 4906 y(p)s(enden)m(t)34 b(con\014guration)e
+(\014les,)h(library)e(\014les,)h(and)h(to)s(ols.)1918
+5251 y(2)p eop
+%%Page: 3 3
+3 2 bop 324 548 a Fd(con\014g:)49 b Ff(curren)m(tly)33
+b(empt)m(y)-8 b(.)324 751 y Fd(do)s(c:)49 b Ff(the)28
+b(DejaGn)m(u)f(texinfo)g(source)i(and)e(the)h(do)s(cumen)m(tation)f(in)
+g('info',)g('dvi',)i('ps',)568 872 y(and)42 b('p)s(df)7
+b(')43 b(represen)m(tation,)j(resp)s(ectiv)m(ely)e(dejagn)m(u.info*,)g
+(dejagn)m(u.dvi,)i(de-)568 992 y(jagn)m(u.ps,)33 b(and)g(dejagn)m(u.p)s
+(df.)44 b(A)32 b(DejaGn)m(u)h(man)e(page)i(is)f(also)g(a)m(v)-5
+b(ailable.)568 1154 y(It)37 b(also)g(con)m(tains)g(the)h(T)1493
+1175 y(E)1547 1154 y(X)g(v)m(ersion)g(\(README.tex\))h(of)e(this)g(do)s
+(cumen)m(t)g(as)568 1274 y(w)m(ell)c(as)h(the)g('dvi',)h('ps')g('h)m
+(tml',)e(and)h('p)s(df)7 b(')34 b(represen)m(tation,)h(resp)s(ectiv)m
+(ely)g(no-)568 1395 y(tice.dvi,)d(notice.ps,)h(notice.h)m(tml,)e(and)i
+(notice.p)s(df.)324 1598 y Fd(testsuite:)48 b Ff(con)m(tains)32
+b(a)g(mixture)g(of)g(DejaGn)m(u)h(and)f(BlueGn)m(u)h(test)g(scripts.)
+324 1802 y Fd(con)m(trib:)47 b Ff(con)m(tains)33 b(examples)g(ho)m(w)g
+(DejaGn)m(u)f(is)g(used)i(at)e(Cygn)m(us.)324 2005 y
+Fd(example:)48 b Ff(con)m(tains)39 b(a)f(full)f(DejaGn)m(u)h(test)h
+(framew)m(ork)f(example)g(for)g(testing)g(the)568 2125
+y(program)31 b('calc')h(whic)m(h)h(is)f(also)g(included.)324
+2458 y Fg(4)161 b(Installation)55 b(and)f(use)f(under)f(Unix)324
+2677 y Ff(Before)37 b(y)m(ou)h(can)f(install)d(and)k(use)f(BlueGn)m(u)g
+(y)m(ou)h(need)g(to)f(ha)m(v)m(e)h(installed)d(the)i(fol-)324
+2798 y(lo)m(wing)31 b(three)i(pac)m(k)-5 b(ages:)469
+3001 y Fe(\017)49 b Ff(Tcl)32 b(v)m(ersion)h(8.0.3)469
+3204 y Fe(\017)49 b Ff(Tk)33 b(v)m(ersion)g(8.0.3)469
+3408 y Fe(\017)49 b Ff(incr)32 b(Tcl)g(v)m(ersion)h(3.0.1)324
+3611 y(The)42 b(source)g(for)e(these)i(pac)m(k)-5 b(ages)42
+b(should)f(all)e(b)s(e)i(lo)s(cated)f(in)g(one)h(directory)-8
+b(.)69 b(The)324 3732 y(sub)s(directory)33 b(in)f(the)h(directory)f
+(should)h(b)s(e:)469 3935 y Fe(\017)49 b Ff(tcl8.0.3)469
+4138 y Fe(\017)g Ff(tk8.0.3)469 4342 y Fe(\017)g Ff(itcl3.0.1)470
+4545 y(The)27 b(follo)m(wing)d(examples)i(use)h(the)f(command)f
+(`./con\014gure)i({pre\014x=/to)s(ols/...`.)324 4666
+y(This)33 b(will)e(install)g(all)g(pac)m(k)-5 b(ages)34
+b(in)e(a)h(directory)g(\\/to)s(ols".)43 b(When)35 b(y)m(ou)e(omit)f
+(the)h(\\{)324 4786 y(pre\014x"-switc)m(h)26 b(then)g(the)g
+(installation)c(default)j(will)e(b)s(e)j(the)g(directory)f(\\/usr/lo)s
+(cal".)1918 5251 y(3)p eop
+%%Page: 4 4
+4 3 bop 324 548 a Fc(4.1)135 b(Installation)47 b(of)e(needed)h(P)l(ac)l
+(k)-7 b(ages)324 733 y Ff(When)33 b(y)m(ou)g(ha)m(v)m(e)h(not)e
+(installed)f(Tcl)h(and)h(the)f(other)h(needed)h(extensions,)g(then)f(y)
+m(ou)324 853 y(need)26 b(to)f(retriev)m(e)h(the)f(sources)i(from)d
+(\\www.tcltk.com/itcl".)40 b(Y)-8 b(ou)25 b(need)h(to)f(`gunzip`)324
+973 y(the)31 b(\014les)g(and)g(do)g(a)g(`tar)g(xf`)g(of)g(all)e(these)j
+(pac)m(k)-5 b(ages)32 b(in)e(one)h(directory)-8 b(,)32
+b(let's)f(call)e(this)324 1094 y(directory)j(\\TclTk".)470
+1214 y(F)-8 b(rom)38 b(the)i(directory)f(\\TclTk",)i(y)m(ou)f(should)g
+(do)f(the)h(follo)m(wing)c(to)j(install)e(the)324 1335
+y(pac)m(k)-5 b(ages:)324 1563 y Fb(\045)51 b(cd)h(tcl8.0.3/unix)324
+1683 y(\045)f(./configure)k(--prefix=/tools/tcl8.0.3)i(--enable-gcc)e
+(--enable-shared)324 1804 y(\045)c(make)324 1924 y(\045)g(mkdir)i
+(/tools/tcl8.0.3)324 2044 y(\045)e(make)i(install)324
+2165 y(\045)e(cd)h(../../tk8.0.3/unix)324 2285 y(\045)f(./configure)k
+(--prefix=/tools/tk8.0.3)i(--enable-gcc)d(--enable-shared)324
+2406 y(\045)d(make)324 2526 y(\045)g(mkdir)i(/tools/tk8.0.3)324
+2646 y(\045)e(make)i(install)324 2767 y(\045)e(cd)h(../../itcl3.0.1)324
+2887 y(\045)f(./configure)k(--prefix=/tools/itcl3.0.1)i(--enable-gcc)e
+(--enable-shared)324 3007 y(\045)c(make)324 3128 y(\045)g(mkdir)i
+(/tools/itcl3.0.1)324 3248 y(\045)e(make)i(install)324
+3537 y Fc(4.2)135 b(Installing)47 b(BlueGn)l(u)324 3722
+y Ff(Y)-8 b(ou)41 b(can)g(no)m(w)h(`gunzip`)f(and)g(`tar)g(xf`)g(the)h
+(BlueGn)m(u)f(v)m(ersion)h(2.0.3)e(in)h(the)g(direc-)324
+3842 y(tory)f(\\Tc)m(kTk".)68 b(This)40 b(will)e(create)j(the)f
+(directory)g(\\bluegn)m(u2.0.3".)66 b(No)m(w)40 b(do)g(the)324
+3963 y(follo)m(wing:)324 4191 y Fb(\045)51 b(cd)h(bluegnu2.0.3)324
+4311 y(\045)f(./configure)k(--prefix=/tools/bluegnu2.0.)q(3)324
+4432 y(\045)c(make)324 4552 y(\045)g(mkdir)i(/tools/bluegnu2.0.3)324
+4672 y(\045)e(make)i(install)470 4901 y Ff(This)33 b(will)d(install)g
+(BlueGn)m(u)j(in)f(the)h(directories:)1918 5251 y(4)p
+eop
+%%Page: 5 5
+5 4 bop 469 548 a Fe(\017)49 b Ff(/to)s(ols/bluegn)m(u2.0.3/bin)469
+751 y Fe(\017)g Ff(/to)s(ols/bluegn)m(u2.0.3/lib/bluegn)m(u)469
+955 y Fe(\017)g Ff(/to)s(ols/bluegn)m(u2.0.3/info)469
+1158 y Fe(\017)g Ff(/to)s(ols/bluegn)m(u2.0.3/man)324
+1447 y Fc(4.3)135 b(Using)46 b(BlueGn)l(u)324 1632 y
+Ff(When)39 b(y)m(ou)g(ha)m(v)m(e)h(installed)c([incr)i(Tcl])h(and)f
+(BlueGn)m(u)h(and)f(y)m(ou)h(ha)m(v)m(e)h(the)f(resp)s(ec-)324
+1752 y(tiv)m(e)23 b(\\bin")f(directories)h(in)f(y)m(our)i(P)-8
+b(A)g(TH)24 b(v)-5 b(ariable,)23 b(then)h(y)m(ou)g(can)f(start)g
+(running)g(some)324 1872 y(tests.)41 b(Y)-8 b(ou)21 b(can)h(go)g(in)m
+(to)f(the)h(BlueGn)m(u)f(source)i(directory)f(\\bluegn)m
+(u2.0.3/testsets/examples")324 1993 y(and)32 b(run)h(the)g(follo)m
+(wing:)324 2221 y Fb(\045)51 b(bluegnu)i(versionTcl.itcl)324
+2342 y(\045)e(bluegnu)i(ts_001)324 2462 y(\045)e(bluegnu)i(ts_002)324
+2582 y(\045)e(bluegnu)i(ts_003)470 2811 y Ff(The)37 b(ab)s(o)m(v)m(e)f
+(test)g(result)g(should)f(all)f(b)s(e)i(P)-8 b(ASS.)36
+b(The)h(follo)m(wing)c(test)j(will)d(giv)m(e)j(a)324
+2931 y(result)c(UNKNO)m(WN,)i(b)s(ecause)g(no)e(pass/fail)f
+(instruction)h(ha)m(v)m(e)i(b)s(een)f(giv)m(en.)324 3159
+y Fb(\045)51 b(bluegnu)i(tc001)470 3388 y Ff(The)34 b(last)d(test)j(y)m
+(ou)f(can)g(run)g(will)d(fail)g(in)i(its)g(simple)f(form:)324
+3616 y Fb(\045)51 b(bluegnu)i(tc002)470 3844 y Ff(But)33
+b(will)d(pass)k(if)d(y)m(ou)i(execute)i(the)e(test)g(as)g(follo)m(ws:)
+324 4073 y Fb(\045)51 b(bluegnu)i(tc002[English])470
+4301 y Ff(This)46 b(is)g(b)s(ecause)i(the)e(test)h(scripts)g(need)g(a)f
+(test)h(case)g(iden)m(ti\014er)f(to)f(\014nd)i(the)324
+4421 y(correct)33 b(b)s(enc)m(hmark)g(co)s(de.)1918 5251
+y(5)p eop
+%%Page: 6 6
+6 5 bop 324 548 a Fg(5)161 b(Changes)324 796 y Fc(5.1)135
+b(V)-11 b(ersion)45 b(2.0.3)324 981 y Ff(This)37 b(b)s(eing)f(the)i
+(\014rst)f(public)f(release)i(it)d(is)i(not)g(to)g(useful)g(to)f(list)g
+(all)f(the)i(c)m(hanges.)324 1101 y(BlueGn)m(u)46 b(has)g(b)s(een)h(mo)
+s(deled)e(after)h(DejaGn)m(u)g(and)g(is)g(a)g(complete)f(new)i(imple-)
+324 1222 y(men)m(tation)31 b(whic)m(h)i(has)g(b)s(een)g(tested)g
+(thoroughly)-8 b(.)43 b(When)33 b(do)s(cumen)m(tation)e(is)h(b)s(eing)
+324 1342 y(written)e(more)f(c)m(hanges)j(will)c(b)s(e)i(made.)42
+b(An)31 b(example)e(of)h(some)g(of)f(these)j(c)m(hanges)f(as)324
+1462 y(a)k(result)f(of)h(this)g(do)s(cumen)m(tation)f(e\013ort)h(can)g
+(b)s(e)g(found)g(in)f(the)i(test-suites)g(ts)p Fb(_)p
+Ff(001,)324 1583 y(ts)p Fb(_)p Ff(002,)d(and)g(ts)p Fb(_)p
+Ff(003.)45 b(The)34 b(\014rst)f(t)m(w)m(o)h(are)f(not)g(as)g(easy)h(to)
+e(write)h(as)g(the)h(third.)44 b(The)324 1703 y(test)33
+b(suite)g(ts)p Fb(_)p Ff(001)f(is)g(a)g(script)h(implemen)m(tation)c
+(of)k(the)g(command)e(line:)324 1906 y Fb(\045)51 b(cd)h
+(bluegnu2.0.3/testsets)324 2027 y(\045)f(bluegnu)i
+(examples/tc002[English=)q(B])k(\\)324 2147 y(>)51 b
+("examples/tc002[Dutch=B])q(={M)q(SG=H)q(allo)58 b(Wereld}")324
+2351 y Ff(This)35 b(ma)m(y)g(b)s(e)g(useful)g(for)g(simple)e(tests)k
+(but)e(when)h(y)m(ou)g(w)m(an)m(t)g(to)f(write)f(more)h(com-)324
+2471 y(plex)28 b(test-suite)f(scripts)i(y)m(ou)f(w)m(ould)g(lik)m(e)f
+(some)g(more)g(\015exibilit)m(y)-8 b(,)27 b(so)h(t)m(w)m(o)g(pro)s
+(cedures)324 2591 y(w)m(ere)39 b(in)m(tro)s(duced,)f(whic)m(h)g(are)g
+(sho)m(wn)g(in)f(test-suite)h(ts)p Fb(_)p Ff(002.)58
+b(This)37 b(mak)m(es)h(writing)324 2712 y(rather)g(complex)g(so)h(the)g
+(pro)s(cedures)h(ha)m(v)m(e)g(b)s(ecome)f(part)f(of)g(the)h(pro)s
+(cedures)h('ap-)324 2832 y(p)s(endQueue',)32 b('prep)s(endQueue',)h
+(and)d('run)m(test'.)44 b(The)30 b(resulting)f(script)h(is)f(sho)m(wn)i
+(in)324 2953 y(test-suit)h(ts)p Fb(_)p Ff(003.)470 3073
+y(Changes)i(lik)m(e)e(this)g(will)e(b)s(e)j(made)f(in)g(the)h(future!)
+324 3406 y Fg(6)161 b(F)-13 b(uture)52 b(Enhancemen)l(ts)324
+3625 y Ff(The)33 b(follo)m(wing)d(enhancemen)m(ts)35
+b(are)d(b)s(eing)g(planned:)469 3828 y Fe(\017)49 b Ff(T)-8
+b(arget)24 b(co)s(de)h(will)e(b)s(e)i(made)f(in)m(to)g(a)g(class)h
+(with)f(metho)s(ds)h('start',)h('load',)f('exit',)568
+3949 y(and)d('v)m(ersion'.)40 b(Instead)23 b(of)e(the)h(curren)m(t)h(')
+p Fa(<)p Ff(target)p Fa(>)p Fb(_)p Ff(start',)h(')p Fa(<)p
+Ff(target)p Fa(>)p Fb(_)p Ff(load',)568 4069 y(')p Fa(<)p
+Ff(target)p Fa(>)p Fb(_)p Ff(exit',)33 b(and)g(')p Fa(<)p
+Ff(target)p Fa(>)p Fb(_)p Ff(v)m(ersion',)h(whic)m(h)g(ha)m(v)m(e)h(b)s
+(een)f(tak)m(en)g(from)568 4189 y(DejaGn)m(u.)469 4393
+y Fe(\017)49 b Ff(Pro)s(cedures)34 b(will)d(b)s(e)i(created)h(that)f
+(mak)m(e)g(it)f(easy)i(to)f(test)h(WEB)f(application)568
+4513 y(from)e(the)i(framew)m(ork.)469 4716 y Fe(\017)49
+b Ff(Other)34 b(enhancemen)m(ts)i(will)31 b(b)s(e)j(made)g(dep)s
+(ending)g(on)g(the)g(use)h(of)f(the)g(frame-)568 4837
+y(w)m(ork)f(in)f(testing)g(di\013eren)m(t)h(applications.)1918
+5251 y(6)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
diff --git a/contrib/bluegnu2.0.3/example/Makefile.in b/contrib/bluegnu2.0.3/example/Makefile.in
new file mode 100644
index 0000000..3fc31ac
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/Makefile.in
@@ -0,0 +1,98 @@
+VPATH = @srcdir@
+srcdir = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = $(exec_prefix)/bin
+libdir = $(exec_prefix)/lib
+tooldir = $(libdir)/$(target_alias)
+datadir = $(exec_prefix)/lib/dejagnu
+mandir = $(prefix)/man
+
+infodir = $(prefix)/info
+includedir = $(prefix)/include
+docdir = $(datadir)/doc
+targetdir = $(datadir)/$(target_canonical)
+
+SHELL = /bin/sh
+
+# Examples don't get installed
+INSTALL =
+INSTALL_PROGRAM = $(INSTALL)
+INSTALL_DATA = $(INSTALL)
+
+CC = @CC@
+CFLAGS = -g
+SUBDIRS = @subdirs@
+RUNTEST = runtest
+RUNTESTFLAGS =
+
+FLAGS_TO_PASS = \
+ "CC=$(CC)" \
+ "CFLAGS=$(CFLAGS)" \
+ "INSTALL=$(INSTALL)" \
+ "INSTALL_DATA=$(INSTALL_DATA)" \
+ "INSTALL_PROGRAM=$(INSTALL_PROGRAM)" \
+ "LDFLAGS=$(LDFLAGS)" \
+ "MAKEINFO=$(MAKEINFO)" \
+ "RUNTEST=$(RUNTEST)" \
+ "RUNTESTFLAGS=$(RUNTESTFLAGS)" \
+ "exec_prefix=$(exec_prefix)" \
+ "prefix=$(prefix)" \
+ "tooldir=$(tooldir)"
+
+#### host, target, and site specific Makefile frags come in here.
+
+all: force
+ @$(MAKE) subdir_do DO=$@ $(FLAGS_TO_PASS)
+
+.PHONY: info install install-info check installcheck dvi
+info:
+install:
+dvi:
+install-info:
+check:
+installcheck:
+
+.NOEXPORT:
+MAKEOVERRIDES=
+
+check: force
+ rootme=`pwd`; export rootme; $(MAKE) DO=check DODIRS=calc subdir_do
+
+subdir_do: force
+ @for i in $(SUBDIRS); do \
+ echo "Making $(DO) in $${i}..." ; \
+ if [ -d ./$$i ] ; then \
+ if (rootme=`pwd`/ ; export rootme ; \
+ rootsrc=`cd $(srcdir); pwd`/ ; export rootsrc ; \
+ cd ./$$i; \
+ $(MAKE) $(FLAGS_TO_PASS) $(DO)) ; then true ; \
+ else exit 1 ; fi ; \
+ else true ; fi ; \
+ done
+force:
+
+clean mostlyclean:
+ -rm -f \#* *~ core *.o a.out xgdb *.x
+ @$(MAKE) subdir_do DO=$@ $(FLAGS_TO_PASS)
+
+distclean maintainer-clean realclean: clean
+ @$(MAKE) subdir_do DO=$@ $(FLAGS_TO_PASS)
+ -rm -f *~ core
+ -rm -f Makefile *-init.exp site.*
+ -rm -f config.status config.log config.cache
+ -rm -fr *.log summary detail
+
+Makefile: $(srcdir)/Makefile.in $(host_makefile_frag) config.status
+ @echo "Rebuilding the Makefile..."
+ $(SHELL) ./config.status
+
+configure: $(srcdir)/configure.in $(srcdir)/Makefile.in $(srcdir)/../aclocal.m4
+ @echo "Rebuilding configure..."
+ @cd ${srcdir} ;\
+ autoconf --localdir=${srcdir}/..
+
+config.status:
+ @echo "Rebuilding config.status..."
+ $(SHELL) ./config.status --recheck
diff --git a/contrib/bluegnu2.0.3/example/calc/Makefile.in b/contrib/bluegnu2.0.3/example/calc/Makefile.in
new file mode 100644
index 0000000..ecd1283
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/Makefile.in
@@ -0,0 +1,112 @@
+# Copyright (C) 1988, 1990, 1991, 1992, 1994 Free Software Foundation, Inc.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 1, or (at your option)
+# any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+#
+
+# target name
+PROG= calc
+
+# compiler specifics
+CC = @CC@
+CFLAGS = -g -I$(srcdir) -I.
+CALC = calc
+
+# directory specifics
+VPATH = @srcdir@
+srcdir = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+# testsuite specifics
+# Setup the testing framework, if you have one
+# Flags that we pass when building the testsuite.
+EXPECT = ` \
+ if [ -f $${rootme}/../../../expect/expect ] ; then \
+ echo $${rootme}/../../../expect/expect ; \
+ else echo expect ; fi`
+
+RUNTEST = ` \
+ if [ -f $${srcdir}/../../../dejagnu/runtest ] ; then \
+ echo $${srcdir}/../../../dejagnu/runtest ; \
+ else echo runtest ; fi`
+
+RUNTESTFLAGS=
+
+## --- NOTHING BELOW HERE SHOULD REQUIRE MODIFICATIONS --- ##
+
+SRCS= calc.c
+
+OBJS= calc.o
+
+all: ${PROG}
+
+calc.o: calc.c
+
+.c.o:
+ ${CC} ${CFLAGS} -I$(srcdir) -I. -c $<
+
+${PROG}: ${OBJS} ${DPADD}
+ ${CC} ${LDFLAGS} ${CFLAGS} -o $@ ${OBJS} ${DPADD} ${LDADD}
+
+check: site.exp all
+ rootme=`pwd`; export rootme; \
+ srcdir=${srcdir} ; export srcdir ; \
+ EXPECT=${EXPECT} ; export EXPECT ; \
+ if [ -f $${rootme}/../../expect/expect ] ; then \
+ TCL_LIBRARY=$${srcdir}/../../tcl/library ; \
+ export TCL_LIBRARY ; fi ; \
+ ${RUNTEST} ${RUNTESTFLAGS} --tool ${PROG} CALC=${PROG} --srcdir ${srcdir}/testsuite
+
+site.exp: ./config.status Makefile
+ @echo "Making a new config file..."
+ -@rm -f ./tmp?
+ @touch site.exp
+
+ -@mv site.exp site.bak
+ @echo "## these variables are automatically generated by make ##" > ./tmp0
+ @echo "# Do not edit here. If you wish to override these values" >> ./tmp0
+ @echo "# add them to the last section" >> ./tmp0
+ @echo "set tool calc" >> ./tmp0
+ @echo "set srcdir ${srcdir}" >> ./tmp0
+ @echo "set objdir `pwd`" >> ./tmp0
+ @echo "## All variables above are generated by configure. Do Not Edit ##" >> ./tmp0
+ @cat ./tmp0 > site.exp
+ @cat site.bak | sed \
+ -e '1,/^## All variables above are.*##/ d' >> site.exp
+ -@rm -f ./tmp?
+
+install: ${PROG}
+
+clean mostlyclean:
+ -rm -f a.out [Ee]rrs tags mklog core ${OBJS} ${PROG}
+
+distclean maintainer-clean realclean: clean
+ -rm -f Makefile
+ -rm -f config.status config.log config.cache
+ -rm -f calc.h calc.log calc.plog calc.psum
+ -rm -f calc.sum site.exp
+
+Makefile: $(srcdir)/Makefile.in $(host_makefile_frag) config.status
+ @echo "Rebuilding the Makefile..."
+ $(SHELL) ./config.status
+
+configure: $(srcdir)/configure.in $(srcdir)/Makefile.in $(srcdir)/../../aclocal.m4
+ @echo "Rebuilding configure..."
+ @cd ${srcdir} ;\
+ autoconf --localdir=${srcdir}/../..
+
+config.status:
+ @echo "Rebuilding config.status..."
+ $(SHELL) ./config.status --recheck
diff --git a/contrib/bluegnu2.0.3/example/calc/calc.1 b/contrib/bluegnu2.0.3/example/calc/calc.1
new file mode 100644
index 0000000..ea60393
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/calc.1
@@ -0,0 +1,29 @@
+.\"
+.TH SKEL 1 "28th Jan 1993"
+.SH NAME
+calc \- a very dumb calculator to demonstrate
+.I deja-gnu
+.SH SYNOPSIS
+.B calc
+.SH DESCRIPTION
+.LP
+.B calc
+accepts the commands:
+.TP
+.B add #1 #2
+Add #1 and #2 and print the answer.
+.TP
+.B multiply #1 #2
+Multiply #1 and #2 and print the answer.
+.TP
+.B quit
+.br
+Exit
+.TP
+.B version
+Print a version string.
+.SH BUGS
+.LP
+.B multiply 2 n
+gives the wrong answer (unless n == 0).
+
diff --git a/contrib/bluegnu2.0.3/example/calc/calc.c b/contrib/bluegnu2.0.3/example/calc/calc.c
new file mode 100644
index 0000000..784e39b
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/calc.c
@@ -0,0 +1,65 @@
+#ifdef HAVE_STDLIB_H
+#include <stdlib.h>
+#endif
+#include <ctype.h>
+#include <stdio.h>
+#include "calc.h"
+
+static int words();
+
+int main()
+{
+ char line[SIZE];
+ int nword;
+ char *words[NWORD];
+
+ while(printf("calc: "), fflush(stdout), fgets(line,SIZE,stdin) != NULL) {
+ if((nword = split(line,words,NWORD)) == 0) continue;
+ if(strcmp(words[0],"add") == 0) {
+ if(nword != 3) {
+ printf("Usage: add #1 #2\n");
+ } else {
+ printf("%d",atoi(words[1]) + atoi(words[2]));
+ }
+ } else if(strcmp(words[0],"multiply") == 0) {
+ if(nword != 3) {
+ printf("Usage: multiply #1 #2\n");
+ } else {
+ int i1 = atoi(words[1]);
+ if(i1 == 2) i1 = 3; /* this is a bug */
+ printf("%d",i1*atoi(words[2]));
+ }
+ } else if(strcmp(words[0],"quit") == 0) {
+ break;
+ } else if(strcmp(words[0],"version") == 0) {
+ printf("Version: %s",VERSION);
+ } else {
+ printf("Unknown command: %s",words[0]);
+ }
+ printf("\n");
+ }
+
+ return(0);
+}
+
+int
+split(line,words,nword)
+char *line;
+char **words;
+int nword; /* number of elements in words */
+{
+ int i;
+
+ while(isspace(*line)) line++;
+ if(*line == '\0') return(0);
+
+ for(i = 0;i < nword;i++) {
+ words[i] = line;
+ while(*line != '\0' && !isspace(*line)) line++;
+ if(*line == '\0') break;
+ *line++ = '\0';
+ while(isspace(*line)) line++;
+ }
+
+ return(i);
+}
diff --git a/contrib/bluegnu2.0.3/example/calc/calc.h.in b/contrib/bluegnu2.0.3/example/calc/calc.h.in
new file mode 100644
index 0000000..1e420a7
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/calc.h.in
@@ -0,0 +1,18 @@
+/*
+ * Check for headers
+ */
+#ifndef __CALC_H__
+#define __CALC_H__
+
+#undef HAVE_STDLIB_H
+
+/*
+ * Check for functions
+ */
+#undef HAVE_STRCMP
+
+#define NWORD 10
+#define SIZE 100
+#define VERSION "1.0 Beta"
+
+#endif /* __CALC_H__ */
diff --git a/contrib/bluegnu2.0.3/example/calc/configure b/contrib/bluegnu2.0.3/example/calc/configure
new file mode 100755
index 0000000..4d61f01
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/configure
@@ -0,0 +1,812 @@
+#! /bin/sh
+
+# Guess values for system-dependent variables and create Makefiles.
+# Generated automatically using autoconf version 2.4
+# Copyright (C) 1992, 1993, 1994 Free Software Foundation, Inc.
+#
+# This configure script is free software; the Free Software Foundation
+# gives unlimited permission to copy, distribute and modify it.
+
+# Defaults:
+ac_help=
+ac_default_prefix=/usr/local
+# Any additions from configure.in:
+
+# Initialize some variables set by options.
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+build=NONE
+cache_file=./config.cache
+exec_prefix=NONE
+host=NONE
+no_create=
+nonopt=NONE
+no_recursion=
+prefix=NONE
+program_prefix=NONE
+program_suffix=NONE
+program_transform_name=s,x,x,
+silent=
+site=
+srcdir=
+target=NONE
+verbose=
+x_includes=NONE
+x_libraries=NONE
+
+# Initialize some other variables.
+subdirs=
+
+ac_prev=
+for ac_option
+do
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$ac_prev"; then
+ eval "$ac_prev=\$ac_option"
+ ac_prev=
+ continue
+ fi
+
+ case "$ac_option" in
+ -*=*) ac_optarg=`echo "$ac_option" | sed 's/[-_a-zA-Z0-9]*=//'` ;;
+ *) ac_optarg= ;;
+ esac
+
+ # Accept the important Cygnus configure options, so we can diagnose typos.
+
+ case "$ac_option" in
+
+ -build | --build | --buil | --bui | --bu | --b)
+ ac_prev=build ;;
+ -build=* | --build=* | --buil=* | --bui=* | --bu=* | --b=*)
+ build="$ac_optarg" ;;
+
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ cache_file="$ac_optarg" ;;
+
+ -disable-* | --disable-*)
+ ac_feature=`echo $ac_option|sed -e 's/-*disable-//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_feature| sed 's/[-a-zA-Z0-9_]//g'`"; then
+ { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; }
+ fi
+ ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+ eval "enable_${ac_feature}=no" ;;
+
+ -enable-* | --enable-*)
+ ac_feature=`echo $ac_option|sed -e 's/-*enable-//' -e 's/=.*//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_feature| sed 's/[-_a-zA-Z0-9]//g'`"; then
+ { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; }
+ fi
+ ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+ case "$ac_option" in
+ *=*) ;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "enable_${ac_feature}='$ac_optarg'" ;;
+
+ -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+ | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+ | --exec | --exe | --ex)
+ ac_prev=exec_prefix ;;
+ -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+ | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+ | --exec=* | --exe=* | --ex=*)
+ exec_prefix="$ac_optarg" ;;
+
+ -gas | --gas | --ga | --g)
+ # Obsolete; use --with-gas.
+ with_gas=yes ;;
+
+ -help | --help | --hel | --he)
+ # Omit some internal or obsolete options to make the list less imposing.
+ # This message is too long to be a string in the A/UX 3.1 sh.
+ cat << EOF
+Usage: configure [options] [host]
+Options: [defaults in brackets after descriptions]
+Configuration:
+ --cache-file=FILE cache test results in FILE
+ --help print this message
+ --no-create do not create output files
+ --quiet, --silent do not print \`checking...' messages
+ --version print the version of autoconf that created configure
+Directory and file names:
+ --prefix=PREFIX install architecture-independent files in PREFIX
+ [$ac_default_prefix]
+ --exec-prefix=PREFIX install architecture-dependent files in PREFIX
+ [same as prefix]
+ --srcdir=DIR find the sources in DIR [configure dir or ..]
+ --program-prefix=PREFIX prepend PREFIX to installed program names
+ --program-suffix=SUFFIX append SUFFIX to installed program names
+ --program-transform-name=PROGRAM run sed PROGRAM on installed program names
+Host type:
+ --build=BUILD configure for building on BUILD [BUILD=HOST]
+ --host=HOST configure for HOST [guessed]
+ --target=TARGET configure for TARGET [TARGET=HOST]
+Features and packages:
+ --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no)
+ --enable-FEATURE[=ARG] include FEATURE [ARG=yes]
+ --with-PACKAGE[=ARG] use PACKAGE [ARG=yes]
+ --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
+ --x-includes=DIR X include files are in DIR
+ --x-libraries=DIR X library files are in DIR
+--enable and --with options recognized:$ac_help
+EOF
+ exit 0 ;;
+
+ -host | --host | --hos | --ho)
+ ac_prev=host ;;
+ -host=* | --host=* | --hos=* | --ho=*)
+ host="$ac_optarg" ;;
+
+ -nfp | --nfp | --nf)
+ # Obsolete; use --without-fp.
+ with_fp=no ;;
+
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c)
+ no_create=yes ;;
+
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r)
+ no_recursion=yes ;;
+
+ -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+ ac_prev=prefix ;;
+ -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+ prefix="$ac_optarg" ;;
+
+ -program-prefix | --program-prefix | --program-prefi | --program-pref \
+ | --program-pre | --program-pr | --program-p)
+ ac_prev=program_prefix ;;
+ -program-prefix=* | --program-prefix=* | --program-prefi=* \
+ | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+ program_prefix="$ac_optarg" ;;
+
+ -program-suffix | --program-suffix | --program-suffi | --program-suff \
+ | --program-suf | --program-su | --program-s)
+ ac_prev=program_suffix ;;
+ -program-suffix=* | --program-suffix=* | --program-suffi=* \
+ | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+ program_suffix="$ac_optarg" ;;
+
+ -program-transform-name | --program-transform-name \
+ | --program-transform-nam | --program-transform-na \
+ | --program-transform-n | --program-transform- \
+ | --program-transform | --program-transfor \
+ | --program-transfo | --program-transf \
+ | --program-trans | --program-tran \
+ | --progr-tra | --program-tr | --program-t)
+ ac_prev=program_transform_name ;;
+ -program-transform-name=* | --program-transform-name=* \
+ | --program-transform-nam=* | --program-transform-na=* \
+ | --program-transform-n=* | --program-transform-=* \
+ | --program-transform=* | --program-transfor=* \
+ | --program-transfo=* | --program-transf=* \
+ | --program-trans=* | --program-tran=* \
+ | --progr-tra=* | --program-tr=* | --program-t=*)
+ program_transform_name="$ac_optarg" ;;
+
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ silent=yes ;;
+
+ -site | --site | --sit)
+ ac_prev=site ;;
+ -site=* | --site=* | --sit=*)
+ site="$ac_optarg" ;;
+
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ srcdir="$ac_optarg" ;;
+
+ -target | --target | --targe | --targ | --tar | --ta | --t)
+ ac_prev=target ;;
+ -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+ target="$ac_optarg" ;;
+
+ -v | -verbose | --verbose | --verbos | --verbo | --verb)
+ verbose=yes ;;
+
+ -version | --version | --versio | --versi | --vers)
+ echo "configure generated by autoconf version 2.4"
+ exit 0 ;;
+
+ -with-* | --with-*)
+ ac_package=`echo $ac_option|sed -e 's/-*with-//' -e 's/=.*//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_package| sed 's/[-_a-zA-Z0-9]//g'`"; then
+ { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; }
+ fi
+ ac_package=`echo $ac_package| sed 's/-/_/g'`
+ case "$ac_option" in
+ *=*) ;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "with_${ac_package}='$ac_optarg'" ;;
+
+ -without-* | --without-*)
+ ac_package=`echo $ac_option|sed -e 's/-*without-//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_package| sed 's/[-a-zA-Z0-9_]//g'`"; then
+ { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; }
+ fi
+ ac_package=`echo $ac_package| sed 's/-/_/g'`
+ eval "with_${ac_package}=no" ;;
+
+ --x)
+ # Obsolete; use --with-x.
+ with_x=yes ;;
+
+ -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+ | --x-incl | --x-inc | --x-in | --x-i)
+ ac_prev=x_includes ;;
+ -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+ | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+ x_includes="$ac_optarg" ;;
+
+ -x-libraries | --x-libraries | --x-librarie | --x-librari \
+ | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+ ac_prev=x_libraries ;;
+ -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+ | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+ x_libraries="$ac_optarg" ;;
+
+ -*) { echo "configure: error: $ac_option: invalid option; use --help to show usage" 1>&2; exit 1; }
+ ;;
+
+ *)
+ if test -n "`echo $ac_option| sed 's/[-a-z0-9.]//g'`"; then
+ echo "configure: warning: $ac_option: invalid host type" 1>&2
+ fi
+ if test "x$nonopt" != xNONE; then
+ { echo "configure: error: can only configure for one host and one target at a time" 1>&2; exit 1; }
+ fi
+ nonopt="$ac_option"
+ ;;
+
+ esac
+done
+
+if test -n "$ac_prev"; then
+ { echo "configure: error: missing argument to --`echo $ac_prev | sed 's/_/-/g'`" 1>&2; exit 1; }
+fi
+
+trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15
+
+# File descriptor usage:
+# 0 standard input
+# 1 file creation
+# 2 errors and warnings
+# 3 some systems may open it to /dev/tty
+# 4 used on the Kubota Titan
+# 6 checking for... messages and results
+# 5 compiler messages saved in config.log
+if test "$silent" = yes; then
+ exec 6>/dev/null
+else
+ exec 6>&1
+fi
+exec 5>./config.log
+
+echo "\
+This file contains any messages produced by compilers while
+running configure, to aid debugging if configure makes a mistake.
+" 1>&5
+
+# Strip out --no-create and --no-recursion so they do not pile up.
+# Also quote any args containing shell metacharacters.
+ac_configure_args=
+for ac_arg
+do
+ case "$ac_arg" in
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c) ;;
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r) ;;
+ *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*)
+ ac_configure_args="$ac_configure_args '$ac_arg'" ;;
+ *) ac_configure_args="$ac_configure_args $ac_arg" ;;
+ esac
+done
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi
+if test "${LANG+set}" = set; then LANG=C; export LANG; fi
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -rf conftest* confdefs.h
+# AIX cpp loses on an empty file, so make sure it contains at least a newline.
+echo > confdefs.h
+
+# A filename unique to this package, relative to the directory that
+# configure is in, which we can look for to find out if srcdir is correct.
+ac_unique_file=calc.c
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+ ac_srcdir_defaulted=yes
+ # Try the directory containing this script, then its parent.
+ ac_prog=$0
+ ac_confdir=`echo $ac_prog|sed 's%/[^/][^/]*$%%'`
+ test "x$ac_confdir" = "x$ac_prog" && ac_confdir=.
+ srcdir=$ac_confdir
+ if test ! -r $srcdir/$ac_unique_file; then
+ srcdir=..
+ fi
+else
+ ac_srcdir_defaulted=no
+fi
+if test ! -r $srcdir/$ac_unique_file; then
+ if test "$ac_srcdir_defaulted" = yes; then
+ { echo "configure: error: can not find sources in $ac_confdir or .." 1>&2; exit 1; }
+ else
+ { echo "configure: error: can not find sources in $srcdir" 1>&2; exit 1; }
+ fi
+fi
+srcdir=`echo "${srcdir}" | sed 's%\([^/]\)/*$%\1%'`
+
+# Prefer explicitly selected file to automatically selected ones.
+if test -z "$CONFIG_SITE"; then
+ if test "x$prefix" != xNONE; then
+ CONFIG_SITE="$prefix/share/config.site $prefix/etc/config.site"
+ else
+ CONFIG_SITE="$ac_default_prefix/share/config.site $ac_default_prefix/etc/config.site"
+ fi
+fi
+for ac_site_file in $CONFIG_SITE; do
+ if test -r "$ac_site_file"; then
+ echo "loading site script $ac_site_file"
+ . "$ac_site_file"
+ fi
+done
+
+if test -r "$cache_file"; then
+ echo "loading cache $cache_file"
+ . $cache_file
+else
+ echo "creating cache $cache_file"
+ > $cache_file
+fi
+
+ac_ext=c
+# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options.
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.$ac_ext 1>&5 2>&5'
+ac_link='${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS 1>&5 2>&5'
+
+if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then
+ # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu.
+ if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then
+ ac_n= ac_c='
+' ac_t=' '
+ else
+ ac_n=-n ac_c= ac_t=
+ fi
+else
+ ac_n= ac_c='\c' ac_t=
+fi
+
+
+
+CC=${CC-cc}
+
+#
+# Look for various header files
+#
+echo $ac_n "checking how to run the C preprocessor""... $ac_c" 1>&6
+# On Suns, sometimes $CPP names a directory.
+if test -n "$CPP" && test -d "$CPP"; then
+ CPP=
+fi
+if test -z "$CPP"; then
+if eval "test \"`echo '$''{'ac_cv_prog_CPP'+set}'`\" = set"; then
+ echo $ac_n "(cached) $ac_c" 1>&6
+else
+ # This must be in double quotes, not single quotes, because CPP may get
+ # substituted into the Makefile and "${CC-cc}" will confuse make.
+ CPP="${CC-cc} -E"
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp.
+ cat > conftest.$ac_ext <<EOF
+#line 423 "configure"
+#include "confdefs.h"
+#include <assert.h>
+Syntax Error
+EOF
+eval "$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out"
+ac_err=`grep -v '^ *+' conftest.out`
+if test -z "$ac_err"; then
+ :
+else
+ echo "$ac_err" >&5
+ rm -rf conftest*
+ CPP="${CC-cc} -E -traditional-cpp"
+ cat > conftest.$ac_ext <<EOF
+#line 437 "configure"
+#include "confdefs.h"
+#include <assert.h>
+Syntax Error
+EOF
+eval "$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out"
+ac_err=`grep -v '^ *+' conftest.out`
+if test -z "$ac_err"; then
+ :
+else
+ echo "$ac_err" >&5
+ rm -rf conftest*
+ CPP=/lib/cpp
+fi
+rm -f conftest*
+fi
+rm -f conftest*
+ ac_cv_prog_CPP="$CPP"
+fi
+ CPP="$ac_cv_prog_CPP"
+else
+ ac_cv_prog_CPP="$CPP"
+fi
+echo "$ac_t""$CPP" 1>&6
+
+ac_safe=`echo "stdlib.h" | tr './\055' '___'`
+echo $ac_n "checking for stdlib.h""... $ac_c" 1>&6
+if eval "test \"`echo '$''{'ac_cv_header_$ac_safe'+set}'`\" = set"; then
+ echo $ac_n "(cached) $ac_c" 1>&6
+else
+ cat > conftest.$ac_ext <<EOF
+#line 468 "configure"
+#include "confdefs.h"
+#include <stdlib.h>
+EOF
+eval "$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out"
+ac_err=`grep -v '^ *+' conftest.out`
+if test -z "$ac_err"; then
+ rm -rf conftest*
+ eval "ac_cv_header_$ac_safe=yes"
+else
+ echo "$ac_err" >&5
+ rm -rf conftest*
+ eval "ac_cv_header_$ac_safe=no"
+fi
+rm -f conftest*
+fi
+if eval "test \"`echo '$ac_cv_header_'$ac_safe`\" = yes"; then
+ echo "$ac_t""yes" 1>&6
+ :
+else
+ echo "$ac_t""no" 1>&6
+cat >> confdefs.h <<\EOF
+#define HAVE_STDLIB_H 1
+EOF
+
+fi
+
+
+#
+# Look for various functions
+#
+echo $ac_n "checking for strcmp""... $ac_c" 1>&6
+if eval "test \"`echo '$''{'ac_cv_func_strcmp'+set}'`\" = set"; then
+ echo $ac_n "(cached) $ac_c" 1>&6
+else
+ cat > conftest.$ac_ext <<EOF
+#line 504 "configure"
+#include "confdefs.h"
+/* System header to define __stub macros and hopefully few prototypes,
+ which can conflict with char strcmp(); below. */
+#include <assert.h>
+/* Override any gcc2 internal prototype to avoid an error. */
+char strcmp();
+
+int main() { return 0; }
+int t() {
+
+/* The GNU C library defines this for functions which it implements
+ to always fail with ENOSYS. Some functions are actually named
+ something starting with __ and the normal name is an alias. */
+#if defined (__stub_strcmp) || defined (__stub___strcmp)
+choke me
+#else
+strcmp();
+#endif
+
+; return 0; }
+EOF
+if eval $ac_link; then
+ rm -rf conftest*
+ eval "ac_cv_func_strcmp=yes"
+else
+ rm -rf conftest*
+ eval "ac_cv_func_strcmp=no"
+fi
+rm -f conftest*
+
+fi
+if eval "test \"`echo '$ac_cv_func_'strcmp`\" = yes"; then
+ echo "$ac_t""yes" 1>&6
+ cat >> confdefs.h <<\EOF
+#define HAVE_STRCMP 1
+EOF
+
+else
+ echo "$ac_t""no" 1>&6
+fi
+
+
+#
+# Output Makefile with substitutions
+
+trap '' 1 2 15
+cat > confcache <<\EOF
+# This file is a shell script that caches the results of configure
+# tests run on this system so they can be shared between configure
+# scripts and configure runs. It is not useful on other systems.
+# If it contains results you don't want to keep, you may remove or edit it.
+#
+# By default, configure uses ./config.cache as the cache file,
+# creating it if it does not exist already. You can give configure
+# the --cache-file=FILE option to use a different cache file; that is
+# what configure does when it calls configure scripts in
+# subdirectories, so they share the cache.
+# Giving --cache-file=/dev/null disables caching, for debugging configure.
+# config.status only pays attention to the cache file if you give it the
+# --recheck option to rerun configure.
+#
+EOF
+# Ultrix sh set writes to stderr and can't be redirected directly,
+# and sets the high bit in the cache file unless we assign to the vars.
+(set) 2>&1 |
+ sed -n "s/^\([a-zA-Z0-9_]*_cv_[a-zA-Z0-9_]*\)=\(.*\)/\1=\${\1='\2'}/p" \
+ >> confcache
+if cmp -s $cache_file confcache; then
+ :
+else
+ if test -w $cache_file; then
+ echo "updating cache $cache_file"
+ cat confcache > $cache_file
+ else
+ echo "not updating unwritable cache $cache_file"
+ fi
+fi
+rm -f confcache
+
+trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15
+
+test "x$prefix" = xNONE && prefix=$ac_default_prefix
+# Let make expand exec_prefix.
+test "x$exec_prefix" = xNONE && exec_prefix='${prefix}'
+
+# Any assignment to VPATH causes Sun make to only execute
+# the first set of double-colon rules, so remove it if not needed.
+# If there is a colon in the path, we need to keep it.
+if test "x$srcdir" = x.; then
+ ac_vpsub='/^[ ]*VPATH[ ]*=[^:]*$/d'
+fi
+
+trap 'rm -f $CONFIG_STATUS conftest*; exit 1' 1 2 15
+
+DEFS=-DHAVE_CONFIG_H
+
+# Without the "./", some shells look in PATH for config.status.
+: ${CONFIG_STATUS=./config.status}
+
+echo creating $CONFIG_STATUS
+rm -f $CONFIG_STATUS
+cat > $CONFIG_STATUS <<EOF
+#! /bin/sh
+# Generated automatically by configure.
+# Run this file to recreate the current configuration.
+# This directory was configured as follows,
+# on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+#
+# $0 $ac_configure_args
+#
+# Compiler output produced by configure, useful for debugging
+# configure, is in ./config.log if it exists.
+
+ac_cs_usage="Usage: $CONFIG_STATUS [--recheck] [--version] [--help]"
+for ac_option
+do
+ case "\$ac_option" in
+ -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+ echo "running \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion"
+ exec \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion ;;
+ -version | --version | --versio | --versi | --vers | --ver | --ve | --v)
+ echo "$CONFIG_STATUS generated by autoconf version 2.4"
+ exit 0 ;;
+ -help | --help | --hel | --he | --h)
+ echo "\$ac_cs_usage"; exit 0 ;;
+ *) echo "\$ac_cs_usage"; exit 1 ;;
+ esac
+done
+
+ac_given_srcdir=$srcdir
+
+trap 'rm -fr `echo "Makefile calc.h" | sed "s/:[^ ]*//g"` conftest*; exit 1' 1 2 15
+
+# Protect against being on the right side of a sed subst in config.status.
+sed 's/%@/@@/; s/@%/@@/; s/%g$/@g/; /@g$/s/[\\\\&%]/\\\\&/g;
+ s/@@/%@/; s/@@/@%/; s/@g$/%g/' > conftest.subs <<\CEOF
+$ac_vpsub
+$extrasub
+s%@CFLAGS@%$CFLAGS%g
+s%@CPPFLAGS@%$CPPFLAGS%g
+s%@CXXFLAGS@%$CXXFLAGS%g
+s%@DEFS@%$DEFS%g
+s%@LDFLAGS@%$LDFLAGS%g
+s%@LIBS@%$LIBS%g
+s%@exec_prefix@%$exec_prefix%g
+s%@prefix@%$prefix%g
+s%@program_transform_name@%$program_transform_name%g
+s%@CPP@%$CPP%g
+s%@CC@%$CC%g
+
+CEOF
+EOF
+cat >> $CONFIG_STATUS <<EOF
+
+CONFIG_FILES=\${CONFIG_FILES-"Makefile"}
+EOF
+cat >> $CONFIG_STATUS <<\EOF
+for ac_file in .. $CONFIG_FILES; do if test "x$ac_file" != x..; then
+ # Support "outfile[:infile]", defaulting infile="outfile.in".
+ case "$ac_file" in
+ *:*) ac_file_in=`echo "$ac_file"|sed 's%.*:%%'`
+ ac_file=`echo "$ac_file"|sed 's%:.*%%'` ;;
+ *) ac_file_in="${ac_file}.in" ;;
+ esac
+
+ # Adjust relative srcdir, etc. for subdirectories.
+
+ # Remove last slash and all that follows it. Not all systems have dirname.
+ ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'`
+ if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then
+ # The file is in a subdirectory.
+ test ! -d "$ac_dir" && mkdir "$ac_dir"
+ ac_dir_suffix="/`echo $ac_dir|sed 's%^\./%%'`"
+ # A "../" for each directory in $ac_dir_suffix.
+ ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'`
+ else
+ ac_dir_suffix= ac_dots=
+ fi
+
+ case "$ac_given_srcdir" in
+ .) srcdir=.
+ if test -z "$ac_dots"; then top_srcdir=.
+ else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;;
+ /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;;
+ *) # Relative path.
+ srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix"
+ top_srcdir="$ac_dots$ac_given_srcdir" ;;
+ esac
+
+ echo creating "$ac_file"
+ rm -f "$ac_file"
+ configure_input="Generated automatically from `echo $ac_file_in|sed 's%.*/%%'` by configure."
+ case "$ac_file" in
+ *Makefile*) ac_comsub="1i\\
+# $configure_input" ;;
+ *) ac_comsub= ;;
+ esac
+ sed -e "$ac_comsub
+s%@configure_input@%$configure_input%g
+s%@srcdir@%$srcdir%g
+s%@top_srcdir@%$top_srcdir%g
+" -f conftest.subs $ac_given_srcdir/$ac_file_in > $ac_file
+fi; done
+rm -f conftest.subs
+
+# These sed commands are passed to sed as "A NAME B NAME C VALUE D", where
+# NAME is the cpp macro being defined and VALUE is the value it is being given.
+#
+# ac_d sets the value in "#define NAME VALUE" lines.
+ac_dA='s%^\([ ]*\)#\([ ]*define[ ][ ]*\)'
+ac_dB='\([ ][ ]*\)[^ ]*%\1#\2'
+ac_dC='\3'
+ac_dD='%g'
+# ac_u turns "#undef NAME" with trailing blanks into "#define NAME VALUE".
+ac_uA='s%^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)'
+ac_uB='\([ ]\)%\1#\2define\3'
+ac_uC=' '
+ac_uD='\4%g'
+# ac_e turns "#undef NAME" without trailing blanks into "#define NAME VALUE".
+ac_eA='s%^\([ ]*\)#\([ ]*\)undef\([ ][ ]*\)'
+ac_eB='$%\1#\2define\3'
+ac_eC=' '
+ac_eD='%g'
+
+CONFIG_HEADERS=${CONFIG_HEADERS-"calc.h"}
+for ac_file in .. $CONFIG_HEADERS; do if test "x$ac_file" != x..; then
+ # Support "outfile[:infile]", defaulting infile="outfile.in".
+ case "$ac_file" in
+ *:*) ac_file_in=`echo "$ac_file"|sed 's%.*:%%'`
+ ac_file=`echo "$ac_file"|sed 's%:.*%%'` ;;
+ *) ac_file_in="${ac_file}.in" ;;
+ esac
+
+ echo creating $ac_file
+
+ rm -f conftest.frag conftest.in conftest.out
+ cp $ac_given_srcdir/$ac_file_in conftest.in
+
+EOF
+
+# Transform confdefs.h into a sed script conftest.vals that substitutes
+# the proper values into config.h.in to produce config.h. And first:
+# Protect against being on the right side of a sed subst in config.status.
+# Protect against being in an unquoted here document in config.status.
+rm -f conftest.vals
+cat > conftest.hdr <<\EOF
+s/[\\&%]/\\&/g
+s%[\\$`]%\\&%g
+s%#define \([A-Za-z_][A-Za-z0-9_]*\) \(.*\)%${ac_dA}\1${ac_dB}\1${ac_dC}\2${ac_dD}%gp
+s%ac_d%ac_u%gp
+s%ac_u%ac_e%gp
+EOF
+sed -n -f conftest.hdr confdefs.h > conftest.vals
+rm -f conftest.hdr
+
+# This sed command replaces #undef with comments. This is necessary, for
+# example, in the case of _POSIX_SOURCE, which is predefined and required
+# on some systems where configure will not decide to define it.
+cat >> conftest.vals <<\EOF
+s%^[ ]*#[ ]*undef[ ][ ]*[a-zA-Z_][a-zA-Z_0-9]*%/* & */%
+EOF
+
+# Break up conftest.vals because some shells have a limit on
+# the size of here documents, and old seds have small limits too.
+# Maximum number of lines to put in a single here document.
+ac_max_here_lines=12
+
+rm -f conftest.tail
+while :
+do
+ ac_lines=`grep -c . conftest.vals`
+ # grep -c gives empty output for an empty file on some AIX systems.
+ if test -z "$ac_lines" || test "$ac_lines" -eq 0; then break; fi
+ # Write a limited-size here document to conftest.frag.
+ echo ' cat > conftest.frag <<CEOF' >> $CONFIG_STATUS
+ sed ${ac_max_here_lines}q conftest.vals >> $CONFIG_STATUS
+ echo 'CEOF
+ sed -f conftest.frag conftest.in > conftest.out
+ rm -f conftest.in
+ mv conftest.out conftest.in
+' >> $CONFIG_STATUS
+ sed 1,${ac_max_here_lines}d conftest.vals > conftest.tail
+ rm -f conftest.vals
+ mv conftest.tail conftest.vals
+done
+rm -f conftest.vals
+
+cat >> $CONFIG_STATUS <<\EOF
+ rm -f conftest.frag conftest.h
+ echo "/* $ac_file. Generated automatically by configure. */" > conftest.h
+ cat conftest.in >> conftest.h
+ rm -f conftest.in
+ if cmp -s $ac_file conftest.h 2>/dev/null; then
+ echo "$ac_file is unchanged"
+ rm -f conftest.h
+ else
+ rm -f $ac_file
+ mv conftest.h $ac_file
+ fi
+fi; done
+
+
+
+exit 0
+EOF
+chmod +x $CONFIG_STATUS
+rm -fr confdefs* $ac_clean_files
+test "$no_create" = yes || ${CONFIG_SHELL-/bin/sh} $CONFIG_STATUS || exit 1
+
diff --git a/contrib/bluegnu2.0.3/example/calc/configure.in b/contrib/bluegnu2.0.3/example/calc/configure.in
new file mode 100644
index 0000000..473e879
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/configure.in
@@ -0,0 +1,19 @@
+dnl Process this file with autoconf to produce a configure script.
+AC_INIT(calc.c)
+AC_CONFIG_HEADER(calc.h)
+CC=${CC-cc}
+
+#
+# Look for various header files
+#
+AC_HEADER_CHECK(stdlib.h, ,AC_DEFINE(HAVE_STDLIB_H))
+
+#
+# Look for various functions
+#
+AC_FUNC_CHECK(strcmp, AC_DEFINE(HAVE_STRCMP))
+
+#
+# Output Makefile with substitutions
+AC_SUBST(CC)
+AC_OUTPUT(Makefile)
diff --git a/contrib/bluegnu2.0.3/example/calc/testsuite/calc.test/calc.exp b/contrib/bluegnu2.0.3/example/calc/testsuite/calc.test/calc.exp
new file mode 100644
index 0000000..73e99e4
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/testsuite/calc.test/calc.exp
@@ -0,0 +1,60 @@
+set timeout 3
+#
+# expectations that clean up in case of error. Note that `$test' is
+# a purely local variable.
+#
+# The first of these is used to match any bad responses, and resynchronise
+# things by finding a prompt. The second is a timeout error, and shouldn't
+# ever be triggered.
+#
+expect_after {
+ -re "\[^\n\r\]*$prompt$" {
+ fail "$test (bad match)"
+ if { $verbose > 0 } {
+ regexp ".*\r\n(\[^\r\n\]+)(\[\r\n\])+$prompt$" \
+ $expect_out(buffer) "" output
+ send_user "\tUnmatched output: \"$output\"\n"
+ }
+ }
+ timeout {
+ fail "$test (timeout)"
+ }
+}
+#
+# Here are the tests
+#
+set test "version"
+send "version\n"
+expect {
+ -re "Version:.*$prompt$" { pass "version" }
+}
+
+set test add1
+send "add 3 4\n"
+expect {
+ -re "7+.*$prompt$" { pass "$test" }
+}
+
+set test add2
+send "add 1 2 3\n"
+expect {
+ -re "Usage: add #1 #2.*$prompt$" { pass "$test" }
+}
+
+set test multiply1
+send "multiply 3 4\n"
+expect {
+ -re "12.*$prompt$" { pass "$test" }
+}
+
+set test multiply2
+send "multiply 2 4\n"
+expect {
+ -re "8.*$prompt$" { pass "$test" }
+}
+
+set test multiply3
+send "multiply 1 2 3\n"
+expect {
+ -re "Usage: multiply #1 #2.*$prompt$" { pass "$test" }
+}
diff --git a/contrib/bluegnu2.0.3/example/calc/testsuite/config/unix.exp b/contrib/bluegnu2.0.3/example/calc/testsuite/config/unix.exp
new file mode 100644
index 0000000..aec9f40
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/calc/testsuite/config/unix.exp
@@ -0,0 +1,49 @@
+if ![info exists prompt] then {
+ set prompt "calc: "
+}
+#
+# calc_version -- extract and print the version number of calc
+#
+
+proc calc_version {} {
+ global CALC
+ global prompt
+ set tmp [exec echo "version" | $CALC]
+ regexp "$prompt *(\[^\n\]*)\n.*" $tmp tmp version
+ clone_output "[which $CALC] version $version\n"
+}
+#
+# calc_load -- loads the program
+#
+proc calc_load { arg } {
+ #
+}
+
+#
+# calc_exit -- quit and cleanup
+#
+proc calc_exit {} {
+ send "quit\n"
+}
+
+#
+# calc_start -- start calc running
+#
+proc calc_start {} {
+ global CALC
+ global prompt
+ global spawn_id
+ global verbose
+
+ if { $verbose > 1 } {
+ send_user "starting $CALC\n"
+ }
+ spawn $CALC
+ expect {
+ -re "No such file.*" { perror "Can't start $CALC"; exit 1 }
+ -re "$prompt$" { }
+ timeout { perror "Failed to spawn $CALC (timeout)"; exit 1 }
+ }
+}
+
+calc_start
diff --git a/contrib/bluegnu2.0.3/example/configure b/contrib/bluegnu2.0.3/example/configure
new file mode 100755
index 0000000..b9c061b
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/configure
@@ -0,0 +1,697 @@
+#! /bin/sh
+
+# Guess values for system-dependent variables and create Makefiles.
+# Generated automatically using autoconf version 2.4
+# Copyright (C) 1992, 1993, 1994 Free Software Foundation, Inc.
+#
+# This configure script is free software; the Free Software Foundation
+# gives unlimited permission to copy, distribute and modify it.
+
+# Defaults:
+ac_help=
+ac_default_prefix=/usr/local
+# Any additions from configure.in:
+
+# Initialize some variables set by options.
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+build=NONE
+cache_file=./config.cache
+exec_prefix=NONE
+host=NONE
+no_create=
+nonopt=NONE
+no_recursion=
+prefix=NONE
+program_prefix=NONE
+program_suffix=NONE
+program_transform_name=s,x,x,
+silent=
+site=
+srcdir=
+target=NONE
+verbose=
+x_includes=NONE
+x_libraries=NONE
+
+# Initialize some other variables.
+subdirs=
+
+ac_prev=
+for ac_option
+do
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$ac_prev"; then
+ eval "$ac_prev=\$ac_option"
+ ac_prev=
+ continue
+ fi
+
+ case "$ac_option" in
+ -*=*) ac_optarg=`echo "$ac_option" | sed 's/[-_a-zA-Z0-9]*=//'` ;;
+ *) ac_optarg= ;;
+ esac
+
+ # Accept the important Cygnus configure options, so we can diagnose typos.
+
+ case "$ac_option" in
+
+ -build | --build | --buil | --bui | --bu | --b)
+ ac_prev=build ;;
+ -build=* | --build=* | --buil=* | --bui=* | --bu=* | --b=*)
+ build="$ac_optarg" ;;
+
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ cache_file="$ac_optarg" ;;
+
+ -disable-* | --disable-*)
+ ac_feature=`echo $ac_option|sed -e 's/-*disable-//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_feature| sed 's/[-a-zA-Z0-9_]//g'`"; then
+ { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; }
+ fi
+ ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+ eval "enable_${ac_feature}=no" ;;
+
+ -enable-* | --enable-*)
+ ac_feature=`echo $ac_option|sed -e 's/-*enable-//' -e 's/=.*//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_feature| sed 's/[-_a-zA-Z0-9]//g'`"; then
+ { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; }
+ fi
+ ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+ case "$ac_option" in
+ *=*) ;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "enable_${ac_feature}='$ac_optarg'" ;;
+
+ -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+ | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+ | --exec | --exe | --ex)
+ ac_prev=exec_prefix ;;
+ -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+ | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+ | --exec=* | --exe=* | --ex=*)
+ exec_prefix="$ac_optarg" ;;
+
+ -gas | --gas | --ga | --g)
+ # Obsolete; use --with-gas.
+ with_gas=yes ;;
+
+ -help | --help | --hel | --he)
+ # Omit some internal or obsolete options to make the list less imposing.
+ # This message is too long to be a string in the A/UX 3.1 sh.
+ cat << EOF
+Usage: configure [options] [host]
+Options: [defaults in brackets after descriptions]
+Configuration:
+ --cache-file=FILE cache test results in FILE
+ --help print this message
+ --no-create do not create output files
+ --quiet, --silent do not print \`checking...' messages
+ --version print the version of autoconf that created configure
+Directory and file names:
+ --prefix=PREFIX install architecture-independent files in PREFIX
+ [$ac_default_prefix]
+ --exec-prefix=PREFIX install architecture-dependent files in PREFIX
+ [same as prefix]
+ --srcdir=DIR find the sources in DIR [configure dir or ..]
+ --program-prefix=PREFIX prepend PREFIX to installed program names
+ --program-suffix=SUFFIX append SUFFIX to installed program names
+ --program-transform-name=PROGRAM run sed PROGRAM on installed program names
+Host type:
+ --build=BUILD configure for building on BUILD [BUILD=HOST]
+ --host=HOST configure for HOST [guessed]
+ --target=TARGET configure for TARGET [TARGET=HOST]
+Features and packages:
+ --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no)
+ --enable-FEATURE[=ARG] include FEATURE [ARG=yes]
+ --with-PACKAGE[=ARG] use PACKAGE [ARG=yes]
+ --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
+ --x-includes=DIR X include files are in DIR
+ --x-libraries=DIR X library files are in DIR
+--enable and --with options recognized:$ac_help
+EOF
+ exit 0 ;;
+
+ -host | --host | --hos | --ho)
+ ac_prev=host ;;
+ -host=* | --host=* | --hos=* | --ho=*)
+ host="$ac_optarg" ;;
+
+ -nfp | --nfp | --nf)
+ # Obsolete; use --without-fp.
+ with_fp=no ;;
+
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c)
+ no_create=yes ;;
+
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r)
+ no_recursion=yes ;;
+
+ -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+ ac_prev=prefix ;;
+ -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+ prefix="$ac_optarg" ;;
+
+ -program-prefix | --program-prefix | --program-prefi | --program-pref \
+ | --program-pre | --program-pr | --program-p)
+ ac_prev=program_prefix ;;
+ -program-prefix=* | --program-prefix=* | --program-prefi=* \
+ | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+ program_prefix="$ac_optarg" ;;
+
+ -program-suffix | --program-suffix | --program-suffi | --program-suff \
+ | --program-suf | --program-su | --program-s)
+ ac_prev=program_suffix ;;
+ -program-suffix=* | --program-suffix=* | --program-suffi=* \
+ | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+ program_suffix="$ac_optarg" ;;
+
+ -program-transform-name | --program-transform-name \
+ | --program-transform-nam | --program-transform-na \
+ | --program-transform-n | --program-transform- \
+ | --program-transform | --program-transfor \
+ | --program-transfo | --program-transf \
+ | --program-trans | --program-tran \
+ | --progr-tra | --program-tr | --program-t)
+ ac_prev=program_transform_name ;;
+ -program-transform-name=* | --program-transform-name=* \
+ | --program-transform-nam=* | --program-transform-na=* \
+ | --program-transform-n=* | --program-transform-=* \
+ | --program-transform=* | --program-transfor=* \
+ | --program-transfo=* | --program-transf=* \
+ | --program-trans=* | --program-tran=* \
+ | --progr-tra=* | --program-tr=* | --program-t=*)
+ program_transform_name="$ac_optarg" ;;
+
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ silent=yes ;;
+
+ -site | --site | --sit)
+ ac_prev=site ;;
+ -site=* | --site=* | --sit=*)
+ site="$ac_optarg" ;;
+
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ srcdir="$ac_optarg" ;;
+
+ -target | --target | --targe | --targ | --tar | --ta | --t)
+ ac_prev=target ;;
+ -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+ target="$ac_optarg" ;;
+
+ -v | -verbose | --verbose | --verbos | --verbo | --verb)
+ verbose=yes ;;
+
+ -version | --version | --versio | --versi | --vers)
+ echo "configure generated by autoconf version 2.4"
+ exit 0 ;;
+
+ -with-* | --with-*)
+ ac_package=`echo $ac_option|sed -e 's/-*with-//' -e 's/=.*//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_package| sed 's/[-_a-zA-Z0-9]//g'`"; then
+ { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; }
+ fi
+ ac_package=`echo $ac_package| sed 's/-/_/g'`
+ case "$ac_option" in
+ *=*) ;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "with_${ac_package}='$ac_optarg'" ;;
+
+ -without-* | --without-*)
+ ac_package=`echo $ac_option|sed -e 's/-*without-//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_package| sed 's/[-a-zA-Z0-9_]//g'`"; then
+ { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; }
+ fi
+ ac_package=`echo $ac_package| sed 's/-/_/g'`
+ eval "with_${ac_package}=no" ;;
+
+ --x)
+ # Obsolete; use --with-x.
+ with_x=yes ;;
+
+ -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+ | --x-incl | --x-inc | --x-in | --x-i)
+ ac_prev=x_includes ;;
+ -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+ | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+ x_includes="$ac_optarg" ;;
+
+ -x-libraries | --x-libraries | --x-librarie | --x-librari \
+ | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+ ac_prev=x_libraries ;;
+ -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+ | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+ x_libraries="$ac_optarg" ;;
+
+ -*) { echo "configure: error: $ac_option: invalid option; use --help to show usage" 1>&2; exit 1; }
+ ;;
+
+ *)
+ if test -n "`echo $ac_option| sed 's/[-a-z0-9.]//g'`"; then
+ echo "configure: warning: $ac_option: invalid host type" 1>&2
+ fi
+ if test "x$nonopt" != xNONE; then
+ { echo "configure: error: can only configure for one host and one target at a time" 1>&2; exit 1; }
+ fi
+ nonopt="$ac_option"
+ ;;
+
+ esac
+done
+
+if test -n "$ac_prev"; then
+ { echo "configure: error: missing argument to --`echo $ac_prev | sed 's/_/-/g'`" 1>&2; exit 1; }
+fi
+
+trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15
+
+# File descriptor usage:
+# 0 standard input
+# 1 file creation
+# 2 errors and warnings
+# 3 some systems may open it to /dev/tty
+# 4 used on the Kubota Titan
+# 6 checking for... messages and results
+# 5 compiler messages saved in config.log
+if test "$silent" = yes; then
+ exec 6>/dev/null
+else
+ exec 6>&1
+fi
+exec 5>./config.log
+
+echo "\
+This file contains any messages produced by compilers while
+running configure, to aid debugging if configure makes a mistake.
+" 1>&5
+
+# Strip out --no-create and --no-recursion so they do not pile up.
+# Also quote any args containing shell metacharacters.
+ac_configure_args=
+for ac_arg
+do
+ case "$ac_arg" in
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c) ;;
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r) ;;
+ *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*)
+ ac_configure_args="$ac_configure_args '$ac_arg'" ;;
+ *) ac_configure_args="$ac_configure_args $ac_arg" ;;
+ esac
+done
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi
+if test "${LANG+set}" = set; then LANG=C; export LANG; fi
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -rf conftest* confdefs.h
+# AIX cpp loses on an empty file, so make sure it contains at least a newline.
+echo > confdefs.h
+
+# A filename unique to this package, relative to the directory that
+# configure is in, which we can look for to find out if srcdir is correct.
+ac_unique_file=Makefile.in
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+ ac_srcdir_defaulted=yes
+ # Try the directory containing this script, then its parent.
+ ac_prog=$0
+ ac_confdir=`echo $ac_prog|sed 's%/[^/][^/]*$%%'`
+ test "x$ac_confdir" = "x$ac_prog" && ac_confdir=.
+ srcdir=$ac_confdir
+ if test ! -r $srcdir/$ac_unique_file; then
+ srcdir=..
+ fi
+else
+ ac_srcdir_defaulted=no
+fi
+if test ! -r $srcdir/$ac_unique_file; then
+ if test "$ac_srcdir_defaulted" = yes; then
+ { echo "configure: error: can not find sources in $ac_confdir or .." 1>&2; exit 1; }
+ else
+ { echo "configure: error: can not find sources in $srcdir" 1>&2; exit 1; }
+ fi
+fi
+srcdir=`echo "${srcdir}" | sed 's%\([^/]\)/*$%\1%'`
+
+# Prefer explicitly selected file to automatically selected ones.
+if test -z "$CONFIG_SITE"; then
+ if test "x$prefix" != xNONE; then
+ CONFIG_SITE="$prefix/share/config.site $prefix/etc/config.site"
+ else
+ CONFIG_SITE="$ac_default_prefix/share/config.site $ac_default_prefix/etc/config.site"
+ fi
+fi
+for ac_site_file in $CONFIG_SITE; do
+ if test -r "$ac_site_file"; then
+ echo "loading site script $ac_site_file"
+ . "$ac_site_file"
+ fi
+done
+
+if test -r "$cache_file"; then
+ echo "loading cache $cache_file"
+ . $cache_file
+else
+ echo "creating cache $cache_file"
+ > $cache_file
+fi
+
+ac_ext=c
+# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options.
+ac_cpp='$CPP $CPPFLAGS'
+ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.$ac_ext 1>&5 2>&5'
+ac_link='${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS 1>&5 2>&5'
+
+if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then
+ # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu.
+ if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then
+ ac_n= ac_c='
+' ac_t=' '
+ else
+ ac_n=-n ac_c= ac_t=
+ fi
+else
+ ac_n= ac_c='\c' ac_t=
+fi
+
+
+CC=${CC-cc}
+
+ac_aux_dir=
+for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do
+ if test -f $ac_dir/install-sh; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install-sh -c"
+ break
+ elif test -f $ac_dir/install.sh; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install.sh -c"
+ break
+ fi
+done
+if test -z "$ac_aux_dir"; then
+ { echo "configure: error: can not find install-sh or install.sh in $srcdir $srcdir/.. $srcdir/../.." 1>&2; exit 1; }
+fi
+ac_config_guess=$ac_aux_dir/config.guess
+ac_config_sub=$ac_aux_dir/config.sub
+ac_configure=$ac_aux_dir/configure # This should be Cygnus configure.
+
+subdirs="calc"
+
+
+
+trap '' 1 2 15
+cat > confcache <<\EOF
+# This file is a shell script that caches the results of configure
+# tests run on this system so they can be shared between configure
+# scripts and configure runs. It is not useful on other systems.
+# If it contains results you don't want to keep, you may remove or edit it.
+#
+# By default, configure uses ./config.cache as the cache file,
+# creating it if it does not exist already. You can give configure
+# the --cache-file=FILE option to use a different cache file; that is
+# what configure does when it calls configure scripts in
+# subdirectories, so they share the cache.
+# Giving --cache-file=/dev/null disables caching, for debugging configure.
+# config.status only pays attention to the cache file if you give it the
+# --recheck option to rerun configure.
+#
+EOF
+# Ultrix sh set writes to stderr and can't be redirected directly,
+# and sets the high bit in the cache file unless we assign to the vars.
+(set) 2>&1 |
+ sed -n "s/^\([a-zA-Z0-9_]*_cv_[a-zA-Z0-9_]*\)=\(.*\)/\1=\${\1='\2'}/p" \
+ >> confcache
+if cmp -s $cache_file confcache; then
+ :
+else
+ if test -w $cache_file; then
+ echo "updating cache $cache_file"
+ cat confcache > $cache_file
+ else
+ echo "not updating unwritable cache $cache_file"
+ fi
+fi
+rm -f confcache
+
+trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15
+
+test "x$prefix" = xNONE && prefix=$ac_default_prefix
+# Let make expand exec_prefix.
+test "x$exec_prefix" = xNONE && exec_prefix='${prefix}'
+
+# Any assignment to VPATH causes Sun make to only execute
+# the first set of double-colon rules, so remove it if not needed.
+# If there is a colon in the path, we need to keep it.
+if test "x$srcdir" = x.; then
+ ac_vpsub='/^[ ]*VPATH[ ]*=[^:]*$/d'
+fi
+
+trap 'rm -f $CONFIG_STATUS conftest*; exit 1' 1 2 15
+
+# Transform confdefs.h into DEFS.
+# Protect against shell expansion while executing Makefile rules.
+# Protect against Makefile macro expansion.
+cat > conftest.defs <<\EOF
+s%#define \([A-Za-z_][A-Za-z0-9_]*\) \(.*\)%-D\1=\2%g
+s%[ `~#$^&*(){}\\|;'"<>?]%\\&%g
+s%\[%\\&%g
+s%\]%\\&%g
+s%\$%$$%g
+EOF
+DEFS=`sed -f conftest.defs confdefs.h | tr '\012' ' '`
+rm -f conftest.defs
+
+
+# Without the "./", some shells look in PATH for config.status.
+: ${CONFIG_STATUS=./config.status}
+
+echo creating $CONFIG_STATUS
+rm -f $CONFIG_STATUS
+cat > $CONFIG_STATUS <<EOF
+#! /bin/sh
+# Generated automatically by configure.
+# Run this file to recreate the current configuration.
+# This directory was configured as follows,
+# on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+#
+# $0 $ac_configure_args
+#
+# Compiler output produced by configure, useful for debugging
+# configure, is in ./config.log if it exists.
+
+ac_cs_usage="Usage: $CONFIG_STATUS [--recheck] [--version] [--help]"
+for ac_option
+do
+ case "\$ac_option" in
+ -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+ echo "running \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion"
+ exec \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion ;;
+ -version | --version | --versio | --versi | --vers | --ver | --ve | --v)
+ echo "$CONFIG_STATUS generated by autoconf version 2.4"
+ exit 0 ;;
+ -help | --help | --hel | --he | --h)
+ echo "\$ac_cs_usage"; exit 0 ;;
+ *) echo "\$ac_cs_usage"; exit 1 ;;
+ esac
+done
+
+ac_given_srcdir=$srcdir
+
+trap 'rm -fr `echo "Makefile" | sed "s/:[^ ]*//g"` conftest*; exit 1' 1 2 15
+
+# Protect against being on the right side of a sed subst in config.status.
+sed 's/%@/@@/; s/@%/@@/; s/%g$/@g/; /@g$/s/[\\\\&%]/\\\\&/g;
+ s/@@/%@/; s/@@/@%/; s/@g$/%g/' > conftest.subs <<\CEOF
+$ac_vpsub
+$extrasub
+s%@CFLAGS@%$CFLAGS%g
+s%@CPPFLAGS@%$CPPFLAGS%g
+s%@CXXFLAGS@%$CXXFLAGS%g
+s%@DEFS@%$DEFS%g
+s%@LDFLAGS@%$LDFLAGS%g
+s%@LIBS@%$LIBS%g
+s%@exec_prefix@%$exec_prefix%g
+s%@prefix@%$prefix%g
+s%@program_transform_name@%$program_transform_name%g
+s%@subdirs@%$subdirs%g
+s%@CC@%$CC%g
+
+CEOF
+EOF
+cat >> $CONFIG_STATUS <<EOF
+
+CONFIG_FILES=\${CONFIG_FILES-"Makefile"}
+EOF
+cat >> $CONFIG_STATUS <<\EOF
+for ac_file in .. $CONFIG_FILES; do if test "x$ac_file" != x..; then
+ # Support "outfile[:infile]", defaulting infile="outfile.in".
+ case "$ac_file" in
+ *:*) ac_file_in=`echo "$ac_file"|sed 's%.*:%%'`
+ ac_file=`echo "$ac_file"|sed 's%:.*%%'` ;;
+ *) ac_file_in="${ac_file}.in" ;;
+ esac
+
+ # Adjust relative srcdir, etc. for subdirectories.
+
+ # Remove last slash and all that follows it. Not all systems have dirname.
+ ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'`
+ if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then
+ # The file is in a subdirectory.
+ test ! -d "$ac_dir" && mkdir "$ac_dir"
+ ac_dir_suffix="/`echo $ac_dir|sed 's%^\./%%'`"
+ # A "../" for each directory in $ac_dir_suffix.
+ ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'`
+ else
+ ac_dir_suffix= ac_dots=
+ fi
+
+ case "$ac_given_srcdir" in
+ .) srcdir=.
+ if test -z "$ac_dots"; then top_srcdir=.
+ else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;;
+ /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;;
+ *) # Relative path.
+ srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix"
+ top_srcdir="$ac_dots$ac_given_srcdir" ;;
+ esac
+
+ echo creating "$ac_file"
+ rm -f "$ac_file"
+ configure_input="Generated automatically from `echo $ac_file_in|sed 's%.*/%%'` by configure."
+ case "$ac_file" in
+ *Makefile*) ac_comsub="1i\\
+# $configure_input" ;;
+ *) ac_comsub= ;;
+ esac
+ sed -e "$ac_comsub
+s%@configure_input@%$configure_input%g
+s%@srcdir@%$srcdir%g
+s%@top_srcdir@%$top_srcdir%g
+" -f conftest.subs $ac_given_srcdir/$ac_file_in > $ac_file
+fi; done
+rm -f conftest.subs
+
+
+
+exit 0
+EOF
+chmod +x $CONFIG_STATUS
+rm -fr confdefs* $ac_clean_files
+test "$no_create" = yes || ${CONFIG_SHELL-/bin/sh} $CONFIG_STATUS || exit 1
+
+if test "$no_recursion" != yes; then
+
+ # Remove --cache-file and --srcdir arguments so they do not pile up.
+ ac_sub_configure_args=
+ ac_prev=
+ for ac_arg in $ac_configure_args; do
+ if test -n "$ac_prev"; then
+ ac_prev=
+ continue
+ fi
+ case "$ac_arg" in
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ ;;
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ ;;
+ *) ac_sub_configure_args="$ac_sub_configure_args $ac_arg" ;;
+ esac
+ done
+
+ for ac_config_dir in calc; do
+
+ # Do not complain, so a configure script can configure whichever
+ # parts of a large source tree are present.
+ if test ! -d $srcdir/$ac_config_dir; then
+ continue
+ fi
+
+ echo configuring in $ac_config_dir
+
+ case "$srcdir" in
+ .) ;;
+ *)
+ if test -d ./$ac_config_dir || mkdir ./$ac_config_dir; then :;
+ else
+ { echo "configure: error: can not create `pwd`/$ac_config_dir" 1>&2; exit 1; }
+ fi
+ ;;
+ esac
+
+ ac_popdir=`pwd`
+ cd $ac_config_dir
+
+ case "$srcdir" in
+ .) # No --srcdir option. We are building in place.
+ ac_sub_srcdir=$srcdir ;;
+ /*) # Absolute path.
+ ac_sub_srcdir=$srcdir/$ac_config_dir ;;
+ *) # Relative path.
+ ac_sub_srcdir=../$srcdir/$ac_config_dir ;;
+ esac
+
+ # Check for guested configure; otherwise get Cygnus style configure.
+ if test -f $ac_sub_srcdir/configure; then
+ ac_sub_configure=$ac_sub_srcdir/configure
+ elif test -f $ac_sub_srcdir/configure.in; then
+ ac_sub_configure=$ac_configure
+ else
+ echo "configure: warning: no configuration information is in $ac_config_dir" 1>&2
+ ac_sub_configure=
+ fi
+
+ # The recursion is here.
+ if test -n "$ac_sub_configure"; then
+
+ # Make the cache file name correct relative to the subdirectory.
+ # A "../" for each directory in /$ac_config_dir.
+ ac_dots=`echo $ac_config_dir|sed -e 's%^\./%%' -e 's%[^/]$%&/%' -e 's%[^/]*/%../%g'`
+ case "$cache_file" in
+ /*) ac_sub_cache_file=$cache_file ;;
+ *) # Relative path.
+ ac_sub_cache_file="$ac_dots$cache_file" ;;
+ esac
+
+ echo "running ${CONFIG_SHELL-/bin/sh} $ac_sub_configure $ac_sub_configure_args --cache-file=$ac_sub_cache_file --srcdir=$ac_sub_srcdir"
+ # The eval makes quoting arguments work.
+ if eval ${CONFIG_SHELL-/bin/sh} $ac_sub_configure $ac_sub_configure_args --cache-file=$ac_sub_cache_file --srcdir=$ac_sub_srcdir
+ then :
+ else
+ { echo "configure: error: $ac_sub_configure failed for $ac_config_dir" 1>&2; exit 1; }
+ fi
+ fi
+
+ cd $ac_popdir
+ done
+fi
+
diff --git a/contrib/bluegnu2.0.3/example/configure.in b/contrib/bluegnu2.0.3/example/configure.in
new file mode 100644
index 0000000..36f3f46
--- /dev/null
+++ b/contrib/bluegnu2.0.3/example/configure.in
@@ -0,0 +1,8 @@
+dnl Process this file with autoconf to produce a configure script.
+AC_INIT(Makefile.in)
+CC=${CC-cc}
+
+AC_CONFIG_SUBDIRS(calc)
+
+AC_SUBST(CC)
+AC_OUTPUT(Makefile)
diff --git a/contrib/bluegnu2.0.3/lib/BlueGnu_target.itcl b/contrib/bluegnu2.0.3/lib/BlueGnu_target.itcl
new file mode 100644
index 0000000..e1a9363
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/BlueGnu_target.itcl
@@ -0,0 +1,105 @@
+#
+# This script create a BlueGnu Target object
+#
+
+verbose "BlueGnu Target Information ****" 3
+
+proc BlueGnu {args} {
+ global nspTestSuite auto_path env
+ global testCases
+
+ verbose "@@@@@@@@@@@ BlueGnu Target Initialization Procedure @@@@@@@@@@@"
+ verbose " auto_path:\n >$auto_path<" 5
+ #
+ # Create the BlueGnu Target Object, which need to be returned.
+ #
+ namespace eval $nspTestSuite {
+ set args [uplevel 1 set args]
+ verbose "Arguments: $args (are not used)" 3
+ verbose "======= BlueGnu Procedure creates Target Object" 3
+
+
+ # Check argument and remove the local argument from the list
+ # All argument that do not contain a equal sign are also removed
+ set i 0
+ catch {unset rmList}
+ foreach arg $args {
+ if {!$i} {
+ if {[llength [split $arg "="]] == 1} {
+ uplevel set eInterface $arg
+ lappend rmList $i
+ }
+ }
+ if {[string compare [lindex [split $arg "="] 0] \
+ "testCases"] == 0} {
+ uplevel set testCases [lindex [split $arg "="] 1]
+ lappend rmList $i
+ }
+ incr i
+ }
+ if {[info exists rmList]} {
+ #puts "rmList >$rmList<"
+ for {set i [expr [llength $rmList] - 1]} {$i >= 0} {incr i -1} {
+ set args [lreplace $args $i $i]
+ }
+ }
+ verbose "Arguments (passed): $args" 5
+
+ verbose "Arguments (used): $args" 3
+ set target [eval [concat createTarget $args]]
+ if {! [string match ::* $target]} {
+ set target [namespace current]::$target
+ }
+ debug {Target name >$target<} 3
+
+ # Save all Environment Variables so they may be cleared!
+ #
+ [$target environment] saveEnv
+ }
+
+ # Return the name of the Target Object that has been created
+ # This should be the last statement
+ return [namespace eval $nspTestSuite {set target}]
+}
+
+proc BlueGnu_start {} {
+ verbose "@@@@@@@@@@@ Starting BlueGnu Environment @@@@@@@@@@@"
+}
+
+proc BlueGnu_load {} {
+ verbose "@@@@@@@@@@@ Load BlueGnu Environment @@@@@@@@@@@"
+}
+
+proc BlueGnu_exit {} {
+ verbose "@@@@@@@@@@@ Exit BlueGnu Environment @@@@@@@@@@@"
+}
+
+proc BlueGnu_version {} {
+ verbose "@@@@@@@@@@@ Version BlueGnu Environment @@@@@@@@@@@"
+}
+
+proc BlueGnu_overwrite {szNamespace} {
+ # Modify output procedures to return instead of doing output
+ #
+ uplevel #0 {
+ rename send_user send_user_saved
+ rename send_error send_error_saved
+ rename send_log send_log_saved
+ }
+ proc ::send_user args "set ${szNamespace}::sending(USER) 1"
+ proc ::send_error args "set ${szNamespace}::sending(ERROR) 1"
+ proc ::send_log args "set ${szNamespace}::sending(LOG) 1"
+}
+
+proc BlueGnu_restore {} {
+ # Restore original procedures
+ #
+ uplevel #0 {
+ rename send_user ""
+ rename send_error ""
+ rename send_log ""
+ rename send_user_saved send_user
+ rename send_error_saved send_error
+ rename send_log_saved send_log
+ }
+}
diff --git a/contrib/bluegnu2.0.3/lib/Default_target.itcl b/contrib/bluegnu2.0.3/lib/Default_target.itcl
new file mode 100644
index 0000000..f66b20a
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/Default_target.itcl
@@ -0,0 +1,82 @@
+#
+# This script create a Default Target object
+#
+
+verbose "Default Target Information ****" 3
+
+proc Default {args} {
+ global nspTestSuite auto_path env
+ global testCases
+
+ verbose "@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@"
+ verbose "@@@@@@@ Default Target Initialization Procedure"
+ verbose {@@@@@@@ auto_path:\n [join [split $auto_path] \
+ "\n "]} 4
+ #
+ # Create the Default Target Object, which need to be returned.
+ #
+ namespace eval $nspTestSuite {
+ set args [uplevel 1 set args]
+ verbose "Arguments: $args (are not used)" 3
+ verbose "======= Default Procedure creates Target Object" 3
+
+
+ # Check argument and remove the local argument from the list
+ # All argument that do not contain a equal sign are also removed
+ set i 0
+ catch {unset rmList}
+ foreach arg $args {
+ if {!$i} {
+ if {[llength [split $arg "="]] == 1} {
+ uplevel set eInterface $arg
+ lappend rmList $i
+ }
+ }
+ if {[string compare [lindex [split $arg "="] 0] \
+ "testCases"] == 0} {
+ uplevel set testCases [lindex [split $arg "="] 1]
+ lappend rmList $i
+ }
+ incr i
+ }
+ if {[info exists rmList]} {
+ #puts "rmList >$rmList<"
+ for {set i [expr [llength $rmList] - 1]} {$i >= 0} {incr i -1} {
+ set args [lreplace $args $i $i]
+ }
+ }
+ verbose "Arguments (passed): $args" 5
+
+ verbose "Arguments (used): $args" 3
+ set target [eval [concat createTarget $args]]
+ if {! [string match ::* $target]} {
+ set target [namespace current]::$target
+ }
+ debug {Target name >$target<} 3
+
+ # Save all Environment Variables so they may be cleared!
+ #
+ [$target environment] saveEnv
+ }
+
+ # Return the name of the Target Object that has been created
+ # This should be the last statement
+ return [namespace eval $nspTestSuite {set target}]
+}
+
+proc Default_start {} {
+ verbose "@@@@@@@ Starting Default Environment"
+}
+
+proc Default_load {} {
+ verbose "@@@@@@@ Load Default Environment"
+}
+
+proc Default_exit {} {
+ verbose "@@@@@@@ Exit Default Environment"
+ verbose "@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@@"
+}
+
+proc Default_version {} {
+ verbose "@@@@@@@ Version Default Environment"
+}
diff --git a/contrib/bluegnu2.0.3/lib/Types.itcl b/contrib/bluegnu2.0.3/lib/Types.itcl
new file mode 100644
index 0000000..e2ef2b4
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/Types.itcl
@@ -0,0 +1,216 @@
+# -*-Tcl-*-
+#
+# This [incr Tcl] library script contains type definitions
+#
+#
+# Type super class
+#
+
+if {[string length [info commands debug]] == 0} {
+ proc debug {args} {}
+}
+
+class Type {
+ variable _value
+ variable _valueSaved
+ variable _voidPtr
+ variable _bVoid
+ protected variable _currentNamespace
+ protected variable _lProc
+ protected variable _upLevel
+
+ constructor args {
+ debug {======= Constructor: [info class] $this $args} 3
+ # Go up in the inheritance tree
+ debug { Go up inheritance tree} 4
+ set level 1
+ if {[string compare [info class] ::Type] != 0} {
+ debug { level set to >1<} 5
+ while {[string compare [info class] \
+ [uplevel $level {namespace current}]] != 0} {
+ debug {>[info class]< != >[uplevel $level\
+ {namespace current}]<} 5
+ incr level
+ debug { level incrmented to >$level<} 5
+ }
+ debug {>[info class]< == >[uplevel $level\
+ {namespace current}]<} 5
+ incr level
+ regsub {^::} [uplevel $level {namespace current}] "" currentNamespace
+ } else {
+ regsub {^::} [uplevel {namespace current}] "" currentNamespace
+ }
+ set upLevel [expr [info level] - $level]
+ set lProc [info level $upLevel]
+ debug { Called from level: >$upLevel<} 4
+ debug { Called from : >$lProc<} 4
+ debug { Current namespace: >$currentNamespace<} 4
+ #catch {puts " [uplevel "info body [lindex $lProc 0]"]"}
+ set _bVoid 0
+ set _voidPtr 0
+ if {[llength $args] > 0} {
+ set _value [lindex $args 0]
+ } else {
+ set _value ""
+ }
+ if {$upLevel == 0} {
+ debug {Called from global} 4
+ set $this $_value
+ debug {this variable: [set $this]} 4
+ trace variable $this rwu traceType
+ } elseif {[string length $currentNamespace] && \
+ [string length $lProc]} {
+ debug {Called from procedure in namespace} 4
+ debug { this: >$this<} 4
+ debug {set $this >$_value<}
+ catch {
+ uplevel #$upLevel set [namespace tail $this] \"$_value\"
+ uplevel #$upLevel trace variable [namespace tail $this] \
+ rwu traceType
+ } szErrMsg; debug { szErrMsg: >$szErrMsg<} 4
+ } elseif {[string length $currentNamespace]} {
+ debug {Called from namespace} 4
+ debug {set $this >$_value<}
+ catch {
+ namespace eval ${currentNamespace} "set $this \"$_value\"\n\
+ trace variable $this rwu traceType"
+ } szErrMsg
+ debug { TRACE set} 4
+ debug { szErrMsg: >$szErrMsg<} 4
+ } else {
+ debug {Called from procedure} 4
+ set var [namespace tail $this]
+ uplevel "set $var $_value"
+ debug {this variable: [uplevel "set $var"]} 4
+ uplevel "trace variable $var rwu traceType"
+ }
+ }
+
+ destructor {
+ debug {======= destructor $this} 3
+ set calledFrom [lindex [split [info level [expr [info level] - 1]]] 0]
+ debug { calledFrom: >$calledFrom<} 4
+ debug { >[info level [expr [info level] - 1]]<} 4
+ # just return when called from traceType
+ if {[string compare $calledFrom "traceType"] != 0} {
+ set var [namespace tail $this]
+ debug { var: >$var<} 4
+ debug { >[join [trace vinfo $var]]<} 4
+ debug { >[uplevel [join [trace vinfo $var]]]<} 4
+ debug { >[join [uplevel "trace vinfo $var"]]<} 4
+ catch {
+ debug {eval uplevel \"trace vdelete $var [join [uplevel "trace vinfo $var"]]\"} 4
+ eval uplevel "trace vdelete $var [join [uplevel "trace vinfo $var"]]"
+ uplevel unset $var
+ } szErrMsg; debug { #### szErrMsg: >$szErrMsg<} 4
+ }
+ }
+
+ public method value {args} {
+ if {[llength $args] > 0} {
+ set _value [lindex $args 0]
+ }
+ return $_value
+ }
+
+ public method setNull {{ptr 0}} {
+ set _voidPtr $ptr
+ set _bVoid 1
+ }
+
+ public method unsetNull {} {
+ set _bVoid 0
+ }
+
+ public method isNull {} {
+ return $_bVoid
+ }
+
+ public method getNull {} {
+ return $_voidPtr
+ }
+}
+
+proc traceType {name1 name2 ops} {
+ debug {======= traceType >$name1< >$name2< >$ops<} 3
+ upvar $name1 var
+ set upLevel [expr [info level] - 1]
+ set lProc [info level $upLevel]
+ regsub {^::} [uplevel {namespace current}] "" currentNamespace
+ debug { Called from level: >$upLevel<} 4
+ debug { level namespace : >[uplevel #$upLevel namespace current]<} 4
+ debug { Called from : >$lProc<} 4
+ debug { Current namespace: >$currentNamespace<} 4
+ if {$upLevel == 0} {
+ debug {Called from global} 4
+ switch $ops {
+ r {
+ set var [uplevel $name1 value]
+ }
+ w {
+ if [catch {$name1 value [set var]}] {
+ uplevel "$name1 value [set var]"
+ }
+ }
+ u {
+ uplevel delete object $name1
+ }
+ }
+ } elseif {[string length $currentNamespace] && \
+ [string length $lProc]} {
+ debug {Called from procedure in namespace} 4
+ set var [uplevel ::itcl::find objects $name1]
+ debug { $name1 ->$var< = ><} 4
+ switch $ops {
+ r {
+ uplevel set $name1 [uplevel $var value]
+ }
+ w {
+ if [catch {uplevel $var value [uplevel set $name1]} szErrMsg] {
+ debug {####### Error: $szErrMsg} 4
+
+ }
+ }
+ u {
+ uplevel delete object $name1
+ }
+ }
+ } elseif {[string length $currentNamespace]} {
+ debug {Called from namespace} 4
+ set var [uplevel "namespace which -variable $name1"]
+ debug { $name1 ->$var< = ><} 4
+ switch $ops {
+ r {
+ set $var [$var value]
+ }
+ w {
+ if [catch {$var value [set $var]} szErrMsg] {
+ debug {####### Error: $szErrMsg} 4
+
+ }
+ }
+ u {
+ debug {Deleting >$name1<} 4
+ debug { [namespace current]} 4
+ catch {delete object $name1}
+ debug { DONE!} 4
+ }
+ }
+ } else {
+ debug {Called from procedure} 4
+ switch $ops {
+ r {
+ set $name1 [$name1 value]
+ }
+ w {
+ if [catch {$name1 value [uplevel set $name1]}] {
+ uplevel "$name1 value [set $name1]"
+ }
+ }
+ u {
+ delete object $name1
+ }
+ }
+ }
+}
+
diff --git a/contrib/bluegnu2.0.3/lib/bluegnu.itcl b/contrib/bluegnu2.0.3/lib/bluegnu.itcl
new file mode 100644
index 0000000..da02c8b
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/bluegnu.itcl
@@ -0,0 +1,22 @@
+#! iexpect
+#
+# This program is an Object Oriented version of the
+# DejaGnu's runtest program and DejaGnu is a subset.
+#
+# BlueGnu implements a super set of a DejaGnu compatible test Framework
+#
+# Copyright (C) 1998 jotOmega dsc, Inc.
+
+#This file is part of the BlueGnu Test Framework.
+#
+# Load Application Framework Class and associated data
+#
+source $env(BLUEGNULIB)/testSessionApplication.itcl
+
+append auto_path " [pwd]/lib"
+
+set objApplication [::BlueGnu::Application #auto szName=BlueGnu]
+
+$objApplication processArguments argv
+
+$objApplication execute
diff --git a/contrib/bluegnu2.0.3/lib/bug.exp b/contrib/bluegnu2.0.3/lib/bug.exp
new file mode 100644
index 0000000..5d52182
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/bug.exp
@@ -0,0 +1,125 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#load_lib remote.exp
+
+#
+# set target variables only if needed.
+#
+global targetname
+global connectmode
+global env
+
+if ![info exists targetname] {
+ if [info exists env(TARGETNAME)] {
+ set targetname $env(TARGETNAME)
+ } else {
+ puts stderr "ERROR: Need a target name for the board."
+ puts stderr " Use the --name option\n"
+ exit 1
+ }
+}
+
+# the default connect program to use
+if ![info exists connectmode] {
+ set connectmode "tip"
+ warning "Using default of $connectmode for target communication."
+}
+
+#
+# Load a file into the bug monitor
+#
+proc bug_load { shell_id file } {
+ global OBJCOPY
+ global shell_prompt
+
+ if { $shell_id < 0 } {
+ warning "$file not executed because there is no target."
+ return -1
+ }
+
+ # NOTE: this requires OBJCOPY to be tested first
+ catch "exec $OBJCOPY -O srec $file $file.srec" result
+ if ![string match "" $result] {
+ perror "Couldn't convert to srecord for downloading"
+ return -1
+ }
+
+ send -i $shell_id "lo 0\r"
+ expect {
+ -i $shell_id "lo 0*" {
+ verbose "Got load command echo" 0
+ }
+ -i $shell_id timeout {
+ perror "Load command didn't echo back"
+ return -1
+ }
+ }
+
+ if { [download $file.srec $shell_id] < 0 } {
+ return -1
+ }
+
+ send -i $shell_id "\r\r"
+ expect {
+ -i $shell_id -re "$shell_prompt.*$" {
+ }
+ -i $shell_id timeout {
+ perror "Load command didn't echo back"
+ return -1
+ }
+ }
+
+ catch "exec rm -f $file.srec"
+ return 0
+}
+
+#
+# Execute a program
+#
+proc bug_execute { shell_id addr } {
+ global shell_prompt
+ global exec_output
+
+ set exec_output ""
+
+ if { $shell_id < 0 } {
+ warning "$arg not executed because there is no target."
+ return -1
+ }
+ send -i $shell_id "go $addr\r"
+ verbose "Sent execute command"
+ expect {
+ -i $shell_id "*Effective address: $addr" {
+ exp_continue
+ }
+ -i $shell_id -re "$shell_prompt.*$" {
+ set exec_output $expect_out(buffer)
+ return 0
+ }
+ -i $shell_id timeout {
+ perror "Couldn't execute program (timed out)."
+ return 1
+ }
+ }
+
+}
+
diff --git a/contrib/bluegnu2.0.3/lib/debugger.exp b/contrib/bluegnu2.0.3/lib/debugger.exp
new file mode 100644
index 0000000..8dd0701
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/debugger.exp
@@ -0,0 +1,252 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#
+# Dump the values of a shell expression representing variable
+# names.
+proc dumpvars { args } {
+ uplevel 1 [list foreach i [uplevel 1 "info vars $args"] {
+ if { [catch "array names $i" names ] } {
+ eval "puts \"${i} = \$${i}\""
+ } else {
+ foreach k $names {
+ eval "puts \"$i\($k\) = \$$i\($k\)\""
+ }
+ }
+ }
+ ]
+}
+
+#
+# dump the values of a shell expression representing variable
+# names.
+proc dumplocals { args } {
+ uplevel 1 [list foreach i [uplevel 1 "info locals $args"] {
+ if { [catch "array names $i" names ] } {
+ eval "puts \"${i} = \$${i}\""
+ } else {
+ foreach k $names {
+ eval "puts \"$i\($k\) = \$$i\($k\)\""
+ }
+ }
+ }
+ ]
+}
+#
+# Dump the body of procedures specified by a regexp.
+#
+proc dumprocs { args } {
+ foreach i [info procs $args] {
+ puts "\nproc $i \{ [info args $i] \} \{ [info body $i]\}"
+ }
+}
+
+#
+# Dump all the current watchpoints
+#
+proc dumpwatch { args } {
+ foreach i [uplevel 1 "info vars $args"] {
+ set tmp ""
+ if { [catch "uplevel 1 array name $i" names] } {
+ set tmp [uplevel 1 trace vinfo $i]
+ if ![string match "" $tmp] {
+ puts "$i $tmp"
+ }
+ } else {
+ foreach k $names {
+ set tmp [uplevel 1 trace vinfo [set i]($k)]
+ if ![string match "" $tmp] {
+ puts "[set i]($k) = $tmp"
+ }
+ }
+ }
+ }
+}
+
+#
+# Trap a watchpoint for an array
+#
+proc watcharray { element type} {
+ upvar [set array]($element) avar
+ case $type {
+ "w" { puts "New value of [set array]($element) is $avar" }
+ "r" { puts "[set array]($element) (= $avar) was just read" }
+ "u" { puts "[set array]($element) (= $avar) was just unset" }
+ }
+}
+
+proc watchvar { v type } {
+ upvar $v var
+ case $type {
+ "w" { puts "New value of $v is $var" }
+ "r" { puts "$v (=$var) was just read" }
+ "u" { puts "$v (=$var) was just unset" }
+ }
+}
+
+#
+# Watch when a variable is written
+#
+proc watchunset { arg } {
+ if { [catch "uplevel 1 array name $arg" names ] } {
+ if ![uplevel 1 info exists $arg] {
+ puts stderr "$arg does not exist"
+ return
+ }
+ uplevel 1 trace variable $arg u watchvar
+ } else {
+ foreach k $names {
+ if ![uplevel 1 info exists $arg] {
+ puts stderr "$arg does not exist"
+ return
+ }
+ uplevel 1 trace variable [set arg]($k) u watcharray
+ }
+ }
+}
+
+#
+# Watch when a variable is written
+#
+proc watchwrite { arg } {
+ if { [catch "uplevel 1 array name $arg" names ] } {
+ if ![uplevel 1 info exists $arg] {
+ puts stderr "$arg does not exist"
+ return
+ }
+ uplevel 1 trace variable $arg w watchvar
+ } else {
+ foreach k $names {
+ if ![uplevel 1 info exists $arg] {
+ puts stderr "$arg does not exist"
+ return
+ }
+ uplevel 1 trace variable [set arg]($k) w watcharray
+ }
+ }
+}
+
+#
+# Watch when a variable is read
+#
+proc watchread { arg } {
+ if { [catch "uplevel 1 array name $arg" names ] } {
+ if ![uplevel 1 info exists $arg] {
+ puts stderr "$arg does not exist"
+ return
+ }
+ uplevel 1 trace variable $arg r watchvar
+ } else {
+ foreach k $names {
+ if ![uplevel 1 info exists $arg] {
+ puts stderr "$arg does not exist"
+ return
+ }
+ uplevel 1 trace variable [set arg]($k) r watcharray
+ }
+ }
+}
+
+#
+# Delete a watch point
+#
+proc watchdel { args } {
+ foreach i [uplevel 1 "info vars $args"] {
+ set tmp ""
+ if { [catch "uplevel 1 array name $i" names] } {
+ catch "uplevel 1 trace vdelete $i w watchvar"
+ catch "uplevel 1 trace vdelete $i r watchvar"
+ catch "uplevel 1 trace vdelete $i u watchvar"
+ } else {
+ foreach k $names {
+ catch "uplevel 1 trace vdelete [set i]($k) w watcharray"
+ catch "uplevel 1 trace vdelete [set i]($k) r watcharray"
+ catch "uplevel 1 trace vdelete [set i]($k) u watcharray"
+ }
+ }
+ }
+}
+
+#
+# This file creates GDB style commands for the Tcl debugger
+#
+proc print { var } {
+ puts "$var"
+}
+
+proc quit { } {
+ log_summary
+ exit
+}
+
+proc bt { } {
+ puts "[w]"
+}
+
+#
+# create some stub procedures since we can't alias the command names
+#
+proc dp { args } {
+ uplevel 1 dumprocs $args
+}
+
+proc dv { args } {
+ uplevel 1 dumpvars $args
+}
+
+proc dl { args } {
+ uplevel 1 dumplocals $args
+}
+
+proc dw { args } {
+ uplevel 1 dumpwatch $args
+}
+
+proc q { } {
+ quit
+}
+
+proc p { args } {
+ uplevel 1 print $args
+}
+
+proc wu { args } {
+ uplevel 1 watchunset $args
+}
+
+proc ww { args } {
+ uplevel 1 watchwrite $args
+}
+
+proc wr { args } {
+ uplevel 1 watchread $args
+}
+
+proc wd { args } {
+ uplevel 1 watchdel $args
+}
+
+
+
+
+
+
+
diff --git a/contrib/bluegnu2.0.3/lib/dejagnu.itcl b/contrib/bluegnu2.0.3/lib/dejagnu.itcl
new file mode 100644
index 0000000..35957cc
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/dejagnu.itcl
@@ -0,0 +1,81 @@
+#! iexpect
+#
+# This program is a full compatible Object Oriented version of
+# DejaGnu's runtest program
+#
+# Copyright (C) 1998 jotOmega dsc, Inc.
+
+#This file is part of BlueGnu.
+
+################################################################
+# Preemble
+################################################################
+# Check Environment variables:
+#
+# BLUEGNULIBS
+# TESTSUITEROOT
+#
+
+if [info exists env(BLUEGNULIBS)] {
+ set szToolsLib $env(BLUEGNULIBS)
+} else {
+ set szToolsLib [file dirname $argv0]
+ set PWD [pwd]
+ cd $szToolsLib
+ set szToolsLib [pwd]
+ cd $PWD
+ regsub {/bin$} $szToolsLib {/lib/bluegnu} szToolsLib
+ set env(BLUEGNULIBS) $szToolsLib
+}
+
+if [info exists env(TESTSUITEROOT)] {
+ set szRootDir $env(TESTSUITEROOT)
+} else {
+ set szRootDir [pwd]
+ set env(TESTSUITEROOT) $szRootDir
+}
+if [info exists env(DEBUG)] {
+ set bDebug 1
+} else {
+ set bDebug 0
+}
+
+# Make sure that the testsuite root directory is our working directory
+# all tests name are relative to this directory
+cd $szRootDir
+
+# set the default tool. All test are relative to this directory.
+#
+set szTool $szRootDir
+catch {unset lTool}
+lappend lTool $szTool
+
+#
+# source basic utilities
+#
+source $szToolsLib/testSessionClasses.itcl
+source $szToolsLib/testSessionFramework.itcl
+#source $szToolsLib/testSessionUtils.itcl
+#
+verbose "Library : >$szToolsLib<"
+verbose "TestSuite: >$szRootDir<"
+verbose "$argv0 $argv" 5
+#
+# from here we should use only defined utilities
+################################################################
+################################################################
+
+set szRootName [file rootname $argv0]
+puts "RootName : >$szRootName<"
+
+::TestSession::Queue Q0
+::TestSession::DejaGnu E0; # will load dejagnu.tcl
+
+while {! [catch {Q0 pop} T]} {
+ clone_output "Q0 element: $T"
+ runtest E0 $T
+}
+
+delete object Q0
+delete object E0
+
diff --git a/contrib/bluegnu2.0.3/lib/dejagnu.tcl b/contrib/bluegnu2.0.3/lib/dejagnu.tcl
new file mode 100644
index 0000000..f5b48bd
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/dejagnu.tcl
@@ -0,0 +1,1130 @@
+#
+# Procedures that are used within DejaGnu
+#
+puts "DejaGnu=======1.3"
+
+set frame_version 1.3
+if ![info exists argv0] {
+ send_error "Must use a version of Expect greater than 5.0\n"
+ exit 1
+}
+
+#
+# trap some signals so we know whats happening. These definitions are only
+# temporary until we read in the library stuff
+#
+trap { send_user "\nterminated\n"; exit 1 } SIGTERM
+trap { send_user "\ninterrupted by user\n"; exit 1 } SIGINT
+trap { send_user "\nsegmentation violation\n"; exit 1 } SIGSEGV
+trap { send_user "\nsigquit\n"; exit 1 } SIGQUIT
+
+
+#
+# Initialize a few global variables used by all tests.
+# `reset_vars' resets several of these, we define them here to document their
+# existence. In fact, it would be nice if all globals used by some interface
+# of dejagnu proper were documented here.
+#
+# Keep these all lowercase. Interface variables used by the various
+# testsuites (eg: the gcc testsuite) should be in all capitals
+# (eg: TORTURE_OPTIONS).
+#
+set mail_logs 0 ;# flag for mailing of summary and diff logs
+set psum_file "latest" ;# file name of previous summary to diff against
+set testcnt 0 ;# number of testcases that ran
+set passcnt 0 ;# number of testcases that passed
+set failcnt 0 ;# number of testcases that failed
+set xfailcnt 0 ;# number of testcases expected to fail which did
+set xpasscnt 0 ;# number of testcases that passed unexpectedly
+set warncnt 0 ;# number of warnings
+set errcnt 0 ;# number of errors
+set unsupportedcnt 0 ;# number of testcases that can't run
+set unresolvedcnt 0 ;# number of testcases whose result is unknown
+set untestedcnt 0 ;# number of untested testcases
+set exit_status 0 ;# exit code returned by this program
+set xfail_flag 0
+set xfail_prms 0
+set sum_file "" ;# name of the file that contains the summary log
+set base_dir "" ;# the current working directory
+set logname "" ;# the users login name
+set passwd ""
+set prms_id 0 ;# GNATS prms id number
+set bug_id 0 ;# optional bug id number
+set dir "" ;# temp variable for directory names
+set srcdir "." ;# source directory containing the test suite
+set ignoretests "" ;# list of tests to not execute
+set objdir "." ;# directory where test case binaries live
+set makevars "" ;# FIXME: Is this used anywhere?
+set reboot 0
+set configfile site.exp ;# (local to this file)
+set multipass "" ;# list of passes and var settings
+set target_abbrev "unix" ;# environment (unix, sim, vx, etc.).
+set errno ""; ;#
+#
+# set communication parameters here
+#
+set netport ""
+set targetname ""
+set connectmode ""
+set serialport ""
+set baud ""
+#
+# These describe the host and target environments.
+#
+set build_triplet "" ;# type of architecture to run tests on
+set build_os "" ;# type of os the tests are running on
+set build_vendor "" ;# vendor name of the OS or workstation the test are running on
+set build_cpu "" ;# type of the cpu tests are running on
+set host_triplet "" ;# type of architecture to run tests on, sometimes remotely
+set host_os "" ;# type of os the tests are running on
+set host_vendor "" ;# vendor name of the OS or workstation the test are running on
+set host_cpu "" ;# type of the cpu tests are running on
+set target_triplet "" ;# type of architecture to run tests on, final remote
+set target_os "" ;# type of os the tests are running on
+set target_vendor "" ;# vendor name of the OS or workstation the test are running on
+set target_cpu "" ;# type of the cpu tests are running on
+set target_alias "" ;# standard abbreviation of target
+
+#
+# some convenience abbreviations
+#
+if ![info exists hex] {
+ set hex "0x\[0-9A-Fa-f\]+"
+}
+if ![info exists decimal] {
+ set decimal "\[0-9\]+"
+}
+
+#
+# set the base dir (current working directory)
+#
+set base_dir [pwd]
+
+#
+# These are tested in case they are not initialized in $configfile. They are
+# tested here instead of the init module so they can be overridden by command
+# line options.
+#
+if ![info exists all_flag] {
+ set all_flag 0
+}
+if ![info exists binpath] {
+ set binpath ""
+}
+if ![info exists debug] {
+ set debug 0
+}
+if 0 {
+ if ![info exists options] {
+ set options ""
+ }
+}
+if ![info exists outdir] {
+ set outdir "."
+}
+if ![info exists reboot] {
+ set reboot 1
+}
+if ![info exists all_runtests] {
+ # FIXME: Can we create an empty array?
+ # we don't have to (JWN 20 March 1998)
+ #set all_runtests(empty) ""
+}
+if ![info exists tracelevel] {
+ set tracelevel 0
+}
+if ![info exists verbose] {
+ set verbose 0
+}
+
+#
+# verbose [-n] [-log] [--] message [level]
+#
+# Print MESSAGE if the verbose level is >= LEVEL.
+# The default value of LEVEL is 1.
+# "-n" says to not print a trailing newline.
+# "-log" says to add the text to the log file even if it won't be printed.
+# Note that the apparent behaviour of `send_user' dictates that if the message
+# is printed it is also added to the log file.
+# Use "--" if MESSAGE begins with "-".
+#
+# This is defined here rather than in framework.exp so we can use it
+# while still loading in the support files.
+#
+proc verbose { args } {
+ global verbose
+ set newline 1
+ set logfile 0
+
+ set i 0
+ if { [string index [lindex $args 0] 0] == "-" } {
+ for { set i 0 } { $i < [llength $args] } { incr i } {
+ if { [lindex $args $i] == "--" } {
+ incr i
+ break
+ } elseif { [lindex $args $i] == "-n" } {
+ set newline 0
+ } elseif { [lindex $args $i] == "-log" } {
+ set logfile 1
+ } elseif { [string index [lindex $args $i] 0] == "-" } {
+ clone_output "ERROR: verbose: illegal argument: [lindex $args $i]"
+ return
+ } else {
+ break
+ }
+ }
+ if { [llength $args] == $i } {
+ clone_output "ERROR: verbose: nothing to print"
+ return
+ }
+ }
+
+ set level 1
+ if { [llength $args] > $i + 1 } {
+ set level [lindex $args [expr $i+1]]
+ }
+ set message [lindex $args $i]
+
+ if { $verbose >= $level } {
+ # There is no need for the "--" argument here, but play it safe.
+ # We assume send_user also sends the text to the log file (which
+ # appears to be the case though the docs aren't clear on this).
+ if { $newline } {
+ send_user -- "$message\n"
+ } else {
+ send_user -- "$message"
+ }
+ } elseif { $logfile } {
+ if { $newline } {
+ send_log "$message\n"
+ } else {
+ send_log "$message"
+ }
+ }
+}
+
+#
+# Transform a tool name to get the installed name.
+# target_triplet is the canonical target name. target_alias is the
+# target name used when configure was run.
+#
+proc transform { name } {
+ global target_triplet
+ global target_alias
+ global host_triplet
+
+ if [string match $target_triplet $host_triplet] {
+ return $name
+ }
+ if [string match "native" $target_triplet] {
+ return $name
+ }
+ if [string match "" $target_triplet] {
+ return $name
+ } else {
+ set tmp ${target_alias}-${name}
+ verbose "Transforming $name to $tmp"
+ return $tmp
+ }
+}
+
+#
+# findfile arg0 [arg1] [arg2]
+#
+# Find a file and see if it exists. If you only care about the false
+# condition, then you'll need to pass a null "" for arg1.
+# arg0 is the filename to look for. If the only arg,
+# then that's what gets returned. If this is the
+# only arg, then if it exists, arg0 gets returned.
+# if it doesn't exist, return only the prog name.
+# arg1 is optional, and it's what gets returned if
+# the file exists.
+# arg2 is optional, and it's what gets returned if
+# the file doesn't exist.
+#
+proc findfile { args } {
+ # look for the file
+ verbose "Seeing if [lindex $args 0] exists." 2
+ if [file exists [lindex $args 0]] {
+ if { [llength $args] > 1 } {
+ verbose "Found file, returning [lindex $args 1]"
+ return [lindex $args 1]
+ } else {
+ verbose "Found file, returning [lindex $args 0]"
+ return [lindex $args 0]
+ }
+ } else {
+ if { [llength $args] > 2 } {
+ verbose "Didn't find file, returning [lindex $args 2]"
+ return [lindex $args 2]
+ } else {
+ verbose "Didn't find file, returning [file tail [lindex $args 0]]"
+ return [transform [file tail [lindex $args 0]]]
+ }
+ }
+}
+
+#
+# load_file [-1] [--] file1 [ file2 ... ]
+#
+# Utility to source a file. All are sourced in order unless the flag "-1"
+# is given in which case we stop after finding the first one.
+# The result is 1 if a file was found, 0 if not.
+# If a tcl error occurs while sourcing a file, we print an error message
+# and exit.
+#
+# ??? Perhaps add an optional argument of some descriptive text to add to
+# verbose and error messages (eg: -t "library file" ?).
+#
+proc load_file { args } {
+ set i 0
+ set only_one 0
+ if { [lindex $args $i] == "-1" } {
+ set only_one 1
+ incr i
+ }
+ if { [lindex $args $i] == "--" } {
+ incr i
+ }
+
+ set found 0
+ foreach file [lrange $args $i end] {
+ verbose "Looking for $file" 2
+ if [file exists $file] {
+ set found 1
+ verbose "Found $file"
+ if { [catch "uplevel #0 source $file"] == 1 } {
+ send_error "ERROR: tcl error sourcing $file.\n"
+ global errorInfo
+ if [info exists errorInfo] {
+ send_error "$errorInfo\n"
+ }
+ exit 1
+ }
+ if $only_one {
+ break
+ }
+ }
+ }
+ return $found
+}
+
+#
+# Parse the arguments the first time looking for these. We will ultimately
+# parse them twice. Things are complicated because:
+# - we want to parse --verbose early on
+# - we don't want config files to override command line arguments
+# (eg: $base_dir/$configfile vs --host/--target; $DEJAGNU vs --baud,
+# --connectmode, and --name)
+# - we need some command line arguments before we can process some config files
+# (eg: --objdir before $objdir/$configfile, --host/--target before $DEJAGNU)
+# The use of `arg_host_triplet' and `arg_target_triplet' lets us avoid parsing
+# the arguments three times.
+#
+
+set arg_host_triplet ""
+set arg_target_triplet ""
+set arg_build_triplet ""
+set argc [ llength $argv ]
+for { set i 0 } { $i < $argc } { incr i } {
+ set option [lindex $argv $i]
+
+ # make all options have two hyphens
+ switch -glob -- $option {
+ "--*" {
+ }
+ "-*" {
+ set option "-$option"
+ }
+ }
+
+ # split out the argument for options that take them
+ switch -glob -- $option {
+ "--*=*" {
+ set optarg [lindex [split $option =] 1]
+ }
+ "--ba*" -
+ "--bu*" -
+ "--co*" -
+ "--ho*" -
+ "--i*" -
+ "--m*" -
+ "--n*" -
+ "--ob*" -
+ "--ou*" -
+ "--sr*" -
+ "--st*" -
+ "--ta*" -
+ "--to*" {
+ incr i
+ set optarg [lindex $argv $i]
+ }
+ }
+
+ switch -glob -- $option {
+ "--bu*" { # (--build) the build host configuration
+ set arg_build_triplet $optarg
+ continue
+ }
+
+ "--ho*" { # (--host) the host configuration
+ set arg_host_triplet $optarg
+ continue
+ }
+
+ "--ob*" { # (--objdir) where the test case object code lives
+ set objdir $optarg
+ continue
+ }
+
+ "--sr*" { # (--srcdir) where the testsuite source code lives
+ set srcdir $optarg
+ continue
+ }
+
+ "--ta*" { # (--target) the target configuration
+ set arg_target_triplet $optarg
+ continue
+ }
+
+ "--to*" { # (--tool) specify tool name
+ set tool $optarg
+ continue
+ }
+
+ "--v" -
+ "--verb*" { # (--verbose) verbose output
+ incr verbose
+ continue
+ }
+ }
+}
+verbose "Verbose level is $verbose"
+
+#
+# get the users login name
+#
+if [string match "" $logname] {
+ if [info exists env(USER)] {
+ set logname $env(USER)
+ } else {
+ if [info exists env(LOGNAME)] {
+ set logname $env(LOGNAME)
+ } else {
+ # try getting it with whoami
+ catch "set logname [exec whoami]" tmp
+ if [string match "*couldn't find*to execute*" $tmp] {
+ # try getting it with who am i
+ unset tmp
+ catch "set logname [exec who am i]" tmp
+ if [string match "*Command not found*" $tmp] {
+ send_user "ERROR: couldn't get the users login name\n"
+ set logname "Unknown"
+ } else {
+ set logname [lindex [split $logname " !"] 1]
+ }
+ }
+ }
+ }
+}
+verbose "Login name is $logname"
+
+#
+# Begin sourcing the config files.
+# All are sourced in order.
+#
+# Search order:
+# $HOME/.dejagnurc -> $base_dir/$configfile -> $objdir/$configfile
+# -> installed -> $DEJAGNU
+#
+# ??? It might be nice to do $HOME last as it would allow it to be the
+# ultimate override. Though at present there is still $DEJAGNU.
+#
+# For the normal case, we rely on $base_dir/$configfile to set
+# host_triplet and target_triplet.
+#
+
+load_file ~/.dejagnurc $base_dir/$configfile
+
+#
+# If objdir didn't get set in $base_dir/$configfile, set it to $base_dir.
+# Make sure we source $objdir/$configfile in case $base_dir/$configfile doesn't
+# exist and objdir was given on the command line.
+#
+
+if [expr [string match "." $objdir] || [string match $srcdir $objdir]] {
+ set objdir $base_dir
+} else {
+ load_file $objdir/$configfile
+}
+verbose "Using test sources in $srcdir"
+verbose "Using test binaries in $objdir"
+
+set execpath [file dirname $argv0]
+set libdir [file dirname $execpath]/bluegnu
+if [info exists env(BLUEGNULIBS)] {
+ set libdir $env(BLUEGNULIBS)
+}
+verbose "Using $libdir to find libraries"
+
+#
+# If the host or target was given on the command line, override the above
+# config files. We allow $DEJAGNU to massage them though in case it would
+# ever want to do such a thing.
+#
+if { $arg_host_triplet != "" } {
+ set host_triplet $arg_host_triplet
+}
+if { $arg_build_triplet != "" } {
+ set build_triplet $arg_build_triplet
+}
+
+# if we only specify --host, then that must be the build machne too, and we're
+# stuck using the old functionality of a simple cross test
+if [expr { $build_triplet == "" && $host_triplet != "" } ] {
+ set build_triplet $host_triplet
+}
+# if we only specify --build, then we'll use that as the host too
+if [expr { $build_triplet != "" && $host_triplet == "" } ] {
+ set host_triplet $build_triplet
+}
+unset arg_host_triplet arg_build_triplet
+
+#
+# If the build machine type hasn't been specified by now, use config.guess.
+#
+
+if [expr { $build_triplet == "" && $host_triplet == ""} ] {
+ # find config.guess
+ foreach dir "$libdir $libdir/.. $srcdir/.. $srcdir/../.." {
+ verbose "Looking for $dir" 2
+ if [file exists $dir/config.guess] {
+ set config_guess $dir/config.guess
+ verbose "Found $dir/config.guess"
+ break
+ }
+ }
+
+ # get the canonical config name
+ if ![info exists config_guess] {
+ send_error "ERROR: Couldn't guess configuration.\n"
+ exit 1
+ }
+ catch "exec $config_guess" build_triplet
+ case $build_triplet in {
+ { "No uname command or uname output not recognized" "Unable to guess system type" } {
+ verbose "WARNING: Uname output not recognized"
+ set build_triplet unknown
+ }
+ }
+ verbose "Assuming build host is $build_triplet"
+ if { $host_triplet == "" } {
+ set host_triplet $build_triplet
+ }
+
+}
+
+#
+# Figure out the target. If the target hasn't been specified, then we have to assume
+# we are native.
+#
+if { $arg_target_triplet != "" } {
+ set target_triplet $arg_target_triplet
+} elseif { $target_triplet == "" } {
+ set target_triplet $build_triplet
+ verbose "Assuming native target is $target_triplet" 2
+}
+unset arg_target_triplet
+#
+# Default target_alias to target_triplet.
+#
+if ![info exists target_alias] {
+ set target_alias $target_triplet
+}
+
+#
+# Find and load the global config file if it exists.
+# The global config file is used to set the connect mode and other
+# parameters specific to each particular target.
+# These files assume the host and target have been set.
+#
+
+if { [load_file -- $libdir/$configfile] == 0 } {
+ # If $DEJAGNU isn't set either then there isn't any global config file.
+ # Warn the user as there really should be one.
+ if { ! [info exists env(DEJAGNU)] } {
+ send_error "WARNING: Couldn't find the global config file.\n"
+ }
+}
+
+if [info exists env(DEJAGNU)] {
+ if { [load_file -- $env(DEJAGNU)] == 0 } {
+ # It may seem odd to only issue a warning if there isn't a global
+ # config file, but issue an error if $DEJAGNU is erroneously defined.
+ # Since $DEJAGNU is set there is *supposed* to be a global config file,
+ # so the current behaviour seems reasonable.
+ send_error "ERROR: global config file $env(DEJAGNU) not found.\n"
+ exit 1
+ }
+}
+
+#
+# parse out the config parts of the triplet name
+#
+
+# build values
+if { $build_cpu == "" } {
+ regsub -- "-.*-.*" ${build_triplet} "" build_cpu
+}
+if { $build_vendor == "" } {
+ regsub -- "^\[a-z0-9\]*-" ${build_triplet} "" build_vendor
+ regsub -- "-.*" ${build_vendor} "" build_vendor
+}
+if { $build_os == "" } {
+ regsub -- ".*-.*-" ${build_triplet} "" build_os
+}
+
+# host values
+if { $host_cpu == "" } {
+ regsub -- "-.*-.*" ${host_triplet} "" host_cpu
+}
+if { $host_vendor == "" } {
+ regsub -- "^\[a-z0-9\]*-" ${host_triplet} "" host_vendor
+ regsub -- "-.*" ${host_vendor} "" host_vendor
+}
+if { $host_os == "" } {
+ regsub -- ".*-.*-" ${host_triplet} "" host_os
+}
+
+# target values
+if { $target_cpu == "" } {
+ regsub -- "-.*-.*" ${target_triplet} "" target_cpu
+}
+if { $target_vendor == "" } {
+ regsub -- "^\[a-z0-9\]*-" ${target_triplet} "" target_vendor
+ regsub -- "-.*" ${target_vendor} "" target_vendor
+}
+if { $target_os == "" } {
+ regsub -- ".*-.*-" ${target_triplet} "" target_os
+}
+
+#
+# Parse the command line arguments.
+#
+
+set argc [ llength $argv ]
+for { set i 0 } { $i < $argc } { incr i } {
+ set option [ lindex $argv $i ]
+
+ # make all options have two hyphens
+ switch -glob -- $option {
+ "--*" {
+ }
+ "-*" {
+ set option "-$option"
+ }
+ }
+
+ # split out the argument for options that take them
+ switch -glob -- $option {
+ "--*=*" {
+ set optarg [lindex [split $option =] 1]
+ }
+ "--ba*" -
+ "--bu*" -
+ "--co*" -
+ "--ho*" -
+ "--i*" -
+ "--m*" -
+ "--n*" -
+ "--ob*" -
+ "--ou*" -
+ "--sr*" -
+ "--st*" -
+
+ "--ta*" -
+ "--to*" {
+ incr i
+ set optarg [lindex $argv $i]
+ }
+ }
+
+ switch -glob -- $option {
+ "--V*" -
+ "--vers*" { # (--version) version numbers
+ send_user "Expect version is\t[exp_version]\n"
+ send_user "Tcl version is\t\t[ info tclversion ]\n"
+ send_user "Framework version is\t$frame_version\n"
+ exit
+ }
+
+ "--v*" { # (--verbose) verbose output
+ # Already parsed.
+ continue
+ }
+
+ "--bu*" { # (--build) the build host configuration
+ # Already parsed (and don't set again). Let $DEJAGNU rename it.
+ continue
+ }
+
+ "--ho*" { # (--host) the host configuration
+ # Already parsed (and don't set again). Let $DEJAGNU rename it.
+ continue
+ }
+
+ "--ta*" { # (--target) the target configuration
+ # Already parsed (and don't set again). Let $DEJAGNU rename it.
+ continue
+ }
+
+ "--a*" { # (--all) print all test output to screen
+ set all_flag 1
+ verbose "Print all test output to screen"
+ continue
+ }
+
+ "--ba*" { # (--baud) the baud to use for a serial line
+ set baud $optarg
+ verbose "The baud rate is now $baud"
+ continue
+ }
+
+ "--co*" { # (--connect) the connection mode to use
+ set connectmode $optarg
+ verbose "Comm method is $connectmode"
+ continue
+ }
+
+ "--d*" { # (--debug) expect internal debugging
+ if [file exists ./dbg.log] {
+ catch "exec rm -f ./dbg.log"
+ }
+ if { $verbose > 2 } {
+ exp_internal -f dbg.log 1
+ } else {
+ exp_internal -f dbg.log 0
+ }
+ verbose "Expect Debugging is ON"
+ continue
+ }
+
+ "--D[01]" { # (-Debug) turn on Tcl debugger
+ verbose "Tcl debugger is ON"
+ continue
+ }
+
+ "--m*" { # (--mail) mail the output
+ set mailing_list $optarg
+ set mail_logs 1
+ verbose "Mail results to $mailing_list"
+ continue
+ }
+
+ "--r*" { # (--reboot) reboot the target
+ set reboot 1
+ verbose "Will reboot the target (if supported)"
+ continue
+ }
+
+ "--ob*" { # (--objdir) where the test case object code lives
+ # Already parsed, but parse again to make sure command line
+ # options override any config file.
+ set objdir $optarg
+ verbose "Using test binaries in $objdir"
+ continue
+ }
+
+ "--ou*" { # (--outdir) where to put the output files
+ set outdir $optarg
+ verbose "Test output put in $outdir"
+ continue
+ }
+
+ "*.exp" { # specify test names to run
+ set all_runtests($option) ""
+ verbose "Running only tests $option"
+ continue
+ }
+
+ "*.exp=*" { # specify test names to run
+ set j [string first "=" $option]
+ set tmp [list [string range $option 0 [expr $j - 1]] \
+ [string range $option [expr $j + 1] end]]
+ set all_runtests([lindex $tmp 0]) [lindex $tmp 1]
+ verbose "Running only tests $option"
+ unset tmp j
+ continue
+ }
+
+ "--i*" { # (--ignore) specify test names to exclude
+ set ignoretests $optarg
+ verbose "Ignoring test $ignoretests"
+ continue
+ }
+
+ "--sr*" { # (--srcdir) where the testsuite source code lives
+ # Already parsed, but parse again to make sure command line
+ # options override any config file.
+
+ set srcdir $optarg
+ continue
+ }
+
+ "--st*" { # (--strace) expect trace level
+ set tracelevel $optarg
+ strace $tracelevel
+ verbose "Source Trace level is now $tracelevel"
+ continue
+ }
+
+ "--n*" { # (--name) the target's name
+ # ??? `targetname' is a confusing word to use here.
+ set targetname $optarg
+ verbose "Target name is now $targetname"
+ continue
+ }
+
+ "--to*" { # (--tool) specify tool name
+ set tool $optarg
+ verbose "Testing $tool"
+ continue
+ }
+
+ "[A-Z]*=*" { # process makefile style args like CC=gcc, etc...
+ if [regexp "^(\[A-Z_\]+)=(.*)$" $option junk var val] {
+ if {0 > [lsearch -exact $makevars $var]} {
+ lappend makevars "$var"
+ set $var $val
+ } else {
+ set $var [concat [set $var] $val]
+ }
+ verbose "$var is now [set $var]"
+ #append makevars "set $var $val;" ;# FIXME: Used anywhere?
+ unset junk var val
+ } else {
+ send_error "Illegal variable specification:\n"
+ send_error "$option\n"
+ }
+ continue
+ }
+
+ "--he*" { # (--help) help text
+ send_user "USAGE: runtest \[options...\]\n"
+ send_user "\t--all (-a)\t\tPrint all test output to screen\n"
+ send_user "\t--baud (-ba)\t\tThe baud rate\n"
+ send_user "\t--build \[string\]\t\tThe canonical config name of the build machine\n"
+ send_user "\t--host \[string\]\t\tThe canonical config name of the host machine\n"
+ send_user "\t--target \[string\]\tThe canonical config name of the target board\n"
+ send_user "\t--connect (-co)\t\[type\]\tThe type of connection to use\n"
+ send_user "\t--debug (-de)\t\tSet expect debugging ON\n"
+ send_user "\t--help (-he)\t\tPrint help text\n"
+ send_user "\t--ignore \[name(s)\]\tThe names of specific tests to ignore\n"
+ send_user "\t--mail \[name(s)\]\tWho to mail the results to\n"
+ send_user "\t--name \[name\]\t\tThe hostname of the target board\n"
+ send_user "\t--objdir \[name\]\t\tThe test suite binary directory\n"
+ send_user "\t--outdir \[name\]\t\tThe directory to put logs in\n"
+ send_user "\t--reboot \[name\]\t\tReboot the target (if supported)\n"
+ send_user "\t--srcdir \[name\]\t\tThe test suite source code directory\n"
+ send_user "\t--strace \[number\]\tSet expect tracing ON\n"
+ send_user "\t--tool\[name(s)\]\t\tRun tests on these tools\n"
+ send_user "\t--verbose (-v)\t\tEmit verbose output\n"
+ send_user "\t--version (-V)\t\tEmit all version numbers\n"
+ send_user "\t--D\[0-1\]\t\tTcl debugger\n"
+ send_user "\tscript.exp\[=arg(s)\]\tRun these tests only\n"
+ send_user "\tMakefile style arguments can also be used, ex. CC=gcc\n\n"
+ exit 0
+ }
+
+ default {
+ send_error "\nIllegal Argument \"$option\"\n"
+ send_error "try \"runtest --help\" for option list\n"
+ exit 1
+ }
+
+ }
+}
+
+#
+# check for a few crucial variables
+#
+if ![info exists tool] {
+ send_error "WARNING: No tool specified\n"
+ set tool ""
+}
+
+#
+# initialize a few Tcl variables to something other than their default
+#
+if { $verbose > 2 } {
+ log_user 1
+} else {
+ log_user 0
+}
+
+set timeout 10
+
+#
+# load_lib -- load a library by sourcing it
+#
+# If there a multiple files with the same name, stop after the first one found.
+# The order is first look in the install dir, then in a parallel dir in the
+# source tree, (up one or two levels), then in the current dir.
+#
+proc load_lib { file } {
+ global verbose libdir srcdir base_dir execpath tool
+
+ # ??? We could use `load_file' here but then we'd lose the "library file"
+ # specific text in verbose and error messages. Worth it?
+ set found 0
+ foreach dir "$libdir $libdir/lib [file dirname [file dirname $srcdir]]/bluegnu/lib $srcdir/lib . [file dirname [file dirname [file dirname $srcdir]]]/bluegnu/lib" {
+ verbose "Looking for library file $dir/$file" 2
+ if [file exists $dir/$file] {
+ set found 1
+ verbose "Loading library file $dir/$file"
+ if { [catch "uplevel #0 source $dir/$file"] == 1 } {
+ send_error "ERROR: tcl error sourcing library file $dir/$file.\n"
+ global errorInfo
+ if [info exists errorInfo] {
+ send_error "$errorInfo\n"
+ }
+ exit 1
+ }
+ break
+ }
+ }
+ if { $found == 0 } {
+ send_error "ERROR: Couldn't find library file $file.\n"
+ exit 1
+ }
+}
+
+#
+# load the testing framework libraries
+#
+load_lib utils.exp
+load_lib framework.exp
+load_lib debugger.exp
+load_lib remote.exp
+load_lib target.exp
+
+#
+# open log files
+#
+open_logs
+
+# print the config info
+clone_output "Test Run By $logname on [timestamp -format %c]"
+if [is3way] {
+ clone_output "Target is $target_triplet"
+ clone_output "Host is $host_triplet"
+ clone_output "Build is $build_triplet"
+} else {
+ if [isnative] {
+ clone_output "Native configuration is $target_triplet"
+ } else {
+ clone_output "Target is $target_triplet"
+ clone_output "Host is $host_triplet"
+ }
+}
+
+clone_output "\n\t\t=== $tool tests ===\n"
+
+#
+# Find the tool init file. This is in the config directory of the tool's
+# testsuite directory. These used to all be named $target_abbrev-$tool.exp,
+# but as the $tool variable goes away, it's now just $target_abbrev.exp.
+# First we look for a file named with both the abbrev and the tool names.
+# Then we look for one named with just the abbrev name. Finally, we look for
+# a file called default, which is the default actions, as some tools could
+# be purely host based. Unknown is mostly for error trapping.
+#
+
+set found 0
+if ![info exists target_abbrev] {
+ set target_abbrev "unix"
+}
+foreach dir "${srcdir}/config ${srcdir}/../config ${srcdir}/../../config ${srcdir}/../../../config" {
+ foreach initfile "${target_abbrev}-${tool}.exp ${target_abbrev}.exp ${target_os}.exp default.exp unknown.exp" {
+ verbose "Looking for tool init file ${dir}/${initfile}" 2
+ if [file exists ${dir}/${initfile}] {
+ set found 1
+ verbose "Using ${dir}/${initfile} as tool init file."
+ if [catch "uplevel #0 source ${dir}/${initfile}"]==1 {
+ send_error "ERROR: tcl error sourcing tool init file ${dir}/${initfile}.\n"
+ if [info exists errorInfo] {
+ send_error "$errorInfo\n"
+ }
+ exit 1
+ }
+ break
+ }
+ }
+ if $found {
+ break
+ }
+}
+
+if { $found == 0 } {
+ send_error "ERROR: Couldn't find tool init file.\n"
+ exit 1
+}
+unset found
+
+#
+# Trap some signals so we know what's happening. These replace the previous
+# ones because we've now loaded the library stuff.
+#
+if ![exp_debug] {
+ foreach sig "{SIGTERM {terminated}} \
+ {SIGINT {interrupted by user}} \
+ {SIGQUIT {interrupted by user}} \
+ {SIGSEGV {segmentation violation}}" {
+ trap { send_error "Got a [trap -name] signal, [lindex $sig 1]\n"; \
+ log_summary } [lindex $sig 0]
+ verbose "setting trap for [lindex $sig 0] to \"[lindex $sig 1]\"" 1
+ }
+}
+unset sig
+
+#
+# Setup for main test execution loop
+#
+
+if [info exists errorInfo] {
+ unset errorInfo
+}
+reset_vars
+# FIXME: The trailing '/' is deprecated and will go away at some point.
+# Do not assume $srcdir has a trailing '/'.
+append srcdir "/"
+# make sure we have only single path delimiters
+regsub -all "//*" $srcdir "/" srcdir
+
+
+# If multiple passes requested, set them up. Otherwise prepare just one.
+# The format of `MULTIPASS' is a list of elements containing
+# "{ name var1=value1 ... }" where `name' is a generic name for the pass and
+# currently has no other meaning.
+
+if { [info exists MULTIPASS] } {
+ set multipass $MULTIPASS
+}
+if { $multipass == "" } {
+ set multipass { "" }
+}
+
+# Pass varaibale passed as arguments into the queue
+#
+foreach var $makevars {
+ if {[string compare $var "MULTIPASS"] != 0} {
+ appendQueue Q0 "./tools/setVariable.exp=$var=[set $var]"
+ }
+}
+
+foreach pass $multipass {
+ # multipass_name is set for `record_test' to use (see framework.exp).
+ if { [lindex $pass 0] != "" } {
+ set multipass_name [lindex $pass 0]
+ clone_output "Running pass `$multipass_name' ..."
+ # Pass MULTIPASS into queue
+ appendQueue Q0 "./tools/setVariable.exp=MULTIPASS=$pass"
+ } else {
+ set multipass_name ""
+ }
+ set restore ""
+ foreach varval [lrange $pass 1 end] {
+ # FIXME: doesn't handle a=b=c.
+ set tmp [split $varval "="]
+ set var [lindex $tmp 0]
+ # Save previous value.
+ if [info exists $var] {
+ lappend restore "$var [list [eval concat \$$var]]"
+ } else {
+ lappend restore "$var"
+ }
+ # Handle "CFLAGS=$CFLAGS foo".
+ # FIXME: Do we need to `catch' this?
+ eval set $var \[concat [lindex $tmp 1]\]
+ verbose "$var is now [eval concat \$$var]"
+ unset tmp var
+ }
+
+ # look for the top level testsuites. if $tool doesn't
+ # exist and there are no subdirectories in $srcdir, then
+ # we default to srcdir.
+ set test_top_dirs [lsort [getdirs ${srcdir} "$tool*"]]
+ if { ${test_top_dirs} == "" } {
+ set test_top_dirs ${srcdir}
+ }
+ verbose "Top level testsuite dirs are ${test_top_dirs}" 2
+ foreach dir "${test_top_dirs}" {
+ foreach test_name [lsort [find ${dir} *.exp]] {
+ if { ${test_name} == "" } {
+ continue
+ }
+ # Ignore this one if asked to.
+ if ![string match "" ${ignoretests}] {
+ if { 0 <= [lsearch ${ignoretests} [file tail ${test_name}]]} {
+ continue
+ }
+ }
+ # Get the path after the $srcdir so we know the subdir we're in.
+ set subdir ""
+ regsub $srcdir [file dirname $test_name] "" subdir
+ if { "$srcdir" == "$subdir/" } {
+ set subdir ""
+ }
+ # Check to see if the range of tests is limited,
+ # set `runtests' to a list of two elements: the script name
+ # and any arguments ("" if none).
+ if { [array size all_runtests] > 0 } {
+ if { 0 > [lsearch [array names all_runtests] [file tail $test_name]]} {
+ continue
+ }
+ set runtests [list [file tail $test_name] $all_runtests([file tail $test_name])]
+ } else {
+ set runtests [list [file tail $test_name] ""]
+ }
+ clone_output "Running $test_name ..."
+ ####################################################
+ #
+ # Append test to queue
+ #
+ if {[string length [lindex $runtests 1]] == 0} {
+ appendQueue Q0 $test_name
+ } else {
+ appendQueue Q0 [join [list $test_name \
+ [lindex $runtests 1]] "="]
+ }
+ #
+ ####################################################
+ }
+ }
+
+ # Restore the variables set by this pass.
+ foreach varval $restore {
+ if { [llength $varval] > 1 } {
+ verbose "Restoring [lindex $varval 0] to [lindex $varval 1]" 4
+ set [lindex $varval 0] [lindex $varval 1]
+ } else {
+ verbose "Restoring [lindex $varval 0] to `unset'" 4
+ unset [lindex $varval 0]
+ }
+ }
+}
+#
+# do quite a bit of cleaning
+#
+unset restore i
+unset ignoretests
+foreach var $makevars {
+ unset $var
+}
+catch {unset tmp}
+catch {unset makevars}
+catch {unset pass}
+catch {unset multipass}
+catch {unset var}
+catch {unset varval}
+puts "======= DejaGnu"
diff --git a/contrib/bluegnu2.0.3/lib/dg.exp b/contrib/bluegnu2.0.3/lib/dg.exp
new file mode 100644
index 0000000..64b3e32
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/dg.exp
@@ -0,0 +1,881 @@
+# `dg' general purpose testcase driver.
+# Copyright (C) 1994, 1995, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+
+# Please email any bugs, comments, and/or additions to this file to:
+# dje@cygnus.com.
+
+# This file was written by Doug Evans (dje@cygnus.com).
+
+# This file is based on old-dejagnu.exp. It is intended to be more extensible
+# without incurring the overhead that old-dejagnu.exp can. All test framework
+# commands appear in the testcase as "{ dg-xxx args ... }". We pull them out
+# with one grep, and then run the function(s) named by "dg-xxx". When running
+# dg-xxx, the line number that it occurs on is always passed as the first
+# argument. We also support different kinds of tools via callbacks.
+#
+# The currently supported options are:
+#
+# dg-prms-id N
+# set prms_id to N
+#
+# dg-options "options ..." [{ target selector }]
+# specify special options to pass to the tool (eg: compiler)
+#
+# dg-do do-what-keyword [{ target/xfail selector }]
+# `do-what-keyword' is tool specific and is passed unchanged to
+# ${tool}-dg-test. An example is gcc where `keyword' can be any of:
+# preprocess|compile|assemble|link|run
+# and will do one of: produce a .i, produce a .s, produce a .o,
+# produce an a.out, or produce an a.out and run it (the default is
+# compile).
+#
+# dg-error regexp comment [{ target/xfail selector } [{.|0|linenum}]]
+# indicate an error message <regexp> is expected on this line
+# (the test fails if it doesn't occur)
+# Linenum=0 for general tool messages (eg: -V arg missing).
+# "." means the current line.
+#
+# dg-warning regexp comment [{ target/xfail selector } [{.|0|linenum}]]
+# indicate a warning message <regexp> is expected on this line
+# (the test fails if it doesn't occur)
+#
+# dg-bogus regexp comment [{ target/xfail selector } [{.|0|linenum}]]
+# indicate a bogus error message <regexp> use to occur here
+# (the test fails if it does occur)
+#
+# dg-build regexp comment [{ target/xfail selector }]
+# indicate the build use to fail for some reason
+# (errors covered here include bad assembler generated, tool crashes,
+# and link failures)
+# (the test fails if it does occur)
+#
+# dg-excess-errors comment [{ target/xfail selector }]
+# indicate excess errors are expected (any line)
+# (this should only be used sparingly and temporarily)
+#
+# dg-output regexp [{ target selector }]
+# indicate the expected output of the program is <regexp>
+# (there may be multiple occurrences of this, they are concatenated)
+#
+# dg-final { tcl code }
+# add some tcl code to be run at the end
+# (there may be multiple occurrences of this, they are concatenated)
+# (unbalanced braces must be \-escaped)
+#
+# "{ target selector }" is a list of expressions that determine whether the
+# test succeeds or fails for a particular target, or in some cases whether the
+# option applies for a particular target. If the case of `dg-do' it specifies
+# whether the testcase is even attempted on the specified target.
+#
+# The target selector is always optional. The format is one of:
+#
+# { xfail *-*-* ... } - the test is expected to fail for the given targets
+# { target *-*-* ... } - the option only applies to the given targets
+#
+# At least one target must be specified, use *-*-* for "all targets".
+# At present it is not possible to specify both `xfail' and `target'.
+# "native" may be used in place of "*-*-*".
+#
+# Example:
+#
+# [ ... some complicated code ... ]
+# return a; /* { dg-build "fatal" "ran out of spill regs" { xfail i386-*-* } } */
+#
+# In this example, the compiler use to crash on the "return a;" for some
+# target and that it still does crash on i386-*-*. Admittedly, this is a
+# contrived example.
+#
+# ??? It might be possible to add additional optional arguments by having
+# something like: { dg-error ".*syntax.*" "syntax error" { { foo 1 } ... } }
+#
+# Callbacks
+#
+# ${tool}-dg-test testfile do-what-keyword extra-flags
+#
+# Run the test, be it compiler, assembler, or whatever.
+#
+# ${tool}-dg-prune target_triplet text
+#
+# Optional callback to delete output from the tool that can occur
+# even in successful ("pass") situations and interfere with output
+# pattern matching. This also gives the tool an opportunity to review
+# the output and check for any conditions which indicate an "untested"
+# or "unresolved" state. An example is if a testcase is too big and
+# fills all available ram (which can happen for 16 bit cpus). The
+# result is either the pruned text or
+# "::untested|unresolved|unsupported::message"
+# (eg: "::unsupported::memory full").
+#
+# Notes:
+# 1) All runnable testcases must return 0 from main() for success.
+# You can't rely on getting any return code from target boards, and the
+# `exec' command says a program fails if it returns non-zero.
+#
+# Language independence is (theoretically) achieved by:
+#
+# 1) Using global $tool to indicate the language (eg: gcc, g++, gas, etc.).
+# This should only be used to look up other objects. We don't want to
+# have to add code for each new language that is supported. If this is
+# done right, no code needs to be added here for each new language.
+#
+# 2) Passing tool options in as arguments.
+#
+# Earlier versions of ${tool}_start (eg: gcc_start) would only take the name
+# of the file to compile as an argument. Newer versions accept a list of
+# one or two elements, the second being a string of *all* options to pass
+# to the tool. We require this facility.
+#
+# 3) Callbacks.
+#
+# Try not to do anything else that makes life difficult.
+#
+# The normal way to write a testsuite is to have a .exp file containing:
+#
+# load_lib ${tool}-dg.exp
+# dg-init
+# dg-runtest [lsort [glob -nocomplain $srcdir/$subdir/foo*]] ...
+# dg-finish
+
+# Global state variables.
+# The defaults are for GCC.
+
+# The default do-what keyword.
+set dg-do-what-default compile
+
+# When dg-interpreter-batch-mode is 1, no execution test or excess error
+# tests are performed.
+set dg-interpreter-batch-mode 0
+
+# Line number format. This is how line numbers appear in program output.
+set dg-linenum-format ":%d:"
+proc dg-format-linenum { linenum } {
+ global dg-linenum-format
+ return [format ${dg-linenum-format} $linenum]
+}
+
+# Useful subroutines.
+
+# dg-get-options -- pick out the dg-xxx options in a testcase
+#
+# PROG is the file name of the testcase.
+# The result is a list of options found.
+#
+# Example: For the following testcase:
+#
+# /* { dg-prms-id 1234 } */
+# int foo { return 0; } /* { dg-build fatal "some comment" } */
+#
+# we return:
+#
+# { dg-prms-id 1 1234 } { dg-build 2 fatal "some comment" }
+
+proc dg-get-options { prog } {
+ set result ""
+
+ set tmp [grep $prog "{\[ \t\]\+dg-\[-a-z\]\+\[ \t\]\+.*\[ \t\]\+}" line]
+ if ![string match "" $tmp] {
+ foreach i $tmp {
+ #send_user "Found: $i\n"
+ # FIXME: When to use "+" and "\+" isn't clear.
+ # Seems to me it took awhile to get this to work.
+ regexp "(\[0-9\]\+)\[ \t\]\+{\[ \t\]+(dg-\[-a-z\]+)\[ \t\]\+(.*)\[ \t\]+}\[^\}\]*(\n|$)" $i i line cmd args
+ #send_user "Found: $cmd $line $args\n"
+ append result " { $cmd $line $args }"
+ }
+ }
+
+ #send_user "Returning: $result\n"
+ return $result
+}
+
+#
+# Process optional xfail/target arguments
+#
+# SELECTOR is "xfail target-triplet-1 ..." or "target target-triplet-1 ..."
+# `target-triplet' may be "native".
+# For xfail, the result is "F" (expected to Fail) if the current target is
+# affected, otherwise "P" (expected to Pass).
+# For target, the result is "S" (target is Selected) if the target is selected,
+# otherwise "N" (target is Not selected).
+#
+proc dg-process-target { selector } {
+ global target_triplet
+
+ set isnative [isnative]
+ set triplet_match 0
+
+ #send_user "dg-process-target: $selector\n"
+
+ set selector [string trim $selector]
+ if [regexp "^xfail " $selector] {
+ set what xfail
+ } elseif [regexp "^target " $selector] {
+ set what target
+ } else {
+ # The use of error here and in other dg-xxx utilities is intentional.
+ # dg-test will catch them and do the right thing.
+ error "syntax error in target selector \"$selector\""
+ }
+
+ # ??? This should work but it doesn't. tcl bug?
+ #if [regexp "^${what}(( \[^ \]+-\[^ \]+-\[^ \]+)|( native))+$" $selector tmp selector]
+ if [regexp "^${what}( \[^ \]+-\[^ \]+-\[^ \]+| native)+$" $selector] {
+ regsub "^${what} " $selector "" selector
+ #send_user "selector: $selector\n"
+ foreach triplet $selector {
+ if [string match $triplet $target_triplet] {
+ set triplet_match 1
+ } elseif { $isnative && $triplet == "native" } {
+ set triplet_match 1
+ }
+ }
+ } else {
+ error "syntax error in target selector \"$selector\""
+ }
+
+ if { $triplet_match } {
+ return [expr { $what == "xfail" ? "F" : "S" }]
+ } else {
+ return [expr { $what == "xfail" ? "P" : "N" }]
+ }
+}
+
+# Predefined user option handlers.
+# The line number is always the first element.
+# Note that each of these are varargs procs (they have an `args' argument).
+# Tests for optional arguments are coded with ">=" to simplify adding new ones.
+
+proc dg-prms-id { args } {
+ global prms_id ;# this is a testing framework variable
+
+ if { [llength $args] > 2 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ set prms_id [lindex $args 1]
+}
+
+#
+# Set tool options
+#
+# Different options can be used for different targets by having multiple
+# instances, selecting a different target each time. Since options are
+# processed in order, put the default value first. Subsequent occurrences
+# will override previous ones.
+#
+
+proc dg-options { args } {
+ upvar dg-extra-tool-flags extra-tool-flags
+
+ if { [llength $args] > 3 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ if { [llength $args] >= 3 } {
+ switch [dg-process-target [lindex $args 2]] {
+ "S" { set extra-tool-flags [lindex $args 1] }
+ "N" { }
+ "F" { error "[lindex $args 0]: `xfail' not allowed here" }
+ "P" { error "[lindex $args 0]: `xfail' not allowed here" }
+ }
+ } else {
+ set extra-tool-flags [lindex $args 1]
+ }
+}
+
+#
+# Record what to do (compile/run/etc.)
+#
+# Multiple instances are supported (since we don't support target and xfail
+# selectors on one line), though it doesn't make much sense to change the
+# compile/assemble/link/run field. Nor does it make any sense to have
+# multiple lines of target selectors (use one line).
+#
+proc dg-do { args } {
+ upvar dg-do-what do-what
+
+ if { [llength $args] > 3 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ set selected [lindex ${do-what} 1] ;# selected? (""/S/N)
+ set expected [lindex ${do-what} 2] ;# expected to pass/fail (P/F)
+
+ if { [llength $args] >= 3 } {
+ switch [dg-process-target [lindex $args 2]] {
+ "S" {
+ set selected "S"
+ }
+ "N" {
+ # Don't deselect a target if it's been explicitly selected,
+ # but indicate a specific target has been selected (so don't
+ # do this testcase if it's not appropriate for this target).
+ # The user really shouldn't have multiple lines of target
+ # selectors, but try to do the intuitive thing (multiple lines
+ # are OR'd together).
+ if { $selected != "S" } {
+ set selected "N"
+ }
+ }
+ "F" { set expected "F" }
+ "P" {
+ # There's nothing to do for "P". We don't want to clobber a
+ # previous xfail for this target.
+ }
+ }
+ } else {
+ # Note: A previous occurrence of `dg-do' with target/xfail selectors
+ # is a user mistake. We clobber previous values here.
+ set selected S
+ set expected P
+ }
+
+ switch [lindex $args 1] {
+ "preprocess" { }
+ "compile" { }
+ "assemble" { }
+ "link" { }
+ "run" { }
+ default {
+ error "[lindex $args 0]: syntax error"
+ }
+ }
+ set do-what [list [lindex $args 1] $selected $expected]
+}
+
+proc dg-error { args } {
+ upvar dg-messages messages
+
+ if { [llength $args] > 5 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ set xfail ""
+ if { [llength $args] >= 4 } {
+ switch [dg-process-target [lindex $args 3]] {
+ "F" { set xfail "X" }
+ "P" { set xfail "" }
+ "N" {
+ # If we get "N", this error doesn't apply to us so ignore it.
+ return
+ }
+ }
+ }
+
+ if { [llength $args] >= 5 } {
+ switch [lindex $args 4] {
+ "." { set line [dg-format-linenum [lindex $args 0]] }
+ "0" { set line "" }
+ "default" { set line [dg-format-linenum [lindex $args 4]] }
+ }
+ } else {
+ set line [dg-format-linenum [lindex $args 0]]
+ }
+
+ lappend messages [list $line "${xfail}ERROR" [lindex $args 1] [lindex $args 2]]
+}
+
+proc dg-warning { args } {
+ upvar dg-messages messages
+
+ if { [llength $args] > 5 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ set xfail ""
+ if { [llength $args] >= 4 } {
+ switch [dg-process-target [lindex $args 3]] {
+ "F" { set xfail "X" }
+ "P" { set xfail "" }
+ "N" {
+ # If we get "N", this warning doesn't apply to us so ignore it.
+ return
+ }
+ }
+ }
+
+ if { [llength $args] >= 5 } {
+ switch [lindex $args 4] {
+ "." { set line [dg-format-linenum [lindex $args 0]] }
+ "0" { set line "" }
+ "default" { set line [dg-format-linenum [lindex $args 4]] }
+ }
+ } else {
+ set line [dg-format-linenum [lindex $args 0]]
+ }
+
+ lappend messages [list $line "${xfail}WARNING" [lindex $args 1] [lindex $args 2]]
+}
+
+proc dg-bogus { args } {
+ upvar dg-messages messages
+
+ if { [llength $args] > 5 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ set xfail ""
+ if { [llength $args] >= 4 } {
+ switch [dg-process-target [lindex $args 3]] {
+ "F" { set xfail "X" }
+ "P" { set xfail "" }
+ "N" {
+ # If we get "N", this message doesn't apply to us so ignore it.
+ return
+ }
+ }
+ }
+
+ if { [llength $args] >= 5 } {
+ switch [lindex $args 4] {
+ "." { set line [dg-format-linenum [lindex $args 0]] }
+ "0" { set line "" }
+ "default" { set line [dg-format-linenum [lindex $args 4]] }
+ }
+ } else {
+ set line [dg-format-linenum [lindex $args 0]]
+ }
+
+ lappend messages [list $line "${xfail}BOGUS" [lindex $args 1] [lindex $args 2]]
+}
+
+proc dg-build { args } {
+ upvar dg-messages messages
+
+ if { [llength $args] > 4 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ set xfail ""
+ if { [ llength $args] >= 4 } {
+ switch [dg-process-target [lindex $args 3]] {
+ "F" { set xfail "X" }
+ "P" { set xfail "" }
+ "N" {
+ # If we get "N", this lossage doesn't apply to us so ignore it.
+ return
+ }
+ }
+ }
+
+ lappend messages [list [lindex $args 0] "${xfail}BUILD" [lindex $args 1] [lindex $args 2]]
+}
+
+proc dg-excess-errors { args } {
+ upvar dg-excess-errors-flag excess-errors-flag
+
+ if { [llength $args] > 3 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ if { [llength $args] >= 3 } {
+ switch [dg-process-target [lindex $args 2]] {
+ "F" { set excess-errors-flag 1 }
+ "S" { set excess-errors-flag 1 }
+ }
+ } else {
+ set excess-errors-flag 1
+ }
+}
+
+#
+# Indicate expected program output
+#
+# We support multiple occurrences, but we do not implicitly insert newlines
+# between them.
+#
+# Note that target boards don't all support this kind of thing so it's a good
+# idea to specify the target all the time. If one or more targets are
+# explicitly selected, the test won't be performed if we're not one of them
+# (as long as we were never mentioned).
+#
+# If you have target dependent output and want to set an xfail for one or more
+# of them, use { dg-output "" { xfail a-b-c ... } }. The "" won't contribute
+# to the expected output.
+#
+proc dg-output { args } {
+ upvar dg-output-text output-text
+
+ if { [llength $args] > 3 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ # Allow target dependent output.
+
+ set expected [lindex ${output-text} 0]
+ if { [llength $args] >= 3 } {
+ switch [dg-process-target [lindex $args 2]] {
+ "N" { return }
+ "S" { }
+ "F" { set expected "F" }
+ # Don't override a previous xfail.
+ "P" { }
+ }
+ }
+
+ if { [llength ${output-text}] == 1 } {
+ # First occurrence.
+ set output-text [list $expected [lindex $args 1]]
+ } else {
+ set output-text [list $expected "[lindex ${output-text} 1][lindex $args 1]"]
+ }
+}
+
+proc dg-final { args } {
+ upvar dg-final-code final-code
+
+ if { [llength $args] > 2 } {
+ error "[lindex $args 0]: too many arguments"
+ return
+ }
+
+ #send_user "dg-final: $args\n"
+ append final-code "[lindex $args 1]\n"
+}
+
+#
+# Set up our environment
+#
+# There currently isn't much to do, but always calling it allows us to add
+# enhancements without having to update our callers.
+# It must be run before calling `dg-test'.
+
+proc dg-init { } {
+ # If the tool has an "init" routine, call it.
+ global tool
+ if ![string match "" [info procs ${tool}_init]] {
+ ${tool}_init
+ }
+}
+
+# dg-runtest -- simple main loop useful to most testsuites
+#
+# FLAGS is a set of options to always pass.
+# DEFAULT_EXTRA_FLAGS is a set of options to pass if the testcase doesn't
+# specify any (with dg-option).
+# ??? We're flipping between "flag" and "option" here.
+
+proc dg-runtest { testcases flags default-extra-flags } {
+ global runtests
+
+ foreach testcase $testcases {
+ # If we're only testing specific files and this isn't one of them, skip it.
+ if ![runtest_file_p $runtests $testcase] {
+ continue
+ }
+ verbose "Testing [file tail [file dirname $testcase]]/[file tail $testcase]"
+ dg-test $testcase $flags ${default-extra-flags}
+ }
+}
+
+#
+# Runs a new style DejaGnu test
+#
+# PROG is the full path name of the file to pass to the tool (eg: compiler).
+# TOOL_FLAGS is a set of options to always pass.
+# DEFAULT_EXTRA_TOOL_FLAGS are additional options if the testcase has none.
+
+proc dg-test { prog tool_flags default_extra_tool_flags } {
+ global dg-do-what-default dg-interpreter-batch-mode dg-linenum-format
+ global errorCode errorInfo
+ global comp_output exec_output
+ global tool
+ global srcdir ;# eg: /calvin/dje/devo/gcc/./testsuite/
+ global host_triplet target_triplet
+
+ set text "\[- A-Za-z0-9\.\;\"\_\:\'\`\(\)\!\#\=\+\?\&\*]*"
+
+ regsub "^$srcdir/?" $prog "" name
+ # If we couldn't rip $srcdir out of `prog' then just do the best we can.
+ # The point is to reduce the unnecessary noise in the logs. Don't strip
+ # out too much because different testcases with the same name can confuse
+ # `test-tool'.
+ if [string match "/*" $name] {
+ set name "[file tail [file dirname $prog]]/[file tail $prog]"
+ }
+
+ # Process any embedded dg options in the testcase.
+
+ # Use "" for the second element of dg-do-what so we can tell if it's been
+ # explicitly set to "S".
+ set dg-do-what [list ${dg-do-what-default} "" P]
+ set dg-excess-errors-flag 0
+ set dg-messages ""
+ set dg-extra-tool-flags $default_extra_tool_flags
+ set dg-final-code ""
+
+ # `dg-output-text' is a list of two elements: pass/fail and text.
+ # Leave second element off for now (indicates "don't perform test")
+ set dg-output-text "P"
+
+ # Define our own "special function" `unknown' so we catch spelling errors.
+ # But first rename the existing one so we can restore it afterwards.
+ catch {rename dg-save-unknown ""}
+ rename unknown dg-save-unknown
+ proc unknown { args } {
+ return -code error "unknown dg option: $args"
+ }
+
+ set tmp [dg-get-options $prog]
+ foreach op $tmp {
+ verbose "Processing option: $op" 3
+ set status [catch "$op" errmsg]
+ if { $status != 0 } {
+ if { 0 && [info exists errorInfo] } {
+ # This also prints a backtrace which will just confuse
+ # testcase writers, so it's disabled.
+ perror "$name: $errorInfo\n"
+ } else {
+ perror "$name: $errmsg for \"$op\"\n"
+ }
+ # ??? The call to unresolved here is necessary to clear `errcnt'.
+ # What we really need is a proc like perror that doesn't set errcnt.
+ # It should also set exit_status to 1.
+ unresolved "$name: $errmsg for \"$op\""
+ return
+ }
+ }
+
+ # Restore normal error handling.
+ rename unknown ""
+ rename dg-save-unknown unknown
+
+ # If we're not supposed to try this test on this target, we're done.
+ if { [lindex ${dg-do-what} 1] == "N" } {
+ unsupported "$name"
+ verbose "$name not supported on this target, skipping it" 3
+ return
+ }
+
+ # Run the tool and analyze the results.
+ # The result of ${tool}-dg-test is in a bit of flux.
+ # Currently it is the name of the output file (or "" if none).
+ # If we need more than this it will grow into a list of things.
+ # No intention is made (at this point) to preserve upward compatibility
+ # (though at some point we'll have to).
+
+ set output_file [${tool}-dg-test $prog [lindex ${dg-do-what} 0] "$tool_flags ${dg-extra-tool-flags}"]
+
+ #send_user "\nold_dejagnu.exp: comp_output1 = :$comp_output:\n\n"
+ #send_user "\nold_dejagnu.exp: message = :$message:\n\n"
+ #send_user "\nold_dejagnu.exp: message length = [llength $message]\n\n"
+
+ foreach i ${dg-messages} {
+ verbose "Scanning for message: $i" 4
+
+ # Remove all error messages for the line [lindex $i 0]
+ # in the source file. If we find any, success!
+ set line [lindex $i 0]
+ set pattern [lindex $i 2]
+ set comment [lindex $i 3]
+ #send_user "Before:\n$comp_output\n"
+ if [regsub -all "(^|\n)(\[^\n\]+$line\[^\n\]*($pattern)\[^\n\]*\n?)+" $comp_output "\n" comp_output] {
+ set comp_output [string trimleft $comp_output]
+ set ok pass
+ set uhoh fail
+ } else {
+ set ok fail
+ set uhoh pass
+ }
+ #send_user "After:\n$comp_output\n"
+
+ # $line will either be a formatted line number or a number all by
+ # itself. Delete the formatting.
+ scan $line ${dg-linenum-format} line
+ switch [lindex $i 1] {
+ "ERROR" {
+ $ok "$name $comment (test for errors, line $line)"
+ }
+ "XERROR" {
+ x$ok "$name $comment (test for errors, line $line)"
+ }
+ "WARNING" {
+ $ok "$name $comment (test for warnings, line $line)"
+ }
+ "XWARNING" {
+ x$ok "$name $comment (test for warnings, line $line)"
+ }
+ "BOGUS" {
+ $uhoh "$name $comment (test for bogus messages, line $line)"
+ }
+ "XBOGUS" {
+ x$uhoh "$name $comment (test for bogus messages, line $line)"
+ }
+ "BUILD" {
+ $uhoh "$name $comment (test for build failure, line $line)"
+ }
+ "XBUILD" {
+ x$uhoh "$name $comment (test for build failure, line $line)"
+ }
+ "EXEC" { }
+ "XEXEC" { }
+ }
+ #send_user "\nold_dejagnu.exp: comp_output2= :$comp_output:\n\n"
+ }
+ #send_user "\nold_dejagnu.exp: comp_output3 = :$comp_output:\n\n"
+
+ # Remove messages from the tool that we can ignore.
+ #send_user "comp_output: $comp_output\n"
+ set comp_output [prune_system_crud $host_triplet $comp_output]
+
+ if { [info proc ${tool}-dg-prune] != "" } {
+ set comp_output [${tool}-dg-prune $target_triplet $comp_output]
+ switch -glob $comp_output {
+ "::untested::*" {
+ regsub "::untested::" $comp_output "" message
+ untested "$name: $message"
+ return
+ }
+ "::unresolved::*" {
+ regsub "::unresolved::" $comp_output "" message
+ unresolved "$name: $message"
+ return
+ }
+ "::unsupported::*" {
+ regsub "::unsupported::" $comp_output "" message
+ unsupported "$name: $message"
+ return
+ }
+ }
+ }
+
+ # See if someone forgot to delete the extra lines.
+ regsub -all "\n+" $comp_output "\n" comp_output
+ regsub "^\n+" $comp_output "" comp_output
+ #send_user "comp_output: $comp_output\n"
+
+ # Don't do this if we're testing an interpreter.
+ # FIXME: why?
+ if { ${dg-interpreter-batch-mode} == 0 } {
+ # Catch excess errors (new bugs or incomplete testcases).
+ if ${dg-excess-errors-flag} {
+ setup_xfail "*-*-*"
+ }
+ if ![string match "" $comp_output] {
+ fail "$name (test for excess errors)"
+ send_log "Excess errors:\n$comp_output\n"
+ } else {
+ pass "$name (test for excess errors)"
+ }
+ }
+
+ # Run the executable image if asked to do so.
+ # FIXME: This is the only place where we assume a standard meaning to
+ # the `keyword' argument of dg-do. This could be cleaned up.
+ if { [lindex ${dg-do-what} 0] == "run" } {
+ if ![file exists $output_file] {
+ warning "$name compilation failed to produce executable"
+ } else {
+ set status -1
+ set status [${tool}_load $output_file]
+ #send_user "After exec, status: $status\n"
+ if { [lindex ${dg-do-what} 2] == "F" } {
+ setup_xfail "*-*-*"
+ }
+ if { "$status" == "pass" } {
+ pass "$name execution test"
+ verbose "Exec succeeded." 3
+ if { [llength ${dg-output-text}] > 1 } {
+ #send_user "${dg-output-text}\n"
+ if { [lindex ${dg-output-text} 0] == "F" } {
+ setup_xfail "*-*-*"
+ }
+ set texttmp [lindex ${dg-output-text} 1]
+ if { ![regexp $texttmp ${exec_output}] } {
+ fail "$name output pattern test, is ${exec_output}, should match $texttmp"
+ verbose "Failed test for output pattern $texttmp" 3
+ } else {
+ pass "$name output pattern test, $texttmp"
+ verbose "Passed test for output pattern $texttmp" 3
+ }
+ unset texttmp
+ }
+ } elseif { "$status" == "fail" } {
+ # It would be nice to get some info out of errorCode.
+ if [info exists errorCode] {
+ verbose "Exec failed, errorCode: $errorCode" 3
+ } else {
+ verbose "Exec failed, errorCode not defined!" 3
+ }
+ fail "$name execution test"
+ } else {
+ $status "$name execution test"
+ }
+ }
+ }
+
+ # Are there any further tests to perform?
+ # Note that if the program has special run-time requirements, running
+ # of the program can be delayed until here. Ditto for other situations.
+ # It would be a bit cumbersome though.
+
+ if ![string match ${dg-final-code} ""] {
+ regsub -all "\\\\(\[{}\])" ${dg-final-code} "\\1" dg-final-code
+ # Note that the use of `args' here makes this a varargs proc.
+ proc dg-final-proc { args } ${dg-final-code}
+ verbose "Running dg-final tests." 3
+ verbose "dg-final-proc:\n[info body dg-final-proc]" 4
+ if [catch "dg-final-proc $prog" errmsg] {
+ perror "$name: error executing dg-final: $errmsg"
+ # ??? The call to unresolved here is necessary to clear `errcnt'.
+ # What we really need is a proc like perror that doesn't set errcnt.
+ # It should also set exit_status to 1.
+ unresolved "$name: error executing dg-final: $errmsg"
+ }
+ }
+
+ # Do some final clean up.
+ # When testing an interpreter, we don't compile something and leave an
+ # output file.
+ if { ${dg-interpreter-batch-mode} == 0 } {
+ catch "exec rm -f $output_file"
+ }
+}
+
+#
+# Do any necessary cleanups
+#
+# This is called at the end to undo anything dg-init did (that needs undoing).
+#
+proc dg-finish { } {
+ # Reset this in case caller wonders whether s/he should.
+ global prms_id
+ set prms_id 0
+
+ # The framework doesn't like to see any error remnants, so remove them.
+ global errorInfo
+ if [info exists errorInfo] {
+ unset errorInfo
+ }
+
+ # If the tool has a "finish" routine, call it.
+ # There may be a bit of duplication (eg: resetting prms_id), leave it.
+ # Let's keep these procs robust.
+ global tool
+ if ![string match "" [info procs ${tool}_finish]] {
+ ${tool}_finish
+ }
+}
diff --git a/contrib/bluegnu2.0.3/lib/foo.itcl b/contrib/bluegnu2.0.3/lib/foo.itcl
new file mode 100644
index 0000000..cd2c6f0
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/foo.itcl
@@ -0,0 +1,21 @@
+
+source lib/testSessionClasses.itcl
+source lib/testSessionFramework.itcl
+source lib/testSessionUtils.itcl
+
+
+namespace TestSession {
+ Environment E0
+
+ #E0 saveEnv
+ E0 clearEnv
+ puts [join [E0 <<] "\n"]
+
+ exit
+
+ foreach obj [info objects] {
+ puts "$obj - [$obj <<]"
+ }
+}
+
+::TestSession::clone_output "ERROR: testing"
diff --git a/contrib/bluegnu2.0.3/lib/framework.exp b/contrib/bluegnu2.0.3/lib/framework.exp
new file mode 100644
index 0000000..2018c4a
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/framework.exp
@@ -0,0 +1,677 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+# These variables are local to this file.
+# This or more warnings and a test fails.
+set warning_threshold 3
+# This or more errors and a test fails.
+set perror_threshold 1
+
+proc mail_file { file to subject } {
+ if [file readable $file] {
+ catch "exec mail -s \"$subject\" $to < $file"
+ }
+}
+
+#
+# Open the output logs
+#
+proc open_logs { } {
+ global outdir
+ global tool
+ global sum_file
+
+ if { ${tool} == "" } {
+ set tool testrun
+ }
+ catch "exec rm -f $outdir/$tool.sum"
+ set sum_file [open "$outdir/$tool.sum" w]
+ catch "exec rm -f $outdir/$tool.log"
+ log_file -a "$outdir/$tool.log"
+ verbose "Opening log files in $outdir"
+ if { ${tool} == "testrun" } {
+ set tool ""
+ }
+}
+
+
+#
+# Close the output logs
+#
+proc close_logs { } {
+ global sum_file
+
+ catch "close $sum_file"
+}
+
+#
+# Check build host triplet for pattern
+#
+# With no arguments it returns the triplet string.
+#
+proc isbuild { args } {
+ global build_triplet
+ global host_triplet
+
+ if ![info exists build_triplet] {
+ set build_triplet ${host_triplet}
+ }
+ if [string match "" $args] {
+ return $build_triplet
+ }
+ verbose "Checking pattern \"$args\" with $build_triplet" 2
+
+ if [string match "$args" $build_triplet] {
+ return 1
+ } else {
+ return 0
+ }
+}
+
+#
+# If this is a canadian (3 way) cross. This means the tools are
+# being built with a cross compiler for another host.
+#
+proc is3way {} {
+ global host_triplet
+ global build_triplet
+
+ if ![info exists build_triplet] {
+ set build_triplet ${host_triplet}
+ }
+ verbose "Checking $host_triplet against $build_triplet" 2
+ if { "$build_triplet" == "$host_triplet" } {
+ return 0
+ }
+ return 1
+}
+
+#
+# Check host triplet for pattern
+#
+# With no arguments it returns the triplet string.
+#
+proc ishost { args } {
+ global host_triplet
+
+ if [string match "" $args] {
+ return $host_triplet
+ }
+ verbose "Checking pattern \"$args\" with $host_triplet" 2
+
+ if [string match "$args" $host_triplet] {
+ return 1
+ } else {
+ return 0
+ }
+}
+
+#
+# Check target triplet for pattern
+#
+# With no arguments it returns the triplet string.
+# Returns 1 if the target looked for, or 0 if not.
+#
+proc istarget { args } {
+ global target_triplet
+
+ # if no arg, return the config string
+ if [string match "" $args] {
+ if [info exists target_triplet] {
+ return $target_triplet
+ } else {
+ perror "No target configuration names found."
+ }
+ }
+
+ # now check against the cannonical name
+ if [info exists target_triplet] {
+ verbose "Checking \"$args\" against \"$target_triplet\"" 2
+ if [string match "$args" $target_triplet] {
+ return 1
+ }
+ }
+
+ # nope, no match
+ return 0
+}
+
+#
+# Check to see if we're running the tests in a native environment
+#
+# Returns 1 if running native, 0 if on a target.
+#
+proc isnative { } {
+ global target_triplet
+ global build_triplet
+
+ if [string match $build_triplet $target_triplet] {
+ return 1
+ }
+ return 0
+}
+
+#
+# unknown -- called by expect if a proc is called that doesn't exist
+#
+proc unknown { args } {
+ global errorCode
+ global errorInfo
+
+ clone_output "ERROR: (DejaGnu) proc \"$args\" does not exist."
+ if [info exists errorCode] {
+ send_error "The error code is $errorCode\n"
+ }
+ if [info exists errorInfo] {
+ send_error "The info on the error is:\n$errorInfo\n"
+ }
+
+ log_summary
+}
+
+#
+# Print output to stdout (or stderr) and to log file
+#
+# If the --all flag (-a) option was used then all messages go the the screen.
+# Without this, all messages that start with a keyword are written only to the
+# detail log file. All messages that go to the screen will also appear in the
+# detail log. This should only be used by the framework itself using pass,
+# fail, xpass, xfail, warning, perror, note, untested, unresolved, or
+# unsupported procedures.
+#
+proc clone_output { message } {
+ global sum_file
+ global all_flag
+
+ puts $sum_file "$message"
+ case [lindex $message 0] in {
+ {"PASS:" "XFAIL:" "UNRESOLVED:" "UNSUPPORTED:" "UNTESTED:"} {
+ if $all_flag {
+ send_user "$message\n"
+ return "$message"
+ } else {
+ send_log "$message\n"
+ }
+ }
+ {"ERROR:" "WARNING:" "NOTE:"} {
+ send_error "$message\n"
+ return "$message"
+ }
+ default {
+ send_user "$message\n"
+ return "$message"
+ }
+ }
+}
+
+#
+# Reset all globally used variables
+#
+proc reset_vars {} {
+ # test result counters
+ global testcnt
+ global failcnt
+ global passcnt
+ global xfailcnt
+ global xpasscnt
+ global untestedcnt
+ global unresolvedcnt
+ global unsupportedcnt
+
+ # other miscellaneous variables
+ global prms_id
+ global bug_id
+
+ # reset them all
+ set prms_id 0
+ set bug_id 0
+ set testcnt 0
+ set failcnt 0
+ set passcnt 0
+ set xfailcnt 0
+ set xpasscnt 0
+ set untestedcnt 0
+ set unresolvedcnt 0
+ set unsupportedcnt 0
+
+ # Variables local to this file.
+ global warning_threshold perror_threshold
+ set warning_threshold 3
+ set perror_threshold 1
+}
+
+#
+# Print summary of all pass/fail counts
+#
+# Calling this exits.
+#
+proc log_summary {} {
+ global tool
+ global sum_file
+ global exit_status
+ global failcnt
+ global passcnt
+ global testcnt
+ global xfailcnt
+ global xpasscnt
+ global untestedcnt
+ global unresolvedcnt
+ global unsupportedcnt
+ global mail_logs
+ global outdir
+ global mailing_list
+
+ clone_output "\n\t\t=== $tool Summary ===\n"
+
+ # If the tool set `testcnt', it wants us to do a sanity check on the
+ # total count, so compare the reported number of testcases with the
+ # expected number. Maintaining an accurate count in `testcnt' isn't easy
+ # so it's not clear how often this will be used.
+ if { $testcnt > 0 } {
+ # total all the testcases reported
+ set totlcnt [expr $failcnt+$passcnt+$xfailcnt+$xpasscnt]
+ set totlcnt [expr $totlcnt+$untestedcnt+$unresolvedcnt+$unsupportedcnt]
+
+ if { $testcnt>$totlcnt || $testcnt<$totlcnt } {
+ if { $testcnt > $totlcnt } {
+ set mismatch "unreported [expr $testcnt-$totlcnt]"
+ }
+ if { $testcnt < $totlcnt } {
+ set mismatch "misreported [expr $totlcnt-$testcnt]"
+ }
+ } else {
+ verbose "# of testcases run $testcnt"
+ }
+
+ if [info exists mismatch] {
+ clone_output "### ERROR: totals do not equal number of testcases run"
+ clone_output "### ERROR: # of testcases expected $testcnt"
+ clone_output "### ERROR: # of testcases reported $totlcnt"
+ clone_output "### ERROR: # of testcases $mismatch\n"
+ }
+ }
+
+ if { $passcnt > 0 } {
+ clone_output "# of expected passes $passcnt"
+ }
+ if { $xfailcnt > 0 } {
+ clone_output "# of expected failures $xfailcnt"
+ }
+ if { $xpasscnt > 0 } {
+ clone_output "# of unexpected successes $xpasscnt"
+ }
+ if { $failcnt > 0 } {
+ clone_output "# of unexpected failures $failcnt"
+ }
+ if { $unresolvedcnt > 0 } {
+ clone_output "# of unresolved testcases $unresolvedcnt"
+ }
+ if { $untestedcnt > 0 } {
+ clone_output "# of untested testcases $untestedcnt"
+ }
+ if { $unsupportedcnt > 0 } {
+ clone_output "# of unsupported tests $unsupportedcnt"
+ }
+ # extract version number
+ if {[info procs ${tool}_version] != ""} {
+ if {[catch "${tool}_version" output]} {
+ warning "${tool}_version failed:\n$output"
+ }
+ }
+ close_logs
+ cleanup
+ if $mail_logs {
+ mail_file $outdir/$tool.sum $mailing_list "Dejagnu Summary Log"
+ }
+ exit $exit_status
+}
+
+#
+# Close all open files, remove temp file and core files
+#
+proc cleanup {} {
+ global sum_file
+ global exit_status
+ global done_list
+ global base_dir
+ global subdir
+
+ #catch "exec rm -f [glob xgdb core *.x *.o *_soc a.out]"
+ #catch "exec rm -f [glob -nocomplain $subdir/*.o $subdir/*.x $subdir/*_soc]"
+}
+
+#
+# Setup a flag to control whether a failure is expected or not
+#
+# Multiple target triplet patterns can be specified for targets
+# for which the test fails. A decimal number can be specified,
+# which is the PRMS number.
+#
+proc setup_xfail { args } {
+ global xfail_flag
+ global xfail_prms
+
+ set xfail_prms 0
+ set argc [ llength $args ]
+ for { set i 0 } { $i < $argc } { incr i } {
+ set sub_arg [ lindex $args $i ]
+ # is a prms number. we assume this is a number with no characters
+ if [regexp "^\[0-9\]+$" $sub_arg] {
+ set xfail_prms $sub_arg
+ continue
+ }
+ if [istarget $sub_arg] {
+ set xfail_flag 1
+ continue
+ }
+ }
+}
+
+#
+# Clear the xfail flag for a particular target
+#
+proc clear_xfail { args } {
+ global xfail_flag
+ global xfail_prms
+
+ set argc [ llength $args ]
+ for { set i 0 } { $i < $argc } { incr i } {
+ set sub_arg [ lindex $args $i ]
+ case $sub_arg in {
+ "*-*-*" { # is a configuration triplet
+ if [istarget $sub_arg] {
+ set xfail_flag 0
+ set xfail_prms 0
+ }
+ continue
+ }
+ }
+ }
+}
+
+#
+# Record that a test has passed or failed (perhaps unexpectedly)
+#
+# This is an internal procedure, only used in this file.
+#
+proc record_test { type message } {
+ global passcnt failcnt xpasscnt xfailcnt
+ global untestedcnt unresolvedcnt unsupportedcnt
+ global exit_status
+ global prms_id bug_id
+ global xfail_flag xfail_prms
+ global errcnt warncnt
+ global warning_threshold perror_threshold
+
+ # If we have too many warnings or errors,
+ # the output of the test can't be considered correct.
+ if { $warning_threshold > 0 && $warncnt >= $warning_threshold
+ || $perror_threshold > 0 && $errcnt >= $perror_threshold } {
+ # Reset these first to prevent infinite recursion.
+ set warncnt 0
+ set errcnt 0
+ unresolved $message
+ return
+ }
+
+ switch $type {
+ PASS {
+ incr passcnt
+ if $prms_id {
+ set message [concat $message "\t(PRMS $prms_id)"]
+ }
+ }
+ FAIL {
+ incr failcnt
+ set exit_status 1
+ if $prms_id {
+ set message [concat $message "\t(PRMS $prms_id)"]
+ }
+ }
+ XPASS {
+ incr xpasscnt
+ set exit_status 1
+ if { $xfail_prms != 0 } {
+ set message [concat $message "\t(PRMS $xfail_prms)"]
+ }
+ }
+ XFAIL {
+ incr xfailcnt
+ if { $xfail_prms != 0 } {
+ set message [concat $message "\t(PRMS $xfail_prms)"]
+ }
+ }
+ UNTESTED {
+ incr untestedcnt
+ # The only reason we look at the xfail stuff is to pick up
+ # `xfail_prms'.
+ if { $xfail_flag && $xfail_prms != 0 } {
+ set message [concat $message "\t(PRMS $xfail_prms)"]
+ } elseif $prms_id {
+ set message [concat $message "\t(PRMS $prms_id)"]
+ }
+ }
+ UNRESOLVED {
+ incr unresolvedcnt
+ set exit_status 1
+ # The only reason we look at the xfail stuff is to pick up
+ # `xfail_prms'.
+ if { $xfail_flag && $xfail_prms != 0 } {
+ set message [concat $message "\t(PRMS $xfail_prms)"]
+ } elseif $prms_id {
+ set message [concat $message "\t(PRMS $prms_id)"]
+ }
+ }
+ UNSUPPORTED {
+ incr unsupportedcnt
+ # The only reason we look at the xfail stuff is to pick up
+ # `xfail_prms'.
+ if { $xfail_flag && $xfail_prms != 0 } {
+ set message [concat $message "\t(PRMS $xfail_prms)"]
+ } elseif $prms_id {
+ set message [concat $message "\t(PRMS $prms_id)"]
+ }
+ }
+ default {
+ perror "record_test called with bad type `$type'"
+ set errcnt 0
+ return
+ }
+ }
+
+ if $bug_id {
+ set message [concat $message "\t(BUG $bug_id)"]
+ }
+
+ global multipass_name
+ if { $multipass_name != "" } {
+ clone_output "$type: $multipass_name: $message"
+ } else {
+ clone_output "$type: $message"
+ }
+
+ # Reset these so they're ready for the next test case. We don't reset
+ # prms_id or bug_id here. There may be multiple tests for them. Instead
+ # they are reset in the main loop after each test. It is also the
+ # testsuite driver's responsibility to reset them after each testcase.
+ set warncnt 0
+ set errcnt 0
+ set xfail_flag 0
+ set xfail_prms 0
+}
+
+#
+# Record that a test has passed
+#
+proc pass { message } {
+ global xfail_flag
+
+ if $xfail_flag {
+ record_test XPASS $message
+ } else {
+ record_test PASS $message
+ }
+}
+
+#
+# Record that a test has failed
+#
+proc fail { message } {
+ global xfail_flag
+
+ if $xfail_flag {
+ record_test XFAIL $message
+ } else {
+ record_test FAIL $message
+ }
+}
+
+#
+# Record that a test has passed unexpectedly
+#
+proc xpass { message } {
+ record_test XPASS $message
+}
+
+#
+# Record that a test has failed unexpectedly
+#
+proc xfail { message } {
+ record_test XFAIL $message
+}
+
+#
+# Set warning threshold
+#
+proc set_warning_threshold { threshold } {
+ set warning_threshold $threshold
+}
+
+#
+# Get warning threshold
+#
+proc get_warning_threshold { } {
+ return $warning_threshold
+}
+
+#
+# Prints warning messages
+# These are warnings from the framework, not from the tools being tested.
+# It takes a string, and an optional number and returns nothing.
+#
+proc warning { args } {
+ global warncnt
+ global errno
+
+ if { [llength $args] > 1 } {
+ set warncnt [lindex $args 1]
+ } else {
+ incr warncnt
+ }
+ set message [lindex $args 0]
+
+ clone_output "WARNING: $message"
+ set errno "WARNING: $message"
+
+ global errorInfo
+ if [info exists errorInfo] {
+ unset errorInfo
+ }
+}
+
+#
+# Prints error messages
+# These are errors from the framework, not from the tools being tested.
+# It takes a string, and an optional number and returns nothing.
+#
+proc perror { args } {
+ global errcnt
+ global errno
+
+ if { [llength $args] > 1 } {
+ set errcnt [lindex $args 1]
+ } else {
+ incr errcnt
+ }
+ set message [lindex $args 0]
+
+ clone_output "ERROR: $message"
+ set errno "ERROR: $message"
+
+ global errorInfo
+ if [info exists errorInfo] {
+ unset errorInfo
+ }
+}
+
+#
+# Prints informational messages
+#
+# These are messages from the framework, not from the tools being tested.
+# This means that it is currently illegal to call this proc outside
+# of dejagnu proper.
+#
+proc note { message } {
+ clone_output "NOTE: $message"
+
+ # ??? It's not clear whether we should do this. Let's not, and only do
+ # so if we find a real need for it.
+ #global errorInfo
+ #if [info exists errorInfo] {
+ # unset errorInfo
+ #}
+}
+
+#
+# untested -- mark the test case as untested
+#
+proc untested { message } {
+ record_test UNTESTED $message
+}
+
+#
+# Mark the test case as unresolved
+#
+proc unresolved { message } {
+ record_test UNRESOLVED $message
+}
+
+#
+# Mark the test case as unsupported
+#
+# Usually this is used for a test that is missing OS support.
+#
+proc unsupported { message } {
+ record_test UNSUPPORTED $message
+}
+
+
+#
+# Create an exp_continue proc if it doesn't exist
+#
+# For compatablity with old versions.
+#
+global argv0
+if ![info exists argv0] {
+ proc exp_continue { } {
+ continue -expect
+ }
+}
diff --git a/contrib/bluegnu2.0.3/lib/libgloss.exp b/contrib/bluegnu2.0.3/lib/libgloss.exp
new file mode 100644
index 0000000..7e54e8d
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/libgloss.exp
@@ -0,0 +1,225 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#
+# Find the linker script for the current target. Returns a string
+# suitable to pass to $CC or $CXX to use a liblgoss based linker script,
+# or NULL if there is no support.
+#
+proc libgloss_script { } {
+ global srcdir
+ global target_cpu
+ global LDFLAGS
+ global CFLAGS
+ global CXXFLAGS
+ global target_info
+
+ # sanity check
+ if ![info exists LDFLAGS] {
+ set LDFLAGS ""
+ }
+ if ![info exists CFLAGS] {
+ set CFLAGS ""
+ }
+
+ if ![info exists CXXFLAGS] {
+ set CXXFLAGS ""
+ }
+
+ # find the linker script. first we look at the config
+ # data and hope to find it all ready for us to use. if
+ # that fails, then look in the LDFLAGS and CFLAGS variables that
+ # get set in the global site.exp file.
+ if [info exists target_info(target,name)] {
+ set script $target_info(target,name).ld
+ } else {
+ if [regexp -- "-T.*\.ld" ${LDFLAGS} script] {
+ string trimleft ${script} "-T"
+ }
+ if [regexp -- "-T.*\.ld" ${CFLAGS} script] {
+ string trimleft ${script} "-T"
+ }
+ if [regexp -- "-T.*\.ld" ${CXXFLAGS} script] {
+ string trimleft ${script} "-T"
+ }
+ }
+
+ if ![info exists script] {
+ warning "Couldn't find the linker script name for target"
+ return ""
+ }
+
+ # if we're on a remote host, we can't search for the file, so use the
+ # linker script in the path.
+ if [is3way] {
+ return "-T${script}"
+ }
+
+ # search for the general directories
+ foreach i ".. ../.. ../../.. ../../../.." {
+ verbose "Looking for a ${srcdir}/${i}/libgloss/${target_cpu}/${script}" 2
+ if [file exists ${srcdir}/$i/libgloss/${target_cpu}/${script} ] {
+ verbose "Found ${srcdir}/${i}/libgloss/${target_cpu}/${script}." 3
+ return "-T${srcdir}/${i}/libgloss/${target_cpu}/${script}"
+ }
+ }
+
+ # we didn't find the script, so we have to hope it's installed
+ return "-T${script}"
+}
+
+#
+# Find all the pieces of libgloss for testing the GNU development tools
+# needed to use $CC or $CXX. It returns a string suitable to pass to
+# $CC or $CXX to get a fully linked binary for the target.
+#
+proc libgloss_flags { } {
+ global target_alias
+ global target_cpu
+ global srcdir
+ global base_dir
+
+ # libgloss doesn't work native
+ if [isnative] {
+ return ""
+ }
+
+ # if we're on a remote host, we can't search for the file, so we can only
+ # use an installed compiler, so we don't add any paths here.
+ if [is3way] {
+ return "[libgloss_script]"
+ }
+
+ # search for the general directories
+ foreach i ".. ../.. ../../.. ../../../.." {
+ if [file exists ${base_dir}/${i}/${target_alias}/libgloss/${target_cpu} ] {
+ verbose "Found ${base_dir}/${i}/${target_alias}/libgloss/${target_cpu}." 3
+ return "-L${base_dir}/${i}/${target_alias}/libgloss/${target_cpu} [libgloss_script]"
+ }
+ }
+
+ # we didn't find any support at all
+ return "[libgloss_script]"
+}
+
+#
+# Find the C libraries
+#
+proc newlib_flags { } {
+ global base_dir
+ global srcdir
+ global target_alias
+
+ # if we're on a remote host, we can't search for the file, so use the
+ # newlib already installed.
+ if [is3way] {
+ return ""
+ }
+
+ # search for the general directories
+ foreach i ".. ../.. ../../.. ../../../.." {
+ verbose "Looking for a ${base_dir}/${i}/${target_alias}/newlib/targ-include" 2
+ if [file exists ${base_dir}/${i}/${target_alias}/newlib/targ-include ] {
+ verbose "Found ${base_dir}/${i}/${target_alias}/newlib/targ-include." 3
+ set incls1 "-I${base_dir}/${i}/${target_alias}/newlib/targ-include"
+ }
+ verbose "Looking for a ${srcdir}/${i}/newlib/libc/include" 2
+ if [file exists ${srcdir}/${i}/newlib/libc/include ] {
+ verbose "Found ${srcdir}/${i}/newlib/libc/include." 3
+ set incls2 "-I${srcdir}/${i}/newlib/libc/include"
+ }
+ }
+
+ # search for the general directories
+ foreach i ".. ../.. ../../.. ../../../.." {
+ verbose "Looking for a ${base_dir}/${i}/newlib" 2
+ if [file exists ${base_dir}/${i}/newlib ] {
+ verbose "Found ${base_dir}/${i}/newlib." 3
+ return "-B${base_dir}/${i}/newlib/ ${incls1} ${incls2}"
+ }
+ }
+ return ""
+}
+
+#
+# Find all the pieces of libgloss for testing the GNU development tools
+# needed to use $LD. This gets fun cause we have to guess the name of the
+# BSP for this target. If returns a string suitable to pass to LD to get
+# a fully linked binary for the target. It also sets two global variables,
+# CRT0 is the path to the startup file, and
+# BSP is the path to the support library.
+#
+proc libgloss_ld {} {
+#proc gloss_ld {} {
+ global target_cpu
+ global srcdir
+ global base_dir
+ global CRT0
+ global BSP
+
+ # libgloss doesn't work native
+ if [isnative] {
+ return ""
+ }
+
+# set ldflags ""
+ # search for the general directories
+ foreach i ".. ../.. ../../.. ../../../.." {
+ if ![info exists gloss_srcdir] {
+ if [file exists ${srcdir}/$i/libgloss/${target_cpu} ] {
+ verbose "Found ${srcdir}/$i/libgloss/${target_cpu}." 3
+ set gloss_srcdir "$i/libgloss/${target_cpu}"
+ }
+ }
+ if ![info exists gloss_objdir] {
+ if [file exists ${base_dir}/$i/libgloss/${target_cpu} ] {
+ verbose "Found ${base_dir}/$i/libgloss/${target_cpu}." 3
+ set gloss_objdir "$i/libgloss/${target_cpu}"
+ append ldflags " -L${gloss_objdir} "
+ }
+ }
+ }
+
+ # find the crt0
+ if [file exists ${gloss_objdir}/crt0.o] {
+ verbose "Found ${base_dir}/$i/libgloss/${target_cpu}." 3
+ set CRT0 "$i/libgloss/${target_cpu}"
+ append ldflags " ${gloss_objdir}/crt0.o "
+ } else {
+ perror "No crt0.o built for this target"
+ }
+
+ # find the BSP (currently an object, it may become an archive soon)
+ foreach i "[list_targets]" {
+ if [info exists target_info($i,name}] {
+ if [file exists ${gloss_objdir}/${target_info}($i,name).o ] {
+ set BSP "${target_info}($i,name).o"
+ append ldflags " -lc -l ${target_info}($i,name).o -lc "
+ }
+ }
+ }
+ if [expr ![info exists gloss_srcdir] || ![info exists gloss_srcdir]] {
+ warning "No libgloss support in build tree"
+ return ""
+ } else {
+ return "${ldflags}"
+ }
+}
diff --git a/contrib/bluegnu2.0.3/lib/nonexpect.itcl b/contrib/bluegnu2.0.3/lib/nonexpect.itcl
new file mode 100644
index 0000000..230f411
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/nonexpect.itcl
@@ -0,0 +1,74 @@
+#
+# The following procedures are creted to replace the
+# procedures defined in expect incase expect is not used as the
+# test framework
+#
+
+proc send_user args {
+ set newline 1
+ set logfile 0
+ set i 0
+ if { [string index [lindex $args 0] 0] == "-" } {
+ for { set i 0 } { $i < [llength $args] } { incr i } {
+ if { [lindex $args $i] == "--" } {
+ incr i
+ break
+ } elseif { [lindex $args $i] == "-n" } {
+ set newline 0
+ } elseif { [lindex $args $i] == "-log" } {
+ set logfile 1
+ } elseif { [string index [lindex $args $i] 0] == "-" } {
+ ::BlueGnu::clone_output "ERROR: verbose:\
+ illegal argument: [lindex $args $i]"
+ return
+ } else {
+ break
+ }
+ }
+ if { [llength $args] == $i } {
+ ::BlueGnu::clone_output "ERROR: send_user: nothing to print"
+ return
+ }
+ }
+ puts -nonewline [lindex $args $i]
+}
+
+proc send_error msg {
+ puts -nonewline stderr $msg
+}
+
+proc send_log msg {
+ global log_file
+
+ if {[info exists log_file]} {
+ puts -nonewline $log_file $msg
+ } else {
+ send_user "####### No log file has been defined\n"
+ puts -nonewline stderr $msg
+ }
+}
+
+proc log_file {args} {
+ global log_file
+ if {[info exists log_file]} {
+ catch {close $log_file}
+ unset log_file
+ }
+ set eAppend w
+ foreach arg $args {
+ switch -- $arg {
+ -a {
+ set eAppend a
+ }
+ default {
+ set log_file $arg
+ }
+ }
+ }
+ if {[info exist log_file]} {
+ set log_file [open $log_file $eAppend]
+ } else {
+ set log_file stderr
+ }
+}
+
diff --git a/contrib/bluegnu2.0.3/lib/remote.exp b/contrib/bluegnu2.0.3/lib/remote.exp
new file mode 100644
index 0000000..1b80617
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/remote.exp
@@ -0,0 +1,896 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+# these just need to be initialized
+# FIXME: This is deprecated (we should have no knowledge of global `shell_id').
+# Remove at some point.
+set shell_id 0
+
+#
+# Open a connection to a remote host or target. This requires the target_info
+# array be filled in with the proper info to work. The old variables are also
+# still functional.
+#
+# type is either "host" or "target". The default is target if no type is supplied.
+# It returns the spawn id of the process that is the connection.
+#
+proc remote_open { args } {
+ global target_info
+ global connectmode
+ global targetname
+ global serialport
+ global netport
+ global reboot
+ global shell_id
+ global spawn_id
+
+ if { [llength $args] == 0 } {
+ set type "target"
+ } else {
+ set type $args
+ }
+
+ # set the current connection
+ if [info exists target_info(${type},name)] {
+ if { $target_info(${type},name) != "" } {
+ if { [info proc push_$type] != "" } {
+ push_$type $target_info(${type},name)
+ }
+ } else {
+ warning "Couldn't push target, name was NULL"
+ }
+ }
+
+ if [info exists target_info(${type},connect)] {
+ set connect_prog $target_info(${type},connect)
+ } else {
+ if [info exists connectmode] {
+ set connect_prog $connectmode
+ } else {
+ perror "No connectmode specified"
+ set shell_id -1
+ return $shell_id
+ }
+ }
+
+ # reboot the machine if we neeed to, typically by using an x10 controller.
+ if $reboot {
+ if { [info procs "reboot_hook"] != "" } {
+ reboot_hook
+ }
+ }
+
+ set shell_id [$connect_prog $type]
+
+ if [info exists target_info] {
+ set target_info(${type},fileid) $shell_id
+ if [info exists target_info(${type},name)] {
+ set target_info($target_info(${type},name),fileid) $shell_id
+ }
+ }
+ return $shell_id
+}
+
+#
+# Close the remote connection.
+# shell_id - This is the id number returned by the any of the connection
+# procedures, or an index into one of the arrays.
+#
+proc remote_close { arg } {
+ # get the type of connection, host or target
+ if [expr [string match "host" $arg] || [string match "target" $arg]] {
+ set type $arg
+ if [info exists target_info(${type},fileid)] {
+ set shell_id $target_info(${type},fileid)
+ } else {
+ perror "No shell id for to close"
+ }
+ } else {
+ set shell_id $arg
+ }
+
+ verbose "Closing the remote shell $shell_id" 2
+ catch "close -i $shell_id"
+ catch "wait -i $shell_id"
+
+ return 0
+}
+
+
+# Most of these procedures try to establish the connection 3 times before
+# returning. If $verbose is set to a value of 2 or greater, then error
+# messages will appear for each attempt. If there is an error that
+# can't be recovered from, it returns a -1. If the connection is
+# established, it returns the shell's process number returned by the
+# tcl command spawn.
+# Hostname refers to the entry in /etc/hosts for this target. The
+# procedure's name is the same as its unix counterpart.
+# The final argument is the type of connection to establish, the default
+# is the target. This can also be passed as the second arg or the third.
+
+#
+# Connect using telnet. This takes two arguments. The first one is the
+# hostname, and the second is the optional port number. This sets
+# the fileid field in the config array, and returns -1 for error, or the
+# spawn id.
+#
+proc telnet { args } {
+ global verbose
+ global connectmode
+ global shell_prompt
+ global spawn_id
+ global timeout
+ global errno
+
+ set hostname [lindex $args 0]
+
+ # get the port number
+ if { [llength $args] > 1 } {
+ set port [lindex $args 1]
+ } else {
+ set port 23
+ }
+
+ # get the hostname and port number from the config array
+ if [expr [string match "host" $hostname] || [string match "target" $hostname]] {
+ set type $hostname
+ set hosttmp [split $target_info($type,netport) ":"]
+ set hostname [lindex $hosttmp 0]
+ if { [llength $hosttmp] > 1 } {
+ set port [lindex $hosttmp 1]
+ }
+ unset hosttmp
+ if [info exists target_info($type,prompt)] {
+ set shell_prompt $target_info($type,prompt)
+ }
+ } else {
+ set type target
+ }
+ if ![info exists shell_prompt] { # if no prompt, then set it to something generic
+ set shell_prompt ".*> "
+ }
+
+ set tries 0
+ set result -1
+ verbose "Starting a telnet connection to $hostname:$port" 2
+ spawn telnet $hostname $port
+ exp_send "\r\n"
+ while { $tries <= 3 } {
+ catch expect {
+ "ogin:" {
+ perror "telnet: need to login"
+ break
+ }
+ "assword:" {
+ perror "telnet: need a password"
+ break
+ }
+ -re ".*$shell_prompt.*$" {
+ verbose "Got prompt\n"
+ set result 0
+ }
+ "Connected to" {
+ exp_continue
+ }
+ -re "\[\r\n\]*" {
+ exp_continue
+ }
+ "unknown host" {
+ exp_send "\003"
+ perror "telnet: unknown host"
+ break
+ }
+ "Escape character is" {
+ exp_send "\r\n"
+ exp_continue
+ }
+ "has logged on from" {
+ exp_continue
+ }
+ "You have no Kerberos tickets" {
+ warning "telnet: no kerberos Tickets, please kinit"
+ break
+ }
+ -re "Connection refused.*$" {
+ exp_send "\003"
+ warning "telnet: connection refused."
+ }
+ -re "Sorry, this system is engaged.*" {
+ exp_send "\003"
+ warning "telnet: already connected."
+ }
+ "Connection closed by foreign host.*$" {
+ warning "telnet: connection closed by foreign host."
+ break
+ }
+ timeout {
+ exp_send "\003"
+ warning "telnet: timed out trying to connect."
+ }
+ eof {
+ perror "telnet: got unexpected EOF from telnet."
+ break
+ }
+ }
+ incr tries
+ }
+ # we look for this hear again cause it means something went wrong, and
+ # it doesn't always show up in the expect in buffer till the server times out.
+ if [info exists expect_out(buffer)] {
+ if [regexp "assword:|ogin:|" $expect_out(buffer)] {
+ perror "telnet: need to supply a login and password."
+ }
+ }
+ if { $result < 0 } {
+ catch close
+ catch wait
+# perror "telnet: couldn't connect after $tries tries."
+ set spawn_id -1
+ }
+ set target_info(target,fileid) $spawn_id
+ if [info exists target_info(target,name)] {
+ set target_info($target_info(target,name),fileid) $spawn_id
+ }
+ return $spawn_id
+}
+
+#
+# Connect to hostname using rlogin. The global RLOGIN
+# is the name of the actual rlogin program. This is for systems
+# using rlogin to braindead targets that don't support kerboros.
+# It returns either the spawn_id or a -1.
+# The final argument is the type of connection to establish, the default
+# is the target. This can also be passed as the second arg or the third.
+#
+proc rlogin { arg } {
+ global spawn_id
+ global target_info
+ global RLOGIN
+ global errno
+
+ set tries 0
+ set result -1
+
+ # get the hostname and port number from the config array
+ if [expr [string match "host" $arg] || [string match "target" $arg]] {
+ set type $arg
+ set hostname [lindex [split $target_info(${type},netport) ":"] 0]
+ if [info exists target_info($type,prompt)] {
+ set shell_prompt $target_info($type,prompt)
+ }
+ } else {
+ set hostname $arg
+ set type target
+ }
+ if ![info exists shell_prompt] { # if no prompt, then set it to something generic
+ set shell_prompt ".*> "
+ }
+
+ # get the right version of rlogin
+ if ![info exists RLOGIN] {
+ set RLOGIN rlogin
+ }
+
+ # start connection and store the spawn_id
+ verbose "Opening a $RLOGIN connection to $hostname" 2
+ spawn $RLOGIN $hostname
+ if { $spawn_id < 0 } {
+ perror "invalid spawn id from rlogin"
+ return
+ }
+ set target_info(${type},fileid) $spawn_id
+ if [info exists target_info($type,name)] {
+ set target_info($target_info($type,name),fileid) $spawn_id
+ }
+
+ # try to connect to the target. We give up after 3 attempts. At one point
+ # we used to look for the prompt, but we may not know what it looks like.
+ while { $tries <= 3 } {
+ expect {
+ -re ".*$shell_prompt.*$" {
+ verbose "Got prompt\n"
+ set result 0
+ break
+ }
+ -re "TERM = .*\\)\[ ]*$" {
+ send "dumb\r\n"
+ expect {
+ "Terminal type is*$" {
+ verbose "rlogin: set the terminal to dumb" 2
+ }
+ default {
+ warning "rlogin: couldn't set terminmal type"
+ }
+ }
+ set result 10
+ break
+ }
+ "unknown host" {
+ perror "rlogin: unknown host"
+ break
+ }
+ "has logged on from" {
+ exp_continue
+ }
+ "Terminal type is" {
+ verbose "rlogin: connected, got terminal prompt" 2
+ set result 0
+ break
+ }
+ -re "Maximum number of users already logged in.*$" {
+ warning "rlogin: maximum number of users already logged in"
+ }
+ -re "Sorry, shell is locked.*Connection closed.*$" {
+ warning "rlogin: lready connected."
+ }
+ -re "Sorry, this system is engaged.*Connection closed.*$" {
+ warning "rlogin: system engaged."
+ }
+ -re "Kerberos rcmd failed.*$" {
+ warning "rlogin: Kerberos rcmd failed, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ -re "trying normal rlogin.*$" {
+ warning "rlogin: trying normal rlogin."
+ catch close
+ catch wait
+ break
+ }
+ -re "unencrypted connection.*$" {
+ warning "rlogin: unencrypted connection, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ -re "isn't registered for Kerberos.*service.*$" {
+ warning "rsh: isn't registered, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ -re "You have no Kerberos tickets.*$" {
+ warning "rlogin: No kerberos Tickets, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ timeout {
+ warning "rlogin: timed out trying to connect."
+ }
+ eof {
+ perror "rlogin: got EOF while trying to connect."
+ break
+ }
+ }
+ incr tries
+ }
+
+ # if the error was fatal, there's nothing to send to
+ catch { send "\r\n" } tmp
+ if [string match "*invalid spawn id*" $tmp] {
+ perror "Couldn't rlogin to $hostname, fatal error."
+ catch "close $spawn_id"
+ set target_info(${type},fileid) $spawn_id
+ if [info exists target_info(${type},name)] {
+ set target_info($target_info(${type},name),fileid) $spawn_id
+ }
+ return $spawn_id
+ }
+ expect {
+ "\r\n*$" {
+ exp_continue
+ }
+ -re "\[- A-Za-z0-9\.\;\"\_\:\'\`\(\)\!\#\=\+\?\&\*]+.*$" {
+ # this is kinda gross, but if we get most any legit ascii
+ # text we figure we connected. Others tests later will
+ # determine if the connection actually works.
+ verbose "We got some text" 2
+ }
+ }
+
+ # see if we maxed out on errors
+ if { $result < 0 } {
+ catch close
+ catch wait
+# perror "rlogin: couldn't rlogin to $hostname, Too many errors"
+ catch "close $spawn_id"
+ set spawn_id -1
+ set target_info(${type},fileid) $spawn_id
+ if [info exists target_info(${type},name)] {
+ set target_info($target_info(${type},name),fileid) $spawn_id
+ }
+ } else {
+ verbose "rlogin: connected to $hostname" 2
+ }
+
+ return $spawn_id
+}
+
+#
+# Connect to hostname using rsh
+#
+proc rsh { arg } {
+ global spawn_id
+ global target_info
+ global RSH
+ global errno
+
+ set tries 0
+ set result -1
+
+ # get the hostname and port number from the config array
+ if [expr [string match "host" $arg] || [string match "target" $arg]] {
+ set type $arg
+ set hostname [lindex [split $target_info(${type},netport) ":"] 0]
+ if [info exists target_info(${type},prompt)] {
+ set shell_prompt $target_info(${type},prompt)
+ }
+ } else {
+ set hostname $arg
+ set type target
+ }
+ if ![info exists shell_prompt] { # if no prompt, then set it to something generic
+ set shell_prompt ".*> "
+ }
+
+ if ![info exists RSH] {
+ set RSH rsh
+ }
+ spawn $RSH $hostname
+ if { $spawn_id < 0 } {
+ perror "invalid spawn id from rsh"
+ return
+ }
+ set target_info(${type},fileid) $spawn_id
+ if [info exists target_info(${type},name)] {
+ set target_info($target_info(${type},name),fileid) $spawn_id
+ }
+ if [info exists target_info(${type},prompt)] {
+ set prompt $target_info(${type},prompt)
+ }
+ send "\r\n"
+ while { $tries <= 3 } {
+ expect {
+ -re ".*$shell_prompt.*$" {
+ verbose "Got prompt\n"
+ set result 0
+ break
+ }
+ -re "TERM = .*$" {
+ warning "Setting terminal type to vt100"
+ set result 0
+ send "vt100\n"
+ break
+ }
+ "unknown host" {
+ exp_send "\003"
+ perror "telnet: unknown host"
+ break
+ }
+ "has logged on from" {
+ exp_continue
+ }
+ -re "isn't registered for Kerberos.*service.*$" {
+ warning "rsh: isn't registered for Kerberos, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ -re "Kerberos rcmd failed.*$" {
+ warning "rsh: Kerberos rcmd failed, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ -re "You have no Kerberos tickets.*$" {
+ warning "rsh: No kerberos Tickets, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ "Terminal type is" {
+ verbose "rsh: connected, got terminal prompt" 2
+ set result 0
+ break
+ }
+ -re "trying normal rlogin.*$" {
+ warning "rsh: trying normal rlogin."
+ catch close
+ catch wait
+ break
+ }
+ -re "unencrypted connection.*$" {
+ warning "rsh: unencrypted connection, please kinit"
+ catch close
+ catch wait
+ break
+ }
+ -re "Sorry, shell is locked.*Connection closed.*$" {
+ warning "rsh: already connected."
+ }
+ timeout {
+ warning "rsh: timed out trying to connect."
+ }
+ eof {
+ perror "rsh: got EOF while trying to connect."
+ break
+ }
+ }
+ incr tries
+ }
+
+ if { $result < 0 } {
+# perror "rsh: couldn't connect after $tries tries."
+ set spawn_id -1
+ }
+ set target_info(${type},fileid) $spawn_id
+ if [info exists target_info(${type},name)] {
+ set target_info($target_info(${type},name),fileid) $spawn_id
+ }
+ return $spawn_id
+}
+
+#
+# Download an executable to a network neighbor
+#
+# DEST is assumed to already contain the nodename.
+# Returns the status returned by the rcp command.
+#
+proc rcp_download { src dest } {
+ set status [catch "exec rcp $src $dest" output]
+ if { $status == 0 } {
+ verbose "Copied $src to $dest" 2
+ } else {
+ verbose "Download to $dest failed, $output."
+ }
+ return $status
+}
+
+#
+# This proc is deprecated. Please use `execute_anywhere' instead.
+#
+# Execute a program on the remote system using rsh
+#
+# SYSTEM is the host name of the system to run the program on.
+# CMD is the program to run (including path) and any arguments.
+# The result is a list of two elements.
+# First element: 0 for success, 1 for failure, -1 for comms failure.
+# Second element: program output (success/failure) or error message (comms).
+#
+proc rsh_exec { system cmd } {
+ verbose "Executing $system:$cmd" 3
+ # If CMD sends any output to stderr, exec will think it failed. More often
+ # than not that will be true, but it doesn't catch the case where there is
+ # no output but the exit code is non-zero. The "2>&1" is done on the
+ # remote system and is not a special flag for `exec'.
+ set status [catch "exec rsh $system $cmd 2>&1 \\; echo XYZ$?ZYX" output]
+ # `status' doesn't mean much here other than rsh worked ok.
+ # What we want is whether $cmd ran ok.
+ if { $status != 0 } {
+ regsub "XYZ(\[0-9\]*)ZYX\n?" $output "" output
+ return [list -1 "rsh to $system failed for $cmd, $output"]
+ }
+ regexp "XYZ(\[0-9\]*)ZYX" $output junk status
+ verbose "rsh_exec: status:$status text:$output" 4
+ if { $status == "" } {
+ return [list -1 "Couldn't parse rsh output, $output."]
+ }
+ regsub "XYZ(\[0-9\]*)ZYX\n?" $output "" output
+ # Delete one trailing \n because that is what `exec' will do and we want
+ # to behave identical to it.
+ regsub "\n$" $output "" output
+ return [list [expr $status != 0] $output]
+}
+
+#
+# Connect to using tip
+# port - must be a name from /etc/remote, or "host" or "target".
+# returns -1 if it failed, the spawn_id if it worked
+#
+proc tip { arg } {
+ global verbose
+ global shell_prompt
+ global target_info
+ global spawn_id
+
+ set tries 0
+ set result -1
+
+ if [expr [string match "host" $arg] || [string match "target" $arg]] {
+ set port $target_info(${type},target)
+ if [info exists target_info(${type},prompt)] {
+ set shell_prompt $target_info(${type},prompt)
+ }
+ } else {
+ set port $arg
+ }
+ if ![info exists shell_prompt] { # if no prompt, then set it to something generic
+ set shell_prompt ".*> "
+ }
+
+ spawn tip -v $port
+ if { $spawn_id < 0 } {
+ perror "invalid spawn id from tip"
+ return -1
+ }
+ set target_info(target,fileid) $spawn_id
+ set target_info($target_info(target,name),fileid) $spawn_id
+ expect {
+ -re ".*connected.*$" {
+ send "\r\n"
+ expect {
+ -re ".*$shell_prompt.*$" {
+ verbose "Got prompt\n"
+ set result 0
+ incr tries
+ }
+ timeout {
+ warning "Never got prompt."
+ set result -1
+ incr tries
+ if $tries<=2 {
+ exp_continue
+ }
+ }
+ }
+ }
+ -re "all ports busy.*$" {
+ set result -1
+ perror "All ports busy."
+ incr tries
+ if { $tries <= 2 } {
+ exp_continue
+ }
+ }
+ -re "Connection Closed.*$" {
+ perror "Never connected."
+ set result -1
+ incr tries
+ if { $tries <= 2 } {
+ exp_continue
+ }
+ }
+ -re ".*: Permission denied.*link down.*$" {
+ perror "Link down."
+ set result -1
+ incr tries
+ }
+ timeout {
+ perror "Timed out trying to connect."
+ set result -1
+ incr tries
+ if { $tries <= 2 } {
+ exp_continue
+ }
+ }
+ eof {
+ perror "Got unexpected EOF from tip."
+ set result -1
+ incr tries
+ }
+ }
+
+ send "\n~s"
+ expect {
+ "~\[set\]*" {
+ verbose "Setting verbose mode" 1
+ send "verbose\n\n\n"
+ }
+ }
+
+ if { $result < 0 } {
+ perror "Couldn't connect after $tries tries."
+ set target_info(${type},fileid) -1
+ set target_info($target_info(${type},name),fileid) -1
+ return -1
+ } else {
+ set target_info(${type},fileid) $spawn_id
+ set target_info($target_info(${type},name),fileid) $spawn_id
+ return $spawn_id
+ }
+}
+
+#
+# Downloads using the ~put command under tip
+# arg - is a full path name to the file to download
+# returns 1 if an error occured, otherwise it returns
+# the spawn_id.
+#
+proc tip_download { shell_id file } {
+ global verbose
+ global decimal
+ global shell_prompt
+ global expect_out
+
+ set result 1
+ if ![file exists $file] {
+ perror "$file doesn't exist."
+ return 1
+ }
+
+ send -i $shell_id "\n~p"
+ expect {
+ -i $shell_id "~\[put\]*" {
+ verbose "Downloading $file, please wait" 1
+ send -i $shell_id "$file\n"
+ set timeout 50
+ expect {
+ -i $shell_id -re ".*$file.*$" {
+ exp_continue
+ }
+ -i $shell_id -re ".*lines transferred in.*minute.*seconds.*$shell_prompt.*$" {
+ verbose "Download $file successfully" 1
+ set result 0
+ }
+ -i $shell_id -re ".*Invalid command.*$shell_prompt$" {
+ warning "Got an Invalid command to the monitor"
+ }
+ -i $shell_id -re ".*$decimal\r" {
+ if [info exists expect_out(buffer)] {
+ verbose "$expect_out(buffer)"
+ exp_continue
+ }
+ }
+ -i $shell_id timeout {
+ perror "Timed out trying to download."
+ set result 1
+ }
+ }
+ }
+ timeout {
+ perror "Timed out waiting for response to put command."
+ }
+ }
+ set timeout 10
+ return $result
+}
+
+#
+# Connect to using kermit
+# args - first is the device name, ie. /dev/ttyb
+# second is the optional baud rate. If this is "host" or "target" the
+# config array is used instead.
+# returns -1 if it failed, otherwise it returns
+# the spawn_id.
+#
+proc kermit { args } {
+ global verbose
+ global shell_prompt
+ global spawn_id
+
+ if { [llength $args] == 1 } {
+ set baud 9600
+ } else {
+ set baud [lindex $args 1]
+ }
+
+ if [expr [string match "host" [lindex $args 0]] || [string match "target" [lindex $arg 0]]] {
+ set device $target_info(${type},serial)
+ if [info exists target_info(${type},baud)] {
+ set baud $target_info(${type},baud)
+ }
+ } else {
+ set device [lindex $args 0]
+ }
+
+ set tries 0
+ set result -1
+ spawn kermit -l $device -b $baud
+ if { $spawn_id < 0 } {
+ perror "invalid spawn id from kermit"
+ return -1
+ }
+ set target_info(${type},fileid) $spawn_id
+ set target_info($target_info(${type},name),fileid) $spawn_id
+ expect {
+ -re ".*ermit.*>.*$" {
+ send "c\n"
+ expect {
+ -re ".*Connecting to $port.*Type the escape character followed by C to.*$" {
+ verbose "Got prompt\n"
+ set result 0
+ incr tries
+ }
+ timeout {
+ warning "Never got prompt."
+ set result -1
+ incr tries
+ if { $tries <= 2 } {
+ exp_continue
+ }
+ }
+ }
+ }
+ -re "Connection Closed.*$" {
+ perror "Never connected."
+ set result -1
+ incr tries
+ if { $tries <= 2 } {
+ exp_continue
+ }
+ }
+ timeout {
+ warning "Timed out trying to connect."
+ set result -1
+ incr tries
+ if { $tries<=2 } {
+ exp_continue
+ }
+ }
+ }
+
+ if { $result < 0 } {
+ perror "Couldn't connect after $tries tries."
+ set target_info(${type},fileid) -1
+ set target_info($target_info(${type},name),fileid) -1
+ return -1
+ } else {
+ set target_info(${type},fileid) $spawn_id
+ set target_info($target_info(${type},name),fileid) $spawn_id
+ return $spawn_id
+ }
+}
+
+#
+# exit the remote shell
+#
+# ??? This proc is deprecated. Please use `remote_close' instead.
+proc exit_remote_shell { shell_id } {
+ return [remote_close $shell_id]
+}
+
+#
+# Download a file using stdin. This will download a file
+# regardless of whether rlogin, telnet, tip, or kermit was
+# used to establish the connection.
+#
+proc download { args } {
+ global spawn_id
+ global verbose
+
+ set file [lindex $args 0]
+
+ if { [llength $args] > 1 } {
+ set shellid [lindex $args 1]
+ } else {
+ set shellid $spawn_id
+ }
+
+ set lines 0
+ set fd [open $file r]
+ while { [gets $fd cur_line] >= 0 } {
+ set errmess ""
+ catch "send -i $shellid \"$cur_line\"" errmess
+ if [string match "write\(spawn_id=\[0-9\]+\):" $errmess] {
+ perror "sent \"$command\" got expect error \"$errmess\""
+ catch "close $fd"
+ return -1
+ }
+ verbose "." 2
+ verbose "Sent $cur_line" 3
+ incr lines
+ }
+ verbose "$lines lines downloaded"
+ close $fd
+ return 0
+}
diff --git a/contrib/bluegnu2.0.3/lib/serverUtils.itcl b/contrib/bluegnu2.0.3/lib/serverUtils.itcl
new file mode 100644
index 0000000..7e7c8bb
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/serverUtils.itcl
@@ -0,0 +1,51 @@
+#
+#
+#
+
+proc EvalServer {port {interp {}} {openCmd EvalOpenProc}} {
+ puts "in EvalServer"
+ socket -server [list EvalAccept $interp $openCmd] $port
+}
+
+proc EvalAccept {interp openCmd newsock addr port} {
+ global eval
+
+ puts "in EvalAccept"
+ set eval(cmdbuf,$newsock) {}
+ puts "[fconfigure $newsock]"
+ fconfigure $newsock -buffering line
+ fileevent $newsock readable [list EvalRead $newsock $interp]
+ puts "in EvalAccept: got fileevent"
+ if [catch {
+ interp eval $interp $openCmd $newsock $addr $port
+ }] {
+ close $newsock
+ }
+}
+
+proc EvalOpenProc {sock addr port} {
+ puts "in EvalOpenProc"
+ # dummy
+}
+
+proc EvalRead {sock interp} {
+ global eval errorInfo errorCode
+
+ puts "in EvalRead"
+ if [eof $sock] {
+ close $sock
+ } else {
+ gets $sock line
+ append eval(cmdbuf,$sock) "$line\n"
+ if {[string length $eval(cmdbuf,$sock)] && \
+ [info complete $eval(cmdbuf,$sock)]} {
+ puts ">$eval(cmdbuf,$sock)<"
+ }
+ set reply "Done\n"
+ puts $sock 1
+ puts -nonewline $sock $reply
+ flush $sock
+ set eval(cmdbuf,$sock) {}
+ }
+}
+
diff --git a/contrib/bluegnu2.0.3/lib/target.exp b/contrib/bluegnu2.0.3/lib/target.exp
new file mode 100644
index 0000000..1454dad
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/target.exp
@@ -0,0 +1,520 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+# a hairy pattern to recognize text
+set text "\[- A-Za-z0-9\.\;\"\_\:\'\`\(\)\!\#\=\+\?\&\*]"
+
+#
+# this is a collection of support procs for the target data
+# structures. We use a named array, since Tcl has no real data
+# structures. Here's the special index words for the array:
+# Required fields are:
+# name - the name of the target. (mostly for error messages) This
+# should also be the string used for this target's array.
+# It should also be the same as the linker script so we
+# can find them dynamically.
+# Optional fields are:
+# ldflags - the flags required to produce a fully linked executable.
+# config - the target canonical for this target. This is a regexp
+# as passed to istarget or isnative.
+# cflags - the flags required to produce an object file from a
+# source file.
+# connect - the connectmode for this target. This is for both IP and
+# serial connections.
+# target - the hostname of the target. This is for TCP/IP based connections,
+# and is also used for version of tip that use /etc/remote.
+# serial - the serial port. This is typically /dev/tty? or com?:.
+# netport - the IP port.
+# baud - the baud rate for a serial port connection.
+# x10 - parameters for the x10 controller (used to reboot)
+# fileid - the fileid or spawn id of of the connection.
+# prompt - a regexp for matching the prompt.
+# abbrev - abbreviation for tool init files.
+# ioport - the port for I/O on dual port systems.
+#
+# there are three main arrays, indexed in with "target", "build", and "host".
+# all other targets are indexed with a name usually based on the linker script
+# like "idp", or "ex93x.ld".
+#
+
+#
+# Set the elements of the target data structure
+# The order of the values is name, ldflags, config, cflags, connect, target, serial,
+# netport, baud, x10, fileid, prompt, abbrev, ioport.
+# FIXME: I'm not entirely sure this proc is a good idea...
+proc set_target_info { args } {
+ global target_info
+
+ set name [lindex $args 0]
+
+ # process the linker arguments
+ if { [llength $args] > 0 } {
+ set target_info($name,ldflags) [lindex $args 1]
+ } else {
+ set target_info($name,ldflags) ""
+ }
+
+ # process the config string
+ if { [llength $args] > 1 } {
+ set target_info($name,config) [lindex $args 2]
+ } else {
+ set target_info($name,config) ""
+ }
+
+ # process the compiler arguments
+ if { [llength $args] > 2 } {
+ set target_info($name,cflags) [lindex $args 3]
+ } else {
+ set target_info($name,cflags) ""
+ }
+
+ # process the connection mode
+ if { [llength $args] > 3 } {
+ set target_info($name,connect) [lindex $args 3]
+ } else {
+ set target_info($name,connect) ""
+ }
+
+ # process the target's hostname
+ if { [llength $args] > 4 } {
+ set target_info($name,target) [lindex $args 3]
+ } else {
+ set target_info($name,target) ""
+ }
+
+ # process the serial port
+ if { [llength $args] > 5 } {
+ set target_info($name,serial) [lindex $args 3]
+ } else {
+ set target_info($name,serial) ""
+ }
+
+ # process the netport
+ if { [llength $args] > 6 } {
+ set target_info($name,netport) [lindex $args 3]
+ } else {
+ set target_info($name,netport) ""
+ }
+
+ # process the baud
+ if { [llength $args] > 7 } {
+ set target_info($name,baud) [lindex $args 3]
+ } else {
+ set target_info($name,baud) ""
+ }
+
+ # process the x10 unit number.
+ if { [llength $args] > 8 } {
+ set target_info($name,x10) [lindex $args 3]
+ } else {
+ set target_info($name,x10) ""
+ }
+
+ # process the fileid
+ if { [llength $args] > 9 } {
+ set target_info($name,fileid) [lindex $args 3]
+ } else {
+ set target_info($name,fileid) ""
+ }
+
+ # process the prompt
+ if { [llength $args] > 10 } {
+ set target_info($name,prompt) [lindex $args 3]
+ } else {
+ set target_info($name,prompt) ""
+ }
+
+ # process the abbrev
+ if { [llength $args] > 10 } {
+ set target_info($name,connect) [lindex $args 3]
+ } else {
+ set target_info($name,connect) ""
+ }
+
+ # process the ioport
+ if { [llength $args] > 11 } {
+ set target_info($name,ioport) [lindex $args 3]
+ } else {
+ set target_info($name,ioport) ""
+ }
+}
+
+#
+# Set the target connection.
+#
+proc push_target { name } {
+ pop_config target
+ push_config target $name
+}
+
+#
+# Set the host connnection.
+#
+proc push_host { name } {
+ pop_config host
+ push_config host $name
+}
+
+#
+# Set the config for the current host or target connection.
+#
+proc push_config { type name } {
+ global target_info
+
+ if [info exists target_info(${name},name)] {
+ set target_info($type,name) $name
+ }
+ if [info exists target_info(${name},ldflags)] {
+ set target_info($type,ldflags) $target_info(${name},ldflags)
+ }
+ if [info exists target_info(${name},config)] {
+ set target_info($type,config) $target_info(${name},config)
+ }
+ if [info exists target_info(${name},cflags)] {
+ set target_info($type,cflags) $target_info(${name},cflags)
+ }
+ if [info exists target_info(${name},connect)] {
+ set target_info($type,connect) $target_info(${name},connect)
+ }
+ if [info exists target_info(${name},target)] {
+ set target_info($type,target) $target_info(${name},target)
+ }
+ if [info exists target_info(${name},serial)] {
+ set target_info($type,serial) $target_info(${name},serial)
+ }
+ if [info exists target_info(${name},netport)] {
+ set target_info($type,netport) $target_info(${name},netport)
+ }
+ if [info exists target_info(${name},baud)] {
+ set target_info($type,baud) $target_info(${name},baud)
+ }
+ if [info exists target_info(${name},x10)] {
+ set target_info($type,x10) $target_info(${name},x10)
+ }
+ if [info exists target_info(${name},fileid)] {
+ set target_info($type,fileid) $target_info(${name},fileid)
+ }
+ if [info exists target_info(${name},prompt)] {
+ set target_info($type,prompt) $target_info(${name},prompt)
+ }
+ if [info exists target_info(${name},abbrev)] {
+ set target_info($type,abbrev) $target_info(${name},abbrev)
+ }
+ if [info exists target_info(${name},ioport)] {
+ set target_info($type,ioport) $target_info(${name},ioport)
+ }
+}
+
+#
+# Set the current connection for target or host.
+#
+proc pop_config { type } {
+ global target_info
+
+ set target_info(${type},name) ""
+ set target_info(${type},ldflags) ""
+ set target_info(${type},config) ""
+ set target_info(${type},cflags) ""
+ set target_info(${type},connect) ""
+ set target_info(${type},target) ""
+ set target_info(${type},serial) ""
+ set target_info(${type},netport) ""
+ set target_info(${type},baud) ""
+ set target_info(${type},x10) ""
+ set target_info(${type},fileid) ""
+ set target_info(${type},prompt) ""
+ set target_info(${type},abbrev) ""
+ set target_info(${type},ioport) ""
+}
+
+#
+# Unset the target connection.
+#
+proc pop_target { } {
+ pop_config target
+}
+
+
+#
+# Unset the host connection.
+#
+proc pop_host { } {
+ pop_config host
+}
+
+#
+# list all the configured targets.
+# returns:
+# "" if there are no targets.
+# else it returns a list of unique names.
+#
+proc list_targets { } {
+ global target_info
+
+ if ![info exists target_info] {
+ return ""
+ }
+
+ set j ""
+ set targs ""
+ foreach i "[lsort [array names target_info]]" {
+ set i "[lindex [split $i ","] 0]"
+ if { $i == $j } {
+ continue
+ } else {
+ lappend targs "[lindex [split $i ","] 0]"
+ set j $i
+ }
+ }
+ return $targs
+}
+
+#
+# Remove extraneous warnings we don't care about
+#
+proc prune_warnings { text } {
+ # remove the \r part of "\r\n" so we don't break all the patterns
+ # we want to match.
+ regsub -all -- "\r" $text "" text
+
+ # This is from sun4's. Do it for all machines for now.
+ # The "\\1" is to try to preserve a "\n" but only if necessary.
+ if [ishost "sparc-*-sunos"] {
+ regsub -all "(^|\n)(ld.so: warning:\[^\n\]*\n?)+" $text "\\1" text
+ }
+
+ # See Brendan for the raison d'etre of this one.
+ if [ishost "alpha*-*-*"] {
+ regsub -all "(^|\n)(/usr/(ucb|bin)/ld.*without exceptions was\[^\n\]+\n?)" $text "\\1" text
+ }
+
+
+ # Ignore these.
+ regsub -all "(^|\n)\[^\n\]*linker input file unused since linking not done" $text "" text
+ regsub -all "(^|\n)\[^\n\]*file path prefix \[^\n\]* never used" $text "" text
+
+ # It might be tempting to get carried away and delete blank lines, etc.
+ # Just delete *exactly* what we're ask to, and that's it.
+ return $text
+}
+
+#
+# Invoke the compiler. This gets interesting cause the compiler may
+# not be on the same machine we're running DejaGnu on.
+#
+proc compile { arg } {
+ global target_info
+ global comp_output
+ global CC
+
+ if [info exists target_info(target,cflags)] {
+ lappend options "$target_info(target,cflags)"
+ }
+
+ append options " $arg"
+
+ verbose "Invoking the compiler as $CC $options"
+ set comp_output [prune_warnings [execute_anywhere "$CC $options"]]
+ return ${comp_output}
+}
+
+#
+# Invoke the archiver.
+#
+proc archive { arg } {
+ global target_info
+ global comp_output
+ global AR
+
+ if [info exists target_info(target,arflags)] {
+ lappend options "$target_info(target,arflags)"
+ }
+ append options "$arg"
+
+ verbose "Invoking the archiver as $AR $options"
+ set comp_output [prune_warnings [execute_anywhere "$AR $options"]]
+ return ${comp_output}
+}
+
+proc ranlib { arg } {
+ global target_info
+ global comp_output
+ global RANLIB
+
+ append options "$arg"
+
+ verbose "Invoking the archiver as $RANLIB $options"
+ set comp_output [prune_warnings [execute_anywhere "$RANLIB $options"]]
+ return ${comp_output}
+}
+
+#
+# Link a few objects together. This gets interesting cause the
+# objects may not be on the same machine we're running DejaGnu on.
+#
+proc link_objects { arg } {
+ global target_info
+ global comp_output
+ global LD
+
+ set options "$arg"
+ if [info exists target_info(target,ldlags)] {
+ lappend options "$target_info(target,ldlags)"
+ }
+
+ set comp_output [execute_anywhere "$LD $args"]
+ return [ prune_warnings $comp_output]
+}
+
+#
+# Remotely execute something. This gets fun cause we can't expect an
+# Unix machine on the other end. We'll use expect instead so we can
+# connect using $connectmode. This is really designed for executing
+# the tools to be tested, rather than the test cases.
+#
+proc execute_anywhere { cmdline } {
+ global exec_output
+ global target_info
+
+ if ![info exists target_info(current,prompt)] {
+ set prompt ""
+ } else {
+ set prompt $target_info(current,prompt)
+ }
+
+ # if we're running stuff that's hosted on the same machine
+ if ![is3way] {
+ verbose -log "Executing on local host: ${cmdline}" 2
+ set status [catch "exec ${cmdline}" exec_output]
+ if ![string match "" ${exec_output}] {
+ # FIXME: This should be done below, after `else'.
+ verbose -log -- "${exec_output}" 2
+ }
+ return ${exec_output}
+ } else {
+ verbose -log "Executing on remote host: ${cmdline}" 2
+ # open the connection
+ verbose "Connecting to remote host" 2
+ set shellid [remote_open "host"]
+ if { $shellid < 0 } {
+ perror "Can't open connection to remote host"
+ return REMOTERROR
+ }
+# stty -echo
+ send -i $shellid "echo START ; $cmdline ; echo END\r\n"
+ expect {
+ -i $shellid "echo START \; $cmdline \; echo END" {
+ }
+ default {
+ warning "Never got command echo"
+ }
+ }
+ expect {
+ -i $shellid "START" {
+ exp_continue
+ }
+ -i $shellid "END" {
+ regsub -all "\]" $expect_out(buffer) "" exec_output
+ regsub "END" $exec_output "" exec_output
+ } default {
+ set exec_output $i
+ }
+ }
+ }
+
+ if [info exists exec_output] {
+ verbose "EXEC_OUTPUT = \"$exec_output\"" 2
+ }
+
+
+# stty echo
+ # close the connection
+ remote_close $shellid
+
+ if [info exists exec_output] {
+ return $exec_output
+ } else {
+ return REMOTERROR
+ }
+}
+
+#
+# Get something resembling a prompt We can't grab more
+# than the last word cause we have no real idea how long
+# the prompt is. We also get the full prompt, but it's
+# kinda useless as it might contain command numbers or
+# paths that change. If we can't return a prompt, return
+# null. so at least other patterns won't break.
+#
+proc getprompt { shellid } {
+ global spawn_id
+
+ if { $shellid < 0 } {
+ perror "Invalid spawn id"
+ return ""
+ }
+
+ set tries 0
+ set text ""
+
+ while { $tries <=3 } {
+ verbose "Trying to get the remote host's prompt"
+ send -i $shellid "ACK\r\n"
+ expect {
+ -i $shellid -re "Kerberos rcmd failed.*$" {
+ perror "Need to kinit"
+ return ""
+ }
+ -i $shellid -re "$text*\[\r\n\]*" {
+ return [lindex [split $expect_out(buffer) "\r\n"] 5]
+ break
+ }
+ -i $shellid -re "Terminal type is.*tty.*\>" {
+ return [lindex [split $expect_out(buffer) "\r\n"] 5]
+ break
+ }
+ -i $shellid "" {
+ warning "No prompt"
+ }
+ -i $shellid timeout {
+ perror "Couldn't sync with the remote system"
+ }
+ -i $shellid eof {
+ perror "Got EOF instead of a prompt"
+ }
+ }
+ incr tries
+ }
+
+ # see if we maxed out on errors
+ if { $tries >= 3 } {
+ warning "Couldn't get the prompt"
+ return ""
+ }
+}
+
+
+#
+#
+#
+proc make { args } {
+ perror "Unimplemented"
+}
diff --git a/contrib/bluegnu2.0.3/lib/tclIndex b/contrib/bluegnu2.0.3/lib/tclIndex
new file mode 100644
index 0000000..7b09971
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/tclIndex
@@ -0,0 +1,21 @@
+# Tcl autoload index file: each line identifies a Tcl
+
+doCmd testSessionFramework.itcl
+
+send_user nonexpect.itcl
+send_error nonexpect.itcl
+send_log nonexpect.itcl
+log_file nonexpect.itcl
+
+::BlueGnu::Application testSessionApplication.itcl
+::BlueGnu::Environment testSessionClasses.itcl
+::BlueGnu::Target testSessionClasses.itcl
+::BlueGnu::Test testSessionClasses.itcl
+::BlueGnu::Queue testSessionClasses.itcl
+::BlueGnu::Error testSessionClasses.itcl
+
+Default Default_target.itcl
+BlueGnu BlueGnu_target.itcl
+
+# Types
+Type Types.itcl
diff --git a/contrib/bluegnu2.0.3/lib/testSessionApplication.itcl b/contrib/bluegnu2.0.3/lib/testSessionApplication.itcl
new file mode 100644
index 0000000..3d57722
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/testSessionApplication.itcl
@@ -0,0 +1,314 @@
+#
+# This file defines the Application Class
+#
+
+source $env(BLUEGNULIB)/testSessionFramework.itcl
+source $env(BLUEGNULIB)/testSessionClasses.itcl
+
+namespace eval ::BlueGnu {
+ class Application {
+ protected variable szName "Default"
+ protected variable lTargets {}
+ protected variable lTests
+ protected variable szCurrentTarget
+ protected variable objCurrentTarget
+ protected variable objEnvironment
+ protected variable szOutDir
+
+ constructor {args} {
+ debug {======= Doing Application construction} 3
+ set szOutDir "..."
+ foreach varval $args {
+ set varval [split $varval "="]
+ if {[llength $varval] != 2} {
+ error "Missing <variable>=<value> pair"
+ }
+ set var [lindex $varval 0]
+ set val [lindex $varval 1]
+ set variables {}
+ foreach v [lsort [info variable]] {
+ regexp {[^:]+$} $v v
+ lappend variables $v
+ }
+ if {[lsearch -exact $variables $var] >= 0} {
+ set $var $val
+ } else {
+ error "$var does not exists in Class [info class]"
+ }
+ }
+ }
+
+ destructor {
+ }
+
+ public method execute {} {
+ debug {======= Starting with Execution of the Application} 3
+ debug { list of indexes for lTests is [array names lTests]} 4
+ set iTarget 0
+ set objEnvironment [uplevel #0 \
+ "::BlueGnu::Environment #auto \
+ szName=$szName"]
+ debug { objEnvironment = >$objEnvironment<} 3
+ debug { +++ [infoWhich $objEnvironment] +++} 4
+ debug { === [::itcl::find objects] ===} 4
+ uplevel #0 set objCurrentEnvironment $objEnvironment
+ foreach target $lTargets {
+ set szTargetName [lindex [split $target "="] 0]
+ open_logs $szTargetName
+ incr iTarget
+ # set current Test Suite Namespace
+ uplevel #0 set nspTestSuite "::TestSuite[format %.5d $iTarget]"
+ debug { Processing target: >$target< in Test Suite\
+ [uplevel set nspTestSuite]} 3
+ namespace eval [uplevel set nspTestSuite] {
+ debug { Context is >[namespace current]<} 3
+ variable iTestNr 0
+ proc autoTest {} {
+ variable iTestNr
+
+ incr iTestNr
+ debug {iTestNr = $iTestNr} 5
+ debug {namespace current = >[namespace current]<} 5
+ debug {format = >T[format %.5d $iTestNr]<} 5
+ return [namespace current]::T[format %.5d $iTestNr]
+ }
+
+ set target [uplevel set target]
+ debug { In namespace eval [namespace current]\
+ for target: >$target<} 3
+ if {! [catch {
+ if {[string length $target] == 0} {
+ # Create a default Target Object
+ #
+ debug { Create a default Target Object} 3
+ uplevel #0 set objCurrentTarget \
+ [infoWhich \
+ [::BlueGnu::Target #auto \
+ szID=default \
+ szName=default \
+ objQueue=[infoWhich [::BlueGnu::Queue #auto]] \
+ objEnvironment=[uplevel set objEnvironment]]]
+ } else {
+ # Call the Target Procedure
+ # This procedure should return a Target Object.
+ # Arguments are passed to this procedure.
+ debug { Create target: >$target<} 3
+ set list [split $target "="]
+ uplevel #0 set objCurrentTarget \
+ [infoWhich \
+ [eval [lindex $list 0] \
+ [join [lrange $list 1 end] "="] \
+ objEnvironment=[uplevel set objEnvironment]]]
+ }
+ } szErrMsg]} {
+ debug { Current Target is\
+ >[set target \
+ [uplevel #0 set objCurrentTarget]]<} 3
+
+ debug { Working with target index\
+ [uplevel set iTarget]} 4
+ if {[uplevel {info exists lTests($iTarget)}]} {
+ foreach test [uplevel {set lTests($iTarget)}] {
+ debug { test: $test} 3
+ $target queue append $test
+ }
+ }
+ $target start
+ $target runTests
+ $target exit
+
+ # report results of the testing
+ #
+ debug { #### All Objects: [::itcl::find objects]} 3
+ foreach T [lsort [::itcl::find objects T*]] {
+ debug { #### Deleting Object $T\
+ ([$T info class])} 0
+ delete object $T
+ }
+ # remove constructed objects
+ #
+ debug { Removing Target Class Object $target} 3
+ delete object $target
+ } else {
+ global errorCode errorInfo
+ perror "Couldn't create target >$target<!\
+ \n May be no procedure with name\
+ >$target< defined!\
+ \n errorMsg : >$szErrMsg<\
+ \n errorInfo: >$errorInfo<\
+ \n errorCode: >$errorCode<"
+ debug { error info:\n$errorInfo} 3
+ }
+ }
+ namespace delete [uplevel set nspTestSuite]
+ close_logs
+ }
+ debug { objects: >[::itcl::find objects]<} 4
+ debug {####### deleting Object Environment >$objEnvironment<} 4
+ delete object $objEnvironment
+ }
+
+ public method processArguments {arguments} {
+ upvar $arguments argv
+ global szCurrentTestDirectory
+
+ set state NORMAL
+ set iTarget 0
+ foreach arg $argv {
+ switch -regexp -- $arg {
+ {^-a(l(l)?)?$} {
+ debug { all_flag set to TRUE} 4
+ set ::BlueGnu::all_flag 1
+ }
+ {^-o(u(t(d(i(r)?)?)?)?)?$} {
+ debug { Output Directory is next argument} 4
+ set state OUTDIR
+ }
+ {^--o(u(t(d(i(r)?)?)?)?)?=.*} {
+ set components [split $arg "="]
+ debug { Processing Output Directory >$arg<} 4
+ set szOutDir [lindex $components 1]
+ set state NORMAL
+ }
+ {^-[-]?t(a(r(g(e(t)?)?)?)?)?([=].*|$)} {
+ set components [split $arg "="]
+ if {[llength $components] == 1} {
+ debug { Target is next argument} 4
+ set state TARGET
+ } else {
+ debug { Processing Target >$arg<} 4
+ setTarget iTarget \
+ [join [lrange $components 1 end] "="]
+ set state NORMAL
+ }
+ }
+ default {
+ debug { Processing argument: >$arg<} 3
+ switch $state {
+ OUTDIR {
+ set szOutDir $arg
+ set state NORMAL
+ }
+ TARGET {
+ setTarget iTarget $arg
+ set state NORMAL
+ }
+ NORMAL {
+ set components [split $arg "="]
+ regexp {([^[]*)(.*)} [lindex $components 0] \
+ dummy szFileName szCaseArgs
+ append szCaseArgs "=[join \
+ [lrange $components 1 end] "="]"
+ debug { arg: >$arg<} 3
+ debug { components: >$components<} 3
+ debug { case+args: >$szCaseArgs<} 3
+ debug { Test Script: >$szFileName<} 3
+ debug { : >$szCurrentTestDirectory<} 3
+ set szDname [file dirname $szFileName]
+ set szFname [file tail $szFileName]
+
+ if {[file exist [set test [file join \
+ $szCurrentTestDirectory \
+ $szFileName]]]} {
+ # file should be a test
+ debug { is a test: >$test<!} 3
+ if {! [info exists szCurrentTarget]} {
+ setTarget iTarget {}
+ }
+ lappend lTests($iTarget) \
+ [file join \
+ $szCurrentTestDirectory \
+ $arg]
+ debug { Appended test:\
+ >[file join \
+ $szCurrentTestDirectory \
+ $arg]<!} 3
+ } elseif {[llength [set tests \
+ [locateFile $szFname $szDname]]] > 0} {
+ foreach test $tests {
+ if {[file exists $test]} {
+ # file should be a test
+ debug { is a test:\
+ >$test<!!} 3
+ if {! [info exists\
+ szCurrentTarget]} {
+ setTarget iTarget {}
+ }
+ lappend lTests($iTarget) \
+ $test$szCaseArgs
+ debug { Appended test:\
+ >$test$szCaseArgs<!!} 2
+ } else {
+ warning "Test >$test< can't\
+ be found"
+ }
+ }
+ } else {
+ perror "$szFileName is not a test!\
+ Does not exists!"
+ }
+ }
+ }
+ }
+ }
+ }
+ debug { ==== Found tests:} 3
+ foreach index [lsort [array names lTests]] {
+ debug { lTests($index) = $lTests($index)} 4
+ }
+ debug { Targets are: $lTargets} 4
+ }
+ private method setTarget {index target} {
+ upvar $index iTarget
+
+ incr iTarget
+ if {[string length $target] == 0} {
+ set szCurrentTarget "Default"
+ lappend lTargets $szCurrentTarget
+ debug { Default Current Target} 3
+ } else {
+ set szCurrentTarget $target
+ lappend lTargets $szCurrentTarget
+ debug { Current target: >$szCurrentTarget<} 3
+ }
+ debug { Found target >$szCurrentTarget<} 3
+ }
+
+ private method open_logs {target} {
+ global env
+
+ set target [string trim $target]
+ if {[string compare $szOutDir "..."] == 0} {
+ debug { No Output directory defined, creating one} 3
+ set szOutDir \
+ "logs/$env(USER)_${target}_[exec date +%Y%m%d]_"
+ set szI [format "%.4d" [set i 0]]
+ while {[file isdirectory $szOutDir$szI]} {
+ set szI [format "%.4d" [incr i]]
+ }
+ set szOutDir $szOutDir$szI
+ }
+ if {! [file isdirectory $szOutDir]} {
+ exec mkdir -p $szOutDir
+ }
+ if {[string length $target] == 0} {
+ set szTool testrun
+ } else {
+ set szTool $target
+ }
+ catch "exec rm -f $szOutDir/$szTool.sum"
+ namespace eval ::BlueGnu \
+ "set ::BlueGnu::sum_file [open "$szOutDir/$szTool.sum" w]"
+ puts $::BlueGnu::sum_file "# $szOutDir/$szTool.sum"
+ catch "exec rm -f $szOutDir/$szTool.log"
+ log_file -a "$szOutDir/$szTool.log"
+ send_log "# $szOutDir/$szTool.log\n"
+ debug { Opening log and summary files in $szOutDir} 3
+ }
+ private method close_logs {} {
+ }
+ public method outDir {} {
+ return $szOutDir
+ }
+ }
+}
diff --git a/contrib/bluegnu2.0.3/lib/testSessionClasses.itcl b/contrib/bluegnu2.0.3/lib/testSessionClasses.itcl
new file mode 100644
index 0000000..a9428af
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/testSessionClasses.itcl
@@ -0,0 +1,1341 @@
+#
+# This [incr Tcl] source file contains the class specifications
+# for the testSession of BlueGnu
+#
+namespace eval ::BlueGnu {
+ variable lArgs {}
+
+ variable errcnt 0
+ variable errno "NONE"
+ variable warncnt 0
+ variable xfail_flag 0
+
+ class Common {
+ # arguments passed to the constructor are always in the form:
+ # <variable>=<value>
+ #
+ constructor {args} {
+ debug {Constructor for >$this< [info level] [info class]} 9
+ foreach varval $args {
+ set varval [split $varval "="]
+ if {[llength $varval] != 2} {
+ error "Missing <variable>=<value> pair"
+ }
+ set var [lindex $varval 0]
+ set val [lindex $varval 1]
+ set variables {}
+ foreach v [lsort [info variable]] {
+ regexp {[^:]+$} $v v
+ lappend variables $v
+ }
+ if {[lsearch -exact $variables $var] >= 0} {
+ set $var $val
+ } else {
+ perror "variable >$var< does not exists in Class\
+ [info class]\n \
+ (was passed as argument and is ignored!)"
+ }
+ }
+ }
+
+ public method << {} {
+ set lResult {}
+ foreach var [lsort [info variable]] {
+ regexp {[^:]+$} $var v
+ debug {Found variable: >$v<} 9
+ if [array exists $v] {
+ debug { is an array} 9
+ foreach index [lsort [array names $v]] {
+ lappend lResult "${v}($index)=[set ${v}($index)]"
+ }
+ } else {
+ debug { is simple variable} 9
+ if {[string compare [set value [info variable $var -value]] \
+ "<undefined>"] != 0} {
+ switch $v {
+ this -
+ text {}
+ default {
+ lappend lResult [list $v $value]
+ }
+ }
+ }
+ }
+ }
+ set lResult
+ }
+ }
+
+ class Test {
+ inherit Common
+
+ protected variable szID
+ protected variable bTestCase
+ protected variable szTestCase
+ protected variable szTestCaseID
+ protected variable szTestCaseArgs
+ protected variable szName
+ protected variable szTool
+ protected variable eType
+ protected variable eResult
+ protected variable szScriptName
+ protected variable lArguments
+ protected variable szHostName
+ protected variable iPassed
+ protected variable iFailed
+ protected variable iXPassed
+ protected variable iXFailed
+ protected variable iCrashed
+ protected variable iError
+ protected variable iWarning
+ protected variable iUnresolved
+ protected variable iUntested
+ protected variable iUnsupported
+ protected variable i
+ protected variable benchmarkObject
+ protected variable benchmarkClassName
+
+ constructor testScript {
+ set szTool [uplevel #0 set szCurrentTestDirectory]
+ debug {======= Global Default Test Directory is\
+ >$szTool<} 5
+
+ set lArguments {}
+ # remove all multiple spaces/tabs into one space
+ # and parse the argument list
+ # <testScript> ::= <szScriptName>?[test case ID]?=<argument list>
+ # <argument list> ::= <argument> <argument list>
+ # <argument> ::= <variable name> | <variable name>=<value>
+ debug { testScript(1) is >$testScript<} 5
+ regsub -all "(\[ \t\]+)" [string trim $testScript] " " testScript
+ debug { testScript(2) is >$testScript<} 5
+ #
+ # Split testScript into script, test case ID, and arguments
+ regexp {^([^[=]+)([[]([^]]+)[]])?(=(.*))?$} $testScript dummy \
+ script tc tcID argT argL
+ debug { script: >$script<} 5
+ debug { tc: >$tc<} 5
+ debug { tcID: >$tcID<} 5
+ debug { argT: >$argT<} 5
+ debug { argL: >$argL<} 5
+ if {[set i [string first {=} $testScript]] >= 0} {
+ set testScriptArgs [string range $testScript \
+ [expr $i + 1] end]
+ set testScript [string range $testScript 0 [expr $i - 1]]
+ } else {
+ set testScriptArgs {}
+ }
+ set testScript $script
+ set szTestCase $tcID
+ if {[string length $szTestCase] > 0} {
+ set bTestCase 1
+ } else {
+ set bTestCase 0
+ }
+ set szTestCaseID [lindex [split $szTestCase "="] 0]
+ set szTestCaseArgs [join [lrange [split $szTestCase "="] 1 end] \
+ "="]
+ debug {szTestCase == >$szTestCase<} 5
+ debug {szTestCaseID == >$szTestCaseID<} 5
+ debug {szTestCaseArgs == >$szTestCaseArgs<} 5
+ set testScriptArgs $argL
+ debug {testScript(3) is >$testScript<} 5
+ debug {testScriptArgs(1) is >$testScriptArgs<} 5
+ set lArguments [eval list $testScriptArgs]
+ set i 0
+ foreach arg $lArguments {
+ debug {arg($i) is >$arg<} 5
+ set lArguments [lreplace $lArguments $i $i [split $arg "="]]
+ incr i
+ }
+ debug {Test script >$testScript<, test case >$szTestCase<} 3
+ debug { pathtype is [file pathtype $testScript]} 3
+ switch [file pathtype $testScript] {
+ relative {
+ error "Test Script name >$testScript<\
+ should not be relative"
+ }
+ absolute {
+ debug {Absolute reference in $this to Test Script\
+ >$testScript<} 3
+ set szScriptName $testScript
+ }
+ }
+ debug {Default Test Directory is >$szTool<}
+ if {[file exists $testScript]} {
+ debug {Test script >$testScript< exists!}
+ set szName [file tail $testScript]
+ set szID [file rootname $szName]
+ set szPWD [pwd]
+ set szTool [file dirname $testScript]
+ cd $szTool
+ set szTool [pwd]
+ cd $szPWD
+ set szScriptName [file join $szTool [file tail $testScript]]
+ regsub {.} [string toupper [file extension $szName]] {} eType
+ set eResult INITIALIZED
+ } else {
+ debug {Test script >$testScript< does NOT exists!}
+ set szRoot ""
+ set szID ""
+ set szName ""
+ set szTool ""
+ uplevel #0 set szCurrentTestDirectory "\"$szTool\""
+ set eType "NONE"
+ set szScriptName "$testScript"
+ set lArguments {}
+ set eResult EMPTY
+ }
+ set szHostName [info host]
+ set iPassed 0
+ set iFailed 0
+ set iXPassed 0
+ set iXFailed 0
+ set iCrashed 0
+ set iError 0
+ set iWarning 0
+ set iUnresolved 0
+ set iUntested 0
+ set iUnsupported 0
+ debug {Default Test Directory is >$szTool<}
+ debug {Global Default Test Directory is\
+ >[uplevel #0 set szCurrentTestDirectory]<}
+
+ debug {Target: >[[uplevel #0 set objCurrentTarget] <<]<}
+
+ while {1} {
+ # Create Benchmark Class Object
+ #
+ # First initialize
+ #
+ set szTargetID [[uplevel #0 set objCurrentTarget] ID]
+ regsub -all {[^a-zA-Z0-9_]} $szTargetID "_" szTargetID
+ regsub -all {[^a-zA-Z0-9_]} $szID "_" szTmpID
+ regsub -all {[^a-zA-Z0-9_]} $szTestCaseID "_" szTmpTestCaseID
+ #
+ # First try Benchmark Class in namespace for Target
+ # and test case ID if exists otherwise test script ID
+ #
+ set benchmarkClassName ::$szTargetID
+ if {$bTestCase} {
+ append benchmarkClassName ::$szTmpTestCaseID
+ } else {
+ append benchmarkClassName ::$szTmpID
+ }
+ debug {=== Trying benchmark: $benchmarkClassName} 3
+ if [catch {
+ set benchmarkObject \
+ [eval $benchmarkClassName #auto $szTestCaseArgs]
+ if {! [string match ::* $benchmarkObject]} {
+ set benchmarkObject \
+ [namespace current]::$benchmarkObject
+ }
+ debug {benchmarkObject: >$benchmarkObject<} 3
+ } errMsg] {
+ debug {Error Msg: >>>$errMsg<<<} 3
+ debug { info: >>>[uplevel #0 set errorInfo]<<<} 4
+ } else {
+ break
+ }
+ #
+ # Now try Benchmark class for test script name
+ # with test case ID or Benchmark
+ #
+ set benchmarkClassName ::$szTmpID
+ if {$bTestCase} {
+ append benchmarkClassName ::$szTmpTestCaseID
+ } else {
+ append benchmarkClassName ::Benchmark
+ }
+ debug {=== Trying benchmark: $benchmarkClassName} 3
+ if [catch {
+ set benchmarkObject [infoWhich \
+ [eval $benchmarkClassName #auto $szTestCaseArgs]]
+ } errMsg] {
+ debug {Error Msg: >>>$errMsg<<<} 3
+ debug { info: >>>[uplevel #0 set errorInfo]<<<} 4
+ } else {
+ break
+ }
+ #
+ # Now try target ID and benchmark
+ #
+ set benchmarkClassName ::${szTargetID}::Benchmark
+ debug {=== Trying benchmark: $benchmarkClassName} 3
+ debug { namespace: >[namespace current]<} 3
+ if [catch {
+ set benchmarkObject [infoWhich \
+ [eval $benchmarkClassName #auto $szTestCaseArgs] \
+ [namespace current]]
+ } errMsg] {
+ debug {Error Msg: >>>$errMsg<<<} 3
+ debug { info: >>>[uplevel #0 set errorInfo]<<<} 4
+ } else {
+ break
+ }
+ #
+ # Now try the generic BlueGnu benchmark function
+ #
+ set benchmarkClassName ::BlueGnu::Benchmark
+ debug {=== Trying benchmark: $benchmarkClassName} 3
+ if [catch {
+ set benchmarkObject [infoWhich \
+ [eval $benchmarkClassName #auto $szTestCaseArgs]]
+ debug {[warning "Default Benchmark Class\
+ is being used!"]}
+ } errMsg] {
+ warning "NO Benchmark Class >$benchmarkClassName<\
+ defined"
+ debug {[warning "Class: >$benchmarkClassName<\
+ has not been defined.\n ### Error Msg:\
+ $errMsg"]}
+ set benchmarkObject ""
+ break
+ }
+ debug { benchmark: $benchmarkClassName\
+ ($benchmarkObject)} 3
+ uplevel #0 {
+ set errorInfo NONE
+ }
+ break
+ }
+ }
+
+ destructor {
+ setResult
+ switch $eResult {
+ PASSED {
+ printResult
+ if {! $bTestCase} {
+ ::BlueGnu::clone_output " Statistics :\
+ $iPassed (PASS),\
+ $iXFailed (XFAIL)"
+ }
+ }
+ FAILED {
+ printResult
+ if {! $bTestCase} {
+ ::BlueGnu::clone_output " Statistics :\
+ $iPassed (PASS),\
+ $iXFailed (XFAIL)"
+ ::BlueGnu::clone_output " :\
+ $iFailed (FAIL),\
+ $iXPassed (XPASS)"
+ }
+ }
+ UNKNOWN {
+ }
+ default {
+ printResult
+ if {! $bTestCase} {
+ ::BlueGnu::clone_output " Statistics :\
+ $iPassed (PASS),\
+ $iXFailed (XFAIL)"
+ ::BlueGnu::clone_output " :\
+ $iFailed (FAIL),\
+ $iXPassed (XPASS)"
+ if {$iUntested} {
+ ::BlueGnu::clone_output " :\
+ $iUntested (UNTESTED)"
+ }
+ if {$iUnresolved} {
+ ::BlueGnu::clone_output " :\
+ $iUnresolved (UNRESOLVED)"
+ }
+ if {$iUnsupported} {
+ ::BlueGnu::clone_output " :\
+ $iUnsupported (UNSUPPORTED)"
+ }
+ if {$iCrashed} {
+ ::BlueGnu::clone_output " :\
+ $iCrashed (CRASHED)"
+ }
+ if {$iError} {
+ ::BlueGnu::clone_output " :\
+ $iError (ERROR)"
+ }
+ if {$iWarning} {
+ ::BlueGnu::clone_output " :\
+ $iWarning (WARNING)"
+ }
+ }
+ }
+ }
+ # remove benchmark Class Object
+ #
+ if {$benchmarkObject != ""} {
+ debug {#### Benchmark Object: >$benchmarkObject<\
+ ([catch {$benchmarkObject info class}])} 3
+ debug {#### Benchmark Class : >$benchmarkClassName<} 3
+ catch {delete object $benchmarkObject}
+ if {$benchmarkClassName != "::BlueGnu::Benchmark"} {
+ catch {delete class $benchmarkClassName}
+ }
+ }
+ ::BlueGnu::clone_output ""
+ }
+
+ private method printResult {} {
+ if {$bTestCase} {
+ ::BlueGnu::clone_output "******* Result :\
+ [format "%-12s" $eResult] for test case :\
+ >$szTestCase<"
+ } else {
+ ::BlueGnu::clone_output "******* Result :\
+ [format "%-12s" $eResult] for test script :\
+ >$szID<"
+ }
+ }
+
+ public method ID {} {
+ return $szID
+ }
+
+ public method testCase {} {
+ return $szTestCase
+ }
+
+ public method testCaseID {} {
+ return $szTestCaseID
+ }
+
+ public method testCaseArgs {} {
+ return $szTestCaseArgs
+ }
+
+ public method benchmarkObject {} {
+ return $benchmarkObject
+ }
+
+ public method benchmarkClassName {} {
+ return $benchmarkClassName
+ }
+
+ public method name {args} {
+ if {[llength $args] == 1} {
+ set szName [lindex $args 0]
+ }
+ return $szName
+ }
+
+ public method result {} {
+ return $eResult
+ }
+
+ public method arguments {} {
+ return $lArguments
+ }
+
+ public method pass {szMsg} {
+ global objCurrentEnvironment
+ if {[namespace eval ::BlueGnu {set xfail_flag}]} {
+ incr iXPassed
+ $objCurrentEnvironment record_test XPASS $szMsg
+ } else {
+ incr iPassed
+ $objCurrentEnvironment record_test PASS $szMsg
+ }
+ setResult
+ }
+ public method fail {szMsg} {
+ global objCurrentEnvironment
+ if {[namespace eval ::BlueGnu {set xfail_flag}]} {
+ incr iXFailed
+ $objCurrentEnvironment record_test XFAIL $szMsg
+ } else {
+ incr iFailed
+ $objCurrentEnvironment record_test FAIL $szMsg
+ }
+ setResult
+ }
+
+ public method perror {szMsg} {
+ global objCurrentEnvironment
+ incr iError
+ $objCurrentEnvironment record_test ERROR $szMsg
+ setResult
+ }
+
+ public method crashed {szMsg} {
+ global objCurrentEnvironment
+ incr iCrashed
+ $objCurrentEnvironment record_test CRASHED $szMsg
+ setResult
+ }
+
+ public method warning {szMsg} {
+ global objCurrentEnvironment
+ incr iWarning
+ $objCurrentEnvironment record_test WARNING $szMsg
+ setResult
+ }
+
+ public method note {szMsg} {
+ global objCurrentEnvironment
+ $objCurrentEnvironment record_test NOTE $szMsg
+ }
+
+ public method unresolved {szMsg} {
+ global objCurrentEnvironment
+ incr iUnresolved
+ $objCurrentEnvironment record_test UNRESOLVED $szMsg
+ }
+ public method untested {szMsg} {
+ global objCurrentEnvironment
+ incr iUntested
+ $objCurrentEnvironment record_test UNTESTED $szMsg
+ }
+ public method unsupported {szMsg} {
+ global objCurrentEnvironment
+ incr iUnsupported
+ $objCurrentEnvironment record_test UNSUPPORTED $szMsg
+ }
+
+ private method setResult {} {
+ if {$iUnresolved || \
+ $iError || $iCrashed || \
+ ($iWarning > [namespace eval ::BlueGnu { \
+ set warning_threshold}] && \
+ 0 < [namespace eval ::BlueGnu { \
+ set warning_threshold}])} {
+ set eResult UNRESOLVED
+ } elseif {$iUntested} {
+ set eResult UNTESTED
+ } elseif {$iUnsupported} {
+ set eResult UNSUPPORTED
+ } elseif {($iPassed > 0 || $iXFailed > 0) && \
+ $iFailed == 0 && $iXPassed == 0} {
+ set eResult "PASSED"
+ } elseif {$iFailed || $iXPassed} {
+ set eResult "FAILED"
+ } elseif {$iPassed == 0 && $iXPassed && \
+ $iFailed == 0 && $iXFailed && $iCrashed == 0 && \
+ $iError == 0 && $iWarning == 0} {
+ set eResult ACTIVATED
+ } else {
+ set eResult UNKNOWN
+ }
+ }
+
+ public method getResult {} {
+ setResult
+ return $eResult
+ }
+
+ public method tool {} {
+ return $szTool
+ }
+
+ public method scriptName {} {
+ return $szScriptName
+ }
+
+ public method << {} {
+ if 0 {
+ lappend lResult [list ID $szID]
+ lappend lResult [list name $szName]
+ lappend lResult [list tool $szTool]
+ lappend lResult [list type $eType]
+ lappend lResult [list result $eResult]
+ lappend lResult [list root $szRoot]
+ lappend lResult [list script $szScriptName]
+ lappend lResult [list arguments $lArguments]
+ lappend lResult [list host $szHostName]
+
+ return $lResult
+ } else {
+ eval [info function Common::<< -body]
+ }
+ }
+
+ public method runtest {} {
+ global objCurrentEnvironment
+ setResult
+
+ if {$bTestCase} {
+ ::BlueGnu::clone_output "####### Begin test case :\
+ >$szTestCase<"
+ debug { [scriptName]\n \
+ [name]=[arguments]}
+ } else {
+ ::BlueGnu::clone_output "####### Begin test script :\
+ >$szID<"
+ debug { [scriptName]\n \
+ [name]=[arguments]}
+ }
+ verbose { Full Pathname : $szScriptName} 1
+ debug {=== Running test in $this: $szScriptName} 3
+ debug {[join [<<] "\n"]} 9
+ catch {debug {Global Default Test Directory is\
+ >[uplevel #0 set szCurrentTestDirectory]<}}
+ catch {debug {Default Test Directory is >$szTool<}}
+
+ if [catch {
+ uplevel #0 set szCurrentTestDirectory "$szTool"
+ uplevel #0 lappend lTool {$szCurrentTestDirectory}
+ uplevel #0 set objCurrentTest $this
+ uplevel #0 lappend lTestName {$objCurrentTest}
+ uplevel 1 variable bTestCase $bTestCase
+ uplevel 1 variable szTestCase \"$szTestCase\"
+ uplevel 1 variable szTestCaseID \"$szTestCaseID\"
+ uplevel 1 variable szTestCaseArgs \"$szTestCaseArgs\"
+ uplevel 1 variable iArgs [llength $lArguments]
+ uplevel 1 variable lArgs [concat {[list} $lArguments {]}]
+ uplevel 1 variable szID $szID
+ uplevel 1 variable szScriptName $szScriptName
+ uplevel 1 variable szName $szName
+ uplevel 1 variable szTool $szTool
+ } szErrMsg] {
+ debug {Error Msg:>>>$szErrmsg<<<} 0
+ }
+ if {[catch {uplevel 1 source $szScriptName} szErrMsg]} {
+ global errorInfo errorCode
+ crashed ">$szErrMsg<\
+ \n in script: >$szScriptName<\
+ \n errorInfo: >$errorInfo<\
+ \n errorCode: >$errorCode<"
+ }
+ setResult
+ $objCurrentEnvironment reportTestResult $eResult
+
+ uplevel #0 {set lTestName [lreplace $lTestName end end]}
+ uplevel #0 {set objCurrentTest [lrange $lTestName end end]}
+ uplevel #0 {set lTool [lreplace $lTool end end]}
+ uplevel #0 {set szCurrentTestDirectory [lrange $lTool end end]}
+
+ catch {debug {Default Test Directory is >$szTool<} 3}
+ catch {debug {Global Default Test Directory is\
+ >[uplevel #0 set szCurrentTestDirectory]<} 3}
+ debug {=== Done with test in $this: $szScriptName ($bTestCase)} 3
+ if {$bTestCase} {
+ ::BlueGnu::clone_output "####### End test case :\
+ >$szTestCase<"
+ } else {
+ ::BlueGnu::clone_output "####### End test script :\
+ >$szID<"
+ }
+ return $this
+ }
+ }
+
+ class Queue {
+ inherit Common
+
+ protected variable lTestNames
+
+ constructor {} {
+ set lTestNames {}
+ }
+
+ public method append args {
+ set testName [join $args]
+ debug { queue appending >$testName<} 3
+ lappend lTestNames $testName
+ debug { DONE} 3
+ }
+
+ public method prepend args {
+ #set testName [join $args]
+ debug {Queue::prepend $args} 3
+ foreach arg $args {
+ debug { append >$arg< to comList} 3
+ lappend comList $arg
+ }
+ debug { queue prepending comList: >$comList<} 3
+ debug { [llength $comList] elements in comList} 3
+ #set lTestNames [linsert $lTestNames 0 "$testName"]
+ debug { [llength $lTestNames] elements in lTestNames} 3
+ set lTestNames [concat $comList $lTestNames]
+ debug { [llength $lTestNames] elements in lTestNames} 3
+ debug { DONE} 3
+ }
+
+ public method pop {} {
+ if {[llength $lTestNames] == 0} {
+ return -code error -errorinfo "Empty Queue" {}
+ }
+ if {[llength $lTestNames] == 1} {
+ set testName [lindex $lTestNames 0]
+ set lTestNames {}
+ return $testName
+ #return -code error $testName
+ }
+ set testName [lindex $lTestNames 0]
+ set lTestNames [lrange $lTestNames 1 end]
+ return $testName
+ }
+
+ public method << {} {
+ #lappend lResult [list tests $lTestNames]
+
+ #return $lResult
+ eval [info function Common::<< -body]
+ }
+ }
+
+ class Environment {
+ inherit Common
+
+ protected variable szName "Default"
+
+ protected variable iPassCnt 0
+ protected variable iFailCnt 0
+ protected variable iXPassCnt 0
+ protected variable iXFailCnt 0
+ protected variable iUntestedCnt 0
+ protected variable iUnresolvedCnt 0
+ protected variable iUnsupportedCnt 0
+ protected variable iCrashedCnt 0
+ protected variable iErrorCnt 0
+ protected variable iWarningCnt 0
+ protected variable iCnt 0
+
+ protected variable iWarningThreshold 0
+ protected variable iErrorThreshold 0
+
+ protected variable bXFailFlag 0
+ protected variable bExitStatus 0
+
+ protected variable eResult UNKNOWN
+ protected variable iUntested 0
+ protected variable iUnsupported 0
+ protected variable iUnresolved 0
+ protected variable iPassed 0
+ protected variable iFailed 0
+
+
+ protected variable ENV
+ protected variable bSaved 0
+ common defaultEnvironment [list PATH FPATH \
+ BLUEGNULIB TESTSUITEROOT TESTSETS TMPDIR \
+ DISPLAY EDITOR EMACSFONT HOME LANG LOGIN LOGNAME SHELL \
+ TERM USER WINDOWID DEBUG LPDEST \
+ ORGANIZATION OSTYPE PAGER \
+ PARM_SEARCH_PATH \
+ ]
+
+ constructor {args} {
+ debug {Level in Constructor: [info level]} 9
+ eval [info function Common::constructor -body]
+ setResult
+ }
+
+ destructor {
+ global objCurrentTarget
+ debug {******* [info class]::destructor} 3
+
+ ::BlueGnu::clone_output "******* Result :\
+ [format "%-12s" $eResult]\
+ for test session : >$szName<"
+ switch $eResult {
+ PASSED {
+ ::BlueGnu::clone_output " Statistics :\
+ $iPassed (PASS)"
+ ::BlueGnu::clone_output "******* Cumulative statistics\
+ for all test script!"
+ ::BlueGnu::clone_output " Statistics Totals :\
+ $iPassCnt (PASS),\
+ $iXFailCnt (XFAIL)"
+ if {$iUntested} {
+ ::BlueGnu::clone_output " :\
+ $iUntested (UNTESTED)"
+ }
+ if {$iWarningCnt} {
+ ::BlueGnu::clone_output " :\
+ $iWarningCnt (WARNING)"
+ }
+ }
+ UNKNOWN -
+ default {
+ ::BlueGnu::clone_output " Statistics :\
+ $iPassed (PASS)"
+ ::BlueGnu::clone_output " :\
+ $iFailed (FAIL)"
+ if {$iUntested} {
+ ::BlueGnu::clone_output " :\
+ $iUntested (UNTESTED)"
+ }
+ if {$iUnresolved} {
+ ::BlueGnu::clone_output " :\
+ $iUnresolved (UNRESOLVED)"
+ }
+ if {$iUnsupported} {
+ ::BlueGnu::clone_output " :\
+ $iUnsupported (UNSUPPORTED)"
+ }
+ ::BlueGnu::clone_output "******* Cumulative statistics\
+ for all test script!"
+ ::BlueGnu::clone_output " Statistics Totals :\
+ $iPassCnt (PASS),\
+ $iXFailCnt (XFAIL)"
+ ::BlueGnu::clone_output " :\
+ $iFailCnt (FAIL),\
+ $iXPassCnt (XPASS)"
+ if {$iUntestedCnt} {
+ ::BlueGnu::clone_output " :\
+ $iUntestedCnt (UNTESTED)"
+ }
+ if {$iUnresolvedCnt} {
+ ::BlueGnu::clone_output " :\
+ $iUnresolvedCnt (UNRESOLVED)"
+ }
+ if {$iUnsupportedCnt} {
+ ::BlueGnu::clone_output " :\
+ $iUnsupportedCnt (UNSUPPORTED)"
+ }
+ if {$iCrashedCnt} {
+ ::BlueGnu::clone_output " :\
+ $iCrashedCnt (CRASHED)"
+ }
+ if {$iErrorCnt} {
+ ::BlueGnu::clone_output " :\
+ $iErrorCnt (ERROR)"
+ }
+ if {$iWarningCnt} {
+ ::BlueGnu::clone_output " :\
+ $iWarningCnt (WARNING)"
+ }
+ }
+ }
+ if {$::BlueGnu::errcnt} {
+ ::BlueGnu::clone_output "####### Encountered\
+ $::BlueGnu::errcnt System Errors!"
+ }
+ ::BlueGnu::clone_output "###########################\n"
+ }
+
+ public method name {} {
+ return $szName
+ }
+
+ public method record_test {type message} {
+ debug {******* ${this}::record_test \n \
+ $type $message} 3
+ if {$iWarningThreshold > 0 && \
+ $iWarningCnt >= $iWarningThreshold \
+ || \
+ $iErrorThreshold > 0 && \
+ $iErrorCnt >= $iErrorThreshold} {
+ # Reset these first to prevent infinite recursion.
+ set iWarningCnt 0
+ set iErrorCnt 0
+ ::unresolved $message
+ return
+ }
+
+ debug { switching on type >$type<}
+ switch $type {
+ PASS {
+ incr iPassCnt
+ }
+ FAIL {
+ incr iFailCnt
+ set bExitStatus 1
+ }
+ XPASS {
+ incr iXPassCnt
+ }
+ XFAIL {
+ incr iXFailCnt
+ }
+ UNTESTED {
+ incr iUntestedCnt
+ }
+ UNRESOLVED {
+ incr iUnresolvedCnt
+ }
+ UNSUPPORTED {
+ incr iUnsupportedCnt
+ }
+ ERROR {
+ incr iErrorCnt
+ }
+ CRASHED {
+ incr iCrashedCnt
+ }
+ NOTE {
+ }
+ WARNING {
+ incr iWarningCnt
+ }
+ default {
+ debug {record_test called with bad type >$type<} -1
+ set iErrorCnt 0
+ return
+ }
+ }
+
+ ::BlueGnu::clone_output "$type: $message"
+
+ # reset variables here
+ namespace eval ::BlueGnu {
+ set xfail_flag 0
+ set xfail_prms {}
+ }
+ }
+
+ private method setResult {} {
+ if {$iUnresolved} {
+ set eResult UNRESOLVED
+ } elseif {$iPassed > 0 && $iFailed == 0} {
+ set eResult "PASSED"
+ } elseif {$iFailed} {
+ set eResult "FAILED"
+ } elseif {$iPassed == 0 && $iFailed == 0 && \
+ $iUntested && $iUnsupported == 0 && \
+ $iUnresolved == 0} {
+ set eResult ACTIVATED
+ } else {
+ set eResult UNKNOWN
+ }
+ }
+
+ public method reportTestResult {eTestResult} {
+ switch $eTestResult {
+ "PASSED" {
+ incr iPassed
+ }
+ "FAILED" {
+ incr iFailed
+ }
+ "UNSUPPORTED" {
+ incr iUnsupported
+ }
+ "UNTESTED" {
+ incr iUntested
+ }
+ "UNRESOLVED" {
+ incr iUnresolved
+ }
+ }
+ setResult
+ }
+
+ public method saveEnv {} {
+ global env
+
+ set bSaved 1
+ foreach index [lsort [array names env]] {
+ debug {ENV($index) := $env($index)} 5
+ #set ENV($index) $env($index)
+ array set ENV [list $index $env($index)]
+ }
+ }
+
+ public method clearEnv {} {
+ global env
+
+ set bSaved 1
+ #debug {removing ENV} 5
+ #catch {unset ENV}
+ foreach index [array names env] {
+ debug {removing env($index) := $env($index)} 5
+ if {0 > [lsearch -exact $defaultEnvironment $index]} {
+ debug { removed} 5
+ unset env($index)
+ } else {
+ debug { kept} 5
+ if {[string compare $index PATH] == 0} {
+ # Do not touch PATH
+ #set env(PATH) \
+ "/etc:/usr/lib:/usr/ucb:/bin:/usr/bin:/usr/bin/X11:/usr/lpp/X11/Xamples/bin:/usr/local/bin"
+ }
+ #set ENV($index) $env($index)
+ }
+ }
+ }
+
+ public method restoreEnv {} {
+ global env
+
+ if {$bSaved} {
+ catch {unset env}
+ foreach index [array names ENV] {
+ debug {env($index) := $ENV($index)} 5
+ #set ENV($index) $env($index)
+ array set env [list $index $ENV($index)]
+ }
+ } else {
+ debug {Environment had not been saved!}
+ }
+ }
+
+ public method runTest args {
+ global nspTestSuite
+ debug {======= runTest $args} 3
+
+ set iRuntest 0
+ set elResult [list]
+
+ set iRun 0
+ foreach arg $args {
+ debug {======= runTest $arg} 3
+ incr iRun
+
+ # Create name for namespace for the test
+ # and check if already exist
+ #
+ set szRuntest runtest$iRuntest
+ set namespaceCurrent [namespace current]
+ debug { szRuntest: >$szRuntest<} 4
+ debug { namespace current : >$namespaceCurrent<} 4
+ debug { namespace current children:\
+ >[namespace children $namespaceCurrent]<} 4
+ while {[string compare \
+ [namespace children $namespaceCurrent \
+ ${namespaceCurrent}::$szRuntest] ""] != 0} {
+ incr iRuntest
+ set szRuntest runtest$iRuntest
+ }
+ # now we have a unique namespace name for the running
+ # of the test
+ #
+ debug { runTest namespace: >$szRuntest<} 4
+ set szScript $arg
+ # create a Test Class object
+ if {! [catch {::BlueGnu::Test [${nspTestSuite}::autoTest] \
+ $szScript} testObject]} {
+ if [catch {
+ uplevel #0 set objCurrentTest \
+ [namespace current]::$testObject
+ debug {[join [$testObject <<] "\n"]} 9
+ namespace eval $szRuntest {
+ if [catch {[uplevel set testObject] runtest} \
+ szErrMsg] {
+ uplevel set szErrMsg "\{$szErrMsg\}"
+ uplevel {
+ global errorInfo errorCode
+ record_test CRASHED ">$szErrMsg<\
+ \n in script: >$szScript<\
+ \n errorInfo: >$errorInfo<\
+ \n errorCode: >$errorCode<"
+ }
+ }
+ }
+ debug {[join [$testObject <<] "\n"]} 9
+ uplevel "lappend elResult [$testObject getResult]"
+ delete object $testObject
+ } szErrMsg] {
+ global errorInfo errorCode
+ record_test CRASHED ">$szErrMsg<\
+ \n in script: >$szScript<\
+ \n errorInfo: >$errorInfo<\
+ \n errorCode: >$errorCode<"
+ }
+ } else {
+ global errorInfo errorCode
+ record_test CRASHED ">$testObject<\
+ \n in script: >$szScript<\
+ \n errorInfo: >$errorInfo<\
+ \n errorCode: >$errorCode<"
+ }
+ namespace delete $szRuntest
+ uplevel #0 {debug {argv: [set argv]} 3}
+ }
+ if {$iRun == 0} {
+ warning "No tests have been passed to runTest method!"
+ }
+ return $elResult
+ }
+
+ public method << {} {
+ debug {in $this method} 5
+ eval [info function Common::<< -body]
+ #lappend lResult [list ENV [array get ENV]]
+ }
+ }
+
+ # The following is a class definition for the target implementation
+ # in DejaGnu (see lib/target.exp for more detail)
+ #
+ class Target {
+ inherit Common
+
+ protected variable szID
+ protected variable szName
+ protected variable szApplication
+ protected variable objEnvironment
+ protected variable objQueue
+
+ protected variable connect
+ protected variable target
+ protected variable serial
+ protected variable netport
+ protected variable baud
+ protected variable X10
+ protected variable ioport
+
+ protected variable fileid
+ protected variable prompt
+ protected variable abbrev
+ protected variable config
+ protected variable cflags
+ protected variable ldflags
+
+ protected variable X
+
+ # a hairy pattern to recognize text
+ common text "\[- A-Za-z0-9\.\;\"\_\:\'\`\(\)\!\#\=\+\?\&\*]"
+
+
+ constructor {args} {
+ eval [info function Common::constructor -body]
+ }
+
+ destructor {
+ delete object $objQueue
+ }
+
+ public method name {args} {
+ if {[llength $args] == 0} {
+ return $szName
+ } else {
+ set szName [lindex $args 0]
+ }
+ }
+
+ public method ID {args} {
+ if {[llength $args] == 0} {
+ return $szID
+ } else {
+ set szID [lindex $args 0]
+ }
+ }
+
+ public method << {} {
+ eval [info function Common::<< -body]
+ }
+
+ public method environment {} {
+ return $objEnvironment
+ }
+
+ public method start {} {
+ if {[string length [uplevel #0 info procs ${szID}_start]] != 0} {
+ uplevel #0 ${szID}_start
+ }
+ }
+
+ public method load {args} {
+ if {[string length [uplevel #0 info procs ${szID}_load]] != 0} {
+ eval uplevel #0 ${szID}_load $args
+ }
+ }
+
+ public method exit {} {
+ if {[string length [uplevel #0 info procs ${szID}_exit]] != 0} {
+ uplevel #0 ${szID}_exit
+ }
+ }
+
+ public method version {} {
+ if {[string length [uplevel #0 info procs ${szID}_version]] != 0} {
+ uplevel #0 ${szID}_version
+ }
+ }
+
+ public method runTests {} {
+ debug {======= ${this}::runTest} 3
+ set elResult [list]
+ # if an application has been defined we run all the test
+ # inside that application
+ #
+ if {[string compare [info variable szApplication] ""] != 0 && \
+ [string compare [info variable szApplication -value] \
+ "<undefined>"] != 0} {
+ debug {Application specified >[info variable \
+ szApplication -value]<}
+ # build argument list
+ debug {>>[<<]<<}
+ } else {
+ # We just run all the tests in the currently running
+ # [incr Tcl/?Expect?] interpreter.
+ #
+ # set the current Queue and Environment
+ #
+ uplevel #0 set objCurrentQueue [infoWhich $objQueue]
+ uplevel #0 set objCurrentEnvironment \
+ [infoWhich $objEnvironment]
+ #
+ # Pop a test from the queue and run it in the environment
+ ::BlueGnu::clone_output "###########################"
+ ::BlueGnu::clone_output "####### Begin test session:\
+ [[infoWhich $objEnvironment] name] >$objEnvironment<"
+ while {! [catch {$objQueue pop} T]} {
+ debug {test: $T} 3
+ set elResult [$objEnvironment runTest $T]
+ }
+ ::BlueGnu::clone_output "####### End test session :\
+ [[infoWhich $objEnvironment] name]"
+ }
+ return $elResult
+ }
+
+ public method queue {function element} {
+ switch $function {
+ append {
+ $objQueue append $element
+ }
+ prepend {
+ $objQueue prepend $element
+ }
+ }
+ }
+ }
+
+ class Target2 {
+ inherit Target
+
+ protected variable XYZ
+
+ constructor {args} {
+ eval [info function Common::constructor -body]
+ }
+
+ public method << {} {
+ eval [info function Common::<< -body]
+ }
+ }
+
+
+ class DejaGnu {
+ inherit Environment
+
+ constructor {} {
+ debug {Level in Constructor DejaGnu: [info level]} 9
+ uplevel #0 {debug {argc = $argc: $argv} 9}
+ # source always in global space
+ #
+ uplevel #0 source {$env(BLUEGNULIBS)/dejagnu.tcl}
+ }
+
+ destructor {
+ #####################################################################
+ # This comes from the original runtest
+ # all done, cleanup
+ #
+ uplevel #0 {
+ if { [info procs ${tool}_exit] != "" } {
+ if {[catch "${tool}_exit" tmp]} {
+ # ??? We can get away with calling `warning'
+ # here without ensuring
+ # `warncnt' isn't changed because we're about to exit.
+ warning "${tool}_exit failed:\n$tmp"
+ }
+ }
+ log_summary
+ }
+ }
+
+
+ public method runTest {args} {
+ global nspTestSuite
+
+ foreach arg $args {
+ debug {******* DejaGnu running test: >$arg<}
+ debug {set szTestName \[Test \[${nspTestSuite}::autoTest\] $arg\]} 3
+ debug {set testName >[${nspTestSuite}::autoTest]<} 3
+ uplevel #0 set szTestName [Test [${nspTestSuite}::autoTest] $arg]
+ uplevel #0 {
+ debug $szTestName 3
+ debug [join [$szTestName <<] "\n"] 5
+ set test_name {[$szTestName scriptName]}
+ catch {unset tmp}; set tmp {}
+ foreach arg [$szTestName arguments] {
+ lappend tmp [join $arg "="]
+ }
+ set runtests [list [$szTestName name] $tmp]
+ debug {args = >[$szTestName arguments]<} 3
+ source [$szTestName scriptName]
+ catch {eval unset [info vars __*]}
+ }
+ }
+ }
+ }
+
+ class DejaGnu2 {
+ inherit DejaGnu
+
+ protected variable currentTool
+
+ constructor {} {
+ debug {Level in Constructor DejaGnu2: [info level]} 9
+ set currentTool {}
+ uplevel #0 {debug {argc = $argc: $argv} 9}
+ # source always in global space
+ #
+ uplevel #0 source {$env(BLUEGNULIBS)/dejagnu2.tcl}
+ }
+
+ public method tool {args} {
+ if {[llength $args] == 1} {
+ set currentTool [lindex $args 0]
+ }
+ return $currentTool
+ }
+ }
+
+ class Benchmark {
+ protected variable bResult 0
+ protected variable DATA
+ protected variable FORMAT
+ protected variable ARG
+
+ protected constructor {args} {
+ debug {======= Constructing class [info class] =======} 3
+ debug {======= ::BlueGnu::Benchmark::constructor $args} 4
+ set i 0
+ foreach arg $args {
+ debug { ARG($i): >$arg<} 5
+ set ARG($i) [split $arg "="]
+ incr i
+ }
+ }
+ protected destructor {
+ debug {======= [info class]::destructor} 3
+ }
+
+ protected method benchmark {benchmarkFunction args} {
+ warning "Method >benchmark< has not been implemented for\
+ Class >[info class]<"
+ return $bResult
+ }
+
+ protected method warningNoBenchmarkArguments {} {
+ warning "NO argument have been supplies for\n the benchmark\
+ method in class [info class]"
+ }
+ protected method warningNoBenchmarkFunction {} {
+ warning "NO benchmark function >[uplevel set benchmarkFunction]<\
+ defined for\n the benchmark method in class [info class]"
+ }
+ }
+
+ class Error {
+ private variable _errorCode
+ private variable _errorMsg
+ private variable _errorInfo
+
+ public constructor {errorCode errorMsg errorInfo} {
+ set _errorCode $errorCode
+ set _errorMsg $errorMsg
+ set _errorInfo $errorInfo
+ }
+
+ public method errorCode {} {
+ return $_errorCode
+ }
+ public method errorMsg {} {
+ return $_errorMsg
+ }
+ public method errorInfo {} {
+ return $_errorInfo
+ }
+ public method why {} {
+ return $_errorMsg
+ }
+ public method verboseWhy {} {
+ return $_errorInfo
+ }
+ }
+}
diff --git a/contrib/bluegnu2.0.3/lib/testSessionFramework.itcl b/contrib/bluegnu2.0.3/lib/testSessionFramework.itcl
new file mode 100644
index 0000000..7f96880
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/testSessionFramework.itcl
@@ -0,0 +1,1386 @@
+#
+#
+#
+#
+# unknown -- called by expect if a proc is called that doesn't exist
+#
+
+# Set auto_load to take BLUEGNULIB first on search path
+#
+set auto_path "$env(BLUEGNULIB) $auto_path"
+
+# find tclIndex file in the test suite directory structure
+# $env(TESTSUITEROOT) and in the path up to the root
+#
+if {! [info exists env(TESTSUITEROOT)]} {
+ set env(TESTSUITEROOT) [exec /bin/sh -c pwd]
+}
+set PWD $env(TESTSUITEROOT)
+
+if {[info exists env(TESTSETS)]} {
+ if {[lsearch -exact [split $env(TESTSETS) ":"] $PWD] < 0} {
+ set env(TESTSETS) $PWD:$env(TESTSETS)
+ }
+} else {
+ set env(TESTSETS) $PWD
+}
+cd $PWD
+
+
+# First thing to do is calculate the verbose level and the debug flag
+# as well as the definition of the associated procedures:
+# verbose and debug.
+#
+# Check the Debug level
+if [info exists env(DEBUG)] {
+ switch -regexp [string toupper $env(DEBUG)] {
+ 1 - ^T(R(U(E)?)?)?$ - ^Y(E(S)?)?$ {
+ set bDebug 1
+ }
+ default {
+ set bDebug 0
+ }
+ }
+} else {
+ set bDebug 0
+}
+
+# Calculate verbose level
+# Complete a first path over the argument list
+# Calculate the Verbose Level
+set verbose 0
+foreach __arg $argv {
+ switch -regexp -- $__arg {
+ {^-[-]?v(e(r(b(o(s(e)?)?)?)?)?)?$} {
+ incr verbose
+ }
+ default {
+ lappend __lArgs $__arg
+ }
+ }
+}
+if {[catch {set argv $__lArgs}]} {
+ set argv {}
+}
+
+# Define the procedures: verbose & debug
+#
+# verbose [-n] [-log] [--] message [level]
+#
+# Print MESSAGE if the verbose level is >= LEVEL.
+# The default value of LEVEL is 1.
+# "-n" says to not print a trailing newline.
+# "-log" says to add the text to the log file even if it won't be printed.
+# Note that the apparent behaviour of `send_user' dictates that if the message
+# is printed it is also added to the log file.
+# Use "--" if MESSAGE begins with "-".
+#
+# This is defined here rather than in framework.exp so we can use it
+# while still loading in the support files.
+#
+proc verbose {args} {
+ debug {======= verbose $args} 3
+ global verbose
+
+ set newline 1
+ set logfile 0
+
+ set i 0
+ if {[string index [lindex $args 0] 0] == "-"} {
+ for { set i 0 } { $i < [llength $args] } { incr i } {
+ if { [lindex $args $i] == "--" } {
+ incr i
+ break
+ } elseif { [lindex $args $i] == "-n" } {
+ set newline 0
+ } elseif { [lindex $args $i] == "-log" } {
+ set logfile 1
+ } elseif { [string index [lindex $args $i] 0] == "-" } {
+ return [::BlueGnu::clone_output "ERROR: verbose:\
+ illegal argument: [lindex $args $i]"]
+ } else {
+ break
+ }
+ }
+ }
+ if {[llength $args] == $i} {
+ return [::BlueGnu::clone_output "ERROR: verbose: nothing to print"]
+ }
+
+
+ set level 1
+ if {[llength $args] == $i + 2} {
+ if [catch {set level [expr [lindex $args [expr $i+1]]]} szErrMsg] {
+ return [::BlueGnu::clone_output "ERROR: verbose: level number\
+ >$szErrMsg<"]
+ }
+ } elseif {[llength $args] > $i + 2} {
+ return [::BlueGnu::clone_output "ERROR: verbose: Too many arguments"]
+ }
+ set message [lindex $args $i]
+
+ if {$level <= $verbose} {
+ # There is no need for the "--" argument here, but play it safe.
+ # We assume send_user also sends the text to the log file (which
+ # appears to be the case though the docs aren't clear on this).
+ if 0 {
+ if {[string compare \
+ [namespace eval ::BlueGnu \
+ {set ::BlueGnu::sum_file}] stdout] != 0} {
+ set szCmd [list uplevel puts [namespace eval ::BlueGnu \
+ {set ::BlueGnu::sum_file}]]
+ lappend szCmd "\"$message\""
+ debug {==## 1 >$szCmd<} 9
+ if {[catch {eval $szCmd}]} {
+ puts [namespace eval ::BlueGnu \
+ {set ::BlueGnu::sum_file}] $message
+ }
+ }
+ }
+ if [catch {set message \
+ "[uplevel set __szTmp \"$message\"]"} szErrMsg] {
+ set message "$message == ERROR: >$szErrMsg<"
+ }
+ if {$newline} {
+ #append message "\n"
+ }
+ debug {$message} 0
+ return [::BlueGnu::clone_output "$message"]
+ } elseif {$logfile} {
+ if [catch {set message \
+ "[uplevel set __szTmp \"$message\"]"} szErrMsg] {
+ set message "$message == ERROR: >$szErrMsg<"
+ }
+ if {$newline} {
+ append message "\n"
+ }
+ debug {$message} 0
+ return [send_log $message]
+ }
+ return ""
+}
+
+if {$bDebug} {
+ proc debug {text {level 1}} {
+ global verbose
+
+ if {$level <= $verbose} {
+ set szCmd [list uplevel ::BlueGnu::clone_output]
+ set szA $level; set iMax [uplevel info level]
+ for {set i 0} {$i < $iMax} \
+ {incr i} {append szA ">"}
+ lappend szCmd "\"$szA$text\""
+ eval $szCmd
+ }
+ }
+} else {
+ proc debug {text {level 1}} {
+ }
+}
+
+# This procedure will find a file in the directory structure
+# any where below the current working directory
+# any where on the search path
+# or up the directory tree
+#
+proc locateFile {szFileName {szSubDirectory "."}} {
+ debug {======= locateFile $szFileName $szSubDirectory} 3
+ global env
+ # remove a trailing "/" from sub directory name
+ regexp {(.*)/$} $szSubDirectory dummy szSubDirectory
+
+ set newList {}
+ set searchList {.}
+ set tmpDir [pwd]
+ while {[string compare [set dir [file dirname $tmpDir]] "/"] != 0} {
+ lappend searchList $dir
+ set tmpDir $dir
+ }
+ foreach dir [split $env(TESTSETS) ":"] {
+ lappend searchList $dir
+ }
+ foreach dirList $searchList {
+ foreach test [searchForFile $szFileName $dirList $szSubDirectory] {
+ # only files that are readable and
+ # not a directory, symbolic link or device
+ # are added to the list
+ if {[file isfile $test] && [file readable $test]} {
+ # add only if not already exists in list
+ if {[lsearch -exact $newList $test] < 0} {
+ lappend newList $test
+ }
+ }
+ }
+ }
+ debug {======= returning newList: >$newList<} 4
+ return $newList
+}
+
+proc locateDir {szFileName {szSubDirectory "."}} {
+ debug {======= locateDir $szFileName $szSubDirectory} 3
+ global env
+ # remove a trailing "/" from sub directory name
+ regexp {(.*)/$} $szSubDirectory dummy szSubDirectory
+
+ set newList {}
+ set searchList {.}
+ set tmpDir [pwd]
+ while {[string compare [set dir [file dirname $tmpDir]] "/"] != 0} {
+ lappend searchList $dir
+ set tmpDir $dir
+ }
+ foreach dir [split $env(TESTSETS) ":"] {
+ lappend searchList $dir
+ }
+ foreach dirList $searchList {
+ foreach test [searchForFile $szFileName $dirList $szSubDirectory] {
+ # only files that are directories
+ # are added to the list
+ if {[file isdirectory $test]} {
+ # add only if not already exists in list
+ if {[lsearch -exact $newList $test] < 0} {
+ lappend newList $test
+ }
+ }
+ }
+ }
+ debug {======= returning newList: >$newList<} 4
+ return $newList
+}
+
+proc searchForFile {szFileName dirList szSubDirectory} {
+ debug {======= searchForFile $szFileName $dirList $szSubDirectory} 3
+ # find sub directory in or below the current working directory
+ set szDirSrc ""
+ foreach file [file split $szSubDirectory] {
+ if {[string compare $file "."] == 0} {
+ if {! [info exists newList]} {
+ set newList {}
+ }
+ continue
+ } else {
+ foreach dir $dirList {
+ catch {unset newList}
+ foreach newDir [findFile $dir $file] {
+ lappend newList $newDir
+ }
+ }
+ }
+ if {[catch {set dirList $newList}]} {
+ set dirList {}
+ }
+ }
+ debug { dirList = >$dirList<} 4
+ set fileList {}
+ foreach dir $dirList {
+ set newList [findFile $dir $szFileName]
+ if {[llength $newList] > 0} {
+ set fileList [concat $fileList $newList]
+ }
+ }
+ debug { fileList = >$fileList<} 4
+ if {[llength $fileList] != 0} {
+ # NO test found, next step in searching
+ #return $fileList
+ }
+
+ set newList {}
+ set PWD [pwd]
+ foreach dir $fileList {
+ debug { dir = >$dir<} 4
+ cd [file dirname $dir]
+ lappend newList "[pwd]/[file tail $dir]"
+ cd $PWD
+ }
+
+ debug { newList = >$newList<} 4
+ return $newList
+}
+
+proc findFile {szDirectory szFileName} {
+ global locatedFile env
+
+ debug {======= findFile $szDirectory $szFileName} 3
+ if {! [info exists locatedFile($szDirectory/$szFileName)]} {
+ if {[file readable $szDirectory/$szFileName]} {
+ set locatedFile($szDirectory/$szFileName) $szDirectory/$szFileName
+ } else {
+ if {$szDirectory == "." || \
+ [lsearch -exact [split $env(TESTSETS) ":"] \
+ $szDirectory] >= 0} {
+ set locatedFile($szDirectory/$szFileName) \
+ [split [exec find $szDirectory -name $szFileName \
+ -print] "\n"]
+ } else {
+ return {}
+ }
+ }
+ }
+ return $locatedFile($szDirectory/$szFileName)
+}
+
+# appendArguments
+#
+# This procedure will append the string pathed in arguments to every
+# element of fileList
+# return a list with the same number of element in which each
+# element has the arguments appended
+#
+proc appendArguments {fileList arguments} {
+ set newList {}
+ debug {======= appendArguments $fileList $arguments} 3
+ debug { length argument list: >[llength $arguments]<} 4
+ if {[string length $arguments] > 0} {
+ foreach file $fileList {
+ regexp {([^[=]+)([[][^]]*[]])?(.*)} $file dummy szT szID szA
+ debug {dummy: >$dummy<} 4
+ debug {szT : >$szT<} 4
+ if {[string length $szID] > 0} {
+ #regexp {[[]([^]]+)[]]} $szID dummy szID
+ }
+ debug {szID : >$szID<} 4
+ if {[string length $szA] > 0} {
+ regexp {=(.*)} $szA dummy szA
+ }
+ debug {szA : >$szA<} 4
+ #set lFile [split $file "="]
+ if {[string length $szA] > 0} {
+ set szSep " "
+ } else {
+ set szSep "="
+ }
+ lappend newList ${file}${szSep}$arguments
+ }
+ return $newList
+ }
+ return $fileList
+}
+
+# appendTestCaseID
+#
+# This procedure will append the string pathed in arguments to every
+# element of fileList
+# return a list with the same number of element in which each
+# element has the arguments appended
+#
+proc appendTestCaseID {fileList {szTestCaseID ""}} {
+ set newList {}
+ debug {======= appendTestCaseID $fileList >$szTestCaseID<} 3
+ set bMultiFiles [expr [llength $fileList] > 1]
+ set i 1
+ foreach file $fileList {
+ regexp {([^[=]+)([[][^]]*[]])?(.*)} $file dummy szT szID szA
+ debug {dummy: >$dummy<} 4
+ debug {szT : >$szT<} 4
+ if {[string length $szID] > 0} {
+ regexp {[[]([^]]+)[]]} $szID dummy szID
+ }
+ debug {szID : >$szID<} 4
+ if {[string length $szA] > 0} {
+ #regexp {=(.*)} $szA dummy szA
+ }
+ debug {szA : >$szA<} 4
+ if {[string length $szID] > 0} {
+ set szID [string trim "${szID}${szTestCaseID}"]
+ } else {
+ set szID ${szTestCaseID}
+ }
+ if {[llength [split $szID "="]] > 1} {
+ set szSep " "
+ } else {
+ set szSep "="
+ }
+ if {[string length $szID] == 0} {
+ lappend newList "${szT}$szA"
+ continue
+ }
+ if {$bMultiFiles} {
+ set szI [format "${szSep}seqNr=%03d" $i]
+ } else {
+ set szI ""
+ }
+ lappend newList "${szT}\[${szID}${szI}\]$szA"
+ incr i
+ }
+ return $newList
+}
+
+# processArgs
+#
+# This procedure expect all optional arguments to be name=value pairs
+# It will set all variable named to the value given within
+# the procedure body
+# It will return an empty list or a list of all remaining not name=value
+# pair in the argument list
+#
+proc processArgs {args} {
+ debug {======= processArgs $args} 3
+
+ set llArgs $args
+ set args {}
+
+ # set default errorCode=NONE
+ uplevel set errorCode NONE
+ # now process all name=value pair arguments
+ ####### There may be a better way to do this see pre 8.0 code
+ foreach lArgs $llArgs {
+ foreach arg $lArgs {
+ set NVP [split $arg "="]
+ if {[llength $NVP] > 1} {
+ debug {uplevel set [lindex $NVP 0] \
+ [list [join [lrange $NVP 1 end] "="]]} 3
+ uplevel set [lindex $NVP 0] \
+ [list [join [lrange $NVP 1 end] "="]]
+ } else {
+ lappend args $arg
+ }
+ }
+ }
+ debug { processArgs returns: $args} 3
+ return $args
+}
+
+# processInternalArgs
+#
+# This procedure expect all optional arguments to be {name value} pairs
+# It will set all variable named to the value given within
+# the procedure body
+# It will return an empty list or a list of all remaining not name=value
+# pair in the argument list
+#
+proc processInternalArgs {lArgs} {
+ debug {======= processInternalArgs $lArgs} 3
+ set arglist {}
+
+ # set default errorCode=NONE
+ uplevel set errorCode NONE
+ # now process all {name value} pair arguments
+ foreach arg $lArgs {
+ if {[llength $arg] == 2} {
+ debug {uplevel set [lindex $arg 0] \
+ [list [join [lrange $arg 1 end] "="]]} 3
+ uplevel set [lindex $arg 0] \
+ [list [join [lrange $arg 1 end] "="]]
+ } else {
+ lappend arglist $arg
+ }
+ }
+ debug {processInternalArgs returns: $arglist} 3
+ return $arglist
+}
+
+# processTestScriptArgs
+#
+# This procedure expect all optional arguments to be {name value} pairs
+# It will set all variable named to the value given within
+# the procedure body
+# It will return an empty list or a list of all remaining not name=value
+# pair in the argument list
+#
+# This is a copy of the procedure "processInternalArgs" without an argument
+# however this procedure may become different
+#
+#
+proc processTestScriptArgs {} {
+ upvar lArgs lArgs
+ set arglist {}
+
+ # set default errorCode=NONE
+ uplevel set errorCode NONE
+ debug {======= processTestScriptArgs $lArgs} 3
+ # now process all {name value} pair arguments
+ foreach arg $lArgs {
+ if {[llength $arg] == 2} {
+ debug {uplevel set [lindex $arg 0] \
+ [list [join [lrange $arg 1 end] "="]]} 4
+ uplevel set [lindex $arg 0] \
+ [list [join [lrange $arg 1 end] "="]]
+ } else {
+ lappend arglist $arg
+ }
+ }
+ debug { processInternalArgs returns: $arglist} 4
+ return $arglist
+}
+
+# Command execution command
+# This command is like the catch command, however it can do some additional
+# testing and in case of an error it will return a error class.
+#
+proc doCmd {szCmd args} {
+ global errorInfo errorCode
+ if {! [info exists errorInfo]} {
+ set errorInfo "<errorInfo has not been defined>"
+ }
+
+ debug {======= doCmd >$szCmd< >$args<} 3
+ foreach arg $args {
+ set vv [split $arg "="]
+ if {[llength $vv] == 2} {
+ debug { ==>> Expected value: [lindex $vv 0]=[eval list \
+ [lindex $vv 1]]} 5
+ set [lindex $vv 0] [eval list [lindex $vv 1]]
+ } elseif {[llength $vv] == 1} {
+ if {! [info exists errorObj]} {
+ debug { ==>> upvar $vv errorObj} 5
+ if "! [uplevel info exists $vv]" {
+ debug { ==>> creating: $vv (uplevel)} 5
+ uplevel [list set $vv {}]
+ }
+ upvar $vv errorObj
+ }
+ }
+ }
+ if {[catch {uplevel 1 $szCmd} szErrMsg]} {
+ debug {======= ErrMsg : \n$szErrMsg\n======= from:\n$szCmd} 5
+ set errorObj ""
+ if {[string compare $errorCode NONE] == 0} {
+ set errorCode UNDEFINED
+ }
+ set errorInfoSave $errorInfo
+ set errorCodeSave $errorCode
+ catch {set errorObj [uplevel infoWhich \{$szErrMsg\}]}
+ set errorInfo $errorInfoSave
+ set errorCode $errorCodeSave
+ debug { ==>> errorObj: >$errorObj<} 5
+ if {[string compare $errorObj ""] == 0} {
+ set errorObj [uplevel \
+ ::BlueGnu::Error #auto \{$errorCode\} \
+ \{$szErrMsg\} \{$errorInfo\}]
+ debug {errorObj: >$errorObj<} 5
+ set errorObj [uplevel infoWhich \{$errorObj\}]
+ debug {errorObj: >$errorObj<} 5
+ debug {Command: [string trim $szCmd]} 5
+ debug {ErrMsg : \n$szErrMsg} 5
+ debug {====================} 5
+ global errorInfo
+ debug {ErrInfo: $errorInfo\n====================} 5
+ }
+ set bReturn 1
+ if {[info exists errorCode]} {
+ debug { errorCode= $errorCode} 5
+ debug { Class= [$errorObj info class]} 5
+ catch {debug { isa BC_RTN= [$errorObj isa BC_RTN]} 5}
+ catch {debug { isa ERROR= [$errorObj isa Error]} 5}
+ catch {
+ if [$errorObj isa BC_RTN] {
+ if {[set i \
+ [lsearch -exact $errorCode \
+ [list [$errorObj SEVERITY] \
+ [$errorObj FACILITY] [$errorObj CODE]]]] >= 0} {
+ setup_xfail
+ set bReturn 0
+ }
+ fail "Expected errorCode=$errorCode, got:\
+ [$errorObj getShortMsg]\
+ \{[$errorObj SEVERITY] [$errorObj FACILITY]\
+ [$errorObj CODE]\} for >$szCmd<"
+ #verbose { errorCode: [$errorObj errorCode]}
+ #verbose { why: [$errorObj why]}
+ #verbose {verboseWhy: [$errorObj verboseWhy]} 2
+ }
+ }
+ catch {
+ if [$errorObj isa Error] {
+ debug { Error= [$errorObj errorCode]} 5
+ if {[set i \
+ [lsearch -exact $errorCode \
+ [$errorObj errorCode]]] >= 0} {
+ setup_xfail
+ set bReturn 0
+ }
+ fail "Expected errorCode=$errorCode, got:\
+ [$errorObj errorCode] for >$szCmd<"
+ verbose { errorCode: [$errorObj errorCode]}
+ verbose { why: [$errorObj why]}
+ verbose {verboseWhy: [$errorObj verboseWhy]} 2
+ }
+ }
+ }
+ return $bReturn
+ } else {
+ set bReturn 0
+ set NOT ""
+ if {[info exists errorCode]} {
+ if {[lsearch -exact $errorCode "NONE"] < 0} {
+ setup_xfail
+ set NOT "not "
+ set bReturn 1
+ }
+ pass "errorCode=NONE ${NOT}found in expected set\
+ of errorCodes=\{$errorCode\} for >$szCmd<"
+ }
+ if {[info exists return]} {
+ debug {Return: >$return<} 3
+ set bResult 0
+ set iFalse 0
+ set iFalseFound 0
+ set iTrue 0
+ set iTrueFound 0
+ foreach lResult $return {
+ if {[llength $lResult] == 2} {
+ set bFlag [string toupper [lindex $lResult 0]]
+ set szResult [lindex $lResult 1]
+ } else {
+ set bFlag ""
+ set szResult [lindex $lResult 0]
+ }
+ debug {Checking >$szErrMsg< against $bFlag >$szResult<} 3
+ switch $bFlag {
+ 0 - NOT - NO - FALSE {
+ # no matches allowed
+ incr iFalse
+ debug {Should not match >$szErrMsg< != >$szResult<} 4
+ if {[string compare $szErrMsg $szResult] != 0} {
+ pass "The NOT Expected Result >$szResult<\
+ was not found for >$szCmd<"
+ incr iFalseFound
+ } else {
+ fail "The NOT Expected Result >$szResult<\
+ was found for >$szCmd<"
+ }
+ }
+ 1 - {} - YES - TRUE {
+ # only one match allowed
+ incr iTrue
+ debug {Should match >$szErrMsg< == >$szResult<} 4
+ if {[string compare $szErrMsg $szResult] == 0} {
+ pass "Expected Result >$szResult<\
+ found for >$szCmd<"
+ incr iTrueFound
+ }
+ }
+ default {
+ perror "doCmd result flag: 1, 0, <empty>,\
+ NOT, YES, NO, TRUE, FALSE"
+ }
+ }
+ }
+ set bResult [expr $iFalse == $iFalseFound]
+ if {$iTrue > 0} {
+ set bResult [expr $bResult && ($iTrueFound == 1)]
+ }
+ if {! $bResult} {
+ fail "Expected Result(s) >$return<\n \
+ did not match with: >$szErrMsg< for >$szCmd<"
+ set bReturn 1
+ }
+ }
+ if {[info exists errorObj]} {
+ set errorObj $szErrMsg
+ }
+ }
+ return $bReturn
+}
+
+
+# deleteObjects
+#
+# This procedure takes multiple arguments each can be a single object
+# or a list of objects
+# it will delete all these object
+# No return value
+#
+proc deleteObjects {args} {
+ debug {======= deleteObjects $args} 3
+ foreach arg $args {
+ foreach object $arg {
+ debug " delete object >$object<" 4
+ delete object $object
+ }
+ }
+ return {}
+}
+
+# isObject
+# This procedure accepts a fully qualified object name as argument
+# and checks if that object exists
+proc isObject {object} {
+ debug {======= isObject $object} 3
+ set tmp [namespace tail $object]
+ return [expr [lsearch [namespace eval [namespace qualifier $object] {
+ ::itcl::find objects
+ }
+ ] $tmp] >= 0]
+}
+
+# checkObject
+# This procedure takes an object and a class name is argument
+# It checks if the object exists, has a counter part in C++ and
+# is of the correct class
+#
+proc checkObject {object szClassName} {
+ debug {======= checkObject $object $szClassName} 3
+ if {! [catch {
+ set class [uplevel "$object info class"]
+ if {[catch {[findObject $object] isa $szClassName} bCl]} {
+ if {[string compare [namespace tail $class] \
+ [namespace tail $szClassName]] == 0} {
+ debug {Class [namespace tail $szClassName]\
+ match class of object} 4
+ } else {
+ error "Miss match"
+ }
+ } elseif {! $bCl} {
+ error 1
+ }
+ } iRet]} {
+ return 1
+ }
+
+ set obj [findObject $object]
+ set class [findClass $szClassName]
+ if {[string length $obj] > 0 && [string length $class] > 0} {
+ debug { ==>> object and class passed do exists} 4
+ if {[catch {set bISA [$obj isa $class]}]} {
+ debug {Class $szClassName is not inscope to match $object} 4
+ return 0
+ }
+ if {! $bISA} {
+ debug {$object is not of Class $szClassName} 4
+ return 0
+ }
+ } else {
+ debug {$object and/or $szClassName have not been found!} 4
+ return 0
+ }
+ return 1
+}
+
+# findObject
+# This procedure take the name of an object, possibly without any qualifier
+# and search all namespaces to find the object.
+# When a qualifier is specified, it will check if it is complete
+# The procedure return the fully qualified name of the object if it exists or
+# an empty string otherwise.
+#
+proc findObject {object {namespace ::}} {
+ debug {======= findObject $object $namespace} 3
+ set ns [namespace qualifier $object]
+ set obj [namespace tail $object]
+ set objs [namespace eval $namespace {::itcl::find objects}]
+ if {[lsearch $objs $obj] >= 0} {
+ regsub "::$" $namespace "" namespace
+ return ${namespace}::$obj
+ } else {
+ set result ""
+ foreach cns [namespace children $namespace] {
+ set result [findObject $obj $cns]
+ if {[string length $result] > 0} break
+ }
+ }
+ return $result
+}
+
+# findClass
+# This procedure take the name of an class, possibly without any qualifier
+# and search all namespaces to find the class.
+# When a qualifier is specified, it will check if it is complete
+# The procedure return the fully qualified name of the Class if it exists or
+# an empty string otherwise.
+#
+proc findClass {class {namespace ::}} {
+ debug {======= findClass $class $namespace} 3
+ set ns [namespace qualifier $class]
+ set obj [namespace tail $class]
+ set objs [namespace eval $namespace {::itcl::find classes}]
+ if {[lsearch $objs $obj] >= 0} {
+ regsub "::$" $namespace "" namespace
+ return ${namespace}::$obj
+ } else {
+ set result ""
+ foreach cns [namespace children $namespace] {
+ set result [findClass $obj $cns]
+ if {[string length $result] > 0} break
+ }
+ }
+ return $result
+}
+
+# The parseTest command will validate the argument as an existing
+# test including testCaseID and arguments.
+# It will return a list of all acceptable test script
+#
+proc parseTest {args} {
+ global szCurrentTestDirectory
+ debug {======= parseTest $args} 3
+
+ foreach arg $args {
+ foreach szTest $arg {
+ regexp {([^[=]+)([[][^]]*[]])?(.*)} $szTest dummy szT szID szA
+ debug {dummy: >$dummy<} 4
+ debug {szT : >$szT<} 4
+ if {[string length $szID] > 0} {
+ #regexp {[[]([^]]+)[]]} $szID dummy szID
+ }
+ debug {szID : >$szID<} 4
+ if {[string length $szA] > 0} {
+ #regexp {=(.*)} $szA dummy szA
+ }
+ debug {szA : >$szA<} 4
+ set szFileName $szT
+ set szDname [file dirname $szFileName]
+ set szFname [file tail $szFileName]
+
+ if {[file exist [set test [file join \
+ $szCurrentTestDirectory \
+ $szFileName]]]} {
+ # file should be a test
+ debug { is a test: >$test<!} 3
+ lappend testList [file join $szCurrentTestDirectory $szTest]
+ } elseif {[llength [set tests \
+ [locateFile $szFname $szDname]]] > 0} {
+ foreach test $tests {
+ if {[file exists $test]} {
+ # file should be a test
+ debug { is a test: >$test<!!} 3
+ lappend testList ${test}${szID}${szA}
+ } else {
+ warning "Test >$test< can't be found"
+ }
+ }
+ } else {
+ perror "$szFileName is not a test!\
+ Does not exists!"
+ }
+ }
+ }
+ if [info exists testList] {
+ if [llength $testList] {
+ return $testList
+ }
+ }
+ return [list]
+}
+
+# The global available runtest procedure
+# this procedure will find the current environment
+# and execute the runTest procedure in that environment
+
+proc runtest {args} {
+ global objCurrentEnvironment szCurrentTestDirectory
+ debug {======= runtest $args} 3
+ set elResult [list]
+
+ if {[llength $args] > 0} {
+ set Env [lindex $args 0]
+ debug { Checking for environment: >$Env<} 3
+ debug { >[infoWhich $Env]<} 5
+ debug { Current Test Directory: >$szCurrentTestDirectory<} 5
+ if {[string compare [infoWhich $Env] ""] == 0} {
+ debug { not an environment} 4
+ if {[info exist objCurrentEnvironment] && \
+ [string compare \
+ [infoWhich $objCurrentEnvironment] ""] != 0} {
+ debug { Found Current Environment\
+ >$objCurrentEnvironment<} 5
+ set Env $objCurrentEnvironment
+ } else {
+ error "NO default environent"
+ }
+ } else {
+ debug { is an environment} 3
+ set args [lrange $args 1 end]
+ }
+ set T [lindex $args 0]
+ set A [lindex $args 1]
+ set I [lindex $args 2]
+ foreach t [appendTestCaseID [appendArguments [parseTest $T] $A] $I] {
+ debug { ==>> $objCurrentEnvironment\
+ runTest $t} 3
+ lappend elResult \
+ [$Env runTest $t]
+ }
+ } else {
+ warning "No tests have been passed to runtest procedure!"
+ }
+ return $elResult
+}
+
+proc appendQueue {args} {
+ global objCurrentQueue szCurrentTestDirectory
+ debug {======= appendQueue $args} 3
+
+ set iRun 0
+ set Queue [lindex $args 0]
+ if {[string compare [infoWhich $Queue] ""] == 0} {
+ if {[info exist objCurrentQueue]} {
+ set Queue $objCurrentQueue
+ } else {
+ error "NO default queue"
+ }
+ } else {
+ set args [lrange $args 1 end]
+ }
+ set T [lindex $args 0]
+ set A [lindex $args 1]
+ set I [lindex $args 2]
+ foreach t [appendTestCaseID [appendArguments [parseTest $T] $A] $I] {
+ debug { ==>> $Queue append $t} 3
+ incr iRun
+ $Queue append $t
+ }
+ if {$iRun == 0} {
+ warning "NO argument to appendQueue have been processed"
+ }
+}
+
+proc prependQueue {args} {
+ global objCurrentQueue szCurrentTestDirectory
+ debug {======= prependQueue $args} 3
+
+ set iRun 0
+ set Queue [lindex $args 0]
+ if {[string compare [infoWhich [lindex $args 0]] ""] == 0} {
+ if {[info exist objCurrentQueue]} {
+ set Queue $objCurrentQueue
+ } else {
+ error "NO default queue"
+ }
+ } else {
+ set args [lrange $args 1 end]
+ }
+ set T [lindex $args 0]
+ set A [lindex $args 1]
+ set I [lindex $args 2]
+ foreach t [appendTestCaseID [appendArguments [parseTest $T] $A] $I] {
+ incr iRun
+ lappend comList $t
+ }
+ debug { ==>> $Queue prepend $comList} 3
+ eval $Queue prepend $comList
+
+ if {$iRun == 0} {
+ warning "NO argument to appendQueu have been processed"
+ }
+}
+
+proc perror {args} {
+ global errorInfo
+ global objCurrentTest
+ global objCurrentEnvironment
+
+ # save errorInfo
+ set errorInfoSave $errorInfo
+
+ if { [llength $args] > 1 } {
+ set $::BlueGnu::errcnt [lindex [uplevel set args] 1]
+ } else {
+ incr ::BlueGnu::errcnt
+ }
+
+ while 1 {
+ set szMsg [lindex $args 0]
+
+ if {[catch {$objCurrentTest perror $szMsg} \
+ szErrMsg]} {
+ if {[info exists objCurrentTest]} {
+ debug {No current test: >$szErrMsg<:\
+ current test >$objCurrentTest< message:\n \
+ $szMsg} 3
+ } else {
+ debug {PERROR: No current test: >$szErrMsg<:\
+ current test >DOES NOT EXIST< message:\n \
+ $szMsg} 3
+ debug { info: >>>$errorInfo<<<} 4
+ }
+ } else {
+ break
+ }
+ catch {
+ set szCmd [concat \"$objCurrentEnvironment\" record_test \
+ ERROR \$szMsg]
+ }
+ if {[catch {eval $szCmd} szErrMsg]} {
+ verbose {No current environment (ERROR): >$szErrMsg<} 3
+ } else {
+ break
+ }
+
+ ::BlueGnu::clone_output "ERROR: $szMsg"
+ namespace eval ::BlueGnu {
+ set errno "ERROR: [uplevel set szMsg]"
+ }
+ break
+ }
+
+ # restore errorInfo
+ set errorInfo $errorInfoSave
+}
+
+proc warning {args} {
+ global errorInfo
+ global objCurrentTest
+ global objCurrentEnvironment
+
+ # save errorInfo
+ set errorInfoSave $errorInfo
+
+ if { [llength $args] > 1 } {
+ namespace eval ::BlueGnu {
+ set warncnt [lindex [uplevel set args] 1]
+ }
+ } else {
+ namespace eval ::BlueGnu {
+ incr warncnt
+ }
+ }
+
+ while 1 {
+ set szMsg [lindex $args 0]
+
+ if {[catch {$objCurrentTest warning $szMsg} \
+ szErrMsg]} {
+ if {[info exists objCurrentTest]} {
+ verbose {No current test: >$szErrMsg<:\
+ current test >$objCurrentTest< message:\n \
+ $szMsg} 3
+ } else {
+ verbose {WARNING: No current test: >$szErrMsg<:\
+ current test >DOES NOT EXIST< message:\n \
+ $szMsg} 3
+ }
+ } else {
+ break
+ }
+ catch {
+ set szCmd [concat \"$objCurrentEnvironment\" record_test \
+ WARNING \$szMsg]
+ }
+ if {[catch {eval $szCmd} szErrMsg]} {
+ verbose {No current environment (WARNING): >$szErrMsg<} 3
+ } else {
+ break
+ }
+
+ set szMsg [lindex $args 0]
+ ::BlueGnu::clone_output "WARNING: $szMsg"
+ namespace eval ::BlueGnu {
+ set errno "WARNING: [uplevel set szMsg]"
+ }
+ break
+ }
+ if 0 {
+ uplevel #0 {
+ verbose {uplevel #0 to remove errorInfo}
+ if [info exists errorInfo] {
+ unset errorInfo
+ }
+ }
+ }
+ # restore errorInfo
+ set errorInfo $errorInfoSave
+}
+
+proc note {szMsg} {
+ global objCurrentTest
+
+ $objCurrentTest note $szMsg
+}
+
+proc pass {szMsg} {
+ global objCurrentTest
+
+ $objCurrentTest pass $szMsg
+}
+
+proc fail {szMsg} {
+ global objCurrentTest
+
+ $objCurrentTest fail $szMsg
+}
+
+proc unresolved {szMsg} {
+ global objCurrentTest
+
+ $objCurrentTest unresolved $szMsg
+}
+
+proc untested {szMsg} {
+ global objCurrentTest
+
+ $objCurrentTest untested $szMsg
+}
+
+proc unsupported {szMsg} {
+ global objCurrentTest
+
+ $objCurrentTest unsupported $szMsg
+}
+
+proc get_warning_threshold {} {
+ return [namespace eval ::BlueGnu {set warning_threshold}]
+}
+
+proc set_warning_threshold {threshold} {
+ namespace eval ::BlueGnu {
+ set warning_threshold [uplevel set threshold]
+ }
+}
+
+proc setup_xfail {args} {
+ namespace eval ::BlueGnu {set xfail_flag 1}
+}
+
+proc clear_xfail {args} {
+ namespace eval ::BlueGnu {set xfail_flag 0}
+}
+
+proc benchmark {benchmarkFunction args} {
+ debug {======= benchmark $benchmarkFunction $args}
+ global objCurrentTest
+ global errorInfo
+
+ if 0 {
+ debug {[foreach var [info vars] {
+ verbose {local var: >$var<}}]
+ }
+ uplevel {
+ debug {[foreach var [info vars] {
+ verbose {uplevel local var: >$var<}}]
+ }
+ }
+ debug {[foreach var [info globals] {
+ verbose {global var: >$var<}}]
+ }
+ }
+
+ set errorInfo ""
+ set szID [$objCurrentTest ID]
+ set szTestCaseID [$objCurrentTest testCaseID]
+ set benchmarkObject [$objCurrentTest benchmarkObject]
+ set benchmarkClassName [$objCurrentTest benchmarkClassName]
+ debug { ==>> test ID: >$szID<} 3
+ debug { test case ID: >$szTestCaseID<} 3
+ debug { check test object: >$benchmarkObject<} 3
+ if {$benchmarkObject == ""} {
+ warning "NO Benchmark Class defines for >$benchmarkClassName<"
+ set bResult 0
+ } else {
+ if [catch {
+ set bResult [eval $benchmarkObject benchmark \
+ $benchmarkFunction $args]
+ } errMsg] {
+ warning "NO checking has been done for\
+ ${benchmarkClassName}::benchmark $benchmarkFunction $args"
+ debug {[perror "BenchmarkFunction: >$benchmarkFunction<\
+ has not been defined\
+ in class $benchmarkClassName\n### Error Msg: $errMsg"]} 0
+ debug {### Error Info: $errorInfo} 0
+ set bResult 0
+ }
+ }
+ return $bResult
+}
+
+proc envPATH {szAction szDir} {
+ debug {======= envPATH $szAction $szDir} 3
+
+ global env
+ if [file isdirectory $szDir] {
+ # remove directory from Path if it exists
+ set envPATH $env(PATH)
+ while {[regsub :?$szDir:? $envPATH {:} envPATH]} {
+ }
+ regsub {^:} $envPATH {} envPATH
+ regsub {:$} $envPATH {} envPATH
+ set env(PATH) $envPATH
+ switch $szAction {
+ prefix -
+ prepend {
+ set env(PATH) "$szDir:$env(PATH)"
+ }
+ append {
+ append env(PATH) ":$szDir"
+ }
+ default {
+ }
+ }
+ }
+}
+
+# replacement for info which commaond
+#
+proc infoWhich {name {namespace ::}} {
+ debug {======= infoWhich $name $namespace} 3
+ if [catch {uplevel set infoWhich__name $name} szErrMsg] {
+ debug { error: $szErrMsg}
+ return ""
+ }
+ uplevel {
+ debug { objects: >[::itcl::find objects]<} 4
+ debug { namespace: >[namespace current]<} 4
+ infoWhichYYY
+ }
+ set name [uplevel set infoWhich__name]
+ uplevel unset infoWhich__name
+ debug {infoWhich return: >$name<} 4
+ return $name
+}
+proc infoWhichXXX {} {
+ uplevel {
+ set i [lsearch -regexp [::itcl::find objects] "[namespace tail \
+ $infoWhich__name]"]
+ if {$i < 0} {
+ set infoWhich__name ""
+ } else {
+ set infoWhich__name [lindex [::itcl::find objects] $i]
+ if {! [string match ::* $infoWhich__name]} {
+ set infoWhich__name [namespace current]::$infoWhich__name
+ }
+ regsub "^::::" $infoWhich__name "::" infoWhich__name
+ }
+ }
+}
+proc infoWhichYYY {} {
+ uplevel {
+ if [catch {infoWhichXXX} szErrMsg] {
+ verbose "infoWhichYYY error Msg: $szErrMsg"
+ set infoWhich__name ""
+ }
+ }
+}
+
+namespace eval ::BlueGnu {
+ variable warning_threshold 0
+
+ variable sum_file stdout
+ variable all_flag 0
+
+ variable xfail_flag 0
+ variable xfail_prms {}
+ #
+ # Print output to stdout (or stderr) and to log file
+ #
+ # If the --all flag (-a) option was used then all messages
+ # go the the screen.
+ # Without this, all messages that start with a keyword are
+ # written only to the
+ # detail log file. All messages that go to the screen will
+ # also appear in the
+ # detail log. This should only be used by the framework itself using pass,
+ # fail, xpass, xfail, warning, perror, note, untested, unresolved, or
+ # unsupported procedures.
+ #
+ proc clone_output {message} {
+ variable sum_file
+ variable all_flag
+
+ #everything goes in the summary file
+ #
+ puts $sum_file "$message"
+
+ # Depending on the type of message, the message is send
+ # to other resources
+ #
+ case [lindex [split $message] 0] in {
+ {"FAIL:" "XPASS:" "UNRESOLVED:" "UNSUPPORTED:" "UNTESTED:"} {
+ send_user "$message\n"
+ send_log "$message\n"
+ }
+ {"PASS:" "XFAIL:"} {
+ if $all_flag {
+ send_user "$message\n"
+ }
+ send_log "$message\n"
+ }
+ "ERROR:" {
+ #send_user "$message\n"
+ send_error "$message\n"
+ send_log "$message\n"
+ }
+ {"WARNING:" "NOTE:"} {
+ if $all_flag {
+ send_error "$message\n"
+ }
+ send_log "$message\n"
+ }
+ "*******" {
+ send_user "$message\n"
+ #send_log "$message\n"
+ #send_error "$message\n"
+ }
+ default {
+ send_user "$message\n"
+ }
+ }
+
+ # we always return turn the message unchanged
+ #
+ return "$message"
+ }
+}
+
+proc createTarget {args} {
+ verbose {In: createTarget >$args<} 3
+ set szCmd "::BlueGnu::Target #auto "
+ set bID 0
+ set bEnv 0
+ set bQueue 0
+ foreach item $args {
+ if {[string compare \
+ [lindex [split $item "="] 0] szID] == 0} {
+ set bID 1
+ }
+ if {[string compare \
+ [lindex [split $item "="] 0] objEnvironment] == 0} {
+ set bEnv 1
+ }
+ if {[string compare \
+ [lindex [split $item "="] 0] objQueue] == 0} {
+ set bQueue 1
+ }
+ append szCmd "\{$item\} "
+ }
+ if {! $bID} {
+ append szCmd "szID=Default "
+ }
+ if {! $bEnv} {
+ append szCmd "objEnvironment=[infoWhich \
+ [::BlueGnu::Environment #auto]] "
+ }
+ if {! $bQueue} {
+ append szCmd "objQueue=[infoWhich [::BlueGnu::Queue #auto]] "
+ }
+ verbose {Command: >$szCmd<} 3
+ set target [uplevel #0 "eval $szCmd"]
+ verbose {Created target: >$target<} 3
+ verbose { >>>[$target <<]<<<} 4
+ verbose { >>>[[infoWhich $target] <<]<<<} 4
+ verbose { == [join [$target <<] "\n == "]} 3
+ return [infoWhich $target]
+}
+
+# Initialize all global variables not yet initialized
+#
+set szCurrentTestDirectory $env(TESTSUITEROOT)
+
+# Remove all temporary variables from the global space
+catch {eval unset [info globals __*]}
+debug {Global variables available:\
+ \n [join [lsort [info globals]] "\n "]} 9
+debug {Global procedures available:\
+ \n [join [lsort [info procs]] "\n "]} 9
+
+foreach dir [split $env(TESTSETS) ":"] {
+ if {[string compare $dir $PWD] == 0} {
+ foreach indexFile [locateFile tclIndex] {
+ set indexDir [file dirname $indexFile]
+ if {[lsearch -exact [split $auto_path] $indexDir] < 0} {
+ set auto_path "$indexDir $auto_path"
+ }
+ }
+ foreach indexFile [locateFile tclIndex lib] {
+ set indexDir [file dirname $indexFile]
+ if {[lsearch -exact [split $auto_path] $indexDir] < 0} {
+ set auto_path "$indexDir $auto_path"
+ }
+ }
+ } else {
+ if {[file exists $dir/tclIndex]} {
+ set auto_path "$dir $auto_path"
+ }
+ }
+}
+debug {auto_path has been intialize to:\n [join $auto_path "\n "]} 3
+verbose {TESTSETS: >$env(TESTSETS)<} 3
diff --git a/contrib/bluegnu2.0.3/lib/testSessionUtils.itcl b/contrib/bluegnu2.0.3/lib/testSessionUtils.itcl
new file mode 100644
index 0000000..4c960c4
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/testSessionUtils.itcl
@@ -0,0 +1,26 @@
+#
+# Procedures and other definitions for application:
+#
+# testSession
+#
+
+
+
+proc popQueue {args} {
+ global szDefaultQueue
+
+ if {[llength $args] == 1} {
+ set Queue [lindex $args 0]
+ if {[string compare [infoWhich $Queue] ""] == 0} {
+ error "NOT a queue >$args<"
+ } else {
+ eval [concat [infoWhich $Queue] pop]
+ }
+ } else {
+ if {[info exist szDefaultQueue]} {
+ eval [concat $szDefaultQueue pop]
+ } else {
+ error "NO default queue"
+ }
+ }
+}
diff --git a/contrib/bluegnu2.0.3/lib/udi.exp b/contrib/bluegnu2.0.3/lib/udi.exp
new file mode 100644
index 0000000..b8c940e
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/udi.exp
@@ -0,0 +1,213 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#
+# set target variables only if needed.
+#
+global targetname
+global connectmode
+global env
+
+if ![info exists targetname] {
+ if [info exists env(TARGETNAME)] {
+ set targetname $env(TARGETNAME)
+ } else {
+ puts stderr "ERROR: Need a target name for the udi target."
+ puts stderr " Use the --name option\n"
+ exit 1
+ }
+}
+
+# the default connect program to use
+if ![info exists connectmode] {
+ set connectmode "mondfe"
+ warning "Using default of $connectmode for target communication."
+ if {[which mondfe] == 0} {
+ perror "\"mondfe\" does not exist. Check your path."
+ exit 1
+ }
+}
+
+#
+# Connect to udi using mondfe
+#
+# HOSTNAME can be `iss' to talk to the simulator.
+# The result is the value of `spawn_id' or -1 for failure.
+#
+proc mondfe { hostname } {
+ global shell_prompt
+ global spawn_id
+
+ set retries 0
+ set result -1
+
+ verbose "Attempting to connect to $hostname via mondfe."
+ spawn mondfe -D -TIP $hostname
+
+ expect {
+ "$shell_prompt" {
+ verbose "Got prompt"
+ set result 0
+ }
+ "*server bind*failed: Address already in use*" {
+ warning "Socket file already exists."
+ incr retries
+ if { $retries <= 2 } {
+ continue -expect
+ }
+ }
+ -indices -re ".*(UDIERROR\[^\r\n\]*)\[\r\n\]" {
+ warning "$expect_out(1,string)"
+ continue -expect
+ }
+ -indices -re ".*(DFEERROR\[^\r\n\]*)\[\r\n\]" {
+ warning "$expect_out(1,string)"
+ continue -expect
+ }
+ timeout {
+ warning "Timed out trying to connect."
+ set result -1
+ incr retries
+ if { $retries <= 2 } {
+ send -i $spawn_id "\n"
+ continue -expect
+ }
+ }
+ }
+
+ if { $result < 0 } {
+ perror "Couldn't connect after $retries retries."
+ return -1
+ } else {
+ return $spawn_id
+ }
+}
+
+#
+# Downloads using the y (yank) command in mondfe
+#
+# SHELL_ID is the from the result of `mondfe'.
+# ARG is a full path name to the file to download.
+# Returns 1 if an error occured, 0 otherwise.
+#
+proc mondfe_download { shell_id arg } {
+ global decimal ;# ??? What is this?
+ global shell_prompt
+
+ if ![file exists $arg] {
+ perror "$arg doesn't exist."
+ return 1
+ }
+
+ verbose "Downloading $arg." 2
+ set result 1
+ send -i $shell_id "y $arg\n"
+ expect {
+ -i $shell_id "y $arg*loading $arg*" {
+ continue -expect
+ }
+ -i $shell_id -re "Loading *TEXT section from\[^\r\]*\r" {
+ verbose -n "." 2
+ continue -expect
+ }
+ -i $shell_id -re "Loaded *TEXT section from\[^\n\]*\n" {
+ verbose " TEXT section loaded." 2
+ continue -expect
+ }
+ -i $shell_id -re "Loading *LIT section from\[^\r\]*\r" {
+ verbose -n "." 2
+ continue -expect
+ }
+ -i $shell_id -re "Loaded *LIT section from\[^\n\]*\n" {
+ verbose " LIT section loaded." 2
+ continue -expect
+ }
+ -i $shell_id -re "Loading *DATA section from\[^\r\]*\r" {
+ verbose -n "." 2
+ continue -expect
+ }
+ -i $shell_id -re "Loaded *DATA section from\[^\n\]*\n" {
+ verbose " DATA section loaded." 2
+ continue -expect
+ }
+ -i $shell_id -re "Clearing *BSS section from\[^\r\]*\r" {
+ verbose -n "." 2
+ continue -expect
+ }
+ -i $shell_id -re ".*Cleared *BSS section from.*$shell_prompt$" {
+ verbose " BSS section cleared." 2
+ verbose "Downloaded $arg successfully." 2
+ set result 0
+ }
+ -i $shell_id -re "DFEWARNING: $decimal : EMMAGIC: Bad COFF file magic number.*Command failed.*$shell_prompt$" {
+ warning "Bad COFF file magic number"
+ set result 1
+ }
+ -i $shell_id -re ".*Ignoring COMMENT section \($decimal bytes\).*$shell_prompt$" {
+ verbose "Ignoring COMMENT section" 2
+ verbose "Downloaded $arg successfully." 2
+ set result 0
+ }
+ -i $shell_id timeout {
+ perror "Timed out trying to download $arg."
+ set result 1
+ }
+ }
+
+# FIXME: the following keeps the download from working
+# "Could not read COFF section" {
+# perror "Couldn't read COFF section."
+# set result 1
+# }
+
+ if { $result && [info exists expect_out(buffer)] } {
+ send_log $expect_out(buffer)
+ }
+ return $result
+}
+
+#
+# Exit the remote shell
+#
+proc exit_mondfe { shell_id } {
+ send -i $shell_id "q\n"
+ expect {
+ -i $shell_id "Goodbye." {
+ verbose "Exited mondfe $shell_id"
+ }
+ timeout {
+ warning "mondfe didn't exit cleanly"
+ }
+ }
+
+ catch "close -i $shell_id"
+ return 0
+}
+
+#
+# Exit the remote shell
+#
+proc exit_montip { shell_id } {
+ verbose "exiting montip $shell_id"
+
+ catch "close -i $shell_id"
+ return 0
+}
diff --git a/contrib/bluegnu2.0.3/lib/util-defs.exp b/contrib/bluegnu2.0.3/lib/util-defs.exp
new file mode 100644
index 0000000..17fcf1a
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/util-defs.exp
@@ -0,0 +1,110 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#
+# Run a utility and test the result.
+#
+# Parameters:
+# First one is the command
+# Second one is command arguments
+# Third one is the file name
+# Fourth one is the regexp style pattern to match for a PASS
+#
+# Returns:
+# 1 if the test failed,
+# 0 if the test passes,
+# -1 if there was an internal error.
+#
+
+proc util_test { args } {
+ global verbose
+ # get the parameters
+ set cmd [lindex $args 0]
+ verbose "Utility to execute is $cmd" 2
+ set cmd_arg [lindex $args 1]
+ verbose "Command line arguments are $cmd_arg" 2
+ set file [lindex $args 2]
+ verbose "The file name to use is $file" 2
+ set pattern [lindex $args 3]
+ verbose "The pattern to match is \"$pattern\"" 2
+
+ if [info exists file] {
+ if ![string match "" $file] {
+ if ![file exists $file] {
+ perror "$file doesn't exist"
+ return -1
+ }
+ }
+ }
+
+ # Run the utility to be tested and analyze the results.
+
+ set comp_output [util_start $cmd $cmd_arg $file]
+
+ verbose "Output is \"$comp_output\"" 2
+ verbose "Pattern is \"$pattern\"" 2
+
+ if [regexp "$pattern" $comp_output] {
+ verbose "Pattern matches." 2
+ return 0
+ }
+
+ verbose "Pattern does not match." 2
+ return 1
+}
+
+#
+# Run the utility
+#
+# Return NULL or the output.
+#
+
+proc util_start { args } {
+ global verbose
+ set cmd [lindex $args 0]
+ set cmd_arg [lindex $args 1]
+ set file [lindex $args 2]
+
+ if {[which $cmd] == 0} {
+ perror "Can't find $cmd"
+ return ""
+ }
+
+ if { $verbose > 0 } {
+ verbose "Spawning \"$cmd $cmd_arg $file\""
+ } else {
+ send_log "Spawning \"$cmd $cmd_arg $file\"\n"
+ }
+ catch "exec $cmd $cmd_arg $file" comp_output
+ if ![string match "" $comp_output] {
+ send_log "$comp_output\n"
+ }
+ return $comp_output
+}
+
+#
+# add some basic error trapping. These mostly catch programming error's
+# within the tests themselves
+#
+expect_before {
+ buffer_full { perror "Internal buffer is full" }
+ "can't open 'nmtest'" { perror "Can't open test file" }
+}
diff --git a/contrib/bluegnu2.0.3/lib/utils.exp b/contrib/bluegnu2.0.3/lib/utils.exp
new file mode 100644
index 0000000..2372264
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/utils.exp
@@ -0,0 +1,454 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#
+# Most of the procedures found here mimic their unix counter-part.
+# This file is sourced by runtest.exp, so they are usable by any test case.
+#
+
+#
+# Gets the directories in a directory
+# args: the first is the dir to look in, the next
+# is the pattern to match. It
+# defaults to *. Patterns are csh style
+# globbing rules
+# returns: a list of dirs or NULL
+#
+proc getdirs { args } {
+ set path [lindex $args 0]
+ if { [llength $args] > 1} {
+ set pattern [lindex $args 1]
+ } else {
+ set pattern "*"
+ }
+ verbose "Looking in ${path} for directories that match \"${pattern}\"" 3
+ catch "glob ${path}/${pattern}" tmp
+ if { ${tmp} != "" } {
+ foreach i ${tmp} {
+ if [file isdirectory $i] {
+ switch -- "[file tail $i]" {
+ "testsuite" -
+ "config" -
+ "lib" -
+ "CVS" -
+ "RCS" -
+ "SCCS" {
+ verbose "Ignoring directory [file tail $i]" 3
+ continue
+ }
+ default {
+ if [file readable $i] {
+ verbose "Found directory [file tail $i]" 3
+ lappend dirs $i
+ }
+ }
+ }
+ }
+ }
+ } else {
+ perror "$tmp"
+ return ""
+ }
+
+ if ![info exists dirs] {
+ return ""
+ } else {
+ return $dirs
+ }
+}
+
+#
+# Finds all the files recursively
+# rootdir - this is the directory to start the search
+# from. This is and all subdirectories are search for
+# filenames. Directory names are not included in the
+# list, but the filenames have path information.
+# pattern - this is the pattern to match. Patterns are csh style
+# globbing rules.
+# returns: a list or a NULL.
+#
+proc find { rootdir pattern } {
+ # first find all the directories
+ set dirs "$rootdir "
+ while 1 {
+ set tmp $rootdir
+ set rootdir ""
+ if [string match "" $tmp] {
+ break
+ }
+ foreach i $tmp {
+ set j [getdirs $i]
+ if ![string match "" $j] {
+ append dirs "$j "
+ set rootdir $j
+ unset j
+ } else {
+ set rootdir ""
+ }
+ }
+ set tmp ""
+ }
+
+ # find all the files that match the pattern
+ foreach i $dirs {
+ verbose "Looking in $i" 3
+ set tmp [glob -nocomplain $i/$pattern]
+ if { [llength $tmp] != 0 } {
+ foreach j $tmp {
+ if ![file isdirectory $j] {
+ lappend files $j
+ verbose "Adding $j to file list" 3
+ }
+ }
+ }
+ }
+
+ if ![info exists files] {
+ lappend files ""
+ }
+ return $files
+}
+
+#
+# Search the path for a file. This is basically a version
+# of the BSD-unix which utility. This procedure depends on
+# the shell environment variable $PATH. It returns 0 if $PATH
+# does not exist or the binary is not in the path. If the
+# binary is in the path, it returns the full path to the binary.
+#
+proc which { file } {
+ global env
+
+ # strip off any extraneous arguments (like flags to the compiler)
+ set file [lindex $file 0]
+
+ # if it exists then the path must be OK
+ # ??? What if $file has no path and "." isn't in $PATH?
+ if [file exists $file] {
+ return $file
+ }
+ if [info exists env(PATH)] {
+ set path [split $env(PATH) ":"]
+ } else {
+ return 0
+ }
+
+ foreach i $path {
+ verbose "Checking against $i" 3
+ if [file exists $i/$file] {
+ if [file executable $i/$file] {
+ return $i/$file
+ } else {
+ warning "$i/$file exists but is not an executable"
+ }
+ }
+ }
+ # not in path
+ return 0
+}
+
+#
+# Looks for a string in a file.
+# return:list of lines that matched or NULL if none match.
+# args: first arg is the filename,
+# second is the pattern,
+# third are any options.
+# Options: line - puts line numbers of match in list
+#
+proc grep { args } {
+
+ set file [lindex $args 0]
+ set pattern [lindex $args 1]
+
+ verbose "Grepping $file for the pattern \"$pattern\"" 3
+
+ set argc [llength $args]
+ if { $argc > 2 } {
+ for { set i 2 } { $i < $argc } { incr i } {
+ append options [lindex $args $i]
+ append options " "
+ }
+ } else {
+ set options ""
+ }
+
+ set i 0
+ set fd [open $file r]
+ while { [gets $fd cur_line]>=0 } {
+ incr i
+ if [regexp -- "$pattern" $cur_line match] {
+ if ![string match "" $options] {
+ foreach opt $options {
+ case $opt in {
+ "line" {
+ lappend grep_out [concat $i $match]
+ }
+ }
+ }
+ } else {
+ lappend grep_out $match
+ }
+ }
+ }
+ close $fd
+ unset fd
+ unset i
+ if ![info exists grep_out] {
+ set grep_out ""
+ }
+ return $grep_out
+}
+
+#
+# Remove elements based on patterns. elements are delimited by spaces.
+# pattern is the pattern to look for using glob style matching
+# list is the list to check against
+# returns the new list
+#
+proc prune { list pattern } {
+ foreach i $list {
+ verbose "Checking pattern \"$pattern\" against $i" 3
+ if ![string match $pattern $i] {
+ lappend tmp $i
+ } else {
+ verbose "Removing element $i from list" 3
+ }
+ }
+ return $tmp
+}
+
+#
+# Attempt to kill a process that you started
+#
+proc slay { name } {
+ set in [open [concat "|ps"] r]
+ while {[gets $in line]>-1} {
+ if ![string match "*expect*slay*" $line] {
+ if [string match "*$name*" $line] {
+ set pid [lindex $line 0]
+ catch "exec kill -9 $pid]"
+ verbose "Killing $name, pid = $pid\n"
+ }
+ }
+ }
+ close $in
+}
+
+#
+# Convert a relative path to an absolute one
+#
+proc absolute { path } {
+ if [string match "." $path] {
+ return [pwd]
+ }
+
+ set basedir [pwd]
+ cd $path
+ set path [pwd]
+ cd $basedir
+ return $path
+}
+
+#
+# Source a file and trap any real errors. This ignores extraneous
+# output. returns a 1 if there was an error, otherwise it returns 0.
+#
+proc psource { file } {
+ global errorInfo
+ global errorCode
+
+ unset errorInfo
+ if [file exists $file] {
+ catch "source $file"
+ if [info exists errorInfo] {
+ send_error "ERROR: errors in $file\n"
+ send_error "$errorInfo"
+ return 1
+ }
+ }
+ return 0
+}
+
+#
+# Check if a testcase should be run or not
+#
+# RUNTESTS is a copy of global `runtests'.
+#
+# This proc hides the details of global `runtests' from the test scripts, and
+# implements uniform handling of "script arguments" where those arguments are
+# file names (ie: the "foo" in make check RUNTESTFLAGS="bar.exp=foo").
+# "glob" style expressions are supported as well as multiple files (with
+# spaces between them).
+# Eg: RUNTESTFLAGS="bar.exp=foo1.c foo2.c foo3*.c bar*.c"
+#
+proc runtest_file_p { runtests testcase } {
+ if [string length [lindex $runtests 1]] {
+ set testcase [file tail $testcase]
+ foreach ptn [lindex $runtests 1] {
+ if [string match $ptn $testcase] {
+ return 1
+ }
+ }
+ return 0
+ }
+ return 1
+}
+
+#
+# Delete various system verbosities from TEXT on SYSTEM
+#
+# An example is:
+# ld.so: warning: /usr/lib/libc.so.1.8.1 has older revision than expected 9
+#
+# SYSTEM is typical $target_triplet or $host_triplet.
+#
+# This is useful when trying to do pattern matches on program output.
+# Sites with particularily verbose os's may wish to override this in site.exp.
+#
+# We get loaded after site.exp so only define this if not already defined.
+#
+
+if { [info procs prune_system_crud] == "" } {
+ proc prune_system_crud { system text } {
+ # This is from sun4's. Do it for all machines for now.
+ # The "\\1" is to try to preserve a "\n" but only if necessary.
+ regsub -all "(^|\n)(ld.so: warning:\[^\n\]*\n?)+" $text "\\1" text
+
+ # This happens when compiling on Alpha OSF/1 with cc -g -O.
+ regsub -all "(^|\n)(\n*uopt: Warning: file not optimized; use -g3 if both optimization and debug wanted\n?)+" $text "\\1" text
+
+ # This happens when compiling on Alpha OSF using gas.
+ regsub -all "(^|\n)(/usr/ucb/ld:\nWarning: Linking some objects which contain exception information sections\n\tand some which do not. This may cause fatal runtime exception handling\n\tproblems\[^\n\]*\n?)+" $text "\\1" text
+
+ # This happens on SunOS with cc -g -O.
+ regsub -all "(^|\n)(cc: Warning: -O conflicts with -g. -O turned off.\n?)+" $text "\\1" text
+
+ # This happens when using g++ on a DWARF system.
+ regsub -all "(^|\n)(cc1plus: warning: -g option not supported for C\\+\\+ on systems using the DWARF debugging format\n?)+" $text "\\1" text
+
+ # It might be tempting to get carried away and delete blank lines, etc.
+ # Just delete *exactly* what we're ask to, and that's it.
+ return $text
+ }
+}
+
+#
+# Compares two files line-by-line
+# returns 1 it the files match,
+# returns 0 if there was a file error,
+# returns -1 if they didn't match.
+#
+proc diff { file_1 file_2 } {
+ set eof -1
+ set differences 0
+
+ if [file exists ${file_1}] {
+ set file_a [open ${file_1} r]
+ } else {
+ warning "${file_1} doesn't exist"
+ return 0
+ }
+
+ if [file exists ${file_2}] {
+ set file_b [open ${file_2} r]
+ } else {
+ warning "${file_2} doesn't exist"
+ return 0
+ }
+
+ verbose "# Diff'ing: ${file_1} ${file_2}\n" 1
+
+ while { [gets ${file_a} line] != ${eof} } {
+ if [regexp "^#.*$" ${line}] {
+ continue
+ } else {
+ lappend list_a ${line}
+ }
+ }
+ close ${file_a}
+
+ while { [gets ${file_b} line] != ${eof} } {
+ if [regexp "^#.*$" ${line}] {
+ continue
+ } else {
+ lappend list_b ${line}
+ }
+ }
+ close ${file_b}
+ for { set i 0 } { $i < [llength $list_a] } { incr i } {
+ set line_a [lindex ${list_a} ${i}]
+ set line_b [lindex ${list_b} ${i}]
+
+# verbose "\t${file_1}: ${i}: ${line_a}\n" 3
+# verbose "\t${file_2}: ${i}: ${line_b}\n" 3
+ if [string compare ${line_a} ${line_b}] {
+ verbose "line #${i}\n" 2
+ verbose "\< ${line_a}\n" 2
+ verbose "\> ${line_b}\n" 2
+
+ send_log "line #${i}\n"
+ send_log "\< ${line_a}\n"
+ send_log "\> ${line_b}\n"
+
+ set differences -1
+ }
+ }
+
+ if { [llength ${list_a}] != [llength ${list_b}] } {
+ verbose "Files not the same" 2
+ set differences -1
+ } else {
+ verbose "Files are the same" 2
+ set differences 1
+ }
+ return ${differences}
+}
+
+#
+# Set an environment variable
+#
+proc setenv { var val } {
+ global env
+
+ set env($var) $val
+}
+
+#
+# Unset an environment variable
+#
+proc unsetenv { var } {
+ global env
+ unset env($var)
+}
+
+#
+# Get a value from an environment variable
+#
+proc getenv { var } {
+ global env
+
+ if [info exists env($var)] {
+ return $env($var)
+ } else {
+ return ""
+ }
+}
+
diff --git a/contrib/bluegnu2.0.3/lib/vrtx.exp b/contrib/bluegnu2.0.3/lib/vrtx.exp
new file mode 100644
index 0000000..91be6c5
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/vrtx.exp
@@ -0,0 +1,334 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+# these just need to be initialized
+# FIXME: The usage of `shell_id' as a global here seems wrong. Most targets
+# have it local to the file of our caller. See for example udi.exp.
+set shell_id 0
+
+#
+# set default values
+#
+
+global env
+if ![info exists env(SPECTRA)] {
+ perror "SPECTRA environment variable is not set."
+ exit 1
+} else {
+ set SPECTRA $env(SPECTRA)
+ append CFLAGS " -I $SPECTRA/target/include"
+}
+
+# the hostname of the target board
+
+global targetname
+if ![info exists targetname] {
+ puts stderr "ERROR: Need a target name for Spectra."
+ puts stderr " Use the --target option\n"
+ exit 1
+}
+
+# the default connect program to use
+global connectmode
+if ![info exists connectmode] {
+ set connectmode "xsh"
+ warning "Using default of $connectmode for target communication."
+}
+
+#
+# Connect to Spectra (VTRX) using xsh
+#
+proc xsh { hostname } {
+ global verbose
+ global hex
+ global connectmode
+ global shell_prompt
+ global spawn_id
+ global shell_id
+ global spawn_id
+ global env
+ global target_triplet
+
+ set retries 0
+ set result 0
+ if {[which xsh] != 0} {
+ spawn xsh
+ } else {
+ warning "Can't find xsh in path"
+ return
+ }
+
+ set shell_id $spawn_id
+
+ # start the shell
+ expect {
+ "*Spectra Cross-Development Shell version*$shell_prompt" {
+ verbose "Got prompt"
+ set result 0
+ }
+ timeout {
+ warning "Timed out trying to connect."
+ set result -1
+ incr retries
+ if { $retries <= 2 } {
+ exp_continue
+ }
+ }
+ }
+
+ # connect to the shell
+ set retries 0
+ send "connect $hostname\n"
+ expect {
+ "connect $hostname*$hostname connected \(non-os mode\)*\n" {
+ set shell_prompt "$hostname> "
+ verbose "Connected to $hostname"
+ }
+ "*connect: not attached*" {
+ warning "Couldn't attach target"
+ set result -1
+ }
+ -re ".* reset on target.*$" {
+ send_user "Spectra was reset\n"
+ exp_continue
+ }
+ -re "\[0-9A-Fa-f\]+\[ 0x\]+\[0-9A-Fa-f\]+.*$" {
+ exp_continue
+ }
+ "$hostname> " {
+ #send "\n"
+ }
+ timeout {
+ warning "Timed out trying to connect after $expect_out(seconds) seconds."
+ set result -1
+ incr retries
+ if { $retries <= 2 } {
+ exp_continue
+ }
+ }
+ }
+
+ send "\n\n\n"
+ expect {
+ "*$hostname*$hostname" {
+ verbose "Cleared reset messages" 1
+ }
+ timeout {
+ warning "Couldn't clear reset messages"
+ set result 1
+ }
+ }
+
+ # load to operating system
+ set timeout 20
+ set retries 0
+ if {[xsh_load $env(SPECTRA)/${target_triplet}-os.o {-e sys_start_crt0}]!=0} {
+ perror "Couldn't load Spectra into target"
+ return -1
+ }
+
+ set timeout 10
+ # start the OS running
+ set retries 0
+ send "go\n"
+ expect {
+ -re ".*Multithreading on target darkstar.*$" {
+ verbose "Spectra has been started..." 1
+ set result 0
+ }
+ -re ".*reset on target.*$" {
+ verbose "Spectra was reset"
+ exp_continue
+ }
+ -re "\[0-9A-Fa-f\]+\[ 0x\]+\[0-9A-Fa-f\]+.*$" {
+ #send "\n"
+ exp_continue
+ }
+ -re "go\n" { exp_continue }
+ "$shell_prompt" { exp_continue }
+ timeout {
+ perror "Spectra wouldn't start"
+ set result -1
+ incr retries
+ if { $retries <= 2 } {
+ send "go\r"
+ exp_continue
+ }
+ }
+ }
+
+ if { $result < 0 } {
+ perror "Couldn't connect after $retries retries.\n"
+ return -1
+ } else {
+ return $spawn_id
+ }
+}
+
+#
+# Downloads using the load command in Spectra
+# arg - is a full path name to the file to download
+# returns 1 if a spectra error occured,
+# -1 if an internal error occured,
+# 0 otherwise.
+#
+proc xsh_load { args } {
+ global verbose
+ global shell_id
+ global decimal
+ global hex
+ global shell_prompt
+ global expect_out
+
+ set result 1
+ set retries 0
+
+ if { [llength $args] == 1 } {
+ set opts ""
+ } else {
+ set opts [lindex $args 1]
+ }
+ set file [lindex $args 0]
+
+ if ![file exists $file] {
+ perror "$file doesn't exist."
+ return 1
+ }
+
+ verbose "Downloading $file..."
+
+ send -i $shell_id "load $opts $file\r"
+ set force 0
+ expect {
+ -i $shell_id -re "\[0-9A-Fa-f\]+\[ 0x\]+\[0-9A-Fa-f\]+\r\n" {
+ set timeout 1
+ send "dout\n"
+ while $force<2 {
+ expect {
+ "dout*undefined kernel symbol*$shell_prompt" {
+ verbose "Attempted to flush I/O buffers" 1
+ }
+ timout {
+ incr force
+ flush stdout
+ }
+ }
+ }
+ set timeout 20
+ exp_continue
+ }
+ -i $shell_id "load $opts $file*\r" {
+ verbose "Loading a.out..."
+ exp_continue
+ }
+ -i $shell_id "Warm reset on target*\n" {
+ verbose "Spectra did a warm reset"
+ exp_continue
+ }
+ -i $shell_id "Cold reset on target*\n" {
+ verbose "Spectra did a cold reset"
+ exp_continue
+ }
+ -i $shell_id "loading a.out*\r" {
+ verbose "Loading a.out..."
+ exp_continue
+ }
+ -i $shell_id "reading symbols*\r" {
+ verbose "Reading symbols..."
+ exp_continue
+ }
+ -i $shell_id "defining symbols*\r" {
+ verbose "defining symbols..."
+ exp_continue
+ }
+ -i $shell_id "*loading image*\r" {
+ verbose "Loading image..."
+ exp_continue
+ }
+ -i $shell_id -re ".*bytes loaded:.*$decimal.*$" {
+ verbose "$expect_out(buffer)"
+ exp_continue
+ }
+ -i $shell_id "*loading done*\r" {
+ verbose "Loading done..."
+ exp_continue
+ }
+ -i $shell_id "*setting PC*\r" {
+ verbose "Setting PC..."
+ exp_continue
+ }
+ -i $shell_id "*resolving symbols*\r" {
+ verbose "Resolving symbols..."
+ exp_continue
+ }
+ -i $shell_id -re ".*load module id = $decimal.*$" {
+ verbose ""
+ }
+ }
+ -i $shell_id -re ".*load: undefined symbols.*$" {
+ perror "undefined symbols, make sure os is loaded and running"
+ set result -1
+ }
+ -i $shell_id "$shell_prompt" {
+ set result 0
+ exp_continue
+ }
+ -i $shell_id "load: no default target" {
+ perror "default target isn't set"
+ return -1
+ }
+ -i $shell_id timeout {
+ perror "Timed out trying to download after $expect_out(seconds) seconds."
+ incr retries
+ set result 1
+ if { $retries <= 2 } {
+ exp_continue
+ }
+ }
+ }
+
+ set timeout 10
+ if [info exists expect_out(buffer)] {
+ send_log $expect_out(buffer)
+ }
+ return $result
+}
+
+#
+# Exit the remote shell
+#
+proc xsh_exit { shell_id } {
+ global verbose
+ global connectmode
+ global targetname
+ global shell_prompt
+ global shell_id
+
+ send -i $shell_id "exit\n"
+
+ verbose "Exiting shell."
+ set shell_id 0
+ return 0
+}
+
+
+
+
diff --git a/contrib/bluegnu2.0.3/lib/vxworks.exp b/contrib/bluegnu2.0.3/lib/vxworks.exp
new file mode 100644
index 0000000..cf7c3bd
--- /dev/null
+++ b/contrib/bluegnu2.0.3/lib/vxworks.exp
@@ -0,0 +1,265 @@
+# Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#
+# set target variables only if needed.
+#
+global targetname
+global connectmode
+global env
+global checktask
+
+if ![info exists targetname] {
+ if [info exists env(TARGETNAME)] {
+ set targetname $env(TARGETNAME)
+ } else {
+ puts stderr "ERROR: Need a target name for the vxworks board."
+ puts stderr " Use the --name option\n"
+ exit 1
+ }
+}
+
+# The default connect program to use.
+if ![info exists connectmode] {
+ set connectmode "telnet"
+ warning "Using default of $connectmode for target communication."
+}
+
+if ![info exists checktask] {
+ set checktask "fp"
+}
+
+#
+# Compute a path to vxworks' value for it
+#
+# We use a default ftp device called "filesys" to load files from.
+# This way it works without NFS.
+# This proc may be overridden by the user. The typical thing to do is use
+# a different name for the device, but it might also return a different path
+# to PROG.
+#
+# ??? This is experimental. This kind of thing can't be specified on the
+# command line, but neither can specifying the kinds of transformations that
+# one might want to do without actually passing tcl code at which point it
+# makes just as much sense to stick it in a config file.
+#
+if { [info procs vxworks_transform_path] == "" } {
+ proc vxworks_transform_path { prog } {
+ return "filesys:$prog"
+ }
+}
+
+#
+# Load a file into vxworks
+#
+# The result is:
+# 0 - success
+# 1 - failed (eg: link failed so testcase should fail)
+# -1 - unresolved (eg: timeout, bad passwd)
+# -2 - unsupported (not used)
+# -3 - untested (not used)
+#
+proc vxworks_ld { shell_id prog } {
+ global shell_prompt
+ global expect_out
+ global logname
+ global passwd
+ global decimal hex
+
+ set timeout 100 ;# for this call only
+ set result -7 ;# -7 is a local value meaning "not done"
+ set tries 0
+ set maxtries 3
+
+ set prog [vxworks_transform_path $prog]
+
+ if { $passwd != "" } {
+ send -i $shell_id "iam \"$logname\",\"$passwd\"\r"
+ } else {
+ send -i $shell_id "iam \"$logname\"\r"
+ }
+ expect {
+ -i $shell_id "iam*value = 0 = 0x0*$shell_prompt" {
+ verbose "Set default user." 2
+ }
+ -i $shell_id timeout {
+ # ??? This is really an error. It's not clear whether `perror'
+ # or `warning' should be used here. There are *lots* of other
+ # cases like this.
+ perror "Couldn't set default user."
+ set result -1
+ }
+ }
+
+ # We always want to exit the program via the code at the end.
+ # If the load fails we want `expect_out' stored in the log and this
+ # saves duplicating that code.
+
+ while { $result == -7 } {
+ verbose "Loading $prog into vxworks."
+ send -i $shell_id "ld < $prog\r"
+ incr tries
+ expect {
+ -i $shell_id "Login incorrect." {
+ if { $tries == $maxtries } {
+ perror "Login failed."
+ set result -1
+ break
+ }
+ if [string match "" $passwd] {
+ stty -echo
+ warning "Login failed for default user"
+ send_user "Type in password (for $logname) please: "
+ expect_user -re "(.*)\n"
+ send_user "\n"
+ set passwd "$expect_out(1,string)"
+ stty echo
+ }
+ send -i $shell_id "iam \"$logname\",\"$passwd\"\r"
+ expect {
+ -i $shell_id "iam*value = 0 = 0x0*$shell_prompt " {
+ verbose "Set new user and password" 2
+ }
+ -i $shell_id timeout {
+ perror "Couldn't set user and password (timed out)."
+ set result -1
+ }
+ }
+ }
+ -i $shell_id -re "USER.*command not understood" {
+ perror "Need to set the user and password."
+ set result -1
+ }
+ -i $shell_id -re "ld <.*undefined symbol:.*$shell_prompt $" {
+ # This is an error in the testcase, don't call perror.
+ warning "Undefined symbol, $prog not loaded."
+ set result 1
+ }
+ -i $shell_id -re "ld <.*can't open input.*$shell_prompt $" {
+ perror "Can't access $prog."
+ set result -1
+ }
+ -i $shell_id -re "ld <.*value = ${decimal} = ${hex}.*$shell_prompt $" {
+ verbose "Loaded $prog into vxworks."
+ set result 0
+ }
+ -i $shell_id -re "ld <\[^\r\]*\r(.*)$shell_prompt $" {
+ warning "Load failed: $expect_out(1,string)"
+ set result -1
+ }
+ -i $shell_id timeout {
+ warning "Timed out trying load $prog."
+ set result -1
+ }
+ }
+ }
+
+ if { $result && [info exists expect_out(buffer)] } {
+ send_log "$expect_out(buffer)"
+ }
+ return $result
+}
+
+#
+# Start a thread (process) executing
+#
+# The result is:
+# 0 - success
+# 1 - failed (eg: testcase aborted)
+# -1 - unresolved (eg: timeout)
+# -2 - unsupported (not used)
+# -3 - untested (not used)
+#
+proc vxworks_spawn { shell_id function } {
+ global shell_prompt
+ global checktask
+
+ # There isn't a command to wait for a thread to finish, so we have to keep
+ # polling. Bummer.
+
+ set timeout 20 ;# for this call only
+
+ send -i $shell_id "sp $function\r"
+ expect {
+ -i $shell_id -re "sp $function.*task spawned:.*name = (\[a-z0-9\]+).*value = (\[0-9\]+).*$shell_prompt $" {
+ set name $expect_out(1,string)
+ set value $expect_out(2,string)
+ verbose "$function running, name $name, value $value"
+ set tries 0
+ set maxtries 100 ;# Don't hang on testcases with infinite loops.
+ set result -7 ;# "not done"
+ while { $result == -7 } {
+ # Get the task's frame pointer.
+ # VxWorks will return -1 if the task isn't running.
+ send -i $shell_id "$checktask \"$name\"\r"
+ incr tries
+ expect {
+ -i $shell_id -re "task $value - aborted.*$shell_prompt $" {
+ # FIXME: It's not clear we'll ever get here.
+ verbose "$function aborted"
+ set result 1
+ }
+ -i $shell_id -re ".*AbOrT.*$shell_prompt $" {
+ # This requires support from the environment to
+ # redefine abort() to print this.
+ verbose "$function aborted"
+ set result 1
+ }
+ # This is here to try to cope with apparently flaky h/w.
+ -i $shell_id -re ".*Bus Error.*$" {
+ # This is potentially an error in the testcase,
+ # don't call perror.
+ warning "Bus Error."
+ # Delete the task (it's still around).
+ send -i $shell_id "td $name\r"
+ set result 1
+ }
+ -i $shell_id -re "value = \[0-9\]+.*$shell_prompt $" {
+ # Task is still running.
+ if { $tries == $maxtries } {
+ warning "$function started, won't stop"
+ set result -1
+ } else {
+ catch "exec sleep 1"
+ }
+ }
+ -i $shell_id -re "value = -1.*$shell_prompt $" {
+ # Task is no longer running.
+ set result 0
+ }
+ -i $shell_id timeout {
+ warning "$function started, can't determine status (timed out)"
+ set result -1
+ }
+ }
+ }
+ }
+ -i $shell_id timeout {
+ warning "Couldn't run $function (timed out)"
+ set result -1
+ }
+ }
+
+ if { $result && [info exists expect_out(buffer)] } {
+ send_log "$expect_out(buffer)"
+ }
+ return $result
+}
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/appendQueue.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/appendQueue.itcl
new file mode 100644
index 0000000..fcdf33d
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/appendQueue.itcl
@@ -0,0 +1,9 @@
+#
+# Test script for appendQueue command
+#
+
+#appendQueue [list namespaceVariables.itcl namespaceVariables.itcl \
+ namespaceVariables.itcl] "arg1 arg2 arg3" append
+
+appendQueue [list namespaceVariables.itcl namespaceVariables.itcl \
+ namespaceVariables.itcl]
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/clone_output.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/clone_output.itcl
new file mode 100644
index 0000000..56ff9cb
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/clone_output.itcl
@@ -0,0 +1,156 @@
+#
+# This test check the BlueGnu command clone_output
+#
+
+verbose "all_flag: >$::BlueGnu::all_flag<"
+
+BlueGnu_overwrite [namespace current]
+
+set szCurrent [::BlueGnu::clone_output "namespace: >[namespace current]<"]
+
+set szSendUser [::BlueGnu::clone_output "send_user: >[info body ::send_user]<"]
+
+# Checking default messages
+#
+catch {unset sending}
+::BlueGnu::clone_output "Hello there!"
+::BlueGnu::clone_output " [array names sending]"
+if [catch {
+ if {$sending(USER) && ([llength [array names sending]] == 1)} {
+ pass "Default message"
+ } else {
+ fail "Default Message: [array names sending]"
+ }
+} szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n sending("])"
+ perror "Missing sending array elements"
+}
+
+# Checking the PASS type messages
+#
+foreach szMsg {"PASS: hello there!" "XFAIL: hello there!"} {
+ catch {unset sending}
+ ::BlueGnu::clone_output $szMsg
+ if {$::BlueGnu::all_flag} {
+ if [catch {
+ if {$sending(USER) && $sending(LOG) && \
+ ([llength [array names sending]] == 2)} {
+ pass "PASS message"
+ } else {
+ fail "PASS Message: [array names sending]"
+ }
+ } szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n \
+ sending("])"
+ perror "Missing sending array elements"
+ }
+ } else {
+ if [catch {
+ if {$sending(LOG) && ([llength [array names sending]] == 1)} {
+ pass "PASS message"
+ } else {
+ fail "PASS Message: [array names sending]"
+ }
+ } szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n \
+ sending("])"
+ perror "Missing sending array elements"
+ }
+ }
+}
+
+# Checking the fail type messages
+#
+foreach szMsg {"FAIL: Hallo daar!" "XPASS: Hallo daar!" \
+ "UNRESOLVED: Hello unresolved!" "UNSUPPORTED: Hello unsupported!" \
+ "UNTESTED: not tested!"} {
+ catch {unset sending}
+ ::BlueGnu::clone_output $szMsg
+ if [catch {
+ if {$sending(USER) && $sending(LOG) && \
+ ([llength [array names sending]] == 2)} {
+ pass "PASS message"
+ } else {
+ fail "PASS Message: [array names sending]"
+ }
+ } szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n sending("])"
+ perror "Missing sending array elements"
+ }
+}
+
+# Checking ERROR type messages
+#
+catch {unset sending}
+::BlueGnu::clone_output "ERROR: hallo daar!"
+if [catch {
+ if {$sending(LOG) && $sending(ERROR) && \
+ ([llength [array names sending]] == 2)} {
+ pass "PASS message"
+ } else {
+ fail "PASS Message: [array names sending]"
+ }
+} szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n sending("])"
+ perror "Missing sending array elements"
+}
+
+# Checking WARNING type message
+#
+foreach szMsg {"WARNING: Hello there!" "NOTE: Hello there!"} {
+ catch {unset sending}
+ ::BlueGnu::clone_output $szMsg
+ if {$::BlueGnu::all_flag} {
+ if [catch {
+ if {$sending(ERROR) && $sending(LOG) && \
+ ([llength [array names sending]] == 2)} {
+ pass "PASS message"
+ } else {
+ fail "PASS Message: [array names sending]"
+ }
+ } szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n \
+ sending("])"
+ perror "Missing sending array elements"
+ }
+ } else {
+ if [catch {
+ if {$sending(LOG) && ([llength [array names sending]] == 1)} {
+ pass "PASS message"
+ } else {
+ fail "PASS Message: [array names sending]"
+ }
+ } szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n \
+ sending("])"
+ perror "Missing sending array elements"
+ }
+ }
+}
+
+# Checking ******* type messages
+#
+catch {unset sending}
+::BlueGnu::clone_output "******* Ik zie sterretjes!"
+if [catch {
+ if {$sending(USER) && ([llength [array names sending]] == 1)} {
+ pass "PASS message"
+ } else {
+ fail "PASS Message: [array names sending]"
+ }
+} szErrMsg] {
+ ::BlueGnu::clone_output "####### $szErrMsg\n \
+ sending([join [array names sending] ")\n sending("])"
+ perror "Missing sending array elements"
+}
+
+catch {unset sending}
+
+BlueGnu_restore \ No newline at end of file
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/locateFile.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/locateFile.itcl
new file mode 100644
index 0000000..9f629e9
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/locateFile.itcl
@@ -0,0 +1,46 @@
+#
+# Unit test for command: locateFile
+#
+
+note "[locateFile A.itcl]"
+
+
+if {[regexp {verbose.itcl$} [locateFile verbose.itcl]]} {
+ pass "Found verbose.itcl as >[locateFile verbose.itcl]<"
+} else {
+ fail "Couldn't find verbose.itcl"
+}
+if {[regexp {lib/bug.exp$} [locateFile bug.exp lib]]} {
+ pass "Found bug.exp as >[locateFile bug.exp lib]<"
+} else {
+ fail "Couldn't find bug.exp"
+}
+if {[regexp {testsuite/T/test_004.exp$} \
+ [locateFile test_004.exp testsuite/T]]} {
+ pass "Found test_004.exp as >[locateFile test_004.exp testsuite/T]<"
+} else {
+ fail "Couldn't find test_004.exp as\
+ >\[locateFile test_004.exp testsuite/T\]<"
+}
+if {[regexp {testsuite/T/test_004.exp$} \
+ [locateFile test_004.exp testsuite]]} {
+ pass "Found test_004.exp as >[locateFile test_004.exp testsuite]<"
+} else {
+ fail "Couldn't find test_004.exp as\
+ >\[locateFile test_004.exp testsuite\]<"
+}
+if {[regexp {testsuite/T/test_004.exp$} \
+ [locateFile test_004.exp T]]} {
+ pass "Found test_004.exp as >[locateFile test_004.exp T]<"
+} else {
+ fail "Couldn't find test_004.exp as\
+ >\[locateFile test_004.exp T\]<"
+}
+if {[regexp {testsuite/T/test_004.exp$} \
+ [locateFile test_004.exp]]} {
+ pass "Found test_004.exp as >[locateFile test_004.exp]<"
+} else {
+ fail "Couldn't find test_004.exp as\
+ >\[locateFile test_004.exp testsuite\]<"
+}
+
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/namespaceVariables.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/namespaceVariables.itcl
new file mode 100644
index 0000000..c1143dc
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/namespaceVariables.itcl
@@ -0,0 +1,36 @@
+#
+# This test script prints the namespace variables
+# pass the the test script when available varibale matches the expected
+# and visa versa
+#
+
+proc checkVars {} {
+ set lExpectedVars [list \
+ bTestCase \
+ iArgs lArgs \
+ szID szName \
+ szScriptName szTool \
+ szTestCase szTestCaseID szTestCaseArgs \
+ ]
+ set lVars [uplevel info vars]
+ note "Available Variable:"
+ foreach v [lsort $lVars] {
+ if {[lsearch [info globals] $v] < 0} {
+ note "[format %15s $v] = >[uplevel set $v]<"
+ if {[lsearch $lExpectedVars $v] >= 0} {
+ pass "Available variable >$v< in list of expected"
+ } else {
+ fail "Available variable >$v< NOT in list of expected"
+ }
+ }
+ }
+ foreach v $lExpectedVars {
+ if {[lsearch $lVars $v] >= 0} {
+ pass "Expected variable >$v< in list of available"
+ } else {
+ fail "Expected variable >$v< NOT in list of available"
+ }
+ }
+}
+
+checkVars
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/prependQueue.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/prependQueue.itcl
new file mode 100644
index 0000000..66bf2ab
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/prependQueue.itcl
@@ -0,0 +1,6 @@
+#
+# Test script for prependQueue command
+#
+
+prependQueue [list namespaceVariables.itcl namespaceVariables.itcl \
+ namespaceVariables.itcl] arg2 prepend
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/runtest.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/runtest.itcl
new file mode 100644
index 0000000..0768026
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/runtest.itcl
@@ -0,0 +1,19 @@
+#
+# This script is testing the runtest command
+#
+
+#runtest [list A.itcl\[1\]=arg A.itcl\[2\]=arg]
+runtest [list namespaceVariables.itcl namespaceVariables.itcl]
+
+#note "test scripts: >>>>\n[join [parseTest A.itcl A.itcl\[2=x=y\]=arg2 \
+ [list A.itcl\[1\] A.itcl]] "\n"]<<<<"
+#note "test scripts: >>>>\n[join [appendTestCaseID [appendArguments \
+ [parseTest A.itcl A.itcl\[2=x=y\]=arg2 \
+ [list A.itcl\[1\] A.itcl]] XYZ=abc] DEF] "\n"]<<<<"
+
+#note "test scripts: >[appendTestCaseID \
+ [list A.itcl\[DEF\]=xyz=100 A.itcl\[GHI\]=xyz=200] =SSN=00101001]<"
+
+#note "test scripts: >[appendArguments \
+ [list A.itcl A.itcl=SSN=001010001 \
+ A.itcl\[1\] A.itcl\[2\]=SSN=001010001] BODS=ABC]<" \ No newline at end of file
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/testNaming.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/testNaming.itcl
new file mode 100644
index 0000000..af13995
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/testNaming.itcl
@@ -0,0 +1,19 @@
+#
+# This test script test the commands:
+# appendArguments
+# appendTestCaseID
+#
+
+
+note "[appendTestCaseID A ID]"
+note "[appendTestCaseID [list A B C] ID]"
+note "[appendTestCaseID A ID=arg1=100]"
+note "[appendTestCaseID [list A B C] ID=arg2]"
+note "[appendTestCaseID [appendArguments A arg1] ID]"
+note "[appendArguments [appendTestCaseID B ID] arg1]"
+note "[appendTestCaseID [appendArguments [list A B C] arg1] ID]"
+note "[appendArguments [appendTestCaseID [list X Y Z] ID] arg1]"
+note "[appendTestCaseID [appendArguments [list A B C] \
+ "arg1=1 arg2 arg3=100"] ID]"
+note "[appendArguments [appendTestCaseID [list X Y Z] ID] \
+ "arg1=1 arg2 arg3=100"]"
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/ts001/A.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/ts001/A.itcl
new file mode 100644
index 0000000..b3ac5f9
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/ts001/A.itcl
@@ -0,0 +1 @@
+note "ts001/A.itcl"
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/ts002/A.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/ts002/A.itcl
new file mode 100644
index 0000000..9d61374
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/ts002/A.itcl
@@ -0,0 +1 @@
+note "ts002/A.itcl"
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/types.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/types.itcl
new file mode 100644
index 0000000..0911f9c
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/types.itcl
@@ -0,0 +1,55 @@
+# -*-Tcl-*-
+#
+# Checking Type definition
+#
+
+verbose "auto_path: >[set auto_path]<"
+
+verbose [Type A 100]
+verbose [set A]
+verbose $A
+verbose [A value]
+
+namespace eval TN {
+ verbose [Type B 200]
+ verbose [set B]
+ verbose $B
+ verbose [B value]
+ verbose [::itcl::find objects]
+}
+
+verbose [::itcl::find objects]
+
+namespace eval TN {
+ verbose [::itcl::find objects]
+}
+
+proc Y {} {
+ proc YY {} {
+ puts "in YY"
+ }
+ set Tmp 100
+ verbose {[Type C 200]}
+ verbose {[set C]}
+ verbose {$C}
+ verbose {[C value]}
+ verbose {[set C 400]}
+ verbose {[set C]}
+ verbose {Locals: >[info locals]<}
+ verbose {Globals: >[info globals]<}
+ verbose {Vars: >[info vars]<}
+ verbose {Commands: >[lsort [split [info commands]]]<}
+ verbose {[::itcl::find objects]}
+ verbose {A: >[A value]<}
+}
+
+verbose "################################ Doing Y"
+Y
+YY
+rename Y ""
+YY
+
+verbose {[::itcl::find objects]}
+
+verbose [Type Z text]
+delete object Z
diff --git a/contrib/bluegnu2.0.3/testsets/BlueGnu/verbose.itcl b/contrib/bluegnu2.0.3/testsets/BlueGnu/verbose.itcl
new file mode 100644
index 0000000..90d208f
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/BlueGnu/verbose.itcl
@@ -0,0 +1,562 @@
+#
+# test for verbose levels
+#
+#
+
+global verbose
+
+verbose "verbose level: >$verbose<" 0
+
+# Modify output procedures to return instead of doing output
+#
+uplevel #0 {
+ rename send_user send_user_saved
+ rename send_error send_error_saved
+ rename send_log send_log_saved
+ proc send_user args {
+ eval return "\{USER: [join $args]\}"
+ }
+ proc send_error args {
+ eval return "\{ERROR: [join $args]\}"
+ }
+ proc send_log args {
+ eval return "\{LOG: [join $args]\}"
+ }
+}
+
+# Checkin verbose with out any swicthes
+#
+foreach level {0 1} {
+ set szV [verbose "some text" $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+
+ set szV [verbose {[set l some text]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ } else {
+ fail "Didn't detect ERROR in commands >$szV<"
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+
+ set szV [verbose {[set l "some text"]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+}
+
+# checking verbose --
+#
+foreach level {0 1} {
+ set szV [verbose -- "some text" $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+
+ set szV [verbose -- {[set l some text]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ } else {
+ fail "Didn't detect ERROR in commands >$szV<"
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+
+ set szV [verbose -- {[set l "some text"]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+}
+
+# Checking verbose -n (Suppress NL)
+#
+foreach level {0 1} {
+ set szV [verbose -n "some text" $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+
+ set szV [verbose -n {[set l some text]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ } else {
+ fail "Didn't detect ERROR in commands >$szV<"
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+
+ set szV [verbose -n {[set l "some text"]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+}
+
+# checking verbose -log
+#
+foreach level {0 1} {
+ set szV [verbose -log "some text" $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if {$level > $verbose} {
+ if [regexp "^LOG:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+ }
+
+ set szV [verbose -log {[set l some text]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if {$level > $verbose} {
+ if [regexp "^LOG:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ } else {
+ fail "Didn't detect ERROR in commands >$szV<"
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ } else {
+ fail "Didn't detect ERROR in commands >$szV<"
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+ }
+
+ set szV [verbose -log {[set l "some text"]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if {$level > $verbose} {
+ if [regexp "^LOG:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ pass "$szV"
+ } else {
+ fail "Expected NL at end of >$szV<"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+ }
+}
+
+# checking verbose -n -log
+#
+foreach level {0 1} {
+ set szV [verbose -n -log "some text" $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if {$level > $verbose} {
+ if [regexp "^LOG:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+ }
+
+ set szV [verbose -log -n {[set l some text]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if {$level > $verbose} {
+ if [regexp "^LOG:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ } else {
+ fail "Didn't detect ERROR in commands >$szV<"
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ } else {
+ fail "Didn't detect ERROR in commands >$szV<"
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+ }
+
+ set szV [verbose -n -log -- {[set l "some text"]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, output expected"
+ } else {
+ if {[string length $szV] == 0} {
+ pass "No output expected"
+ } else {
+ if {$level > $verbose} {
+ if [regexp "^LOG:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ } else {
+ if [regexp "^USER:" $szV] {
+ if [regexp "ERROR:" $szV] {
+ fail "Did detect ERROR in commands >$szV<"
+ } else {
+ if {[string compare \
+ [string range $szV end end] "\n"] == 0} {
+ fail "Didn't expected NL at end of >$szV<"
+ } else {
+ pass "$szV"
+ }
+ }
+ } else {
+ fail "Didn't used send_user"
+ }
+ }
+ }
+ }
+}
+
+if {$verbose >= 1} {
+ set szV [verbose -n -BB -log -- {[set l "some text"]} $level]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, ERROR output expected"
+ } else {
+ if [regexp "^ERROR:.*illegal argument:" $szV] {
+ setup_xfail
+ }
+ fail "$szV"
+ }
+
+ set szV [verbose]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, ERROR output expected"
+ } else {
+ if [regexp "^ERROR:.*nothing to print$" $szV] {
+ setup_xfail
+ }
+ fail "$szV"
+ }
+
+ set szV [verbose -n --]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, ERROR output expected"
+ } else {
+ if [regexp "^ERROR:.*nothing to print$" $szV] {
+ setup_xfail
+ }
+ fail "$szV"
+ }
+
+ set szV [verbose -n -- ABC def 100]
+ if {[string length $szV] == 0 && $level <= $verbose} {
+ fail "verbose level $level, ERROR output expected >$szV<"
+ } else {
+ if [regexp "^ERROR:.*Too many arguments$" $szV] {
+ setup_xfail
+ }
+ fail "$szV"
+ }
+} else {
+ warning "NO verbose error returns tester, verbose level < 1"
+}
+
+# Restore original procedures
+#
+uplevel #0 {
+ rename send_user ""
+ rename send_error ""
+ rename send_log ""
+ rename send_user_saved send_user
+ rename send_error_saved send_error
+ rename send_log_saved send_log
+}
diff --git a/contrib/bluegnu2.0.3/testsets/examples/lib/benchmark.itcl b/contrib/bluegnu2.0.3/testsets/examples/lib/benchmark.itcl
new file mode 100644
index 0000000..b8f589c
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/examples/lib/benchmark.itcl
@@ -0,0 +1,64 @@
+#
+#
+
+namespace eval ::tc002 {
+ if {[::itcl::find classes Benchmark] != "Benchmark"} {
+ class Benchmark {
+ inherit ::BlueGnu::Benchmark
+
+ public constructor {args} {
+ }
+
+ public method benchmark {benchmarkFunction args} {
+ verbose {******* ${this}::benchmark\
+ $benchmarkFunction $args}
+ verbose "Length Args is >[llength $args]<" 2
+ set bResult 0
+ switch -exact $benchmarkFunction {
+ English {
+ set bResult 1
+ }
+ Dutch {
+ set bResult 1
+ }
+ }
+ if $bResult {
+ pass "[info class]::benchmark\
+ $benchmarkFunction $args"
+ } else {
+ fail "[info class]::benchmark\
+ $benchmarkFunction $args"
+ }
+ return $bResult
+ }
+ }
+
+ class English {
+ inherit ::tc002::Benchmark
+
+ public constructor {args} {
+ eval ::BlueGnu::Benchmark::constructor $args
+ ::tc002::Benchmark::constructor
+ } {
+ verbose "******* Initialize Priority Benchmark Values"
+ foreach i [lsort [array names ARG]] {
+ verbose { ARG($i): >$ARG($i)<} 2
+ }
+ }
+ }
+
+ class Dutch {
+ inherit ::tc002::Benchmark
+
+ public constructor {args} {
+ eval ::BlueGnu::Benchmark::constructor $args
+ ::tc002::Benchmark::constructor
+ } {
+ verbose "******* Initialize Priority Benchmark Values"
+ foreach i [lsort [array names ARG]] {
+ verbose { ARG($i): >$ARG($i)<} 2
+ }
+ }
+ }
+ }
+} \ No newline at end of file
diff --git a/contrib/bluegnu2.0.3/testsets/examples/tc001 b/contrib/bluegnu2.0.3/testsets/examples/tc001
new file mode 100644
index 0000000..bc76f0d
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/examples/tc001
@@ -0,0 +1,3 @@
+set MSG "Hello World"
+processTestScriptArgs
+note $MSG
diff --git a/contrib/bluegnu2.0.3/testsets/examples/tc002 b/contrib/bluegnu2.0.3/testsets/examples/tc002
new file mode 100644
index 0000000..1ec0192
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/examples/tc002
@@ -0,0 +1,3 @@
+set MSG "Hello World"
+processTestScriptArgs
+benchmark $szTestCaseID $MSG
diff --git a/contrib/bluegnu2.0.3/testsets/examples/ts_001 b/contrib/bluegnu2.0.3/testsets/examples/ts_001
new file mode 100644
index 0000000..354941c
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/examples/ts_001
@@ -0,0 +1,2 @@
+appendQueue examples/tc002\[English=B\]
+appendQueue examples/tc002\[Dutch=B\]={MSG=Hallo Wereld}
diff --git a/contrib/bluegnu2.0.3/testsets/examples/ts_002 b/contrib/bluegnu2.0.3/testsets/examples/ts_002
new file mode 100644
index 0000000..ff5ccc0
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/examples/ts_002
@@ -0,0 +1,4 @@
+appendQueue [appendTestCaseID \
+ [locateFile tc002 examples] English=A]
+appendQueue [appendArguments [appendTestCaseID \
+ [locateFile tc002 examples] Dutch=A] "{MSG=Hallo Wereld}"]
diff --git a/contrib/bluegnu2.0.3/testsets/examples/ts_003 b/contrib/bluegnu2.0.3/testsets/examples/ts_003
new file mode 100644
index 0000000..146b551
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/examples/ts_003
@@ -0,0 +1,2 @@
+appendQueue tc002 {} English=B
+appendQueue tc002 {MSG=Hallo Wereld} Dutch=B
diff --git a/contrib/bluegnu2.0.3/testsets/examples/versionTcl.itcl b/contrib/bluegnu2.0.3/testsets/examples/versionTcl.itcl
new file mode 100644
index 0000000..94c9b82
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/examples/versionTcl.itcl
@@ -0,0 +1,8 @@
+if [doCmd {set tcl_version} errorCode=NONE \
+ return=[list [list 1 8.0]] V] {
+ # code when failure:
+ # variable tcl_version does not exists or
+ # does not return 8.0
+} else {
+ # variable V will contain 8.0
+}
diff --git a/contrib/bluegnu2.0.3/testsets/tclIndex b/contrib/bluegnu2.0.3/testsets/tclIndex
new file mode 100644
index 0000000..70fa126
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsets/tclIndex
@@ -0,0 +1,5 @@
+# Tcl autoload index file: each line identifies a Tcl
+
+::tc002::Benchmark examples/lib/benchmark.itcl
+::tc002::English examples/lib/benchmark.itcl
+::tc002::Dutch examples/lib/benchmark.itcl
diff --git a/contrib/bluegnu2.0.3/testsuite/Makefile.in b/contrib/bluegnu2.0.3/testsuite/Makefile.in
new file mode 100644
index 0000000..405ca3d
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/Makefile.in
@@ -0,0 +1,100 @@
+# Copyright (C) 1988, 1990, 1991, 1992, 1994, 1995 Free Software Foundation, Inc.
+# Copyright (C) 1998 jotOmega dsc, Inc.
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 1, or (at your option)
+# any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+#
+
+# directory specifics
+VPATH = @srcdir@
+srcdir = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+host = @host@
+
+.PHONY: info install-info check installcheck dvi install
+info:
+install:
+dvi:
+install-info:
+check:
+installcheck:
+.NOEXPORT:
+TCLHDIR = @TCLHDIR@
+
+BLUEGNUFLAGS =
+EXPECT = ` \
+ if [ -f $${rootme}/../../expect/expect ] ; then \
+ echo $${rootme}/../../expect/expect ; \
+ else echo expect ; fi`
+
+BLUEGNU = ` \
+ if [ -f ${srcdir}/../bluegnu ] ; then \
+ echo ${srcdir}/../bluegnu ; \
+ else echo bluegnu ; fi`
+
+
+all:
+
+check: site.exp all
+ rootme=`pwd`; export rootme; \
+ srcdir=${srcdir} ; export srcdir ; \
+ EXPECT=${EXPECT} ; export EXPECT ; \
+ if [ -f $${rootme}/../../expect/expect ] ; then \
+ TCL_LIBRARY=`echo @TCLHDIR@ | sed -e 's/-I//' -e 's/generic/library/'` ; \
+ export TCL_LIBRARY ; fi ; \
+ ${BLUEGNU} ${BLUEGNUFLAGS} BLUEGNU=${BLUEGNU} --tool bluegnu --srcdir ${srcdir}
+
+site.exp: ./config.status Makefile
+ @echo "Making a new config file..."
+ -@rm -f ./tmp?
+ @touch site.exp
+ -@mv site.exp site.bak
+ @echo "## these variables are automatically generated by make ##" > ./tmp0
+ @echo "# Do not edit here. If you wish to override these values" >> ./tmp0
+ @echo "# add them to the last section" >> ./tmp0
+ @echo "set tool bluegnu" >> ./tmp0
+ @echo "set srcdir ${srcdir}" >> ./tmp0
+ @echo "set objdir `pwd`" >> ./tmp0
+ @echo "set host_triplet ${host}" >> ./tmp0
+ @echo "set tmpdir `pwd`/tmpdir" >> ./tmp0
+ @echo "## All variables above are generated by configure. Do Not Edit ##" >> ./tmp0
+ @cat ./tmp0 > site.exp
+ @cat site.bak | sed \
+ -e '1,/^## All variables above are.*##/ d' >> site.exp
+ -@rm -f ./tmp?
+
+clean mostlyclean:
+ -rm -f \#* *~ core *.o a.out xgdb *.x
+ -rm -f [Ee]rrs tags mklog ${OBJS} ${PROG} x.* xXx.*
+
+distclean maintainer-clean realclean: clean
+ -rm -f Makefile
+ -rm -f config.status config.log config.cache
+ -rm -f calc.h calc.log calc.plog calc.psum confdefs.h
+ -rm -f calc.sum site.exp
+ -rm -rf tmpdir
+
+Makefile: $(srcdir)/Makefile.in $(host_makefile_frag) config.status
+ @echo "Rebuilding the Makefile..."
+ $(SHELL) ./config.status
+
+configure: $(srcdir)/configure.in $(srcdir)/Makefile.in $(srcdir)/../aclocal.m4
+ @echo "Rebuilding configure..."
+ @cd ${srcdir} ;\
+ autoconf --localdir=${srcdir}/..
+
+config.status:
+ @echo "Rebuilding config.status..."
+ $(SHELL) ./config.status --recheck
diff --git a/contrib/bluegnu2.0.3/testsuite/T/env.exp b/contrib/bluegnu2.0.3/testsuite/T/env.exp
new file mode 100644
index 0000000..ce48f79
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/env.exp
@@ -0,0 +1,12 @@
+
+uplevel #0 {
+ foreach var [lsort [info globals]] {
+ if {[array exists $var]} {
+ foreach index [lsort [array names $var]] {
+ puts "${var}($index)=[set ${var}($index)]"
+ }
+ } else {
+ puts "$var=[set $var]"
+ }
+ }
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/T/env.iexp b/contrib/bluegnu2.0.3/testsuite/T/env.iexp
new file mode 100644
index 0000000..ca29e5f
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/env.iexp
@@ -0,0 +1,48 @@
+
+puts "======= Environment (Start) ======="
+
+foreach item [lsort [array names env]] {
+ if [catch {puts " env($item)=$env($item)"} szErrMsg] {
+ puts "******* >> msg : $szErrMsg"
+ puts "******* >> errorInfo: [uplevel #0 set errorInfo]"
+ puts "******* >> errorCode: [uplevel #0 set errorCode]"
+ }
+}
+
+foreach info [list {info locals} \
+ {info globals} {uplevel #0 info globals} \
+ {info vars}] {
+ puts "=== Command: $info"
+ foreach item [lsort [eval $info]] {
+ if [catch {puts " $item=>[eval set $item]<"} szErrMsg] {
+ if [regexp "variable is array" $szErrMsg] {
+ foreach elem [lsort [array names $item]] {
+ puts " ${item}($elem)=>[set ${item}($elem)]<"
+ }
+ } else {
+ puts "******* >> msg : $szErrMsg"
+ puts "******* >> errorInfo: [uplevel #0 set errorInfo]"
+ puts "******* >> errorCode: [uplevel #0 set errorCode]"
+ }
+ }
+ }
+}
+
+foreach info [list {namespace all} \
+ {namespace children} {namespace parent} \
+ classes commands context level library locals \
+ objects patchlevel procs script tclversion] {
+ puts "=== info $info"
+ foreach item [lsort [eval info $info]] {
+ puts " $item"
+ }
+}
+
+puts "argv: [set argv]"
+puts "szTestName: [set szTestName]"
+catch {puts "lTestName : $lTestName"}
+$szTestName pass
+puts [$szTestName <<]
+
+#runtest ::E0 env.iexp
+puts "======= Environment (End) ======="
diff --git a/contrib/bluegnu2.0.3/testsuite/T/foo.exp b/contrib/bluegnu2.0.3/testsuite/T/foo.exp
new file mode 100644
index 0000000..c5f9770
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/foo.exp
@@ -0,0 +1,5 @@
+appendQueue env.iexp
+appendQueue ../tools/env.exp
+appendQueue env.iexp
+appendQueue ../tools/env.exp
+appendQueue ../tools/foo.exp
diff --git a/contrib/bluegnu2.0.3/testsuite/T/subT/test_002.exp b/contrib/bluegnu2.0.3/testsuite/T/subT/test_002.exp
new file mode 100644
index 0000000..a887fc9
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/subT/test_002.exp
@@ -0,0 +1,20 @@
+
+puts "Test test_002.exp: level [info level]"
+puts "szTestName: [set szTestName]"
+puts "lTestName : $lTestName"
+
+namespace ::Common {
+ if [info exists i] {
+ if {[expr $i % 2]} {
+ puts " Remainder is 1 >$i<"
+ incr i
+ return
+ } else {
+ puts " Zero remainder >$i<"
+ incr i
+ }
+ puts " === End: $env(SHELL)"
+ } else {
+ puts "#### i doesn't exists"
+ }
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/T/test_000.exp b/contrib/bluegnu2.0.3/testsuite/T/test_000.exp
new file mode 100644
index 0000000..9548c1c
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/test_000.exp
@@ -0,0 +1,8 @@
+
+namespace Common {
+ private variable iCount 0
+}
+
+verbose "prepeding test_001.exp"
+prependQueue test_001.exp
+pass "test_000.exp"
diff --git a/contrib/bluegnu2.0.3/testsuite/T/test_001.exp b/contrib/bluegnu2.0.3/testsuite/T/test_001.exp
new file mode 100644
index 0000000..0ecd02b
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/test_001.exp
@@ -0,0 +1,19 @@
+
+verbose "Test test_001.exp: level [info level]"
+verbose "Global tools: [uplevel #0 set szCurrentTestDirectory]"
+
+appendQueue test_003.exp=1
+prependQueue test_003.exp=2 test_003.exp=3
+verbose "Context: [info context]"
+runtest test_003.exp=R0
+appendQueue test_003.exp=A0
+prependQueue test_003.exp=A2 test_003.exp=A3
+
+namespace Common {
+ incr iCount
+ verbose "Counter is $iCount"
+ if {$iCount < 5} {
+ prependQueue test_001.exp
+ }
+ pass "test_001.exp: iCount - $iCount"
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/T/test_002.exp b/contrib/bluegnu2.0.3/testsuite/T/test_002.exp
new file mode 100644
index 0000000..e1a185a
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/test_002.exp
@@ -0,0 +1,22 @@
+
+verbose "Test test_002.exp: level [info level]"
+verbose "szTestName: [set szTestName]"
+verbose "lTestName : $lTestName"
+pass
+namespace ::Common {
+ if [info exists i] {
+ if {[expr $i % 2]} {
+ verbose " Remainder is 1 >$i<"
+ incr i
+ pass "karel"
+ return
+ } else {
+ verbose " Zero remainder >$i<"
+ fail "pieter"
+ incr i
+ }
+ verbose " === End: $env(SHELL)"
+ } else {
+ verbose "#### i doesn't exists"
+ }
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/T/test_003.exp b/contrib/bluegnu2.0.3/testsuite/T/test_003.exp
new file mode 100644
index 0000000..32c0481
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/test_003.exp
@@ -0,0 +1,3 @@
+
+verbose "t003.exp == $lArgs"
+pass "t003.exp == $lArgs" \ No newline at end of file
diff --git a/contrib/bluegnu2.0.3/testsuite/T/test_004.exp b/contrib/bluegnu2.0.3/testsuite/T/test_004.exp
new file mode 100644
index 0000000..6cda091
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/T/test_004.exp
@@ -0,0 +1,3 @@
+
+puts " in test 4"
+pass "test 4" \ No newline at end of file
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/clone_output.test b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/clone_output.test
new file mode 100644
index 0000000..2b5178f
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/clone_output.test
@@ -0,0 +1,68 @@
+# test clone_output
+
+set srcdir [lindex $argv 0]
+set subdir [lindex $argv 1]
+set objdir [lindex $argv 2]
+
+if [ file exists $objdir/setval.tmp ] {
+ source $objdir/setval.tmp
+} else {
+ puts "ERROR: $objdir/setval.tmp doesn't exist"
+}
+if [ file exists $srcdir$subdir/default_procs.tcl ] {
+ source "$srcdir$subdir/default_procs.tcl"
+} else {
+ puts "ERROR: $srcdir$subdir/default_procs.tcl doesn't exist"
+}
+if [ file exists $srcdir/../lib/framework.exp] {
+ source $srcdir/../lib/framework.exp
+} else {
+ puts "ERROR: $srcdir/../lib/framework.exp doesn't exist"
+}
+
+set all_flag 0
+global all_flag
+set errno ""
+
+# stuff that shouldn't print anything without all_flag set
+set all_flag 0
+set tests {
+ { "lib_pat_test" "clone_output" "PASS: Foo" "" "clone_output(pass) without all_flag set" }
+ { "lib_pat_test" "clone_output" "UNRESOLVED: Foo" "" "clone_output(unresolved) without all_flag set" }
+ { "lib_pat_test" "clone_output" "UNSUPPORTED: Foo" "" "clone_output(unsupported) without all_flag set" }
+ { "lib_pat_test" "clone_output" "UNTESTED: Foo" "" "clone_output(untested) without all_flag set" }
+ { "lib_pat_test" "clone_output" "ERROR: Bar" "ERROR: Bar" "clone_output(error) without all_flag set" }
+ { "lib_pat_test" "clone_output" "WARNING: Bar" "WARNING: Bar" "clone_output(warning) without all_flag set" }
+ { "lib_pat_test" "clone_output" "NOTE: Bar" "NOTE: Bar" "clone_output(note) without all_flag set" }
+}
+
+run_tests $tests
+
+# tests for all_flag set to 1
+set all_flag 1
+set tests {
+ { "lib_pat_test" "clone_output" "PASS: Foo" "PASS: Foo" "clone_output(pass) with all_flag set" }
+ { "lib_pat_test" "clone_output" "XFAIL: Foo" "XFAIL: Foo" "clone_output(xfail) with all_flag set" }
+ { "lib_pat_test" "clone_output" "UNRESOLVED: Foo" "UNRESOLVED: Foo" "clone_output(unresolved) with all_flag set" }
+ { "lib_pat_test" "clone_output" "UNSUPPORTED: Foo" "UNSUPPORTED: Foo" "clone_output(unsupported) with all_flag set" }
+ { "lib_pat_test" "clone_output" "UNTESTED: Foo" "UNTESTED: Foo" "clone_output(untested) with all_flag set" }
+ { "lib_pat_test" "clone_output" "ERROR: Foo" "ERROR: Foo" "clone_output(error) with all_flag set" }
+ { "lib_pat_test" "clone_output" "WARNING: Foo" "WARNING: Foo" "clone_output(warning) with all_flag set" }
+ { "lib_pat_test" "clone_output" "NOTE: Foo" "NOTE: Foo" "clone_output(note) with all_flag set" }
+}
+
+run_tests $tests
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/config.test b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/config.test
new file mode 100644
index 0000000..3d70572
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/config.test
@@ -0,0 +1,138 @@
+# test clone_output
+
+set srcdir [lindex $argv 0]
+set subdir [lindex $argv 1]
+set objdir [lindex $argv 2]
+
+if [ file exists $objdir/setval.tmp ] {
+ source $objdir/setval.tmp
+} else {
+ puts "ERROR: $objdir/setval.tmp doesn't exist"
+}
+if [ file exists $srcdir$subdir/default_procs.tcl ] {
+ source "$srcdir$subdir/default_procs.tcl"
+} else {
+ puts "ERROR: $srcdir$subdir/default_procs.tcl doesn't exist"
+}
+if [ file exists $srcdir/../lib/framework.exp] {
+ source $srcdir/../lib/framework.exp
+} else {
+ puts "ERROR: $srcdir/../lib/framework.exp doesn't exist"
+}
+
+set all_flag 1
+
+set host_triplet i586-unknown-linux
+set target_triplet i586-unknown-linux
+set target_cpu i586
+set target_os linux
+set build_triplet i586-unknown-linux
+
+# FIXME: should use run_tests here, but due to Tcl's weird scoping rules, I get
+# problems.
+
+#
+# Tests for a native configuration
+#
+if [isbuild $build_triplet] {
+ puts "PASSED: isbuild, native"
+} else {
+ puts "FAILED: isbuild, native"
+}
+
+if [isbuild $target_cpu-*-$target_os ] {
+ puts "PASSED: isbuild, native regexp"
+} else {
+ puts "FAILED: isbuild, native regexp"
+}
+
+if [isbuild hppa-ibm-macos ] {
+ puts "FAILED: isbuild, native bogus config string"
+} else {
+ puts "PASSED: isbuild, native bogus config string"
+}
+
+# ishost tests
+if [ishost $host_triplet] {
+ puts "PASSED: ishost, native"
+} else {
+ puts "FAILED: ishost, native"
+}
+
+if [ishost $target_cpu-*-$target_os] {
+ puts "PASSED: ishost, native regexp"
+} else {
+ puts "FAILED: ishost, native regexp"
+}
+
+if [ishost hppa-ibm-macos] {
+ puts "FAILED: ishost, native bogus config string"
+} else {
+ puts "PASSED: ishost, native bogus config string"
+}
+
+# istarget tests
+if [istarget $target_triplet] {
+ puts "PASSED: istarget, native"
+} else {
+ puts "FAILED: istarget, native"
+}
+
+if [istarget $target_cpu-*-$target_os] {
+ puts "PASSED: istarget, native regexp"
+} else {
+ puts "FAILED: istarget, native regexp"
+}
+
+if [istarget hppa-ibm-macos] {
+ puts "FAILED: istarget, native bogus config string"
+} else {
+ puts "PASSED: istarget, native bogus config string"
+}
+
+# native tests
+if [isnative] {
+ puts "PASSED: isnative, native"
+} else {
+ puts "FAILED: isnative, native"
+}
+
+if [is3way] {
+ puts "FAILED: is3way, native"
+} else {
+ puts "PASSED: is3way, native"
+}
+
+#
+# Tests for a normal cross configuration
+#
+set target_triplet m68k-unknown-elf
+if [isnative] {
+ puts "FAILED: isnative, cross"
+} else {
+ puts "PASSED: isnative, cross"
+}
+
+if [is3way] {
+ puts "FAILED: is3way, cross"
+} else {
+ puts "PASSED: is3way, cross"
+}
+
+#
+# Tests for a canadian cross configuration
+#
+set host_triplet i386-unknown-winnt
+if [isnative] {
+ puts "FAILED: isnative, canadian cross"
+} else {
+ puts "PASSED: isnative, canadian cross"
+}
+
+if [is3way] {
+ puts "PASSED: is3way, canadian cross"
+} else {
+ puts "FAILED: is3way, canadian cross"
+}
+
+
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/default_procs.tcl b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/default_procs.tcl
new file mode 100644
index 0000000..a0e6f88
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/default_procs.tcl
@@ -0,0 +1,94 @@
+set sum_file [open .tmp w]
+set reboot 0
+set errno ""
+
+# this tests a proc for a returned pattern
+proc lib_pat_test { cmd arg pattern } {
+ catch "$cmd \"$arg\"" result
+ puts "CMD(lib_pat_test) was: $cmd \"$arg\""
+ puts "RESULT(lib_pat_test) was: \"${result}\" for pattern \"$pattern\"."
+ if [ regexp -- "with too many" $result ] {
+ return -1
+ }
+ if [ string match "$pattern" $result ] {
+ return 1
+ } else {
+ return 0
+ }
+}
+
+# this tests a proc for a returned value
+proc lib_ret_test { cmd arg val } {
+ catch "$cmd \"$arg\"" result
+# catch "set result [$cmd $arg]" output
+# set result "$cmd [eval $arg]
+ puts "CMD(lib_ret_test) was: $cmd $arg"
+ puts "RESULT(lib_ret_test) was: $result"
+# puts "OUTPUT(lib_ret_test) was: $output"
+
+ if { $result == $val } {
+ return 1
+ } else {
+ return 0
+ }
+}
+
+#
+# This runs a standard test for a proc. The list is set up as:
+# |test proc|proc being tested|args|pattern|message|
+# test proc is something like lib_pat_test or lib_ret_test.
+#
+proc run_tests { tests } {
+ foreach i "$tests" {
+ set result [ [lindex $i 0] "[lindex $i 1]" "[lindex $i 2]" "[lindex $i 3]" ]
+ switch -- $result {
+ "-1" {
+ puts "ERRORED: [lindex $i 4]"
+ }
+ "1" {
+ puts "PASSED: [lindex $i 4]"
+ }
+ "0" {
+ puts "FAILED: [lindex $i 4]"
+ }
+ default {
+ puts "BAD VALUE: [lindex $i 4]"
+ }
+ }
+ }
+}
+
+proc send_log { msg } {
+ # this is just a stub for testing
+}
+
+proc pass { msg } {
+ puts "PASSED: $msg"
+}
+
+proc fail { msg } {
+ puts "FAILED: $msg"
+}
+
+proc perror { msg } {
+ global errno
+ puts "ERRORED: $msg"
+ set errno "$msg"
+}
+
+proc warning { msg } {
+ global errno
+ puts "WARNED: $msg"
+ set errno "$msg"
+}
+
+proc untested { msg } {
+ puts "NOTTESTED: $msg"
+}
+
+proc unsupported { msg } {
+ puts "NOTSUPPORTED: $msg"
+}
+proc verbose { args } {
+ puts "[lindex $args 0]"
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/libs.exp b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/libs.exp
new file mode 100644
index 0000000..77f96b5
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/libs.exp
@@ -0,0 +1,73 @@
+load_lib libsup.exp
+
+proc process_test { test } {
+ global srcdir
+ global subdir
+ global objdir
+ global EXPECT
+
+ verbose "Executing test case $test"
+ set text "\[- A-Za-z0-9\,\.\;\"\_\:\'\`\(\)\!\#\=\+\?\&\*]*"
+
+ set timeout 150
+
+ if [file exists $test] {
+ verbose "Processing test $test" 2
+ spawn -open [open "|$EXPECT $test $srcdir $subdir [pwd]" r]
+ expect {
+ "No such file or directory" {
+ perror "$test wouldn't run" 0
+ }
+ -re "\[\r\n\]*NOTSUPPORTED: $text\[\r\n\]*" {
+ unsupported "[lrange $expect_out(0,string) 1 end]"
+ exp_continue
+ }
+ -re "\[\r\n\]*NOTTESTED: $text\[\r\n\]*" {
+ untested "[lrange $expect_out(0,string) 1 end]"
+ exp_continue
+ }
+ -re "\[\r\n\]*PASSED: $text\[\r\n\]*" {
+ pass "[lrange $expect_out(0,string) 1 end]"
+ exp_continue
+ }
+ -re "\[\r\n\]*FAILED: $text\[\r\n\]*" {
+ fail "[lrange $expect_out(0,string) 1 end]"
+ exp_continue
+ }
+ -re "\[\r\n\]*WARNED: $text\[\r\n\]*" {
+ verbose "$expect_out(0,string)" 2
+ exp_continue
+ }
+ -re "\[\r\n\]*ERRORED: $text\[\r\n\]*" {
+ verbose "$expect_out(0,string)" 2
+ exp_continue
+ }
+ timeout {
+ perror "$test timed out" 0
+ exp_continue
+ }
+ eof {
+ verbose "All Done" 3
+ }
+ }
+ } else {
+ perror "$test doesn't exist" 0
+ }
+}
+
+if ![info exists EXPECT] {
+ set EXPECT [findfile $base_dir/../../expect/expect "$base_dir/../../expect/expect" expect]
+ verbose "EXPECT defaulting to $EXPECT" 2
+}
+
+make_defaults_file [pwd]/setval.tmp
+
+foreach i [glob $srcdir/$subdir/*.test] {
+ process_test $i
+}
+
+
+
+
+
+
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/options.exp b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/options.exp
new file mode 100644
index 0000000..87777fa
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/options.exp
@@ -0,0 +1,91 @@
+# Copyright (C) 1988, 90-92, 1994, 1995 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+load_lib util-defs.exp
+
+# move the site.exp file so we have no default to confuse us.
+#if [file exists $objdir/site.exp] {
+# catch "exec mv -f $objdir/site.exp $objdir/site.ignore"
+#}
+set fd [open site.exp w]
+puts ${fd} "set host_triplet $host_triplet"
+puts ${fd} "set srcdir $srcdir/.."
+puts ${fd} "set objdir $objdir/.."
+puts ${fd} "set tmpdir $objdir/../tmpdir"
+close $fd
+
+#
+# Set up the list.
+# 1st field is the command line option.
+# 2nd field is the pattern to match.
+# NOTE - No variable substitutions can be used.
+# 3rd field is an optional message to print with PASS/FAIL.
+#
+
+
+set tests {
+ { "" "WARNING: No tool specified" "No arguments" }
+ { "-v --tool xXx" "Found.*site\..*Loading.*utils\.exp" "Loading library files" }
+ { "-v --tool xXx" "Expect binary is.*Using.*main test driver" "Loading basic packages" }
+ { "--F --tool x" "Illegal Argument \"--F\"" "Bad argument" }
+ { "--tool x" "Couldn't find tool init file" "Bad tool name" }
+ { "--help" "USAGE:*" "Display help" }
+ { "-v -v -v" "Verbose level is 3" "Verbose set correctly" }
+ { "-V" "Expect version is.*Tcl version is.*Framework version is*" "--version" }
+ { "-v --target m68k-vxworks" "Target is m68k-vxworks" "--target option" }
+ { "-v --host sparc-sun-sunos4.1.9" "Native configuration is sparc-sun-sunos4.1.9" "--host option" }
+ { "-v -a" "Print all test output to screen" "--all option" }
+ { "-v --objdir xXx" "Using test binaries in xXx" "--objdir option" }
+ { "-v --baud 666" "The baud rate is now 666" "--baud option" }
+ { "-v --tool xXx" "Testing xXx" "--tool option" }
+ { "-v --debug" "Expect Debugging is ON" "--debug option" }
+ { "-v --D0" "Tcl debugger is ON" "--D0 option" }
+ { "-v --strace 1" "Source Trace level is now 1.* 1 if" "--strace option" }
+}
+
+# Old tests not used anymore
+# { "-v --build sparc-sun-sunos4.1.9" "Native configuration is sparc-sun-sunos4.1.9" "--build option" }
+# { "-v --srcdir xXx" "Using test sources in xXx" "--srcdir option" }
+
+foreach i $tests {
+ if [util_test "$RUNTEST" "[lindex $i 0]" "" "[lindex $i 1]"] {
+ fail "[lindex $i 2]"
+ } else {
+ pass "[lindex $i 2]"
+ }
+}
+
+
+set fd [open site.exp w]
+puts ${fd} "set host_triplet $host_triplet"
+puts ${fd} "set tool runtest"
+puts ${fd} "set srcdir $srcdir"
+puts ${fd} "set objdir $objdir"
+puts ${fd} "set tmpdir $objdir/tmpdir"
+close $fd
+
+# clean up log files left by the child runtest
+if [file exists $objdir/x.sum] {
+ exec rm -f $objdir/x.*
+}
+if [file exists $objdir/xXx.sum] {
+ exec rm -f $objdir/xXx.*
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/remote.test b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/remote.test
new file mode 100644
index 0000000..9df5e56
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/remote.test
@@ -0,0 +1,217 @@
+set srcdir [lindex $argv 0]
+set subdir [lindex $argv 1]
+set objdir [lindex $argv 2]
+
+if [ file exists $objdir/setval.tmp ] {
+ source $objdir/setval.tmp
+} else {
+ puts "ERROR: $objdir/setval.tmp doesn't exist"
+}
+if [ file exists $srcdir$subdir/default_procs.tcl ] {
+ source "$srcdir$subdir/default_procs.tcl"
+} else {
+ puts "ERROR: $srcdir$subdir/default_procs.tcl doesn't exist"
+}
+
+set file $srcdir/../lib/remote.exp
+if [ file exists $file] {
+ source $file
+} else {
+ puts "ERROR: $file doesn't exist"
+}
+
+global errno ""
+
+#
+# Create a false target config array
+#
+set target_info(idp,name) "idp"
+set target_info(idp,ldflags) "-Tidp.ld"
+set target_info(idp,config) m68k-unknown-aout
+set target_info(idp,cflags) ""
+set target_info(idp,connect) telnet
+set target_info(idp,target) "s12"
+set target_info(idp,serial) "tstty12"
+set target_info(idp,netport) "localhost:23"
+set target_info(idp,baud) "9600"
+# MVME target
+set target_info(mvme,name) "mvme"
+set target_info(mvme,ldflags) "-Tmvme.ld"
+set target_info(mvme,config) m68k-unknown-aout
+set target_info(mvme,cflags) ""
+set target_info(mvme,connect) telnet
+set target_info(mvme,target) "s12"
+set target_info(mvme,serial) "tstty8"
+set target_info(mvme,netport) "localhost:23"
+set target_info(mvme,baud) "9600"
+
+# Test remote open. We try not to use any of the support procs in
+# target.exp to for isolation testing. "target" is the name of the
+# default array setup by the procs in target.exp.
+
+set timeout 100
+set errno ""
+
+#
+# Force connection errors
+#
+
+# force an rlogin error
+if { [rlogin foobar.barfoo.com] < 0 } {
+ puts "PASSED: rlogin bogus host"
+} else {
+ puts "FAILED: rlogin bogus"
+}
+
+# force an rsh error
+if { [rsh foobar.barfoo.com] < 0 } {
+ puts "PASSED: rsh bogus host"
+} else {
+ puts "FAILED: rsh bogus"
+}
+
+# force a telnet error
+if { [telnet foobar.barfoo.com] < 0 } {
+ puts "PASSED: telnet bogus host"
+} else {
+ puts "FAILED: telnet bogus"
+}
+
+#
+# Connect to localhost
+#
+
+# localhost rlogin test
+if { [rlogin localhost] < 0 } {
+ if [string match "*unencrypted connection" $errno] {
+ NOTTESTED "rlogin localhost"
+ } else {
+ puts "FAILED: rlogin localhost"
+ }
+} else {
+ puts "PASSED: rlogin localhost"
+}
+catch "exp_send exit\n"
+catch "close -i $spawn_id"
+catch "wait -i $spawn_id"
+
+# localhost rsh test
+if { [rsh localhost] < 0 } {
+ if [string match "*kinit" $errno] {
+ puts "NOTTESTED: rsh localhost"
+ } else {
+ puts "FAILED: rsh localhost"
+ }
+} else {
+ puts "PASSED: rsh localhost"
+}
+catch "exp_send exit\n"
+catch "close -i $spawn_id"
+catch "wait -i $spawn_id"
+
+# localhost telnet test. In this case it will return
+# an error cause we get prompted for a password or login. For
+# now this is considered an error, as we usually only
+# telnet to a terminal server.
+if { [telnet localhost] < 0 } {
+ if [string match "*password." $errno] {
+ puts "NOTTESTED: telnet localhost"
+ } else {
+ puts "FAILED: telnet localhost"
+ }
+} else {
+ puts "PASSED: telnet localhost"
+}
+catch "exp_send exit\n"
+catch "close -i $spawn_id"
+catch "wait -i $spawn_id"
+
+#
+# Connect to the configured target
+#
+set target_info(target,netport) $target_info(idp,netport)
+set target_info(target,target) localhost
+set target_info(target,connect) rlogin
+if { [rlogin target] < 0 } {
+ if [ string match "*kinit" $errno] {
+ puts "NOTTESTED: rlogin target"
+ } else {
+ puts "FAILED: rlogin target"
+ }
+} else {
+ puts "PASSED: rlogin target"
+}
+catch "exp_send exit\n"
+catch "close -i $spawn_id"
+catch "wait -i $spawn_id"
+
+# test remote_open
+if { [rsh target] < 0 } {
+ if [ string match "*kinit" $errno] {
+ puts "NOTTESTED: rsh target"
+ } else {
+ puts "FAILED: rsh target"
+ }
+} else {
+ puts "PASSED: rsh target"
+}
+catch "exp_send exit\n"
+catch "close -i $spawn_id"
+catch "wait -i $spawn_id"
+
+# telnet to host
+# FIXME: This won't work till we figure out how to telnet and
+# not get a password prompt.
+
+#
+# Connect to the configured host
+#
+set target_info(host,connect) rlogin
+set target_info(host,netport) $target_info(idp,netport)
+set target_info(host,target) localhost
+
+# rlogin to host
+if { [rlogin host] < 0 } {
+ if [ string match "*kinit*" $errno] {
+ puts "NOTTESTED: rlogin host"
+ } else {
+ puts "FAILED: rlogin host"
+ }
+} else {
+ puts "PASSED: rlogin host"
+}
+catch "exp_send exit\n"
+catch "close -i $spawn_id"
+catch "wait -i $spawn_id"
+
+# rsh to host
+if { [rsh host] < 0 } {
+ if [ string match "*kinit*" $errno] {
+ puts "NOTTESTED: rsh host"
+ } else {
+ puts "FAILED: rsh host"
+ }
+} else {
+ puts "PASSED: rsh host"
+}
+catch "exp_send exit\n"
+catch "close -i $spawn_id"
+catch "wait -i $spawn_id"
+
+# telnet to host
+# FIXME: This won't work till we figure out how to telnet and
+# not get a password prompt.
+
+# tip port
+# remote_close args
+# rcp_download src dest
+# tip_download shell_id file
+# kermit args
+# download args
+
+
+
+
+
+
+
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats-sub.exp b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats-sub.exp
new file mode 100644
index 0000000..966bb75
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats-sub.exp
@@ -0,0 +1,16 @@
+# Subordinate to stats.exp.
+
+# If not called by stats.exp, quit now.
+if { ![info exists STATS_TEST] } {
+ return
+}
+
+switch $STATS_TEST {
+ pass { pass "pass test" }
+ fail { fail "fail test" }
+ xpass { xpass "xpass test" }
+ xfail { xfail "xfail test" }
+ untested { untested "untested test" }
+ unresolved { unresolved "unresolved test" }
+ unsupported { unsupported "unsupported test" }
+} \ No newline at end of file
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats.exp b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats.exp
new file mode 100644
index 0000000..3b30f9d
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/stats.exp
@@ -0,0 +1,49 @@
+# Copyright (C) 1995 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file tests pass/fail/etc.
+# The way we do this is to recursively invoke ourselves on a small testsuite
+# and analyze the results.
+
+load_lib util-defs.exp
+
+if ![file isdirectory $tmpdir] {
+ catch "exec mkdir $tmpdir"
+}
+
+set tests {
+ { pass "expected passes\[ \t\]+1\n" }
+ { fail "unexpected failures\[ \t\]+1\n" }
+ { xpass "unexpected successes\[ \t\]+1\n" }
+ { xfail "expected failures\[ \t\]+1\n" }
+ { untested "untested testcases\[ \t\]+1\n" }
+ { unresolved "unresolved testcases\[ \t\]+1\n" }
+ { unsupported "unsupported tests\[ \t\]+1\n" }
+}
+
+foreach t $tests {
+ if [util_test "$RUNTEST" \
+ "--outdir $tmpdir STATS_TEST=[lindex $t 0] stats-sub.exp" \
+ "" \
+ [lindex $t 1]] {
+ fail [lindex $t 0]
+ } else {
+ pass [lindex $t 0]
+ }
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/target.test b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/target.test
new file mode 100644
index 0000000..8c18980
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/target.test
@@ -0,0 +1,247 @@
+set srcdir [lindex $argv 0]
+set subdir [lindex $argv 1]
+set objdir [lindex $argv 2]
+
+if [ file exists $objdir/setval.tmp ] {
+ source $objdir/setval.tmp
+} else {
+ puts "ERROR: $objdir/setval.tmp doesn't exist"
+}
+if [ file exists $srcdir$subdir/default_procs.tcl ] {
+ source "$srcdir$subdir/default_procs.tcl"
+} else {
+ puts "ERROR: $srcdir$subdir/default_procs.tcl doesn't exist"
+}
+
+set file $srcdir/../lib/target.exp
+if [ file exists $file] {
+ source $file
+} else {
+ puts "ERROR: $file doesn't exist"
+}
+# we load framework so we can use stuff like is3way
+set file $srcdir/../lib/framework.exp
+if [ file exists $file] {
+ source $file
+} else {
+ puts "ERROR: $file doesn't exist"
+}
+# we load the remote stuff so we can test execute_anywhere
+set file $srcdir/../lib/remote.exp
+if [ file exists $file] {
+ source $file
+} else {
+ puts "ERROR: $file doesn't exist"
+}
+
+#
+# Create a false target config array
+#
+set target_info(idp,name) "idp"
+set target_info(idp,ldflags) "-Tidp.ld"
+set target_info(idp,config) m68k-unknown-aout
+set target_info(idp,cflags) ""
+set target_info(idp,connect) "telnet"
+set target_info(idp,target) "s12"
+set target_info(idp,serial) "tstty12"
+set target_info(idp,netport) "localhost:23"
+set target_info(idp,baud) "9600"
+# MVME target
+set target_info(mvme,name) "mvme"
+set target_info(mvme,ldflags) "-Tmvme.ld"
+set target_info(mvme,config) m68k-unknown-aout
+set target_info(mvme,cflags) ""
+set target_info(mvme,connect) "telnet"
+set target_info(mvme,target) "s12"
+set target_info(mvme,serial) "tstty8"
+set target_info(mvme,netport) "localhost:23"
+set target_info(mvme,baud) "9600"
+
+# Test remote open. We try not to use any of the support procs in
+# target.exp to for isolation testing. "target" is the name of the
+# default array setup by the procs in target.exp.
+
+set timeout 100
+
+# test list_target
+
+if { [list_targets] == "idp mvme" } {
+ puts "PASSED: list_targets"
+} else {
+ puts "FAILED: list_targets"
+}
+push_config target idp
+set matches 0
+if { $target_info(target,name) == "idp" } {
+ incr matches
+}
+if { $target_info(target,ldflags) == "-Tidp.ld" } {
+ incr matches
+}
+if { $target_info(target,config) == "m68k-unknown-aout" } {
+ incr matches
+}
+if { $target_info(target,cflags) == "" } {
+ incr matches
+}
+if { $target_info(target,connect) == "telnet" } {
+ incr matches
+}
+if { $target_info(target,target) == "s12" } {
+ incr matches
+}
+if { $target_info(target,serial) == "tstty12" } {
+ incr matches
+}
+if { $target_info(target,netport) == "localhost:23" } {
+ incr matches
+}
+if { $target_info(target,baud) == "9600" } {
+ incr matches
+}
+if { $matches == 9 } {
+ puts "PASSED: push_config target"
+} else {
+ puts "FAILED: push_config target"
+}
+
+# test pop_config target
+pop_config target
+set matches 0
+if { $target_info(target,name) == "" } {
+ incr matches
+}
+if { $target_info(target,ldflags) == "" } {
+ incr matches
+}
+if { $target_info(target,config) == "" } {
+ incr matches
+}
+if { $target_info(target,cflags) == "" } {
+ incr matches
+}
+if { $target_info(target,connect) == "" } {
+ incr matches
+}
+if { $target_info(target,target) == "" } {
+ incr matches
+}
+if { $target_info(target,serial) == "" } {
+ incr matches
+}
+if { $target_info(target,netport) == "" } {
+ incr matches
+}
+if { $target_info(target,baud) == "" } {
+ incr matches
+}
+if { $matches == 9 } {
+ puts "PASSED: pop_config target"
+} else {
+ puts "FAILED: pop_config target"
+}
+
+push_config host idp
+set matches 0
+if { $target_info(host,name) == "idp" } {
+ incr matches
+}
+if { $target_info(host,ldflags) == "-Tidp.ld" } {
+ incr matches
+}
+if { $target_info(host,config) == "m68k-unknown-aout" } {
+ incr matches
+}
+if { $target_info(host,cflags) == "" } {
+ incr matches
+}
+if { $target_info(host,connect) == "telnet" } {
+ incr matches
+}
+if { $target_info(host,target) == "s12" } {
+ incr matches
+}
+if { $target_info(host,serial) == "tstty12" } {
+ incr matches
+}
+if { $target_info(host,netport) == "localhost:23" } {
+ incr matches
+}
+if { $target_info(host,baud) == "9600" } {
+ incr matches
+}
+if { $matches == 9 } {
+ puts "PASSED: push_config target"
+} else {
+ puts "FAILED: push_config target"
+}
+
+# test pop_config host
+pop_config host
+set matches 0
+if { $target_info(host,name) == "" } {
+ incr matches
+}
+if { $target_info(host,ldflags) == "" } {
+ incr matches
+}
+if { $target_info(host,config) == "" } {
+ incr matches
+}
+if { $target_info(host,cflags) == "" } {
+ incr matches
+}
+if { $target_info(host,connect) == "" } {
+ incr matches
+}
+if { $target_info(host,target) == "" } {
+ incr matches
+}
+if { $target_info(host,serial) == "" } {
+ incr matches
+}
+if { $target_info(host,netport) == "" } {
+ incr matches
+}
+if { $target_info(host,baud) == "" } {
+ incr matches
+}
+if { $matches == 9 } {
+ puts "PASSED: pop_config host"
+} else {
+ puts "FAILED: pop_config host"
+}
+
+# test execute_anywhere for a native environment
+set host_triplet i586-unknown-linux
+set target_triplet i586-unknown-linux
+set build_triplet i586-unknown-linux
+if { [string match "*setval.tmp*" [execute_anywhere "ls"]] } {
+ puts "PASSED: execute_anywhere, native"
+} else {
+ puts "FAILED: execute_anywhere, native"
+}
+
+# test execute_anywhere for a normal cross
+set target_triplet m68k-unknown-coff
+if { [string match "*testsuite" [execute_anywhere "pwd"]] } {
+ puts "PASSED: execute_anywhere, normal cross"
+} else {
+ puts "FAILED: execute_anywhere, normal cross"
+}
+
+# test execute_anywhere for a canadian cross
+set build_triplet m68k-test-test
+set target_info(host,connect) rlogin
+set target_info(host,netport) $target_info(idp,netport)
+set target_info(host,target) localhost
+if { [string match "*FooBar*" [execute_anywhere "echo FooBar"]] } {
+ puts "PASSED: execute_anywhere, canadian cross"
+} else {
+ puts "FAILED: execute_anywhere, canadian cross"
+}
+
+# compile arg
+# archive arg
+# ranlib arg
+# link_objects arg
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile1 b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile1
new file mode 100644
index 0000000..8397fe3
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile1
@@ -0,0 +1 @@
+# just so we don't look empty.
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile2 b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile2
new file mode 100644
index 0000000..7d1d836
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subfile2
@@ -0,0 +1,2 @@
+# just so we don't look empty.
+
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subsubdir1/subsubfile1 b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subsubdir1/subsubfile1
new file mode 100644
index 0000000..7d1d836
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir1/subsubdir1/subsubfile1
@@ -0,0 +1,2 @@
+# just so we don't look empty.
+
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir2/subfile2 b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir2/subfile2
new file mode 100644
index 0000000..7d1d836
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/topdir/subdir2/subfile2
@@ -0,0 +1,2 @@
+# just so we don't look empty.
+
diff --git a/contrib/bluegnu2.0.3/testsuite/bluegnu.all/utils.test b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/utils.test
new file mode 100644
index 0000000..864c797
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/bluegnu.all/utils.test
@@ -0,0 +1,118 @@
+set srcdir [lindex $argv 0]
+set subdir [lindex $argv 1]
+set objdir [lindex $argv 2]
+
+if [ file exists $objdir/setval.tmp ] {
+ source $objdir/setval.tmp
+} else {
+ puts "ERROR: $objdir/setval.tmp doesn't exist"
+}
+if [ file exists $srcdir$subdir/default_procs.tcl ] {
+ source "$srcdir$subdir/default_procs.tcl"
+} else {
+ puts "ERROR: $srcdir$subdir/default_procs.tcl doesn't exist"
+}
+
+set file $srcdir/../lib/utils.exp
+if [ file exists $file] {
+ source $file
+} else {
+ puts "ERROR: $file doesn't exist"
+}
+
+#
+# getdirs tests
+#
+if [lib_pat_test "getdirs" "${srcdir}/runtest.all" "runtest.all/topdir" ] {
+ puts "FAILED: getdirs toplevel, no arguments"
+} else {
+ puts "PASSED: getdirs toplevel, no arguments"
+}
+
+if [lib_pat_test "getdirs" "${srcdir}/runtest.all top*" "runtest.all/topdir" ] {
+ puts "FAILED: getdirs toplevel, one subdir"
+} else {
+ puts "PASSED: getdirs toplevel, one subdir"
+}
+
+if [lib_pat_test "getdirs" "${srcdir}/runtest.all/topdir" "subdir1*subdir2" ] {
+ puts "FAILED: getdirs toplevel, two subdirs"
+} else {
+ puts "PASSED: getdirs toplevel, two subdirs"
+}
+
+#
+# find tests
+#
+if [string match "*/subdir2/subfile2" "[find ${srcdir}/runtest.all/topdir/subdir2 sub*]"] {
+ puts "PASSED: find, only one level deep"
+} else {
+ puts "FAILED: find, only one level deep"
+}
+
+#set path ${srcdir}/runtest.all/topdir/subdir1
+#exp_test "find ${path} sub*" "Adding */subdir1/subsubdir1/subsubfile1" "find, two levels deep"
+
+if [string match "*/subdir1/subsubdir1/subsubfile1" "[find ${srcdir}/runtest.all/topdir/subdir1 sub*]"] {
+ puts "PASSED: find, two levels deep"
+} else {
+ puts "FAILED: find, two levels deep"
+}
+
+#
+# environment varible utility tests
+#
+
+if [info exists env(TESTRUN)] {
+ unset env(TESTRUN)
+}
+
+# test setenv
+setenv TESTRUN FooBar
+if [info exists env(TESTRUN)] {
+ if { $env(TESTRUN) == "FooBar" } {
+ pass "setenv, set an environment variable"
+ } else {
+ fail "setenv, set an environment variable
+ }
+} else {
+ fail "setenv, set an environment variable"
+}
+# test getenv
+if [info exists env(TESTRUN)] {
+ if { [getenv TESTRUN] == "FooBar" } {
+ pass "getenv, get an environment variable"
+ } else {
+ fail "getenv, get an environment variable"
+ }
+} else {
+ untested "getenv, get an environment variable"
+}
+
+# test unsetenv
+if [info exists env(TESTRUN)] {
+ unsetenv TESTRUN
+ if [info exists env(TESTRUN)] {
+ fail "unsetenv, unset an environment variable"
+ } else {
+ pass "unsetenv, unset an environment variable"
+ }
+} else {
+ untested "unsetenv, unset an environment variable"
+}
+
+# which file
+# grep args
+# prune list pattern
+# slay name
+# absolute path
+# psource file
+# diff file_1 file_2
+
+
+
+
+
+
+
+
diff --git a/contrib/bluegnu2.0.3/testsuite/config/default.exp b/contrib/bluegnu2.0.3/testsuite/config/default.exp
new file mode 100644
index 0000000..719c21b
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/config/default.exp
@@ -0,0 +1,79 @@
+ Copyright (C) 1988, 90-93, 1995 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+global RUNTEST
+if ![info exists RUNTEST] then {
+ set RUNTEST [transform runtest]
+}
+
+if ![info exists EXPECT] {
+ set EXPECT [findfile $base_dir/../../expect/expect "$base_dir/../../expect/expect" expect]
+ verbose "EXPECT defaulting to $EXPECT" 2
+}
+
+global RUNTESTFLAGS
+if ![info exists RUNTESTFLAGS] then {
+ set RUNTESTFLAGS "-v -v -a"
+}
+
+#
+# runtest_version -- extract and print the version number
+#
+proc runtest_version { } {
+ global RUNTEST
+
+ catch {exec $RUNTEST -V} tmp
+ if [info exists tmp] then {
+ clone_output "$tmp\n"
+ }
+}
+
+#
+# runtest_load -- loads the program. For runtest, this is just a stub
+#
+proc runtest_load { arg } {
+}
+
+#
+# runtest_exit -- exit the test driver for expect
+#
+proc runtest_exit { } {
+ close
+}
+
+#
+# runtest_start -- start everything
+#
+proc runtest_start { } {
+ global verbose
+ global spawn_id
+ global subdir
+ global srcdir
+ global objdir
+ global RUNTEST
+ global RUNTESTFLAGS
+
+ if {[which $RUNTEST] != 0} then {
+ perror "Can't find $RUNTEST"
+ }
+
+# return [open [concat "$RUNTEST $RUNTESTFLAGS"] r]
+}
diff --git a/contrib/bluegnu2.0.3/testsuite/configure b/contrib/bluegnu2.0.3/testsuite/configure
new file mode 100755
index 0000000..560258e
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/configure
@@ -0,0 +1,1076 @@
+#! /bin/sh
+
+# Guess values for system-dependent variables and create Makefiles.
+# Generated automatically using autoconf version 2.7
+# Copyright (C) 1992, 1993, 1994 Free Software Foundation, Inc.
+#
+# This configure script is free software; the Free Software Foundation
+# gives unlimited permission to copy, distribute and modify it.
+
+# Defaults:
+ac_help=
+ac_default_prefix=/usr/local
+# Any additions from configure.in:
+ac_help="$ac_help
+ --with-tclinclude directory where tcl private headers are"
+
+# Initialize some variables set by options.
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+build=NONE
+cache_file=./config.cache
+exec_prefix=NONE
+host=NONE
+no_create=
+nonopt=NONE
+no_recursion=
+prefix=NONE
+program_prefix=NONE
+program_suffix=NONE
+program_transform_name=s,x,x,
+silent=
+site=
+srcdir=
+target=NONE
+verbose=
+x_includes=NONE
+x_libraries=NONE
+bindir='${exec_prefix}/bin'
+sbindir='${exec_prefix}/sbin'
+libexecdir='${exec_prefix}/libexec'
+datadir='${prefix}/share'
+sysconfdir='${prefix}/etc'
+sharedstatedir='${prefix}/com'
+localstatedir='${prefix}/var'
+libdir='${exec_prefix}/lib'
+includedir='${prefix}/include'
+oldincludedir='/usr/include'
+infodir='${prefix}/info'
+mandir='${prefix}/man'
+
+# Initialize some other variables.
+subdirs=
+MFLAGS= MAKEFLAGS=
+
+ac_prev=
+for ac_option
+do
+
+ # If the previous option needs an argument, assign it.
+ if test -n "$ac_prev"; then
+ eval "$ac_prev=\$ac_option"
+ ac_prev=
+ continue
+ fi
+
+ case "$ac_option" in
+ -*=*) ac_optarg=`echo "$ac_option" | sed 's/[-_a-zA-Z0-9]*=//'` ;;
+ *) ac_optarg= ;;
+ esac
+
+ # Accept the important Cygnus configure options, so we can diagnose typos.
+
+ case "$ac_option" in
+
+ -bindir | --bindir | --bindi | --bind | --bin | --bi)
+ ac_prev=bindir ;;
+ -bindir=* | --bindir=* | --bindi=* | --bind=* | --bin=* | --bi=*)
+ bindir="$ac_optarg" ;;
+
+ -build | --build | --buil | --bui | --bu)
+ ac_prev=build ;;
+ -build=* | --build=* | --buil=* | --bui=* | --bu=*)
+ build="$ac_optarg" ;;
+
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ cache_file="$ac_optarg" ;;
+
+ -datadir | --datadir | --datadi | --datad | --data | --dat | --da)
+ ac_prev=datadir ;;
+ -datadir=* | --datadir=* | --datadi=* | --datad=* | --data=* | --dat=* \
+ | --da=*)
+ datadir="$ac_optarg" ;;
+
+ -disable-* | --disable-*)
+ ac_feature=`echo $ac_option|sed -e 's/-*disable-//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_feature| sed 's/[-a-zA-Z0-9_]//g'`"; then
+ { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; }
+ fi
+ ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+ eval "enable_${ac_feature}=no" ;;
+
+ -enable-* | --enable-*)
+ ac_feature=`echo $ac_option|sed -e 's/-*enable-//' -e 's/=.*//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_feature| sed 's/[-_a-zA-Z0-9]//g'`"; then
+ { echo "configure: error: $ac_feature: invalid feature name" 1>&2; exit 1; }
+ fi
+ ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+ case "$ac_option" in
+ *=*) ;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "enable_${ac_feature}='$ac_optarg'" ;;
+
+ -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+ | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+ | --exec | --exe | --ex)
+ ac_prev=exec_prefix ;;
+ -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+ | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+ | --exec=* | --exe=* | --ex=*)
+ exec_prefix="$ac_optarg" ;;
+
+ -gas | --gas | --ga | --g)
+ # Obsolete; use --with-gas.
+ with_gas=yes ;;
+
+ -help | --help | --hel | --he)
+ # Omit some internal or obsolete options to make the list less imposing.
+ # This message is too long to be a string in the A/UX 3.1 sh.
+ cat << EOF
+Usage: configure [options] [host]
+Options: [defaults in brackets after descriptions]
+Configuration:
+ --cache-file=FILE cache test results in FILE
+ --help print this message
+ --no-create do not create output files
+ --quiet, --silent do not print \`checking...' messages
+ --version print the version of autoconf that created configure
+Directory and file names:
+ --prefix=PREFIX install architecture-independent files in PREFIX
+ [$ac_default_prefix]
+ --exec-prefix=EPREFIX install architecture-dependent files in EPREFIX
+ [same as prefix]
+ --bindir=DIR user executables in DIR [EPREFIX/bin]
+ --sbindir=DIR system admin executables in DIR [EPREFIX/sbin]
+ --libexecdir=DIR program executables in DIR [EPREFIX/libexec]
+ --datadir=DIR read-only architecture-independent data in DIR
+ [PREFIX/share]
+ --sysconfdir=DIR read-only single-machine data in DIR [PREFIX/etc]
+ --sharedstatedir=DIR modifiable architecture-independent data in DIR
+ [PREFIX/com]
+ --localstatedir=DIR modifiable single-machine data in DIR [PREFIX/var]
+ --libdir=DIR object code libraries in DIR [EPREFIX/lib]
+ --includedir=DIR C header files in DIR [PREFIX/include]
+ --oldincludedir=DIR C header files for non-gcc in DIR [/usr/include]
+ --infodir=DIR info documentation in DIR [PREFIX/info]
+ --mandir=DIR man documentation in DIR [PREFIX/man]
+ --srcdir=DIR find the sources in DIR [configure dir or ..]
+ --program-prefix=PREFIX prepend PREFIX to installed program names
+ --program-suffix=SUFFIX append SUFFIX to installed program names
+ --program-transform-name=PROGRAM
+ run sed PROGRAM on installed program names
+EOF
+ cat << EOF
+Host type:
+ --build=BUILD configure for building on BUILD [BUILD=HOST]
+ --host=HOST configure for HOST [guessed]
+ --target=TARGET configure for TARGET [TARGET=HOST]
+Features and packages:
+ --disable-FEATURE do not include FEATURE (same as --enable-FEATURE=no)
+ --enable-FEATURE[=ARG] include FEATURE [ARG=yes]
+ --with-PACKAGE[=ARG] use PACKAGE [ARG=yes]
+ --without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
+ --x-includes=DIR X include files are in DIR
+ --x-libraries=DIR X library files are in DIR
+EOF
+ if test -n "$ac_help"; then
+ echo "--enable and --with options recognized:$ac_help"
+ fi
+ exit 0 ;;
+
+ -host | --host | --hos | --ho)
+ ac_prev=host ;;
+ -host=* | --host=* | --hos=* | --ho=*)
+ host="$ac_optarg" ;;
+
+ -includedir | --includedir | --includedi | --included | --include \
+ | --includ | --inclu | --incl | --inc)
+ ac_prev=includedir ;;
+ -includedir=* | --includedir=* | --includedi=* | --included=* | --include=* \
+ | --includ=* | --inclu=* | --incl=* | --inc=*)
+ includedir="$ac_optarg" ;;
+
+ -infodir | --infodir | --infodi | --infod | --info | --inf)
+ ac_prev=infodir ;;
+ -infodir=* | --infodir=* | --infodi=* | --infod=* | --info=* | --inf=*)
+ infodir="$ac_optarg" ;;
+
+ -libdir | --libdir | --libdi | --libd)
+ ac_prev=libdir ;;
+ -libdir=* | --libdir=* | --libdi=* | --libd=*)
+ libdir="$ac_optarg" ;;
+
+ -libexecdir | --libexecdir | --libexecdi | --libexecd | --libexec \
+ | --libexe | --libex | --libe)
+ ac_prev=libexecdir ;;
+ -libexecdir=* | --libexecdir=* | --libexecdi=* | --libexecd=* | --libexec=* \
+ | --libexe=* | --libex=* | --libe=*)
+ libexecdir="$ac_optarg" ;;
+
+ -localstatedir | --localstatedir | --localstatedi | --localstated \
+ | --localstate | --localstat | --localsta | --localst \
+ | --locals | --local | --loca | --loc | --lo)
+ ac_prev=localstatedir ;;
+ -localstatedir=* | --localstatedir=* | --localstatedi=* | --localstated=* \
+ | --localstate=* | --localstat=* | --localsta=* | --localst=* \
+ | --locals=* | --local=* | --loca=* | --loc=* | --lo=*)
+ localstatedir="$ac_optarg" ;;
+
+ -mandir | --mandir | --mandi | --mand | --man | --ma | --m)
+ ac_prev=mandir ;;
+ -mandir=* | --mandir=* | --mandi=* | --mand=* | --man=* | --ma=* | --m=*)
+ mandir="$ac_optarg" ;;
+
+ -nfp | --nfp | --nf)
+ # Obsolete; use --without-fp.
+ with_fp=no ;;
+
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c)
+ no_create=yes ;;
+
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r)
+ no_recursion=yes ;;
+
+ -oldincludedir | --oldincludedir | --oldincludedi | --oldincluded \
+ | --oldinclude | --oldinclud | --oldinclu | --oldincl | --oldinc \
+ | --oldin | --oldi | --old | --ol | --o)
+ ac_prev=oldincludedir ;;
+ -oldincludedir=* | --oldincludedir=* | --oldincludedi=* | --oldincluded=* \
+ | --oldinclude=* | --oldinclud=* | --oldinclu=* | --oldincl=* | --oldinc=* \
+ | --oldin=* | --oldi=* | --old=* | --ol=* | --o=*)
+ oldincludedir="$ac_optarg" ;;
+
+ -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+ ac_prev=prefix ;;
+ -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+ prefix="$ac_optarg" ;;
+
+ -program-prefix | --program-prefix | --program-prefi | --program-pref \
+ | --program-pre | --program-pr | --program-p)
+ ac_prev=program_prefix ;;
+ -program-prefix=* | --program-prefix=* | --program-prefi=* \
+ | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+ program_prefix="$ac_optarg" ;;
+
+ -program-suffix | --program-suffix | --program-suffi | --program-suff \
+ | --program-suf | --program-su | --program-s)
+ ac_prev=program_suffix ;;
+ -program-suffix=* | --program-suffix=* | --program-suffi=* \
+ | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+ program_suffix="$ac_optarg" ;;
+
+ -program-transform-name | --program-transform-name \
+ | --program-transform-nam | --program-transform-na \
+ | --program-transform-n | --program-transform- \
+ | --program-transform | --program-transfor \
+ | --program-transfo | --program-transf \
+ | --program-trans | --program-tran \
+ | --progr-tra | --program-tr | --program-t)
+ ac_prev=program_transform_name ;;
+ -program-transform-name=* | --program-transform-name=* \
+ | --program-transform-nam=* | --program-transform-na=* \
+ | --program-transform-n=* | --program-transform-=* \
+ | --program-transform=* | --program-transfor=* \
+ | --program-transfo=* | --program-transf=* \
+ | --program-trans=* | --program-tran=* \
+ | --progr-tra=* | --program-tr=* | --program-t=*)
+ program_transform_name="$ac_optarg" ;;
+
+ -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+ | -silent | --silent | --silen | --sile | --sil)
+ silent=yes ;;
+
+ -sbindir | --sbindir | --sbindi | --sbind | --sbin | --sbi | --sb)
+ ac_prev=sbindir ;;
+ -sbindir=* | --sbindir=* | --sbindi=* | --sbind=* | --sbin=* \
+ | --sbi=* | --sb=*)
+ sbindir="$ac_optarg" ;;
+
+ -sharedstatedir | --sharedstatedir | --sharedstatedi \
+ | --sharedstated | --sharedstate | --sharedstat | --sharedsta \
+ | --sharedst | --shareds | --shared | --share | --shar \
+ | --sha | --sh)
+ ac_prev=sharedstatedir ;;
+ -sharedstatedir=* | --sharedstatedir=* | --sharedstatedi=* \
+ | --sharedstated=* | --sharedstate=* | --sharedstat=* | --sharedsta=* \
+ | --sharedst=* | --shareds=* | --shared=* | --share=* | --shar=* \
+ | --sha=* | --sh=*)
+ sharedstatedir="$ac_optarg" ;;
+
+ -site | --site | --sit)
+ ac_prev=site ;;
+ -site=* | --site=* | --sit=*)
+ site="$ac_optarg" ;;
+
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ srcdir="$ac_optarg" ;;
+
+ -sysconfdir | --sysconfdir | --sysconfdi | --sysconfd | --sysconf \
+ | --syscon | --sysco | --sysc | --sys | --sy)
+ ac_prev=sysconfdir ;;
+ -sysconfdir=* | --sysconfdir=* | --sysconfdi=* | --sysconfd=* | --sysconf=* \
+ | --syscon=* | --sysco=* | --sysc=* | --sys=* | --sy=*)
+ sysconfdir="$ac_optarg" ;;
+
+ -target | --target | --targe | --targ | --tar | --ta | --t)
+ ac_prev=target ;;
+ -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+ target="$ac_optarg" ;;
+
+ -v | -verbose | --verbose | --verbos | --verbo | --verb)
+ verbose=yes ;;
+
+ -version | --version | --versio | --versi | --vers)
+ echo "configure generated by autoconf version 2.7"
+ exit 0 ;;
+
+ -with-* | --with-*)
+ ac_package=`echo $ac_option|sed -e 's/-*with-//' -e 's/=.*//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_package| sed 's/[-_a-zA-Z0-9]//g'`"; then
+ { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; }
+ fi
+ ac_package=`echo $ac_package| sed 's/-/_/g'`
+ case "$ac_option" in
+ *=*) ;;
+ *) ac_optarg=yes ;;
+ esac
+ eval "with_${ac_package}='$ac_optarg'" ;;
+
+ -without-* | --without-*)
+ ac_package=`echo $ac_option|sed -e 's/-*without-//'`
+ # Reject names that are not valid shell variable names.
+ if test -n "`echo $ac_package| sed 's/[-a-zA-Z0-9_]//g'`"; then
+ { echo "configure: error: $ac_package: invalid package name" 1>&2; exit 1; }
+ fi
+ ac_package=`echo $ac_package| sed 's/-/_/g'`
+ eval "with_${ac_package}=no" ;;
+
+ --x)
+ # Obsolete; use --with-x.
+ with_x=yes ;;
+
+ -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+ | --x-incl | --x-inc | --x-in | --x-i)
+ ac_prev=x_includes ;;
+ -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+ | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+ x_includes="$ac_optarg" ;;
+
+ -x-libraries | --x-libraries | --x-librarie | --x-librari \
+ | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+ ac_prev=x_libraries ;;
+ -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+ | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+ x_libraries="$ac_optarg" ;;
+
+ -*) { echo "configure: error: $ac_option: invalid option; use --help to show usage" 1>&2; exit 1; }
+ ;;
+
+ *)
+ if test -n "`echo $ac_option| sed 's/[-a-z0-9.]//g'`"; then
+ echo "configure: warning: $ac_option: invalid host type" 1>&2
+ fi
+ if test "x$nonopt" != xNONE; then
+ { echo "configure: error: can only configure for one host and one target at a time" 1>&2; exit 1; }
+ fi
+ nonopt="$ac_option"
+ ;;
+
+ esac
+done
+
+if test -n "$ac_prev"; then
+ { echo "configure: error: missing argument to --`echo $ac_prev | sed 's/_/-/g'`" 1>&2; exit 1; }
+fi
+
+trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15
+
+# File descriptor usage:
+# 0 standard input
+# 1 file creation
+# 2 errors and warnings
+# 3 some systems may open it to /dev/tty
+# 4 used on the Kubota Titan
+# 6 checking for... messages and results
+# 5 compiler messages saved in config.log
+if test "$silent" = yes; then
+ exec 6>/dev/null
+else
+ exec 6>&1
+fi
+exec 5>./config.log
+
+echo "\
+This file contains any messages produced by compilers while
+running configure, to aid debugging if configure makes a mistake.
+" 1>&5
+
+# Strip out --no-create and --no-recursion so they do not pile up.
+# Also quote any args containing shell metacharacters.
+ac_configure_args=
+for ac_arg
+do
+ case "$ac_arg" in
+ -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+ | --no-cr | --no-c) ;;
+ -no-recursion | --no-recursion | --no-recursio | --no-recursi \
+ | --no-recurs | --no-recur | --no-recu | --no-rec | --no-re | --no-r) ;;
+ *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*)
+ ac_configure_args="$ac_configure_args '$ac_arg'" ;;
+ *) ac_configure_args="$ac_configure_args $ac_arg" ;;
+ esac
+done
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi
+if test "${LANG+set}" = set; then LANG=C; export LANG; fi
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -rf conftest* confdefs.h
+# AIX cpp loses on an empty file, so make sure it contains at least a newline.
+echo > confdefs.h
+
+# A filename unique to this package, relative to the directory that
+# configure is in, which we can look for to find out if srcdir is correct.
+ac_unique_file=Makefile.in
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+ ac_srcdir_defaulted=yes
+ # Try the directory containing this script, then its parent.
+ ac_prog=$0
+ ac_confdir=`echo $ac_prog|sed 's%/[^/][^/]*$%%'`
+ test "x$ac_confdir" = "x$ac_prog" && ac_confdir=.
+ srcdir=$ac_confdir
+ if test ! -r $srcdir/$ac_unique_file; then
+ srcdir=..
+ fi
+else
+ ac_srcdir_defaulted=no
+fi
+if test ! -r $srcdir/$ac_unique_file; then
+ if test "$ac_srcdir_defaulted" = yes; then
+ { echo "configure: error: can not find sources in $ac_confdir or .." 1>&2; exit 1; }
+ else
+ { echo "configure: error: can not find sources in $srcdir" 1>&2; exit 1; }
+ fi
+fi
+srcdir=`echo "${srcdir}" | sed 's%\([^/]\)/*$%\1%'`
+
+# Prefer explicitly selected file to automatically selected ones.
+if test -z "$CONFIG_SITE"; then
+ if test "x$prefix" != xNONE; then
+ CONFIG_SITE="$prefix/share/config.site $prefix/etc/config.site"
+ else
+ CONFIG_SITE="$ac_default_prefix/share/config.site $ac_default_prefix/etc/config.site"
+ fi
+fi
+for ac_site_file in $CONFIG_SITE; do
+ if test -r "$ac_site_file"; then
+ echo "loading site script $ac_site_file"
+ . "$ac_site_file"
+ fi
+done
+
+if test -r "$cache_file"; then
+ echo "loading cache $cache_file"
+ . $cache_file
+else
+ echo "creating cache $cache_file"
+ > $cache_file
+fi
+
+ac_ext=c
+# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options.
+ac_cpp='echo $CPP $CPPFLAGS 1>&5;
+$CPP $CPPFLAGS'
+ac_compile='echo ${CC-cc} -c $CFLAGS $CPPFLAGS conftest.$ac_ext 1>&5;
+${CC-cc} -c $CFLAGS $CPPFLAGS conftest.$ac_ext 1>&5 2>&5'
+ac_link='echo ${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS 1>&5;
+${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.$ac_ext $LIBS 1>&5 2>&5'
+
+if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then
+ # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu.
+ if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then
+ ac_n= ac_c='
+' ac_t=' '
+ else
+ ac_n=-n ac_c= ac_t=
+ fi
+else
+ ac_n= ac_c='\c' ac_t=
+fi
+
+
+
+echo $ac_n "checking how to run the C preprocessor""... $ac_c" 1>&6
+# On Suns, sometimes $CPP names a directory.
+if test -n "$CPP" && test -d "$CPP"; then
+ CPP=
+fi
+if test -z "$CPP"; then
+if eval "test \"`echo '$''{'ac_cv_prog_CPP'+set}'`\" = set"; then
+ echo $ac_n "(cached) $ac_c" 1>&6
+else
+ # This must be in double quotes, not single quotes, because CPP may get
+ # substituted into the Makefile and "${CC-cc}" will confuse make.
+ CPP="${CC-cc} -E"
+ # On the NeXT, cc -E runs the code through the compiler's parser,
+ # not just through cpp.
+ cat > conftest.$ac_ext <<EOF
+#line 537 "configure"
+#include "confdefs.h"
+#include <assert.h>
+Syntax Error
+EOF
+eval "$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out"
+ac_err=`grep -v '^ *+' conftest.out`
+if test -z "$ac_err"; then
+ :
+else
+ echo "$ac_err" >&5
+ rm -rf conftest*
+ CPP="${CC-cc} -E -traditional-cpp"
+ cat > conftest.$ac_ext <<EOF
+#line 551 "configure"
+#include "confdefs.h"
+#include <assert.h>
+Syntax Error
+EOF
+eval "$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out"
+ac_err=`grep -v '^ *+' conftest.out`
+if test -z "$ac_err"; then
+ :
+else
+ echo "$ac_err" >&5
+ rm -rf conftest*
+ CPP=/lib/cpp
+fi
+rm -f conftest*
+fi
+rm -f conftest*
+ ac_cv_prog_CPP="$CPP"
+fi
+ CPP="$ac_cv_prog_CPP"
+else
+ ac_cv_prog_CPP="$CPP"
+fi
+echo "$ac_t""$CPP" 1>&6
+
+# If we cannot run a trivial program, we must be cross compiling.
+echo $ac_n "checking whether cross-compiling""... $ac_c" 1>&6
+if eval "test \"`echo '$''{'ac_cv_c_cross'+set}'`\" = set"; then
+ echo $ac_n "(cached) $ac_c" 1>&6
+else
+ if test "$cross_compiling" = yes; then
+ ac_cv_c_cross=yes
+else
+cat > conftest.$ac_ext <<EOF
+#line 585 "configure"
+#include "confdefs.h"
+main(){return(0);}
+EOF
+eval $ac_link
+if test -s conftest && (./conftest; exit) 2>/dev/null; then
+ ac_cv_c_cross=no
+else
+ ac_cv_c_cross=yes
+fi
+fi
+rm -fr conftest*
+fi
+
+echo "$ac_t""$ac_cv_c_cross" 1>&6
+cross_compiling=$ac_cv_c_cross
+
+
+#
+# Ok, lets find the tcl source trees so we can use the headers
+# Warning: transition of version 9 to 10 will break this algorithm
+# because 10 sorts before 9. We also look for just tcl. We have to
+# be careful that we don't match stuff like tclX by accident.
+# the alternative search directory is involked by --with-tclinclude
+#
+no_tcl=true
+echo $ac_n "checking for Tcl private headers""... $ac_c" 1>&6
+# Check whether --with-tclinclude or --without-tclinclude was given.
+if test "${with_tclinclude+set}" = set; then
+ withval="$with_tclinclude"
+ with_tclinclude=${withval}
+fi
+
+if eval "test \"`echo '$''{'ac_cv_c_tclh'+set}'`\" = set"; then
+ echo $ac_n "(cached) $ac_c" 1>&6
+else
+
+# first check to see if --with-tclinclude was specified
+if test x"${with_tclinclude}" != x ; then
+ if test -f ${with_tclinclude}/tclInt.h ; then
+ ac_cv_c_tclh=`(cd ${with_tclinclude}; pwd)`
+ else
+ { echo "configure: error: ${with_tclinclude} directory doesn't contain private headers" 1>&2; exit 1; }
+ fi
+fi
+# next check in private source directory
+#
+# since ls returns lowest version numbers first, reverse its output
+if test x"${ac_cv_c_tclh}" = x ; then
+ for i in \
+ ${srcdir}/../tcl \
+ `ls -dr ${srcdir}/../tcl[0-9]* 2>/dev/null` \
+ ${srcdir}/../../tcl \
+ `ls -dr ${srcdir}/../../tcl[0-9]* 2>/dev/null` \
+ ${srcdir}/../../../tcl \
+ `ls -dr ${srcdir}/../../../tcl[0-9]* 2>/dev/null ` ; do
+ if test -f $i/tclInt.h ; then
+ ac_cv_c_tclh=`(cd $i; pwd)`
+ break
+ fi
+ # Tcl 7.5 and greater puts headers in subdirectory.
+ if test -f $i/generic/tclInt.h ; then
+ ac_cv_c_tclh=`(cd $i; pwd)`/generic
+ fi
+ done
+fi
+# finally check in a few common install locations
+#
+# since ls returns lowest version numbers first, reverse its output
+if test x"${ac_cv_c_tclh}" = x ; then
+ for i in \
+ `ls -dr /usr/local/src/tcl[0-9]* 2>/dev/null` \
+ `ls -dr /usr/local/lib/tcl[0-9]* 2>/dev/null` \
+ /usr/local/src/tcl \
+ /usr/local/lib/tcl \
+ ${prefix}/include ; do
+ if test -f $i/tclInt.h ; then
+ ac_cv_c_tclh=`(cd $i; pwd)`
+ break
+ fi
+ done
+fi
+# see if one is installed
+if test x"${ac_cv_c_tclh}" = x ; then
+ ac_safe=`echo "tclInt.h" | tr './\055' '___'`
+echo $ac_n "checking for tclInt.h""... $ac_c" 1>&6
+if eval "test \"`echo '$''{'ac_cv_header_$ac_safe'+set}'`\" = set"; then
+ echo $ac_n "(cached) $ac_c" 1>&6
+else
+ cat > conftest.$ac_ext <<EOF
+#line 675 "configure"
+#include "confdefs.h"
+#include <tclInt.h>
+EOF
+eval "$ac_cpp conftest.$ac_ext >/dev/null 2>conftest.out"
+ac_err=`grep -v '^ *+' conftest.out`
+if test -z "$ac_err"; then
+ rm -rf conftest*
+ eval "ac_cv_header_$ac_safe=yes"
+else
+ echo "$ac_err" >&5
+ rm -rf conftest*
+ eval "ac_cv_header_$ac_safe=no"
+fi
+rm -f conftest*
+fi
+if eval "test \"`echo '$ac_cv_header_'$ac_safe`\" = yes"; then
+ echo "$ac_t""yes" 1>&6
+ ac_cv_c_tclh=installed
+else
+ echo "$ac_t""no" 1>&6
+ac_cv_c_tclh=""
+fi
+
+fi
+
+fi
+
+if test x"${ac_cv_c_tclh}" = x ; then
+ TCLHDIR="# no Tcl private headers found"
+ { echo "configure: error: Can't find Tcl private headers" 1>&2; exit 1; }
+fi
+if test x"${ac_cv_c_tclh}" != x ; then
+ no_tcl=""
+ if test x"${ac_cv_c_tkh}" = x"installed" ; then
+ echo "$ac_t""is installed" 1>&6
+ TCLHDIR=""
+ else
+ echo "$ac_t""found in ${ac_cv_c_tclh}" 1>&6
+ # this hack is cause the TCLHDIR won't print if there is a "-I" in it.
+ TCLHDIR="-I${ac_cv_c_tclh}"
+ fi
+fi
+
+echo $ac_n "checking Tcl version""... $ac_c" 1>&6
+rm -rf tclmajor tclminor
+orig_includes="$CPPFLAGS"
+
+if test x"${TCLHDIR}" != x ; then
+ CPPFLAGS="$CPPFLAGS $TCLHDIR"
+fi
+
+if test "$cross_compiling" = yes; then
+ { echo "configure: error: can't be cross compiled" 1>&2; exit 1; }
+
+else
+cat > conftest.$ac_ext <<EOF
+#line 732 "configure"
+#include "confdefs.h"
+
+#include <stdio.h>
+#include "tcl.h"
+main() {
+ FILE *maj = fopen("tclmajor","w");
+ FILE *min = fopen("tclminor","w");
+ fprintf(maj,"%d",TCL_MAJOR_VERSION);
+ fprintf(min,"%d",TCL_MINOR_VERSION);
+ fclose(maj);
+ fclose(min);
+ return 0;
+}
+EOF
+eval $ac_link
+if test -s conftest && (./conftest; exit) 2>/dev/null; then
+ tclmajor=`cat tclmajor`
+ tclminor=`cat tclminor`
+ tclversion=$tclmajor.$tclminor
+ echo "$ac_t""$tclversion" 1>&6
+ rm -f tclmajor tclminor
+
+else
+ echo "$ac_t""can't happen" 1>&6
+
+fi
+fi
+rm -fr conftest*
+CPPFLAGS="${orig_includes}"
+
+
+
+
+
+ac_aux_dir=
+for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do
+ if test -f $ac_dir/install-sh; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install-sh -c"
+ break
+ elif test -f $ac_dir/install.sh; then
+ ac_aux_dir=$ac_dir
+ ac_install_sh="$ac_aux_dir/install.sh -c"
+ break
+ fi
+done
+if test -z "$ac_aux_dir"; then
+ { echo "configure: error: can not find install-sh or install.sh in $srcdir $srcdir/.. $srcdir/../.." 1>&2; exit 1; }
+fi
+ac_config_guess=$ac_aux_dir/config.guess
+ac_config_sub=$ac_aux_dir/config.sub
+ac_configure=$ac_aux_dir/configure # This should be Cygnus configure.
+
+subdirs="calc"
+
+
+
+trap '' 1 2 15
+cat > confcache <<\EOF
+# This file is a shell script that caches the results of configure
+# tests run on this system so they can be shared between configure
+# scripts and configure runs. It is not useful on other systems.
+# If it contains results you don't want to keep, you may remove or edit it.
+#
+# By default, configure uses ./config.cache as the cache file,
+# creating it if it does not exist already. You can give configure
+# the --cache-file=FILE option to use a different cache file; that is
+# what configure does when it calls configure scripts in
+# subdirectories, so they share the cache.
+# Giving --cache-file=/dev/null disables caching, for debugging configure.
+# config.status only pays attention to the cache file if you give it the
+# --recheck option to rerun configure.
+#
+EOF
+# Ultrix sh set writes to stderr and can't be redirected directly,
+# and sets the high bit in the cache file unless we assign to the vars.
+(set) 2>&1 |
+ sed -n "s/^\([a-zA-Z0-9_]*_cv_[a-zA-Z0-9_]*\)=\(.*\)/\1=\${\1='\2'}/p" \
+ >> confcache
+if cmp -s $cache_file confcache; then
+ :
+else
+ if test -w $cache_file; then
+ echo "updating cache $cache_file"
+ cat confcache > $cache_file
+ else
+ echo "not updating unwritable cache $cache_file"
+ fi
+fi
+rm -f confcache
+
+trap 'rm -fr conftest* confdefs* core core.* *.core $ac_clean_files; exit 1' 1 2 15
+
+test "x$prefix" = xNONE && prefix=$ac_default_prefix
+# Let make expand exec_prefix.
+test "x$exec_prefix" = xNONE && exec_prefix='${prefix}'
+
+# Any assignment to VPATH causes Sun make to only execute
+# the first set of double-colon rules, so remove it if not needed.
+# If there is a colon in the path, we need to keep it.
+if test "x$srcdir" = x.; then
+ ac_vpsub='/^[ ]*VPATH[ ]*=[^:]*$/d'
+fi
+
+trap 'rm -f $CONFIG_STATUS conftest*; exit 1' 1 2 15
+
+# Transform confdefs.h into DEFS.
+# Protect against shell expansion while executing Makefile rules.
+# Protect against Makefile macro expansion.
+cat > conftest.defs <<\EOF
+s%#define \([A-Za-z_][A-Za-z0-9_]*\) \(.*\)%-D\1=\2%g
+s%[ `~#$^&*(){}\\|;'"<>?]%\\&%g
+s%\[%\\&%g
+s%\]%\\&%g
+s%\$%$$%g
+EOF
+DEFS=`sed -f conftest.defs confdefs.h | tr '\012' ' '`
+rm -f conftest.defs
+
+
+# Without the "./", some shells look in PATH for config.status.
+: ${CONFIG_STATUS=./config.status}
+
+echo creating $CONFIG_STATUS
+rm -f $CONFIG_STATUS
+cat > $CONFIG_STATUS <<EOF
+#! /bin/sh
+# Generated automatically by configure.
+# Run this file to recreate the current configuration.
+# This directory was configured as follows,
+# on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+#
+# $0 $ac_configure_args
+#
+# Compiler output produced by configure, useful for debugging
+# configure, is in ./config.log if it exists.
+
+ac_cs_usage="Usage: $CONFIG_STATUS [--recheck] [--version] [--help]"
+for ac_option
+do
+ case "\$ac_option" in
+ -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+ echo "running \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion"
+ exec \${CONFIG_SHELL-/bin/sh} $0 $ac_configure_args --no-create --no-recursion ;;
+ -version | --version | --versio | --versi | --vers | --ver | --ve | --v)
+ echo "$CONFIG_STATUS generated by autoconf version 2.7"
+ exit 0 ;;
+ -help | --help | --hel | --he | --h)
+ echo "\$ac_cs_usage"; exit 0 ;;
+ *) echo "\$ac_cs_usage"; exit 1 ;;
+ esac
+done
+
+ac_given_srcdir=$srcdir
+
+trap 'rm -fr `echo "Makefile" | sed "s/:[^ ]*//g"` conftest*; exit 1' 1 2 15
+EOF
+cat >> $CONFIG_STATUS <<EOF
+
+# Protect against being on the right side of a sed subst in config.status.
+sed 's/%@/@@/; s/@%/@@/; s/%g\$/@g/; /@g\$/s/[\\\\&%]/\\\\&/g;
+ s/@@/%@/; s/@@/@%/; s/@g\$/%g/' > conftest.subs <<\\CEOF
+$ac_vpsub
+$extrasub
+s%@CFLAGS@%$CFLAGS%g
+s%@CPPFLAGS@%$CPPFLAGS%g
+s%@CXXFLAGS@%$CXXFLAGS%g
+s%@DEFS@%$DEFS%g
+s%@LDFLAGS@%$LDFLAGS%g
+s%@LIBS@%$LIBS%g
+s%@exec_prefix@%$exec_prefix%g
+s%@prefix@%$prefix%g
+s%@program_transform_name@%$program_transform_name%g
+s%@bindir@%$bindir%g
+s%@sbindir@%$sbindir%g
+s%@libexecdir@%$libexecdir%g
+s%@datadir@%$datadir%g
+s%@sysconfdir@%$sysconfdir%g
+s%@sharedstatedir@%$sharedstatedir%g
+s%@localstatedir@%$localstatedir%g
+s%@libdir@%$libdir%g
+s%@includedir@%$includedir%g
+s%@oldincludedir@%$oldincludedir%g
+s%@infodir@%$infodir%g
+s%@mandir@%$mandir%g
+s%@CPP@%$CPP%g
+s%@TCLHDIR@%$TCLHDIR%g
+s%@subdirs@%$subdirs%g
+s%@host@%$host%g
+
+CEOF
+EOF
+cat >> $CONFIG_STATUS <<EOF
+
+CONFIG_FILES=\${CONFIG_FILES-"Makefile"}
+EOF
+cat >> $CONFIG_STATUS <<\EOF
+for ac_file in .. $CONFIG_FILES; do if test "x$ac_file" != x..; then
+ # Support "outfile[:infile]", defaulting infile="outfile.in".
+ case "$ac_file" in
+ *:*) ac_file_in=`echo "$ac_file"|sed 's%.*:%%'`
+ ac_file=`echo "$ac_file"|sed 's%:.*%%'` ;;
+ *) ac_file_in="${ac_file}.in" ;;
+ esac
+
+ # Adjust relative srcdir, etc. for subdirectories.
+
+ # Remove last slash and all that follows it. Not all systems have dirname.
+ ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'`
+ if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then
+ # The file is in a subdirectory.
+ test ! -d "$ac_dir" && mkdir "$ac_dir"
+ ac_dir_suffix="/`echo $ac_dir|sed 's%^\./%%'`"
+ # A "../" for each directory in $ac_dir_suffix.
+ ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'`
+ else
+ ac_dir_suffix= ac_dots=
+ fi
+
+ case "$ac_given_srcdir" in
+ .) srcdir=.
+ if test -z "$ac_dots"; then top_srcdir=.
+ else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;;
+ /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;;
+ *) # Relative path.
+ srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix"
+ top_srcdir="$ac_dots$ac_given_srcdir" ;;
+ esac
+
+ echo creating "$ac_file"
+ rm -f "$ac_file"
+ configure_input="Generated automatically from `echo $ac_file_in|sed 's%.*/%%'` by configure."
+ case "$ac_file" in
+ *Makefile*) ac_comsub="1i\\
+# $configure_input" ;;
+ *) ac_comsub= ;;
+ esac
+ sed -e "$ac_comsub
+s%@configure_input@%$configure_input%g
+s%@srcdir@%$srcdir%g
+s%@top_srcdir@%$top_srcdir%g
+" -f conftest.subs $ac_given_srcdir/$ac_file_in > $ac_file
+fi; done
+rm -f conftest.subs
+
+
+
+exit 0
+EOF
+chmod +x $CONFIG_STATUS
+rm -fr confdefs* $ac_clean_files
+test "$no_create" = yes || ${CONFIG_SHELL-/bin/sh} $CONFIG_STATUS || exit 1
+
+if test "$no_recursion" != yes; then
+
+ # Remove --cache-file and --srcdir arguments so they do not pile up.
+ ac_sub_configure_args=
+ ac_prev=
+ for ac_arg in $ac_configure_args; do
+ if test -n "$ac_prev"; then
+ ac_prev=
+ continue
+ fi
+ case "$ac_arg" in
+ -cache-file | --cache-file | --cache-fil | --cache-fi \
+ | --cache-f | --cache- | --cache | --cach | --cac | --ca | --c)
+ ac_prev=cache_file ;;
+ -cache-file=* | --cache-file=* | --cache-fil=* | --cache-fi=* \
+ | --cache-f=* | --cache-=* | --cache=* | --cach=* | --cac=* | --ca=* | --c=*)
+ ;;
+ -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+ ac_prev=srcdir ;;
+ -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+ ;;
+ *) ac_sub_configure_args="$ac_sub_configure_args $ac_arg" ;;
+ esac
+ done
+
+ for ac_config_dir in calc; do
+
+ # Do not complain, so a configure script can configure whichever
+ # parts of a large source tree are present.
+ if test ! -d $srcdir/$ac_config_dir; then
+ continue
+ fi
+
+ echo configuring in $ac_config_dir
+
+ case "$srcdir" in
+ .) ;;
+ *)
+ if test -d ./$ac_config_dir || mkdir ./$ac_config_dir; then :;
+ else
+ { echo "configure: error: can not create `pwd`/$ac_config_dir" 1>&2; exit 1; }
+ fi
+ ;;
+ esac
+
+ ac_popdir=`pwd`
+ cd $ac_config_dir
+
+ case "$srcdir" in
+ .) # No --srcdir option. We are building in place.
+ ac_sub_srcdir=$srcdir ;;
+ /*) # Absolute path.
+ ac_sub_srcdir=$srcdir/$ac_config_dir ;;
+ *) # Relative path.
+ ac_sub_srcdir=../$srcdir/$ac_config_dir ;;
+ esac
+
+ # Check for guested configure; otherwise get Cygnus style configure.
+ if test -f $ac_sub_srcdir/configure; then
+ ac_sub_configure=$ac_sub_srcdir/configure
+ elif test -f $ac_sub_srcdir/configure.in; then
+ ac_sub_configure=$ac_configure
+ else
+ echo "configure: warning: no configuration information is in $ac_config_dir" 1>&2
+ ac_sub_configure=
+ fi
+
+ # The recursion is here.
+ if test -n "$ac_sub_configure"; then
+
+ # Make the cache file name correct relative to the subdirectory.
+ # A "../" for each directory in /$ac_config_dir.
+ ac_dots=`echo $ac_config_dir|sed -e 's%^\./%%' -e 's%[^/]$%&/%' -e 's%[^/]*/%../%g'`
+ case "$cache_file" in
+ /*) ac_sub_cache_file=$cache_file ;;
+ *) # Relative path.
+ ac_sub_cache_file="$ac_dots$cache_file" ;;
+ esac
+
+ echo "running ${CONFIG_SHELL-/bin/sh} $ac_sub_configure $ac_sub_configure_args --cache-file=$ac_sub_cache_file --srcdir=$ac_sub_srcdir"
+ # The eval makes quoting arguments work.
+ if eval ${CONFIG_SHELL-/bin/sh} $ac_sub_configure $ac_sub_configure_args --cache-file=$ac_sub_cache_file --srcdir=$ac_sub_srcdir
+ then :
+ else
+ { echo "configure: error: $ac_sub_configure failed for $ac_config_dir" 1>&2; exit 1; }
+ fi
+ fi
+
+ cd $ac_popdir
+ done
+fi
+
diff --git a/contrib/bluegnu2.0.3/testsuite/configure.in b/contrib/bluegnu2.0.3/testsuite/configure.in
new file mode 100644
index 0000000..80b25da
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/configure.in
@@ -0,0 +1,9 @@
+dnl Process this file with autoconf to produce a configure script.
+AC_INIT(Makefile.in)
+
+CY_AC_PATH_TCLH
+
+AC_CONFIG_SUBDIRS(calc)
+
+AC_SUBST(host)
+AC_OUTPUT(Makefile)
diff --git a/contrib/bluegnu2.0.3/testsuite/lib/libsup.exp b/contrib/bluegnu2.0.3/testsuite/lib/libsup.exp
new file mode 100644
index 0000000..64ef858
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/lib/libsup.exp
@@ -0,0 +1,220 @@
+ Copyright (C) 92, 93, 94, 95, 1996 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+# Please email any bugs, comments, and/or additions to this file to:
+# bug-dejagnu@prep.ai.mit.edu
+
+# This file was written by Rob Savoye. (rob@welcomehome.org)
+
+#
+# Setup an environment so we can execute library procs without DejaGnu
+#
+
+#
+# Create a default environment and start expect.
+#
+proc make_defaults_file { defs } {
+ global srcdir
+ global objdir
+ global subdir
+ global build_triplet
+ global host_triplet
+ global target_triplet
+ global target_os
+ global target_cpu
+
+ # We need to setup default values and a few default procs so we
+ # can execute library code without DejaGnu
+ set fd [open $defs w]
+ puts ${fd} "set tool foobar"
+ puts ${fd} "set srcdir ${srcdir}"
+ puts ${fd} "set objdir ${objdir}"
+ puts ${fd} "set subdir ${subdir}"
+ puts ${fd} "set build_triplet ${build_triplet}"
+ puts ${fd} "set host_triplet ${host_triplet}"
+ puts ${fd} "set target_triplet ${target_triplet}"
+ puts ${fd} "set target_os ${target_os}"
+ puts ${fd} "set target_cpu ${target_cpu}"
+ puts ${fd} "set tool foobar"
+ puts ${fd} "set testcnt 0"
+ puts ${fd} "set warncnt 0"
+ puts ${fd} "set errcnt 0"
+ puts ${fd} "set passcnt 0"
+ puts ${fd} "set xpasscnt 0"
+ puts ${fd} "set failcnt 0"
+ puts ${fd} "set xfailcnt 0"
+ puts ${fd} "set prms_id 0"
+ puts ${fd} "set bug_id 0"
+ puts ${fd} "set exit_status 0"
+ puts ${fd} "set untestedcnt 0"
+ puts ${fd} "set unresolvedcnt 0"
+ puts ${fd} "set unsupportedcnt 0"
+ puts ${fd} "set xfail_flag 0"
+ puts ${fd} "set xfail_prms 0"
+ puts ${fd} "set mail_logs 0"
+ puts ${fd} "set multipass_name 0"
+ catch "close $fd"
+}
+
+proc start_expect { } {
+ global spawn_id
+ global base_dir
+
+ # We need to setup default values and a few default procs so we
+ # can execute library code without DejaGnu
+ set defaults_file setval.tmp
+ make_defaults_file $defaults_file
+ set fd [open ${defaults_file} w]
+
+ # look for expect
+ if ![info exists EXPECT] {
+ set EXPECT [findfile $base_dir/../../expect/expect "$base_dir/../../expect/expect" expect]
+ verbose "EXPECT defaulting to $EXPECT" 2
+ }
+
+# catch close
+# catch wait
+
+ # Start expect runing
+ spawn "$EXPECT"
+ expect {
+ -re "expect.*> " {
+ verbose "Started the child expect shell" 2
+ }
+ timeout {
+ perror "Timed out starting the child expect shell."
+ return -1
+ }
+ }
+
+ # Load the defaults file
+ exp_send "source ${defaults_file}\n"
+ expect {
+ "expect*> " {
+ verbose "Loaded testing defaults file." 2
+ return 1
+ }
+ timeout {
+ perror "Couldn't load the testing defaults file."
+ return -1
+ }
+ }
+}
+
+#
+# Stop the runing expect process
+#
+proc stop_expect { } {
+ global spawn_id
+
+ # make expect exit
+ exp_send "exit\n"
+ catch "close -i $spawn_id"
+ catch "wait -i $spawn_id"
+}
+
+#
+# Load the library to test
+#
+proc load_test_lib { lib } {
+ global spawn_id
+ exp_send "source ${lib}\n"
+ expect {
+ "expect*> " {
+ verbose "Testing ${lib}" 2
+ }
+ timeout {
+ perror "Couldn't load the libraries to test"
+ return -1
+ }
+ }
+}
+
+#
+# test a library proc that emits patterns
+#
+proc exp_test { cmd pattern msg } {
+ global spawn_id
+
+ exp_send "puts ACK ; $cmd ; puts NAK\r\n"
+ expect {
+ "puts ACK*puts NAK" {
+ verbose "Got command echo" 3
+ }
+ timeout {
+ warning "Never got command echo"
+ }
+ }
+
+ expect {
+ "ACK" {
+ exp_continue
+ }
+ -re "\r\n1\r\n" {
+ warning "$msg, 1 was returned"
+ exp_continue
+ }
+ -re "\r\n0\r\n" {
+ warning "$msg, 0 was returned"
+ exp_continue
+ }
+ "$pattern" {
+ pass "$msg"
+ }
+ timeout {
+ fail "$msg"
+ }
+ }
+}
+
+# test a config proc that only returns a code
+# ex... config_test "isbuild $build_triplet" "pass" "fail" "isbuild, native"
+# args are: command, true condition, false condition, message to print
+proc config_test { cmd true false msg } {
+ global spawn_id
+
+ set timeout 20
+ exp_send "puts ACK ; puts \[$cmd\] ; puts NAK\r\n"
+ expect {
+ "puts ACK*$cmd*puts NAK" {
+ verbose "Got command echo" 3
+ }
+ timeout {
+ warning "Never got command echo"
+ }
+ }
+
+ expect {
+ -re "Checking pattern*with*\[\r\n\]" {
+ exp_continue
+ }
+ -re "\r\n1\r\n" {
+ $true "$msg"
+ }
+ -re "\r\n0\r\n" {
+ $false "$msg"
+ }
+ timeout {
+ perror "$msg (timed out)"
+ }
+ }
+}
+
+
+
+
+
+
diff --git a/contrib/bluegnu2.0.3/testsuite/tools/env.exp b/contrib/bluegnu2.0.3/testsuite/tools/env.exp
new file mode 100644
index 0000000..ebbe79f
--- /dev/null
+++ b/contrib/bluegnu2.0.3/testsuite/tools/env.exp
@@ -0,0 +1,20 @@
+
+puts "======= Environment (Start) ======="
+
+foreach __item [lsort [list env]] {
+ if {[string compare $__item "__info"] == 0} continue
+ if [catch {puts " $__item=>[eval set $__item]<"} szErrMsg] {
+ if [regexp "variable is array" $szErrMsg] {
+ foreach __elem [lsort [array names $__item]] {
+ puts " ${__item}($__elem)=>[set ${__item}($__elem)]<"
+ }
+ } else {
+ puts "******* >> msg : $szErrMsg"
+ puts "******* >> errorInfo: [uplevel #0 set errorInfo]"
+ puts "******* >> errorCode: [uplevel #0 set errorCode]"
+ }
+ }
+}
+
+pass env.exp
+puts "======= Environment (End) ======="